+10 -2

.env.example

··· 1 1 - COCOON_DID= 2 2 - COCOON_HOSTNAME= 1 1 + COCOON_DID="did:web:cocoon.example.com" 2 2 + COCOON_HOSTNAME="cocoon.example.com" 3 3 + COCOON_ROTATION_KEY_PATH="./rotation.key" 4 4 + COCOON_JWK_PATH="./jwk.key" 5 5 + COCOON_CONTACT_EMAIL="me@example.com" 6 6 + COCOON_RELAYS=https://bsky.network 7 7 + # Generate with `openssl rand -hex 16` 8 8 + COCOON_ADMIN_PASSWORD= 9 9 + # openssl rand -hex 32 10 10 + COCOON_SESSION_SECRET=

+2

.gitignore

··· 2 2 .env 3 3 /cocoon 4 4 *.key 5 5 + *.secret 6 6 + .DS_Store

+21

LICENSE

··· 1 1 + MIT License 2 2 + 3 3 + Copyright (c) 2025 me@haileyok.com 4 4 + 5 5 + Permission is hereby granted, free of charge, to any person obtaining a copy 6 6 + of this software and associated documentation files (the "Software"), to deal 7 7 + in the Software without restriction, including without limitation the rights 8 8 + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell 9 9 + copies of the Software, and to permit persons to whom the Software is 10 10 + furnished to do so, subject to the following conditions: 11 11 + 12 12 + The above copyright notice and this permission notice shall be included in all 13 13 + copies or substantial portions of the Software. 14 14 + 15 15 + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR 16 16 + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, 17 17 + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE 18 18 + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER 19 19 + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, 20 20 + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE 21 21 + SOFTWARE.

+67 -50

README.md

··· 5 5 6 6 Cocoon is a PDS implementation in Go. It is highly experimental, and is not ready for any production use. 7 7 8 8 - ### Impmlemented Endpoints 8 8 + ## Implemented Endpoints 9 9 10 10 > [!NOTE] 11 11 - Just because something is implemented doesn't mean it is finisehd. Tons of these are returning bad errors, don't do validation properly, etc. I'll make a "second pass" checklist at some point to do all of that. 11 11 + Just because something is implemented doesn't mean it is finished. Tons of these are returning bad errors, don't do validation properly, etc. I'll make a "second pass" checklist at some point to do all of that. 12 12 + 13 13 + ### Identity 14 14 + 15 15 + - [ ] `com.atproto.identity.getRecommendedDidCredentials` 16 16 + - [ ] `com.atproto.identity.requestPlcOperationSignature` 17 17 + - [x] `com.atproto.identity.resolveHandle` 18 18 + - [ ] `com.atproto.identity.signPlcOperation` 19 19 + - [ ] `com.atproto.identity.submitPlcOperation` 20 20 + - [x] `com.atproto.identity.updateHandle` 21 21 + 22 22 + ### Repo 23 23 + 24 24 + - [x] `com.atproto.repo.applyWrites` 25 25 + - [x] `com.atproto.repo.createRecord` 26 26 + - [x] `com.atproto.repo.putRecord` 27 27 + - [x] `com.atproto.repo.deleteRecord` 28 28 + - [x] `com.atproto.repo.describeRepo` 29 29 + - [x] `com.atproto.repo.getRecord` 30 30 + - [x] `com.atproto.repo.importRepo` (Works "okay". You still have to handle PLC operations on your own when migrating. Use with extreme caution.) 31 31 + - [x] `com.atproto.repo.listRecords` 32 32 + - [ ] `com.atproto.repo.listMissingBlobs` 33 33 + 34 34 + ### Server 35 35 + 36 36 + - [ ] `com.atproto.server.activateAccount` 37 37 + - [x] `com.atproto.server.checkAccountStatus` 38 38 + - [x] `com.atproto.server.confirmEmail` 39 39 + - [x] `com.atproto.server.createAccount` 40 40 + - [x] `com.atproto.server.createInviteCode` 41 41 + - [x] `com.atproto.server.createInviteCodes` 42 42 + - [ ] `com.atproto.server.deactivateAccount` 43 43 + - [ ] `com.atproto.server.deleteAccount` 44 44 + - [x] `com.atproto.server.deleteSession` 45 45 + - [x] `com.atproto.server.describeServer` 46 46 + - [ ] `com.atproto.server.getAccountInviteCodes` 47 47 + - [ ] `com.atproto.server.getServiceAuth` 48 48 + - ~~[ ] `com.atproto.server.listAppPasswords`~~ - not going to add app passwords 49 49 + - [x] `com.atproto.server.refreshSession` 50 50 + - [ ] `com.atproto.server.requestAccountDelete` 51 51 + - [x] `com.atproto.server.requestEmailConfirmation` 52 52 + - [x] `com.atproto.server.requestEmailUpdate` 53 53 + - [x] `com.atproto.server.requestPasswordReset` 54 54 + - [ ] `com.atproto.server.reserveSigningKey` 55 55 + - [x] `com.atproto.server.resetPassword` 56 56 + - ~~[] `com.atproto.server.revokeAppPassword`~~ - not going to add app passwords 57 57 + - [x] `com.atproto.server.updateEmail` 12 58 13 13 - - [ ] com.atproto.identity.getRecommendedDidCredentials 14 14 - - [ ] com.atproto.identity.requestPlcOperationSignature 15 15 - - [x] com.atproto.identity.resolveHandle 16 16 - - [ ] com.atproto.identity.signPlcOperation 17 17 - - [ ] com.atproto.identity.submitPlcOperatioin 18 18 - - [x] com.atproto.identity.updateHandle 19 19 - - [ ] com.atproto.label.queryLabels 20 20 - - [ ] com.atproto.moderation.createReport 59 59 + ### Sync 21 60 22 22 - - [x] com.atproto.repo.applyWrites 23 23 - - [x] com.atproto.repo.createRecord 24 24 - - [x] com.atproto.repo.putRecord 25 25 - - [ ] com.atproto.repo.deleteRecord 26 26 - - [x] com.atproto.repo.describeRepo 27 27 - - [x] com.atproto.repo.getRecord 28 28 - - [ ] com.atproto.repo.importRepo 29 29 - - [x] com.atproto.repo.listRecords 30 30 - - [ ] com.atproto.repo.listMissingBlobs 61 61 + - [x] `com.atproto.sync.getBlob` 62 62 + - [x] `com.atproto.sync.getBlocks` 63 63 + - [x] `com.atproto.sync.getLatestCommit` 64 64 + - [x] `com.atproto.sync.getRecord` 65 65 + - [x] `com.atproto.sync.getRepoStatus` 66 66 + - [x] `com.atproto.sync.getRepo` 67 67 + - [x] `com.atproto.sync.listBlobs` 68 68 + - [x] `com.atproto.sync.listRepos` 69 69 + - ~~[ ] `com.atproto.sync.notifyOfUpdate`~~ - BGS doesn't even have this implemented lol 70 70 + - [x] `com.atproto.sync.requestCrawl` 71 71 + - [x] `com.atproto.sync.subscribeRepos` 31 72 73 73 + ### Other 32 74 33 33 - - [ ] com.atproto.server.activateAccount 34 34 - - [ ] com.atproto.server.checkAccountStatus 35 35 - - [ ] com.atproto.server.confirmEmail 36 36 - - [x] com.atproto.server.createAccount 37 37 - - [ ] com.atproto.server.deactivateAccount 38 38 - - [ ] com.atproto.server.deleteAccount 39 39 - - [x] com.atproto.server.deleteSession 40 40 - - [x] com.atproto.server.describeServer 41 41 - - [ ] com.atproto.server.getAccountInviteCodes 42 42 - - [ ] com.atproto.server.getServiceAuth 43 43 - - [ ] com.atproto.server.listAppPasswords 44 44 - - [x] com.atproto.server.refreshSession 45 45 - - [ ] com.atproto.server.requestAccountDelete 46 46 - - [ ] com.atproto.server.requestEmailConfirmation 47 47 - - [ ] com.atproto.server.requestEmailUpdate 48 48 - - [ ] com.atproto.server.requestPasswordReset 49 49 - - [ ] com.atproto.server.reserveSigningKey 50 50 - - [ ] com.atproto.server.resetPassword 51 51 - - [ ] com.atproto.server.revokeAppPassword 52 52 - - [ ] com.atproto.server.updateEmail 75 75 + - [ ] `com.atproto.label.queryLabels` 76 76 + - [x] `com.atproto.moderation.createReport` (Note: this should be handled by proxying, not actually implemented in the PDS) 77 77 + - [x] `app.bsky.actor.getPreferences` 78 78 + - [x] `app.bsky.actor.putPreferences` 53 79 54 54 - - [x] com.atproto.sync.getBlob 55 55 - - [x] com.atproto.sync.getBlocks 56 56 - - [x] com.atproto.sync.getLatestCommit 57 57 - - [x] com.atproto.sync.getRecord 58 58 - - [x] com.atproto.sync.getRepoStatus 59 59 - - [x] com.atproto.sync.getRepo 60 60 - - [x] com.atproto.sync.listBlobs 61 61 - - [x] com.atproto.sync.listRepos 62 62 - - ~[ ] com.atproto.sync.notifyOfUpdate~ - BGS doesn't even have this implemented lol 63 63 - - [x] com.atproto.sync.requestCrawl 64 64 - - [x] com.atproto.sync.subscribeRepos 80 80 + ## License 65 81 82 82 + This project is licensed under MIT license. `server/static/pico.css` is also licensed under MIT license, available at [https://github.com/picocss/pico/](https://github.com/picocss/pico/).

-126

blockstore/blockstore.go

··· 1 1 - package blockstore 2 2 - 3 3 - import ( 4 4 - "context" 5 5 - "fmt" 6 6 - 7 7 - "github.com/bluesky-social/indigo/atproto/syntax" 8 8 - "github.com/haileyok/cocoon/models" 9 9 - blocks "github.com/ipfs/go-block-format" 10 10 - "github.com/ipfs/go-cid" 11 11 - "gorm.io/gorm" 12 12 - "gorm.io/gorm/clause" 13 13 - ) 14 14 - 15 15 - type SqliteBlockstore struct { 16 16 - db *gorm.DB 17 17 - did string 18 18 - readonly bool 19 19 - inserts []blocks.Block 20 20 - } 21 21 - 22 22 - func New(did string, db *gorm.DB) *SqliteBlockstore { 23 23 - return &SqliteBlockstore{ 24 24 - did: did, 25 25 - db: db, 26 26 - readonly: false, 27 27 - inserts: []blocks.Block{}, 28 28 - } 29 29 - } 30 30 - 31 31 - func NewReadOnly(did string, db *gorm.DB) *SqliteBlockstore { 32 32 - return &SqliteBlockstore{ 33 33 - did: did, 34 34 - db: db, 35 35 - readonly: true, 36 36 - inserts: []blocks.Block{}, 37 37 - } 38 38 - } 39 39 - 40 40 - func (bs *SqliteBlockstore) Get(ctx context.Context, cid cid.Cid) (blocks.Block, error) { 41 41 - var block models.Block 42 42 - if err := bs.db.Raw("SELECT * FROM blocks WHERE did = ? AND cid = ?", bs.did, cid.Bytes()).Scan(&block).Error; err != nil { 43 43 - return nil, err 44 44 - } 45 45 - 46 46 - b, err := blocks.NewBlockWithCid(block.Value, cid) 47 47 - if err != nil { 48 48 - return nil, err 49 49 - } 50 50 - 51 51 - return b, nil 52 52 - } 53 53 - 54 54 - func (bs *SqliteBlockstore) Put(ctx context.Context, block blocks.Block) error { 55 55 - bs.inserts = append(bs.inserts, block) 56 56 - 57 57 - if bs.readonly { 58 58 - return nil 59 59 - } 60 60 - 61 61 - b := models.Block{ 62 62 - Did: bs.did, 63 63 - Cid: block.Cid().Bytes(), 64 64 - Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 65 65 - Value: block.RawData(), 66 66 - } 67 67 - 68 68 - if err := bs.db.Clauses(clause.OnConflict{ 69 69 - Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 70 70 - UpdateAll: true, 71 71 - }).Create(&b).Error; err != nil { 72 72 - return err 73 73 - } 74 74 - 75 75 - return nil 76 76 - } 77 77 - 78 78 - func (bs *SqliteBlockstore) DeleteBlock(context.Context, cid.Cid) error { 79 79 - panic("not implemented") 80 80 - } 81 81 - 82 82 - func (bs *SqliteBlockstore) Has(context.Context, cid.Cid) (bool, error) { 83 83 - panic("not implemented") 84 84 - } 85 85 - 86 86 - func (bs *SqliteBlockstore) GetSize(context.Context, cid.Cid) (int, error) { 87 87 - panic("not implemented") 88 88 - } 89 89 - 90 90 - func (bs *SqliteBlockstore) PutMany(context.Context, []blocks.Block) error { 91 91 - panic("not implemented") 92 92 - } 93 93 - 94 94 - func (bs *SqliteBlockstore) AllKeysChan(ctx context.Context) (<-chan cid.Cid, error) { 95 95 - panic("not implemented") 96 96 - } 97 97 - 98 98 - func (bs *SqliteBlockstore) HashOnRead(enabled bool) { 99 99 - panic("not implemented") 100 100 - } 101 101 - 102 102 - func (bs *SqliteBlockstore) UpdateRepo(ctx context.Context, root cid.Cid, rev string) error { 103 103 - if err := bs.db.Exec("UPDATE repos SET root = ?, rev = ? WHERE did = ?", root.Bytes(), rev, bs.did).Error; err != nil { 104 104 - return err 105 105 - } 106 106 - 107 107 - return nil 108 108 - } 109 109 - 110 110 - func (bs *SqliteBlockstore) Execute(ctx context.Context) error { 111 111 - if !bs.readonly { 112 112 - return fmt.Errorf("blockstore was not readonly") 113 113 - } 114 114 - 115 115 - bs.readonly = false 116 116 - for _, b := range bs.inserts { 117 117 - bs.Put(ctx, b) 118 118 - } 119 119 - bs.readonly = true 120 120 - 121 121 - return nil 122 122 - } 123 123 - 124 124 - func (bs *SqliteBlockstore) GetLog() []blocks.Block { 125 125 - return bs.inserts 126 126 - }

-186

cmd/admin/main.go

··· 1 1 - package main 2 2 - 3 3 - import ( 4 4 - "crypto/ecdsa" 5 5 - "crypto/elliptic" 6 6 - "crypto/rand" 7 7 - "encoding/json" 8 8 - "fmt" 9 9 - "os" 10 10 - "time" 11 11 - 12 12 - "github.com/bluesky-social/indigo/atproto/crypto" 13 13 - "github.com/bluesky-social/indigo/atproto/syntax" 14 14 - "github.com/haileyok/cocoon/internal/helpers" 15 15 - "github.com/lestrrat-go/jwx/v2/jwk" 16 16 - "github.com/urfave/cli/v2" 17 17 - "golang.org/x/crypto/bcrypt" 18 18 - "gorm.io/driver/sqlite" 19 19 - "gorm.io/gorm" 20 20 - ) 21 21 - 22 22 - func main() { 23 23 - app := cli.App{ 24 24 - Name: "admin", 25 25 - Commands: cli.Commands{ 26 26 - runCreateRotationKey, 27 27 - runCreatePrivateJwk, 28 28 - runCreateInviteCode, 29 29 - runResetPassword, 30 30 - }, 31 31 - ErrWriter: os.Stdout, 32 32 - } 33 33 - 34 34 - app.Run(os.Args) 35 35 - } 36 36 - 37 37 - var runCreateRotationKey = &cli.Command{ 38 38 - Name: "create-rotation-key", 39 39 - Usage: "creates a rotation key for your pds", 40 40 - Flags: []cli.Flag{ 41 41 - &cli.StringFlag{ 42 42 - Name: "out", 43 43 - Required: true, 44 44 - Usage: "output file for your rotation key", 45 45 - }, 46 46 - }, 47 47 - Action: func(cmd *cli.Context) error { 48 48 - key, err := crypto.GeneratePrivateKeyK256() 49 49 - if err != nil { 50 50 - return err 51 51 - } 52 52 - 53 53 - bytes := key.Bytes() 54 54 - 55 55 - if err := os.WriteFile(cmd.String("out"), bytes, 0644); err != nil { 56 56 - return err 57 57 - } 58 58 - 59 59 - return nil 60 60 - }, 61 61 - } 62 62 - 63 63 - var runCreatePrivateJwk = &cli.Command{ 64 64 - Name: "create-private-jwk", 65 65 - Usage: "creates a private jwk for your pds", 66 66 - Flags: []cli.Flag{ 67 67 - &cli.StringFlag{ 68 68 - Name: "out", 69 69 - Required: true, 70 70 - Usage: "output file for your jwk", 71 71 - }, 72 72 - }, 73 73 - Action: func(cmd *cli.Context) error { 74 74 - privKey, err := ecdsa.GenerateKey(elliptic.P256(), rand.Reader) 75 75 - if err != nil { 76 76 - return err 77 77 - } 78 78 - 79 79 - key, err := jwk.FromRaw(privKey) 80 80 - if err != nil { 81 81 - return err 82 82 - } 83 83 - 84 84 - kid := fmt.Sprintf("%d", time.Now().Unix()) 85 85 - 86 86 - if err := key.Set(jwk.KeyIDKey, kid); err != nil { 87 87 - return err 88 88 - } 89 89 - 90 90 - b, err := json.Marshal(key) 91 91 - if err != nil { 92 92 - return err 93 93 - } 94 94 - 95 95 - if err := os.WriteFile(cmd.String("out"), b, 0644); err != nil { 96 96 - return err 97 97 - } 98 98 - 99 99 - return nil 100 100 - }, 101 101 - } 102 102 - 103 103 - var runCreateInviteCode = &cli.Command{ 104 104 - Name: "create-invite-code", 105 105 - Usage: "creates an invite code", 106 106 - Flags: []cli.Flag{ 107 107 - &cli.StringFlag{ 108 108 - Name: "for", 109 109 - Usage: "optional did to assign the invite code to", 110 110 - }, 111 111 - &cli.IntFlag{ 112 112 - Name: "uses", 113 113 - Usage: "number of times the invite code can be used", 114 114 - Value: 1, 115 115 - }, 116 116 - }, 117 117 - Action: func(cmd *cli.Context) error { 118 118 - db, err := newDb() 119 119 - if err != nil { 120 120 - return err 121 121 - } 122 122 - 123 123 - forDid := "did:plc:123" 124 124 - if cmd.String("for") != "" { 125 125 - did, err := syntax.ParseDID(cmd.String("for")) 126 126 - if err != nil { 127 127 - return err 128 128 - } 129 129 - 130 130 - forDid = did.String() 131 131 - } 132 132 - 133 133 - uses := cmd.Int("uses") 134 134 - 135 135 - code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(8), helpers.RandomVarchar(8)) 136 136 - 137 137 - if err := db.Exec("INSERT INTO invite_codes (did, code, remaining_use_count) VALUES (?, ?, ?)", forDid, code, uses).Error; err != nil { 138 138 - return err 139 139 - } 140 140 - 141 141 - fmt.Printf("New invite code created with %d uses: %s\n", uses, code) 142 142 - 143 143 - return nil 144 144 - }, 145 145 - } 146 146 - 147 147 - var runResetPassword = &cli.Command{ 148 148 - Name: "reset-password", 149 149 - Usage: "resets a password", 150 150 - Flags: []cli.Flag{ 151 151 - &cli.StringFlag{ 152 152 - Name: "did", 153 153 - Usage: "did of the user who's password you want to reset", 154 154 - }, 155 155 - }, 156 156 - Action: func(cmd *cli.Context) error { 157 157 - db, err := newDb() 158 158 - if err != nil { 159 159 - return err 160 160 - } 161 161 - 162 162 - didStr := cmd.String("did") 163 163 - did, err := syntax.ParseDID(didStr) 164 164 - if err != nil { 165 165 - return err 166 166 - } 167 167 - 168 168 - newPass := fmt.Sprintf("%s-%s", helpers.RandomVarchar(12), helpers.RandomVarchar(12)) 169 169 - hashed, err := bcrypt.GenerateFromPassword([]byte(newPass), 10) 170 170 - if err != nil { 171 171 - return err 172 172 - } 173 173 - 174 174 - if err := db.Exec("UPDATE repos SET password = ? WHERE did = ?", hashed, did.String()).Error; err != nil { 175 175 - return err 176 176 - } 177 177 - 178 178 - fmt.Printf("Password for %s has been reset to: %s", did.String(), newPass) 179 179 - 180 180 - return nil 181 181 - }, 182 182 - } 183 183 - 184 184 - func newDb() (*gorm.DB, error) { 185 185 - return gorm.Open(sqlite.Open("cocoon.db"), &gorm.Config{}) 186 186 - }

+228 -3

cmd/cocoon/main.go

··· 1 1 package main 2 2 3 3 import ( 4 4 + "crypto/ecdsa" 5 5 + "crypto/elliptic" 6 6 + "crypto/rand" 7 7 + "encoding/json" 4 8 "fmt" 5 9 "os" 10 10 + "time" 6 11 12 12 + "github.com/bluesky-social/indigo/atproto/crypto" 13 13 + "github.com/bluesky-social/indigo/atproto/syntax" 14 14 + "github.com/haileyok/cocoon/internal/helpers" 7 15 "github.com/haileyok/cocoon/server" 8 16 _ "github.com/joho/godotenv/autoload" 17 17 + "github.com/lestrrat-go/jwx/v2/jwk" 9 18 "github.com/urfave/cli/v2" 19 19 + "golang.org/x/crypto/bcrypt" 20 20 + "gorm.io/driver/sqlite" 21 21 + "gorm.io/gorm" 10 22 ) 11 23 12 24 var Version = "dev" ··· 57 69 EnvVars: []string{"COCOON_RELAYS"}, 58 70 }, 59 71 &cli.StringFlag{ 72 72 + Name: "admin-password", 73 73 + Required: true, 74 74 + EnvVars: []string{"COCOON_ADMIN_PASSWORD"}, 75 75 + }, 76 76 + &cli.StringFlag{ 60 77 Name: "smtp-user", 61 78 Required: false, 62 79 EnvVars: []string{"COCOON_SMTP_USER"}, ··· 86 103 Required: false, 87 104 EnvVars: []string{"COCOON_SMTP_NAME"}, 88 105 }, 106 106 + &cli.BoolFlag{ 107 107 + Name: "s3-backups-enabled", 108 108 + EnvVars: []string{"COCOON_S3_BACKUPS_ENABLED"}, 109 109 + }, 110 110 + &cli.StringFlag{ 111 111 + Name: "s3-region", 112 112 + EnvVars: []string{"COCOON_S3_REGION"}, 113 113 + }, 114 114 + &cli.StringFlag{ 115 115 + Name: "s3-bucket", 116 116 + EnvVars: []string{"COCOON_S3_BUCKET"}, 117 117 + }, 118 118 + &cli.StringFlag{ 119 119 + Name: "s3-endpoint", 120 120 + EnvVars: []string{"COCOON_S3_ENDPOINT"}, 121 121 + }, 122 122 + &cli.StringFlag{ 123 123 + Name: "s3-access-key", 124 124 + EnvVars: []string{"COCOON_S3_ACCESS_KEY"}, 125 125 + }, 126 126 + &cli.StringFlag{ 127 127 + Name: "s3-secret-key", 128 128 + EnvVars: []string{"COCOON_S3_SECRET_KEY"}, 129 129 + }, 130 130 + &cli.StringFlag{ 131 131 + Name: "session-secret", 132 132 + EnvVars: []string{"COCOON_SESSION_SECRET"}, 133 133 + }, 134 134 + &cli.StringFlag{ 135 135 + Name: "default-atproto-proxy", 136 136 + EnvVars: []string{"COCOON_DEFAULT_ATPROTO_PROXY"}, 137 137 + Value: "did:web:api.bsky.app#bsky_appview", 138 138 + }, 139 139 + &cli.StringFlag{ 140 140 + Name: "blockstore-variant", 141 141 + EnvVars: []string{"COCOON_BLOCKSTORE_VARIANT"}, 142 142 + Value: "sqlite", 143 143 + }, 89 144 }, 90 145 Commands: []*cli.Command{ 91 91 - run, 146 146 + runServe, 147 147 + runCreateRotationKey, 148 148 + runCreatePrivateJwk, 149 149 + runCreateInviteCode, 150 150 + runResetPassword, 92 151 }, 93 152 ErrWriter: os.Stdout, 94 153 Version: Version, 95 154 } 96 155 97 97 - app.Run(os.Args) 156 156 + if err := app.Run(os.Args); err != nil { 157 157 + fmt.Printf("Error: %v\n", err) 158 158 + } 98 159 } 99 160 100 100 - var run = &cli.Command{ 161 161 + var runServe = &cli.Command{ 101 162 Name: "run", 102 163 Usage: "Start the cocoon PDS", 103 164 Flags: []cli.Flag{}, 104 165 Action: func(cmd *cli.Context) error { 166 166 + 105 167 s, err := server.New(&server.Args{ 106 168 Addr: cmd.String("addr"), 107 169 DbName: cmd.String("db-name"), ··· 112 174 ContactEmail: cmd.String("contact-email"), 113 175 Version: Version, 114 176 Relays: cmd.StringSlice("relays"), 177 177 + AdminPassword: cmd.String("admin-password"), 115 178 SmtpUser: cmd.String("smtp-user"), 116 179 SmtpPass: cmd.String("smtp-pass"), 117 180 SmtpHost: cmd.String("smtp-host"), 118 181 SmtpPort: cmd.String("smtp-port"), 119 182 SmtpEmail: cmd.String("smtp-email"), 120 183 SmtpName: cmd.String("smtp-name"), 184 184 + S3Config: &server.S3Config{ 185 185 + BackupsEnabled: cmd.Bool("s3-backups-enabled"), 186 186 + Region: cmd.String("s3-region"), 187 187 + Bucket: cmd.String("s3-bucket"), 188 188 + Endpoint: cmd.String("s3-endpoint"), 189 189 + AccessKey: cmd.String("s3-access-key"), 190 190 + SecretKey: cmd.String("s3-secret-key"), 191 191 + }, 192 192 + SessionSecret: cmd.String("session-secret"), 193 193 + DefaultAtprotoProxy: cmd.String("default-atproto-proxy"), 194 194 + BlockstoreVariant: server.MustReturnBlockstoreVariant(cmd.String("blockstore-variant")), 121 195 }) 122 196 if err != nil { 123 197 fmt.Printf("error creating cocoon: %v", err) ··· 132 206 return nil 133 207 }, 134 208 } 209 209 + 210 210 + var runCreateRotationKey = &cli.Command{ 211 211 + Name: "create-rotation-key", 212 212 + Usage: "creates a rotation key for your pds", 213 213 + Flags: []cli.Flag{ 214 214 + &cli.StringFlag{ 215 215 + Name: "out", 216 216 + Required: true, 217 217 + Usage: "output file for your rotation key", 218 218 + }, 219 219 + }, 220 220 + Action: func(cmd *cli.Context) error { 221 221 + key, err := crypto.GeneratePrivateKeyK256() 222 222 + if err != nil { 223 223 + return err 224 224 + } 225 225 + 226 226 + bytes := key.Bytes() 227 227 + 228 228 + if err := os.WriteFile(cmd.String("out"), bytes, 0644); err != nil { 229 229 + return err 230 230 + } 231 231 + 232 232 + return nil 233 233 + }, 234 234 + } 235 235 + 236 236 + var runCreatePrivateJwk = &cli.Command{ 237 237 + Name: "create-private-jwk", 238 238 + Usage: "creates a private jwk for your pds", 239 239 + Flags: []cli.Flag{ 240 240 + &cli.StringFlag{ 241 241 + Name: "out", 242 242 + Required: true, 243 243 + Usage: "output file for your jwk", 244 244 + }, 245 245 + }, 246 246 + Action: func(cmd *cli.Context) error { 247 247 + privKey, err := ecdsa.GenerateKey(elliptic.P256(), rand.Reader) 248 248 + if err != nil { 249 249 + return err 250 250 + } 251 251 + 252 252 + key, err := jwk.FromRaw(privKey) 253 253 + if err != nil { 254 254 + return err 255 255 + } 256 256 + 257 257 + kid := fmt.Sprintf("%d", time.Now().Unix()) 258 258 + 259 259 + if err := key.Set(jwk.KeyIDKey, kid); err != nil { 260 260 + return err 261 261 + } 262 262 + 263 263 + b, err := json.Marshal(key) 264 264 + if err != nil { 265 265 + return err 266 266 + } 267 267 + 268 268 + if err := os.WriteFile(cmd.String("out"), b, 0644); err != nil { 269 269 + return err 270 270 + } 271 271 + 272 272 + return nil 273 273 + }, 274 274 + } 275 275 + 276 276 + var runCreateInviteCode = &cli.Command{ 277 277 + Name: "create-invite-code", 278 278 + Usage: "creates an invite code", 279 279 + Flags: []cli.Flag{ 280 280 + &cli.StringFlag{ 281 281 + Name: "for", 282 282 + Usage: "optional did to assign the invite code to", 283 283 + }, 284 284 + &cli.IntFlag{ 285 285 + Name: "uses", 286 286 + Usage: "number of times the invite code can be used", 287 287 + Value: 1, 288 288 + }, 289 289 + }, 290 290 + Action: func(cmd *cli.Context) error { 291 291 + db, err := newDb() 292 292 + if err != nil { 293 293 + return err 294 294 + } 295 295 + 296 296 + forDid := "did:plc:123" 297 297 + if cmd.String("for") != "" { 298 298 + did, err := syntax.ParseDID(cmd.String("for")) 299 299 + if err != nil { 300 300 + return err 301 301 + } 302 302 + 303 303 + forDid = did.String() 304 304 + } 305 305 + 306 306 + uses := cmd.Int("uses") 307 307 + 308 308 + code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(8), helpers.RandomVarchar(8)) 309 309 + 310 310 + if err := db.Exec("INSERT INTO invite_codes (did, code, remaining_use_count) VALUES (?, ?, ?)", forDid, code, uses).Error; err != nil { 311 311 + return err 312 312 + } 313 313 + 314 314 + fmt.Printf("New invite code created with %d uses: %s\n", uses, code) 315 315 + 316 316 + return nil 317 317 + }, 318 318 + } 319 319 + 320 320 + var runResetPassword = &cli.Command{ 321 321 + Name: "reset-password", 322 322 + Usage: "resets a password", 323 323 + Flags: []cli.Flag{ 324 324 + &cli.StringFlag{ 325 325 + Name: "did", 326 326 + Usage: "did of the user who's password you want to reset", 327 327 + }, 328 328 + }, 329 329 + Action: func(cmd *cli.Context) error { 330 330 + db, err := newDb() 331 331 + if err != nil { 332 332 + return err 333 333 + } 334 334 + 335 335 + didStr := cmd.String("did") 336 336 + did, err := syntax.ParseDID(didStr) 337 337 + if err != nil { 338 338 + return err 339 339 + } 340 340 + 341 341 + newPass := fmt.Sprintf("%s-%s", helpers.RandomVarchar(12), helpers.RandomVarchar(12)) 342 342 + hashed, err := bcrypt.GenerateFromPassword([]byte(newPass), 10) 343 343 + if err != nil { 344 344 + return err 345 345 + } 346 346 + 347 347 + if err := db.Exec("UPDATE repos SET password = ? WHERE did = ?", hashed, did.String()).Error; err != nil { 348 348 + return err 349 349 + } 350 350 + 351 351 + fmt.Printf("Password for %s has been reset to: %s", did.String(), newPass) 352 352 + 353 353 + return nil 354 354 + }, 355 355 + } 356 356 + 357 357 + func newDb() (*gorm.DB, error) { 358 358 + return gorm.Open(sqlite.Open("cocoon.db"), &gorm.Config{}) 359 359 + }

+2

contrib/.gitignore

··· 1 1 + # `nix build` output 2 2 + /result

+27

contrib/flake.lock

··· 1 1 + { 2 2 + "nodes": { 3 3 + "nixpkgs": { 4 4 + "locked": { 5 5 + "lastModified": 1745742390, 6 6 + "narHash": "sha256-1rqa/XPSJqJg21BKWjzJZC7yU0l/YTVtjRi0RJmipus=", 7 7 + "owner": "NixOS", 8 8 + "repo": "nixpkgs", 9 9 + "rev": "26245db0cb552047418cfcef9a25da91b222d6c7", 10 10 + "type": "github" 11 11 + }, 12 12 + "original": { 13 13 + "owner": "NixOS", 14 14 + "ref": "nixos-24.11", 15 15 + "repo": "nixpkgs", 16 16 + "type": "github" 17 17 + } 18 18 + }, 19 19 + "root": { 20 20 + "inputs": { 21 21 + "nixpkgs": "nixpkgs" 22 22 + } 23 23 + } 24 24 + }, 25 25 + "root": "root", 26 26 + "version": 7 27 27 + }

+41

contrib/flake.nix

··· 1 1 + { 2 2 + inputs = { 3 3 + nixpkgs.url = "github:NixOS/nixpkgs/nixos-24.11"; 4 4 + }; 5 5 + outputs = { self, nixpkgs }: 6 6 + let 7 7 + systems = [ "x86_64-linux" "aarch64-linux" "x86_64-darwin" "aarch64-darwin" ]; 8 8 + forAllSystems = f: nixpkgs.lib.genAttrs systems f; 9 9 + outputsBySystem = forAllSystems (system: 10 10 + let 11 11 + pkgs = nixpkgs.legacyPackages.${system}; 12 12 + in 13 13 + { 14 14 + packages = { 15 15 + default = pkgs.buildGo124Module { 16 16 + pname = "cocoon"; 17 17 + version = "0.1.0"; 18 18 + src = ../.; 19 19 + vendorHash = "sha256-kFwd2FnOueEOg/YRTQ8c7/iAO3PoO3yzWyVDFu43QOs="; 20 20 + meta.mainProgram = "cocoon"; 21 21 + }; 22 22 + }; 23 23 + devShells = { 24 24 + default = pkgs.mkShell { 25 25 + buildInputs = [ 26 26 + pkgs.go_1_24 27 27 + pkgs.gopls 28 28 + pkgs.gotools 29 29 + pkgs.go-tools 30 30 + ]; 31 31 + }; 32 32 + }; 33 33 + }); 34 34 + mergeOutputs = outputType: 35 35 + nixpkgs.lib.mapAttrs (system: systemOutputs: systemOutputs.${outputType} or {}) outputsBySystem; 36 36 + in 37 37 + { 38 38 + packages = mergeOutputs "packages"; 39 39 + devShells = mergeOutputs "devShells"; 40 40 + }; 41 41 + }

+45

cspell.json

··· 1 1 + { 2 2 + "version": "0.2", 3 3 + "language": "en", 4 4 + "words": [ 5 5 + "atproto", 6 6 + "bsky", 7 7 + "Cocoon", 8 8 + "PDS", 9 9 + "Plc", 10 10 + "plc", 11 11 + "repo", 12 12 + "InviteCodes", 13 13 + "InviteCode", 14 14 + "Invite", 15 15 + "Signin", 16 16 + "Signout", 17 17 + "JWKS", 18 18 + "dpop", 19 19 + "BGS", 20 20 + "pico", 21 21 + "picocss", 22 22 + "par", 23 23 + "blobs", 24 24 + "blob", 25 25 + "did", 26 26 + "DID", 27 27 + "OAuth", 28 28 + "oauth", 29 29 + "par", 30 30 + "Cocoon", 31 31 + "memcache", 32 32 + "db", 33 33 + "helpers", 34 34 + "middleware", 35 35 + "repo", 36 36 + "static", 37 37 + "pico", 38 38 + "picocss", 39 39 + "MIT", 40 40 + "Go" 41 41 + ], 42 42 + "ignorePaths": [ 43 43 + "server/static/pico.css" 44 44 + ] 45 45 + }

+29 -30

go.mod

··· 4 4 5 5 require ( 6 6 github.com/Azure/go-autorest/autorest/to v0.4.1 7 7 - github.com/bluesky-social/indigo v0.0.0-20250322011324-8e3fa7af986a 7 7 + github.com/aws/aws-sdk-go v1.55.7 8 8 + github.com/bluesky-social/indigo v0.0.0-20250414202759-826fcdeaa36b 8 9 github.com/btcsuite/websocket v0.0.0-20150119174127-31079b680792 10 10 + github.com/domodwyer/mailyak/v3 v3.6.2 11 11 + github.com/go-pkgz/expirable-cache/v3 v3.0.0 9 12 github.com/go-playground/validator v9.31.0+incompatible 10 13 github.com/golang-jwt/jwt/v4 v4.5.2 11 14 github.com/google/uuid v1.4.0 15 15 + github.com/gorilla/sessions v1.4.0 16 16 + github.com/gorilla/websocket v1.5.1 17 17 + github.com/hako/durafmt v0.0.0-20210608085754-5c1018a4e16b 18 18 + github.com/hashicorp/golang-lru/v2 v2.0.7 12 19 github.com/ipfs/go-block-format v0.2.0 13 20 github.com/ipfs/go-cid v0.4.1 14 21 github.com/ipfs/go-ipld-cbor v0.1.0 15 22 github.com/ipld/go-car v0.6.1-0.20230509095817-92d28eb23ba4 16 23 github.com/joho/godotenv v1.5.1 24 24 + github.com/labstack/echo-contrib v0.17.4 17 25 github.com/labstack/echo/v4 v4.13.3 18 26 github.com/lestrrat-go/jwx/v2 v2.0.12 27 27 + github.com/multiformats/go-multihash v0.2.3 19 28 github.com/samber/slog-echo v1.16.1 20 29 github.com/urfave/cli/v2 v2.27.6 21 21 - golang.org/x/crypto v0.36.0 30 30 + github.com/whyrusleeping/cbor-gen v0.2.1-0.20241030202151-b7a6831be65e 31 31 + gitlab.com/yawning/secp256k1-voi v0.0.0-20230925100816-f2616030848b 32 32 + golang.org/x/crypto v0.38.0 22 33 gorm.io/driver/sqlite v1.5.7 23 34 gorm.io/gorm v1.25.12 24 35 ) ··· 27 38 github.com/Azure/go-autorest v14.2.0+incompatible // indirect 28 39 github.com/RussellLuo/slidingwindow v0.0.0-20200528002341-535bb99d338b // indirect 29 40 github.com/beorn7/perks v1.0.1 // indirect 30 30 - github.com/bradfitz/gomemcache v0.0.0-20230905024940-24af94b03874 // indirect 31 41 github.com/carlmjohnson/versioninfo v0.22.5 // indirect 32 32 - github.com/cespare/xxhash/v2 v2.2.0 // indirect 42 42 + github.com/cespare/xxhash/v2 v2.3.0 // indirect 33 43 github.com/cpuguy83/go-md2man/v2 v2.0.5 // indirect 34 44 github.com/decred/dcrd/dcrec/secp256k1/v4 v4.2.0 // indirect 35 35 - github.com/domodwyer/mailyak/v3 v3.6.2 // indirect 36 45 github.com/felixge/httpsnoop v1.0.4 // indirect 37 46 github.com/go-logr/logr v1.4.2 // indirect 38 47 github.com/go-logr/stdr v1.2.2 // indirect ··· 41 50 github.com/goccy/go-json v0.10.2 // indirect 42 51 github.com/gocql/gocql v1.7.0 // indirect 43 52 github.com/gogo/protobuf v1.3.2 // indirect 44 44 - github.com/golang-jwt/jwt v3.2.2+incompatible // indirect 45 53 github.com/golang/snappy v0.0.4 // indirect 46 46 - github.com/gorilla/websocket v1.5.1 // indirect 54 54 + github.com/gorilla/context v1.1.2 // indirect 55 55 + github.com/gorilla/securecookie v1.1.2 // indirect 47 56 github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed // indirect 48 57 github.com/hashicorp/go-cleanhttp v0.5.2 // indirect 49 58 github.com/hashicorp/go-retryablehttp v0.7.5 // indirect 50 59 github.com/hashicorp/golang-lru v1.0.2 // indirect 51 51 - github.com/hashicorp/golang-lru/arc/v2 v2.0.6 // indirect 52 52 - github.com/hashicorp/golang-lru/v2 v2.0.7 // indirect 53 60 github.com/ipfs/bbloom v0.0.4 // indirect 54 61 github.com/ipfs/go-blockservice v0.5.2 // indirect 55 62 github.com/ipfs/go-datastore v0.6.0 // indirect ··· 65 72 github.com/ipfs/go-merkledag v0.11.0 // indirect 66 73 github.com/ipfs/go-metrics-interface v0.0.1 // indirect 67 74 github.com/ipfs/go-verifcid v0.0.3 // indirect 68 68 - github.com/ipld/go-car/v2 v2.13.1 // indirect 69 75 github.com/ipld/go-codec-dagpb v1.6.0 // indirect 70 76 github.com/ipld/go-ipld-prime v0.21.0 // indirect 71 77 github.com/jackc/pgpassfile v1.0.0 // indirect ··· 75 81 github.com/jbenet/goprocess v0.1.4 // indirect 76 82 github.com/jinzhu/inflection v1.0.0 // indirect 77 83 github.com/jinzhu/now v1.1.5 // indirect 84 84 + github.com/jmespath/go-jmespath v0.4.0 // indirect 78 85 github.com/klauspost/cpuid/v2 v2.2.7 // indirect 79 86 github.com/labstack/gommon v0.4.2 // indirect 80 87 github.com/leodido/go-urn v1.4.0 // indirect ··· 83 90 github.com/lestrrat-go/httprc v1.0.4 // indirect 84 91 github.com/lestrrat-go/iter v1.0.2 // indirect 85 92 github.com/lestrrat-go/option v1.0.1 // indirect 86 86 - github.com/mattn/go-colorable v0.1.13 // indirect 93 93 + github.com/mattn/go-colorable v0.1.14 // indirect 87 94 github.com/mattn/go-isatty v0.0.20 // indirect 88 95 github.com/mattn/go-sqlite3 v1.14.22 // indirect 89 89 - github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0 // indirect 90 96 github.com/minio/sha256-simd v1.0.1 // indirect 91 97 github.com/mr-tron/base58 v1.2.0 // indirect 92 98 github.com/multiformats/go-base32 v0.1.0 // indirect 93 99 github.com/multiformats/go-base36 v0.2.0 // indirect 94 100 github.com/multiformats/go-multibase v0.2.0 // indirect 95 95 - github.com/multiformats/go-multicodec v0.9.0 // indirect 96 96 - github.com/multiformats/go-multihash v0.2.3 // indirect 97 101 github.com/multiformats/go-varint v0.0.7 // indirect 102 102 + github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 // indirect 98 103 github.com/opentracing/opentracing-go v1.2.0 // indirect 99 99 - github.com/petar/GoLLRB v0.0.0-20210522233825-ae3b015fd3e9 // indirect 100 104 github.com/polydawn/refmt v0.89.1-0.20221221234430-40501e09de1f // indirect 101 101 - github.com/prometheus/client_golang v1.17.0 // indirect 102 102 - github.com/prometheus/client_model v0.5.0 // indirect 103 103 - github.com/prometheus/common v0.45.0 // indirect 104 104 - github.com/prometheus/procfs v0.12.0 // indirect 105 105 + github.com/prometheus/client_golang v1.22.0 // indirect 106 106 + github.com/prometheus/client_model v0.6.2 // indirect 107 107 + github.com/prometheus/common v0.63.0 // indirect 108 108 + github.com/prometheus/procfs v0.16.1 // indirect 105 109 github.com/russross/blackfriday/v2 v2.1.0 // indirect 106 110 github.com/samber/lo v1.49.1 // indirect 107 111 github.com/segmentio/asm v1.2.0 // indirect 108 112 github.com/spaolacci/murmur3 v1.1.0 // indirect 109 113 github.com/valyala/bytebufferpool v1.0.0 // indirect 110 114 github.com/valyala/fasttemplate v1.2.2 // indirect 111 111 - github.com/whyrusleeping/cbor v0.0.0-20171005072247-63513f603b11 // indirect 112 112 - github.com/whyrusleeping/cbor-gen v0.2.1-0.20241030202151-b7a6831be65e // indirect 113 113 - github.com/whyrusleeping/go-did v0.0.0-20230824162731-404d1707d5d6 // indirect 114 115 github.com/xrash/smetrics v0.0.0-20240521201337-686a1a2994c1 // indirect 115 115 - gitlab.com/yawning/secp256k1-voi v0.0.0-20230925100816-f2616030848b // indirect 116 116 gitlab.com/yawning/tuplehash v0.0.0-20230713102510-df83abbf9a02 // indirect 117 117 go.opentelemetry.io/contrib/instrumentation/net/http/otelhttp v0.46.1 // indirect 118 118 go.opentelemetry.io/otel v1.29.0 // indirect ··· 121 121 go.uber.org/atomic v1.11.0 // indirect 122 122 go.uber.org/multierr v1.11.0 // indirect 123 123 go.uber.org/zap v1.26.0 // indirect 124 124 - golang.org/x/exp v0.0.0-20231110203233-9a3e6036ecaa // indirect 125 125 - golang.org/x/net v0.33.0 // indirect 126 126 - golang.org/x/sync v0.12.0 // indirect 127 127 - golang.org/x/sys v0.31.0 // indirect 128 128 - golang.org/x/text v0.23.0 // indirect 129 129 - golang.org/x/time v0.8.0 // indirect 124 124 + golang.org/x/net v0.40.0 // indirect 125 125 + golang.org/x/sync v0.14.0 // indirect 126 126 + golang.org/x/sys v0.33.0 // indirect 127 127 + golang.org/x/text v0.25.0 // indirect 128 128 + golang.org/x/time v0.11.0 // indirect 130 129 golang.org/x/xerrors v0.0.0-20231012003039-104605ab7028 // indirect 131 131 - google.golang.org/protobuf v1.33.0 // indirect 130 130 + google.golang.org/protobuf v1.36.6 // indirect 132 131 gopkg.in/go-playground/assert.v1 v1.2.1 // indirect 133 132 gopkg.in/inf.v0 v0.9.1 // indirect 134 133 gorm.io/driver/postgres v1.5.7 // indirect

+52 -54

go.sum

··· 7 7 github.com/RussellLuo/slidingwindow v0.0.0-20200528002341-535bb99d338b/go.mod h1:4+EPqMRApwwE/6yo6CxiHoSnBzjRr3jsqer7frxP8y4= 8 8 github.com/alexbrainman/goissue34681 v0.0.0-20191006012335-3fc7a47baff5 h1:iW0a5ljuFxkLGPNem5Ui+KBjFJzKg4Fv2fnxe4dvzpM= 9 9 github.com/alexbrainman/goissue34681 v0.0.0-20191006012335-3fc7a47baff5/go.mod h1:Y2QMoi1vgtOIfc+6DhrMOGkLoGzqSV2rKp4Sm+opsyA= 10 10 + github.com/aws/aws-sdk-go v1.55.7 h1:UJrkFq7es5CShfBwlWAC8DA077vp8PyVbQd3lqLiztE= 11 11 + github.com/aws/aws-sdk-go v1.55.7/go.mod h1:eRwEWoyTWFMVYVQzKMNHWP5/RV4xIUGMQfXQHfHkpNU= 10 12 github.com/benbjohnson/clock v1.1.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA= 11 13 github.com/benbjohnson/clock v1.3.0 h1:ip6w0uFQkncKQ979AypyG0ER7mqUSBdKLOgAle/AT8A= 12 14 github.com/benbjohnson/clock v1.3.0/go.mod h1:J11/hYXuz8f4ySSvYwY0FKfm+ezbsZBKZxNJlLklBHA= ··· 14 16 github.com/beorn7/perks v1.0.1/go.mod h1:G2ZrVWU2WbWT9wwq4/hrbKbnv/1ERSJQ0ibhJ6rlkpw= 15 17 github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932 h1:mXoPYz/Ul5HYEDvkta6I8/rnYM5gSdSV2tJ6XbZuEtY= 16 18 github.com/bitly/go-hostpool v0.0.0-20171023180738-a3a6125de932/go.mod h1:NOuUCSz6Q9T7+igc/hlvDOUdtWKryOrtFyIVABv/p7k= 17 17 - github.com/bluesky-social/indigo v0.0.0-20250322011324-8e3fa7af986a h1:clnSZRgkiifbvfqu9++OHfIh2DWuIoZ8CucxLueQxO0= 18 18 - github.com/bluesky-social/indigo v0.0.0-20250322011324-8e3fa7af986a/go.mod h1:NVBwZvbBSa93kfyweAmKwOLYawdVHdwZ9s+GZtBBVLA= 19 19 + github.com/bluesky-social/indigo v0.0.0-20250414202759-826fcdeaa36b h1:elwfbe+W7GkUmPKFX1h7HaeHvC/kC0XJWfiEHC62xPg= 20 20 + github.com/bluesky-social/indigo v0.0.0-20250414202759-826fcdeaa36b/go.mod h1:yjdhLA1LkK8VDS/WPUoYPo25/Hq/8rX38Ftr67EsqKY= 19 21 github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869 h1:DDGfHa7BWjL4YnC6+E63dPcxHo2sUxDIu8g3QgEJdRY= 20 22 github.com/bmizerany/assert v0.0.0-20160611221934-b7ed37b82869/go.mod h1:Ekp36dRnpXw/yCqJaO+ZrUyxD+3VXMFFr56k5XYrpB4= 21 21 - github.com/bradfitz/gomemcache v0.0.0-20230905024940-24af94b03874 h1:N7oVaKyGp8bttX0bfZGmcGkjz7DLQXhAn3DNd3T0ous= 22 22 - github.com/bradfitz/gomemcache v0.0.0-20230905024940-24af94b03874/go.mod h1:r5xuitiExdLAJ09PR7vBVENGvp4ZuTBeWTGtxuX3K+c= 23 23 github.com/btcsuite/websocket v0.0.0-20150119174127-31079b680792 h1:R8vQdOQdZ9Y3SkEwmHoWBmX1DNXhXZqlTpq6s4tyJGc= 24 24 github.com/btcsuite/websocket v0.0.0-20150119174127-31079b680792/go.mod h1:ghJtEyQwv5/p4Mg4C0fgbePVuGr935/5ddU9Z3TmDRY= 25 25 github.com/carlmjohnson/versioninfo v0.22.5 h1:O00sjOLUAFxYQjlN/bzYTuZiS0y6fWDQjMRvwtKgwwc= 26 26 github.com/carlmjohnson/versioninfo v0.22.5/go.mod h1:QT9mph3wcVfISUKd0i9sZfVrPviHuSF+cUtLjm2WSf8= 27 27 - github.com/cespare/xxhash/v2 v2.2.0 h1:DC2CZ1Ep5Y4k3ZQ899DldepgrayRUGE6BBZ/cd9Cj44= 28 28 - github.com/cespare/xxhash/v2 v2.2.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= 27 27 + github.com/cespare/xxhash/v2 v2.3.0 h1:UL815xU9SqsFlibzuggzjXhog7bL6oX9BbNZnL2UFvs= 28 28 + github.com/cespare/xxhash/v2 v2.3.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= 29 29 github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= 30 30 github.com/cpuguy83/go-md2man/v2 v2.0.5 h1:ZtcqGrnekaHpVLArFSe4HK5DoKx1T0rq2DwVB0alcyc= 31 31 github.com/cpuguy83/go-md2man/v2 v2.0.5/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o= ··· 48 48 github.com/go-logr/logr v1.4.2/go.mod h1:9T104GzyrTigFIr8wt5mBrctHMim0Nb2HLGrmQ40KvY= 49 49 github.com/go-logr/stdr v1.2.2 h1:hSWxHoqTgW2S2qGc0LTAI563KZ5YKYRhT3MFKZMbjag= 50 50 github.com/go-logr/stdr v1.2.2/go.mod h1:mMo/vtBO5dYbehREoey6XUKy/eSumjCCveDpRre4VKE= 51 51 + github.com/go-pkgz/expirable-cache/v3 v3.0.0 h1:u3/gcu3sabLYiTCevoRKv+WzjIn5oo7P8XtiXBeRDLw= 52 52 + github.com/go-pkgz/expirable-cache/v3 v3.0.0/go.mod h1:2OQiDyEGQalYecLWmXprm3maPXeVb5/6/X7yRPYTzec= 51 53 github.com/go-playground/locales v0.14.1 h1:EWaQ/wswjilfKLTECiXz7Rh+3BjFhfDFKv/oXslEjJA= 52 54 github.com/go-playground/locales v0.14.1/go.mod h1:hxrqLVvrK65+Rwrd5Fc6F2O76J/NuW9t0sjnWqG1slY= 53 55 github.com/go-playground/universal-translator v0.18.1 h1:Bcnm0ZwsGyWbCzImXv+pAJnYK9S473LQFuzCbDbfSFY= ··· 63 65 github.com/gocql/gocql v1.7.0/go.mod h1:vnlvXyFZeLBF0Wy+RS8hrOdbn0UWsWtdg07XJnFxZ+4= 64 66 github.com/gogo/protobuf v1.3.2 h1:Ov1cvc58UF3b5XjBnZv7+opcTcQFZebYjWzi34vdm4Q= 65 67 github.com/gogo/protobuf v1.3.2/go.mod h1:P1XiOD3dCwIKUDQYPy72D8LYyHL2YPYrpS2s69NZV8Q= 66 66 - github.com/golang-jwt/jwt v3.2.2+incompatible h1:IfV12K8xAKAnZqdXVzCZ+TOjboZ2keLg81eXfW3O+oY= 67 67 - github.com/golang-jwt/jwt v3.2.2+incompatible/go.mod h1:8pz2t5EyA70fFQQSrl6XZXzqecmYZeUEB8OUGHkxJ+I= 68 68 github.com/golang-jwt/jwt/v4 v4.5.2 h1:YtQM7lnr8iZ+j5q71MGKkNw9Mn7AjHM68uc9g5fXeUI= 69 69 github.com/golang-jwt/jwt/v4 v4.5.2/go.mod h1:m21LjoU+eqJr34lmDMbreY2eSTRJ1cv77w39/MY0Ch0= 70 70 github.com/golang/snappy v0.0.3/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= 71 71 github.com/golang/snappy v0.0.4 h1:yAGX7huGHXlcLOEtBnF4w7FQwA26wojNCwOYAEhLjQM= 72 72 github.com/golang/snappy v0.0.4/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= 73 73 - github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI= 74 74 - github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= 73 73 + github.com/google/go-cmp v0.7.0 h1:wk8382ETsv4JYUZwIsn6YpYiWiBsYLSJiTsyBybVuN8= 74 74 + github.com/google/go-cmp v0.7.0/go.mod h1:pXiqmnSA92OHEEa9HXL2W4E7lf9JzCmGVUdgjX3N/iU= 75 75 + github.com/google/gofuzz v1.2.0 h1:xRy4A+RhZaiKjJ1bPfwQ8sedCA+YS2YcCHW6ec7JMi0= 76 76 + github.com/google/gofuzz v1.2.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= 75 77 github.com/google/gopacket v1.1.19 h1:ves8RnFZPGiFnTS0uPQStjwru6uO6h+nlr9j6fL7kF8= 76 78 github.com/google/gopacket v1.1.19/go.mod h1:iJ8V8n6KS+z2U1A8pUwu8bW5SyEMkXJB8Yo/Vo+TKTo= 77 79 github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI= ··· 79 81 github.com/google/uuid v1.4.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= 80 82 github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1 h1:EGx4pi6eqNxGaHF6qqu48+N2wcFQ5qg5FXgOdqsJ5d8= 81 83 github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= 84 84 + github.com/gorilla/context v1.1.2 h1:WRkNAv2uoa03QNIc1A6u4O7DAGMUVoopZhkiXWA2V1o= 85 85 + github.com/gorilla/context v1.1.2/go.mod h1:KDPwT9i/MeWHiLl90fuTgrt4/wPcv75vFAZLaOOcbxM= 86 86 + github.com/gorilla/securecookie v1.1.2 h1:YCIWL56dvtr73r6715mJs5ZvhtnY73hBvEF8kXD8ePA= 87 87 + github.com/gorilla/securecookie v1.1.2/go.mod h1:NfCASbcHqRSY+3a8tlWJwsQap2VX5pwzwo4h3eOamfo= 88 88 + github.com/gorilla/sessions v1.4.0 h1:kpIYOp/oi6MG/p5PgxApU8srsSw9tuFbt46Lt7auzqQ= 89 89 + github.com/gorilla/sessions v1.4.0/go.mod h1:FLWm50oby91+hl7p/wRxDth9bWSuk0qVL2emc7lT5ik= 82 90 github.com/gorilla/websocket v1.5.1 h1:gmztn0JnHVt9JZquRuzLw3g4wouNVzKL15iLr/zn/QY= 83 91 github.com/gorilla/websocket v1.5.1/go.mod h1:x3kM2JMyaluk02fnUJpQuwD2dCS5NDG2ZHL0uE0tcaY= 84 92 github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed h1:5upAirOpQc1Q53c0bnx2ufif5kANL7bfZWcc6VJWJd8= 85 93 github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed/go.mod h1:tMWxXQ9wFIaZeTI9F+hmhFiGpFmhOHzyShyFUhRm0H4= 94 94 + github.com/hako/durafmt v0.0.0-20210608085754-5c1018a4e16b h1:wDUNC2eKiL35DbLvsDhiblTUXHxcOPwQSCzi7xpQUN4= 95 95 + github.com/hako/durafmt v0.0.0-20210608085754-5c1018a4e16b/go.mod h1:VzxiSdG6j1pi7rwGm/xYI5RbtpBgM8sARDXlvEvxlu0= 86 96 github.com/hashicorp/go-cleanhttp v0.5.2 h1:035FKYIWjmULyFRBKPs8TBQoi0x6d9G4xc9neXJWAZQ= 87 97 github.com/hashicorp/go-cleanhttp v0.5.2/go.mod h1:kO/YDlP8L1346E6Sodw+PrpBSV4/SoxCXGY6BqNFT48= 88 98 github.com/hashicorp/go-hclog v0.9.2 h1:CG6TE5H9/JXsFWJCfoIVpKFIkFe6ysEuHirp4DxCsHI= ··· 91 101 github.com/hashicorp/go-retryablehttp v0.7.5/go.mod h1:Jy/gPYAdjqffZ/yFGCFV2doI5wjtH1ewM9u8iYVjtX8= 92 102 github.com/hashicorp/golang-lru v1.0.2 h1:dV3g9Z/unq5DpblPpw+Oqcv4dU/1omnb4Ok8iPY6p1c= 93 103 github.com/hashicorp/golang-lru v1.0.2/go.mod h1:iADmTwqILo4mZ8BN3D2Q6+9jd8WM5uGBxy+E8yxSoD4= 94 94 - github.com/hashicorp/golang-lru/arc/v2 v2.0.6 h1:4NU7uP5vSoK6TbaMj3NtY478TTAWLso/vL1gpNrInHg= 95 95 - github.com/hashicorp/golang-lru/arc/v2 v2.0.6/go.mod h1:cfdDIX05DWvYV6/shsxDfa/OVcRieOt+q4FnM8x+Xno= 96 104 github.com/hashicorp/golang-lru/v2 v2.0.7 h1:a+bsQ5rvGLjzHuww6tVxozPZFVghXaHOwFs4luLUK2k= 97 105 github.com/hashicorp/golang-lru/v2 v2.0.7/go.mod h1:QeFd9opnmA6QUJc5vARoKUSoFhyfM2/ZepoAG6RGpeM= 98 106 github.com/huin/goupnp v1.0.3 h1:N8No57ls+MnjlB+JPiCVSOyy/ot7MJTqlo7rn+NYSqQ= 99 107 github.com/huin/goupnp v1.0.3/go.mod h1:ZxNlw5WqJj6wSsRK5+YfflQGXYfccj5VgQsMNixHM7Y= 100 108 github.com/ipfs/bbloom v0.0.4 h1:Gi+8EGJ2y5qiD5FbsbpX/TMNcJw8gSqr7eyjHa4Fhvs= 101 109 github.com/ipfs/bbloom v0.0.4/go.mod h1:cS9YprKXpoZ9lT0n/Mw/a6/aFV6DTjTLYHeA+gyqMG0= 102 102 - github.com/ipfs/go-bitfield v1.1.0 h1:fh7FIo8bSwaJEh6DdTWbCeZ1eqOaOkKFI74SCnsWbGA= 103 103 - github.com/ipfs/go-bitfield v1.1.0/go.mod h1:paqf1wjq/D2BBmzfTVFlJQ9IlFOZpg422HL0HqsGWHU= 104 110 github.com/ipfs/go-bitswap v0.11.0 h1:j1WVvhDX1yhG32NTC9xfxnqycqYIlhzEzLXG/cU1HyQ= 105 111 github.com/ipfs/go-bitswap v0.11.0/go.mod h1:05aE8H3XOU+LXpTedeAS0OZpcO1WFsj5niYQH9a1Tmk= 106 112 github.com/ipfs/go-block-format v0.2.0 h1:ZqrkxBA2ICbDRbK8KJs/u0O3dlp6gmAuuXUJNiW1Ycs= ··· 121 127 github.com/ipfs/go-ipfs-blockstore v1.3.1/go.mod h1:KgtZyc9fq+P2xJUiCAzbRdhhqJHvsw8u2Dlqy2MyRTE= 122 128 github.com/ipfs/go-ipfs-blocksutil v0.0.1 h1:Eh/H4pc1hsvhzsQoMEP3Bke/aW5P5rVM1IWFJMcGIPQ= 123 129 github.com/ipfs/go-ipfs-blocksutil v0.0.1/go.mod h1:Yq4M86uIOmxmGPUHv/uI7uKqZNtLb449gwKqXjIsnRk= 124 124 - github.com/ipfs/go-ipfs-chunker v0.0.5 h1:ojCf7HV/m+uS2vhUGWcogIIxiO5ubl5O57Q7NapWLY8= 125 125 - github.com/ipfs/go-ipfs-chunker v0.0.5/go.mod h1:jhgdF8vxRHycr00k13FM8Y0E+6BoalYeobXmUyTreP8= 126 130 github.com/ipfs/go-ipfs-delay v0.0.1 h1:r/UXYyRcddO6thwOnhiznIAiSvxMECGgtv35Xs1IeRQ= 127 131 github.com/ipfs/go-ipfs-delay v0.0.1/go.mod h1:8SP1YXK1M1kXuc4KJZINY3TQQ03J2rwBG9QfXmbRPrw= 128 132 github.com/ipfs/go-ipfs-ds-help v1.1.1 h1:B5UJOH52IbcfS56+Ul+sv8jnIV10lbjLF5eOO0C66Nw= ··· 156 160 github.com/ipfs/go-metrics-interface v0.0.1/go.mod h1:6s6euYU4zowdslK0GKHmqaIZ3j/b/tL7HTWtJ4VPgWY= 157 161 github.com/ipfs/go-peertaskqueue v0.8.1 h1:YhxAs1+wxb5jk7RvS0LHdyiILpNmRIRnZVztekOF0pg= 158 162 github.com/ipfs/go-peertaskqueue v0.8.1/go.mod h1:Oxxd3eaK279FxeydSPPVGHzbwVeHjatZ2GA8XD+KbPU= 159 159 - github.com/ipfs/go-unixfsnode v1.8.0 h1:yCkakzuE365glu+YkgzZt6p38CSVEBPgngL9ZkfnyQU= 160 160 - github.com/ipfs/go-unixfsnode v1.8.0/go.mod h1:HxRu9HYHOjK6HUqFBAi++7DVoWAHn0o4v/nZ/VA+0g8= 161 163 github.com/ipfs/go-verifcid v0.0.3 h1:gmRKccqhWDocCRkC+a59g5QW7uJw5bpX9HWBevXa0zs= 162 164 github.com/ipfs/go-verifcid v0.0.3/go.mod h1:gcCtGniVzelKrbk9ooUSX/pM3xlH73fZZJDzQJRvOUw= 163 165 github.com/ipld/go-car v0.6.1-0.20230509095817-92d28eb23ba4 h1:oFo19cBmcP0Cmg3XXbrr0V/c+xU9U1huEZp8+OgBzdI= ··· 168 170 github.com/ipld/go-codec-dagpb v1.6.0/go.mod h1:ANzFhfP2uMJxRBr8CE+WQWs5UsNa0pYtmKZ+agnUw9s= 169 171 github.com/ipld/go-ipld-prime v0.21.0 h1:n4JmcpOlPDIxBcY037SVfpd1G+Sj1nKZah0m6QH9C2E= 170 172 github.com/ipld/go-ipld-prime v0.21.0/go.mod h1:3RLqy//ERg/y5oShXXdx5YIp50cFGOanyMctpPjsvxQ= 171 171 - github.com/ipld/go-ipld-prime/storage/bsadapter v0.0.0-20230102063945-1a409dc236dd h1:gMlw/MhNr2Wtp5RwGdsW23cs+yCuj9k2ON7i9MiJlRo= 172 172 - github.com/ipld/go-ipld-prime/storage/bsadapter v0.0.0-20230102063945-1a409dc236dd/go.mod h1:wZ8hH8UxeryOs4kJEJaiui/s00hDSbE37OKsL47g+Sw= 173 173 github.com/jackc/pgpassfile v1.0.0 h1:/6Hmqy13Ss2zCq62VdNG8tM1wchn8zjSGOBJ6icpsIM= 174 174 github.com/jackc/pgpassfile v1.0.0/go.mod h1:CEx0iS5ambNFdcRtxPj5JhEz+xB6uRky5eyVu/W2HEg= 175 175 github.com/jackc/pgservicefile v0.0.0-20221227161230-091c0ba34f0a h1:bbPeKD0xmW/Y25WS6cokEszi5g+S0QxI/d45PkRi7Nk= ··· 187 187 github.com/jinzhu/inflection v1.0.0/go.mod h1:h+uFLlag+Qp1Va5pdKtLDYj+kHp5pxUVkryuEj+Srlc= 188 188 github.com/jinzhu/now v1.1.5 h1:/o9tlHleP7gOFmsnYNz3RGnqzefHA47wQpKrrdTIwXQ= 189 189 github.com/jinzhu/now v1.1.5/go.mod h1:d3SSVoowX0Lcu0IBviAWJpolVfI5UJVZZ7cO71lE/z8= 190 190 + github.com/jmespath/go-jmespath v0.4.0 h1:BEgLn5cpjn8UN1mAw4NjwDrS35OdebyEtFe+9YPoQUg= 191 191 + github.com/jmespath/go-jmespath v0.4.0/go.mod h1:T8mJZnbsbmF+m6zOOFylbeCJqk5+pHWvzYPziyZiYoo= 192 192 + github.com/jmespath/go-jmespath/internal/testify v1.5.1 h1:shLQSRRSCCPj3f2gpwzGwWFoC7ycTf1rcQZHOlsJ6N8= 193 193 + github.com/jmespath/go-jmespath/internal/testify v1.5.1/go.mod h1:L3OGu8Wl2/fWfCI6z80xFu9LTZmf1ZRjMHUOPmWr69U= 190 194 github.com/joho/godotenv v1.5.1 h1:7eLL/+HRGLY0ldzfGMeQkb7vMd0as4CfYvUVzLqw0N0= 191 195 github.com/joho/godotenv v1.5.1/go.mod h1:f4LDr5Voq0i2e/R5DDNOoa2zzDfwtkZa6DnEwAbqwq4= 192 196 github.com/jtolds/gls v4.20.0+incompatible h1:xdiiI2gbIgH/gLH7ADydsJ1uDOEzR8yvV7C0MuV77Wo= ··· 204 208 github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= 205 209 github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY= 206 210 github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE= 211 211 + github.com/labstack/echo-contrib v0.17.4 h1:g5mfsrJfJTKv+F5uNKCyrjLK7js+ZW6HTjg4FnDxxgk= 212 212 + github.com/labstack/echo-contrib v0.17.4/go.mod h1:9O7ZPAHUeMGTOAfg80YqQduHzt0CzLak36PZRldYrZ0= 207 213 github.com/labstack/echo/v4 v4.13.3 h1:pwhpCPrTl5qry5HRdM5FwdXnhXSLSY+WE+YQSeCaafY= 208 214 github.com/labstack/echo/v4 v4.13.3/go.mod h1:o90YNEeQWjDozo584l7AwhJMHN0bOC4tAfg+Xox9q5g= 209 215 github.com/labstack/gommon v0.4.2 h1:F8qTUNXgG1+6WQmqoUWnz8WiEU60mXVVw0P4ht1WRA0= ··· 241 247 github.com/libp2p/go-nat v0.1.0/go.mod h1:X7teVkwRHNInVNWQiO/tAiAVRwSr5zoRz4YSTC3uRBM= 242 248 github.com/libp2p/go-netroute v0.2.1 h1:V8kVrpD8GK0Riv15/7VN6RbUQ3URNZVosw7H2v9tksU= 243 249 github.com/libp2p/go-netroute v0.2.1/go.mod h1:hraioZr0fhBjG0ZRXJJ6Zj2IVEVNx6tDTFQfSmcq7mQ= 244 244 - github.com/mattn/go-colorable v0.1.13 h1:fFA4WZxdEF4tXPZVKMLwD8oUnCTTo08duU7wxecdEvA= 245 245 - github.com/mattn/go-colorable v0.1.13/go.mod h1:7S9/ev0klgBDR4GtXTXX8a3vIGJpMovkB8vQcUbaXHg= 250 250 + github.com/mattn/go-colorable v0.1.14 h1:9A9LHSqF/7dyVVX6g0U9cwm9pG3kP9gSzcuIPHPsaIE= 251 251 + github.com/mattn/go-colorable v0.1.14/go.mod h1:6LmQG8QLFO4G5z1gPvYEzlUgJ2wF+stgPZH1UqBm1s8= 246 252 github.com/mattn/go-isatty v0.0.14/go.mod h1:7GGIvUiUoEMVVmxf/4nioHXj79iQHKdU27kJ6hsGG94= 247 247 - github.com/mattn/go-isatty v0.0.16/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM= 248 253 github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY= 249 254 github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y= 250 255 github.com/mattn/go-sqlite3 v1.14.22 h1:2gZY6PC6kBnID23Tichd1K+Z0oS6nE/XwU+Vz/5o4kU= 251 256 github.com/mattn/go-sqlite3 v1.14.22/go.mod h1:Uh1q+B4BYcTPb+yiD3kU8Ct7aC0hY9fxUwlHK0RXw+Y= 252 252 - github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0 h1:jWpvCLoY8Z/e3VKvlsiIGKtc+UG6U5vzxaoagmhXfyg= 253 253 - github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0/go.mod h1:QUyp042oQthUoa9bqDv0ER0wrtXnBruoNd7aNjkbP+k= 254 257 github.com/miekg/dns v1.1.50 h1:DQUfb9uc6smULcREF09Uc+/Gd46YWqJd5DbpPE9xkcA= 255 258 github.com/miekg/dns v1.1.50/go.mod h1:e3IlAVfNqAllflbibAZEWOXOQ+Ynzk/dDozDxY7XnME= 256 259 github.com/minio/sha256-simd v1.0.1 h1:6kaan5IFmwTNynnKKpDHe6FWHohJOHhCPchzK49dzMM= ··· 277 280 github.com/multiformats/go-multistream v0.4.1/go.mod h1:Mz5eykRVAjJWckE2U78c6xqdtyNUEhKSM0Lwar2p77Q= 278 281 github.com/multiformats/go-varint v0.0.7 h1:sWSGR+f/eu5ABZA2ZpYKBILXTTs9JWpdEM/nEGOHFS8= 279 282 github.com/multiformats/go-varint v0.0.7/go.mod h1:r8PUYw/fD/SjBCiKOoDlGF6QawOELpZAu9eioSos/OU= 283 283 + github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 h1:C3w9PqII01/Oq1c1nUAm88MOHcQC9l5mIlSMApZMrHA= 284 284 + github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= 280 285 github.com/opentracing/opentracing-go v1.2.0 h1:uEJPy/1a5RIPAJ0Ov+OIO8OxWu77jEv+1B0VhjKrZUs= 281 286 github.com/opentracing/opentracing-go v1.2.0/go.mod h1:GxEUsuufX4nBwe+T+Wl9TAgYrxe9dPLANfrWvHYVTgc= 282 282 - github.com/orandin/slog-gorm v1.3.2 h1:C0lKDQPAx/pF+8K2HL7bdShPwOEJpPM0Bn80zTzxU1g= 283 283 - github.com/orandin/slog-gorm v1.3.2/go.mod h1:MoZ51+b7xE9lwGNPYEhxcUtRNrYzjdcKvA8QXQQGEPA= 284 287 github.com/petar/GoLLRB v0.0.0-20210522233825-ae3b015fd3e9 h1:1/WtZae0yGtPq+TI6+Tv1WTxkukpXeMlviSxvL7SRgk= 285 288 github.com/petar/GoLLRB v0.0.0-20210522233825-ae3b015fd3e9/go.mod h1:x3N5drFsm2uilKKuuYo6LdyD8vZAW55sH/9w+pbo1sw= 286 289 github.com/pkg/errors v0.8.1/go.mod h1:bwawxfHBFNV+L2hUp1rHADufV3IMtnDRdf1r5NINEl0= ··· 288 291 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= 289 292 github.com/polydawn/refmt v0.89.1-0.20221221234430-40501e09de1f h1:VXTQfuJj9vKR4TCkEuWIckKvdHFeJH/huIFJ9/cXOB0= 290 293 github.com/polydawn/refmt v0.89.1-0.20221221234430-40501e09de1f/go.mod h1:/zvteZs/GwLtCgZ4BL6CBsk9IKIlexP43ObX9AxTqTw= 291 291 - github.com/prometheus/client_golang v1.17.0 h1:rl2sfwZMtSthVU752MqfjQozy7blglC+1SOtjMAMh+Q= 292 292 - github.com/prometheus/client_golang v1.17.0/go.mod h1:VeL+gMmOAxkS2IqfCq0ZmHSL+LjWfWDUmp1mBz9JgUY= 293 293 - github.com/prometheus/client_model v0.5.0 h1:VQw1hfvPvk3Uv6Qf29VrPF32JB6rtbgI6cYPYQjL0Qw= 294 294 - github.com/prometheus/client_model v0.5.0/go.mod h1:dTiFglRmd66nLR9Pv9f0mZi7B7fk5Pm3gvsjB5tr+kI= 295 295 - github.com/prometheus/common v0.45.0 h1:2BGz0eBc2hdMDLnO/8n0jeB3oPrt2D08CekT0lneoxM= 296 296 - github.com/prometheus/common v0.45.0/go.mod h1:YJmSTw9BoKxJplESWWxlbyttQR4uaEcGyv9MZjVOJsY= 297 297 - github.com/prometheus/procfs v0.12.0 h1:jluTpSng7V9hY0O2R9DzzJHYb2xULk9VTR1V1R/k6Bo= 298 298 - github.com/prometheus/procfs v0.12.0/go.mod h1:pcuDEFsWDnvcgNzo4EEweacyhjeA9Zk3cnaOZAZEfOo= 294 294 + github.com/prometheus/client_golang v1.22.0 h1:rb93p9lokFEsctTys46VnV1kLCDpVZ0a/Y92Vm0Zc6Q= 295 295 + github.com/prometheus/client_golang v1.22.0/go.mod h1:R7ljNsLXhuQXYZYtw6GAE9AZg8Y7vEW5scdCXrWRXC0= 296 296 + github.com/prometheus/client_model v0.6.2 h1:oBsgwpGs7iVziMvrGhE53c/GrLUsZdHnqNwqPLxwZyk= 297 297 + github.com/prometheus/client_model v0.6.2/go.mod h1:y3m2F6Gdpfy6Ut/GBsUqTWZqCUvMVzSfMLjcu6wAwpE= 298 298 + github.com/prometheus/common v0.63.0 h1:YR/EIY1o3mEFP/kZCD7iDMnLPlGyuU2Gb3HIcXnA98k= 299 299 + github.com/prometheus/common v0.63.0/go.mod h1:VVFF/fBIoToEnWRVkYoXEkq3R3paCoxG9PXP74SnV18= 300 300 + github.com/prometheus/procfs v0.16.1 h1:hZ15bTNuirocR6u0JZ6BAHHmwS1p8B4P6MRqxtzMyRg= 301 301 + github.com/prometheus/procfs v0.16.1/go.mod h1:teAbpZRB1iIAJYREa1LsoWUXykVXA1KlTmWl8x/U+Is= 299 302 github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= 300 303 github.com/rogpeppe/go-internal v1.10.0 h1:TMyTOH3F/DB16zRVcYyreMH6GnZZrwQVAoYjRBZyWFQ= 301 304 github.com/rogpeppe/go-internal v1.10.0/go.mod h1:UQnix2H7Ngw/k4C5ijL5+65zddjncjaFoBhdsK/akog= ··· 343 346 github.com/whyrusleeping/cbor v0.0.0-20171005072247-63513f603b11/go.mod h1:Wlo/SzPmxVp6vXpGt/zaXhHH0fn4IxgqZc82aKg6bpQ= 344 347 github.com/whyrusleeping/cbor-gen v0.2.1-0.20241030202151-b7a6831be65e h1:28X54ciEwwUxyHn9yrZfl5ojgF4CBNLWX7LR0rvBkf4= 345 348 github.com/whyrusleeping/cbor-gen v0.2.1-0.20241030202151-b7a6831be65e/go.mod h1:pM99HXyEbSQHcosHc0iW7YFmwnscr+t9Te4ibko05so= 346 346 - github.com/whyrusleeping/chunker v0.0.0-20181014151217-fe64bd25879f h1:jQa4QT2UP9WYv2nzyawpKMOCl+Z/jW7djv2/J50lj9E= 347 347 - github.com/whyrusleeping/chunker v0.0.0-20181014151217-fe64bd25879f/go.mod h1:p9UJB6dDgdPgMJZs7UjUOdulKyRr9fqkS+6JKAInPy8= 348 348 - github.com/whyrusleeping/go-did v0.0.0-20230824162731-404d1707d5d6 h1:yJ9/LwIGIk/c0CdoavpC9RNSGSruIspSZtxG3Nnldic= 349 349 - github.com/whyrusleeping/go-did v0.0.0-20230824162731-404d1707d5d6/go.mod h1:39U9RRVr4CKbXpXYopWn+FSH5s+vWu6+RmguSPWAq5s= 350 349 github.com/xrash/smetrics v0.0.0-20240521201337-686a1a2994c1 h1:gEOO8jv9F4OT7lGCjxCBTO/36wtF6j2nSip77qHd4x4= 351 350 github.com/xrash/smetrics v0.0.0-20240521201337-686a1a2994c1/go.mod h1:Ohn+xnUBiLI6FVj/9LpzZWtj1/D6lUovWYBkxHVV3aM= 352 351 github.com/yuin/goldmark v1.1.27/go.mod h1:3hX8gzYuyVAZsxl0MRgGTJEmQBFcNTphYh9decYSb74= ··· 387 386 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= 388 387 golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= 389 388 golang.org/x/crypto v0.12.0/go.mod h1:NF0Gs7EO5K4qLn+Ylc+fih8BSTeIjAP05siRnAh98yw= 390 390 - golang.org/x/crypto v0.36.0 h1:AnAEvhDddvBdpY+uR+MyHmuZzzNqXSe/GvuDeob5L34= 391 391 - golang.org/x/crypto v0.36.0/go.mod h1:Y4J0ReaxCR1IMaabaSMugxJES1EpwhBHhv2bDHklZvc= 389 389 + golang.org/x/crypto v0.38.0 h1:jt+WWG8IZlBnVbomuhg2Mdq0+BBQaHbtqHEFEigjUV8= 390 390 + golang.org/x/crypto v0.38.0/go.mod h1:MvrbAqul58NNYPKnOra203SB9vpuZW0e+RRZV+Ggqjw= 392 391 golang.org/x/exp v0.0.0-20231110203233-9a3e6036ecaa h1:FRnLl4eNAQl8hwxVVC17teOw8kdjVDVAiFMtgUdTSRQ= 393 392 golang.org/x/exp v0.0.0-20231110203233-9a3e6036ecaa/go.mod h1:zk2irFbV9DP96SEBUUAy67IdHUaZuSnrz1n472HUCLE= 394 393 golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= ··· 410 409 golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= 411 410 golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs= 412 411 golang.org/x/net v0.10.0/go.mod h1:0qNGK6F8kojg2nk9dLZ2mShWaEBan6FAoqfSigmmuDg= 413 413 - golang.org/x/net v0.33.0 h1:74SYHlV8BIgHIFC/LrYkOGIwL19eTYXQ5wc6TBuO36I= 414 414 - golang.org/x/net v0.33.0/go.mod h1:HXLR5J+9DxmrqMwG9qjGCxZ+zKXxBru04zlTvWlWuN4= 412 412 + golang.org/x/net v0.40.0 h1:79Xs7wF06Gbdcg4kdCCIQArK11Z1hr5POQ6+fIYHNuY= 413 413 + golang.org/x/net v0.40.0/go.mod h1:y0hY0exeL2Pku80/zKK7tpntoX23cqL3Oa6njdgRtds= 415 414 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 416 415 golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 417 416 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 418 417 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 419 418 golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 420 419 golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 421 421 - golang.org/x/sync v0.12.0 h1:MHc5BpPuC30uJk597Ri8TV3CNZcTLu6B6z4lJy+g6Jw= 422 422 - golang.org/x/sync v0.12.0/go.mod h1:1dzgHSNfp02xaA81J2MS99Qcpr2w7fw1gpm99rleRqA= 420 420 + golang.org/x/sync v0.14.0 h1:woo0S4Yywslg6hp4eUFjTVOyKt0RookbpAHG4c1HmhQ= 421 421 + golang.org/x/sync v0.14.0/go.mod h1:1dzgHSNfp02xaA81J2MS99Qcpr2w7fw1gpm99rleRqA= 423 422 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= 424 423 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= 425 424 golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= ··· 431 430 golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 432 431 golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 433 432 golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 434 434 - golang.org/x/sys v0.0.0-20220811171246-fbc7d0a398ab/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 435 433 golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 436 434 golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 437 435 golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 438 436 golang.org/x/sys v0.11.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 439 439 - golang.org/x/sys v0.31.0 h1:ioabZlmFYtWhL+TRYpcnNlLwhyxaM9kWTDEmfnprqik= 440 440 - golang.org/x/sys v0.31.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= 437 437 + golang.org/x/sys v0.33.0 h1:q3i8TbbEz+JRD9ywIRlyRAQbM0qF7hu24q3teo2hbuw= 438 438 + golang.org/x/sys v0.33.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= 441 439 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= 442 440 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= 443 441 golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k= ··· 449 447 golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= 450 448 golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= 451 449 golang.org/x/text v0.12.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= 452 452 - golang.org/x/text v0.23.0 h1:D71I7dUrlY+VX0gQShAThNGHFxZ13dGLBHQLVl1mJlY= 453 453 - golang.org/x/text v0.23.0/go.mod h1:/BLNzu4aZCJ1+kcD0DNRotWKage4q2rGVAg4o22unh4= 454 454 - golang.org/x/time v0.8.0 h1:9i3RxcPv3PZnitoVGMPDKZSq1xW1gK1Xy3ArNOGZfEg= 455 455 - golang.org/x/time v0.8.0/go.mod h1:3BpzKBy/shNhVucY/MWOyx10tF3SFh9QdLuxbVysPQM= 450 450 + golang.org/x/text v0.25.0 h1:qVyWApTSYLk/drJRO5mDlNYskwQznZmkpV2c8q9zls4= 451 451 + golang.org/x/text v0.25.0/go.mod h1:WEdwpYrmk1qmdHvhkSTNPm3app7v4rsT8F2UD6+VHIA= 452 452 + golang.org/x/time v0.11.0 h1:/bpjEDfN9tkoN/ryeYHnv5hcMlc8ncjMcM4XBk5NWV0= 453 453 + golang.org/x/time v0.11.0/go.mod h1:CDIdPxbZBQxdj6cxyCIdrNogrJKMJ7pr37NYpMcMDSg= 456 454 golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= 457 455 golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= 458 456 golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= ··· 473 471 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= 474 472 golang.org/x/xerrors v0.0.0-20231012003039-104605ab7028 h1:+cNy6SZtPcJQH3LJVLOSmiC7MMxXNOb3PU/VUEz+EhU= 475 473 golang.org/x/xerrors v0.0.0-20231012003039-104605ab7028/go.mod h1:NDW/Ps6MPRej6fsCIbMTohpP40sJ/P/vI1MoTEGwX90= 476 476 - google.golang.org/protobuf v1.33.0 h1:uNO2rsAINq/JlFpSdYEKIZ0uKD/R9cpdv0T+yoGwGmI= 477 477 - google.golang.org/protobuf v1.33.0/go.mod h1:c6P6GXX6sHbq/GpV6MGZEdwhWPcYBgnhAHhKbcUYpos= 474 474 + google.golang.org/protobuf v1.36.6 h1:z1NpPI8ku2WgiWnf+t9wTPsn6eP1L7ksHUlkfLvd9xY= 475 475 + google.golang.org/protobuf v1.36.6/go.mod h1:jduwjTPXsFjZGTmRluh+L6NjiWu7pchiJ2/5YcXBHnY= 478 476 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= 479 477 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= 480 478 gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=

+73 -54

identity/identity.go

··· 13 13 "github.com/bluesky-social/indigo/util" 14 14 ) 15 15 16 16 - func ResolveHandle(ctx context.Context, cli *http.Client, handle string) (string, error) { 17 17 - if cli == nil { 18 18 - cli = util.RobustHTTPClient() 19 19 - } 20 20 - 21 21 - var did string 22 22 - 23 23 - _, err := syntax.ParseHandle(handle) 16 16 + func ResolveHandleFromTXT(ctx context.Context, handle string) (string, error) { 17 17 + name := fmt.Sprintf("_atproto.%s", handle) 18 18 + recs, err := net.LookupTXT(name) 24 19 if err != nil { 25 25 - return "", err 20 20 + return "", fmt.Errorf("handle could not be resolved via txt: %w", err) 26 21 } 27 22 28 28 - recs, err := net.LookupTXT(fmt.Sprintf("_atproto.%s", handle)) 29 29 - if err == nil { 30 30 - for _, rec := range recs { 31 31 - if strings.HasPrefix(rec, "did=") { 32 32 - did = strings.Split(rec, "did=")[1] 33 33 - break 23 23 + for _, rec := range recs { 24 24 + if strings.HasPrefix(rec, "did=") { 25 25 + maybeDid := strings.Split(rec, "did=")[1] 26 26 + if _, err := syntax.ParseDID(maybeDid); err == nil { 27 27 + return maybeDid, nil 34 28 } 35 29 } 36 36 - } else { 37 37 - fmt.Printf("erorr getting txt records: %v\n", err) 38 30 } 39 31 40 40 - if did == "" { 41 41 - req, err := http.NewRequestWithContext( 42 42 - ctx, 43 43 - "GET", 44 44 - fmt.Sprintf("https://%s/.well-known/atproto-did", handle), 45 45 - nil, 46 46 - ) 47 47 - if err != nil { 48 48 - return "", nil 49 49 - } 32 32 + return "", fmt.Errorf("handle could not be resolved via txt: no record found") 33 33 + } 50 34 51 51 - resp, err := http.DefaultClient.Do(req) 52 52 - if err != nil { 53 53 - return "", nil 54 54 - } 55 55 - defer resp.Body.Close() 35 35 + func ResolveHandleFromWellKnown(ctx context.Context, cli *http.Client, handle string) (string, error) { 36 36 + ustr := fmt.Sprintf("https://%s/.well=known/atproto-did", handle) 37 37 + req, err := http.NewRequestWithContext( 38 38 + ctx, 39 39 + "GET", 40 40 + ustr, 41 41 + nil, 42 42 + ) 43 43 + if err != nil { 44 44 + return "", fmt.Errorf("handle could not be resolved via web: %w", err) 45 45 + } 56 46 57 57 - if resp.StatusCode != http.StatusOK { 58 58 - io.Copy(io.Discard, resp.Body) 59 59 - return "", fmt.Errorf("unable to resolve handle") 60 60 - } 47 47 + resp, err := cli.Do(req) 48 48 + if err != nil { 49 49 + return "", fmt.Errorf("handle could not be resolved via web: %w", err) 50 50 + } 51 51 + defer resp.Body.Close() 61 52 62 62 - b, err := io.ReadAll(resp.Body) 63 63 - if err != nil { 64 64 - return "", err 65 65 - } 53 53 + b, err := io.ReadAll(resp.Body) 54 54 + if err != nil { 55 55 + return "", fmt.Errorf("handle could not be resolved via web: %w", err) 56 56 + } 66 57 67 67 - maybeDid := string(b) 58 58 + if resp.StatusCode != http.StatusOK { 59 59 + return "", fmt.Errorf("handle could not be resolved via web: invalid status code %d", resp.StatusCode) 60 60 + } 68 61 69 69 - if _, err := syntax.ParseDID(maybeDid); err != nil { 70 70 - return "", fmt.Errorf("unable to resolve handle") 71 71 - } 62 62 + maybeDid := string(b) 72 63 73 73 - did = maybeDid 64 64 + if _, err := syntax.ParseDID(maybeDid); err != nil { 65 65 + return "", fmt.Errorf("handle could not be resolved via web: invalid did in document") 74 66 } 75 67 76 76 - return did, nil 68 68 + return maybeDid, nil 77 69 } 78 70 79 79 - func FetchDidDoc(ctx context.Context, cli *http.Client, did string) (*DidDoc, error) { 71 71 + func ResolveHandle(ctx context.Context, cli *http.Client, handle string) (string, error) { 80 72 if cli == nil { 81 73 cli = util.RobustHTTPClient() 82 74 } 83 75 84 84 - var ustr string 76 76 + _, err := syntax.ParseHandle(handle) 77 77 + if err != nil { 78 78 + return "", err 79 79 + } 80 80 + 81 81 + if maybeDidFromTxt, err := ResolveHandleFromTXT(ctx, handle); err == nil { 82 82 + return maybeDidFromTxt, nil 83 83 + } 84 84 + 85 85 + if maybeDidFromWeb, err := ResolveHandleFromWellKnown(ctx, cli, handle); err == nil { 86 86 + return maybeDidFromWeb, nil 87 87 + } 88 88 + 89 89 + return "", fmt.Errorf("handle could not be resolved") 90 90 + } 91 91 + 92 92 + func DidToDocUrl(did string) (string, error) { 85 93 if strings.HasPrefix(did, "did:plc:") { 86 86 - ustr = fmt.Sprintf("https://plc.directory/%s", did) 94 94 + return fmt.Sprintf("https://plc.directory/%s", did), nil 87 95 } else if strings.HasPrefix(did, "did:web:") { 88 88 - ustr = fmt.Sprintf("https://%s/.well-known/did.json", strings.TrimPrefix(did, "did:web:")) 96 96 + return fmt.Sprintf("https://%s/.well-known/did.json", strings.TrimPrefix(did, "did:web:")), nil 89 97 } else { 90 90 - return nil, fmt.Errorf("did was not a supported did type") 98 98 + return "", fmt.Errorf("did was not a supported did type") 99 99 + } 100 100 + } 101 101 + 102 102 + func FetchDidDoc(ctx context.Context, cli *http.Client, did string) (*DidDoc, error) { 103 103 + if cli == nil { 104 104 + cli = util.RobustHTTPClient() 105 105 + } 106 106 + 107 107 + ustr, err := DidToDocUrl(did) 108 108 + if err != nil { 109 109 + return nil, err 91 110 } 92 111 93 112 req, err := http.NewRequestWithContext(ctx, "GET", ustr, nil) ··· 95 114 return nil, err 96 115 } 97 116 98 98 - resp, err := http.DefaultClient.Do(req) 117 117 + resp, err := cli.Do(req) 99 118 if err != nil { 100 119 return nil, err 101 120 } ··· 103 122 104 123 if resp.StatusCode != 200 { 105 124 io.Copy(io.Discard, resp.Body) 106 106 - return nil, fmt.Errorf("could not find identity in plc registry") 125 125 + return nil, fmt.Errorf("unable to find did doc at url. did: %s. url: %s", did, ustr) 107 126 } 108 127 109 128 var diddoc DidDoc ··· 127 146 return nil, err 128 147 } 129 148 130 130 - resp, err := http.DefaultClient.Do(req) 149 149 + resp, err := cli.Do(req) 131 150 if err != nil { 132 151 return nil, err 133 152 }

+16 -5

identity/passport.go

··· 19 19 type Passport struct { 20 20 h *http.Client 21 21 bc BackingCache 22 22 - lk sync.Mutex 22 22 + mu sync.RWMutex 23 23 } 24 24 25 25 func NewPassport(h *http.Client, bc BackingCache) *Passport { ··· 30 30 return &Passport{ 31 31 h: h, 32 32 bc: bc, 33 33 - lk: sync.Mutex{}, 34 33 } 35 34 } 36 35 ··· 38 37 skipCache, _ := ctx.Value("skip-cache").(bool) 39 38 40 39 if !skipCache { 40 40 + p.mu.RLock() 41 41 cached, ok := p.bc.GetDoc(did) 42 42 + p.mu.RUnlock() 43 43 + 42 44 if ok { 43 45 return cached, nil 44 46 } 45 47 } 46 48 47 47 - p.lk.Lock() // this is pretty pathetic, and i should rethink this. but for now, fuck it 48 48 - defer p.lk.Unlock() 49 49 - 49 49 + // TODO: should coalesce requests here 50 50 doc, err := FetchDidDoc(ctx, p.h, did) 51 51 if err != nil { 52 52 return nil, err 53 53 } 54 54 55 55 + p.mu.Lock() 55 56 p.bc.PutDoc(did, doc) 57 57 + p.mu.Unlock() 56 58 57 59 return doc, nil 58 60 } ··· 61 63 skipCache, _ := ctx.Value("skip-cache").(bool) 62 64 63 65 if !skipCache { 66 66 + p.mu.RLock() 64 67 cached, ok := p.bc.GetDid(handle) 68 68 + p.mu.RUnlock() 69 69 + 65 70 if ok { 66 71 return cached, nil 67 72 } ··· 72 77 return "", err 73 78 } 74 79 80 80 + p.mu.Lock() 75 81 p.bc.PutDid(handle, did) 82 82 + p.mu.Unlock() 76 83 77 84 return did, nil 78 85 } 79 86 80 87 func (p *Passport) BustDoc(ctx context.Context, did string) error { 88 88 + p.mu.Lock() 89 89 + defer p.mu.Unlock() 81 90 return p.bc.BustDoc(did) 82 91 } 83 92 84 93 func (p *Passport) BustDid(ctx context.Context, handle string) error { 94 94 + p.mu.Lock() 95 95 + defer p.mu.Unlock() 85 96 return p.bc.BustDid(handle) 86 97 }

+65

internal/db/db.go

··· 1 1 + package db 2 2 + 3 3 + import ( 4 4 + "sync" 5 5 + 6 6 + "gorm.io/gorm" 7 7 + "gorm.io/gorm/clause" 8 8 + ) 9 9 + 10 10 + type DB struct { 11 11 + cli *gorm.DB 12 12 + mu sync.Mutex 13 13 + } 14 14 + 15 15 + func NewDB(cli *gorm.DB) *DB { 16 16 + return &DB{ 17 17 + cli: cli, 18 18 + mu: sync.Mutex{}, 19 19 + } 20 20 + } 21 21 + 22 22 + func (db *DB) Create(value any, clauses []clause.Expression) *gorm.DB { 23 23 + db.mu.Lock() 24 24 + defer db.mu.Unlock() 25 25 + return db.cli.Clauses(clauses...).Create(value) 26 26 + } 27 27 + 28 28 + func (db *DB) Exec(sql string, clauses []clause.Expression, values ...any) *gorm.DB { 29 29 + db.mu.Lock() 30 30 + defer db.mu.Unlock() 31 31 + return db.cli.Clauses(clauses...).Exec(sql, values...) 32 32 + } 33 33 + 34 34 + func (db *DB) Raw(sql string, clauses []clause.Expression, values ...any) *gorm.DB { 35 35 + return db.cli.Clauses(clauses...).Raw(sql, values...) 36 36 + } 37 37 + 38 38 + func (db *DB) AutoMigrate(models ...any) error { 39 39 + return db.cli.AutoMigrate(models...) 40 40 + } 41 41 + 42 42 + func (db *DB) Delete(value any, clauses []clause.Expression) *gorm.DB { 43 43 + db.mu.Lock() 44 44 + defer db.mu.Unlock() 45 45 + return db.cli.Clauses(clauses...).Delete(value) 46 46 + } 47 47 + 48 48 + func (db *DB) First(dest any, conds ...any) *gorm.DB { 49 49 + return db.cli.First(dest, conds...) 50 50 + } 51 51 + 52 52 + // TODO: this isn't actually good. we can commit even if the db is locked here. this is probably okay for the time being, but need to figure 53 53 + // out a better solution. right now we only do this whenever we're importing a repo though so i'm mostly not worried, but it's still bad. 54 54 + // e.g. when we do apply writes we should also be using a transcation but we don't right now 55 55 + func (db *DB) BeginDangerously() *gorm.DB { 56 56 + return db.cli.Begin() 57 57 + } 58 58 + 59 59 + func (db *DB) Lock() { 60 60 + db.mu.Lock() 61 61 + } 62 62 + 63 63 + func (db *DB) Unlock() { 64 64 + db.mu.Unlock() 65 65 + }

+63 -1

internal/helpers/helpers.go

··· 1 1 package helpers 2 2 3 3 import ( 4 4 + crand "crypto/rand" 5 5 + "encoding/hex" 6 6 + "errors" 4 7 "math/rand" 8 8 + "net/url" 5 9 10 10 + "github.com/Azure/go-autorest/autorest/to" 6 11 "github.com/labstack/echo/v4" 12 12 + "github.com/lestrrat-go/jwx/v2/jwk" 7 13 ) 8 14 9 9 - var letters = []rune("abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ1234567890") 15 15 + // This will confirm to the regex in the application if 5 chars are used for each side of the - 16 16 + // /^[A-Z2-7]{5}-[A-Z2-7]{5}$/ 17 17 + var letters = []rune("ABCDEFGHIJKLMNOPQRSTUVWXYZ234567") 10 18 11 19 func InputError(e echo.Context, custom *string) error { 12 20 msg := "InvalidRequest" ··· 24 32 return genericError(e, 400, msg) 25 33 } 26 34 35 35 + func InvalidTokenError(e echo.Context) error { 36 36 + return InputError(e, to.StringPtr("InvalidToken")) 37 37 + } 38 38 + 39 39 + func ExpiredTokenError(e echo.Context) error { 40 40 + // WARN: See https://github.com/bluesky-social/atproto/discussions/3319 41 41 + return e.JSON(400, map[string]string{ 42 42 + "error": "ExpiredToken", 43 43 + "message": "*", 44 44 + }) 45 45 + } 46 46 + 27 47 func genericError(e echo.Context, code int, msg string) error { 28 48 return e.JSON(code, map[string]string{ 29 49 "error": msg, ··· 37 57 } 38 58 return string(b) 39 59 } 60 60 + 61 61 + func RandomHex(n int) (string, error) { 62 62 + bytes := make([]byte, n) 63 63 + if _, err := crand.Read(bytes); err != nil { 64 64 + return "", err 65 65 + } 66 66 + return hex.EncodeToString(bytes), nil 67 67 + } 68 68 + 69 69 + func RandomBytes(n int) []byte { 70 70 + bs := make([]byte, n) 71 71 + crand.Read(bs) 72 72 + return bs 73 73 + } 74 74 + 75 75 + func ParseJWKFromBytes(b []byte) (jwk.Key, error) { 76 76 + return jwk.ParseKey(b) 77 77 + } 78 78 + 79 79 + func OauthParseHtu(htu string) (string, error) { 80 80 + u, err := url.Parse(htu) 81 81 + if err != nil { 82 82 + return "", errors.New("`htu` is not a valid URL") 83 83 + } 84 84 + 85 85 + if u.User != nil { 86 86 + _, containsPass := u.User.Password() 87 87 + if u.User.Username() != "" || containsPass { 88 88 + return "", errors.New("`htu` must not contain credentials") 89 89 + } 90 90 + } 91 91 + 92 92 + if u.Scheme != "http" && u.Scheme != "https" { 93 93 + return "", errors.New("`htu` must be http or https") 94 94 + } 95 95 + 96 96 + return OauthNormalizeHtu(u), nil 97 97 + } 98 98 + 99 99 + func OauthNormalizeHtu(u *url.URL) string { 100 100 + return u.Scheme + "://" + u.Host + u.RawPath 101 101 + }

+15 -10

models/models.go

··· 8 8 ) 9 9 10 10 type Repo struct { 11 11 - Did string `gorm:"primaryKey"` 12 12 - CreatedAt time.Time 13 13 - Email string `gorm:"uniqueIndex"` 14 14 - EmailConfirmedAt *time.Time 15 15 - EmailVerificationCode *string 16 16 - Password string 17 17 - SigningKey []byte 18 18 - Rev string 19 19 - Root []byte 20 20 - Preferences []byte 11 11 + Did string `gorm:"primaryKey"` 12 12 + CreatedAt time.Time 13 13 + Email string `gorm:"uniqueIndex"` 14 14 + EmailConfirmedAt *time.Time 15 15 + EmailVerificationCode *string 16 16 + EmailVerificationCodeExpiresAt *time.Time 17 17 + EmailUpdateCode *string 18 18 + EmailUpdateCodeExpiresAt *time.Time 19 19 + PasswordResetCode *string 20 20 + PasswordResetCodeExpiresAt *time.Time 21 21 + Password string 22 22 + SigningKey []byte 23 23 + Rev string 24 24 + Root []byte 25 25 + Preferences []byte 21 26 } 22 27 23 28 func (r *Repo) SignFor(ctx context.Context, did string, msg []byte) ([]byte, error) {

+8

oauth/client/client.go

··· 1 1 + package client 2 2 + 3 3 + import "github.com/lestrrat-go/jwx/v2/jwk" 4 4 + 5 5 + type Client struct { 6 6 + Metadata *Metadata 7 7 + JWKS jwk.Key 8 8 + }

+389

oauth/client/manager.go

··· 1 1 + package client 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + "encoding/json" 6 6 + "errors" 7 7 + "fmt" 8 8 + "io" 9 9 + "log/slog" 10 10 + "net/http" 11 11 + "net/url" 12 12 + "slices" 13 13 + "strings" 14 14 + "time" 15 15 + 16 16 + cache "github.com/go-pkgz/expirable-cache/v3" 17 17 + "github.com/haileyok/cocoon/internal/helpers" 18 18 + "github.com/lestrrat-go/jwx/v2/jwk" 19 19 + ) 20 20 + 21 21 + type Manager struct { 22 22 + cli *http.Client 23 23 + logger *slog.Logger 24 24 + jwksCache cache.Cache[string, jwk.Key] 25 25 + metadataCache cache.Cache[string, Metadata] 26 26 + } 27 27 + 28 28 + type ManagerArgs struct { 29 29 + Cli *http.Client 30 30 + Logger *slog.Logger 31 31 + } 32 32 + 33 33 + func NewManager(args ManagerArgs) *Manager { 34 34 + if args.Logger == nil { 35 35 + args.Logger = slog.Default() 36 36 + } 37 37 + 38 38 + if args.Cli == nil { 39 39 + args.Cli = http.DefaultClient 40 40 + } 41 41 + 42 42 + jwksCache := cache.NewCache[string, jwk.Key]().WithLRU().WithMaxKeys(500).WithTTL(5 * time.Minute) 43 43 + metadataCache := cache.NewCache[string, Metadata]().WithLRU().WithMaxKeys(500).WithTTL(5 * time.Minute) 44 44 + 45 45 + return &Manager{ 46 46 + cli: args.Cli, 47 47 + logger: args.Logger, 48 48 + jwksCache: jwksCache, 49 49 + metadataCache: metadataCache, 50 50 + } 51 51 + } 52 52 + 53 53 + func (cm *Manager) GetClient(ctx context.Context, clientId string) (*Client, error) { 54 54 + metadata, err := cm.getClientMetadata(ctx, clientId) 55 55 + if err != nil { 56 56 + return nil, err 57 57 + } 58 58 + 59 59 + var jwks jwk.Key 60 60 + if metadata.JWKS != nil { 61 61 + // TODO: this is kinda bad but whatever for now. there could obviously be more than one jwk, and we need to 62 62 + // make sure we use the right one 63 63 + k, err := helpers.ParseJWKFromBytes((*metadata.JWKS)[0]) 64 64 + if err != nil { 65 65 + return nil, err 66 66 + } 67 67 + jwks = k 68 68 + } else if metadata.JWKSURI != nil { 69 69 + maybeJwks, err := cm.getClientJwks(ctx, clientId, *metadata.JWKSURI) 70 70 + if err != nil { 71 71 + return nil, err 72 72 + } 73 73 + 74 74 + jwks = maybeJwks 75 75 + } 76 76 + 77 77 + return &Client{ 78 78 + Metadata: metadata, 79 79 + JWKS: jwks, 80 80 + }, nil 81 81 + } 82 82 + 83 83 + func (cm *Manager) getClientMetadata(ctx context.Context, clientId string) (*Metadata, error) { 84 84 + metadataCached, ok := cm.metadataCache.Get(clientId) 85 85 + if !ok { 86 86 + req, err := http.NewRequestWithContext(ctx, "GET", clientId, nil) 87 87 + if err != nil { 88 88 + return nil, err 89 89 + } 90 90 + 91 91 + resp, err := cm.cli.Do(req) 92 92 + if err != nil { 93 93 + return nil, err 94 94 + } 95 95 + defer resp.Body.Close() 96 96 + 97 97 + if resp.StatusCode != http.StatusOK { 98 98 + io.Copy(io.Discard, resp.Body) 99 99 + return nil, fmt.Errorf("fetching client metadata returned response code %d", resp.StatusCode) 100 100 + } 101 101 + 102 102 + b, err := io.ReadAll(resp.Body) 103 103 + if err != nil { 104 104 + return nil, fmt.Errorf("error reading bytes from client response: %w", err) 105 105 + } 106 106 + 107 107 + validated, err := validateAndParseMetadata(clientId, b) 108 108 + if err != nil { 109 109 + return nil, err 110 110 + } 111 111 + 112 112 + return validated, nil 113 113 + } else { 114 114 + return &metadataCached, nil 115 115 + } 116 116 + } 117 117 + 118 118 + func (cm *Manager) getClientJwks(ctx context.Context, clientId, jwksUri string) (jwk.Key, error) { 119 119 + jwks, ok := cm.jwksCache.Get(clientId) 120 120 + if !ok { 121 121 + req, err := http.NewRequestWithContext(ctx, "GET", jwksUri, nil) 122 122 + if err != nil { 123 123 + return nil, err 124 124 + } 125 125 + 126 126 + resp, err := cm.cli.Do(req) 127 127 + if err != nil { 128 128 + return nil, err 129 129 + } 130 130 + defer resp.Body.Close() 131 131 + 132 132 + if resp.StatusCode != http.StatusOK { 133 133 + io.Copy(io.Discard, resp.Body) 134 134 + return nil, fmt.Errorf("fetching client jwks returned response code %d", resp.StatusCode) 135 135 + } 136 136 + 137 137 + type Keys struct { 138 138 + Keys []map[string]any `json:"keys"` 139 139 + } 140 140 + 141 141 + var keys Keys 142 142 + if err := json.NewDecoder(resp.Body).Decode(&keys); err != nil { 143 143 + return nil, fmt.Errorf("error unmarshaling keys response: %w", err) 144 144 + } 145 145 + 146 146 + if len(keys.Keys) == 0 { 147 147 + return nil, errors.New("no keys in jwks response") 148 148 + } 149 149 + 150 150 + // TODO: this is again bad, we should be figuring out which one we need to use... 151 151 + b, err := json.Marshal(keys.Keys[0]) 152 152 + if err != nil { 153 153 + return nil, fmt.Errorf("could not marshal key: %w", err) 154 154 + } 155 155 + 156 156 + k, err := helpers.ParseJWKFromBytes(b) 157 157 + if err != nil { 158 158 + return nil, err 159 159 + } 160 160 + 161 161 + jwks = k 162 162 + } 163 163 + 164 164 + return jwks, nil 165 165 + } 166 166 + 167 167 + func validateAndParseMetadata(clientId string, b []byte) (*Metadata, error) { 168 168 + var metadataMap map[string]any 169 169 + if err := json.Unmarshal(b, &metadataMap); err != nil { 170 170 + return nil, fmt.Errorf("error unmarshaling metadata: %w", err) 171 171 + } 172 172 + 173 173 + _, jwksOk := metadataMap["jwks"].(string) 174 174 + _, jwksUriOk := metadataMap["jwks_uri"].(string) 175 175 + if jwksOk && jwksUriOk { 176 176 + return nil, errors.New("jwks_uri and jwks are mutually exclusive") 177 177 + } 178 178 + 179 179 + for _, k := range []string{ 180 180 + "default_max_age", 181 181 + "userinfo_signed_response_alg", 182 182 + "id_token_signed_response_alg", 183 183 + "userinfo_encryhpted_response_alg", 184 184 + "authorization_encrypted_response_enc", 185 185 + "authorization_encrypted_response_alg", 186 186 + "tls_client_certificate_bound_access_tokens", 187 187 + } { 188 188 + _, kOk := metadataMap[k] 189 189 + if kOk { 190 190 + return nil, fmt.Errorf("unsupported `%s` parameter", k) 191 191 + } 192 192 + } 193 193 + 194 194 + var metadata Metadata 195 195 + if err := json.Unmarshal(b, &metadata); err != nil { 196 196 + return nil, fmt.Errorf("error unmarshaling metadata: %w", err) 197 197 + } 198 198 + 199 199 + u, err := url.Parse(metadata.ClientURI) 200 200 + if err != nil { 201 201 + return nil, fmt.Errorf("unable to parse client uri: %w", err) 202 202 + } 203 203 + 204 204 + if isLocalHostname(u.Hostname()) { 205 205 + return nil, errors.New("`client_uri` hostname is invalid") 206 206 + } 207 207 + 208 208 + if metadata.Scope == "" { 209 209 + return nil, errors.New("missing `scopes` scope") 210 210 + } 211 211 + 212 212 + scopes := strings.Split(metadata.Scope, " ") 213 213 + if !slices.Contains(scopes, "atproto") { 214 214 + return nil, errors.New("missing `atproto` scope") 215 215 + } 216 216 + 217 217 + scopesMap := map[string]bool{} 218 218 + for _, scope := range scopes { 219 219 + if scopesMap[scope] { 220 220 + return nil, fmt.Errorf("duplicate scope `%s`", scope) 221 221 + } 222 222 + 223 223 + // TODO: check for unsupported scopes 224 224 + 225 225 + scopesMap[scope] = true 226 226 + } 227 227 + 228 228 + grantTypesMap := map[string]bool{} 229 229 + for _, gt := range metadata.GrantTypes { 230 230 + if grantTypesMap[gt] { 231 231 + return nil, fmt.Errorf("duplicate grant type `%s`", gt) 232 232 + } 233 233 + 234 234 + switch gt { 235 235 + case "implicit": 236 236 + return nil, errors.New("grantg type `implicit` is not allowed") 237 237 + case "authorization_code", "refresh_token": 238 238 + // TODO check if this grant type is supported 239 239 + default: 240 240 + return nil, fmt.Errorf("grant tyhpe `%s` is not supported", gt) 241 241 + } 242 242 + 243 243 + grantTypesMap[gt] = true 244 244 + } 245 245 + 246 246 + if metadata.ClientID != clientId { 247 247 + return nil, errors.New("`client_id` does not match") 248 248 + } 249 249 + 250 250 + subjectType, subjectTypeOk := metadataMap["subject_type"].(string) 251 251 + if subjectTypeOk && subjectType != "public" { 252 252 + return nil, errors.New("only public `subject_type` is supported") 253 253 + } 254 254 + 255 255 + switch metadata.TokenEndpointAuthMethod { 256 256 + case "none": 257 257 + if metadata.TokenEndpointAuthSigningAlg != "" { 258 258 + return nil, errors.New("token_endpoint_auth_method `none` must not have token_endpoint_auth_signing_alg") 259 259 + } 260 260 + case "private_key_jwt": 261 261 + if metadata.JWKS == nil && metadata.JWKSURI == nil { 262 262 + return nil, errors.New("private_key_jwt auth method requires jwks or jwks_uri") 263 263 + } 264 264 + 265 265 + if metadata.JWKS != nil && len(*metadata.JWKS) == 0 { 266 266 + return nil, errors.New("private_key_jwt auth method requires atleast one key in jwks") 267 267 + } 268 268 + 269 269 + if metadata.TokenEndpointAuthSigningAlg == "" { 270 270 + return nil, errors.New("missing token_endpoint_auth_signing_alg in client metadata") 271 271 + } 272 272 + default: 273 273 + return nil, fmt.Errorf("unsupported client authentication method `%s`", metadata.TokenEndpointAuthMethod) 274 274 + } 275 275 + 276 276 + if !metadata.DpopBoundAccessTokens { 277 277 + return nil, errors.New("dpop_bound_access_tokens must be true") 278 278 + } 279 279 + 280 280 + if !slices.Contains(metadata.ResponseTypes, "code") { 281 281 + return nil, errors.New("response_types must inclue `code`") 282 282 + } 283 283 + 284 284 + if !slices.Contains(metadata.GrantTypes, "authorization_code") { 285 285 + return nil, errors.New("the `code` response type requires that `grant_types` contains `authorization_code`") 286 286 + } 287 287 + 288 288 + if len(metadata.RedirectURIs) == 0 { 289 289 + return nil, errors.New("at least one `redirect_uri` is required") 290 290 + } 291 291 + 292 292 + if metadata.ApplicationType == "native" && metadata.TokenEndpointAuthMethod != "none" { 293 293 + return nil, errors.New("native clients must authenticate using `none` method") 294 294 + } 295 295 + 296 296 + if metadata.ApplicationType == "web" && slices.Contains(metadata.GrantTypes, "implicit") { 297 297 + for _, ruri := range metadata.RedirectURIs { 298 298 + u, err := url.Parse(ruri) 299 299 + if err != nil { 300 300 + return nil, fmt.Errorf("error parsing redirect uri: %w", err) 301 301 + } 302 302 + 303 303 + if u.Scheme != "https" { 304 304 + return nil, errors.New("web clients must use https redirect uris") 305 305 + } 306 306 + 307 307 + if u.Hostname() == "localhost" { 308 308 + return nil, errors.New("web clients must not use localhost as the hostname") 309 309 + } 310 310 + } 311 311 + } 312 312 + 313 313 + for _, ruri := range metadata.RedirectURIs { 314 314 + u, err := url.Parse(ruri) 315 315 + if err != nil { 316 316 + return nil, fmt.Errorf("error parsing redirect uri: %w", err) 317 317 + } 318 318 + 319 319 + if u.User != nil { 320 320 + if u.User.Username() != "" { 321 321 + return nil, fmt.Errorf("redirect uri %s must not contain credentials", ruri) 322 322 + } 323 323 + 324 324 + if _, hasPass := u.User.Password(); hasPass { 325 325 + return nil, fmt.Errorf("redirect uri %s must not contain credentials", ruri) 326 326 + } 327 327 + } 328 328 + 329 329 + switch true { 330 330 + case u.Hostname() == "localhost": 331 331 + return nil, errors.New("loopback redirect uri is not allowed (use explicit ips instead)") 332 332 + case u.Hostname() == "127.0.0.1", u.Hostname() == "[::1]": 333 333 + if metadata.ApplicationType != "native" { 334 334 + return nil, errors.New("loopback redirect uris are only allowed for native apps") 335 335 + } 336 336 + 337 337 + if u.Port() != "" { 338 338 + // reference impl doesn't do anything with this? 339 339 + } 340 340 + 341 341 + if u.Scheme != "http" { 342 342 + return nil, fmt.Errorf("loopback redirect uri %s must use http", ruri) 343 343 + } 344 344 + 345 345 + break 346 346 + case u.Scheme == "http": 347 347 + return nil, errors.New("only loopbvack redirect uris are allowed to use the `http` scheme") 348 348 + case u.Scheme == "https": 349 349 + if isLocalHostname(u.Hostname()) { 350 350 + return nil, fmt.Errorf("redirect uri %s's domain must not be a local hostname", ruri) 351 351 + } 352 352 + break 353 353 + case strings.Contains(u.Scheme, "."): 354 354 + if metadata.ApplicationType != "native" { 355 355 + return nil, errors.New("private-use uri scheme redirect uris are only allowed for native apps") 356 356 + } 357 357 + 358 358 + revdomain := reverseDomain(u.Scheme) 359 359 + 360 360 + if isLocalHostname(revdomain) { 361 361 + return nil, errors.New("private use uri scheme redirect uris must not be local hostnames") 362 362 + } 363 363 + 364 364 + if strings.HasPrefix(u.String(), fmt.Sprintf("%s://", u.Scheme)) || u.Hostname() != "" || u.Port() != "" { 365 365 + return nil, fmt.Errorf("private use uri scheme must be in the form ") 366 366 + } 367 367 + default: 368 368 + return nil, fmt.Errorf("invalid redirect uri scheme `%s`", u.Scheme) 369 369 + } 370 370 + } 371 371 + 372 372 + return &metadata, nil 373 373 + } 374 374 + 375 375 + func isLocalHostname(hostname string) bool { 376 376 + pts := strings.Split(hostname, ".") 377 377 + if len(pts) < 2 { 378 378 + return true 379 379 + } 380 380 + 381 381 + tld := strings.ToLower(pts[len(pts)-1]) 382 382 + return tld == "test" || tld == "local" || tld == "localhost" || tld == "invalid" || tld == "example" 383 383 + } 384 384 + 385 385 + func reverseDomain(domain string) string { 386 386 + pts := strings.Split(domain, ".") 387 387 + slices.Reverse(pts) 388 388 + return strings.Join(pts, ".") 389 389 + }

+20

oauth/client/metadata.go

··· 1 1 + package client 2 2 + 3 3 + type Metadata struct { 4 4 + ClientID string `json:"client_id"` 5 5 + ClientName string `json:"client_name"` 6 6 + ClientURI string `json:"client_uri"` 7 7 + LogoURI string `json:"logo_uri"` 8 8 + TOSURI string `json:"tos_uri"` 9 9 + PolicyURI string `json:"policy_uri"` 10 10 + RedirectURIs []string `json:"redirect_uris"` 11 11 + GrantTypes []string `json:"grant_types"` 12 12 + ResponseTypes []string `json:"response_types"` 13 13 + ApplicationType string `json:"application_type"` 14 14 + DpopBoundAccessTokens bool `json:"dpop_bound_access_tokens"` 15 15 + JWKSURI *string `json:"jwks_uri,omitempty"` 16 16 + JWKS *[][]byte `json:"jwks,omitempty"` 17 17 + Scope string `json:"scope"` 18 18 + TokenEndpointAuthMethod string `json:"token_endpoint_auth_method"` 19 19 + TokenEndpointAuthSigningAlg string `json:"token_endpoint_auth_signing_alg"` 20 20 + }

+52

oauth/constants/constants.go

··· 1 1 + package constants 2 2 + 3 3 + import "time" 4 4 + 5 5 + const ( 6 6 + MaxDpopAge = 10 * time.Second 7 7 + DpopCheckTolerance = 5 * time.Second 8 8 + 9 9 + NonceSecretByteLength = 32 10 10 + 11 11 + NonceMaxRotationInterval = DpopNonceMaxAge / 3 12 12 + NonceMinRotationInterval = 1 * time.Second 13 13 + 14 14 + JTICacheSize = 100_000 15 15 + JTITtl = 24 * time.Hour 16 16 + 17 17 + ClientAssertionTypeJwtBearer = "urn:ietf:params:oauth:client-assertion-type:jwt-bearer" 18 18 + ParExpiresIn = 5 * time.Minute 19 19 + 20 20 + ClientAssertionMaxAge = 1 * time.Minute 21 21 + 22 22 + DeviceIdPrefix = "dev-" 23 23 + DeviceIdBytesLength = 16 24 24 + 25 25 + SessionIdPrefix = "ses-" 26 26 + SessionIdBytesLength = 16 27 27 + 28 28 + RefreshTokenPrefix = "ref-" 29 29 + RefreshTokenBytesLength = 32 30 30 + 31 31 + RequestIdPrefix = "req-" 32 32 + RequestIdBytesLength = 16 33 33 + RequestUriPrefix = "urn:ietf:params:oauth:request_uri:" 34 34 + 35 35 + CodePrefix = "cod-" 36 36 + CodeBytesLength = 32 37 37 + 38 38 + TokenIdPrefix = "tok-" 39 39 + TokenIdBytesLength = 16 40 40 + 41 41 + TokenMaxAge = 60 * time.Minute 42 42 + 43 43 + AuthorizationInactivityTimeout = 5 * time.Minute 44 44 + 45 45 + DpopNonceMaxAge = 3 * time.Minute 46 46 + 47 47 + ConfidentialClientSessionLifetime = 2 * 365 * 24 * time.Hour // 2 years 48 48 + ConfidentialClientRefreshLifetime = 3 * 30 * 24 * time.Hour // 3 months 49 49 + 50 50 + PublicClientSessionLifetime = 2 * 7 * 24 * time.Hour // 2 weeks 51 51 + PublicClientRefreshLifetime = PublicClientSessionLifetime 52 52 + )

+28

oauth/dpop/jti_cache.go

··· 1 1 + package dpop 2 2 + 3 3 + import ( 4 4 + "sync" 5 5 + "time" 6 6 + 7 7 + cache "github.com/go-pkgz/expirable-cache/v3" 8 8 + "github.com/haileyok/cocoon/oauth/constants" 9 9 + ) 10 10 + 11 11 + type jtiCache struct { 12 12 + mu sync.Mutex 13 13 + cache cache.Cache[string, bool] 14 14 + } 15 15 + 16 16 + func newJTICache(size int) *jtiCache { 17 17 + cache := cache.NewCache[string, bool]().WithTTL(24 * time.Hour).WithLRU().WithTTL(constants.JTITtl) 18 18 + return &jtiCache{ 19 19 + cache: cache, 20 20 + mu: sync.Mutex{}, 21 21 + } 22 22 + } 23 23 + 24 24 + func (c *jtiCache) add(jti string) bool { 25 25 + c.mu.Lock() 26 26 + defer c.mu.Unlock() 27 27 + return c.cache.Add(jti, true) 28 28 + }

+249

oauth/dpop/manager.go

··· 1 1 + package dpop 2 2 + 3 3 + import ( 4 4 + "crypto" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "encoding/json" 8 8 + "errors" 9 9 + "fmt" 10 10 + "log/slog" 11 11 + "net/http" 12 12 + "net/url" 13 13 + "strings" 14 14 + "time" 15 15 + 16 16 + "github.com/golang-jwt/jwt/v4" 17 17 + "github.com/haileyok/cocoon/internal/helpers" 18 18 + "github.com/haileyok/cocoon/oauth/constants" 19 19 + "github.com/lestrrat-go/jwx/v2/jwa" 20 20 + "github.com/lestrrat-go/jwx/v2/jwk" 21 21 + ) 22 22 + 23 23 + type Manager struct { 24 24 + nonce *Nonce 25 25 + jtiCache *jtiCache 26 26 + logger *slog.Logger 27 27 + hostname string 28 28 + } 29 29 + 30 30 + type ManagerArgs struct { 31 31 + NonceSecret []byte 32 32 + NonceRotationInterval time.Duration 33 33 + OnNonceSecretCreated func([]byte) 34 34 + JTICacheSize int 35 35 + Logger *slog.Logger 36 36 + Hostname string 37 37 + } 38 38 + 39 39 + func NewManager(args ManagerArgs) *Manager { 40 40 + if args.Logger == nil { 41 41 + args.Logger = slog.Default() 42 42 + } 43 43 + 44 44 + if args.JTICacheSize == 0 { 45 45 + args.JTICacheSize = 100_000 46 46 + } 47 47 + 48 48 + if args.NonceSecret == nil { 49 49 + args.Logger.Warn("nonce secret passed to dpop manager was nil. existing sessions may break. consider saving and restoring your nonce.") 50 50 + } 51 51 + 52 52 + return &Manager{ 53 53 + nonce: NewNonce(NonceArgs{ 54 54 + RotationInterval: args.NonceRotationInterval, 55 55 + Secret: args.NonceSecret, 56 56 + OnSecretCreated: args.OnNonceSecretCreated, 57 57 + }), 58 58 + jtiCache: newJTICache(args.JTICacheSize), 59 59 + logger: args.Logger, 60 60 + hostname: args.Hostname, 61 61 + } 62 62 + } 63 63 + 64 64 + func (dm *Manager) CheckProof(reqMethod, reqUrl string, headers http.Header, accessToken *string) (*Proof, error) { 65 65 + if reqMethod == "" { 66 66 + return nil, errors.New("HTTP method is required") 67 67 + } 68 68 + 69 69 + if !strings.HasPrefix(reqUrl, "https://") { 70 70 + reqUrl = "https://" + dm.hostname + reqUrl 71 71 + } 72 72 + 73 73 + proof := extractProof(headers) 74 74 + 75 75 + if proof == "" { 76 76 + return nil, nil 77 77 + } 78 78 + 79 79 + parser := jwt.NewParser(jwt.WithoutClaimsValidation()) 80 80 + var token *jwt.Token 81 81 + 82 82 + token, _, err := parser.ParseUnverified(proof, jwt.MapClaims{}) 83 83 + if err != nil { 84 84 + return nil, fmt.Errorf("could not parse dpop proof jwt: %w", err) 85 85 + } 86 86 + 87 87 + typ, _ := token.Header["typ"].(string) 88 88 + if typ != "dpop+jwt" { 89 89 + return nil, errors.New(`invalid dpop proof jwt: "typ" must be 'dpop+jwt'`) 90 90 + } 91 91 + 92 92 + dpopJwk, jwkOk := token.Header["jwk"].(map[string]any) 93 93 + if !jwkOk { 94 94 + return nil, errors.New(`invalid dpop proof jwt: "jwk" is missing in header`) 95 95 + } 96 96 + 97 97 + jwkb, err := json.Marshal(dpopJwk) 98 98 + if err != nil { 99 99 + return nil, fmt.Errorf("failed to marshal jwk: %w", err) 100 100 + } 101 101 + 102 102 + key, err := jwk.ParseKey(jwkb) 103 103 + if err != nil { 104 104 + return nil, fmt.Errorf("failed to parse jwk: %w", err) 105 105 + } 106 106 + 107 107 + var pubKey any 108 108 + if err := key.Raw(&pubKey); err != nil { 109 109 + return nil, fmt.Errorf("failed to get raw public key: %w", err) 110 110 + } 111 111 + 112 112 + token, err = jwt.Parse(proof, func(t *jwt.Token) (any, error) { 113 113 + alg := t.Header["alg"].(string) 114 114 + 115 115 + switch key.KeyType() { 116 116 + case jwa.EC: 117 117 + if !strings.HasPrefix(alg, "ES") { 118 118 + return nil, fmt.Errorf("algorithm %s doesn't match EC key type", alg) 119 119 + } 120 120 + case jwa.RSA: 121 121 + if !strings.HasPrefix(alg, "RS") && !strings.HasPrefix(alg, "PS") { 122 122 + return nil, fmt.Errorf("algorithm %s doesn't match RSA key type", alg) 123 123 + } 124 124 + case jwa.OKP: 125 125 + if alg != "EdDSA" { 126 126 + return nil, fmt.Errorf("algorithm %s doesn't match OKP key type", alg) 127 127 + } 128 128 + } 129 129 + 130 130 + return pubKey, nil 131 131 + }, jwt.WithValidMethods([]string{"ES256", "ES384", "ES512", "RS256", "RS384", "RS512", "PS256", "PS384", "PS512", "EdDSA"})) 132 132 + if err != nil { 133 133 + return nil, fmt.Errorf("could not verify dpop proof jwt: %w", err) 134 134 + } 135 135 + 136 136 + if !token.Valid { 137 137 + return nil, errors.New("dpop proof jwt is invalid") 138 138 + } 139 139 + 140 140 + claims, ok := token.Claims.(jwt.MapClaims) 141 141 + if !ok { 142 142 + return nil, errors.New("no claims in dpop proof jwt") 143 143 + } 144 144 + 145 145 + iat, iatOk := claims["iat"].(float64) 146 146 + if !iatOk { 147 147 + return nil, errors.New(`invalid dpop proof jwt: "iat" is missing`) 148 148 + } 149 149 + 150 150 + iatTime := time.Unix(int64(iat), 0) 151 151 + now := time.Now() 152 152 + 153 153 + if now.Sub(iatTime) > constants.DpopNonceMaxAge+constants.DpopCheckTolerance { 154 154 + return nil, errors.New("dpop proof too old") 155 155 + } 156 156 + 157 157 + if iatTime.Sub(now) > constants.DpopCheckTolerance { 158 158 + return nil, errors.New("dpop proof iat is in the future") 159 159 + } 160 160 + 161 161 + jti, _ := claims["jti"].(string) 162 162 + if jti == "" { 163 163 + return nil, errors.New(`invalid dpop proof jwt: "jti" is missing`) 164 164 + } 165 165 + 166 166 + if dm.jtiCache.add(jti) { 167 167 + return nil, errors.New("dpop proof replay detected") 168 168 + } 169 169 + 170 170 + htm, _ := claims["htm"].(string) 171 171 + if htm == "" { 172 172 + return nil, errors.New(`invalid dpop proof jwt: "htm" is missing`) 173 173 + } 174 174 + 175 175 + if htm != reqMethod { 176 176 + return nil, errors.New(`invalid dpop proof jwt: "htm" mismatch`) 177 177 + } 178 178 + 179 179 + htu, _ := claims["htu"].(string) 180 180 + if htu == "" { 181 181 + return nil, errors.New(`invalid dpop proof jwt: "htu" is missing`) 182 182 + } 183 183 + 184 184 + parsedHtu, err := helpers.OauthParseHtu(htu) 185 185 + if err != nil { 186 186 + return nil, errors.New(`invalid dpop proof jwt: "htu" could not be parsed`) 187 187 + } 188 188 + 189 189 + u, _ := url.Parse(reqUrl) 190 190 + if parsedHtu != helpers.OauthNormalizeHtu(u) { 191 191 + return nil, fmt.Errorf(`invalid dpop proof jwt: "htu" mismatch. reqUrl: %s, parsed: %s, normalized: %s`, reqUrl, parsedHtu, helpers.OauthNormalizeHtu(u)) 192 192 + } 193 193 + 194 194 + nonce, _ := claims["nonce"].(string) 195 195 + if nonce == "" { 196 196 + // WARN: this _must_ be `use_dpop_nonce` for clients know they should make another request 197 197 + return nil, errors.New("use_dpop_nonce") 198 198 + } 199 199 + 200 200 + if nonce != "" && !dm.nonce.Check(nonce) { 201 201 + // WARN: this _must_ be `use_dpop_nonce` so that clients will fetch a new nonce 202 202 + return nil, errors.New("use_dpop_nonce") 203 203 + } 204 204 + 205 205 + ath, _ := claims["ath"].(string) 206 206 + 207 207 + if accessToken != nil && *accessToken != "" { 208 208 + if ath == "" { 209 209 + return nil, errors.New(`invalid dpop proof jwt: "ath" is required with access token`) 210 210 + } 211 211 + 212 212 + hash := sha256.Sum256([]byte(*accessToken)) 213 213 + if ath != base64.RawURLEncoding.EncodeToString(hash[:]) { 214 214 + return nil, errors.New(`invalid dpop proof jwt: "ath" mismatch`) 215 215 + } 216 216 + } else if ath != "" { 217 217 + return nil, errors.New(`invalid dpop proof jwt: "ath" claim not allowed`) 218 218 + } 219 219 + 220 220 + thumbBytes, err := key.Thumbprint(crypto.SHA256) 221 221 + if err != nil { 222 222 + return nil, fmt.Errorf("failed to calculate thumbprint: %w", err) 223 223 + } 224 224 + 225 225 + thumb := base64.RawURLEncoding.EncodeToString(thumbBytes) 226 226 + 227 227 + return &Proof{ 228 228 + JTI: jti, 229 229 + JKT: thumb, 230 230 + HTM: htm, 231 231 + HTU: htu, 232 232 + }, nil 233 233 + } 234 234 + 235 235 + func extractProof(headers http.Header) string { 236 236 + dpopHeaders := headers["Dpop"] 237 237 + switch len(dpopHeaders) { 238 238 + case 0: 239 239 + return "" 240 240 + case 1: 241 241 + return dpopHeaders[0] 242 242 + default: 243 243 + return "" 244 244 + } 245 245 + } 246 246 + 247 247 + func (dm *Manager) NextNonce() string { 248 248 + return dm.nonce.NextNonce() 249 249 + }

+108

oauth/dpop/nonce.go

··· 1 1 + package dpop 2 2 + 3 3 + import ( 4 4 + "crypto/hmac" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "encoding/binary" 8 8 + "sync" 9 9 + "time" 10 10 + 11 11 + "github.com/haileyok/cocoon/internal/helpers" 12 12 + "github.com/haileyok/cocoon/oauth/constants" 13 13 + ) 14 14 + 15 15 + type Nonce struct { 16 16 + rotationInterval time.Duration 17 17 + secret []byte 18 18 + 19 19 + mu sync.RWMutex 20 20 + 21 21 + counter int64 22 22 + prev string 23 23 + curr string 24 24 + next string 25 25 + } 26 26 + 27 27 + type NonceArgs struct { 28 28 + RotationInterval time.Duration 29 29 + Secret []byte 30 30 + OnSecretCreated func([]byte) 31 31 + } 32 32 + 33 33 + func NewNonce(args NonceArgs) *Nonce { 34 34 + if args.RotationInterval == 0 { 35 35 + args.RotationInterval = constants.NonceMaxRotationInterval / 3 36 36 + } 37 37 + 38 38 + if args.RotationInterval > constants.NonceMaxRotationInterval { 39 39 + args.RotationInterval = constants.NonceMaxRotationInterval 40 40 + } 41 41 + 42 42 + if args.Secret == nil { 43 43 + args.Secret = helpers.RandomBytes(constants.NonceSecretByteLength) 44 44 + args.OnSecretCreated(args.Secret) 45 45 + } 46 46 + 47 47 + n := &Nonce{ 48 48 + rotationInterval: args.RotationInterval, 49 49 + secret: args.Secret, 50 50 + mu: sync.RWMutex{}, 51 51 + } 52 52 + 53 53 + n.counter = n.currentCounter() 54 54 + n.prev = n.compute(n.counter - 1) 55 55 + n.curr = n.compute(n.counter) 56 56 + n.next = n.compute(n.counter + 1) 57 57 + 58 58 + return n 59 59 + } 60 60 + 61 61 + func (n *Nonce) currentCounter() int64 { 62 62 + return time.Now().UnixNano() / int64(n.rotationInterval) 63 63 + } 64 64 + 65 65 + func (n *Nonce) compute(counter int64) string { 66 66 + h := hmac.New(sha256.New, n.secret) 67 67 + counterBytes := make([]byte, 8) 68 68 + binary.BigEndian.PutUint64(counterBytes, uint64(counter)) 69 69 + h.Write(counterBytes) 70 70 + return base64.RawURLEncoding.EncodeToString(h.Sum(nil)) 71 71 + } 72 72 + 73 73 + func (n *Nonce) rotate() { 74 74 + counter := n.currentCounter() 75 75 + diff := counter - n.counter 76 76 + 77 77 + switch diff { 78 78 + case 0: 79 79 + // counter == n.counter, do nothing 80 80 + case 1: 81 81 + n.prev = n.curr 82 82 + n.curr = n.next 83 83 + n.next = n.compute(counter + 1) 84 84 + case 2: 85 85 + n.prev = n.next 86 86 + n.curr = n.compute(counter) 87 87 + n.next = n.compute(counter + 1) 88 88 + default: 89 89 + n.prev = n.compute(counter - 1) 90 90 + n.curr = n.compute(counter) 91 91 + n.next = n.compute(counter + 1) 92 92 + } 93 93 + 94 94 + n.counter = counter 95 95 + } 96 96 + 97 97 + func (n *Nonce) NextNonce() string { 98 98 + n.mu.Lock() 99 99 + defer n.mu.Unlock() 100 100 + n.rotate() 101 101 + return n.next 102 102 + } 103 103 + 104 104 + func (n *Nonce) Check(nonce string) bool { 105 105 + n.mu.RLock() 106 106 + defer n.mu.RUnlock() 107 107 + return nonce == n.prev || nonce == n.curr || nonce == n.next 108 108 + }

+8

oauth/dpop/proof.go

··· 1 1 + package dpop 2 2 + 3 3 + type Proof struct { 4 4 + JTI string 5 5 + JKT string 6 6 + HTM string 7 7 + HTU string 8 8 + }

+80

oauth/helpers.go

··· 1 1 + package oauth 2 2 + 3 3 + import ( 4 4 + "errors" 5 5 + "fmt" 6 6 + "net/url" 7 7 + "time" 8 8 + 9 9 + "github.com/haileyok/cocoon/internal/helpers" 10 10 + "github.com/haileyok/cocoon/oauth/constants" 11 11 + "github.com/haileyok/cocoon/oauth/provider" 12 12 + ) 13 13 + 14 14 + func GenerateCode() string { 15 15 + h, _ := helpers.RandomHex(constants.CodeBytesLength) 16 16 + return constants.CodePrefix + h 17 17 + } 18 18 + 19 19 + func GenerateTokenId() string { 20 20 + h, _ := helpers.RandomHex(constants.TokenIdBytesLength) 21 21 + return constants.TokenIdPrefix + h 22 22 + } 23 23 + 24 24 + func GenerateRefreshToken() string { 25 25 + h, _ := helpers.RandomHex(constants.RefreshTokenBytesLength) 26 26 + return constants.RefreshTokenPrefix + h 27 27 + } 28 28 + 29 29 + func GenerateRequestId() string { 30 30 + h, _ := helpers.RandomHex(constants.RequestIdBytesLength) 31 31 + return constants.RequestIdPrefix + h 32 32 + } 33 33 + 34 34 + func EncodeRequestUri(reqId string) string { 35 35 + return constants.RequestUriPrefix + url.QueryEscape(reqId) 36 36 + } 37 37 + 38 38 + func DecodeRequestUri(reqUri string) (string, error) { 39 39 + if len(reqUri) < len(constants.RequestUriPrefix) { 40 40 + return "", errors.New("invalid request uri") 41 41 + } 42 42 + 43 43 + reqIdEnc := reqUri[len(constants.RequestUriPrefix):] 44 44 + reqId, err := url.QueryUnescape(reqIdEnc) 45 45 + if err != nil { 46 46 + return "", fmt.Errorf("could not unescape request id: %w", err) 47 47 + } 48 48 + 49 49 + return reqId, nil 50 50 + } 51 51 + 52 52 + type SessionAgeResult struct { 53 53 + SessionAge time.Duration 54 54 + RefreshAge time.Duration 55 55 + SessionExpired bool 56 56 + RefreshExpired bool 57 57 + } 58 58 + 59 59 + func GetSessionAgeFromToken(t provider.OauthToken) SessionAgeResult { 60 60 + sessionLifetime := constants.PublicClientSessionLifetime 61 61 + refreshLifetime := constants.PublicClientRefreshLifetime 62 62 + if t.ClientAuth.Method != "none" { 63 63 + sessionLifetime = constants.ConfidentialClientSessionLifetime 64 64 + refreshLifetime = constants.ConfidentialClientRefreshLifetime 65 65 + } 66 66 + 67 67 + res := SessionAgeResult{} 68 68 + 69 69 + res.SessionAge = time.Since(t.CreatedAt) 70 70 + if res.SessionAge > sessionLifetime { 71 71 + res.SessionExpired = true 72 72 + } 73 73 + 74 74 + refreshAge := time.Since(t.UpdatedAt) 75 75 + if refreshAge > refreshLifetime { 76 76 + res.RefreshExpired = true 77 77 + } 78 78 + 79 79 + return res 80 80 + }

+152

oauth/provider/client_auth.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + "crypto" 6 6 + "encoding/base64" 7 7 + "errors" 8 8 + "fmt" 9 9 + "time" 10 10 + 11 11 + "github.com/golang-jwt/jwt/v4" 12 12 + "github.com/haileyok/cocoon/oauth/client" 13 13 + "github.com/haileyok/cocoon/oauth/constants" 14 14 + "github.com/haileyok/cocoon/oauth/dpop" 15 15 + ) 16 16 + 17 17 + type AuthenticateClientOptions struct { 18 18 + AllowMissingDpopProof bool 19 19 + } 20 20 + 21 21 + type AuthenticateClientRequestBase struct { 22 22 + ClientID string `form:"client_id" json:"client_id" validate:"required"` 23 23 + ClientAssertionType *string `form:"client_assertion_type" json:"client_assertion_type,omitempty"` 24 24 + ClientAssertion *string `form:"client_assertion" json:"client_assertion,omitempty"` 25 25 + } 26 26 + 27 27 + func (p *Provider) AuthenticateClient(ctx context.Context, req AuthenticateClientRequestBase, proof *dpop.Proof, opts *AuthenticateClientOptions) (*client.Client, *ClientAuth, error) { 28 28 + client, err := p.ClientManager.GetClient(ctx, req.ClientID) 29 29 + if err != nil { 30 30 + return nil, nil, fmt.Errorf("failed to get client: %w", err) 31 31 + } 32 32 + 33 33 + if client.Metadata.DpopBoundAccessTokens && proof == nil && (opts == nil || !opts.AllowMissingDpopProof) { 34 34 + return nil, nil, errors.New("dpop proof required") 35 35 + } 36 36 + 37 37 + if proof != nil && !client.Metadata.DpopBoundAccessTokens { 38 38 + return nil, nil, errors.New("dpop proof not allowed for this client") 39 39 + } 40 40 + 41 41 + clientAuth, err := p.Authenticate(ctx, req, client) 42 42 + if err != nil { 43 43 + return nil, nil, err 44 44 + } 45 45 + 46 46 + return client, clientAuth, nil 47 47 + } 48 48 + 49 49 + func (p *Provider) Authenticate(_ context.Context, req AuthenticateClientRequestBase, client *client.Client) (*ClientAuth, error) { 50 50 + metadata := client.Metadata 51 51 + 52 52 + if metadata.TokenEndpointAuthMethod == "none" { 53 53 + return &ClientAuth{ 54 54 + Method: "none", 55 55 + }, nil 56 56 + } 57 57 + 58 58 + if metadata.TokenEndpointAuthMethod == "private_key_jwt" { 59 59 + if req.ClientAssertion == nil { 60 60 + return nil, errors.New(`client authentication method "private_key_jwt" requires a "client_assertion`) 61 61 + } 62 62 + 63 63 + if req.ClientAssertionType == nil || *req.ClientAssertionType != constants.ClientAssertionTypeJwtBearer { 64 64 + return nil, fmt.Errorf("unsupported client_assertion_type %s", *req.ClientAssertionType) 65 65 + } 66 66 + 67 67 + token, _, err := jwt.NewParser().ParseUnverified(*req.ClientAssertion, jwt.MapClaims{}) 68 68 + if err != nil { 69 69 + return nil, fmt.Errorf("error parsing client assertion: %w", err) 70 70 + } 71 71 + 72 72 + kid, ok := token.Header["kid"].(string) 73 73 + if !ok || kid == "" { 74 74 + return nil, errors.New(`"kid" required in client_assertion`) 75 75 + } 76 76 + 77 77 + var rawKey any 78 78 + if err := client.JWKS.Raw(&rawKey); err != nil { 79 79 + return nil, fmt.Errorf("failed to extract raw key: %w", err) 80 80 + } 81 81 + 82 82 + token, err = jwt.Parse(*req.ClientAssertion, func(token *jwt.Token) (any, error) { 83 83 + if token.Method.Alg() != jwt.SigningMethodES256.Alg() { 84 84 + return nil, fmt.Errorf("unexpected signing method: %v", token.Header["alg"]) 85 85 + } 86 86 + 87 87 + return rawKey, nil 88 88 + }) 89 89 + if err != nil { 90 90 + return nil, fmt.Errorf(`unable to verify "client_assertion" jwt: %w`, err) 91 91 + } 92 92 + 93 93 + if !token.Valid { 94 94 + return nil, errors.New("client_assertion jwt is invalid") 95 95 + } 96 96 + 97 97 + claims, ok := token.Claims.(jwt.MapClaims) 98 98 + if !ok { 99 99 + return nil, errors.New("no claims in client_assertion jwt") 100 100 + } 101 101 + 102 102 + sub, _ := claims["sub"].(string) 103 103 + if sub != metadata.ClientID { 104 104 + return nil, errors.New("subject must be client_id") 105 105 + } 106 106 + 107 107 + aud, _ := claims["aud"].(string) 108 108 + if aud != "" && aud != "https://"+p.hostname { 109 109 + return nil, fmt.Errorf("audience must be %s, got %s", "https://"+p.hostname, aud) 110 110 + } 111 111 + 112 112 + iat, iatOk := claims["iat"].(float64) 113 113 + if !iatOk { 114 114 + return nil, errors.New(`invalid client_assertion jwt: "iat" is missing`) 115 115 + } 116 116 + 117 117 + iatTime := time.Unix(int64(iat), 0) 118 118 + if time.Since(iatTime) > constants.ClientAssertionMaxAge { 119 119 + return nil, errors.New("client_assertion jwt too old") 120 120 + } 121 121 + 122 122 + jti, _ := claims["jti"].(string) 123 123 + if jti == "" { 124 124 + return nil, errors.New(`invalid client_assertion jwt: "jti" is missing`) 125 125 + } 126 126 + 127 127 + var exp *float64 128 128 + if maybeExp, ok := claims["exp"].(float64); ok { 129 129 + exp = &maybeExp 130 130 + } 131 131 + 132 132 + alg := token.Header["alg"].(string) 133 133 + 134 134 + thumbBytes, err := client.JWKS.Thumbprint(crypto.SHA256) 135 135 + if err != nil { 136 136 + return nil, fmt.Errorf("failed to calculate thumbprint: %w", err) 137 137 + } 138 138 + 139 139 + thumb := base64.RawURLEncoding.EncodeToString(thumbBytes) 140 140 + 141 141 + return &ClientAuth{ 142 142 + Method: "private_key_jwt", 143 143 + Jti: jti, 144 144 + Exp: exp, 145 145 + Jkt: thumb, 146 146 + Alg: alg, 147 147 + Kid: kid, 148 148 + }, nil 149 149 + } 150 150 + 151 151 + return nil, fmt.Errorf("auth method %s is not implemented in this pds", metadata.TokenEndpointAuthMethod) 152 152 + }

+20

oauth/provider/middleware.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "github.com/labstack/echo/v4" 5 5 + ) 6 6 + 7 7 + func (p *Provider) BaseMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 8 8 + return func(e echo.Context) error { 9 9 + e.Response().Header().Set("cache-control", "no-store") 10 10 + e.Response().Header().Set("pragma", "no-cache") 11 11 + 12 12 + nonce := p.NextNonce() 13 13 + if nonce != "" { 14 14 + e.Response().Header().Set("DPoP-Nonce", nonce) 15 15 + e.Response().Header().Add("access-control-expose-headers", "DPoP-Nonce") 16 16 + } 17 17 + 18 18 + return next(e) 19 19 + } 20 20 + }

+83

oauth/provider/models.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "database/sql/driver" 5 5 + "encoding/json" 6 6 + "fmt" 7 7 + "time" 8 8 + 9 9 + "gorm.io/gorm" 10 10 + ) 11 11 + 12 12 + type ClientAuth struct { 13 13 + Method string 14 14 + Alg string 15 15 + Kid string 16 16 + Jkt string 17 17 + Jti string 18 18 + Exp *float64 19 19 + } 20 20 + 21 21 + func (ca *ClientAuth) Scan(value any) error { 22 22 + b, ok := value.([]byte) 23 23 + if !ok { 24 24 + return fmt.Errorf("failed to unmarshal OauthParRequest value") 25 25 + } 26 26 + return json.Unmarshal(b, ca) 27 27 + } 28 28 + 29 29 + func (ca ClientAuth) Value() (driver.Value, error) { 30 30 + return json.Marshal(ca) 31 31 + } 32 32 + 33 33 + type ParRequest struct { 34 34 + AuthenticateClientRequestBase 35 35 + ResponseType string `form:"response_type" json:"response_type" validate:"required"` 36 36 + CodeChallenge *string `form:"code_challenge" json:"code_challenge" validate:"required"` 37 37 + CodeChallengeMethod string `form:"code_challenge_method" json:"code_challenge_method" validate:"required"` 38 38 + State string `form:"state" json:"state" validate:"required"` 39 39 + RedirectURI string `form:"redirect_uri" json:"redirect_uri" validate:"required"` 40 40 + Scope string `form:"scope" json:"scope" validate:"required"` 41 41 + LoginHint *string `form:"login_hint" json:"login_hint,omitempty"` 42 42 + DpopJkt *string `form:"dpop_jkt" json:"dpop_jkt,omitempty"` 43 43 + } 44 44 + 45 45 + func (opr *ParRequest) Scan(value any) error { 46 46 + b, ok := value.([]byte) 47 47 + if !ok { 48 48 + return fmt.Errorf("failed to unmarshal OauthParRequest value") 49 49 + } 50 50 + return json.Unmarshal(b, opr) 51 51 + } 52 52 + 53 53 + func (opr ParRequest) Value() (driver.Value, error) { 54 54 + return json.Marshal(opr) 55 55 + } 56 56 + 57 57 + type OauthToken struct { 58 58 + gorm.Model 59 59 + ClientId string `gorm:"index"` 60 60 + ClientAuth ClientAuth `gorm:"type:json"` 61 61 + Parameters ParRequest `gorm:"type:json"` 62 62 + ExpiresAt time.Time `gorm:"index"` 63 63 + DeviceId string 64 64 + Sub string `gorm:"index"` 65 65 + Code string `gorm:"index"` 66 66 + Token string `gorm:"uniqueIndex"` 67 67 + RefreshToken string `gorm:"uniqueIndex"` 68 68 + Ip string 69 69 + } 70 70 + 71 71 + type OauthAuthorizationRequest struct { 72 72 + gorm.Model 73 73 + RequestId string `gorm:"primaryKey"` 74 74 + ClientId string `gorm:"index"` 75 75 + ClientAuth ClientAuth `gorm:"type:json"` 76 76 + Parameters ParRequest `gorm:"type:json"` 77 77 + ExpiresAt time.Time `gorm:"index"` 78 78 + DeviceId *string 79 79 + Sub *string 80 80 + Code *string 81 81 + Accepted *bool 82 82 + Ip string 83 83 + }

+31

oauth/provider/provider.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/oauth/client" 5 5 + "github.com/haileyok/cocoon/oauth/dpop" 6 6 + ) 7 7 + 8 8 + type Provider struct { 9 9 + ClientManager *client.Manager 10 10 + DpopManager *dpop.Manager 11 11 + 12 12 + hostname string 13 13 + } 14 14 + 15 15 + type Args struct { 16 16 + Hostname string 17 17 + ClientManagerArgs client.ManagerArgs 18 18 + DpopManagerArgs dpop.ManagerArgs 19 19 + } 20 20 + 21 21 + func NewProvider(args Args) *Provider { 22 22 + return &Provider{ 23 23 + ClientManager: client.NewManager(args.ClientManagerArgs), 24 24 + DpopManager: dpop.NewManager(args.DpopManagerArgs), 25 25 + hostname: args.Hostname, 26 26 + } 27 27 + } 28 28 + 29 29 + func (p *Provider) NextNonce() string { 30 30 + return p.DpopManager.NextNonce() 31 31 + }

+77

recording_blockstore/recording_blockstore.go

··· 1 1 + package recording_blockstore 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + 6 6 + blockformat "github.com/ipfs/go-block-format" 7 7 + "github.com/ipfs/go-cid" 8 8 + blockstore "github.com/ipfs/go-ipfs-blockstore" 9 9 + ) 10 10 + 11 11 + type RecordingBlockstore struct { 12 12 + base blockstore.Blockstore 13 13 + 14 14 + inserts map[cid.Cid]blockformat.Block 15 15 + } 16 16 + 17 17 + func New(base blockstore.Blockstore) *RecordingBlockstore { 18 18 + return &RecordingBlockstore{ 19 19 + base: base, 20 20 + inserts: make(map[cid.Cid]blockformat.Block), 21 21 + } 22 22 + } 23 23 + 24 24 + func (bs *RecordingBlockstore) Has(ctx context.Context, c cid.Cid) (bool, error) { 25 25 + return bs.base.Has(ctx, c) 26 26 + } 27 27 + 28 28 + func (bs *RecordingBlockstore) Get(ctx context.Context, c cid.Cid) (blockformat.Block, error) { 29 29 + return bs.base.Get(ctx, c) 30 30 + } 31 31 + 32 32 + func (bs *RecordingBlockstore) GetSize(ctx context.Context, c cid.Cid) (int, error) { 33 33 + return bs.base.GetSize(ctx, c) 34 34 + } 35 35 + 36 36 + func (bs *RecordingBlockstore) DeleteBlock(ctx context.Context, c cid.Cid) error { 37 37 + return bs.base.DeleteBlock(ctx, c) 38 38 + } 39 39 + 40 40 + func (bs *RecordingBlockstore) Put(ctx context.Context, block blockformat.Block) error { 41 41 + if err := bs.base.Put(ctx, block); err != nil { 42 42 + return err 43 43 + } 44 44 + bs.inserts[block.Cid()] = block 45 45 + return nil 46 46 + } 47 47 + 48 48 + func (bs *RecordingBlockstore) PutMany(ctx context.Context, blocks []blockformat.Block) error { 49 49 + if err := bs.base.PutMany(ctx, blocks); err != nil { 50 50 + return err 51 51 + } 52 52 + 53 53 + for _, b := range blocks { 54 54 + bs.inserts[b.Cid()] = b 55 55 + } 56 56 + 57 57 + return nil 58 58 + } 59 59 + 60 60 + func (bs *RecordingBlockstore) AllKeysChan(ctx context.Context) (<-chan cid.Cid, error) { 61 61 + return bs.AllKeysChan(ctx) 62 62 + } 63 63 + 64 64 + func (bs *RecordingBlockstore) HashOnRead(enabled bool) { 65 65 + } 66 66 + 67 67 + func (bs *RecordingBlockstore) GetLogMap() map[cid.Cid]blockformat.Block { 68 68 + return bs.inserts 69 69 + } 70 70 + 71 71 + func (bs *RecordingBlockstore) GetLogArray() []blockformat.Block { 72 72 + var blocks []blockformat.Block 73 73 + for _, b := range bs.inserts { 74 74 + blocks = append(blocks, b) 75 75 + } 76 76 + return blocks 77 77 + }

+30

server/blockstore_variant.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/sqlite_blockstore" 5 5 + blockstore "github.com/ipfs/go-ipfs-blockstore" 6 6 + ) 7 7 + 8 8 + type BlockstoreVariant int 9 9 + 10 10 + const ( 11 11 + BlockstoreVariantSqlite = iota 12 12 + ) 13 13 + 14 14 + func MustReturnBlockstoreVariant(maybeBsv string) BlockstoreVariant { 15 15 + switch maybeBsv { 16 16 + case "sqlite": 17 17 + return BlockstoreVariantSqlite 18 18 + default: 19 19 + panic("invalid blockstore variant provided") 20 20 + } 21 21 + } 22 22 + 23 23 + func (s *Server) getBlockstore(did string) blockstore.Blockstore { 24 24 + switch s.config.BlockstoreVariant { 25 25 + case BlockstoreVariantSqlite: 26 26 + return sqlite_blockstore.New(did, s.db) 27 27 + default: 28 28 + return sqlite_blockstore.New(did, s.db) 29 29 + } 30 30 + }

+9 -1

server/common.go

··· 20 20 return &repo, nil 21 21 } 22 22 23 23 + func (s *Server) getRepoActorByEmail(email string) (*models.RepoActor, error) { 24 24 + var repo models.RepoActor 25 25 + if err := s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.email= ?", nil, email).Scan(&repo).Error; err != nil { 26 26 + return nil, err 27 27 + } 28 28 + return &repo, nil 29 29 + } 30 30 + 23 31 func (s *Server) getRepoActorByDid(did string) (*models.RepoActor, error) { 24 32 var repo models.RepoActor 25 25 - if err := s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.did = ?", did).Scan(&repo).Error; err != nil { 33 33 + if err := s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.did = ?", nil, did).Scan(&repo).Error; err != nil { 26 34 return nil, err 27 35 } 28 36 return &repo, nil

+74

server/handle_account.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "time" 5 5 + 6 6 + "github.com/haileyok/cocoon/oauth" 7 7 + "github.com/haileyok/cocoon/oauth/constants" 8 8 + "github.com/haileyok/cocoon/oauth/provider" 9 9 + "github.com/hako/durafmt" 10 10 + "github.com/labstack/echo/v4" 11 11 + ) 12 12 + 13 13 + func (s *Server) handleAccount(e echo.Context) error { 14 14 + ctx := e.Request().Context() 15 15 + repo, sess, err := s.getSessionRepoOrErr(e) 16 16 + if err != nil { 17 17 + return e.Redirect(303, "/account/signin") 18 18 + } 19 19 + 20 20 + oldestPossibleSession := time.Now().Add(constants.ConfidentialClientSessionLifetime) 21 21 + 22 22 + var tokens []provider.OauthToken 23 23 + if err := s.db.Raw("SELECT * FROM oauth_tokens WHERE sub = ? AND created_at < ? ORDER BY created_at ASC", nil, repo.Repo.Did, oldestPossibleSession).Scan(&tokens).Error; err != nil { 24 24 + s.logger.Error("couldnt fetch oauth sessions for account", "did", repo.Repo.Did, "error", err) 25 25 + sess.AddFlash("Unable to fetch sessions. See server logs for more details.", "error") 26 26 + sess.Save(e.Request(), e.Response()) 27 27 + return e.Render(200, "account.html", map[string]any{ 28 28 + "flashes": getFlashesFromSession(e, sess), 29 29 + }) 30 30 + } 31 31 + 32 32 + var filtered []provider.OauthToken 33 33 + for _, t := range tokens { 34 34 + ageRes := oauth.GetSessionAgeFromToken(t) 35 35 + if ageRes.SessionExpired { 36 36 + continue 37 37 + } 38 38 + filtered = append(filtered, t) 39 39 + } 40 40 + 41 41 + now := time.Now() 42 42 + 43 43 + tokenInfo := []map[string]string{} 44 44 + for _, t := range tokens { 45 45 + ageRes := oauth.GetSessionAgeFromToken(t) 46 46 + maxTime := constants.PublicClientSessionLifetime 47 47 + if t.ClientAuth.Method != "none" { 48 48 + maxTime = constants.ConfidentialClientSessionLifetime 49 49 + } 50 50 + 51 51 + var clientName string 52 52 + metadata, err := s.oauthProvider.ClientManager.GetClient(ctx, t.ClientId) 53 53 + if err != nil { 54 54 + clientName = t.ClientId 55 55 + } else { 56 56 + clientName = metadata.Metadata.ClientName 57 57 + } 58 58 + 59 59 + tokenInfo = append(tokenInfo, map[string]string{ 60 60 + "ClientName": clientName, 61 61 + "Age": durafmt.Parse(ageRes.SessionAge).LimitFirstN(2).String(), 62 62 + "LastUpdated": durafmt.Parse(now.Sub(t.UpdatedAt)).LimitFirstN(2).String(), 63 63 + "ExpiresIn": durafmt.Parse(now.Add(maxTime).Sub(now)).LimitFirstN(2).String(), 64 64 + "Token": t.Token, 65 65 + "Ip": t.Ip, 66 66 + }) 67 67 + } 68 68 + 69 69 + return e.Render(200, "account.html", map[string]any{ 70 70 + "Repo": repo, 71 71 + "Tokens": tokenInfo, 72 72 + "flashes": getFlashesFromSession(e, sess), 73 73 + }) 74 74 + }

+34

server/handle_account_revoke.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/internal/helpers" 5 5 + "github.com/labstack/echo/v4" 6 6 + ) 7 7 + 8 8 + type AccountRevokeRequest struct { 9 9 + Token string `form:"token"` 10 10 + } 11 11 + 12 12 + func (s *Server) handleAccountRevoke(e echo.Context) error { 13 13 + var req AccountRevokeRequest 14 14 + if err := e.Bind(&req); err != nil { 15 15 + s.logger.Error("could not bind account revoke request", "error", err) 16 16 + return helpers.ServerError(e, nil) 17 17 + } 18 18 + 19 19 + repo, sess, err := s.getSessionRepoOrErr(e) 20 20 + if err != nil { 21 21 + return e.Redirect(303, "/account/signin") 22 22 + } 23 23 + 24 24 + if err := s.db.Exec("DELETE FROM oauth_tokens WHERE sub = ? AND token = ?", nil, repo.Repo.Did, req.Token).Error; err != nil { 25 25 + s.logger.Error("couldnt delete oauth session for account", "did", repo.Repo.Did, "token", req.Token, "error", err) 26 26 + sess.AddFlash("Unable to revoke session. See server logs for more details.", "error") 27 27 + sess.Save(e.Request(), e.Response()) 28 28 + return e.Redirect(303, "/account") 29 29 + } 30 30 + 31 31 + sess.AddFlash("Session successfully revoked!", "success") 32 32 + sess.Save(e.Request(), e.Response()) 33 33 + return e.Redirect(303, "/account") 34 34 + }

+130

server/handle_account_signin.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "errors" 5 5 + "strings" 6 6 + 7 7 + "github.com/bluesky-social/indigo/atproto/syntax" 8 8 + "github.com/gorilla/sessions" 9 9 + "github.com/haileyok/cocoon/internal/helpers" 10 10 + "github.com/haileyok/cocoon/models" 11 11 + "github.com/labstack/echo-contrib/session" 12 12 + "github.com/labstack/echo/v4" 13 13 + "golang.org/x/crypto/bcrypt" 14 14 + "gorm.io/gorm" 15 15 + ) 16 16 + 17 17 + type OauthSigninRequest struct { 18 18 + Username string `form:"username"` 19 19 + Password string `form:"password"` 20 20 + QueryParams string `form:"query_params"` 21 21 + } 22 22 + 23 23 + func (s *Server) getSessionRepoOrErr(e echo.Context) (*models.RepoActor, *sessions.Session, error) { 24 24 + sess, err := session.Get("session", e) 25 25 + if err != nil { 26 26 + return nil, nil, err 27 27 + } 28 28 + 29 29 + did, ok := sess.Values["did"].(string) 30 30 + if !ok { 31 31 + return nil, sess, errors.New("did was not set in session") 32 32 + } 33 33 + 34 34 + repo, err := s.getRepoActorByDid(did) 35 35 + if err != nil { 36 36 + return nil, sess, err 37 37 + } 38 38 + 39 39 + return repo, sess, nil 40 40 + } 41 41 + 42 42 + func getFlashesFromSession(e echo.Context, sess *sessions.Session) map[string]any { 43 43 + defer sess.Save(e.Request(), e.Response()) 44 44 + return map[string]any{ 45 45 + "errors": sess.Flashes("error"), 46 46 + "successes": sess.Flashes("success"), 47 47 + } 48 48 + } 49 49 + 50 50 + func (s *Server) handleAccountSigninGet(e echo.Context) error { 51 51 + _, sess, err := s.getSessionRepoOrErr(e) 52 52 + if err == nil { 53 53 + return e.Redirect(303, "/account") 54 54 + } 55 55 + 56 56 + return e.Render(200, "signin.html", map[string]any{ 57 57 + "flashes": getFlashesFromSession(e, sess), 58 58 + "QueryParams": e.QueryParams().Encode(), 59 59 + }) 60 60 + } 61 61 + 62 62 + func (s *Server) handleAccountSigninPost(e echo.Context) error { 63 63 + var req OauthSigninRequest 64 64 + if err := e.Bind(&req); err != nil { 65 65 + s.logger.Error("error binding sign in req", "error", err) 66 66 + return helpers.ServerError(e, nil) 67 67 + } 68 68 + 69 69 + sess, _ := session.Get("session", e) 70 70 + 71 71 + req.Username = strings.ToLower(req.Username) 72 72 + var idtype string 73 73 + if _, err := syntax.ParseDID(req.Username); err == nil { 74 74 + idtype = "did" 75 75 + } else if _, err := syntax.ParseHandle(req.Username); err == nil { 76 76 + idtype = "handle" 77 77 + } else { 78 78 + idtype = "email" 79 79 + } 80 80 + 81 81 + // TODO: we should make this a helper since we do it for the base create_session as well 82 82 + var repo models.RepoActor 83 83 + var err error 84 84 + switch idtype { 85 85 + case "did": 86 86 + err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.did = ?", nil, req.Username).Scan(&repo).Error 87 87 + case "handle": 88 88 + err = s.db.Raw("SELECT r.*, a.* FROM actors a LEFT JOIN repos r ON a.did = r.did WHERE a.handle = ?", nil, req.Username).Scan(&repo).Error 89 89 + case "email": 90 90 + err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.email = ?", nil, req.Username).Scan(&repo).Error 91 91 + } 92 92 + if err != nil { 93 93 + if err == gorm.ErrRecordNotFound { 94 94 + sess.AddFlash("Handle or password is incorrect", "error") 95 95 + } else { 96 96 + sess.AddFlash("Something went wrong!", "error") 97 97 + } 98 98 + sess.Save(e.Request(), e.Response()) 99 99 + return e.Redirect(303, "/account/signin") 100 100 + } 101 101 + 102 102 + if err := bcrypt.CompareHashAndPassword([]byte(repo.Password), []byte(req.Password)); err != nil { 103 103 + if err != bcrypt.ErrMismatchedHashAndPassword { 104 104 + sess.AddFlash("Handle or password is incorrect", "error") 105 105 + } else { 106 106 + sess.AddFlash("Something went wrong!", "error") 107 107 + } 108 108 + sess.Save(e.Request(), e.Response()) 109 109 + return e.Redirect(303, "/account/signin") 110 110 + } 111 111 + 112 112 + sess.Options = &sessions.Options{ 113 113 + Path: "/", 114 114 + MaxAge: int(AccountSessionMaxAge.Seconds()), 115 115 + HttpOnly: true, 116 116 + } 117 117 + 118 118 + sess.Values = map[any]any{} 119 119 + sess.Values["did"] = repo.Repo.Did 120 120 + 121 121 + if err := sess.Save(e.Request(), e.Response()); err != nil { 122 122 + return err 123 123 + } 124 124 + 125 125 + if req.QueryParams != "" { 126 126 + return e.Redirect(303, "/oauth/authorize?"+req.QueryParams) 127 127 + } else { 128 128 + return e.Redirect(303, "/account") 129 129 + } 130 130 + }

+35

server/handle_account_signout.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/gorilla/sessions" 5 5 + "github.com/labstack/echo-contrib/session" 6 6 + "github.com/labstack/echo/v4" 7 7 + ) 8 8 + 9 9 + func (s *Server) handleAccountSignout(e echo.Context) error { 10 10 + sess, err := session.Get("session", e) 11 11 + if err != nil { 12 12 + return err 13 13 + } 14 14 + 15 15 + sess.Options = &sessions.Options{ 16 16 + Path: "/", 17 17 + MaxAge: -1, 18 18 + HttpOnly: true, 19 19 + } 20 20 + 21 21 + sess.Values = map[any]any{} 22 22 + 23 23 + if err := sess.Save(e.Request(), e.Response()); err != nil { 24 24 + return err 25 25 + } 26 26 + 27 27 + reqUri := e.QueryParam("request_uri") 28 28 + 29 29 + redirect := "/account/signin" 30 30 + if reqUri != "" { 31 31 + redirect += "?" + e.QueryParams().Encode() 32 32 + } 33 33 + 34 34 + return e.Redirect(303, redirect) 35 35 + }

+1 -1

server/handle_actor_get_preferences.go

··· 14 14 15 15 var prefs map[string]any 16 16 err := json.Unmarshal(repo.Preferences, &prefs) 17 17 - if err != nil { 17 17 + if err != nil || prefs["preferences"] == nil { 18 18 prefs = map[string]any{ 19 19 "preferences": map[string]any{}, 20 20 }

+1 -1

server/handle_actor_put_preferences.go

··· 22 22 return err 23 23 } 24 24 25 25 - if err := s.db.Exec("UPDATE repos SET preferences = ? WHERE did = ?", b, repo.Repo.Did).Error; err != nil { 25 25 + if err := s.db.Exec("UPDATE repos SET preferences = ? WHERE did = ?", nil, b, repo.Repo.Did).Error; err != nil { 26 26 return err 27 27 } 28 28

+5 -1

server/handle_identity_update_handle.go

··· 81 81 } 82 82 } 83 83 84 84 + if err := s.passport.BustDoc(context.TODO(), repo.Repo.Did); err != nil { 85 85 + s.logger.Warn("error busting did doc", "error", err) 86 86 + } 87 87 + 84 88 s.evtman.AddEvent(context.TODO(), &events.XRPCStreamEvent{ 85 89 RepoHandle: &atproto.SyncSubscribeRepos_Handle{ 86 90 Did: repo.Repo.Did, ··· 99 103 }, 100 104 }) 101 105 102 102 - if err := s.db.Exec("UPDATE actors SET handle = ? WHERE did = ?", req.Handle, repo.Repo.Did).Error; err != nil { 106 106 + if err := s.db.Exec("UPDATE actors SET handle = ? WHERE did = ?", nil, req.Handle, repo.Repo.Did).Error; err != nil { 103 107 s.logger.Error("error updating handle in db", "error", err) 104 108 return helpers.ServerError(e, nil) 105 109 }

+115

server/handle_import_repo.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "bytes" 5 5 + "context" 6 6 + "io" 7 7 + "slices" 8 8 + "strings" 9 9 + 10 10 + "github.com/bluesky-social/indigo/atproto/syntax" 11 11 + "github.com/bluesky-social/indigo/repo" 12 12 + "github.com/haileyok/cocoon/internal/helpers" 13 13 + "github.com/haileyok/cocoon/models" 14 14 + blocks "github.com/ipfs/go-block-format" 15 15 + "github.com/ipfs/go-cid" 16 16 + "github.com/ipld/go-car" 17 17 + "github.com/labstack/echo/v4" 18 18 + ) 19 19 + 20 20 + func (s *Server) handleRepoImportRepo(e echo.Context) error { 21 21 + urepo := e.Get("repo").(*models.RepoActor) 22 22 + 23 23 + b, err := io.ReadAll(e.Request().Body) 24 24 + if err != nil { 25 25 + s.logger.Error("could not read bytes in import request", "error", err) 26 26 + return helpers.ServerError(e, nil) 27 27 + } 28 28 + 29 29 + bs := s.getBlockstore(urepo.Repo.Did) 30 30 + 31 31 + cs, err := car.NewCarReader(bytes.NewReader(b)) 32 32 + if err != nil { 33 33 + s.logger.Error("could not read car in import request", "error", err) 34 34 + return helpers.ServerError(e, nil) 35 35 + } 36 36 + 37 37 + orderedBlocks := []blocks.Block{} 38 38 + currBlock, err := cs.Next() 39 39 + if err != nil { 40 40 + s.logger.Error("could not get first block from car", "error", err) 41 41 + return helpers.ServerError(e, nil) 42 42 + } 43 43 + currBlockCt := 1 44 44 + 45 45 + for currBlock != nil { 46 46 + s.logger.Info("someone is importing their repo", "block", currBlockCt) 47 47 + orderedBlocks = append(orderedBlocks, currBlock) 48 48 + next, _ := cs.Next() 49 49 + currBlock = next 50 50 + currBlockCt++ 51 51 + } 52 52 + 53 53 + slices.Reverse(orderedBlocks) 54 54 + 55 55 + if err := bs.PutMany(context.TODO(), orderedBlocks); err != nil { 56 56 + s.logger.Error("could not insert blocks", "error", err) 57 57 + return helpers.ServerError(e, nil) 58 58 + } 59 59 + 60 60 + r, err := repo.OpenRepo(context.TODO(), bs, cs.Header.Roots[0]) 61 61 + if err != nil { 62 62 + s.logger.Error("could not open repo", "error", err) 63 63 + return helpers.ServerError(e, nil) 64 64 + } 65 65 + 66 66 + tx := s.db.BeginDangerously() 67 67 + 68 68 + clock := syntax.NewTIDClock(0) 69 69 + 70 70 + if err := r.ForEach(context.TODO(), "", func(key string, cid cid.Cid) error { 71 71 + pts := strings.Split(key, "/") 72 72 + nsid := pts[0] 73 73 + rkey := pts[1] 74 74 + cidStr := cid.String() 75 75 + b, err := bs.Get(context.TODO(), cid) 76 76 + if err != nil { 77 77 + s.logger.Error("record bytes don't exist in blockstore", "error", err) 78 78 + return helpers.ServerError(e, nil) 79 79 + } 80 80 + 81 81 + rec := models.Record{ 82 82 + Did: urepo.Repo.Did, 83 83 + CreatedAt: clock.Next().String(), 84 84 + Nsid: nsid, 85 85 + Rkey: rkey, 86 86 + Cid: cidStr, 87 87 + Value: b.RawData(), 88 88 + } 89 89 + 90 90 + if err := tx.Create(rec).Error; err != nil { 91 91 + return err 92 92 + } 93 93 + 94 94 + return nil 95 95 + }); err != nil { 96 96 + tx.Rollback() 97 97 + s.logger.Error("record bytes don't exist in blockstore", "error", err) 98 98 + return helpers.ServerError(e, nil) 99 99 + } 100 100 + 101 101 + tx.Commit() 102 102 + 103 103 + root, rev, err := r.Commit(context.TODO(), urepo.SignFor) 104 104 + if err != nil { 105 105 + s.logger.Error("error committing", "error", err) 106 106 + return helpers.ServerError(e, nil) 107 107 + } 108 108 + 109 109 + if err := s.UpdateRepo(context.TODO(), urepo.Repo.Did, root, rev); err != nil { 110 110 + s.logger.Error("error updating repo after commit", "error", err) 111 111 + return helpers.ServerError(e, nil) 112 112 + } 113 113 + 114 114 + return nil 115 115 + }

+132

server/handle_oauth_authorize.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "net/url" 5 5 + "strings" 6 6 + "time" 7 7 + 8 8 + "github.com/Azure/go-autorest/autorest/to" 9 9 + "github.com/haileyok/cocoon/internal/helpers" 10 10 + "github.com/haileyok/cocoon/oauth" 11 11 + "github.com/haileyok/cocoon/oauth/provider" 12 12 + "github.com/labstack/echo/v4" 13 13 + ) 14 14 + 15 15 + func (s *Server) handleOauthAuthorizeGet(e echo.Context) error { 16 16 + reqUri := e.QueryParam("request_uri") 17 17 + if reqUri == "" { 18 18 + // render page for logged out dev 19 19 + if s.config.Version == "dev" { 20 20 + return e.Render(200, "authorize.html", map[string]any{ 21 21 + "Scopes": []string{"atproto", "transition:generic"}, 22 22 + "AppName": "DEV MODE AUTHORIZATION PAGE", 23 23 + "Handle": "paula.cocoon.social", 24 24 + "RequestUri": "", 25 25 + }) 26 26 + } 27 27 + return helpers.InputError(e, to.StringPtr("no request uri")) 28 28 + } 29 29 + 30 30 + repo, _, err := s.getSessionRepoOrErr(e) 31 31 + if err != nil { 32 32 + return e.Redirect(303, "/account/signin?"+e.QueryParams().Encode()) 33 33 + } 34 34 + 35 35 + reqId, err := oauth.DecodeRequestUri(reqUri) 36 36 + if err != nil { 37 37 + return helpers.InputError(e, to.StringPtr(err.Error())) 38 38 + } 39 39 + 40 40 + var req provider.OauthAuthorizationRequest 41 41 + if err := s.db.Raw("SELECT * FROM oauth_authorization_requests WHERE request_id = ?", nil, reqId).Scan(&req).Error; err != nil { 42 42 + return helpers.ServerError(e, to.StringPtr(err.Error())) 43 43 + } 44 44 + 45 45 + clientId := e.QueryParam("client_id") 46 46 + if clientId != req.ClientId { 47 47 + return helpers.InputError(e, to.StringPtr("client id does not match the client id for the supplied request")) 48 48 + } 49 49 + 50 50 + client, err := s.oauthProvider.ClientManager.GetClient(e.Request().Context(), req.ClientId) 51 51 + if err != nil { 52 52 + return helpers.ServerError(e, to.StringPtr(err.Error())) 53 53 + } 54 54 + 55 55 + scopes := strings.Split(req.Parameters.Scope, " ") 56 56 + appName := client.Metadata.ClientName 57 57 + 58 58 + data := map[string]any{ 59 59 + "Scopes": scopes, 60 60 + "AppName": appName, 61 61 + "RequestUri": reqUri, 62 62 + "QueryParams": e.QueryParams().Encode(), 63 63 + "Handle": repo.Actor.Handle, 64 64 + } 65 65 + 66 66 + return e.Render(200, "authorize.html", data) 67 67 + } 68 68 + 69 69 + type OauthAuthorizePostRequest struct { 70 70 + RequestUri string `form:"request_uri"` 71 71 + AcceptOrRejct string `form:"accept_or_reject"` 72 72 + } 73 73 + 74 74 + func (s *Server) handleOauthAuthorizePost(e echo.Context) error { 75 75 + repo, _, err := s.getSessionRepoOrErr(e) 76 76 + if err != nil { 77 77 + return e.Redirect(303, "/account/signin") 78 78 + } 79 79 + 80 80 + var req OauthAuthorizePostRequest 81 81 + if err := e.Bind(&req); err != nil { 82 82 + s.logger.Error("error binding authorize post request", "error", err) 83 83 + return helpers.InputError(e, nil) 84 84 + } 85 85 + 86 86 + reqId, err := oauth.DecodeRequestUri(req.RequestUri) 87 87 + if err != nil { 88 88 + return helpers.InputError(e, to.StringPtr(err.Error())) 89 89 + } 90 90 + 91 91 + var authReq provider.OauthAuthorizationRequest 92 92 + if err := s.db.Raw("SELECT * FROM oauth_authorization_requests WHERE request_id = ?", nil, reqId).Scan(&authReq).Error; err != nil { 93 93 + return helpers.ServerError(e, to.StringPtr(err.Error())) 94 94 + } 95 95 + 96 96 + client, err := s.oauthProvider.ClientManager.GetClient(e.Request().Context(), authReq.ClientId) 97 97 + if err != nil { 98 98 + return helpers.ServerError(e, to.StringPtr(err.Error())) 99 99 + } 100 100 + 101 101 + // TODO: figure out how im supposed to actually redirect 102 102 + if req.AcceptOrRejct == "reject" { 103 103 + return e.Redirect(303, client.Metadata.ClientURI) 104 104 + } 105 105 + 106 106 + if time.Now().After(authReq.ExpiresAt) { 107 107 + return helpers.InputError(e, to.StringPtr("the request has expired")) 108 108 + } 109 109 + 110 110 + if authReq.Sub != nil || authReq.Code != nil { 111 111 + return helpers.InputError(e, to.StringPtr("this request was already authorized")) 112 112 + } 113 113 + 114 114 + code := oauth.GenerateCode() 115 115 + 116 116 + if err := s.db.Exec("UPDATE oauth_authorization_requests SET sub = ?, code = ?, accepted = ?, ip = ? WHERE request_id = ?", nil, repo.Repo.Did, code, true, e.RealIP(), reqId).Error; err != nil { 117 117 + s.logger.Error("error updating authorization request", "error", err) 118 118 + return helpers.ServerError(e, nil) 119 119 + } 120 120 + 121 121 + q := url.Values{} 122 122 + q.Set("state", authReq.Parameters.State) 123 123 + q.Set("iss", "https://"+s.config.Hostname) 124 124 + q.Set("code", code) 125 125 + 126 126 + hashOrQuestion := "?" 127 127 + if authReq.ClientAuth.Method != "private_key_jwt" { 128 128 + hashOrQuestion = "#" 129 129 + } 130 130 + 131 131 + return e.Redirect(303, authReq.Parameters.RedirectURI+hashOrQuestion+q.Encode()) 132 132 + }

+12

server/handle_oauth_jwks.go

··· 1 1 + package server 2 2 + 3 3 + import "github.com/labstack/echo/v4" 4 4 + 5 5 + type OauthJwksResponse struct { 6 6 + Keys []any `json:"keys"` 7 7 + } 8 8 + 9 9 + // TODO: ? 10 10 + func (s *Server) handleOauthJwks(e echo.Context) error { 11 11 + return e.JSON(200, OauthJwksResponse{Keys: []any{}}) 12 12 + }

+88

server/handle_oauth_par.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "time" 5 5 + 6 6 + "github.com/Azure/go-autorest/autorest/to" 7 7 + "github.com/haileyok/cocoon/internal/helpers" 8 8 + "github.com/haileyok/cocoon/oauth" 9 9 + "github.com/haileyok/cocoon/oauth/constants" 10 10 + "github.com/haileyok/cocoon/oauth/provider" 11 11 + "github.com/labstack/echo/v4" 12 12 + ) 13 13 + 14 14 + type OauthParResponse struct { 15 15 + ExpiresIn int64 `json:"expires_in"` 16 16 + RequestURI string `json:"request_uri"` 17 17 + } 18 18 + 19 19 + func (s *Server) handleOauthPar(e echo.Context) error { 20 20 + var parRequest provider.ParRequest 21 21 + if err := e.Bind(&parRequest); err != nil { 22 22 + s.logger.Error("error binding for par request", "error", err) 23 23 + return helpers.ServerError(e, nil) 24 24 + } 25 25 + 26 26 + if err := e.Validate(parRequest); err != nil { 27 27 + s.logger.Error("missing parameters for par request", "error", err) 28 28 + return helpers.InputError(e, nil) 29 29 + } 30 30 + 31 31 + // TODO: this seems wrong. should be a way to get the entire request url i believe, but this will work for now 32 32 + dpopProof, err := s.oauthProvider.DpopManager.CheckProof(e.Request().Method, "https://"+s.config.Hostname+e.Request().URL.String(), e.Request().Header, nil) 33 33 + if err != nil { 34 34 + s.logger.Error("error getting dpop proof", "error", err) 35 35 + return helpers.InputError(e, to.StringPtr(err.Error())) 36 36 + } 37 37 + 38 38 + client, clientAuth, err := s.oauthProvider.AuthenticateClient(e.Request().Context(), parRequest.AuthenticateClientRequestBase, dpopProof, &provider.AuthenticateClientOptions{ 39 39 + // rfc9449 40 40 + // https://github.com/bluesky-social/atproto/blob/main/packages/oauth/oauth-provider/src/oauth-provider.ts#L473 41 41 + AllowMissingDpopProof: true, 42 42 + }) 43 43 + if err != nil { 44 44 + s.logger.Error("error authenticating client", "error", err) 45 45 + return helpers.InputError(e, to.StringPtr(err.Error())) 46 46 + } 47 47 + 48 48 + if parRequest.DpopJkt == nil { 49 49 + if client.Metadata.DpopBoundAccessTokens { 50 50 + parRequest.DpopJkt = to.StringPtr(dpopProof.JKT) 51 51 + } 52 52 + } else { 53 53 + if !client.Metadata.DpopBoundAccessTokens { 54 54 + msg := "dpop bound access tokens are not enabled for this client" 55 55 + s.logger.Error(msg) 56 56 + return helpers.InputError(e, &msg) 57 57 + } 58 58 + 59 59 + if dpopProof.JKT != *parRequest.DpopJkt { 60 60 + msg := "supplied dpop jkt does not match header dpop jkt" 61 61 + s.logger.Error(msg) 62 62 + return helpers.InputError(e, &msg) 63 63 + } 64 64 + } 65 65 + 66 66 + eat := time.Now().Add(constants.ParExpiresIn) 67 67 + id := oauth.GenerateRequestId() 68 68 + 69 69 + authRequest := &provider.OauthAuthorizationRequest{ 70 70 + RequestId: id, 71 71 + ClientId: client.Metadata.ClientID, 72 72 + ClientAuth: *clientAuth, 73 73 + Parameters: parRequest, 74 74 + ExpiresAt: eat, 75 75 + } 76 76 + 77 77 + if err := s.db.Create(authRequest, nil).Error; err != nil { 78 78 + s.logger.Error("error creating auth request in db", "error", err) 79 79 + return helpers.ServerError(e, nil) 80 80 + } 81 81 + 82 82 + uri := oauth.EncodeRequestUri(id) 83 83 + 84 84 + return e.JSON(201, OauthParResponse{ 85 85 + ExpiresIn: int64(constants.ParExpiresIn.Seconds()), 86 86 + RequestURI: uri, 87 87 + }) 88 88 + }

+270

server/handle_oauth_token.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "bytes" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "fmt" 8 8 + "slices" 9 9 + "time" 10 10 + 11 11 + "github.com/Azure/go-autorest/autorest/to" 12 12 + "github.com/golang-jwt/jwt/v4" 13 13 + "github.com/haileyok/cocoon/internal/helpers" 14 14 + "github.com/haileyok/cocoon/oauth" 15 15 + "github.com/haileyok/cocoon/oauth/constants" 16 16 + "github.com/haileyok/cocoon/oauth/provider" 17 17 + "github.com/labstack/echo/v4" 18 18 + ) 19 19 + 20 20 + type OauthTokenRequest struct { 21 21 + provider.AuthenticateClientRequestBase 22 22 + GrantType string `form:"grant_type" json:"grant_type"` 23 23 + Code *string `form:"code" json:"code,omitempty"` 24 24 + CodeVerifier *string `form:"code_verifier" json:"code_verifier,omitempty"` 25 25 + RedirectURI *string `form:"redirect_uri" json:"redirect_uri,omitempty"` 26 26 + RefreshToken *string `form:"refresh_token" json:"refresh_token,omitempty"` 27 27 + } 28 28 + 29 29 + type OauthTokenResponse struct { 30 30 + AccessToken string `json:"access_token"` 31 31 + TokenType string `json:"token_type"` 32 32 + RefreshToken string `json:"refresh_token"` 33 33 + Scope string `json:"scope"` 34 34 + ExpiresIn int64 `json:"expires_in"` 35 35 + Sub string `json:"sub"` 36 36 + } 37 37 + 38 38 + func (s *Server) handleOauthToken(e echo.Context) error { 39 39 + var req OauthTokenRequest 40 40 + if err := e.Bind(&req); err != nil { 41 41 + s.logger.Error("error binding token request", "error", err) 42 42 + return helpers.ServerError(e, nil) 43 43 + } 44 44 + 45 45 + proof, err := s.oauthProvider.DpopManager.CheckProof(e.Request().Method, e.Request().URL.String(), e.Request().Header, nil) 46 46 + if err != nil { 47 47 + s.logger.Error("error getting dpop proof", "error", err) 48 48 + return helpers.InputError(e, to.StringPtr(err.Error())) 49 49 + } 50 50 + 51 51 + client, clientAuth, err := s.oauthProvider.AuthenticateClient(e.Request().Context(), req.AuthenticateClientRequestBase, proof, &provider.AuthenticateClientOptions{ 52 52 + AllowMissingDpopProof: true, 53 53 + }) 54 54 + if err != nil { 55 55 + s.logger.Error("error authenticating client", "error", err) 56 56 + return helpers.InputError(e, to.StringPtr(err.Error())) 57 57 + } 58 58 + 59 59 + // TODO: this should come from an oauth provier config 60 60 + if !slices.Contains([]string{"authorization_code", "refresh_token"}, req.GrantType) { 61 61 + return helpers.InputError(e, to.StringPtr(fmt.Sprintf(`"%s" grant type is not supported by the server`, req.GrantType))) 62 62 + } 63 63 + 64 64 + if !slices.Contains(client.Metadata.GrantTypes, req.GrantType) { 65 65 + return helpers.InputError(e, to.StringPtr(fmt.Sprintf(`"%s" grant type is not supported by the client`, req.GrantType))) 66 66 + } 67 67 + 68 68 + if req.GrantType == "authorization_code" { 69 69 + if req.Code == nil { 70 70 + return helpers.InputError(e, to.StringPtr(`"code" is required"`)) 71 71 + } 72 72 + 73 73 + var authReq provider.OauthAuthorizationRequest 74 74 + // get the lil guy and delete him 75 75 + if err := s.db.Raw("DELETE FROM oauth_authorization_requests WHERE code = ? RETURNING *", nil, *req.Code).Scan(&authReq).Error; err != nil { 76 76 + s.logger.Error("error finding authorization request", "error", err) 77 77 + return helpers.ServerError(e, nil) 78 78 + } 79 79 + 80 80 + if req.RedirectURI == nil || *req.RedirectURI != authReq.Parameters.RedirectURI { 81 81 + return helpers.InputError(e, to.StringPtr(`"redirect_uri" mismatch`)) 82 82 + } 83 83 + 84 84 + if authReq.Parameters.CodeChallenge != nil { 85 85 + if req.CodeVerifier == nil { 86 86 + return helpers.InputError(e, to.StringPtr(`"code_verifier" is required`)) 87 87 + } 88 88 + 89 89 + if len(*req.CodeVerifier) < 43 { 90 90 + return helpers.InputError(e, to.StringPtr(`"code_verifier" is too short`)) 91 91 + } 92 92 + 93 93 + switch *&authReq.Parameters.CodeChallengeMethod { 94 94 + case "", "plain": 95 95 + if authReq.Parameters.CodeChallenge != req.CodeVerifier { 96 96 + return helpers.InputError(e, to.StringPtr("invalid code_verifier")) 97 97 + } 98 98 + case "S256": 99 99 + inputChal, err := base64.RawURLEncoding.DecodeString(*authReq.Parameters.CodeChallenge) 100 100 + if err != nil { 101 101 + s.logger.Error("error decoding code challenge", "error", err) 102 102 + return helpers.ServerError(e, nil) 103 103 + } 104 104 + 105 105 + h := sha256.New() 106 106 + h.Write([]byte(*req.CodeVerifier)) 107 107 + compdChal := h.Sum(nil) 108 108 + 109 109 + if !bytes.Equal(inputChal, compdChal) { 110 110 + return helpers.InputError(e, to.StringPtr("invalid code_verifier")) 111 111 + } 112 112 + default: 113 113 + return helpers.InputError(e, to.StringPtr("unsupported code_challenge_method "+*&authReq.Parameters.CodeChallengeMethod)) 114 114 + } 115 115 + } else if req.CodeVerifier != nil { 116 116 + return helpers.InputError(e, to.StringPtr("code_challenge parameter wasn't provided")) 117 117 + } 118 118 + 119 119 + repo, err := s.getRepoActorByDid(*authReq.Sub) 120 120 + if err != nil { 121 121 + helpers.InputError(e, to.StringPtr("unable to find actor")) 122 122 + } 123 123 + 124 124 + now := time.Now() 125 125 + eat := now.Add(constants.TokenMaxAge) 126 126 + id := oauth.GenerateTokenId() 127 127 + 128 128 + refreshToken := oauth.GenerateRefreshToken() 129 129 + 130 130 + accessClaims := jwt.MapClaims{ 131 131 + "scope": authReq.Parameters.Scope, 132 132 + "aud": s.config.Did, 133 133 + "sub": repo.Repo.Did, 134 134 + "iat": now.Unix(), 135 135 + "exp": eat.Unix(), 136 136 + "jti": id, 137 137 + "client_id": authReq.ClientId, 138 138 + } 139 139 + 140 140 + if authReq.Parameters.DpopJkt != nil { 141 141 + accessClaims["cnf"] = *authReq.Parameters.DpopJkt 142 142 + } 143 143 + 144 144 + accessToken := jwt.NewWithClaims(jwt.SigningMethodES256, accessClaims) 145 145 + accessString, err := accessToken.SignedString(s.privateKey) 146 146 + if err != nil { 147 147 + return err 148 148 + } 149 149 + 150 150 + if err := s.db.Create(&provider.OauthToken{ 151 151 + ClientId: authReq.ClientId, 152 152 + ClientAuth: *clientAuth, 153 153 + Parameters: authReq.Parameters, 154 154 + ExpiresAt: eat, 155 155 + DeviceId: "", 156 156 + Sub: repo.Repo.Did, 157 157 + Code: *authReq.Code, 158 158 + Token: accessString, 159 159 + RefreshToken: refreshToken, 160 160 + Ip: authReq.Ip, 161 161 + }, nil).Error; err != nil { 162 162 + s.logger.Error("error creating token in db", "error", err) 163 163 + return helpers.ServerError(e, nil) 164 164 + } 165 165 + 166 166 + // prob not needed 167 167 + tokenType := "Bearer" 168 168 + if authReq.Parameters.DpopJkt != nil { 169 169 + tokenType = "DPoP" 170 170 + } 171 171 + 172 172 + e.Response().Header().Set("content-type", "application/json") 173 173 + 174 174 + return e.JSON(200, OauthTokenResponse{ 175 175 + AccessToken: accessString, 176 176 + RefreshToken: refreshToken, 177 177 + TokenType: tokenType, 178 178 + Scope: authReq.Parameters.Scope, 179 179 + ExpiresIn: int64(eat.Sub(time.Now()).Seconds()), 180 180 + Sub: repo.Repo.Did, 181 181 + }) 182 182 + } 183 183 + 184 184 + if req.GrantType == "refresh_token" { 185 185 + if req.RefreshToken == nil { 186 186 + return helpers.InputError(e, to.StringPtr(`"refresh_token" is required`)) 187 187 + } 188 188 + 189 189 + var oauthToken provider.OauthToken 190 190 + if err := s.db.Raw("SELECT * FROM oauth_tokens WHERE refresh_token = ?", nil, req.RefreshToken).Scan(&oauthToken).Error; err != nil { 191 191 + s.logger.Error("error finding oauth token by refresh token", "error", err, "refresh_token", req.RefreshToken) 192 192 + return helpers.ServerError(e, nil) 193 193 + } 194 194 + 195 195 + if client.Metadata.ClientID != oauthToken.ClientId { 196 196 + return helpers.InputError(e, to.StringPtr(`"client_id" mismatch`)) 197 197 + } 198 198 + 199 199 + if clientAuth.Method != oauthToken.ClientAuth.Method { 200 200 + return helpers.InputError(e, to.StringPtr(`"client authentication method mismatch`)) 201 201 + } 202 202 + 203 203 + if *oauthToken.Parameters.DpopJkt != proof.JKT { 204 204 + return helpers.InputError(e, to.StringPtr("dpop proof does not match expected jkt")) 205 205 + } 206 206 + 207 207 + ageRes := oauth.GetSessionAgeFromToken(oauthToken) 208 208 + 209 209 + if ageRes.SessionExpired { 210 210 + return helpers.InputError(e, to.StringPtr("Session expired")) 211 211 + } 212 212 + 213 213 + if ageRes.RefreshExpired { 214 214 + return helpers.InputError(e, to.StringPtr("Refresh token expired")) 215 215 + } 216 216 + 217 217 + if client.Metadata.DpopBoundAccessTokens && oauthToken.Parameters.DpopJkt == nil { 218 218 + // why? ref impl 219 219 + return helpers.InputError(e, to.StringPtr("dpop jkt is required for dpop bound access tokens")) 220 220 + } 221 221 + 222 222 + nextTokenId := oauth.GenerateTokenId() 223 223 + nextRefreshToken := oauth.GenerateRefreshToken() 224 224 + 225 225 + now := time.Now() 226 226 + eat := now.Add(constants.TokenMaxAge) 227 227 + 228 228 + accessClaims := jwt.MapClaims{ 229 229 + "scope": oauthToken.Parameters.Scope, 230 230 + "aud": s.config.Did, 231 231 + "sub": oauthToken.Sub, 232 232 + "iat": now.Unix(), 233 233 + "exp": eat.Unix(), 234 234 + "jti": nextTokenId, 235 235 + "client_id": oauthToken.ClientId, 236 236 + } 237 237 + 238 238 + if oauthToken.Parameters.DpopJkt != nil { 239 239 + accessClaims["cnf"] = *&oauthToken.Parameters.DpopJkt 240 240 + } 241 241 + 242 242 + accessToken := jwt.NewWithClaims(jwt.SigningMethodES256, accessClaims) 243 243 + accessString, err := accessToken.SignedString(s.privateKey) 244 244 + if err != nil { 245 245 + return err 246 246 + } 247 247 + 248 248 + if err := s.db.Exec("UPDATE oauth_tokens SET token = ?, refresh_token = ?, expires_at = ?, updated_at = ? WHERE refresh_token = ?", nil, accessString, nextRefreshToken, eat, now, *req.RefreshToken).Error; err != nil { 249 249 + s.logger.Error("error updating token", "error", err) 250 250 + return helpers.ServerError(e, nil) 251 251 + } 252 252 + 253 253 + // prob not needed 254 254 + tokenType := "Bearer" 255 255 + if oauthToken.Parameters.DpopJkt != nil { 256 256 + tokenType = "DPoP" 257 257 + } 258 258 + 259 259 + return e.JSON(200, OauthTokenResponse{ 260 260 + AccessToken: accessString, 261 261 + RefreshToken: nextRefreshToken, 262 262 + TokenType: tokenType, 263 263 + Scope: oauthToken.Parameters.Scope, 264 264 + ExpiresIn: int64(eat.Sub(time.Now()).Seconds()), 265 265 + Sub: oauthToken.Sub, 266 266 + }) 267 267 + } 268 268 + 269 269 + return helpers.InputError(e, to.StringPtr(fmt.Sprintf(`grant type "%s" is not supported`, req.GrantType))) 270 270 + }

+27 -15

server/handle_proxy.go

··· 17 17 secp256k1secec "gitlab.com/yawning/secp256k1-voi/secec" 18 18 ) 19 19 20 20 - func (s *Server) handleProxy(e echo.Context) error { 21 21 - repo, isAuthed := e.Get("repo").(*models.RepoActor) 22 22 - 23 23 - pts := strings.Split(e.Request().URL.Path, "/") 24 24 - if len(pts) != 3 { 25 25 - return fmt.Errorf("incorrect number of parts") 26 26 - } 27 27 - 20 20 + func (s *Server) getAtprotoProxyEndpointFromRequest(e echo.Context) (string, string, error) { 28 21 svc := e.Request().Header.Get("atproto-proxy") 29 22 if svc == "" { 30 30 - svc = "did:web:api.bsky.app#bsky_appview" // TODO: should be a config var probably 23 23 + svc = s.config.DefaultAtprotoProxy 31 24 } 32 25 33 26 svcPts := strings.Split(svc, "#") 34 27 if len(svcPts) != 2 { 35 35 - return fmt.Errorf("invalid service header") 28 28 + return "", "", fmt.Errorf("invalid service header") 36 29 } 37 30 38 31 svcDid := svcPts[0] ··· 40 33 41 34 doc, err := s.passport.FetchDoc(e.Request().Context(), svcDid) 42 35 if err != nil { 43 43 - return err 36 36 + return "", "", err 44 37 } 45 38 46 39 var endpoint string ··· 50 43 } 51 44 } 52 45 46 46 + return endpoint, svcDid, nil 47 47 + } 48 48 + 49 49 + func (s *Server) handleProxy(e echo.Context) error { 50 50 + lgr := s.logger.With("handler", "handleProxy") 51 51 + 52 52 + repo, isAuthed := e.Get("repo").(*models.RepoActor) 53 53 + 54 54 + pts := strings.Split(e.Request().URL.Path, "/") 55 55 + if len(pts) != 3 { 56 56 + return fmt.Errorf("incorrect number of parts") 57 57 + } 58 58 + 59 59 + endpoint, svcDid, err := s.getAtprotoProxyEndpointFromRequest(e) 60 60 + if err != nil { 61 61 + lgr.Error("could not get atproto proxy", "error", err) 62 62 + return helpers.ServerError(e, nil) 63 63 + } 64 64 + 53 65 requrl := e.Request().URL 54 66 requrl.Host = strings.TrimPrefix(endpoint, "https://") 55 67 requrl.Scheme = "https" ··· 78 90 } 79 91 hj, err := json.Marshal(header) 80 92 if err != nil { 81 81 - s.logger.Error("error marshaling header", "error", err) 93 93 + lgr.Error("error marshaling header", "error", err) 82 94 return helpers.ServerError(e, nil) 83 95 } 84 96 ··· 93 105 } 94 106 pj, err := json.Marshal(payload) 95 107 if err != nil { 96 96 - s.logger.Error("error marashaling payload", "error", err) 108 108 + lgr.Error("error marashaling payload", "error", err) 97 109 return helpers.ServerError(e, nil) 98 110 } 99 111 ··· 104 116 105 117 sk, err := secp256k1secec.NewPrivateKey(repo.SigningKey) 106 118 if err != nil { 107 107 - s.logger.Error("can't load private key", "error", err) 119 119 + lgr.Error("can't load private key", "error", err) 108 120 return err 109 121 } 110 122 111 123 R, S, _, err := sk.SignRaw(rand.Reader, hash[:]) 112 124 if err != nil { 113 113 - s.logger.Error("error signing", "error", err) 125 125 + lgr.Error("error signing", "error", err) 114 126 } 115 127 116 128 rBytes := R.Bytes()

+7 -1

server/handle_repo_apply_writes.go

··· 60 60 return helpers.ServerError(e, nil) 61 61 } 62 62 63 63 + commit := *results[0].Commit 64 64 + 65 65 + for i := range results { 66 66 + results[i].Commit = nil 67 67 + } 68 68 + 63 69 return e.JSON(200, ComAtprotoRepoApplyWritesResponse{ 64 64 - Commit: *results[0].Commit, 70 70 + Commit: commit, 65 71 Results: results, 66 72 }) 67 73 }

+2

server/handle_repo_create_record.go

··· 55 55 return helpers.ServerError(e, nil) 56 56 } 57 57 58 58 + results[0].Type = nil 59 59 + 58 60 return e.JSON(200, results[0]) 59 61 }

+55

server/handle_repo_delete_record.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/internal/helpers" 5 5 + "github.com/haileyok/cocoon/models" 6 6 + "github.com/labstack/echo/v4" 7 7 + ) 8 8 + 9 9 + type ComAtprotoRepoDeleteRecordRequest struct { 10 10 + Repo string `json:"repo" validate:"required,atproto-did"` 11 11 + Collection string `json:"collection" validate:"required,atproto-nsid"` 12 12 + Rkey string `json:"rkey" validate:"required,atproto-rkey"` 13 13 + SwapRecord *string `json:"swapRecord"` 14 14 + SwapCommit *string `json:"swapCommit"` 15 15 + } 16 16 + 17 17 + func (s *Server) handleDeleteRecord(e echo.Context) error { 18 18 + repo := e.Get("repo").(*models.RepoActor) 19 19 + 20 20 + var req ComAtprotoRepoDeleteRecordRequest 21 21 + if err := e.Bind(&req); err != nil { 22 22 + s.logger.Error("error binding", "error", err) 23 23 + return helpers.ServerError(e, nil) 24 24 + } 25 25 + 26 26 + if err := e.Validate(req); err != nil { 27 27 + s.logger.Error("error validating", "error", err) 28 28 + return helpers.InputError(e, nil) 29 29 + } 30 30 + 31 31 + if repo.Repo.Did != req.Repo { 32 32 + s.logger.Warn("mismatched repo/auth") 33 33 + return helpers.InputError(e, nil) 34 34 + } 35 35 + 36 36 + results, err := s.repoman.applyWrites(repo.Repo, []Op{ 37 37 + { 38 38 + Type: OpTypeDelete, 39 39 + Collection: req.Collection, 40 40 + Rkey: &req.Rkey, 41 41 + SwapRecord: req.SwapRecord, 42 42 + }, 43 43 + }, req.SwapCommit) 44 44 + if err != nil { 45 45 + s.logger.Error("error applying writes", "error", err) 46 46 + return helpers.ServerError(e, nil) 47 47 + } 48 48 + 49 49 + results[0].Type = nil 50 50 + results[0].Uri = nil 51 51 + results[0].Cid = nil 52 52 + results[0].ValidationStatus = nil 53 53 + 54 54 + return e.JSON(200, results[0]) 55 55 + }

+2 -2

server/handle_repo_describe_repo.go

··· 64 64 } 65 65 66 66 var records []models.Record 67 67 - if err := s.db.Raw("SELECT DISTINCT(nsid) FROM records WHERE did = ?", repo.Repo.Did).Scan(&records).Error; err != nil { 67 67 + if err := s.db.Raw("SELECT DISTINCT(nsid) FROM records WHERE did = ?", nil, repo.Repo.Did).Scan(&records).Error; err != nil { 68 68 s.logger.Error("error getting collections", "error", err) 69 69 return helpers.ServerError(e, nil) 70 70 } 71 71 72 72 - var collections []string 72 72 + var collections []string = make([]string, 0, len(records)) 73 73 for _, r := range records { 74 74 collections = append(collections, r.Nsid) 75 75 }

+1 -1

server/handle_repo_get_record.go

··· 32 32 } 33 33 34 34 var record models.Record 35 35 - if err := s.db.Raw("SELECT * FROM records WHERE did = ? AND nsid = ? AND rkey = ?"+cidquery, params...).Scan(&record).Error; err != nil { 35 35 + if err := s.db.Raw("SELECT * FROM records WHERE did = ? AND nsid = ? AND rkey = ?"+cidquery, nil, params...).Scan(&record).Error; err != nil { 36 36 // TODO: handle error nicely 37 37 return err 38 38 }

+40 -11

server/handle_repo_list_records.go

··· 2 2 3 3 import ( 4 4 "strconv" 5 5 - "strings" 6 5 7 6 "github.com/Azure/go-autorest/autorest/to" 8 7 "github.com/bluesky-social/indigo/atproto/data" 8 8 + "github.com/bluesky-social/indigo/atproto/syntax" 9 9 "github.com/haileyok/cocoon/internal/helpers" 10 10 "github.com/haileyok/cocoon/models" 11 11 "github.com/labstack/echo/v4" 12 12 ) 13 13 + 14 14 + type ComAtprotoRepoListRecordsRequest struct { 15 15 + Repo string `query:"repo" validate:"required"` 16 16 + Collection string `query:"collection" validate:"required,atproto-nsid"` 17 17 + Limit int64 `query:"limit"` 18 18 + Cursor string `query:"cursor"` 19 19 + Reverse bool `query:"reverse"` 20 20 + } 13 21 14 22 type ComAtprotoRepoListRecordsResponse struct { 15 23 Cursor *string `json:"cursor,omitempty"` ··· 38 46 } 39 47 40 48 func (s *Server) handleListRecords(e echo.Context) error { 41 41 - did := e.QueryParam("repo") 42 42 - collection := e.QueryParam("collection") 43 43 - cursor := e.QueryParam("cursor") 44 44 - reverse := e.QueryParam("reverse") 49 49 + var req ComAtprotoRepoListRecordsRequest 50 50 + if err := e.Bind(&req); err != nil { 51 51 + s.logger.Error("could not bind list records request", "error", err) 52 52 + return helpers.ServerError(e, nil) 53 53 + } 54 54 + 55 55 + if err := e.Validate(req); err != nil { 56 56 + return helpers.InputError(e, nil) 57 57 + } 58 58 + 59 59 + if req.Limit <= 0 { 60 60 + req.Limit = 50 61 61 + } else if req.Limit > 100 { 62 62 + req.Limit = 100 63 63 + } 64 64 + 45 65 limit, err := getLimitFromContext(e, 50) 46 66 if err != nil { 47 67 return helpers.InputError(e, nil) ··· 51 71 dir := "<" 52 72 cursorquery := "" 53 73 54 54 - if strings.ToLower(reverse) == "true" { 74 74 + if req.Reverse { 55 75 sort = "ASC" 56 76 dir = ">" 57 77 } 58 78 59 59 - params := []any{did, collection} 60 60 - if cursor != "" { 61 61 - params = append(params, cursor) 79 79 + did := req.Repo 80 80 + if _, err := syntax.ParseDID(did); err != nil { 81 81 + actor, err := s.getActorByHandle(req.Repo) 82 82 + if err != nil { 83 83 + return helpers.InputError(e, to.StringPtr("RepoNotFound")) 84 84 + } 85 85 + did = actor.Did 86 86 + } 87 87 + 88 88 + params := []any{did, req.Collection} 89 89 + if req.Cursor != "" { 90 90 + params = append(params, req.Cursor) 62 91 cursorquery = "AND created_at " + dir + " ?" 63 92 } 64 93 params = append(params, limit) 65 94 66 95 var records []models.Record 67 67 - if err := s.db.Raw("SELECT * FROM records WHERE did = ? AND nsid = ? "+cursorquery+" ORDER BY created_at "+sort+" limit ?", params...).Scan(&records).Error; err != nil { 96 96 + if err := s.db.Raw("SELECT * FROM records WHERE did = ? AND nsid = ? "+cursorquery+" ORDER BY created_at "+sort+" limit ?", nil, params...).Scan(&records).Error; err != nil { 68 97 s.logger.Error("error getting records", "error", err) 69 98 return helpers.ServerError(e, nil) 70 99 } ··· 84 113 } 85 114 86 115 var newcursor *string 87 87 - if len(records) == 50 { 116 116 + if len(records) == limit { 88 117 newcursor = to.StringPtr(records[len(records)-1].CreatedAt) 89 118 } 90 119

+1 -1

server/handle_repo_list_repos.go

··· 22 22 // TODO: paginate this bitch 23 23 func (s *Server) handleListRepos(e echo.Context) error { 24 24 var repos []models.Repo 25 25 - if err := s.db.Raw("SELECT * FROM repos ORDER BY created_at DESC LIMIT 500").Scan(&repos).Error; err != nil { 25 25 + if err := s.db.Raw("SELECT * FROM repos ORDER BY created_at DESC LIMIT 500", nil).Scan(&repos).Error; err != nil { 26 26 return err 27 27 } 28 28

+2

server/handle_repo_put_record.go

··· 55 55 return helpers.ServerError(e, nil) 56 56 } 57 57 58 58 + results[0].Type = nil 59 59 + 58 60 return e.JSON(200, results[0]) 59 61 }

+3 -3

server/handle_repo_upload_blob.go

··· 40 40 CreatedAt: s.repoman.clock.Next().String(), 41 41 } 42 42 43 43 - if err := s.db.Create(&blob).Error; err != nil { 43 43 + if err := s.db.Create(&blob, nil).Error; err != nil { 44 44 s.logger.Error("error creating new blob in db", "error", err) 45 45 return helpers.ServerError(e, nil) 46 46 } ··· 72 72 Data: data, 73 73 } 74 74 75 75 - if err := s.db.Create(&blobPart).Error; err != nil { 75 75 + if err := s.db.Create(&blobPart, nil).Error; err != nil { 76 76 s.logger.Error("error adding blob part to db", "error", err) 77 77 return helpers.ServerError(e, nil) 78 78 } ··· 89 89 return helpers.ServerError(e, nil) 90 90 } 91 91 92 92 - if err := s.db.Exec("UPDATE blobs SET cid = ? WHERE id = ?", c.Bytes(), blob.ID).Error; err != nil { 92 92 + if err := s.db.Exec("UPDATE blobs SET cid = ? WHERE id = ?", nil, c.Bytes(), blob.ID).Error; err != nil { 93 93 // there should probably be somme handling here if this fails... 94 94 s.logger.Error("error updating blob", "error", err) 95 95 return helpers.ServerError(e, nil)

+65

server/handle_server_check_account_status.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/internal/helpers" 5 5 + "github.com/haileyok/cocoon/models" 6 6 + "github.com/ipfs/go-cid" 7 7 + "github.com/labstack/echo/v4" 8 8 + ) 9 9 + 10 10 + type ComAtprotoServerCheckAccountStatusResponse struct { 11 11 + Activated bool `json:"activated"` 12 12 + ValidDid bool `json:"validDid"` 13 13 + RepoCommit string `json:"repoCommit"` 14 14 + RepoRev string `json:"repoRev"` 15 15 + RepoBlocks int64 `json:"repoBlocks"` 16 16 + IndexedRecords int64 `json:"indexedRecords"` 17 17 + PrivateStateValues int64 `json:"privateStateValues"` 18 18 + ExpectedBlobs int64 `json:"expectedBlobs"` 19 19 + ImportedBlobs int64 `json:"importedBlobs"` 20 20 + } 21 21 + 22 22 + func (s *Server) handleServerCheckAccountStatus(e echo.Context) error { 23 23 + urepo := e.Get("repo").(*models.RepoActor) 24 24 + 25 25 + resp := ComAtprotoServerCheckAccountStatusResponse{ 26 26 + Activated: true, // TODO: should allow for deactivation etc. 27 27 + ValidDid: true, // TODO: should probably verify? 28 28 + RepoRev: urepo.Rev, 29 29 + ImportedBlobs: 0, // TODO: ??? 30 30 + } 31 31 + 32 32 + rootcid, err := cid.Cast(urepo.Root) 33 33 + if err != nil { 34 34 + s.logger.Error("error casting cid", "error", err) 35 35 + return helpers.ServerError(e, nil) 36 36 + } 37 37 + resp.RepoCommit = rootcid.String() 38 38 + 39 39 + type CountResp struct { 40 40 + Ct int64 41 41 + } 42 42 + 43 43 + var blockCtResp CountResp 44 44 + if err := s.db.Raw("SELECT COUNT(*) AS ct FROM blocks WHERE did = ?", nil, urepo.Repo.Did).Scan(&blockCtResp).Error; err != nil { 45 45 + s.logger.Error("error getting block count", "error", err) 46 46 + return helpers.ServerError(e, nil) 47 47 + } 48 48 + resp.RepoBlocks = blockCtResp.Ct 49 49 + 50 50 + var recCtResp CountResp 51 51 + if err := s.db.Raw("SELECT COUNT(*) AS ct FROM records WHERE did = ?", nil, urepo.Repo.Did).Scan(&recCtResp).Error; err != nil { 52 52 + s.logger.Error("error getting record count", "error", err) 53 53 + return helpers.ServerError(e, nil) 54 54 + } 55 55 + resp.IndexedRecords = recCtResp.Ct 56 56 + 57 57 + var blobCtResp CountResp 58 58 + if err := s.db.Raw("SELECT COUNT(*) AS ct FROM blobs WHERE did = ?", nil, urepo.Repo.Did).Scan(&blobCtResp).Error; err != nil { 59 59 + s.logger.Error("error getting record count", "error", err) 60 60 + return helpers.ServerError(e, nil) 61 61 + } 62 62 + resp.ExpectedBlobs = blobCtResp.Ct 63 63 + 64 64 + return e.JSON(200, resp) 65 65 + }

+11 -3

server/handle_server_confirm_email.go

··· 1 1 package server 2 2 3 3 import ( 4 4 + "time" 5 5 + 4 6 "github.com/Azure/go-autorest/autorest/to" 5 7 "github.com/haileyok/cocoon/internal/helpers" 6 8 "github.com/haileyok/cocoon/models" ··· 25 27 return helpers.InputError(e, nil) 26 28 } 27 29 28 28 - if urepo.EmailVerificationCode == nil { 29 29 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 30 30 + if urepo.EmailVerificationCode == nil || urepo.EmailVerificationCodeExpiresAt == nil { 31 31 + return helpers.ExpiredTokenError(e) 30 32 } 31 33 32 34 if *urepo.EmailVerificationCode != req.Token { 33 35 return helpers.InputError(e, to.StringPtr("InvalidToken")) 34 36 } 35 37 36 36 - if err := s.db.Exec("UPDATE repos SET email_verification_token = NULL, email_confirmed_at = NOW() WHERE did = ?", urepo.Repo.Did).Error; err != nil { 38 38 + if time.Now().UTC().After(*urepo.EmailVerificationCodeExpiresAt) { 39 39 + return helpers.ExpiredTokenError(e) 40 40 + } 41 41 + 42 42 + now := time.Now().UTC() 43 43 + 44 44 + if err := s.db.Exec("UPDATE repos SET email_verification_code = NULL, email_verification_code_expires_at = NULL, email_confirmed_at = ? WHERE did = ?", nil, now, urepo.Repo.Did).Error; err != nil { 37 45 s.logger.Error("error updating user", "error", err) 38 46 return helpers.ServerError(e, nil) 39 47 }

+65 -46

server/handle_server_create_account.go

··· 10 10 "github.com/Azure/go-autorest/autorest/to" 11 11 "github.com/bluesky-social/indigo/api/atproto" 12 12 "github.com/bluesky-social/indigo/atproto/crypto" 13 13 + "github.com/bluesky-social/indigo/atproto/syntax" 13 14 "github.com/bluesky-social/indigo/events" 14 15 "github.com/bluesky-social/indigo/repo" 15 16 "github.com/bluesky-social/indigo/util" 16 16 - "github.com/haileyok/cocoon/blockstore" 17 17 "github.com/haileyok/cocoon/internal/helpers" 18 18 "github.com/haileyok/cocoon/models" 19 19 "github.com/labstack/echo/v4" ··· 39 39 func (s *Server) handleCreateAccount(e echo.Context) error { 40 40 var request ComAtprotoServerCreateAccountRequest 41 41 42 42 + var signupDid string 43 43 + customDidHeader := e.Request().Header.Get("authorization") 44 44 + if customDidHeader != "" { 45 45 + pts := strings.Split(customDidHeader, " ") 46 46 + if len(pts) != 2 { 47 47 + return helpers.InputError(e, to.StringPtr("InvalidDid")) 48 48 + } 49 49 + 50 50 + _, err := syntax.ParseDID(pts[1]) 51 51 + if err != nil { 52 52 + return helpers.InputError(e, to.StringPtr("InvalidDid")) 53 53 + } 54 54 + 55 55 + signupDid = pts[1] 56 56 + } 57 57 + 42 58 if err := e.Bind(&request); err != nil { 43 59 s.logger.Error("error receiving request", "endpoint", "com.atproto.server.createAccount", "error", err) 44 60 return helpers.ServerError(e, nil) ··· 85 101 } 86 102 87 103 var ic models.InviteCode 88 88 - if err := s.db.Raw("SELECT * FROM invite_codes WHERE code = ?", request.InviteCode).Scan(&ic).Error; err != nil { 104 104 + if err := s.db.Raw("SELECT * FROM invite_codes WHERE code = ?", nil, request.InviteCode).Scan(&ic).Error; err != nil { 89 105 if err == gorm.ErrRecordNotFound { 90 106 return helpers.InputError(e, to.StringPtr("InvalidInviteCode")) 91 107 } ··· 109 125 110 126 // TODO: unsupported domains 111 127 112 112 - // TODO: did stuff 113 113 - 114 128 k, err := crypto.GeneratePrivateKeyK256() 115 129 if err != nil { 116 130 s.logger.Error("error creating signing key", "endpoint", "com.atproto.server.createAccount", "error", err) 117 131 return helpers.ServerError(e, nil) 118 132 } 119 133 120 120 - did, op, err := s.plcClient.CreateDID(k, "", request.Handle) 121 121 - if err != nil { 122 122 - s.logger.Error("error creating operation", "endpoint", "com.atproto.server.createAccount", "error", err) 123 123 - return helpers.ServerError(e, nil) 124 124 - } 134 134 + if signupDid == "" { 135 135 + did, op, err := s.plcClient.CreateDID(k, "", request.Handle) 136 136 + if err != nil { 137 137 + s.logger.Error("error creating operation", "endpoint", "com.atproto.server.createAccount", "error", err) 138 138 + return helpers.ServerError(e, nil) 139 139 + } 125 140 126 126 - if err := s.plcClient.SendOperation(e.Request().Context(), did, op); err != nil { 127 127 - s.logger.Error("error sending plc op", "endpoint", "com.atproto.server.createAccount", "error", err) 128 128 - return helpers.ServerError(e, nil) 141 141 + if err := s.plcClient.SendOperation(e.Request().Context(), did, op); err != nil { 142 142 + s.logger.Error("error sending plc op", "endpoint", "com.atproto.server.createAccount", "error", err) 143 143 + return helpers.ServerError(e, nil) 144 144 + } 145 145 + signupDid = did 129 146 } 130 147 131 148 hashed, err := bcrypt.GenerateFromPassword([]byte(request.Password), 10) ··· 135 152 } 136 153 137 154 urepo := models.Repo{ 138 138 - Did: did, 155 155 + Did: signupDid, 139 156 CreatedAt: time.Now(), 140 157 Email: request.Email, 141 158 EmailVerificationCode: to.StringPtr(fmt.Sprintf("%s-%s", helpers.RandomVarchar(6), helpers.RandomVarchar(6))), ··· 144 161 } 145 162 146 163 actor := models.Actor{ 147 147 - Did: did, 164 164 + Did: signupDid, 148 165 Handle: request.Handle, 149 166 } 150 167 151 151 - if err := s.db.Create(&urepo).Error; err != nil { 168 168 + if err := s.db.Create(&urepo, nil).Error; err != nil { 152 169 s.logger.Error("error inserting new repo", "error", err) 153 170 return helpers.ServerError(e, nil) 154 171 } 155 172 156 156 - bs := blockstore.New(did, s.db) 157 157 - r := repo.NewRepo(context.TODO(), did, bs) 158 158 - 159 159 - root, rev, err := r.Commit(context.TODO(), urepo.SignFor) 160 160 - if err != nil { 161 161 - s.logger.Error("error committing", "error", err) 173 173 + if err := s.db.Create(&actor, nil).Error; err != nil { 174 174 + s.logger.Error("error inserting new actor", "error", err) 162 175 return helpers.ServerError(e, nil) 163 176 } 164 177 165 165 - if err := bs.UpdateRepo(context.TODO(), root, rev); err != nil { 166 166 - s.logger.Error("error updating repo after commit", "error", err) 167 167 - return helpers.ServerError(e, nil) 168 168 - } 178 178 + if customDidHeader == "" { 179 179 + bs := s.getBlockstore(signupDid) 180 180 + r := repo.NewRepo(context.TODO(), signupDid, bs) 169 181 170 170 - s.evtman.AddEvent(context.TODO(), &events.XRPCStreamEvent{ 171 171 - RepoHandle: &atproto.SyncSubscribeRepos_Handle{ 172 172 - Did: urepo.Did, 173 173 - Handle: request.Handle, 174 174 - Seq: time.Now().UnixMicro(), // TODO: no 175 175 - Time: time.Now().Format(util.ISO8601), 176 176 - }, 177 177 - }) 182 182 + root, rev, err := r.Commit(context.TODO(), urepo.SignFor) 183 183 + if err != nil { 184 184 + s.logger.Error("error committing", "error", err) 185 185 + return helpers.ServerError(e, nil) 186 186 + } 178 187 179 179 - s.evtman.AddEvent(context.TODO(), &events.XRPCStreamEvent{ 180 180 - RepoIdentity: &atproto.SyncSubscribeRepos_Identity{ 181 181 - Did: urepo.Did, 182 182 - Handle: to.StringPtr(request.Handle), 183 183 - Seq: time.Now().UnixMicro(), // TODO: no 184 184 - Time: time.Now().Format(util.ISO8601), 185 185 - }, 186 186 - }) 188 188 + if err := s.UpdateRepo(context.TODO(), urepo.Did, root, rev); err != nil { 189 189 + s.logger.Error("error updating repo after commit", "error", err) 190 190 + return helpers.ServerError(e, nil) 191 191 + } 192 192 + 193 193 + s.evtman.AddEvent(context.TODO(), &events.XRPCStreamEvent{ 194 194 + RepoHandle: &atproto.SyncSubscribeRepos_Handle{ 195 195 + Did: urepo.Did, 196 196 + Handle: request.Handle, 197 197 + Seq: time.Now().UnixMicro(), // TODO: no 198 198 + Time: time.Now().Format(util.ISO8601), 199 199 + }, 200 200 + }) 187 201 188 188 - if err := s.db.Create(&actor).Error; err != nil { 189 189 - s.logger.Error("error inserting new actor", "error", err) 190 190 - return helpers.ServerError(e, nil) 202 202 + s.evtman.AddEvent(context.TODO(), &events.XRPCStreamEvent{ 203 203 + RepoIdentity: &atproto.SyncSubscribeRepos_Identity{ 204 204 + Did: urepo.Did, 205 205 + Handle: to.StringPtr(request.Handle), 206 206 + Seq: time.Now().UnixMicro(), // TODO: no 207 207 + Time: time.Now().Format(util.ISO8601), 208 208 + }, 209 209 + }) 191 210 } 192 211 193 193 - if err := s.db.Raw("UPDATE invite_codes SET remaining_use_count = remaining_use_count - 1 WHERE code = ?", request.InviteCode).Scan(&ic).Error; err != nil { 212 212 + if err := s.db.Raw("UPDATE invite_codes SET remaining_use_count = remaining_use_count - 1 WHERE code = ?", nil, request.InviteCode).Scan(&ic).Error; err != nil { 194 213 s.logger.Error("error decrementing use count", "error", err) 195 214 return helpers.ServerError(e, nil) 196 215 } ··· 214 233 AccessJwt: sess.AccessToken, 215 234 RefreshJwt: sess.RefreshToken, 216 235 Handle: request.Handle, 217 217 - Did: did, 236 236 + Did: signupDid, 218 237 }) 219 238 }

+39 -4

server/handle_server_create_invite_code.go

··· 2 2 3 3 import ( 4 4 "github.com/google/uuid" 5 5 + "github.com/haileyok/cocoon/internal/helpers" 5 6 "github.com/haileyok/cocoon/models" 6 7 "github.com/labstack/echo/v4" 7 8 ) 8 9 10 10 + type ComAtprotoServerCreateInviteCodeRequest struct { 11 11 + UseCount int `json:"useCount" validate:"required"` 12 12 + ForAccount *string `json:"forAccount,omitempty"` 13 13 + } 14 14 + 15 15 + type ComAtprotoServerCreateInviteCodeResponse struct { 16 16 + Code string `json:"code"` 17 17 + } 18 18 + 9 19 func (s *Server) handleCreateInviteCode(e echo.Context) error { 10 10 - ic := models.InviteCode{ 11 11 - Code: uuid.NewString(), 20 20 + var req ComAtprotoServerCreateInviteCodeRequest 21 21 + if err := e.Bind(&req); err != nil { 22 22 + s.logger.Error("error binding", "error", err) 23 23 + return helpers.ServerError(e, nil) 24 24 + } 25 25 + 26 26 + if err := e.Validate(req); err != nil { 27 27 + s.logger.Error("error validating", "error", err) 28 28 + return helpers.InputError(e, nil) 29 29 + } 30 30 + 31 31 + ic := uuid.NewString() 32 32 + 33 33 + var acc string 34 34 + if req.ForAccount == nil { 35 35 + acc = "admin" 36 36 + } else { 37 37 + acc = *req.ForAccount 38 38 + } 39 39 + 40 40 + if err := s.db.Create(&models.InviteCode{ 41 41 + Code: ic, 42 42 + Did: acc, 43 43 + RemainingUseCount: req.UseCount, 44 44 + }, nil).Error; err != nil { 45 45 + s.logger.Error("error creating invite code", "error", err) 46 46 + return helpers.ServerError(e, nil) 12 47 } 13 48 14 14 - return e.JSON(200, map[string]string{ 15 15 - "code": ic.Code, 49 49 + return e.JSON(200, ComAtprotoServerCreateInviteCodeResponse{ 50 50 + Code: ic, 16 51 }) 17 52 }

+70

server/handle_server_create_invite_codes.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/Azure/go-autorest/autorest/to" 5 5 + "github.com/google/uuid" 6 6 + "github.com/haileyok/cocoon/internal/helpers" 7 7 + "github.com/haileyok/cocoon/models" 8 8 + "github.com/labstack/echo/v4" 9 9 + ) 10 10 + 11 11 + type ComAtprotoServerCreateInviteCodesRequest struct { 12 12 + CodeCount *int `json:"codeCount,omitempty"` 13 13 + UseCount int `json:"useCount" validate:"required"` 14 14 + ForAccounts *[]string `json:"forAccounts,omitempty"` 15 15 + } 16 16 + 17 17 + type ComAtprotoServerCreateInviteCodesResponse []ComAtprotoServerCreateInviteCodesItem 18 18 + 19 19 + type ComAtprotoServerCreateInviteCodesItem struct { 20 20 + Account string `json:"account"` 21 21 + Codes []string `json:"codes"` 22 22 + } 23 23 + 24 24 + func (s *Server) handleCreateInviteCodes(e echo.Context) error { 25 25 + var req ComAtprotoServerCreateInviteCodesRequest 26 26 + if err := e.Bind(&req); err != nil { 27 27 + s.logger.Error("error binding", "error", err) 28 28 + return helpers.ServerError(e, nil) 29 29 + } 30 30 + 31 31 + if err := e.Validate(req); err != nil { 32 32 + s.logger.Error("error validating", "error", err) 33 33 + return helpers.InputError(e, nil) 34 34 + } 35 35 + 36 36 + if req.CodeCount == nil { 37 37 + req.CodeCount = to.IntPtr(1) 38 38 + } 39 39 + 40 40 + if req.ForAccounts == nil { 41 41 + req.ForAccounts = to.StringSlicePtr([]string{"admin"}) 42 42 + } 43 43 + 44 44 + var codes []ComAtprotoServerCreateInviteCodesItem 45 45 + 46 46 + for _, did := range *req.ForAccounts { 47 47 + var ics []string 48 48 + 49 49 + for range *req.CodeCount { 50 50 + ic := uuid.NewString() 51 51 + ics = append(ics, ic) 52 52 + 53 53 + if err := s.db.Create(&models.InviteCode{ 54 54 + Code: ic, 55 55 + Did: did, 56 56 + RemainingUseCount: req.UseCount, 57 57 + }, nil).Error; err != nil { 58 58 + s.logger.Error("error creating invite code", "error", err) 59 59 + return helpers.ServerError(e, nil) 60 60 + } 61 61 + } 62 62 + 63 63 + codes = append(codes, ComAtprotoServerCreateInviteCodesItem{ 64 64 + Account: did, 65 65 + Codes: ics, 66 66 + }) 67 67 + } 68 68 + 69 69 + return e.JSON(200, codes) 70 70 + }

+3 -3

server/handle_server_create_session.go

··· 65 65 var err error 66 66 switch idtype { 67 67 case "did": 68 68 - err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.did = ?", req.Identifier).Scan(&repo).Error 68 68 + err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.did = ?", nil, req.Identifier).Scan(&repo).Error 69 69 case "handle": 70 70 - err = s.db.Raw("SELECT r.*, a.* FROM actors a LEFT JOIN repos r ON a.did = r.did WHERE a.handle = ?", req.Identifier).Scan(&repo).Error 70 70 + err = s.db.Raw("SELECT r.*, a.* FROM actors a LEFT JOIN repos r ON a.did = r.did WHERE a.handle = ?", nil, req.Identifier).Scan(&repo).Error 71 71 case "email": 72 72 - err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE a.email = ?", req.Identifier).Scan(&repo).Error 72 72 + err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.email = ?", nil, req.Identifier).Scan(&repo).Error 73 73 } 74 74 75 75 if err != nil {

+2 -2

server/handle_server_delete_session.go

··· 10 10 token := e.Get("token").(string) 11 11 12 12 var acctok models.Token 13 13 - if err := s.db.Raw("DELETE FROM tokens WHERE token = ? RETURNING *", token).Scan(&acctok).Error; err != nil { 13 13 + if err := s.db.Raw("DELETE FROM tokens WHERE token = ? RETURNING *", nil, token).Scan(&acctok).Error; err != nil { 14 14 s.logger.Error("error deleting access token from db", "error", err) 15 15 return helpers.ServerError(e, nil) 16 16 } 17 17 18 18 - if err := s.db.Exec("DELETE FROM refresh_tokens WHERE token = ?", acctok.RefreshToken).Error; err != nil { 18 18 + if err := s.db.Exec("DELETE FROM refresh_tokens WHERE token = ?", nil, acctok.RefreshToken).Error; err != nil { 19 19 s.logger.Error("error deleting refresh token from db", "error", err) 20 20 return helpers.ServerError(e, nil) 21 21 }

+114

server/handle_server_get_service_auth.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "crypto/rand" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "encoding/json" 8 8 + "fmt" 9 9 + "strings" 10 10 + "time" 11 11 + 12 12 + "github.com/Azure/go-autorest/autorest/to" 13 13 + "github.com/google/uuid" 14 14 + "github.com/haileyok/cocoon/internal/helpers" 15 15 + "github.com/haileyok/cocoon/models" 16 16 + "github.com/labstack/echo/v4" 17 17 + secp256k1secec "gitlab.com/yawning/secp256k1-voi/secec" 18 18 + ) 19 19 + 20 20 + type ServerGetServiceAuthRequest struct { 21 21 + Aud string `query:"aud" validate:"required,atproto-did"` 22 22 + // exp should be a float, as some clients will send a non-integer expiration 23 23 + Exp float64 `query:"exp"` 24 24 + Lxm string `query:"lxm" validate:"required,atproto-nsid"` 25 25 + } 26 26 + 27 27 + func (s *Server) handleServerGetServiceAuth(e echo.Context) error { 28 28 + var req ServerGetServiceAuthRequest 29 29 + if err := e.Bind(&req); err != nil { 30 30 + s.logger.Error("could not bind service auth request", "error", err) 31 31 + return helpers.ServerError(e, nil) 32 32 + } 33 33 + 34 34 + if err := e.Validate(req); err != nil { 35 35 + return helpers.InputError(e, nil) 36 36 + } 37 37 + 38 38 + exp := int64(req.Exp) 39 39 + now := time.Now().Unix() 40 40 + if exp == 0 { 41 41 + exp = now + 60 // default 42 42 + } 43 43 + 44 44 + if req.Lxm == "com.atproto.server.getServiceAuth" { 45 45 + return helpers.InputError(e, to.StringPtr("may not generate auth tokens recursively")) 46 46 + } 47 47 + 48 48 + maxExp := now + (60 * 30) 49 49 + if exp > maxExp { 50 50 + return helpers.InputError(e, to.StringPtr("expiration too big. smoller please")) 51 51 + } 52 52 + 53 53 + repo := e.Get("repo").(*models.RepoActor) 54 54 + 55 55 + header := map[string]string{ 56 56 + "alg": "ES256K", 57 57 + "crv": "secp256k1", 58 58 + "typ": "JWT", 59 59 + } 60 60 + hj, err := json.Marshal(header) 61 61 + if err != nil { 62 62 + s.logger.Error("error marshaling header", "error", err) 63 63 + return helpers.ServerError(e, nil) 64 64 + } 65 65 + 66 66 + encheader := strings.TrimRight(base64.RawURLEncoding.EncodeToString(hj), "=") 67 67 + 68 68 + payload := map[string]any{ 69 69 + "iss": repo.Repo.Did, 70 70 + "aud": req.Aud, 71 71 + "lxm": req.Lxm, 72 72 + "jti": uuid.NewString(), 73 73 + "exp": exp, 74 74 + "iat": now, 75 75 + } 76 76 + pj, err := json.Marshal(payload) 77 77 + if err != nil { 78 78 + s.logger.Error("error marashaling payload", "error", err) 79 79 + return helpers.ServerError(e, nil) 80 80 + } 81 81 + 82 82 + encpayload := strings.TrimRight(base64.RawURLEncoding.EncodeToString(pj), "=") 83 83 + 84 84 + input := fmt.Sprintf("%s.%s", encheader, encpayload) 85 85 + hash := sha256.Sum256([]byte(input)) 86 86 + 87 87 + sk, err := secp256k1secec.NewPrivateKey(repo.SigningKey) 88 88 + if err != nil { 89 89 + s.logger.Error("can't load private key", "error", err) 90 90 + return err 91 91 + } 92 92 + 93 93 + R, S, _, err := sk.SignRaw(rand.Reader, hash[:]) 94 94 + if err != nil { 95 95 + s.logger.Error("error signing", "error", err) 96 96 + return helpers.ServerError(e, nil) 97 97 + } 98 98 + 99 99 + rBytes := R.Bytes() 100 100 + sBytes := S.Bytes() 101 101 + 102 102 + rPadded := make([]byte, 32) 103 103 + sPadded := make([]byte, 32) 104 104 + copy(rPadded[32-len(rBytes):], rBytes) 105 105 + copy(sPadded[32-len(sBytes):], sBytes) 106 106 + 107 107 + rawsig := append(rPadded, sPadded...) 108 108 + encsig := strings.TrimRight(base64.RawURLEncoding.EncodeToString(rawsig), "=") 109 109 + token := fmt.Sprintf("%s.%s", input, encsig) 110 110 + 111 111 + return e.JSON(200, map[string]string{ 112 112 + "token": token, 113 113 + }) 114 114 + }

+2 -2

server/handle_server_refresh_session.go

··· 19 19 token := e.Get("token").(string) 20 20 repo := e.Get("repo").(*models.RepoActor) 21 21 22 22 - if err := s.db.Exec("DELETE FROM refresh_tokens WHERE token = ?", token).Error; err != nil { 22 22 + if err := s.db.Exec("DELETE FROM refresh_tokens WHERE token = ?", nil, token).Error; err != nil { 23 23 s.logger.Error("error getting refresh token from db", "error", err) 24 24 return helpers.ServerError(e, nil) 25 25 } 26 26 27 27 - if err := s.db.Exec("DELETE FROM tokens WHERE refresh_token = ?", token).Error; err != nil { 27 27 + if err := s.db.Exec("DELETE FROM tokens WHERE refresh_token = ?", nil, token).Error; err != nil { 28 28 s.logger.Error("error deleting access token from db", "error", err) 29 29 return helpers.ServerError(e, nil) 30 30 }

+4 -2

server/handle_server_request_email_confirmation.go

··· 2 2 3 3 import ( 4 4 "fmt" 5 5 + "time" 5 6 6 7 "github.com/Azure/go-autorest/autorest/to" 7 8 "github.com/haileyok/cocoon/internal/helpers" ··· 16 17 return helpers.InputError(e, to.StringPtr("InvalidRequest")) 17 18 } 18 19 19 19 - code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(6), helpers.RandomVarchar(6)) 20 20 + code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(5), helpers.RandomVarchar(5)) 21 21 + eat := time.Now().Add(10 * time.Minute).UTC() 20 22 21 21 - if err := s.db.Exec("UPDATE repos SET email_verification_code = ? WHERE did = ?", code, urepo.Repo.Did).Error; err != nil { 23 23 + if err := s.db.Exec("UPDATE repos SET email_verification_code = ?, email_verification_code_expires_at = ? WHERE did = ?", nil, code, eat, urepo.Repo.Did).Error; err != nil { 22 24 s.logger.Error("error updating user", "error", err) 23 25 return helpers.ServerError(e, nil) 24 26 }

+37

server/handle_server_request_email_update.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "fmt" 5 5 + "time" 6 6 + 7 7 + "github.com/haileyok/cocoon/internal/helpers" 8 8 + "github.com/haileyok/cocoon/models" 9 9 + "github.com/labstack/echo/v4" 10 10 + ) 11 11 + 12 12 + type ComAtprotoRequestEmailUpdateResponse struct { 13 13 + TokenRequired bool `json:"tokenRequired"` 14 14 + } 15 15 + 16 16 + func (s *Server) handleServerRequestEmailUpdate(e echo.Context) error { 17 17 + urepo := e.Get("repo").(*models.RepoActor) 18 18 + 19 19 + if urepo.EmailConfirmedAt != nil { 20 20 + code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(5), helpers.RandomVarchar(5)) 21 21 + eat := time.Now().Add(10 * time.Minute).UTC() 22 22 + 23 23 + if err := s.db.Exec("UPDATE repos SET email_update_code = ?, email_update_code_expires_at = ? WHERE did = ?", nil, code, eat, urepo.Repo.Did).Error; err != nil { 24 24 + s.logger.Error("error updating repo", "error", err) 25 25 + return helpers.ServerError(e, nil) 26 26 + } 27 27 + 28 28 + if err := s.sendEmailUpdate(urepo.Email, urepo.Handle, code); err != nil { 29 29 + s.logger.Error("error sending email", "error", err) 30 30 + return helpers.ServerError(e, nil) 31 31 + } 32 32 + } 33 33 + 34 34 + return e.JSON(200, ComAtprotoRequestEmailUpdateResponse{ 35 35 + TokenRequired: urepo.EmailConfirmedAt != nil, 36 36 + }) 37 37 + }

+50

server/handle_server_request_password_reset.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "fmt" 5 5 + "time" 6 6 + 7 7 + "github.com/haileyok/cocoon/internal/helpers" 8 8 + "github.com/haileyok/cocoon/models" 9 9 + "github.com/labstack/echo/v4" 10 10 + ) 11 11 + 12 12 + type ComAtprotoServerRequestPasswordResetRequest struct { 13 13 + Email string `json:"email" validate:"required"` 14 14 + } 15 15 + 16 16 + func (s *Server) handleServerRequestPasswordReset(e echo.Context) error { 17 17 + urepo, ok := e.Get("repo").(*models.RepoActor) 18 18 + if !ok { 19 19 + var req ComAtprotoServerRequestPasswordResetRequest 20 20 + if err := e.Bind(&req); err != nil { 21 21 + return err 22 22 + } 23 23 + 24 24 + if err := e.Validate(req); err != nil { 25 25 + return err 26 26 + } 27 27 + 28 28 + murepo, err := s.getRepoActorByEmail(req.Email) 29 29 + if err != nil { 30 30 + return err 31 31 + } 32 32 + 33 33 + urepo = murepo 34 34 + } 35 35 + 36 36 + code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(5), helpers.RandomVarchar(5)) 37 37 + eat := time.Now().Add(10 * time.Minute).UTC() 38 38 + 39 39 + if err := s.db.Exec("UPDATE repos SET password_reset_code = ?, password_reset_code_expires_at = ? WHERE did = ?", nil, code, eat, urepo.Repo.Did).Error; err != nil { 40 40 + s.logger.Error("error updating repo", "error", err) 41 41 + return helpers.ServerError(e, nil) 42 42 + } 43 43 + 44 44 + if err := s.sendPasswordReset(urepo.Email, urepo.Handle, code); err != nil { 45 45 + s.logger.Error("error sending email", "error", err) 46 46 + return helpers.ServerError(e, nil) 47 47 + } 48 48 + 49 49 + return e.NoContent(200) 50 50 + }

+55

server/handle_server_reset_password.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "time" 5 5 + 6 6 + "github.com/Azure/go-autorest/autorest/to" 7 7 + "github.com/haileyok/cocoon/internal/helpers" 8 8 + "github.com/haileyok/cocoon/models" 9 9 + "github.com/labstack/echo/v4" 10 10 + "golang.org/x/crypto/bcrypt" 11 11 + ) 12 12 + 13 13 + type ComAtprotoServerResetPasswordRequest struct { 14 14 + Token string `json:"token" validate:"required"` 15 15 + Password string `json:"password" validate:"required"` 16 16 + } 17 17 + 18 18 + func (s *Server) handleServerResetPassword(e echo.Context) error { 19 19 + urepo := e.Get("repo").(*models.RepoActor) 20 20 + 21 21 + var req ComAtprotoServerResetPasswordRequest 22 22 + if err := e.Bind(&req); err != nil { 23 23 + s.logger.Error("error binding", "error", err) 24 24 + return helpers.ServerError(e, nil) 25 25 + } 26 26 + 27 27 + if err := e.Validate(req); err != nil { 28 28 + return helpers.InputError(e, nil) 29 29 + } 30 30 + 31 31 + if urepo.PasswordResetCode == nil || urepo.PasswordResetCodeExpiresAt == nil { 32 32 + return helpers.InputError(e, to.StringPtr("InvalidToken")) 33 33 + } 34 34 + 35 35 + if *urepo.PasswordResetCode != req.Token { 36 36 + return helpers.InvalidTokenError(e) 37 37 + } 38 38 + 39 39 + if time.Now().UTC().After(*urepo.PasswordResetCodeExpiresAt) { 40 40 + return helpers.ExpiredTokenError(e) 41 41 + } 42 42 + 43 43 + hash, err := bcrypt.GenerateFromPassword([]byte(req.Password), 10) 44 44 + if err != nil { 45 45 + s.logger.Error("error creating hash", "error", err) 46 46 + return helpers.ServerError(e, nil) 47 47 + } 48 48 + 49 49 + if err := s.db.Exec("UPDATE repos SET password_reset_code = NULL, password_reset_code_expires_at = NULL, password = ? WHERE did = ?", nil, hash, urepo.Repo.Did).Error; err != nil { 50 50 + s.logger.Error("error updating repo", "error", err) 51 51 + return helpers.ServerError(e, nil) 52 52 + } 53 53 + 54 54 + return e.NoContent(200) 55 55 + }

+48

server/handle_server_update_email.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "time" 5 5 + 6 6 + "github.com/haileyok/cocoon/internal/helpers" 7 7 + "github.com/haileyok/cocoon/models" 8 8 + "github.com/labstack/echo/v4" 9 9 + ) 10 10 + 11 11 + type ComAtprotoServerUpdateEmailRequest struct { 12 12 + Email string `json:"email" validate:"required"` 13 13 + EmailAuthFactor bool `json:"emailAuthFactor"` 14 14 + Token string `json:"token" validate:"required"` 15 15 + } 16 16 + 17 17 + func (s *Server) handleServerUpdateEmail(e echo.Context) error { 18 18 + urepo := e.Get("repo").(*models.RepoActor) 19 19 + 20 20 + var req ComAtprotoServerUpdateEmailRequest 21 21 + if err := e.Bind(&req); err != nil { 22 22 + s.logger.Error("error binding", "error", err) 23 23 + return helpers.ServerError(e, nil) 24 24 + } 25 25 + 26 26 + if err := e.Validate(req); err != nil { 27 27 + return helpers.InputError(e, nil) 28 28 + } 29 29 + 30 30 + if urepo.EmailUpdateCode == nil || urepo.EmailUpdateCodeExpiresAt == nil { 31 31 + return helpers.InvalidTokenError(e) 32 32 + } 33 33 + 34 34 + if *urepo.EmailUpdateCode != req.Token { 35 35 + return helpers.InvalidTokenError(e) 36 36 + } 37 37 + 38 38 + if time.Now().UTC().After(*urepo.EmailUpdateCodeExpiresAt) { 39 39 + return helpers.ExpiredTokenError(e) 40 40 + } 41 41 + 42 42 + if err := s.db.Exec("UPDATE repos SET email_update_code = NULL, email_update_code_expires_at = NULL, email_confirmed_at = NULL, email = ? WHERE did = ?", nil, req.Email, urepo.Repo.Did).Error; err != nil { 43 43 + s.logger.Error("error updating repo", "error", err) 44 44 + return helpers.ServerError(e, nil) 45 45 + } 46 46 + 47 47 + return e.NoContent(200) 48 48 + }

+4 -2

server/handle_sync_get_blob.go

··· 26 26 } 27 27 28 28 var blob models.Blob 29 29 - if err := s.db.Raw("SELECT * FROM blobs WHERE did = ? AND cid = ?", did, c.Bytes()).Scan(&blob).Error; err != nil { 29 29 + if err := s.db.Raw("SELECT * FROM blobs WHERE did = ? AND cid = ?", nil, did, c.Bytes()).Scan(&blob).Error; err != nil { 30 30 s.logger.Error("error looking up blob", "error", err) 31 31 return helpers.ServerError(e, nil) 32 32 } ··· 34 34 buf := new(bytes.Buffer) 35 35 36 36 var parts []models.BlobPart 37 37 - if err := s.db.Raw("SELECT * FROM blob_parts WHERE blob_id = ? ORDER BY idx", blob.ID).Scan(&parts).Error; err != nil { 37 37 + if err := s.db.Raw("SELECT * FROM blob_parts WHERE blob_id = ? ORDER BY idx", nil, blob.ID).Scan(&parts).Error; err != nil { 38 38 s.logger.Error("error getting blob parts", "error", err) 39 39 return helpers.ServerError(e, nil) 40 40 } ··· 43 43 for _, p := range parts { 44 44 buf.Write(p.Data) 45 45 } 46 46 + 47 47 + e.Response().Header().Set(echo.HeaderContentDisposition, "attachment; filename="+c.String()) 46 48 47 49 return e.Stream(200, "application/octet-stream", buf) 48 50 }

+1 -2

server/handle_sync_get_blocks.go

··· 6 6 "strings" 7 7 8 8 "github.com/bluesky-social/indigo/carstore" 9 9 - "github.com/haileyok/cocoon/blockstore" 10 9 "github.com/haileyok/cocoon/internal/helpers" 11 10 "github.com/ipfs/go-cid" 12 11 cbor "github.com/ipfs/go-ipld-cbor" ··· 54 53 return helpers.ServerError(e, nil) 55 54 } 56 55 57 57 - bs := blockstore.New(urepo.Repo.Did, s.db) 56 56 + bs := s.getBlockstore(urepo.Repo.Did) 58 57 59 58 for _, c := range cids { 60 59 b, err := bs.Get(context.TODO(), c)

+1 -1

server/handle_sync_get_record.go

··· 18 18 rkey := e.QueryParam("rkey") 19 19 20 20 var urepo models.Repo 21 21 - if err := s.db.Raw("SELECT * FROM repos WHERE did = ?", did).Scan(&urepo).Error; err != nil { 21 21 + if err := s.db.Raw("SELECT * FROM repos WHERE did = ?", nil, did).Scan(&urepo).Error; err != nil { 22 22 s.logger.Error("error getting repo", "error", err) 23 23 return helpers.ServerError(e, nil) 24 24 }

+1 -1

server/handle_sync_get_repo.go

··· 41 41 } 42 42 43 43 var blocks []models.Block 44 44 - if err := s.db.Raw("SELECT * FROM blocks WHERE did = ? ORDER BY rev ASC", urepo.Repo.Did).Scan(&blocks).Error; err != nil { 44 44 + if err := s.db.Raw("SELECT * FROM blocks WHERE did = ? ORDER BY rev ASC", nil, urepo.Repo.Did).Scan(&blocks).Error; err != nil { 45 45 return err 46 46 } 47 47

+1 -1

server/handle_sync_list_blobs.go

··· 35 35 params = append(params, limit) 36 36 37 37 var blobs []models.Blob 38 38 - if err := s.db.Raw("SELECT * FROM blobs WHERE did = ? "+cursorquery+" ORDER BY created_at DESC LIMIT ?", params...).Scan(&blobs).Error; err != nil { 38 38 + if err := s.db.Raw("SELECT * FROM blobs WHERE did = ? "+cursorquery+" ORDER BY created_at DESC LIMIT ?", nil, params...).Scan(&blobs).Error; err != nil { 39 39 s.logger.Error("error getting records", "error", err) 40 40 return helpers.ServerError(e, nil) 41 41 }

+88

server/handle_well_known.go

··· 1 1 package server 2 2 3 3 import ( 4 4 + "fmt" 5 5 + 6 6 + "github.com/Azure/go-autorest/autorest/to" 4 7 "github.com/labstack/echo/v4" 5 8 ) 6 9 10 10 + var ( 11 11 + CocoonSupportedScopes = []string{ 12 12 + "atproto", 13 13 + "transition:email", 14 14 + "transition:generic", 15 15 + "transition:chat.bsky", 16 16 + } 17 17 + ) 18 18 + 19 19 + type OauthAuthorizationMetadata struct { 20 20 + Issuer string `json:"issuer"` 21 21 + RequestParameterSupported bool `json:"request_parameter_supported"` 22 22 + RequestUriParameterSupported bool `json:"request_uri_parameter_supported"` 23 23 + RequireRequestUriRegistration *bool `json:"require_request_uri_registration,omitempty"` 24 24 + ScopesSupported []string `json:"scopes_supported"` 25 25 + SubjectTypesSupported []string `json:"subject_types_supported"` 26 26 + ResponseTypesSupported []string `json:"response_types_supported"` 27 27 + ResponseModesSupported []string `json:"response_modes_supported"` 28 28 + GrantTypesSupported []string `json:"grant_types_supported"` 29 29 + CodeChallengeMethodsSupported []string `json:"code_challenge_methods_supported"` 30 30 + UILocalesSupported []string `json:"ui_locales_supported"` 31 31 + DisplayValuesSupported []string `json:"display_values_supported"` 32 32 + RequestObjectSigningAlgValuesSupported []string `json:"request_object_signing_alg_values_supported"` 33 33 + AuthorizationResponseISSParameterSupported bool `json:"authorization_response_iss_parameter_supported"` 34 34 + RequestObjectEncryptionAlgValuesSupported []string `json:"request_object_encryption_alg_values_supported"` 35 35 + RequestObjectEncryptionEncValuesSupported []string `json:"request_object_encryption_enc_values_supported"` 36 36 + JwksUri string `json:"jwks_uri"` 37 37 + AuthorizationEndpoint string `json:"authorization_endpoint"` 38 38 + TokenEndpoint string `json:"token_endpoint"` 39 39 + TokenEndpointAuthMethodsSupported []string `json:"token_endpoint_auth_methods_supported"` 40 40 + TokenEndpointAuthSigningAlgValuesSupported []string `json:"token_endpoint_auth_signing_alg_values_supported"` 41 41 + RevocationEndpoint string `json:"revocation_endpoint"` 42 42 + IntrospectionEndpoint string `json:"introspection_endpoint"` 43 43 + PushedAuthorizationRequestEndpoint string `json:"pushed_authorization_request_endpoint"` 44 44 + RequirePushedAuthorizationRequests bool `json:"require_pushed_authorization_requests"` 45 45 + DpopSigningAlgValuesSupported []string `json:"dpop_signing_alg_values_supported"` 46 46 + ProtectedResources []string `json:"protected_resources"` 47 47 + ClientIDMetadataDocumentSupported bool `json:"client_id_metadata_document_supported"` 48 48 + } 49 49 + 7 50 func (s *Server) handleWellKnown(e echo.Context) error { 8 51 return e.JSON(200, map[string]any{ 9 52 "@context": []string{ ··· 19 62 }, 20 63 }) 21 64 } 65 65 + 66 66 + func (s *Server) handleOauthProtectedResource(e echo.Context) error { 67 67 + return e.JSON(200, map[string]any{ 68 68 + "resource": "https://" + s.config.Hostname, 69 69 + "authorization_servers": []string{ 70 70 + "https://" + s.config.Hostname, 71 71 + }, 72 72 + "scopes_supported": []string{}, 73 73 + "bearer_methods_supported": []string{"header"}, 74 74 + "resource_documentation": "https://atproto.com", 75 75 + }) 76 76 + } 77 77 + 78 78 + func (s *Server) handleOauthAuthorizationServer(e echo.Context) error { 79 79 + return e.JSON(200, OauthAuthorizationMetadata{ 80 80 + Issuer: "https://" + s.config.Hostname, 81 81 + RequestParameterSupported: true, 82 82 + RequestUriParameterSupported: true, 83 83 + RequireRequestUriRegistration: to.BoolPtr(true), 84 84 + ScopesSupported: CocoonSupportedScopes, 85 85 + SubjectTypesSupported: []string{"public"}, 86 86 + ResponseTypesSupported: []string{"code"}, 87 87 + ResponseModesSupported: []string{"query", "fragment", "form_post"}, 88 88 + GrantTypesSupported: []string{"authorization_code", "refresh_token"}, 89 89 + CodeChallengeMethodsSupported: []string{"S256"}, 90 90 + UILocalesSupported: []string{"en-US"}, 91 91 + DisplayValuesSupported: []string{"page", "popup", "touch"}, 92 92 + RequestObjectSigningAlgValuesSupported: []string{"ES256"}, // only es256 for now... 93 93 + AuthorizationResponseISSParameterSupported: true, 94 94 + RequestObjectEncryptionAlgValuesSupported: []string{}, 95 95 + RequestObjectEncryptionEncValuesSupported: []string{}, 96 96 + JwksUri: fmt.Sprintf("https://%s/oauth/jwks", s.config.Hostname), 97 97 + AuthorizationEndpoint: fmt.Sprintf("https://%s/oauth/authorize", s.config.Hostname), 98 98 + TokenEndpoint: fmt.Sprintf("https://%s/oauth/token", s.config.Hostname), 99 99 + TokenEndpointAuthMethodsSupported: []string{"none", "private_key_jwt"}, 100 100 + TokenEndpointAuthSigningAlgValuesSupported: []string{"ES256"}, // Same as above, just es256 101 101 + RevocationEndpoint: fmt.Sprintf("https://%s/oauth/revoke", s.config.Hostname), 102 102 + IntrospectionEndpoint: fmt.Sprintf("https://%s/oauth/introspect", s.config.Hostname), 103 103 + PushedAuthorizationRequestEndpoint: fmt.Sprintf("https://%s/oauth/par", s.config.Hostname), 104 104 + RequirePushedAuthorizationRequests: true, 105 105 + DpopSigningAlgValuesSupported: []string{"ES256"}, // again same as above 106 106 + ProtectedResources: []string{"https://" + s.config.Hostname}, 107 107 + ClientIDMetadataDocumentSupported: true, 108 108 + }) 109 109 + }

+33 -2

server/mail.go

··· 3 3 import "fmt" 4 4 5 5 func (s *Server) sendWelcomeMail(email, handle string) error { 6 6 + if s.mail == nil { 7 7 + return nil 8 8 + } 9 9 + 6 10 s.mailLk.Lock() 7 11 defer s.mailLk.Unlock() 8 12 ··· 18 22 } 19 23 20 24 func (s *Server) sendPasswordReset(email, handle, code string) error { 25 25 + if s.mail == nil { 26 26 + return nil 27 27 + } 28 28 + 21 29 s.mailLk.Lock() 22 30 defer s.mailLk.Unlock() 23 31 24 32 s.mail.To(email) 25 33 s.mail.Subject("Password reset for " + s.config.Hostname) 26 26 - s.mail.Plain().Set(fmt.Sprintf("Hello %s. Your password reset code is %s.", handle, code)) 34 34 + s.mail.Plain().Set(fmt.Sprintf("Hello %s. Your password reset code is %s. This code will expire in ten minutes.", handle, code)) 35 35 + 36 36 + if err := s.mail.Send(); err != nil { 37 37 + return err 38 38 + } 39 39 + 40 40 + return nil 41 41 + } 42 42 + 43 43 + func (s *Server) sendEmailUpdate(email, handle, code string) error { 44 44 + if s.mail == nil { 45 45 + return nil 46 46 + } 47 47 + 48 48 + s.mailLk.Lock() 49 49 + defer s.mailLk.Unlock() 50 50 + 51 51 + s.mail.To(email) 52 52 + s.mail.Subject("Email update for " + s.config.Hostname) 53 53 + s.mail.Plain().Set(fmt.Sprintf("Hello %s. Your email update code is %s. This code will expire in ten minutes.", handle, code)) 27 54 28 55 if err := s.mail.Send(); err != nil { 29 56 return err ··· 33 60 } 34 61 35 62 func (s *Server) sendEmailVerification(email, handle, code string) error { 63 63 + if s.mail == nil { 64 64 + return nil 65 65 + } 66 66 + 36 67 s.mailLk.Lock() 37 68 defer s.mailLk.Unlock() 38 69 39 70 s.mail.To(email) 40 71 s.mail.Subject("Email verification for " + s.config.Hostname) 41 41 - s.mail.Plain().Set(fmt.Sprintf("Hello %s. Your email verification code is %s", handle, code)) 72 72 + s.mail.Plain().Set(fmt.Sprintf("Hello %s. Your email verification code is %s. This code will expire in ten minutes.", handle, code)) 42 73 43 74 if err := s.mail.Send(); err != nil { 44 75 return err

+268

server/middleware.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "crypto/sha256" 5 5 + "encoding/base64" 6 6 + "fmt" 7 7 + "strings" 8 8 + "time" 9 9 + 10 10 + "github.com/Azure/go-autorest/autorest/to" 11 11 + "github.com/golang-jwt/jwt/v4" 12 12 + "github.com/haileyok/cocoon/internal/helpers" 13 13 + "github.com/haileyok/cocoon/models" 14 14 + "github.com/haileyok/cocoon/oauth/provider" 15 15 + "github.com/labstack/echo/v4" 16 16 + "gitlab.com/yawning/secp256k1-voi" 17 17 + secp256k1secec "gitlab.com/yawning/secp256k1-voi/secec" 18 18 + "gorm.io/gorm" 19 19 + ) 20 20 + 21 21 + func (s *Server) handleAdminMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 22 22 + return func(e echo.Context) error { 23 23 + username, password, ok := e.Request().BasicAuth() 24 24 + if !ok || username != "admin" || password != s.config.AdminPassword { 25 25 + return helpers.InputError(e, to.StringPtr("Unauthorized")) 26 26 + } 27 27 + 28 28 + if err := next(e); err != nil { 29 29 + e.Error(err) 30 30 + } 31 31 + 32 32 + return nil 33 33 + } 34 34 + } 35 35 + 36 36 + func (s *Server) handleLegacySessionMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 37 37 + return func(e echo.Context) error { 38 38 + authheader := e.Request().Header.Get("authorization") 39 39 + if authheader == "" { 40 40 + return e.JSON(401, map[string]string{"error": "Unauthorized"}) 41 41 + } 42 42 + 43 43 + pts := strings.Split(authheader, " ") 44 44 + if len(pts) != 2 { 45 45 + return helpers.ServerError(e, nil) 46 46 + } 47 47 + 48 48 + // move on to oauth session middleware if this is a dpop token 49 49 + if pts[0] == "DPoP" { 50 50 + return next(e) 51 51 + } 52 52 + 53 53 + tokenstr := pts[1] 54 54 + token, _, err := new(jwt.Parser).ParseUnverified(tokenstr, jwt.MapClaims{}) 55 55 + claims, ok := token.Claims.(jwt.MapClaims) 56 56 + if !ok { 57 57 + return helpers.InvalidTokenError(e) 58 58 + } 59 59 + 60 60 + var did string 61 61 + var repo *models.RepoActor 62 62 + 63 63 + // service auth tokens 64 64 + lxm, hasLxm := claims["lxm"] 65 65 + if hasLxm { 66 66 + pts := strings.Split(e.Request().URL.String(), "/") 67 67 + if lxm != pts[len(pts)-1] { 68 68 + s.logger.Error("service auth lxm incorrect", "lxm", lxm, "expected", pts[len(pts)-1], "error", err) 69 69 + return helpers.InputError(e, nil) 70 70 + } 71 71 + 72 72 + maybeDid, ok := claims["iss"].(string) 73 73 + if !ok { 74 74 + s.logger.Error("no iss in service auth token", "error", err) 75 75 + return helpers.InputError(e, nil) 76 76 + } 77 77 + did = maybeDid 78 78 + 79 79 + maybeRepo, err := s.getRepoActorByDid(did) 80 80 + if err != nil { 81 81 + s.logger.Error("error fetching repo", "error", err) 82 82 + return helpers.ServerError(e, nil) 83 83 + } 84 84 + repo = maybeRepo 85 85 + } 86 86 + 87 87 + if token.Header["alg"] != "ES256K" { 88 88 + token, err = new(jwt.Parser).Parse(tokenstr, func(t *jwt.Token) (any, error) { 89 89 + if _, ok := t.Method.(*jwt.SigningMethodECDSA); !ok { 90 90 + return nil, fmt.Errorf("unsupported signing method: %v", t.Header["alg"]) 91 91 + } 92 92 + return s.privateKey.Public(), nil 93 93 + }) 94 94 + if err != nil { 95 95 + s.logger.Error("error parsing jwt", "error", err) 96 96 + return helpers.ExpiredTokenError(e) 97 97 + } 98 98 + 99 99 + if !token.Valid { 100 100 + return helpers.InvalidTokenError(e) 101 101 + } 102 102 + } else { 103 103 + kpts := strings.Split(tokenstr, ".") 104 104 + signingInput := kpts[0] + "." + kpts[1] 105 105 + hash := sha256.Sum256([]byte(signingInput)) 106 106 + sigBytes, err := base64.RawURLEncoding.DecodeString(kpts[2]) 107 107 + if err != nil { 108 108 + s.logger.Error("error decoding signature bytes", "error", err) 109 109 + return helpers.ServerError(e, nil) 110 110 + } 111 111 + 112 112 + if len(sigBytes) != 64 { 113 113 + s.logger.Error("incorrect sigbytes length", "length", len(sigBytes)) 114 114 + return helpers.ServerError(e, nil) 115 115 + } 116 116 + 117 117 + rBytes := sigBytes[:32] 118 118 + sBytes := sigBytes[32:] 119 119 + rr, _ := secp256k1.NewScalarFromBytes((*[32]byte)(rBytes)) 120 120 + ss, _ := secp256k1.NewScalarFromBytes((*[32]byte)(sBytes)) 121 121 + 122 122 + sk, err := secp256k1secec.NewPrivateKey(repo.SigningKey) 123 123 + if err != nil { 124 124 + s.logger.Error("can't load private key", "error", err) 125 125 + return err 126 126 + } 127 127 + 128 128 + pubKey, ok := sk.Public().(*secp256k1secec.PublicKey) 129 129 + if !ok { 130 130 + s.logger.Error("error getting public key from sk") 131 131 + return helpers.ServerError(e, nil) 132 132 + } 133 133 + 134 134 + verified := pubKey.VerifyRaw(hash[:], rr, ss) 135 135 + if !verified { 136 136 + s.logger.Error("error verifying", "error", err) 137 137 + return helpers.ServerError(e, nil) 138 138 + } 139 139 + } 140 140 + 141 141 + isRefresh := e.Request().URL.Path == "/xrpc/com.atproto.server.refreshSession" 142 142 + scope, _ := claims["scope"].(string) 143 143 + 144 144 + if isRefresh && scope != "com.atproto.refresh" { 145 145 + return helpers.InvalidTokenError(e) 146 146 + } else if !hasLxm && !isRefresh && scope != "com.atproto.access" { 147 147 + return helpers.InvalidTokenError(e) 148 148 + } 149 149 + 150 150 + table := "tokens" 151 151 + if isRefresh { 152 152 + table = "refresh_tokens" 153 153 + } 154 154 + 155 155 + if isRefresh { 156 156 + type Result struct { 157 157 + Found bool 158 158 + } 159 159 + var result Result 160 160 + if err := s.db.Raw("SELECT EXISTS(SELECT 1 FROM "+table+" WHERE token = ?) AS found", nil, tokenstr).Scan(&result).Error; err != nil { 161 161 + if err == gorm.ErrRecordNotFound { 162 162 + return helpers.InvalidTokenError(e) 163 163 + } 164 164 + 165 165 + s.logger.Error("error getting token from db", "error", err) 166 166 + return helpers.ServerError(e, nil) 167 167 + } 168 168 + 169 169 + if !result.Found { 170 170 + return helpers.InvalidTokenError(e) 171 171 + } 172 172 + } 173 173 + 174 174 + exp, ok := claims["exp"].(float64) 175 175 + if !ok { 176 176 + s.logger.Error("error getting iat from token") 177 177 + return helpers.ServerError(e, nil) 178 178 + } 179 179 + 180 180 + if exp < float64(time.Now().UTC().Unix()) { 181 181 + return helpers.ExpiredTokenError(e) 182 182 + } 183 183 + 184 184 + if repo == nil { 185 185 + maybeRepo, err := s.getRepoActorByDid(claims["sub"].(string)) 186 186 + if err != nil { 187 187 + s.logger.Error("error fetching repo", "error", err) 188 188 + return helpers.ServerError(e, nil) 189 189 + } 190 190 + repo = maybeRepo 191 191 + did = repo.Repo.Did 192 192 + } 193 193 + 194 194 + e.Set("repo", repo) 195 195 + e.Set("did", did) 196 196 + e.Set("token", tokenstr) 197 197 + 198 198 + if err := next(e); err != nil { 199 199 + return helpers.InvalidTokenError(e) 200 200 + } 201 201 + 202 202 + return nil 203 203 + } 204 204 + } 205 205 + 206 206 + func (s *Server) handleOauthSessionMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 207 207 + return func(e echo.Context) error { 208 208 + authheader := e.Request().Header.Get("authorization") 209 209 + if authheader == "" { 210 210 + return e.JSON(401, map[string]string{"error": "Unauthorized"}) 211 211 + } 212 212 + 213 213 + pts := strings.Split(authheader, " ") 214 214 + if len(pts) != 2 { 215 215 + return helpers.ServerError(e, nil) 216 216 + } 217 217 + 218 218 + if pts[0] != "DPoP" { 219 219 + return next(e) 220 220 + } 221 221 + 222 222 + accessToken := pts[1] 223 223 + 224 224 + nonce := s.oauthProvider.NextNonce() 225 225 + if nonce != "" { 226 226 + e.Response().Header().Set("DPoP-Nonce", nonce) 227 227 + e.Response().Header().Add("access-control-expose-headers", "DPoP-Nonce") 228 228 + } 229 229 + 230 230 + proof, err := s.oauthProvider.DpopManager.CheckProof(e.Request().Method, "https://"+s.config.Hostname+e.Request().URL.String(), e.Request().Header, to.StringPtr(accessToken)) 231 231 + if err != nil { 232 232 + s.logger.Error("invalid dpop proof", "error", err) 233 233 + return helpers.InputError(e, to.StringPtr(err.Error())) 234 234 + } 235 235 + 236 236 + var oauthToken provider.OauthToken 237 237 + if err := s.db.Raw("SELECT * FROM oauth_tokens WHERE token = ?", nil, accessToken).Scan(&oauthToken).Error; err != nil { 238 238 + s.logger.Error("error finding access token in db", "error", err) 239 239 + return helpers.InputError(e, nil) 240 240 + } 241 241 + 242 242 + if oauthToken.Token == "" { 243 243 + return helpers.InvalidTokenError(e) 244 244 + } 245 245 + 246 246 + if *oauthToken.Parameters.DpopJkt != proof.JKT { 247 247 + s.logger.Error("jkt mismatch", "token", oauthToken.Parameters.DpopJkt, "proof", proof.JKT) 248 248 + return helpers.InputError(e, to.StringPtr("dpop jkt mismatch")) 249 249 + } 250 250 + 251 251 + if time.Now().After(oauthToken.ExpiresAt) { 252 252 + return helpers.ExpiredTokenError(e) 253 253 + } 254 254 + 255 255 + repo, err := s.getRepoActorByDid(oauthToken.Sub) 256 256 + if err != nil { 257 257 + s.logger.Error("could not find actor in db", "error", err) 258 258 + return helpers.ServerError(e, nil) 259 259 + } 260 260 + 261 261 + e.Set("repo", repo) 262 262 + e.Set("did", repo.Repo.Did) 263 263 + e.Set("token", accessToken) 264 264 + e.Set("scopes", strings.Split(oauthToken.Parameters.Scope, " ")) 265 265 + 266 266 + return next(e) 267 267 + } 268 268 + }

+144 -50

server/repo.go

··· 3 3 import ( 4 4 "bytes" 5 5 "context" 6 6 + "encoding/json" 6 7 "fmt" 7 8 "io" 8 9 "time" ··· 15 16 "github.com/bluesky-social/indigo/events" 16 17 lexutil "github.com/bluesky-social/indigo/lex/util" 17 18 "github.com/bluesky-social/indigo/repo" 18 18 - "github.com/bluesky-social/indigo/util" 19 19 - "github.com/haileyok/cocoon/blockstore" 19 19 + "github.com/haileyok/cocoon/internal/db" 20 20 "github.com/haileyok/cocoon/models" 21 21 + "github.com/haileyok/cocoon/recording_blockstore" 21 22 blocks "github.com/ipfs/go-block-format" 22 23 "github.com/ipfs/go-cid" 23 24 cbor "github.com/ipfs/go-ipld-cbor" 24 25 "github.com/ipld/go-car" 25 25 - "gorm.io/gorm" 26 26 "gorm.io/gorm/clause" 27 27 ) 28 28 29 29 type RepoMan struct { 30 30 - db *gorm.DB 30 30 + db *db.DB 31 31 s *Server 32 32 clock *syntax.TIDClock 33 33 } ··· 51 51 ) 52 52 53 53 func (ot OpType) String() string { 54 54 - return ot.String() 54 54 + return string(ot) 55 55 } 56 56 57 57 type Op struct { ··· 83 83 } 84 84 85 85 type ApplyWriteResult struct { 86 86 - Uri string `json:"uri"` 87 87 - Cid string `json:"cid"` 88 88 - Commit *RepoCommit `json:"commit"` 89 89 - ValidationStatus *string `json:"validationStatus"` 86 86 + Type *string `json:"$type,omitempty"` 87 87 + Uri *string `json:"uri,omitempty"` 88 88 + Cid *string `json:"cid,omitempty"` 89 89 + Commit *RepoCommit `json:"commit,omitempty"` 90 90 + ValidationStatus *string `json:"validationStatus,omitempty"` 90 91 } 91 92 92 93 type RepoCommit struct { ··· 101 102 return nil, err 102 103 } 103 104 104 104 - dbs := blockstore.New(urepo.Did, rm.db) 105 105 + dbs := rm.s.getBlockstore(urepo.Did) 106 106 + bs := recording_blockstore.New(dbs) 105 107 r, err := repo.OpenRepo(context.TODO(), dbs, rootcid) 106 108 107 109 entries := []models.Record{} 110 110 + var results []ApplyWriteResult 108 111 109 112 for i, op := range writes { 110 113 if op.Type != OpTypeCreate && op.Rkey == nil { 111 114 return nil, fmt.Errorf("invalid rkey") 115 115 + } else if op.Type == OpTypeCreate && op.Rkey != nil { 116 116 + _, _, err := r.GetRecord(context.TODO(), op.Collection+"/"+*op.Rkey) 117 117 + if err == nil { 118 118 + op.Type = OpTypeUpdate 119 119 + } 112 120 } else if op.Rkey == nil { 113 121 op.Rkey = to.StringPtr(rm.clock.Next().String()) 114 122 writes[i].Rkey = op.Rkey ··· 121 129 122 130 switch op.Type { 123 131 case OpTypeCreate: 124 124 - nc, err := r.PutRecord(context.TODO(), op.Collection+"/"+*op.Rkey, op.Record) 132 132 + j, err := json.Marshal(*op.Record) 133 133 + if err != nil { 134 134 + return nil, err 135 135 + } 136 136 + out, err := data.UnmarshalJSON(j) 125 137 if err != nil { 126 138 return nil, err 127 139 } 128 128 - 129 129 - d, _ := data.MarshalCBOR(*op.Record) 140 140 + mm := MarshalableMap(out) 141 141 + nc, err := r.PutRecord(context.TODO(), op.Collection+"/"+*op.Rkey, &mm) 142 142 + if err != nil { 143 143 + return nil, err 144 144 + } 145 145 + d, err := data.MarshalCBOR(mm) 146 146 + if err != nil { 147 147 + return nil, err 148 148 + } 130 149 entries = append(entries, models.Record{ 131 150 Did: urepo.Did, 132 151 CreatedAt: rm.clock.Next().String(), ··· 135 154 Cid: nc.String(), 136 155 Value: d, 137 156 }) 157 157 + results = append(results, ApplyWriteResult{ 158 158 + Type: to.StringPtr(OpTypeCreate.String()), 159 159 + Uri: to.StringPtr("at://" + urepo.Did + "/" + op.Collection + "/" + *op.Rkey), 160 160 + Cid: to.StringPtr(nc.String()), 161 161 + ValidationStatus: to.StringPtr("valid"), // TODO: obviously this might not be true atm lol 162 162 + }) 138 163 case OpTypeDelete: 164 164 + var old models.Record 165 165 + if err := rm.db.Raw("SELECT value FROM records WHERE did = ? AND nsid = ? AND rkey = ?", nil, urepo.Did, op.Collection, op.Rkey).Scan(&old).Error; err != nil { 166 166 + return nil, err 167 167 + } 168 168 + entries = append(entries, models.Record{ 169 169 + Did: urepo.Did, 170 170 + Nsid: op.Collection, 171 171 + Rkey: *op.Rkey, 172 172 + Value: old.Value, 173 173 + }) 139 174 err := r.DeleteRecord(context.TODO(), op.Collection+"/"+*op.Rkey) 140 175 if err != nil { 141 176 return nil, err 142 177 } 178 178 + results = append(results, ApplyWriteResult{ 179 179 + Type: to.StringPtr(OpTypeDelete.String()), 180 180 + }) 143 181 case OpTypeUpdate: 144 144 - nc, err := r.UpdateRecord(context.TODO(), op.Collection+"/"+*op.Rkey, op.Record) 182 182 + j, err := json.Marshal(*op.Record) 145 183 if err != nil { 146 184 return nil, err 147 185 } 148 148 - 149 149 - d, _ := data.MarshalCBOR(*op.Record) 186 186 + out, err := data.UnmarshalJSON(j) 187 187 + if err != nil { 188 188 + return nil, err 189 189 + } 190 190 + mm := MarshalableMap(out) 191 191 + nc, err := r.UpdateRecord(context.TODO(), op.Collection+"/"+*op.Rkey, &mm) 192 192 + if err != nil { 193 193 + return nil, err 194 194 + } 195 195 + d, err := data.MarshalCBOR(mm) 196 196 + if err != nil { 197 197 + return nil, err 198 198 + } 150 199 entries = append(entries, models.Record{ 151 200 Did: urepo.Did, 152 201 CreatedAt: rm.clock.Next().String(), ··· 155 204 Cid: nc.String(), 156 205 Value: d, 157 206 }) 207 207 + results = append(results, ApplyWriteResult{ 208 208 + Type: to.StringPtr(OpTypeUpdate.String()), 209 209 + Uri: to.StringPtr("at://" + urepo.Did + "/" + op.Collection + "/" + *op.Rkey), 210 210 + Cid: to.StringPtr(nc.String()), 211 211 + ValidationStatus: to.StringPtr("valid"), // TODO: obviously this might not be true atm lol 212 212 + }) 158 213 } 159 214 } 160 215 ··· 182 237 ops := make([]*atproto.SyncSubscribeRepos_RepoOp, 0, len(diffops)) 183 238 184 239 for _, op := range diffops { 240 240 + var c cid.Cid 185 241 switch op.Op { 186 242 case "add", "mut": 187 243 kind := "create" ··· 189 245 kind = "update" 190 246 } 191 247 248 248 + c = op.NewCid 192 249 ll := lexutil.LexLink(op.NewCid) 193 250 ops = append(ops, &atproto.SyncSubscribeRepos_RepoOp{ 194 251 Action: kind, ··· 197 254 }) 198 255 199 256 case "del": 257 257 + c = op.OldCid 258 258 + ll := lexutil.LexLink(op.OldCid) 200 259 ops = append(ops, &atproto.SyncSubscribeRepos_RepoOp{ 201 260 Action: "delete", 202 261 Path: op.Rpath, 203 262 Cid: nil, 263 263 + Prev: &ll, 204 264 }) 205 265 } 206 266 207 207 - blk, err := dbs.Get(context.TODO(), op.NewCid) 267 267 + blk, err := dbs.Get(context.TODO(), c) 208 268 if err != nil { 209 269 return nil, err 210 270 } ··· 214 274 } 215 275 } 216 276 217 217 - for _, op := range dbs.GetLog() { 277 277 + for _, op := range bs.GetLogMap() { 218 278 if _, err := carstore.LdWrite(buf, op.Cid().Bytes(), op.RawData()); err != nil { 219 279 return nil, err 220 280 } 221 281 } 222 282 223 223 - var results []ApplyWriteResult 224 224 - 225 283 var blobs []lexutil.LexLink 226 284 for _, entry := range entries { 227 227 - if err := rm.s.db.Clauses(clause.OnConflict{ 228 228 - Columns: []clause.Column{{Name: "did"}, {Name: "nsid"}, {Name: "rkey"}}, 229 229 - UpdateAll: true, 230 230 - }).Create(&entry).Error; err != nil { 231 231 - return nil, err 232 232 - } 285 285 + var cids []cid.Cid 286 286 + if entry.Cid != "" { 287 287 + if err := rm.s.db.Create(&entry, []clause.Expression{clause.OnConflict{ 288 288 + Columns: []clause.Column{{Name: "did"}, {Name: "nsid"}, {Name: "rkey"}}, 289 289 + UpdateAll: true, 290 290 + }}).Error; err != nil { 291 291 + return nil, err 292 292 + } 233 293 234 234 - // we should actually check the type (i.e. delete, create,., update) here but we'll do it later 235 235 - cids, err := rm.incrementBlobRefs(urepo, entry.Value) 236 236 - if err != nil { 237 237 - return nil, err 294 294 + cids, err = rm.incrementBlobRefs(urepo, entry.Value) 295 295 + if err != nil { 296 296 + return nil, err 297 297 + } 298 298 + } else { 299 299 + if err := rm.s.db.Delete(&entry, nil).Error; err != nil { 300 300 + return nil, err 301 301 + } 302 302 + cids, err = rm.decrementBlobRefs(urepo, entry.Value) 303 303 + if err != nil { 304 304 + return nil, err 305 305 + } 238 306 } 239 307 240 308 for _, c := range cids { 241 309 blobs = append(blobs, lexutil.LexLink(c)) 242 310 } 243 243 - 244 244 - results = append(results, ApplyWriteResult{ 245 245 - Uri: "at://" + urepo.Did + "/" + entry.Nsid + "/" + entry.Rkey, 246 246 - Cid: entry.Cid, 247 247 - Commit: &RepoCommit{ 248 248 - Cid: newroot.String(), 249 249 - Rev: rev, 250 250 - }, 251 251 - ValidationStatus: to.StringPtr("valid"), // TODO: obviously this might not be true atm lol 252 252 - }) 253 311 } 254 312 255 313 rm.s.evtman.AddEvent(context.TODO(), &events.XRPCStreamEvent{ ··· 260 318 Rev: rev, 261 319 Since: &urepo.Rev, 262 320 Commit: lexutil.LexLink(newroot), 263 263 - Time: time.Now().Format(util.ISO8601), 321 321 + Time: time.Now().Format(time.RFC3339Nano), 264 322 Ops: ops, 265 323 TooBig: false, 266 324 }, 267 325 }) 268 326 269 269 - if err := dbs.UpdateRepo(context.TODO(), newroot, rev); err != nil { 327 327 + if err := rm.s.UpdateRepo(context.TODO(), urepo.Did, newroot, rev); err != nil { 270 328 return nil, err 271 329 } 272 330 331 331 + for i := range results { 332 332 + results[i].Type = to.StringPtr(*results[i].Type + "Result") 333 333 + results[i].Commit = &RepoCommit{ 334 334 + Cid: newroot.String(), 335 335 + Rev: rev, 336 336 + } 337 337 + } 338 338 + 273 339 return results, nil 274 340 } 275 341 ··· 279 345 return cid.Undef, nil, err 280 346 } 281 347 282 282 - dbs := blockstore.New(urepo.Did, rm.db) 283 283 - bs := util.NewLoggingBstore(dbs) 348 348 + dbs := rm.s.getBlockstore(urepo.Did) 349 349 + bs := recording_blockstore.New(dbs) 284 350 285 351 r, err := repo.OpenRepo(context.TODO(), bs, c) 286 352 if err != nil { ··· 292 358 return cid.Undef, nil, err 293 359 } 294 360 295 295 - return c, bs.GetLoggedBlocks(), nil 361 361 + return c, bs.GetLogArray(), nil 296 362 } 297 363 298 364 func (rm *RepoMan) incrementBlobRefs(urepo models.Repo, cbor []byte) ([]cid.Cid, error) { ··· 302 368 } 303 369 304 370 for _, c := range cids { 305 305 - if err := rm.db.Exec("UPDATE blobs SET ref_count = ref_count + 1 WHERE did = ? AND cid = ?", urepo.Did, c.Bytes()).Error; err != nil { 371 371 + if err := rm.db.Exec("UPDATE blobs SET ref_count = ref_count + 1 WHERE did = ? AND cid = ?", nil, urepo.Did, c.Bytes()).Error; err != nil { 306 372 return nil, err 307 373 } 308 374 } ··· 310 376 return cids, nil 311 377 } 312 378 379 379 + func (rm *RepoMan) decrementBlobRefs(urepo models.Repo, cbor []byte) ([]cid.Cid, error) { 380 380 + cids, err := getBlobCidsFromCbor(cbor) 381 381 + if err != nil { 382 382 + return nil, err 383 383 + } 384 384 + 385 385 + for _, c := range cids { 386 386 + var res struct { 387 387 + ID uint 388 388 + Count int 389 389 + } 390 390 + if err := rm.db.Raw("UPDATE blobs SET ref_count = ref_count - 1 WHERE did = ? AND cid = ? RETURNING id, ref_count", nil, urepo.Did, c.Bytes()).Scan(&res).Error; err != nil { 391 391 + return nil, err 392 392 + } 393 393 + 394 394 + if res.Count == 0 { 395 395 + if err := rm.db.Exec("DELETE FROM blobs WHERE id = ?", nil, res.ID).Error; err != nil { 396 396 + return nil, err 397 397 + } 398 398 + if err := rm.db.Exec("DELETE FROM blob_parts WHERE blob_id = ?", nil, res.ID).Error; err != nil { 399 399 + return nil, err 400 400 + } 401 401 + } 402 402 + } 403 403 + 404 404 + return cids, nil 405 405 + } 406 406 + 313 407 // to be honest, we could just store both the cbor and non-cbor in []entries above to avoid an additional 314 408 // unmarshal here. this will work for now though 315 409 func getBlobCidsFromCbor(cbor []byte) ([]cid.Cid, error) { ··· 320 414 return nil, fmt.Errorf("error unmarshaling cbor: %w", err) 321 415 } 322 416 323 323 - var deepiter func(interface{}) error 324 324 - deepiter = func(item interface{}) error { 417 417 + var deepiter func(any) error 418 418 + deepiter = func(item any) error { 325 419 switch val := item.(type) { 326 326 - case map[string]interface{}: 420 420 + case map[string]any: 327 421 if val["$type"] == "blob" { 328 422 if ref, ok := val["ref"].(string); ok { 329 423 c, err := cid.Parse(ref) ··· 336 430 return deepiter(v) 337 431 } 338 432 } 339 339 - case []interface{}: 433 433 + case []any: 340 434 for _, v := range val { 341 435 deepiter(v) 342 436 }

+346 -129

server/server.go

··· 1 1 package server 2 2 3 3 import ( 4 4 + "bytes" 4 5 "context" 5 6 "crypto/ecdsa" 7 7 + "embed" 6 8 "errors" 7 9 "fmt" 10 10 + "io" 8 11 "log/slog" 9 12 "net/http" 10 13 "net/smtp" 11 14 "os" 12 12 - "strings" 15 15 + "path/filepath" 13 16 "sync" 17 17 + "text/template" 14 18 "time" 15 19 16 16 - "github.com/Azure/go-autorest/autorest/to" 20 20 + "github.com/aws/aws-sdk-go/aws" 21 21 + "github.com/aws/aws-sdk-go/aws/credentials" 22 22 + "github.com/aws/aws-sdk-go/aws/session" 23 23 + "github.com/aws/aws-sdk-go/service/s3" 17 24 "github.com/bluesky-social/indigo/api/atproto" 18 25 "github.com/bluesky-social/indigo/atproto/syntax" 19 26 "github.com/bluesky-social/indigo/events" ··· 21 28 "github.com/bluesky-social/indigo/xrpc" 22 29 "github.com/domodwyer/mailyak/v3" 23 30 "github.com/go-playground/validator" 24 24 - "github.com/golang-jwt/jwt/v4" 31 31 + "github.com/gorilla/sessions" 25 32 "github.com/haileyok/cocoon/identity" 33 33 + "github.com/haileyok/cocoon/internal/db" 26 34 "github.com/haileyok/cocoon/internal/helpers" 27 35 "github.com/haileyok/cocoon/models" 36 36 + "github.com/haileyok/cocoon/oauth/client" 37 37 + "github.com/haileyok/cocoon/oauth/constants" 38 38 + "github.com/haileyok/cocoon/oauth/dpop" 39 39 + "github.com/haileyok/cocoon/oauth/provider" 28 40 "github.com/haileyok/cocoon/plc" 41 41 + "github.com/ipfs/go-cid" 42 42 + echo_session "github.com/labstack/echo-contrib/session" 29 43 "github.com/labstack/echo/v4" 30 44 "github.com/labstack/echo/v4/middleware" 31 31 - "github.com/lestrrat-go/jwx/v2/jwk" 32 45 slogecho "github.com/samber/slog-echo" 33 46 "gorm.io/driver/sqlite" 34 47 "gorm.io/gorm" 35 48 ) 36 49 50 50 + const ( 51 51 + AccountSessionMaxAge = 30 * 24 * time.Hour // one week 52 52 + ) 53 53 + 54 54 + type S3Config struct { 55 55 + BackupsEnabled bool 56 56 + Endpoint string 57 57 + Region string 58 58 + Bucket string 59 59 + AccessKey string 60 60 + SecretKey string 61 61 + } 62 62 + 37 63 type Server struct { 38 38 - http *http.Client 39 39 - httpd *http.Server 40 40 - mail *mailyak.MailYak 41 41 - mailLk *sync.Mutex 42 42 - echo *echo.Echo 43 43 - db *gorm.DB 44 44 - plcClient *plc.Client 45 45 - logger *slog.Logger 46 46 - config *config 47 47 - privateKey *ecdsa.PrivateKey 48 48 - repoman *RepoMan 49 49 - evtman *events.EventManager 50 50 - passport *identity.Passport 64 64 + http *http.Client 65 65 + httpd *http.Server 66 66 + mail *mailyak.MailYak 67 67 + mailLk *sync.Mutex 68 68 + echo *echo.Echo 69 69 + db *db.DB 70 70 + plcClient *plc.Client 71 71 + logger *slog.Logger 72 72 + config *config 73 73 + privateKey *ecdsa.PrivateKey 74 74 + repoman *RepoMan 75 75 + oauthProvider *provider.Provider 76 76 + evtman *events.EventManager 77 77 + passport *identity.Passport 78 78 + 79 79 + dbName string 80 80 + s3Config *S3Config 51 81 } 52 82 53 83 type Args struct { ··· 61 91 JwkPath string 62 92 ContactEmail string 63 93 Relays []string 94 94 + AdminPassword string 64 95 65 96 SmtpUser string 66 97 SmtpPass string ··· 68 99 SmtpPort string 69 100 SmtpEmail string 70 101 SmtpName string 102 102 + 103 103 + S3Config *S3Config 104 104 + 105 105 + SessionSecret string 106 106 + 107 107 + DefaultAtprotoProxy string 108 108 + 109 109 + BlockstoreVariant BlockstoreVariant 71 110 } 72 111 73 112 type config struct { 74 74 - Version string 75 75 - Did string 76 76 - Hostname string 77 77 - ContactEmail string 78 78 - EnforcePeering bool 79 79 - Relays []string 80 80 - SmtpEmail string 81 81 - SmtpName string 113 113 + Version string 114 114 + Did string 115 115 + Hostname string 116 116 + ContactEmail string 117 117 + EnforcePeering bool 118 118 + Relays []string 119 119 + AdminPassword string 120 120 + SmtpEmail string 121 121 + SmtpName string 122 122 + DefaultAtprotoProxy string 123 123 + BlockstoreVariant BlockstoreVariant 82 124 } 83 125 84 126 type CustomValidator struct { ··· 109 151 return nil 110 152 } 111 153 112 112 - func (s *Server) handleSessionMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 113 113 - return func(e echo.Context) error { 114 114 - authheader := e.Request().Header.Get("authorization") 115 115 - if authheader == "" { 116 116 - return e.JSON(401, map[string]string{"error": "Unauthorized"}) 117 117 - } 118 118 - 119 119 - pts := strings.Split(authheader, " ") 120 120 - if len(pts) != 2 { 121 121 - return helpers.ServerError(e, nil) 122 122 - } 123 123 - 124 124 - tokenstr := pts[1] 125 125 - 126 126 - token, err := new(jwt.Parser).Parse(tokenstr, func(t *jwt.Token) (any, error) { 127 127 - if _, ok := t.Method.(*jwt.SigningMethodECDSA); !ok { 128 128 - return nil, fmt.Errorf("unsupported signing method: %v", t.Header["alg"]) 129 129 - } 130 130 - 131 131 - return s.privateKey.Public(), nil 132 132 - }) 133 133 - if err != nil { 134 134 - s.logger.Error("error parsing jwt", "error", err) 135 135 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 136 136 - } 137 137 - 138 138 - claims, ok := token.Claims.(jwt.MapClaims) 139 139 - if !ok || !token.Valid { 140 140 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 141 141 - } 142 142 - 143 143 - isRefresh := e.Request().URL.Path == "/xrpc/com.atproto.server.refreshSession" 144 144 - scope := claims["scope"].(string) 154 154 + //go:embed templates/* 155 155 + var templateFS embed.FS 145 156 146 146 - if isRefresh && scope != "com.atproto.refresh" { 147 147 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 148 148 - } else if !isRefresh && scope != "com.atproto.access" { 149 149 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 150 150 - } 151 151 - 152 152 - table := "tokens" 153 153 - if isRefresh { 154 154 - table = "refresh_tokens" 155 155 - } 157 157 + //go:embed static/* 158 158 + var staticFS embed.FS 156 159 157 157 - type Result struct { 158 158 - Found bool 159 159 - } 160 160 - var result Result 161 161 - if err := s.db.Raw("SELECT EXISTS(SELECT 1 FROM "+table+" WHERE token = ?) AS found", tokenstr).Scan(&result).Error; err != nil { 162 162 - if err == gorm.ErrRecordNotFound { 163 163 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 164 164 - } 160 160 + type TemplateRenderer struct { 161 161 + templates *template.Template 162 162 + isDev bool 163 163 + templatePath string 164 164 + } 165 165 166 166 - s.logger.Error("error getting token from db", "error", err) 167 167 - return helpers.ServerError(e, nil) 166 166 + func (s *Server) loadTemplates() { 167 167 + absPath, _ := filepath.Abs("server/templates/*.html") 168 168 + if s.config.Version == "dev" { 169 169 + tmpl := template.Must(template.ParseGlob(absPath)) 170 170 + s.echo.Renderer = &TemplateRenderer{ 171 171 + templates: tmpl, 172 172 + isDev: true, 173 173 + templatePath: absPath, 168 174 } 169 169 - 170 170 - if !result.Found { 171 171 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 175 175 + } else { 176 176 + tmpl := template.Must(template.ParseFS(templateFS, "templates/*.html")) 177 177 + s.echo.Renderer = &TemplateRenderer{ 178 178 + templates: tmpl, 179 179 + isDev: false, 172 180 } 181 181 + } 182 182 + } 173 183 174 174 - exp, ok := claims["exp"].(float64) 175 175 - if !ok { 176 176 - s.logger.Error("error getting iat from token") 177 177 - return helpers.ServerError(e, nil) 178 178 - } 179 179 - 180 180 - if exp < float64(time.Now().UTC().Unix()) { 181 181 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 182 182 - } 183 183 - 184 184 - repo, err := s.getRepoActorByDid(claims["sub"].(string)) 184 184 + func (t *TemplateRenderer) Render(w io.Writer, name string, data any, c echo.Context) error { 185 185 + if t.isDev { 186 186 + tmpl, err := template.ParseGlob(t.templatePath) 185 187 if err != nil { 186 186 - s.logger.Error("error fetching repo", "error", err) 187 187 - return helpers.ServerError(e, nil) 188 188 + return err 188 189 } 190 190 + t.templates = tmpl 191 191 + } 189 192 190 190 - e.Set("repo", repo) 191 191 - e.Set("did", claims["sub"]) 192 192 - e.Set("token", tokenstr) 193 193 - 194 194 - if err := next(e); err != nil { 195 195 - e.Error(err) 196 196 - } 197 197 - 198 198 - return nil 193 193 + if viewContext, isMap := data.(map[string]any); isMap { 194 194 + viewContext["reverse"] = c.Echo().Reverse 199 195 } 196 196 + 197 197 + return t.templates.ExecuteTemplate(w, name, data) 200 198 } 201 199 202 200 func New(args *Args) (*Server, error) { ··· 224 222 return nil, fmt.Errorf("cocoon hostname must be set") 225 223 } 226 224 225 225 + if args.AdminPassword == "" { 226 226 + return nil, fmt.Errorf("admin password must be set") 227 227 + } 228 228 + 227 229 if args.Logger == nil { 228 230 args.Logger = slog.New(slog.NewTextHandler(os.Stdout, &slog.HandlerOptions{})) 229 231 } 230 232 233 233 + if args.SessionSecret == "" { 234 234 + panic("SESSION SECRET WAS NOT SET. THIS IS REQUIRED. ") 235 235 + } 236 236 + 231 237 e := echo.New() 232 238 233 239 e.Pre(middleware.RemoveTrailingSlash()) 234 240 e.Pre(slogecho.New(args.Logger)) 241 241 + e.Use(echo_session.Middleware(sessions.NewCookieStore([]byte(args.SessionSecret)))) 235 242 e.Use(middleware.CORSWithConfig(middleware.CORSConfig{ 236 243 AllowOrigins: []string{"*"}, 237 244 AllowHeaders: []string{"*"}, ··· 271 278 httpd := &http.Server{ 272 279 Addr: args.Addr, 273 280 Handler: e, 281 281 + // shitty defaults but okay for now, needed for import repo 282 282 + ReadTimeout: 5 * time.Minute, 283 283 + WriteTimeout: 5 * time.Minute, 284 284 + IdleTimeout: 5 * time.Minute, 274 285 } 275 286 276 276 - db, err := gorm.Open(sqlite.Open("cocoon.db"), &gorm.Config{}) 287 287 + gdb, err := gorm.Open(sqlite.Open("cocoon.db"), &gorm.Config{}) 277 288 if err != nil { 278 289 return nil, err 279 290 } 291 291 + dbw := db.NewDB(gdb) 280 292 281 293 rkbytes, err := os.ReadFile(args.RotationKeyPath) 282 294 if err != nil { ··· 300 312 return nil, err 301 313 } 302 314 303 303 - key, err := jwk.ParseKey(jwkbytes) 315 315 + key, err := helpers.ParseJWKFromBytes(jwkbytes) 304 316 if err != nil { 305 317 return nil, err 306 318 } ··· 310 322 return nil, err 311 323 } 312 324 325 325 + oauthCli := &http.Client{ 326 326 + Timeout: 10 * time.Second, 327 327 + } 328 328 + 329 329 + var nonceSecret []byte 330 330 + maybeSecret, err := os.ReadFile("nonce.secret") 331 331 + if err != nil && !os.IsNotExist(err) { 332 332 + args.Logger.Error("error attempting to read nonce secret", "error", err) 333 333 + } else { 334 334 + nonceSecret = maybeSecret 335 335 + } 336 336 + 313 337 s := &Server{ 314 338 http: h, 315 339 httpd: httpd, 316 340 echo: e, 317 341 logger: args.Logger, 318 318 - db: db, 342 342 + db: dbw, 319 343 plcClient: plcClient, 320 344 privateKey: &pkey, 321 345 config: &config{ 322 322 - Version: args.Version, 323 323 - Did: args.Did, 324 324 - Hostname: args.Hostname, 325 325 - ContactEmail: args.ContactEmail, 326 326 - EnforcePeering: false, 327 327 - Relays: args.Relays, 328 328 - SmtpName: args.SmtpName, 329 329 - SmtpEmail: args.SmtpEmail, 346 346 + Version: args.Version, 347 347 + Did: args.Did, 348 348 + Hostname: args.Hostname, 349 349 + ContactEmail: args.ContactEmail, 350 350 + EnforcePeering: false, 351 351 + Relays: args.Relays, 352 352 + AdminPassword: args.AdminPassword, 353 353 + SmtpName: args.SmtpName, 354 354 + SmtpEmail: args.SmtpEmail, 355 355 + DefaultAtprotoProxy: args.DefaultAtprotoProxy, 356 356 + BlockstoreVariant: args.BlockstoreVariant, 330 357 }, 331 358 evtman: events.NewEventManager(events.NewMemPersister()), 332 359 passport: identity.NewPassport(h, identity.NewMemCache(10_000)), 360 360 + 361 361 + dbName: args.DbName, 362 362 + s3Config: args.S3Config, 363 363 + 364 364 + oauthProvider: provider.NewProvider(provider.Args{ 365 365 + Hostname: args.Hostname, 366 366 + ClientManagerArgs: client.ManagerArgs{ 367 367 + Cli: oauthCli, 368 368 + Logger: args.Logger, 369 369 + }, 370 370 + DpopManagerArgs: dpop.ManagerArgs{ 371 371 + NonceSecret: nonceSecret, 372 372 + NonceRotationInterval: constants.NonceMaxRotationInterval / 3, 373 373 + OnNonceSecretCreated: func(newNonce []byte) { 374 374 + if err := os.WriteFile("nonce.secret", newNonce, 0644); err != nil { 375 375 + args.Logger.Error("error writing new nonce secret", "error", err) 376 376 + } 377 377 + }, 378 378 + Logger: args.Logger, 379 379 + Hostname: args.Hostname, 380 380 + }, 381 381 + }), 333 382 } 383 383 + 384 384 + s.loadTemplates() 334 385 335 386 s.repoman = NewRepoMan(s) // TODO: this is way too lazy, stop it 336 387 ··· 340 391 } else { 341 392 mail := mailyak.New(args.SmtpHost+":"+args.SmtpPort, smtp.PlainAuth("", args.SmtpUser, args.SmtpPass, args.SmtpHost)) 342 393 mail.From(s.config.SmtpEmail) 343 343 - mail.From(s.config.SmtpName) 394 394 + mail.FromName(s.config.SmtpName) 344 395 345 396 s.mail = mail 346 397 s.mailLk = &sync.Mutex{} ··· 350 401 } 351 402 352 403 func (s *Server) addRoutes() { 404 404 + // static 405 405 + if s.config.Version == "dev" { 406 406 + s.echo.Static("/static", "server/static") 407 407 + } else { 408 408 + s.echo.GET("/static/*", echo.WrapHandler(http.FileServer(http.FS(staticFS)))) 409 409 + } 410 410 + 353 411 // random stuff 354 412 s.echo.GET("/", s.handleRoot) 355 413 s.echo.GET("/xrpc/_health", s.handleHealth) 356 414 s.echo.GET("/.well-known/did.json", s.handleWellKnown) 415 415 + s.echo.GET("/.well-known/oauth-protected-resource", s.handleOauthProtectedResource) 416 416 + s.echo.GET("/.well-known/oauth-authorization-server", s.handleOauthAuthorizationServer) 357 417 s.echo.GET("/robots.txt", s.handleRobots) 358 418 359 419 // public ··· 376 436 s.echo.GET("/xrpc/com.atproto.sync.listBlobs", s.handleSyncListBlobs) 377 437 s.echo.GET("/xrpc/com.atproto.sync.getBlob", s.handleSyncGetBlob) 378 438 439 439 + // account 440 440 + s.echo.GET("/account", s.handleAccount) 441 441 + s.echo.POST("/account/revoke", s.handleAccountRevoke) 442 442 + s.echo.GET("/account/signin", s.handleAccountSigninGet) 443 443 + s.echo.POST("/account/signin", s.handleAccountSigninPost) 444 444 + s.echo.GET("/account/signout", s.handleAccountSignout) 445 445 + 446 446 + // oauth account 447 447 + s.echo.GET("/oauth/jwks", s.handleOauthJwks) 448 448 + s.echo.GET("/oauth/authorize", s.handleOauthAuthorizeGet) 449 449 + s.echo.POST("/oauth/authorize", s.handleOauthAuthorizePost) 450 450 + 451 451 + // oauth authorization 452 452 + s.echo.POST("/oauth/par", s.handleOauthPar, s.oauthProvider.BaseMiddleware) 453 453 + s.echo.POST("/oauth/token", s.handleOauthToken, s.oauthProvider.BaseMiddleware) 454 454 + 379 455 // authed 380 380 - s.echo.GET("/xrpc/com.atproto.server.getSession", s.handleGetSession, s.handleSessionMiddleware) 381 381 - s.echo.POST("/xrpc/com.atproto.server.refreshSession", s.handleRefreshSession, s.handleSessionMiddleware) 382 382 - s.echo.POST("/xrpc/com.atproto.server.deleteSession", s.handleDeleteSession, s.handleSessionMiddleware) 383 383 - s.echo.POST("/xrpc/com.atproto.identity.updateHandle", s.handleIdentityUpdateHandle, s.handleSessionMiddleware) 384 384 - s.echo.POST("/xrpc/com.atproto.server.confirmEmail", s.handleServerConfirmEmail, s.handleSessionMiddleware) 385 385 - s.echo.POST("/xrpc/com.atproto.server.requestEmailConfirmation", s.handleServerRequestEmailConfirmation, s.handleSessionMiddleware) 456 456 + s.echo.GET("/xrpc/com.atproto.server.getSession", s.handleGetSession, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 457 457 + s.echo.POST("/xrpc/com.atproto.server.refreshSession", s.handleRefreshSession, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 458 458 + s.echo.POST("/xrpc/com.atproto.server.deleteSession", s.handleDeleteSession, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 459 459 + s.echo.POST("/xrpc/com.atproto.identity.updateHandle", s.handleIdentityUpdateHandle, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 460 460 + s.echo.POST("/xrpc/com.atproto.server.confirmEmail", s.handleServerConfirmEmail, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 461 461 + s.echo.POST("/xrpc/com.atproto.server.requestEmailConfirmation", s.handleServerRequestEmailConfirmation, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 462 462 + s.echo.POST("/xrpc/com.atproto.server.requestPasswordReset", s.handleServerRequestPasswordReset) // AUTH NOT REQUIRED FOR THIS ONE 463 463 + s.echo.POST("/xrpc/com.atproto.server.requestEmailUpdate", s.handleServerRequestEmailUpdate, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 464 464 + s.echo.POST("/xrpc/com.atproto.server.resetPassword", s.handleServerResetPassword, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 465 465 + s.echo.POST("/xrpc/com.atproto.server.updateEmail", s.handleServerUpdateEmail, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 466 466 + s.echo.GET("/xrpc/com.atproto.server.getServiceAuth", s.handleServerGetServiceAuth, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 467 467 + s.echo.GET("/xrpc/com.atproto.server.checkAccountStatus", s.handleServerCheckAccountStatus, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 386 468 387 469 // repo 388 388 - s.echo.POST("/xrpc/com.atproto.repo.createRecord", s.handleCreateRecord, s.handleSessionMiddleware) 389 389 - s.echo.POST("/xrpc/com.atproto.repo.putRecord", s.handlePutRecord, s.handleSessionMiddleware) 390 390 - s.echo.POST("/xrpc/com.atproto.repo.applyWrites", s.handleApplyWrites, s.handleSessionMiddleware) 391 391 - s.echo.POST("/xrpc/com.atproto.repo.uploadBlob", s.handleRepoUploadBlob, s.handleSessionMiddleware) 470 470 + s.echo.POST("/xrpc/com.atproto.repo.createRecord", s.handleCreateRecord, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 471 471 + s.echo.POST("/xrpc/com.atproto.repo.putRecord", s.handlePutRecord, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 472 472 + s.echo.POST("/xrpc/com.atproto.repo.deleteRecord", s.handleDeleteRecord, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 473 473 + s.echo.POST("/xrpc/com.atproto.repo.applyWrites", s.handleApplyWrites, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 474 474 + s.echo.POST("/xrpc/com.atproto.repo.uploadBlob", s.handleRepoUploadBlob, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 475 475 + s.echo.POST("/xrpc/com.atproto.repo.importRepo", s.handleRepoImportRepo, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 392 476 393 477 // stupid silly endpoints 394 394 - s.echo.GET("/xrpc/app.bsky.actor.getPreferences", s.handleActorGetPreferences, s.handleSessionMiddleware) 395 395 - s.echo.POST("/xrpc/app.bsky.actor.putPreferences", s.handleActorPutPreferences, s.handleSessionMiddleware) 478 478 + s.echo.GET("/xrpc/app.bsky.actor.getPreferences", s.handleActorGetPreferences, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 479 479 + s.echo.POST("/xrpc/app.bsky.actor.putPreferences", s.handleActorPutPreferences, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 480 480 + 481 481 + // admin routes 482 482 + s.echo.POST("/xrpc/com.atproto.server.createInviteCode", s.handleCreateInviteCode, s.handleAdminMiddleware) 483 483 + s.echo.POST("/xrpc/com.atproto.server.createInviteCodes", s.handleCreateInviteCodes, s.handleAdminMiddleware) 396 484 397 485 // are there any routes that we should be allowing without auth? i dont think so but idk 398 398 - s.echo.GET("/xrpc/*", s.handleProxy, s.handleSessionMiddleware) 399 399 - s.echo.POST("/xrpc/*", s.handleProxy, s.handleSessionMiddleware) 486 486 + s.echo.GET("/xrpc/*", s.handleProxy, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 487 487 + s.echo.POST("/xrpc/*", s.handleProxy, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 400 488 } 401 489 402 490 func (s *Server) Serve(ctx context.Context) error { ··· 414 502 &models.Record{}, 415 503 &models.Blob{}, 416 504 &models.BlobPart{}, 505 505 + &provider.OauthToken{}, 506 506 + &provider.OauthAuthorizationRequest{}, 417 507 ) 418 508 419 509 s.logger.Info("starting cocoon") ··· 423 513 panic(err) 424 514 } 425 515 }() 516 516 + 517 517 + go s.backupRoutine() 426 518 427 519 for _, relay := range s.config.Relays { 428 520 cli := xrpc.Client{Host: relay} ··· 437 529 438 530 return nil 439 531 } 532 532 + 533 533 + func (s *Server) doBackup() { 534 534 + start := time.Now() 535 535 + 536 536 + s.logger.Info("beginning backup to s3...") 537 537 + 538 538 + var buf bytes.Buffer 539 539 + if err := func() error { 540 540 + s.logger.Info("reading database bytes...") 541 541 + s.db.Lock() 542 542 + defer s.db.Unlock() 543 543 + 544 544 + sf, err := os.Open(s.dbName) 545 545 + if err != nil { 546 546 + return fmt.Errorf("error opening database for backup: %w", err) 547 547 + } 548 548 + defer sf.Close() 549 549 + 550 550 + if _, err := io.Copy(&buf, sf); err != nil { 551 551 + return fmt.Errorf("error reading bytes of backup db: %w", err) 552 552 + } 553 553 + 554 554 + return nil 555 555 + }(); err != nil { 556 556 + s.logger.Error("error backing up database", "error", err) 557 557 + return 558 558 + } 559 559 + 560 560 + if err := func() error { 561 561 + s.logger.Info("sending to s3...") 562 562 + 563 563 + currTime := time.Now().Format("2006-01-02_15-04-05") 564 564 + key := "cocoon-backup-" + currTime + ".db" 565 565 + 566 566 + config := &aws.Config{ 567 567 + Region: aws.String(s.s3Config.Region), 568 568 + Credentials: credentials.NewStaticCredentials(s.s3Config.AccessKey, s.s3Config.SecretKey, ""), 569 569 + } 570 570 + 571 571 + if s.s3Config.Endpoint != "" { 572 572 + config.Endpoint = aws.String(s.s3Config.Endpoint) 573 573 + config.S3ForcePathStyle = aws.Bool(true) 574 574 + } 575 575 + 576 576 + sess, err := session.NewSession(config) 577 577 + if err != nil { 578 578 + return err 579 579 + } 580 580 + 581 581 + svc := s3.New(sess) 582 582 + 583 583 + if _, err := svc.PutObject(&s3.PutObjectInput{ 584 584 + Bucket: aws.String(s.s3Config.Bucket), 585 585 + Key: aws.String(key), 586 586 + Body: bytes.NewReader(buf.Bytes()), 587 587 + }); err != nil { 588 588 + return fmt.Errorf("error uploading file to s3: %w", err) 589 589 + } 590 590 + 591 591 + s.logger.Info("finished uploading backup to s3", "key", key, "duration", time.Now().Sub(start).Seconds()) 592 592 + 593 593 + return nil 594 594 + }(); err != nil { 595 595 + s.logger.Error("error uploading database backup", "error", err) 596 596 + return 597 597 + } 598 598 + 599 599 + os.WriteFile("last-backup.txt", []byte(time.Now().String()), 0644) 600 600 + } 601 601 + 602 602 + func (s *Server) backupRoutine() { 603 603 + if s.s3Config == nil || !s.s3Config.BackupsEnabled { 604 604 + return 605 605 + } 606 606 + 607 607 + if s.s3Config.Region == "" { 608 608 + s.logger.Warn("no s3 region configured but backups are enabled. backups will not run.") 609 609 + return 610 610 + } 611 611 + 612 612 + if s.s3Config.Bucket == "" { 613 613 + s.logger.Warn("no s3 bucket configured but backups are enabled. backups will not run.") 614 614 + return 615 615 + } 616 616 + 617 617 + if s.s3Config.AccessKey == "" { 618 618 + s.logger.Warn("no s3 access key configured but backups are enabled. backups will not run.") 619 619 + return 620 620 + } 621 621 + 622 622 + if s.s3Config.SecretKey == "" { 623 623 + s.logger.Warn("no s3 secret key configured but backups are enabled. backups will not run.") 624 624 + return 625 625 + } 626 626 + 627 627 + shouldBackupNow := false 628 628 + lastBackupStr, err := os.ReadFile("last-backup.txt") 629 629 + if err != nil { 630 630 + shouldBackupNow = true 631 631 + } else { 632 632 + lastBackup, err := time.Parse("2006-01-02 15:04:05.999999999 -0700 MST", string(lastBackupStr)) 633 633 + if err != nil { 634 634 + shouldBackupNow = true 635 635 + } else if time.Now().Sub(lastBackup).Seconds() > 3600 { 636 636 + shouldBackupNow = true 637 637 + } 638 638 + } 639 639 + 640 640 + if shouldBackupNow { 641 641 + go s.doBackup() 642 642 + } 643 643 + 644 644 + ticker := time.NewTicker(time.Hour) 645 645 + for range ticker.C { 646 646 + go s.doBackup() 647 647 + } 648 648 + } 649 649 + 650 650 + func (s *Server) UpdateRepo(ctx context.Context, did string, root cid.Cid, rev string) error { 651 651 + if err := s.db.Exec("UPDATE repos SET root = ?, rev = ? WHERE did = ?", nil, root.Bytes(), rev, did).Error; err != nil { 652 652 + return err 653 653 + } 654 654 + 655 655 + return nil 656 656 + }

+2 -2

server/session.go

··· 55 55 RefreshToken: refreshString, 56 56 CreatedAt: now, 57 57 ExpiresAt: accexp, 58 58 - }).Error; err != nil { 58 58 + }, nil).Error; err != nil { 59 59 return nil, err 60 60 } 61 61 ··· 64 64 Did: repo.Did, 65 65 CreatedAt: now, 66 66 ExpiresAt: refexp, 67 67 - }).Error; err != nil { 67 67 + }, nil).Error; err != nil { 68 68 return nil, err 69 69 } 70 70

+4

server/static/pico.css

··· 1 1 + @charset "UTF-8";/*! 2 2 + * Pico CSS ✨ v2.1.1 (https://picocss.com) 3 3 + * Copyright 2019-2025 - Licensed under MIT 4 4 + */:host,:root{--pico-font-family-emoji:"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--pico-font-family-sans-serif:system-ui,"Segoe UI",Roboto,Oxygen,Ubuntu,Cantarell,Helvetica,Arial,"Helvetica Neue",sans-serif,var(--pico-font-family-emoji);--pico-font-family-monospace:ui-monospace,SFMono-Regular,"SF Mono",Menlo,Consolas,"Liberation Mono",monospace,var(--pico-font-family-emoji);--pico-font-family:var(--pico-font-family-sans-serif);--pico-line-height:1.5;--pico-font-weight:400;--pico-font-size:100%;--pico-text-underline-offset:0.1rem;--pico-border-radius:0.25rem;--pico-border-width:0.0625rem;--pico-outline-width:0.125rem;--pico-transition:0.2s ease-in-out;--pico-spacing:1rem;--pico-typography-spacing-vertical:1rem;--pico-block-spacing-vertical:var(--pico-spacing);--pico-block-spacing-horizontal:var(--pico-spacing);--pico-grid-column-gap:var(--pico-spacing);--pico-grid-row-gap:var(--pico-spacing);--pico-form-element-spacing-vertical:0.75rem;--pico-form-element-spacing-horizontal:1rem;--pico-group-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-primary-focus);--pico-group-box-shadow-focus-with-input:0 0 0 0.0625rem var(--pico-form-element-border-color);--pico-modal-overlay-backdrop-filter:blur(0.375rem);--pico-nav-element-spacing-vertical:1rem;--pico-nav-element-spacing-horizontal:0.5rem;--pico-nav-link-spacing-vertical:0.5rem;--pico-nav-link-spacing-horizontal:0.5rem;--pico-nav-breadcrumb-divider:">";--pico-icon-checkbox:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-minus:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='5' y1='12' x2='19' y2='12'%3E%3C/line%3E%3C/svg%3E");--pico-icon-chevron:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='6 9 12 15 18 9'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-date:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Crect x='3' y='4' width='18' height='18' rx='2' ry='2'%3E%3C/rect%3E%3Cline x1='16' y1='2' x2='16' y2='6'%3E%3C/line%3E%3Cline x1='8' y1='2' x2='8' y2='6'%3E%3C/line%3E%3Cline x1='3' y1='10' x2='21' y2='10'%3E%3C/line%3E%3C/svg%3E");--pico-icon-time:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cpolyline points='12 6 12 12 16 14'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-search:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='1.5' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E");--pico-icon-close:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");--pico-icon-loading:url("data:image/svg+xml,%3Csvg fill='none' height='24' width='24' viewBox='0 0 24 24' xmlns='http://www.w3.org/2000/svg' %3E%3Cstyle%3E g %7B animation: rotate 2s linear infinite; transform-origin: center center; %7D circle %7B stroke-dasharray: 75,100; stroke-dashoffset: -5; animation: dash 1.5s ease-in-out infinite; stroke-linecap: round; %7D @keyframes rotate %7B 0%25 %7B transform: rotate(0deg); %7D 100%25 %7B transform: rotate(360deg); %7D %7D @keyframes dash %7B 0%25 %7B stroke-dasharray: 1,100; stroke-dashoffset: 0; %7D 50%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -17.5; %7D 100%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -62; %7D %7D %3C/style%3E%3Cg%3E%3Ccircle cx='12' cy='12' r='10' fill='none' stroke='rgb(136, 145, 164)' stroke-width='4' /%3E%3C/g%3E%3C/svg%3E")}@media (min-width:576px){:host,:root{--pico-font-size:106.25%}}@media (min-width:768px){:host,:root{--pico-font-size:112.5%}}@media (min-width:1024px){:host,:root{--pico-font-size:118.75%}}@media (min-width:1280px){:host,:root{--pico-font-size:125%}}@media (min-width:1536px){:host,:root{--pico-font-size:131.25%}}a{--pico-text-decoration:underline}a.contrast,a.secondary{--pico-text-decoration:underline}small{--pico-font-size:0.875em}h1,h2,h3,h4,h5,h6{--pico-font-weight:700}h1{--pico-font-size:2rem;--pico-line-height:1.125;--pico-typography-spacing-top:3rem}h2{--pico-font-size:1.75rem;--pico-line-height:1.15;--pico-typography-spacing-top:2.625rem}h3{--pico-font-size:1.5rem;--pico-line-height:1.175;--pico-typography-spacing-top:2.25rem}h4{--pico-font-size:1.25rem;--pico-line-height:1.2;--pico-typography-spacing-top:1.874rem}h5{--pico-font-size:1.125rem;--pico-line-height:1.225;--pico-typography-spacing-top:1.6875rem}h6{--pico-font-size:1rem;--pico-line-height:1.25;--pico-typography-spacing-top:1.5rem}tfoot td,tfoot th,thead td,thead th{--pico-font-weight:600;--pico-border-width:0.1875rem}code,kbd,pre,samp{--pico-font-family:var(--pico-font-family-monospace)}kbd{--pico-font-weight:bolder}:where(select,textarea),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-outline-width:0.0625rem}[type=search]{--pico-border-radius:5rem}[type=checkbox],[type=radio]{--pico-border-width:0.125rem}[type=checkbox][role=switch]{--pico-border-width:0.1875rem}details.dropdown summary:not([role=button]){--pico-outline-width:0.0625rem}nav details.dropdown summary:focus-visible{--pico-outline-width:0.125rem}[role=search]{--pico-border-radius:5rem}[role=group]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus),[role=search]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[role=group]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus),[role=search]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=submit],[role=search] button{--pico-form-element-spacing-horizontal:2rem}details summary[role=button]:not(.outline)::after{filter:brightness(0) invert(1)}[aria-busy=true]:not(input,select,textarea):is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0) invert(1)}:host(:not([data-theme=dark])),:root:not([data-theme=dark]),[data-theme=light]{color-scheme:light;--pico-background-color:#fff;--pico-color:#373c44;--pico-text-selection-color:rgba(116, 139, 248, 0.25);--pico-muted-color:#646b79;--pico-muted-border-color:rgb(231, 234, 239.5);--pico-primary:#2060df;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(32, 96, 223, 0.5);--pico-primary-hover:#184eb8;--pico-primary-hover-background:#1d59d0;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(116, 139, 248, 0.5);--pico-primary-inverse:#fff;--pico-secondary:#5d6b89;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(93, 107, 137, 0.5);--pico-secondary-hover:#48536b;--pico-secondary-hover-background:#48536b;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(93, 107, 137, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#181c25;--pico-contrast-background:#181c25;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(24, 28, 37, 0.5);--pico-contrast-hover:#000;--pico-contrast-hover-background:#000;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-secondary-hover);--pico-contrast-focus:rgba(93, 107, 137, 0.25);--pico-contrast-inverse:#fff;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(129, 145, 181, 0.01698),0.0335rem 0.067rem 0.402rem rgba(129, 145, 181, 0.024),0.0625rem 0.125rem 0.75rem rgba(129, 145, 181, 0.03),0.1125rem 0.225rem 1.35rem rgba(129, 145, 181, 0.036),0.2085rem 0.417rem 2.502rem rgba(129, 145, 181, 0.04302),0.5rem 1rem 6rem rgba(129, 145, 181, 0.06),0 0 0 0.0625rem rgba(129, 145, 181, 0.015);--pico-h1-color:#2d3138;--pico-h2-color:#373c44;--pico-h3-color:#424751;--pico-h4-color:#4d535e;--pico-h5-color:#5c6370;--pico-h6-color:#646b79;--pico-mark-background-color:rgb(252.5, 230.5, 191.5);--pico-mark-color:#0f1114;--pico-ins-color:rgb(28.5, 105.5, 84);--pico-del-color:rgb(136, 56.5, 53);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(243, 244.5, 246.75);--pico-code-color:#646b79;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(251, 251.5, 252.25);--pico-form-element-selected-background-color:#dfe3eb;--pico-form-element-border-color:#cfd5e2;--pico-form-element-color:#23262c;--pico-form-element-placeholder-color:var(--pico-muted-color);--pico-form-element-active-background-color:#fff;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(183.5, 105.5, 106.5);--pico-form-element-invalid-active-border-color:rgb(200.25, 79.25, 72.25);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:rgb(76, 154.5, 137.5);--pico-form-element-valid-active-border-color:rgb(39, 152.75, 118.75);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#bfc7d9;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#dfe3eb;--pico-range-active-border-color:#bfc7d9;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:var(--pico-background-color);--pico-card-border-color:var(--pico-muted-border-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(251, 251.5, 252.25);--pico-dropdown-background-color:#fff;--pico-dropdown-border-color:#eff1f4;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#eff1f4;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(232, 234, 237, 0.75);--pico-progress-background-color:#dfe3eb;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(76, 154.5, 137.5)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(200.25, 79.25, 72.25)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme=dark])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme=dark]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),[data-theme=light] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}@media only screen and (prefers-color-scheme:dark){:host(:not([data-theme])),:root:not([data-theme]){color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(137, 153, 249, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#8999f9;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(137, 153, 249, 0.5);--pico-primary-hover:#aeb5fb;--pico-primary-hover-background:#3c71f7;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(137, 153, 249, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}:host(:not([data-theme])) details summary[role=button].contrast:not(.outline)::after,:root:not([data-theme]) details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}:host(:not([data-theme])) [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before,:root:not([data-theme]) [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}}[data-theme=dark]{color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(137, 153, 249, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#8999f9;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(137, 153, 249, 0.5);--pico-primary-hover:#aeb5fb;--pico-primary-hover-background:#3c71f7;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(137, 153, 249, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}[data-theme=dark] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}[data-theme=dark] details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}[data-theme=dark] [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}[type=checkbox],[type=radio],[type=range],progress{accent-color:var(--pico-primary)}*,::after,::before{box-sizing:border-box;background-repeat:no-repeat}::after,::before{text-decoration:inherit;vertical-align:inherit}:where(:host),:where(:root){-webkit-tap-highlight-color:transparent;-webkit-text-size-adjust:100%;-moz-text-size-adjust:100%;text-size-adjust:100%;background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family);text-underline-offset:var(--pico-text-underline-offset);text-rendering:optimizeLegibility;overflow-wrap:break-word;-moz-tab-size:4;-o-tab-size:4;tab-size:4}body{width:100%;margin:0}main{display:block}body>footer,body>header,body>main{padding-block:var(--pico-block-spacing-vertical)}section{margin-bottom:var(--pico-block-spacing-vertical)}.container,.container-fluid{width:100%;margin-right:auto;margin-left:auto;padding-right:var(--pico-spacing);padding-left:var(--pico-spacing)}@media (min-width:576px){.container{max-width:510px;padding-right:0;padding-left:0}}@media (min-width:768px){.container{max-width:700px}}@media (min-width:1024px){.container{max-width:950px}}@media (min-width:1280px){.container{max-width:1200px}}@media (min-width:1536px){.container{max-width:1450px}}.grid{grid-column-gap:var(--pico-grid-column-gap);grid-row-gap:var(--pico-grid-row-gap);display:grid;grid-template-columns:1fr}@media (min-width:768px){.grid{grid-template-columns:repeat(auto-fit,minmax(0%,1fr))}}.grid>*{min-width:0}.overflow-auto{overflow:auto}b,strong{font-weight:bolder}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}address,blockquote,dl,ol,p,pre,table,ul{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-style:normal;font-weight:var(--pico-font-weight)}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family)}h1{--pico-color:var(--pico-h1-color)}h2{--pico-color:var(--pico-h2-color)}h3{--pico-color:var(--pico-h3-color)}h4{--pico-color:var(--pico-h4-color)}h5{--pico-color:var(--pico-h5-color)}h6{--pico-color:var(--pico-h6-color)}:where(article,address,blockquote,dl,figure,form,ol,p,pre,table,ul)~:is(h1,h2,h3,h4,h5,h6){margin-top:var(--pico-typography-spacing-top)}p{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup>*{margin-top:0;margin-bottom:0}hgroup>:not(:first-child):last-child{--pico-color:var(--pico-muted-color);--pico-font-weight:unset;font-size:1rem}:where(ol,ul) li{margin-bottom:calc(var(--pico-typography-spacing-vertical) * .25)}:where(dl,ol,ul) :where(dl,ol,ul){margin:0;margin-top:calc(var(--pico-typography-spacing-vertical) * .25)}ul li{list-style:square}mark{padding:.125rem .25rem;background-color:var(--pico-mark-background-color);color:var(--pico-mark-color);vertical-align:baseline}blockquote{display:block;margin:var(--pico-typography-spacing-vertical) 0;padding:var(--pico-spacing);border-right:none;border-left:.25rem solid var(--pico-blockquote-border-color);border-inline-start:0.25rem solid var(--pico-blockquote-border-color);border-inline-end:none}blockquote footer{margin-top:calc(var(--pico-typography-spacing-vertical) * .5);color:var(--pico-blockquote-footer-color)}abbr[title]{border-bottom:1px dotted;text-decoration:none;cursor:help}ins{color:var(--pico-ins-color);text-decoration:none}del{color:var(--pico-del-color)}::-moz-selection{background-color:var(--pico-text-selection-color)}::selection{background-color:var(--pico-text-selection-color)}:where(a:not([role=button])),[role=link]{--pico-color:var(--pico-primary);--pico-background-color:transparent;--pico-underline:var(--pico-primary-underline);outline:0;background-color:var(--pico-background-color);color:var(--pico-color);-webkit-text-decoration:var(--pico-text-decoration);text-decoration:var(--pico-text-decoration);text-decoration-color:var(--pico-underline);text-underline-offset:0.125em;transition:background-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition)}:where(a:not([role=button])):is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-primary-hover);--pico-underline:var(--pico-primary-hover-underline);--pico-text-decoration:underline}:where(a:not([role=button])):focus-visible,[role=link]:focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}:where(a:not([role=button])).secondary,[role=link].secondary{--pico-color:var(--pico-secondary);--pico-underline:var(--pico-secondary-underline)}:where(a:not([role=button])).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-underline:var(--pico-secondary-hover-underline)}:where(a:not([role=button])).contrast,[role=link].contrast{--pico-color:var(--pico-contrast);--pico-underline:var(--pico-contrast-underline)}:where(a:not([role=button])).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-underline:var(--pico-contrast-hover-underline)}a[role=button]{display:inline-block}button{margin:0;overflow:visible;font-family:inherit;text-transform:none}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[role=button],[type=button],[type=file]::file-selector-button,[type=reset],[type=submit],button{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);--pico-color:var(--pico-primary-inverse);--pico-box-shadow:var(--pico-button-box-shadow, 0 0 0 rgba(0, 0, 0, 0));padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:1rem;line-height:var(--pico-line-height);text-align:center;text-decoration:none;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}[role=button]:is(:hover,:active,:focus),[role=button]:is([aria-current]:not([aria-current=false])),[type=button]:is(:hover,:active,:focus),[type=button]:is([aria-current]:not([aria-current=false])),[type=file]::file-selector-button:is(:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])),[type=reset]:is(:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false])),[type=submit]:is(:hover,:active,:focus),[type=submit]:is([aria-current]:not([aria-current=false])),button:is(:hover,:active,:focus),button:is([aria-current]:not([aria-current=false])){--pico-background-color:var(--pico-primary-hover-background);--pico-border-color:var(--pico-primary-hover-border);--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0));--pico-color:var(--pico-primary-inverse)}[role=button]:focus,[role=button]:is([aria-current]:not([aria-current=false])):focus,[type=button]:focus,[type=button]:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus,[type=submit]:focus,[type=submit]:is([aria-current]:not([aria-current=false])):focus,button:focus,button:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}[type=button],[type=reset],[type=submit]{margin-bottom:var(--pico-spacing)}:is(button,[type=submit],[type=button],[role=button]).secondary,[type=file]::file-selector-button,[type=reset]{--pico-background-color:var(--pico-secondary-background);--pico-border-color:var(--pico-secondary-border);--pico-color:var(--pico-secondary-inverse);cursor:pointer}:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border);--pico-color:var(--pico-secondary-inverse)}:is(button,[type=submit],[type=button],[role=button]).secondary:focus,:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}:is(button,[type=submit],[type=button],[role=button]).contrast{--pico-background-color:var(--pico-contrast-background);--pico-border-color:var(--pico-contrast-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-contrast-hover-background);--pico-border-color:var(--pico-contrast-hover-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:focus,:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}:is(button,[type=submit],[type=button],[role=button]).outline,[type=reset].outline{--pico-background-color:transparent;--pico-color:var(--pico-primary);--pico-border-color:var(--pico-primary)}:is(button,[type=submit],[type=button],[role=button]).outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:transparent;--pico-color:var(--pico-primary-hover);--pico-border-color:var(--pico-primary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary,[type=reset].outline{--pico-color:var(--pico-secondary);--pico-border-color:var(--pico-secondary)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-border-color:var(--pico-secondary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast{--pico-color:var(--pico-contrast);--pico-border-color:var(--pico-contrast)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-border-color:var(--pico-contrast-hover)}:where(button,[type=submit],[type=reset],[type=button],[role=button])[disabled],:where(fieldset[disabled]) :is(button,[type=submit],[type=button],[type=reset],[role=button]){opacity:.5;pointer-events:none}:where(table){width:100%;border-collapse:collapse;border-spacing:0;text-indent:0}td,th{padding:calc(var(--pico-spacing)/ 2) var(--pico-spacing);border-bottom:var(--pico-border-width) solid var(--pico-table-border-color);background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);text-align:left;text-align:start}tfoot td,tfoot th{border-top:var(--pico-border-width) solid var(--pico-table-border-color);border-bottom:0}table.striped tbody tr:nth-child(odd) td,table.striped tbody tr:nth-child(odd) th{background-color:var(--pico-table-row-stripped-background-color)}:where(audio,canvas,iframe,img,svg,video){vertical-align:middle}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}:where(iframe){border-style:none}img{max-width:100%;height:auto;border-style:none}:where(svg:not([fill])){fill:currentColor}svg:not(:host),svg:not(:root){overflow:hidden}code,kbd,pre,samp{font-size:.875em;font-family:var(--pico-font-family)}pre code,pre samp{font-size:inherit;font-family:inherit}pre{-ms-overflow-style:scrollbar;overflow:auto}code,kbd,pre,samp{border-radius:var(--pico-border-radius);background:var(--pico-code-background-color);color:var(--pico-code-color);font-weight:var(--pico-font-weight);line-height:initial}code,kbd,samp{display:inline-block;padding:.375rem}pre{display:block;margin-bottom:var(--pico-spacing);overflow-x:auto}pre>code,pre>samp{display:block;padding:var(--pico-spacing);background:0 0;line-height:var(--pico-line-height)}kbd{background-color:var(--pico-code-kbd-background-color);color:var(--pico-code-kbd-color);vertical-align:baseline}figure{display:block;margin:0;padding:0}figure figcaption{padding:calc(var(--pico-spacing) * .5) 0;color:var(--pico-muted-color)}hr{height:0;margin:var(--pico-typography-spacing-vertical) 0;border:0;border-top:1px solid var(--pico-muted-border-color);color:inherit}[hidden],template{display:none!important}canvas{display:inline-block}input,optgroup,select,textarea{margin:0;font-size:1rem;line-height:var(--pico-line-height);font-family:inherit;letter-spacing:inherit}input{overflow:visible}select{text-transform:none}legend{max-width:100%;padding:0;color:inherit;white-space:normal}textarea{overflow:auto}[type=checkbox],[type=radio]{padding:0}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}::-moz-focus-inner{padding:0;border-style:none}:-moz-focusring{outline:0}:-moz-ui-invalid{box-shadow:none}::-ms-expand{display:none}[type=file],[type=range]{padding:0;border-width:0}input:not([type=checkbox],[type=radio],[type=range]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2)}fieldset{width:100%;margin:0;margin-bottom:var(--pico-spacing);padding:0;border:0}fieldset legend,label{display:block;margin-bottom:calc(var(--pico-spacing) * .375);color:var(--pico-color);font-weight:var(--pico-form-label-font-weight,var(--pico-font-weight))}fieldset legend{margin-bottom:calc(var(--pico-spacing) * .5)}button[type=submit],input:not([type=checkbox],[type=radio]),select,textarea{width:100%}input:not([type=checkbox],[type=radio],[type=range],[type=file]),select,textarea{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal)}input,select,textarea{--pico-background-color:var(--pico-form-element-background-color);--pico-border-color:var(--pico-form-element-border-color);--pico-color:var(--pico-form-element-color);--pico-box-shadow:none;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[readonly]):is(:active,:focus){--pico-background-color:var(--pico-form-element-active-background-color)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[role=switch],[readonly]):is(:active,:focus){--pico-border-color:var(--pico-form-element-active-border-color)}:where(select,textarea):not([readonly]):focus,input:not([type=submit],[type=button],[type=reset],[type=range],[type=file],[readonly]):focus{--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}:where(fieldset[disabled]) :is(input:not([type=submit],[type=button],[type=reset]),select,textarea),input:not([type=submit],[type=button],[type=reset])[disabled],label[aria-disabled=true],select[disabled],textarea[disabled]{opacity:var(--pico-form-element-disabled-opacity);pointer-events:none}label[aria-disabled=true] input[disabled]{opacity:1}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid]{padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal)!important;padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=false]:not(select){background-image:var(--pico-icon-valid)}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=true]:not(select){background-image:var(--pico-icon-invalid)}:where(input,select,textarea)[aria-invalid=false]{--pico-border-color:var(--pico-form-element-valid-border-color)}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus){--pico-border-color:var(--pico-form-element-valid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-valid-focus-color)!important}:where(input,select,textarea)[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus){--pico-border-color:var(--pico-form-element-invalid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-invalid-focus-color)!important}[dir=rtl] :where(input,select,textarea):not([type=checkbox],[type=radio]):is([aria-invalid],[aria-invalid=true],[aria-invalid=false]){background-position:center left .75rem}input::-webkit-input-placeholder,input::placeholder,select:invalid,textarea::-webkit-input-placeholder,textarea::placeholder{color:var(--pico-form-element-placeholder-color);opacity:1}input:not([type=checkbox],[type=radio]),select,textarea{margin-bottom:var(--pico-spacing)}select::-ms-expand{border:0;background-color:transparent}select:not([multiple],[size]){padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal);padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);background-image:var(--pico-icon-chevron);background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}select[multiple] option:checked{background:var(--pico-form-element-selected-background-color);color:var(--pico-form-element-color)}[dir=rtl] select:not([multiple],[size]){background-position:center left .75rem}textarea{display:block;resize:vertical}textarea[aria-invalid]{--pico-icon-height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);background-position:top right .75rem!important;background-size:1rem var(--pico-icon-height)!important}:where(input,select,textarea,fieldset,.grid)+small{display:block;width:100%;margin-top:calc(var(--pico-spacing) * -.75);margin-bottom:var(--pico-spacing);color:var(--pico-muted-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=false]+small{color:var(--pico-ins-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=true]+small{color:var(--pico-del-color)}label>:where(input,select,textarea){margin-top:calc(var(--pico-spacing) * .25)}label:has([type=checkbox],[type=radio]){width:-moz-fit-content;width:fit-content;cursor:pointer}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:1.25em;height:1.25em;margin-top:-.125em;margin-inline-end:.5em;border-width:var(--pico-border-width);vertical-align:middle;cursor:pointer}[type=checkbox]::-ms-check,[type=radio]::-ms-check{display:none}[type=checkbox]:checked,[type=checkbox]:checked:active,[type=checkbox]:checked:focus,[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-checkbox);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=checkbox]~label,[type=radio]~label{display:inline-block;margin-bottom:0;cursor:pointer}[type=checkbox]~label:not(:last-of-type),[type=radio]~label:not(:last-of-type){margin-inline-end:1em}[type=checkbox]:indeterminate{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-minus);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=radio]{border-radius:50%}[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-inverse);border-width:.35em;background-image:none}[type=checkbox][role=switch]{--pico-background-color:var(--pico-switch-background-color);--pico-color:var(--pico-switch-color);width:2.25em;height:1.25em;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:1.25em;background-color:var(--pico-background-color);line-height:1.25em}[type=checkbox][role=switch]:not([aria-invalid]){--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:before{display:block;aspect-ratio:1;height:100%;border-radius:50%;background-color:var(--pico-color);box-shadow:var(--pico-switch-thumb-box-shadow);content:"";transition:margin .1s ease-in-out}[type=checkbox][role=switch]:focus{--pico-background-color:var(--pico-switch-background-color);--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:checked{--pico-background-color:var(--pico-switch-checked-background-color);--pico-border-color:var(--pico-switch-checked-background-color);background-image:none}[type=checkbox][role=switch]:checked::before{margin-inline-start:calc(2.25em - 1.25em)}[type=checkbox][role=switch][disabled]{--pico-background-color:var(--pico-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus{--pico-background-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true]{--pico-background-color:var(--pico-form-element-invalid-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus,[type=radio][aria-invalid=false]:checked,[type=radio][aria-invalid=false]:checked:active,[type=radio][aria-invalid=false]:checked:focus{--pico-border-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true],[type=radio]:checked:active[aria-invalid=true],[type=radio]:checked:focus[aria-invalid=true],[type=radio]:checked[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}[type=color]::-webkit-color-swatch-wrapper{padding:0}[type=color]::-moz-focus-inner{padding:0}[type=color]::-webkit-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}[type=color]::-moz-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}input:not([type=checkbox],[type=radio],[type=range],[type=file]):is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){--pico-icon-position:0.75rem;--pico-icon-width:1rem;padding-right:calc(var(--pico-icon-width) + var(--pico-icon-position));background-image:var(--pico-icon-date);background-position:center right var(--pico-icon-position);background-size:var(--pico-icon-width) auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=time]{background-image:var(--pico-icon-time)}[type=date]::-webkit-calendar-picker-indicator,[type=datetime-local]::-webkit-calendar-picker-indicator,[type=month]::-webkit-calendar-picker-indicator,[type=time]::-webkit-calendar-picker-indicator,[type=week]::-webkit-calendar-picker-indicator{width:var(--pico-icon-width);margin-right:calc(var(--pico-icon-width) * -1);margin-left:var(--pico-icon-position);opacity:0}@-moz-document url-prefix(){[type=date],[type=datetime-local],[type=month],[type=time],[type=week]{padding-right:var(--pico-form-element-spacing-horizontal)!important;background-image:none!important}}[dir=rtl] :is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){text-align:right}[type=file]{--pico-color:var(--pico-muted-color);margin-left:calc(var(--pico-outline-width) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) 0;padding-left:var(--pico-outline-width);border:0;border-radius:0;background:0 0}[type=file]::file-selector-button{margin-right:calc(var(--pico-spacing)/ 2);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal)}[type=file]:is(:hover,:active,:focus)::file-selector-button{--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border)}[type=file]:focus::file-selector-button{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[type=range]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:100%;height:1.25rem;background:0 0}[type=range]::-webkit-slider-runnable-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-webkit-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-moz-range-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-moz-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-ms-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-ms-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-webkit-slider-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-webkit-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-moz-range-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-moz-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-ms-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-ms-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]:active,[type=range]:focus-within{--pico-range-border-color:var(--pico-range-active-border-color);--pico-range-thumb-color:var(--pico-range-thumb-active-color)}[type=range]:active::-webkit-slider-thumb{transform:scale(1.25)}[type=range]:active::-moz-range-thumb{transform:scale(1.25)}[type=range]:active::-ms-thumb{transform:scale(1.25)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem);background-image:var(--pico-icon-search);background-position:center left calc(var(--pico-form-element-spacing-horizontal) + .125rem);background-size:1rem auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem)!important;background-position:center left 1.125rem,center right .75rem}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=false]{background-image:var(--pico-icon-search),var(--pico-icon-valid)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=true]{background-image:var(--pico-icon-search),var(--pico-icon-invalid)}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{background-position:center right 1.125rem}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{background-position:center right 1.125rem,center left .75rem}details{display:block;margin-bottom:var(--pico-spacing)}details summary{line-height:1rem;list-style-type:none;cursor:pointer;transition:color var(--pico-transition)}details summary:not([role]){color:var(--pico-accordion-close-summary-color)}details summary::-webkit-details-marker{display:none}details summary::marker{display:none}details summary::-moz-list-bullet{list-style-type:none}details summary::after{display:block;width:1rem;height:1rem;margin-inline-start:calc(var(--pico-spacing,1rem) * .5);float:right;transform:rotate(-90deg);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:"";transition:transform var(--pico-transition)}details summary:focus{outline:0}details summary:focus:not([role]){color:var(--pico-accordion-active-summary-color)}details summary:focus-visible:not([role]){outline:var(--pico-outline-width) solid var(--pico-primary-focus);outline-offset:calc(var(--pico-spacing,1rem) * 0.5);color:var(--pico-primary)}details summary[role=button]{width:100%;text-align:left}details summary[role=button]::after{height:calc(1rem * var(--pico-line-height,1.5))}details[open]>summary{margin-bottom:var(--pico-spacing)}details[open]>summary:not([role]):not(:focus){color:var(--pico-accordion-open-summary-color)}details[open]>summary::after{transform:rotate(0)}[dir=rtl] details summary{text-align:right}[dir=rtl] details summary::after{float:left;background-position:left center}article{margin-bottom:var(--pico-block-spacing-vertical);padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal);border-radius:var(--pico-border-radius);background:var(--pico-card-background-color);box-shadow:var(--pico-card-box-shadow)}article>footer,article>header{margin-right:calc(var(--pico-block-spacing-horizontal) * -1);margin-left:calc(var(--pico-block-spacing-horizontal) * -1);padding:calc(var(--pico-block-spacing-vertical) * .66) var(--pico-block-spacing-horizontal);background-color:var(--pico-card-sectioning-background-color)}article>header{margin-top:calc(var(--pico-block-spacing-vertical) * -1);margin-bottom:var(--pico-block-spacing-vertical);border-bottom:var(--pico-border-width) solid var(--pico-card-border-color);border-top-right-radius:var(--pico-border-radius);border-top-left-radius:var(--pico-border-radius)}article>footer{margin-top:var(--pico-block-spacing-vertical);margin-bottom:calc(var(--pico-block-spacing-vertical) * -1);border-top:var(--pico-border-width) solid var(--pico-card-border-color);border-bottom-right-radius:var(--pico-border-radius);border-bottom-left-radius:var(--pico-border-radius)}details.dropdown{position:relative;border-bottom:none}details.dropdown>a::after,details.dropdown>button::after,details.dropdown>summary::after{display:block;width:1rem;height:calc(1rem * var(--pico-line-height,1.5));margin-inline-start:.25rem;float:right;transform:rotate(0) translateX(.2rem);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:""}nav details.dropdown{margin-bottom:0}details.dropdown>summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-form-element-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-form-element-background-color);color:var(--pico-form-element-placeholder-color);line-height:inherit;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}details.dropdown>summary:not([role]):active,details.dropdown>summary:not([role]):focus{border-color:var(--pico-form-element-active-border-color);background-color:var(--pico-form-element-active-background-color)}details.dropdown>summary:not([role]):focus{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}details.dropdown>summary:not([role]):focus-visible{outline:0}details.dropdown>summary:not([role])[aria-invalid=false]{--pico-form-element-border-color:var(--pico-form-element-valid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-valid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-valid-focus-color)}details.dropdown>summary:not([role])[aria-invalid=true]{--pico-form-element-border-color:var(--pico-form-element-invalid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-invalid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-invalid-focus-color)}nav details.dropdown{display:inline;margin:calc(var(--pico-nav-element-spacing-vertical) * -1) 0}nav details.dropdown>summary::after{transform:rotate(0) translateX(0)}nav details.dropdown>summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-nav-link-spacing-vertical) * 2);padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav details.dropdown>summary:not([role]):focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}details.dropdown>summary+ul{display:flex;z-index:99;position:absolute;left:0;flex-direction:column;width:100%;min-width:-moz-fit-content;min-width:fit-content;margin:0;margin-top:var(--pico-outline-width);padding:0;border:var(--pico-border-width) solid var(--pico-dropdown-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-dropdown-background-color);box-shadow:var(--pico-dropdown-box-shadow);color:var(--pico-dropdown-color);white-space:nowrap;opacity:0;transition:opacity var(--pico-transition),transform 0s ease-in-out 1s}details.dropdown>summary+ul[dir=rtl]{right:0;left:auto}details.dropdown>summary+ul li{width:100%;margin-bottom:0;padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);list-style:none}details.dropdown>summary+ul li:first-of-type{margin-top:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown>summary+ul li:last-of-type{margin-bottom:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown>summary+ul li a{display:block;margin:calc(var(--pico-form-element-spacing-vertical) * -.5) calc(var(--pico-form-element-spacing-horizontal) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);overflow:hidden;border-radius:0;color:var(--pico-dropdown-color);text-decoration:none;text-overflow:ellipsis}details.dropdown>summary+ul li a:active,details.dropdown>summary+ul li a:focus,details.dropdown>summary+ul li a:focus-visible,details.dropdown>summary+ul li a:hover,details.dropdown>summary+ul li a[aria-current]:not([aria-current=false]){background-color:var(--pico-dropdown-hover-background-color)}details.dropdown>summary+ul li label{width:100%}details.dropdown>summary+ul li:has(label):hover{background-color:var(--pico-dropdown-hover-background-color)}details.dropdown[open]>summary{margin-bottom:0}details.dropdown[open]>summary+ul{transform:scaleY(1);opacity:1;transition:opacity var(--pico-transition),transform 0s ease-in-out 0s}details.dropdown[open]>summary::before{display:block;z-index:1;position:fixed;width:100vw;height:100vh;inset:0;background:0 0;content:"";cursor:default}label>details.dropdown{margin-top:calc(var(--pico-spacing) * .25)}[role=group],[role=search]{display:inline-flex;position:relative;width:100%;margin-bottom:var(--pico-spacing);border-radius:var(--pico-border-radius);box-shadow:var(--pico-group-box-shadow,0 0 0 transparent);vertical-align:middle;transition:box-shadow var(--pico-transition)}[role=group] input:not([type=checkbox],[type=radio]),[role=group] select,[role=group]>*,[role=search] input:not([type=checkbox],[type=radio]),[role=search] select,[role=search]>*{position:relative;flex:1 1 auto;margin-bottom:0}[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=group]>:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child),[role=search]>:not(:first-child){margin-left:0;border-top-left-radius:0;border-bottom-left-radius:0}[role=group] input:not([type=checkbox],[type=radio]):not(:last-child),[role=group] select:not(:last-child),[role=group]>:not(:last-child),[role=search] input:not([type=checkbox],[type=radio]):not(:last-child),[role=search] select:not(:last-child),[role=search]>:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}[role=group] input:not([type=checkbox],[type=radio]):focus,[role=group] select:focus,[role=group]>:focus,[role=search] input:not([type=checkbox],[type=radio]):focus,[role=search] select:focus,[role=search]>:focus{z-index:2}[role=group] [role=button]:not(:first-child),[role=group] [type=button]:not(:first-child),[role=group] [type=reset]:not(:first-child),[role=group] [type=submit]:not(:first-child),[role=group] button:not(:first-child),[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=search] [role=button]:not(:first-child),[role=search] [type=button]:not(:first-child),[role=search] [type=reset]:not(:first-child),[role=search] [type=submit]:not(:first-child),[role=search] button:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child){margin-left:calc(var(--pico-border-width) * -1)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=reset],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=reset],[role=search] [type=submit],[role=search] button{width:auto}@supports selector(:has(*)){[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-button)}[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select,[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select{border-color:transparent}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus),[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-input)}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) button,[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) button{--pico-button-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-border);--pico-button-hover-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-hover-border)}[role=group] [role=button]:focus,[role=group] [type=button]:focus,[role=group] [type=reset]:focus,[role=group] [type=submit]:focus,[role=group] button:focus,[role=search] [role=button]:focus,[role=search] [type=button]:focus,[role=search] [type=reset]:focus,[role=search] [type=submit]:focus,[role=search] button:focus{box-shadow:none}}[role=search]>:first-child{border-top-left-radius:5rem;border-bottom-left-radius:5rem}[role=search]>:last-child{border-top-right-radius:5rem;border-bottom-right-radius:5rem}[aria-busy=true]:not(input,select,textarea,html,form){white-space:nowrap}[aria-busy=true]:not(input,select,textarea,html,form)::before{display:inline-block;width:1em;height:1em;background-image:var(--pico-icon-loading);background-size:1em auto;background-repeat:no-repeat;content:"";vertical-align:-.125em}[aria-busy=true]:not(input,select,textarea,html,form):not(:empty)::before{margin-inline-end:calc(var(--pico-spacing) * .5)}[aria-busy=true]:not(input,select,textarea,html,form):empty{text-align:center}[role=button][aria-busy=true],[type=button][aria-busy=true],[type=reset][aria-busy=true],[type=submit][aria-busy=true],a[aria-busy=true],button[aria-busy=true]{pointer-events:none}:host,:root{--pico-scrollbar-width:0px}dialog{display:flex;z-index:999;position:fixed;top:0;right:0;bottom:0;left:0;align-items:center;justify-content:center;width:inherit;min-width:100%;height:inherit;min-height:100%;padding:0;border:0;-webkit-backdrop-filter:var(--pico-modal-overlay-backdrop-filter);backdrop-filter:var(--pico-modal-overlay-backdrop-filter);background-color:var(--pico-modal-overlay-background-color);color:var(--pico-color)}dialog>article{width:100%;max-height:calc(100vh - var(--pico-spacing) * 2);margin:var(--pico-spacing);overflow:auto}@media (min-width:576px){dialog>article{max-width:510px}}@media (min-width:768px){dialog>article{max-width:700px}}dialog>article>header>*{margin-bottom:0}dialog>article>header .close,dialog>article>header :is(a,button)[rel=prev]{margin:0;margin-left:var(--pico-spacing);padding:0;float:right}dialog>article>footer{text-align:right}dialog>article>footer [role=button],dialog>article>footer button{margin-bottom:0}dialog>article>footer [role=button]:not(:first-of-type),dialog>article>footer button:not(:first-of-type){margin-left:calc(var(--pico-spacing) * .5)}dialog>article .close,dialog>article :is(a,button)[rel=prev]{display:block;width:1rem;height:1rem;margin-top:calc(var(--pico-spacing) * -1);margin-bottom:var(--pico-spacing);margin-left:auto;border:none;background-image:var(--pico-icon-close);background-position:center;background-size:auto 1rem;background-repeat:no-repeat;background-color:transparent;opacity:.5;transition:opacity var(--pico-transition)}dialog>article .close:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),dialog>article :is(a,button)[rel=prev]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){opacity:1}dialog:not([open]),dialog[open=false]{display:none}.modal-is-open{padding-right:var(--pico-scrollbar-width,0);overflow:hidden;pointer-events:none;touch-action:none}.modal-is-open dialog{pointer-events:auto;touch-action:auto}:where(.modal-is-opening,.modal-is-closing) dialog,:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-duration:.2s;animation-timing-function:ease-in-out;animation-fill-mode:both}:where(.modal-is-opening,.modal-is-closing) dialog{animation-duration:.8s;animation-name:modal-overlay}:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-delay:.2s;animation-name:modal}.modal-is-closing dialog,.modal-is-closing dialog>article{animation-delay:0s;animation-direction:reverse}@keyframes modal-overlay{from{-webkit-backdrop-filter:none;backdrop-filter:none;background-color:transparent}}@keyframes modal{from{transform:translateY(-100%);opacity:0}}:where(nav li)::before{float:left;content:"​"}nav,nav ul{display:flex}nav{justify-content:space-between;overflow:visible}nav ol,nav ul{align-items:center;margin-bottom:0;padding:0;list-style:none}nav ol:first-of-type,nav ul:first-of-type{margin-left:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav ol:last-of-type,nav ul:last-of-type{margin-right:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav li{display:inline-block;margin:0;padding:var(--pico-nav-element-spacing-vertical) var(--pico-nav-element-spacing-horizontal)}nav li :where(a,[role=link]){display:inline-block;margin:calc(var(--pico-nav-link-spacing-vertical) * -1) calc(var(--pico-nav-link-spacing-horizontal) * -1);padding:var(--pico-nav-link-spacing-vertical) var(--pico-nav-link-spacing-horizontal);border-radius:var(--pico-border-radius)}nav li :where(a,[role=link]):not(:hover){text-decoration:none}nav li [role=button],nav li [type=button],nav li button,nav li input:not([type=checkbox],[type=radio],[type=range],[type=file]),nav li select{height:auto;margin-right:inherit;margin-bottom:0;margin-left:inherit;padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb]{align-items:center;justify-content:start}nav[aria-label=breadcrumb] ul li:not(:first-child){margin-inline-start:var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb] ul li a{margin:calc(var(--pico-nav-link-spacing-vertical) * -1) 0;margin-inline-start:calc(var(--pico-nav-link-spacing-horizontal) * -1)}nav[aria-label=breadcrumb] ul li:not(:last-child)::after{display:inline-block;position:absolute;width:calc(var(--pico-nav-link-spacing-horizontal) * 4);margin:0 calc(var(--pico-nav-link-spacing-horizontal) * -1);content:var(--pico-nav-breadcrumb-divider);color:var(--pico-muted-color);text-align:center;text-decoration:none;white-space:nowrap}nav[aria-label=breadcrumb] a[aria-current]:not([aria-current=false]){background-color:transparent;color:inherit;text-decoration:none;pointer-events:none}aside li,aside nav,aside ol,aside ul{display:block}aside li{padding:calc(var(--pico-nav-element-spacing-vertical) * .5) var(--pico-nav-element-spacing-horizontal)}aside li a{display:block}aside li [role=button]{margin:inherit}[dir=rtl] nav[aria-label=breadcrumb] ul li:not(:last-child) ::after{content:"\\"}progress{display:inline-block;vertical-align:baseline}progress{-webkit-appearance:none;-moz-appearance:none;display:inline-block;appearance:none;width:100%;height:.5rem;margin-bottom:calc(var(--pico-spacing) * .5);overflow:hidden;border:0;border-radius:var(--pico-border-radius);background-color:var(--pico-progress-background-color);color:var(--pico-progress-color)}progress::-webkit-progress-bar{border-radius:var(--pico-border-radius);background:0 0}progress[value]::-webkit-progress-value{background-color:var(--pico-progress-color);-webkit-transition:inline-size var(--pico-transition);transition:inline-size var(--pico-transition)}progress::-moz-progress-bar{background-color:var(--pico-progress-color)}@media (prefers-reduced-motion:no-preference){progress:indeterminate{background:var(--pico-progress-background-color) linear-gradient(to right,var(--pico-progress-color) 30%,var(--pico-progress-background-color) 30%) top left/150% 150% no-repeat;animation:progress-indeterminate 1s linear infinite}progress:indeterminate[value]::-webkit-progress-value{background-color:transparent}progress:indeterminate::-moz-progress-bar{background-color:transparent}}@media (prefers-reduced-motion:no-preference){[dir=rtl] progress:indeterminate{animation-direction:reverse}}@keyframes progress-indeterminate{0%{background-position:200% 0}100%{background-position:-200% 0}}[data-tooltip]{position:relative}[data-tooltip]:not(a,button,input,[role=button]){border-bottom:1px dotted;text-decoration:none;cursor:help}[data-tooltip]::after,[data-tooltip]::before,[data-tooltip][data-placement=top]::after,[data-tooltip][data-placement=top]::before{display:block;z-index:99;position:absolute;bottom:100%;left:50%;padding:.25rem .5rem;overflow:hidden;transform:translate(-50%,-.25rem);border-radius:var(--pico-border-radius);background:var(--pico-tooltip-background-color);content:attr(data-tooltip);color:var(--pico-tooltip-color);font-style:normal;font-weight:var(--pico-font-weight);font-size:.875rem;text-decoration:none;text-overflow:ellipsis;white-space:nowrap;opacity:0;pointer-events:none}[data-tooltip]::after,[data-tooltip][data-placement=top]::after{padding:0;transform:translate(-50%,0);border-top:.3rem solid;border-right:.3rem solid transparent;border-left:.3rem solid transparent;border-radius:0;background-color:transparent;content:"";color:var(--pico-tooltip-background-color)}[data-tooltip][data-placement=bottom]::after,[data-tooltip][data-placement=bottom]::before{top:100%;bottom:auto;transform:translate(-50%,.25rem)}[data-tooltip][data-placement=bottom]:after{transform:translate(-50%,-.3rem);border:.3rem solid transparent;border-bottom:.3rem solid}[data-tooltip][data-placement=left]::after,[data-tooltip][data-placement=left]::before{top:50%;right:100%;bottom:auto;left:auto;transform:translate(-.25rem,-50%)}[data-tooltip][data-placement=left]:after{transform:translate(.3rem,-50%);border:.3rem solid transparent;border-left:.3rem solid}[data-tooltip][data-placement=right]::after,[data-tooltip][data-placement=right]::before{top:50%;right:auto;bottom:auto;left:100%;transform:translate(.25rem,-50%)}[data-tooltip][data-placement=right]:after{transform:translate(-.3rem,-50%);border:.3rem solid transparent;border-right:.3rem solid}[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{opacity:1}@media (hover:hover) and (pointer:fine){[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{--pico-tooltip-slide-to:translate(-50%, -0.25rem);transform:translate(-50%,.75rem);animation-duration:.2s;animation-fill-mode:forwards;animation-name:tooltip-slide;opacity:0}[data-tooltip]:focus::after,[data-tooltip]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, 0rem);transform:translate(-50%,-.25rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:focus::before,[data-tooltip][data-placement=bottom]:hover::after,[data-tooltip][data-placement=bottom]:hover::before{--pico-tooltip-slide-to:translate(-50%, 0.25rem);transform:translate(-50%,-.75rem);animation-name:tooltip-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, -0.3rem);transform:translate(-50%,-.5rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:focus::before,[data-tooltip][data-placement=left]:hover::after,[data-tooltip][data-placement=left]:hover::before{--pico-tooltip-slide-to:translate(-0.25rem, -50%);transform:translate(.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:hover::after{--pico-tooltip-caret-slide-to:translate(0.3rem, -50%);transform:translate(.05rem,-50%);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:focus::before,[data-tooltip][data-placement=right]:hover::after,[data-tooltip][data-placement=right]:hover::before{--pico-tooltip-slide-to:translate(0.25rem, -50%);transform:translate(-.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:hover::after{--pico-tooltip-caret-slide-to:translate(-0.3rem, -50%);transform:translate(-.05rem,-50%);animation-name:tooltip-caret-slide}}@keyframes tooltip-slide{to{transform:var(--pico-tooltip-slide-to);opacity:1}}@keyframes tooltip-caret-slide{50%{opacity:0}to{transform:var(--pico-tooltip-caret-slide-to);opacity:1}}[aria-controls]{cursor:pointer}[aria-disabled=true],[disabled]{cursor:not-allowed}[aria-hidden=false][hidden]{display:initial}[aria-hidden=false][hidden]:not(:focus){clip:rect(0,0,0,0);position:absolute}[tabindex],a,area,button,input,label,select,summary,textarea{-ms-touch-action:manipulation}[dir=rtl]{direction:rtl}@media (prefers-reduced-motion:reduce){:not([aria-busy=true]),:not([aria-busy=true])::after,:not([aria-busy=true])::before{background-attachment:initial!important;animation-duration:1ms!important;animation-delay:-1ms!important;animation-iteration-count:1!important;scroll-behavior:auto!important;transition-delay:0s!important;transition-duration:0s!important}}

+83

server/static/style.css

··· 1 1 + :root { 2 2 + --zinc-700: rgb(66, 71, 81); 3 3 + --success: rgb(0, 166, 110); 4 4 + --danger: rgb(155, 35, 24); 5 5 + } 6 6 + 7 7 + body { 8 8 + display: flex; 9 9 + flex-direction: column; 10 10 + } 11 11 + 12 12 + main { 13 13 + } 14 14 + 15 15 + .margin-top-sm { 16 16 + margin-top: 2em; 17 17 + } 18 18 + 19 19 + .margin-top-md { 20 20 + margin-top: 2.5em; 21 21 + } 22 22 + 23 23 + .margin-bottom-xs { 24 24 + margin-bottom: 1.5em; 25 25 + } 26 26 + 27 27 + .centered-body { 28 28 + min-height: 100vh; 29 29 + justify-content: center; 30 30 + } 31 31 + 32 32 + .base-container { 33 33 + border: 1px solid var(--zinc-700); 34 34 + border-radius: 10px; 35 35 + padding: 1.75em 1.2em; 36 36 + } 37 37 + 38 38 + .box-shadow-container { 39 39 + box-shadow: 1px 1px 52px 2px rgba(0, 0, 0, 0.42); 40 40 + } 41 41 + 42 42 + .login-container { 43 43 + max-width: 50ch; 44 44 + form :last-child { 45 45 + margin-bottom: 0; 46 46 + } 47 47 + form button { 48 48 + float: right; 49 49 + } 50 50 + } 51 51 + 52 52 + .authorize-container { 53 53 + max-width: 100ch; 54 54 + } 55 55 + 56 56 + button { 57 57 + width: unset; 58 58 + min-width: 16ch; 59 59 + } 60 60 + 61 61 + .button-row { 62 62 + display: flex; 63 63 + gap: 1ch; 64 64 + justify-content: end; 65 65 + } 66 66 + 67 67 + .alert { 68 68 + border: 1px solid var(--zinc-700); 69 69 + border-radius: 10px; 70 70 + padding: 1em 1em; 71 71 + p { 72 72 + color: white; 73 73 + margin-bottom: unset; 74 74 + } 75 75 + } 76 76 + 77 77 + .alert-success { 78 78 + background-color: var(--success); 79 79 + } 80 80 + 81 81 + .alert-danger { 82 82 + background-color: var(--danger); 83 83 + }

+40

server/templates/account.html

··· 1 1 + <!doctype html> 2 2 + <html lang="en"> 3 3 + <head> 4 4 + <meta charset="utf-8" /> 5 5 + <meta name="viewport" content="width=device-width, initial-scale=1" /> 6 6 + <meta name="color-scheme" content="light dark" /> 7 7 + <link rel="stylesheet" href="/static/pico.css" /> 8 8 + <link rel="stylesheet" href="/static/style.css" /> 9 9 + <title>Your Account</title> 10 10 + </head> 11 11 + <body class="margin-top-md"> 12 12 + <main class="container base-container authorize-container margin-top-xl"> 13 13 + <h2>Welcome, {{ .Repo.Handle }}</h2> 14 14 + <ul> 15 15 + <li><a href="/account/signout">Sign Out</a></li> 16 16 + </ul> 17 17 + {{ if .flashes.successes }} 18 18 + <div class="alert alert-success margin-bottom-xs"> 19 19 + <p>{{ index .flashes.successes 0 }}</p> 20 20 + </div> 21 21 + {{ end }} {{ if eq (len .Tokens) 0 }} 22 22 + <div class="alert alert-success" role="alert"> 23 23 + <p class="alert-message">You do not have any active OAuth sessions!</p> 24 24 + </div> 25 25 + {{ else }} {{ range .Tokens }} 26 26 + <div class="base-container"> 27 27 + <h4>{{ .ClientName }}</h4> 28 28 + <p>Session Age: {{ .Age}}</p> 29 29 + <p>Last Updated: {{ .LastUpdated }} ago</p> 30 30 + <p>Expires In: {{ .ExpiresIn }}</p> 31 31 + <p>IP Address: {{ .Ip }}</p> 32 32 + <form action="/account/revoke" method="post"> 33 33 + <input type="hidden" name="token" value="{{ .Token }}" /> 34 34 + <button type="submit" value="">Revoke</button> 35 35 + </form> 36 36 + </div> 37 37 + {{ end }} {{ end }} 38 38 + </main> 39 39 + </body> 40 40 + </html>

+4

server/templates/alert.html

··· 1 1 + <!doctype html> 2 2 + <div class="alert alert-success" role="alert"> 3 3 + <p class="alert-message"></p> 4 4 + </div>

+44

server/templates/authorize.html

··· 1 1 + <!doctype html> 2 2 + <html lang="en"> 3 3 + <head> 4 4 + <meta charset="utf-8" /> 5 5 + <meta name="viewport" content="width=device-width, initial-scale=1" /> 6 6 + <meta name="color-scheme" content="light dark" /> 7 7 + <link rel="stylesheet" href="/static/pico.css" /> 8 8 + <link rel="stylesheet" href="/static/style.css" /> 9 9 + <title>Application Authorization</title> 10 10 + </head> 11 11 + <body class="centered-body"> 12 12 + <main 13 13 + class="container base-container box-shadow-container authorizer-container" 14 14 + > 15 15 + <h2>Authorizing with {{ .AppName }}</h2> 16 16 + <p> 17 17 + You are signed in as <b>{{ .Handle }}</b>. 18 18 + <a href="/account/signout?{{ .QueryParams }}">Switch Account</a> 19 19 + </p> 20 20 + <p><b>{{ .AppName }}</b> is asking for you to grant it these scopes:</p> 21 21 + <ul> 22 22 + {{ range .Scopes }} 23 23 + <li><b>{{.}}</b></li> 24 24 + {{ end }} 25 25 + </ul> 26 26 + <p> 27 27 + If you press Accept, the application will be granted permissions for 28 28 + these scopes with your account <b>{{ .Handle }}</b>. If you reject, you 29 29 + will be sent back to the application. 30 30 + </p> 31 31 + <form action="/oauth/authorize" method="post"> 32 32 + <div class="button-row"> 33 33 + <input type="hidden" name="request_uri" value="{{ .RequestUri }}" /> 34 34 + <button class="secondary" name="accept_or_reject" value="reject"> 35 35 + Reject 36 36 + </button> 37 37 + <button class="primary" name="accept_or_reject" value="accept"> 38 38 + Accept 39 39 + </button> 40 40 + </div> 41 41 + </form> 42 42 + </main> 43 43 + </body> 44 44 + </html>

+34

server/templates/signin.html

··· 1 1 + <!doctype html> 2 2 + <html lang="en"> 3 3 + <head> 4 4 + <meta charset="utf-8" /> 5 5 + <meta name="viewport" content="width=device-width, initial-scale=1" /> 6 6 + <meta name="color-scheme" content="light dark" /> 7 7 + <link rel="stylesheet" href="/static/pico.css" /> 8 8 + <link rel="stylesheet" href="/static/style.css" /> 9 9 + <title>PDS Authentication</title> 10 10 + </head> 11 11 + <body class="centered-body"> 12 12 + <main class="container base-container box-shadow-container login-container"> 13 13 + <h2>Sign into your account</h2> 14 14 + <p>Enter your handle and password below.</p> 15 15 + {{ if .flashes.errors }} 16 16 + <div class="alert alert-danger margin-bottom-xs"> 17 17 + <p>{{ index .flashes.errors 0 }}</p> 18 18 + </div> 19 19 + {{ end }} 20 20 + <form action="/account/signin" method="post"> 21 21 + <input name="username" id="username" placeholder="Handle" /> 22 22 + <br /> 23 23 + <input 24 24 + name="password" 25 25 + id="password" 26 26 + type="password" 27 27 + placeholder="Password" 28 28 + /> 29 29 + <input name="query_params" type="hidden" value="{{ .QueryParams }}" /> 30 30 + <button class="primary" type="submit" value="Login">Login</button> 31 31 + </form> 32 32 + </main> 33 33 + </body> 34 34 + </html>

+155

sqlite_blockstore/sqlite_blockstore.go

··· 1 1 + package sqlite_blockstore 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + "fmt" 6 6 + 7 7 + "github.com/bluesky-social/indigo/atproto/syntax" 8 8 + "github.com/haileyok/cocoon/internal/db" 9 9 + "github.com/haileyok/cocoon/models" 10 10 + blocks "github.com/ipfs/go-block-format" 11 11 + "github.com/ipfs/go-cid" 12 12 + "gorm.io/gorm/clause" 13 13 + ) 14 14 + 15 15 + type SqliteBlockstore struct { 16 16 + db *db.DB 17 17 + did string 18 18 + readonly bool 19 19 + inserts map[cid.Cid]blocks.Block 20 20 + } 21 21 + 22 22 + func New(did string, db *db.DB) *SqliteBlockstore { 23 23 + return &SqliteBlockstore{ 24 24 + did: did, 25 25 + db: db, 26 26 + readonly: false, 27 27 + inserts: map[cid.Cid]blocks.Block{}, 28 28 + } 29 29 + } 30 30 + 31 31 + func NewReadOnly(did string, db *db.DB) *SqliteBlockstore { 32 32 + return &SqliteBlockstore{ 33 33 + did: did, 34 34 + db: db, 35 35 + readonly: true, 36 36 + inserts: map[cid.Cid]blocks.Block{}, 37 37 + } 38 38 + } 39 39 + 40 40 + func (bs *SqliteBlockstore) Get(ctx context.Context, cid cid.Cid) (blocks.Block, error) { 41 41 + var block models.Block 42 42 + 43 43 + maybeBlock, ok := bs.inserts[cid] 44 44 + if ok { 45 45 + return maybeBlock, nil 46 46 + } 47 47 + 48 48 + if err := bs.db.Raw("SELECT * FROM blocks WHERE did = ? AND cid = ?", nil, bs.did, cid.Bytes()).Scan(&block).Error; err != nil { 49 49 + return nil, err 50 50 + } 51 51 + 52 52 + b, err := blocks.NewBlockWithCid(block.Value, cid) 53 53 + if err != nil { 54 54 + return nil, err 55 55 + } 56 56 + 57 57 + return b, nil 58 58 + } 59 59 + 60 60 + func (bs *SqliteBlockstore) Put(ctx context.Context, block blocks.Block) error { 61 61 + bs.inserts[block.Cid()] = block 62 62 + 63 63 + if bs.readonly { 64 64 + return nil 65 65 + } 66 66 + 67 67 + b := models.Block{ 68 68 + Did: bs.did, 69 69 + Cid: block.Cid().Bytes(), 70 70 + Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 71 71 + Value: block.RawData(), 72 72 + } 73 73 + 74 74 + if err := bs.db.Create(&b, []clause.Expression{clause.OnConflict{ 75 75 + Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 76 76 + UpdateAll: true, 77 77 + }}).Error; err != nil { 78 78 + return err 79 79 + } 80 80 + 81 81 + return nil 82 82 + } 83 83 + 84 84 + func (bs *SqliteBlockstore) DeleteBlock(context.Context, cid.Cid) error { 85 85 + panic("not implemented") 86 86 + } 87 87 + 88 88 + func (bs *SqliteBlockstore) Has(context.Context, cid.Cid) (bool, error) { 89 89 + panic("not implemented") 90 90 + } 91 91 + 92 92 + func (bs *SqliteBlockstore) GetSize(context.Context, cid.Cid) (int, error) { 93 93 + panic("not implemented") 94 94 + } 95 95 + 96 96 + func (bs *SqliteBlockstore) PutMany(ctx context.Context, blocks []blocks.Block) error { 97 97 + tx := bs.db.BeginDangerously() 98 98 + 99 99 + for _, block := range blocks { 100 100 + bs.inserts[block.Cid()] = block 101 101 + 102 102 + if bs.readonly { 103 103 + continue 104 104 + } 105 105 + 106 106 + b := models.Block{ 107 107 + Did: bs.did, 108 108 + Cid: block.Cid().Bytes(), 109 109 + Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 110 110 + Value: block.RawData(), 111 111 + } 112 112 + 113 113 + if err := tx.Clauses(clause.OnConflict{ 114 114 + Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 115 115 + UpdateAll: true, 116 116 + }).Create(&b).Error; err != nil { 117 117 + tx.Rollback() 118 118 + return err 119 119 + } 120 120 + } 121 121 + 122 122 + if bs.readonly { 123 123 + return nil 124 124 + } 125 125 + 126 126 + tx.Commit() 127 127 + 128 128 + return nil 129 129 + } 130 130 + 131 131 + func (bs *SqliteBlockstore) AllKeysChan(ctx context.Context) (<-chan cid.Cid, error) { 132 132 + panic("not implemented") 133 133 + } 134 134 + 135 135 + func (bs *SqliteBlockstore) HashOnRead(enabled bool) { 136 136 + panic("not implemented") 137 137 + } 138 138 + 139 139 + func (bs *SqliteBlockstore) Execute(ctx context.Context) error { 140 140 + if !bs.readonly { 141 141 + return fmt.Errorf("blockstore was not readonly") 142 142 + } 143 143 + 144 144 + bs.readonly = false 145 145 + for _, b := range bs.inserts { 146 146 + bs.Put(ctx, b) 147 147 + } 148 148 + bs.readonly = true 149 149 + 150 150 + return nil 151 151 + } 152 152 + 153 153 + func (bs *SqliteBlockstore) GetLog() map[cid.Cid]blocks.Block { 154 154 + return bs.inserts 155 155 + }