+2

.env.example

··· 6 6 COCOON_RELAYS=https://bsky.network 7 7 # Generate with `openssl rand -hex 16` 8 8 COCOON_ADMIN_PASSWORD= 9 9 + # openssl rand -hex 32 10 10 + COCOON_SESSION_SECRET=

+2

.gitignore

··· 2 2 .env 3 3 /cocoon 4 4 *.key 5 5 + *.secret 6 6 + .DS_Store

+21

LICENSE

··· 1 1 + MIT License 2 2 + 3 3 + Copyright (c) 2025 me@haileyok.com 4 4 + 5 5 + Permission is hereby granted, free of charge, to any person obtaining a copy 6 6 + of this software and associated documentation files (the "Software"), to deal 7 7 + in the Software without restriction, including without limitation the rights 8 8 + to use, copy, modify, merge, publish, distribute, sublicense, and/or sell 9 9 + copies of the Software, and to permit persons to whom the Software is 10 10 + furnished to do so, subject to the following conditions: 11 11 + 12 12 + The above copyright notice and this permission notice shall be included in all 13 13 + copies or substantial portions of the Software. 14 14 + 15 15 + THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR 16 16 + IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, 17 17 + FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE 18 18 + AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER 19 19 + LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, 20 20 + OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN THE 21 21 + SOFTWARE.

+68 -59

README.md

··· 5 5 6 6 Cocoon is a PDS implementation in Go. It is highly experimental, and is not ready for any production use. 7 7 8 8 - ### Impmlemented Endpoints 8 8 + ## Implemented Endpoints 9 9 10 10 > [!NOTE] 11 11 - Just because something is implemented doesn't mean it is finisehd. Tons of these are returning bad errors, don't do validation properly, etc. I'll make a "second pass" checklist at some point to do all of that. 11 11 + Just because something is implemented doesn't mean it is finished. Tons of these are returning bad errors, don't do validation properly, etc. I'll make a "second pass" checklist at some point to do all of that. 12 12 13 13 - #### Identity 14 14 - - [ ] com.atproto.identity.getRecommendedDidCredentials 15 15 - - [ ] com.atproto.identity.requestPlcOperationSignature 16 16 - - [x] com.atproto.identity.resolveHandle 17 17 - - [ ] com.atproto.identity.signPlcOperation 18 18 - - [ ] com.atproto.identity.submitPlcOperatioin 19 19 - - [x] com.atproto.identity.updateHandle 13 13 + ### Identity 14 14 + 15 15 + - [ ] `com.atproto.identity.getRecommendedDidCredentials` 16 16 + - [ ] `com.atproto.identity.requestPlcOperationSignature` 17 17 + - [x] `com.atproto.identity.resolveHandle` 18 18 + - [ ] `com.atproto.identity.signPlcOperation` 19 19 + - [ ] `com.atproto.identity.submitPlcOperation` 20 20 + - [x] `com.atproto.identity.updateHandle` 21 21 + 22 22 + ### Repo 23 23 + 24 24 + - [x] `com.atproto.repo.applyWrites` 25 25 + - [x] `com.atproto.repo.createRecord` 26 26 + - [x] `com.atproto.repo.putRecord` 27 27 + - [x] `com.atproto.repo.deleteRecord` 28 28 + - [x] `com.atproto.repo.describeRepo` 29 29 + - [x] `com.atproto.repo.getRecord` 30 30 + - [x] `com.atproto.repo.importRepo` (Works "okay". You still have to handle PLC operations on your own when migrating. Use with extreme caution.) 31 31 + - [x] `com.atproto.repo.listRecords` 32 32 + - [ ] `com.atproto.repo.listMissingBlobs` 33 33 + 34 34 + ### Server 35 35 + 36 36 + - [ ] `com.atproto.server.activateAccount` 37 37 + - [x] `com.atproto.server.checkAccountStatus` 38 38 + - [x] `com.atproto.server.confirmEmail` 39 39 + - [x] `com.atproto.server.createAccount` 40 40 + - [x] `com.atproto.server.createInviteCode` 41 41 + - [x] `com.atproto.server.createInviteCodes` 42 42 + - [ ] `com.atproto.server.deactivateAccount` 43 43 + - [ ] `com.atproto.server.deleteAccount` 44 44 + - [x] `com.atproto.server.deleteSession` 45 45 + - [x] `com.atproto.server.describeServer` 46 46 + - [ ] `com.atproto.server.getAccountInviteCodes` 47 47 + - [ ] `com.atproto.server.getServiceAuth` 48 48 + - ~~[ ] `com.atproto.server.listAppPasswords`~~ - not going to add app passwords 49 49 + - [x] `com.atproto.server.refreshSession` 50 50 + - [ ] `com.atproto.server.requestAccountDelete` 51 51 + - [x] `com.atproto.server.requestEmailConfirmation` 52 52 + - [x] `com.atproto.server.requestEmailUpdate` 53 53 + - [x] `com.atproto.server.requestPasswordReset` 54 54 + - [ ] `com.atproto.server.reserveSigningKey` 55 55 + - [x] `com.atproto.server.resetPassword` 56 56 + - ~~[] `com.atproto.server.revokeAppPassword`~~ - not going to add app passwords 57 57 + - [x] `com.atproto.server.updateEmail` 58 58 + 59 59 + ### Sync 60 60 + 61 61 + - [x] `com.atproto.sync.getBlob` 62 62 + - [x] `com.atproto.sync.getBlocks` 63 63 + - [x] `com.atproto.sync.getLatestCommit` 64 64 + - [x] `com.atproto.sync.getRecord` 65 65 + - [x] `com.atproto.sync.getRepoStatus` 66 66 + - [x] `com.atproto.sync.getRepo` 67 67 + - [x] `com.atproto.sync.listBlobs` 68 68 + - [x] `com.atproto.sync.listRepos` 69 69 + - ~~[ ] `com.atproto.sync.notifyOfUpdate`~~ - BGS doesn't even have this implemented lol 70 70 + - [x] `com.atproto.sync.requestCrawl` 71 71 + - [x] `com.atproto.sync.subscribeRepos` 20 72 21 21 - #### Repo 22 22 - - [x] com.atproto.repo.applyWrites 23 23 - - [x] com.atproto.repo.createRecord 24 24 - - [x] com.atproto.repo.putRecord 25 25 - - [x] com.atproto.repo.deleteRecord 26 26 - - [x] com.atproto.repo.describeRepo 27 27 - - [x] com.atproto.repo.getRecord 28 28 - - [ ] com.atproto.repo.importRepo 29 29 - - [x] com.atproto.repo.listRecords 30 30 - - [ ] com.atproto.repo.listMissingBlobs 73 73 + ### Other 31 74 32 32 - #### Server 33 33 - - [ ] com.atproto.server.activateAccount 34 34 - - [ ] com.atproto.server.checkAccountStatus 35 35 - - [x] com.atproto.server.confirmEmail 36 36 - - [x] com.atproto.server.createAccount 37 37 - - [x] com.atproto.server.createInviteCode 38 38 - - [x] com.atproto.server.createInviteCodes 39 39 - - [ ] com.atproto.server.deactivateAccount 40 40 - - [ ] com.atproto.server.deleteAccount 41 41 - - [x] com.atproto.server.deleteSession 42 42 - - [x] com.atproto.server.describeServer 43 43 - - [ ] com.atproto.server.getAccountInviteCodes 44 44 - - [ ] com.atproto.server.getServiceAuth 45 45 - - ~[ ] com.atproto.server.listAppPasswords~ - not going to add app passwords 46 46 - - [x] com.atproto.server.refreshSession 47 47 - - [ ] com.atproto.server.requestAccountDelete 48 48 - - [x] com.atproto.server.requestEmailConfirmation 49 49 - - [x] com.atproto.server.requestEmailUpdate 50 50 - - [x] com.atproto.server.requestPasswordReset 51 51 - - [ ] com.atproto.server.reserveSigningKey 52 52 - - [x] com.atproto.server.resetPassword 53 53 - - ~[ ] com.atproto.server.revokeAppPassword~ - not going to add app passwords 54 54 - - [x] com.atproto.server.updateEmail 75 75 + - [ ] `com.atproto.label.queryLabels` 76 76 + - [x] `com.atproto.moderation.createReport` (Note: this should be handled by proxying, not actually implemented in the PDS) 77 77 + - [x] `app.bsky.actor.getPreferences` 78 78 + - [x] `app.bsky.actor.putPreferences` 55 79 56 56 - #### Sync 57 57 - - [x] com.atproto.sync.getBlob 58 58 - - [x] com.atproto.sync.getBlocks 59 59 - - [x] com.atproto.sync.getLatestCommit 60 60 - - [x] com.atproto.sync.getRecord 61 61 - - [x] com.atproto.sync.getRepoStatus 62 62 - - [x] com.atproto.sync.getRepo 63 63 - - [x] com.atproto.sync.listBlobs 64 64 - - [x] com.atproto.sync.listRepos 65 65 - - ~[ ] com.atproto.sync.notifyOfUpdate~ - BGS doesn't even have this implemented lol 66 66 - - [x] com.atproto.sync.requestCrawl 67 67 - - [x] com.atproto.sync.subscribeRepos 80 80 + ## License 68 81 69 69 - #### Other 70 70 - - [ ] com.atproto.label.queryLabels 71 71 - - [ ] com.atproto.moderation.createReport 72 72 - - [x] app.bsky.actor.getPreferences 73 73 - - [x] app.bsky.actor.putPreferences 82 82 + This project is licensed under MIT license. `server/static/pico.css` is also licensed under MIT license, available at [https://github.com/picocss/pico/](https://github.com/picocss/pico/).

-163

blockstore/blockstore.go

··· 1 1 - package blockstore 2 2 - 3 3 - import ( 4 4 - "context" 5 5 - "fmt" 6 6 - 7 7 - "github.com/bluesky-social/indigo/atproto/syntax" 8 8 - "github.com/haileyok/cocoon/internal/db" 9 9 - "github.com/haileyok/cocoon/models" 10 10 - blocks "github.com/ipfs/go-block-format" 11 11 - "github.com/ipfs/go-cid" 12 12 - "gorm.io/gorm/clause" 13 13 - ) 14 14 - 15 15 - type SqliteBlockstore struct { 16 16 - db *db.DB 17 17 - did string 18 18 - readonly bool 19 19 - inserts map[cid.Cid]blocks.Block 20 20 - } 21 21 - 22 22 - func New(did string, db *db.DB) *SqliteBlockstore { 23 23 - return &SqliteBlockstore{ 24 24 - did: did, 25 25 - db: db, 26 26 - readonly: false, 27 27 - inserts: map[cid.Cid]blocks.Block{}, 28 28 - } 29 29 - } 30 30 - 31 31 - func NewReadOnly(did string, db *db.DB) *SqliteBlockstore { 32 32 - return &SqliteBlockstore{ 33 33 - did: did, 34 34 - db: db, 35 35 - readonly: true, 36 36 - inserts: map[cid.Cid]blocks.Block{}, 37 37 - } 38 38 - } 39 39 - 40 40 - func (bs *SqliteBlockstore) Get(ctx context.Context, cid cid.Cid) (blocks.Block, error) { 41 41 - var block models.Block 42 42 - 43 43 - maybeBlock, ok := bs.inserts[cid] 44 44 - if ok { 45 45 - return maybeBlock, nil 46 46 - } 47 47 - 48 48 - if err := bs.db.Raw("SELECT * FROM blocks WHERE did = ? AND cid = ?", nil, bs.did, cid.Bytes()).Scan(&block).Error; err != nil { 49 49 - return nil, err 50 50 - } 51 51 - 52 52 - b, err := blocks.NewBlockWithCid(block.Value, cid) 53 53 - if err != nil { 54 54 - return nil, err 55 55 - } 56 56 - 57 57 - return b, nil 58 58 - } 59 59 - 60 60 - func (bs *SqliteBlockstore) Put(ctx context.Context, block blocks.Block) error { 61 61 - bs.inserts[block.Cid()] = block 62 62 - 63 63 - if bs.readonly { 64 64 - return nil 65 65 - } 66 66 - 67 67 - b := models.Block{ 68 68 - Did: bs.did, 69 69 - Cid: block.Cid().Bytes(), 70 70 - Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 71 71 - Value: block.RawData(), 72 72 - } 73 73 - 74 74 - if err := bs.db.Create(&b, []clause.Expression{clause.OnConflict{ 75 75 - Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 76 76 - UpdateAll: true, 77 77 - }}).Error; err != nil { 78 78 - return err 79 79 - } 80 80 - 81 81 - return nil 82 82 - } 83 83 - 84 84 - func (bs *SqliteBlockstore) DeleteBlock(context.Context, cid.Cid) error { 85 85 - panic("not implemented") 86 86 - } 87 87 - 88 88 - func (bs *SqliteBlockstore) Has(context.Context, cid.Cid) (bool, error) { 89 89 - panic("not implemented") 90 90 - } 91 91 - 92 92 - func (bs *SqliteBlockstore) GetSize(context.Context, cid.Cid) (int, error) { 93 93 - panic("not implemented") 94 94 - } 95 95 - 96 96 - func (bs *SqliteBlockstore) PutMany(ctx context.Context, blocks []blocks.Block) error { 97 97 - tx := bs.db.BeginDangerously() 98 98 - 99 99 - for _, block := range blocks { 100 100 - bs.inserts[block.Cid()] = block 101 101 - 102 102 - if bs.readonly { 103 103 - continue 104 104 - } 105 105 - 106 106 - b := models.Block{ 107 107 - Did: bs.did, 108 108 - Cid: block.Cid().Bytes(), 109 109 - Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 110 110 - Value: block.RawData(), 111 111 - } 112 112 - 113 113 - if err := tx.Clauses(clause.OnConflict{ 114 114 - Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 115 115 - UpdateAll: true, 116 116 - }).Create(&b).Error; err != nil { 117 117 - tx.Rollback() 118 118 - return err 119 119 - } 120 120 - } 121 121 - 122 122 - if bs.readonly { 123 123 - return nil 124 124 - } 125 125 - 126 126 - tx.Commit() 127 127 - 128 128 - return nil 129 129 - } 130 130 - 131 131 - func (bs *SqliteBlockstore) AllKeysChan(ctx context.Context) (<-chan cid.Cid, error) { 132 132 - panic("not implemented") 133 133 - } 134 134 - 135 135 - func (bs *SqliteBlockstore) HashOnRead(enabled bool) { 136 136 - panic("not implemented") 137 137 - } 138 138 - 139 139 - func (bs *SqliteBlockstore) UpdateRepo(ctx context.Context, root cid.Cid, rev string) error { 140 140 - if err := bs.db.Exec("UPDATE repos SET root = ?, rev = ? WHERE did = ?", nil, root.Bytes(), rev, bs.did).Error; err != nil { 141 141 - return err 142 142 - } 143 143 - 144 144 - return nil 145 145 - } 146 146 - 147 147 - func (bs *SqliteBlockstore) Execute(ctx context.Context) error { 148 148 - if !bs.readonly { 149 149 - return fmt.Errorf("blockstore was not readonly") 150 150 - } 151 151 - 152 152 - bs.readonly = false 153 153 - for _, b := range bs.inserts { 154 154 - bs.Put(ctx, b) 155 155 - } 156 156 - bs.readonly = true 157 157 - 158 158 - return nil 159 159 - } 160 160 - 161 161 - func (bs *SqliteBlockstore) GetLog() map[cid.Cid]blocks.Block { 162 162 - return bs.inserts 163 163 - }

-186

cmd/admin/main.go

··· 1 1 - package main 2 2 - 3 3 - import ( 4 4 - "crypto/ecdsa" 5 5 - "crypto/elliptic" 6 6 - "crypto/rand" 7 7 - "encoding/json" 8 8 - "fmt" 9 9 - "os" 10 10 - "time" 11 11 - 12 12 - "github.com/bluesky-social/indigo/atproto/crypto" 13 13 - "github.com/bluesky-social/indigo/atproto/syntax" 14 14 - "github.com/haileyok/cocoon/internal/helpers" 15 15 - "github.com/lestrrat-go/jwx/v2/jwk" 16 16 - "github.com/urfave/cli/v2" 17 17 - "golang.org/x/crypto/bcrypt" 18 18 - "gorm.io/driver/sqlite" 19 19 - "gorm.io/gorm" 20 20 - ) 21 21 - 22 22 - func main() { 23 23 - app := cli.App{ 24 24 - Name: "admin", 25 25 - Commands: cli.Commands{ 26 26 - runCreateRotationKey, 27 27 - runCreatePrivateJwk, 28 28 - runCreateInviteCode, 29 29 - runResetPassword, 30 30 - }, 31 31 - ErrWriter: os.Stdout, 32 32 - } 33 33 - 34 34 - app.Run(os.Args) 35 35 - } 36 36 - 37 37 - var runCreateRotationKey = &cli.Command{ 38 38 - Name: "create-rotation-key", 39 39 - Usage: "creates a rotation key for your pds", 40 40 - Flags: []cli.Flag{ 41 41 - &cli.StringFlag{ 42 42 - Name: "out", 43 43 - Required: true, 44 44 - Usage: "output file for your rotation key", 45 45 - }, 46 46 - }, 47 47 - Action: func(cmd *cli.Context) error { 48 48 - key, err := crypto.GeneratePrivateKeyK256() 49 49 - if err != nil { 50 50 - return err 51 51 - } 52 52 - 53 53 - bytes := key.Bytes() 54 54 - 55 55 - if err := os.WriteFile(cmd.String("out"), bytes, 0644); err != nil { 56 56 - return err 57 57 - } 58 58 - 59 59 - return nil 60 60 - }, 61 61 - } 62 62 - 63 63 - var runCreatePrivateJwk = &cli.Command{ 64 64 - Name: "create-private-jwk", 65 65 - Usage: "creates a private jwk for your pds", 66 66 - Flags: []cli.Flag{ 67 67 - &cli.StringFlag{ 68 68 - Name: "out", 69 69 - Required: true, 70 70 - Usage: "output file for your jwk", 71 71 - }, 72 72 - }, 73 73 - Action: func(cmd *cli.Context) error { 74 74 - privKey, err := ecdsa.GenerateKey(elliptic.P256(), rand.Reader) 75 75 - if err != nil { 76 76 - return err 77 77 - } 78 78 - 79 79 - key, err := jwk.FromRaw(privKey) 80 80 - if err != nil { 81 81 - return err 82 82 - } 83 83 - 84 84 - kid := fmt.Sprintf("%d", time.Now().Unix()) 85 85 - 86 86 - if err := key.Set(jwk.KeyIDKey, kid); err != nil { 87 87 - return err 88 88 - } 89 89 - 90 90 - b, err := json.Marshal(key) 91 91 - if err != nil { 92 92 - return err 93 93 - } 94 94 - 95 95 - if err := os.WriteFile(cmd.String("out"), b, 0644); err != nil { 96 96 - return err 97 97 - } 98 98 - 99 99 - return nil 100 100 - }, 101 101 - } 102 102 - 103 103 - var runCreateInviteCode = &cli.Command{ 104 104 - Name: "create-invite-code", 105 105 - Usage: "creates an invite code", 106 106 - Flags: []cli.Flag{ 107 107 - &cli.StringFlag{ 108 108 - Name: "for", 109 109 - Usage: "optional did to assign the invite code to", 110 110 - }, 111 111 - &cli.IntFlag{ 112 112 - Name: "uses", 113 113 - Usage: "number of times the invite code can be used", 114 114 - Value: 1, 115 115 - }, 116 116 - }, 117 117 - Action: func(cmd *cli.Context) error { 118 118 - db, err := newDb() 119 119 - if err != nil { 120 120 - return err 121 121 - } 122 122 - 123 123 - forDid := "did:plc:123" 124 124 - if cmd.String("for") != "" { 125 125 - did, err := syntax.ParseDID(cmd.String("for")) 126 126 - if err != nil { 127 127 - return err 128 128 - } 129 129 - 130 130 - forDid = did.String() 131 131 - } 132 132 - 133 133 - uses := cmd.Int("uses") 134 134 - 135 135 - code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(8), helpers.RandomVarchar(8)) 136 136 - 137 137 - if err := db.Exec("INSERT INTO invite_codes (did, code, remaining_use_count) VALUES (?, ?, ?)", forDid, code, uses).Error; err != nil { 138 138 - return err 139 139 - } 140 140 - 141 141 - fmt.Printf("New invite code created with %d uses: %s\n", uses, code) 142 142 - 143 143 - return nil 144 144 - }, 145 145 - } 146 146 - 147 147 - var runResetPassword = &cli.Command{ 148 148 - Name: "reset-password", 149 149 - Usage: "resets a password", 150 150 - Flags: []cli.Flag{ 151 151 - &cli.StringFlag{ 152 152 - Name: "did", 153 153 - Usage: "did of the user who's password you want to reset", 154 154 - }, 155 155 - }, 156 156 - Action: func(cmd *cli.Context) error { 157 157 - db, err := newDb() 158 158 - if err != nil { 159 159 - return err 160 160 - } 161 161 - 162 162 - didStr := cmd.String("did") 163 163 - did, err := syntax.ParseDID(didStr) 164 164 - if err != nil { 165 165 - return err 166 166 - } 167 167 - 168 168 - newPass := fmt.Sprintf("%s-%s", helpers.RandomVarchar(12), helpers.RandomVarchar(12)) 169 169 - hashed, err := bcrypt.GenerateFromPassword([]byte(newPass), 10) 170 170 - if err != nil { 171 171 - return err 172 172 - } 173 173 - 174 174 - if err := db.Exec("UPDATE repos SET password = ? WHERE did = ?", hashed, did.String()).Error; err != nil { 175 175 - return err 176 176 - } 177 177 - 178 178 - fmt.Printf("Password for %s has been reset to: %s", did.String(), newPass) 179 179 - 180 180 - return nil 181 181 - }, 182 182 - } 183 183 - 184 184 - func newDb() (*gorm.DB, error) { 185 185 - return gorm.Open(sqlite.Open("cocoon.db"), &gorm.Config{}) 186 186 - }

+187 -2

cmd/cocoon/main.go

··· 1 1 package main 2 2 3 3 import ( 4 4 + "crypto/ecdsa" 5 5 + "crypto/elliptic" 6 6 + "crypto/rand" 7 7 + "encoding/json" 4 8 "fmt" 5 9 "os" 10 10 + "time" 6 11 12 12 + "github.com/bluesky-social/indigo/atproto/crypto" 13 13 + "github.com/bluesky-social/indigo/atproto/syntax" 14 14 + "github.com/haileyok/cocoon/internal/helpers" 7 15 "github.com/haileyok/cocoon/server" 8 16 _ "github.com/joho/godotenv/autoload" 17 17 + "github.com/lestrrat-go/jwx/v2/jwk" 9 18 "github.com/urfave/cli/v2" 19 19 + "golang.org/x/crypto/bcrypt" 20 20 + "gorm.io/driver/sqlite" 21 21 + "gorm.io/gorm" 10 22 ) 11 23 12 24 var Version = "dev" ··· 115 127 Name: "s3-secret-key", 116 128 EnvVars: []string{"COCOON_S3_SECRET_KEY"}, 117 129 }, 130 130 + &cli.StringFlag{ 131 131 + Name: "session-secret", 132 132 + EnvVars: []string{"COCOON_SESSION_SECRET"}, 133 133 + }, 134 134 + &cli.StringFlag{ 135 135 + Name: "default-atproto-proxy", 136 136 + EnvVars: []string{"COCOON_DEFAULT_ATPROTO_PROXY"}, 137 137 + Value: "did:web:api.bsky.app#bsky_appview", 138 138 + }, 139 139 + &cli.StringFlag{ 140 140 + Name: "blockstore-variant", 141 141 + EnvVars: []string{"COCOON_BLOCKSTORE_VARIANT"}, 142 142 + Value: "sqlite", 143 143 + }, 118 144 }, 119 145 Commands: []*cli.Command{ 120 120 - run, 146 146 + runServe, 147 147 + runCreateRotationKey, 148 148 + runCreatePrivateJwk, 149 149 + runCreateInviteCode, 150 150 + runResetPassword, 121 151 }, 122 152 ErrWriter: os.Stdout, 123 153 Version: Version, ··· 128 158 } 129 159 } 130 160 131 131 - var run = &cli.Command{ 161 161 + var runServe = &cli.Command{ 132 162 Name: "run", 133 163 Usage: "Start the cocoon PDS", 134 164 Flags: []cli.Flag{}, 135 165 Action: func(cmd *cli.Context) error { 166 166 + 136 167 s, err := server.New(&server.Args{ 137 168 Addr: cmd.String("addr"), 138 169 DbName: cmd.String("db-name"), ··· 158 189 AccessKey: cmd.String("s3-access-key"), 159 190 SecretKey: cmd.String("s3-secret-key"), 160 191 }, 192 192 + SessionSecret: cmd.String("session-secret"), 193 193 + DefaultAtprotoProxy: cmd.String("default-atproto-proxy"), 194 194 + BlockstoreVariant: server.MustReturnBlockstoreVariant(cmd.String("blockstore-variant")), 161 195 }) 162 196 if err != nil { 163 197 fmt.Printf("error creating cocoon: %v", err) ··· 172 206 return nil 173 207 }, 174 208 } 209 209 + 210 210 + var runCreateRotationKey = &cli.Command{ 211 211 + Name: "create-rotation-key", 212 212 + Usage: "creates a rotation key for your pds", 213 213 + Flags: []cli.Flag{ 214 214 + &cli.StringFlag{ 215 215 + Name: "out", 216 216 + Required: true, 217 217 + Usage: "output file for your rotation key", 218 218 + }, 219 219 + }, 220 220 + Action: func(cmd *cli.Context) error { 221 221 + key, err := crypto.GeneratePrivateKeyK256() 222 222 + if err != nil { 223 223 + return err 224 224 + } 225 225 + 226 226 + bytes := key.Bytes() 227 227 + 228 228 + if err := os.WriteFile(cmd.String("out"), bytes, 0644); err != nil { 229 229 + return err 230 230 + } 231 231 + 232 232 + return nil 233 233 + }, 234 234 + } 235 235 + 236 236 + var runCreatePrivateJwk = &cli.Command{ 237 237 + Name: "create-private-jwk", 238 238 + Usage: "creates a private jwk for your pds", 239 239 + Flags: []cli.Flag{ 240 240 + &cli.StringFlag{ 241 241 + Name: "out", 242 242 + Required: true, 243 243 + Usage: "output file for your jwk", 244 244 + }, 245 245 + }, 246 246 + Action: func(cmd *cli.Context) error { 247 247 + privKey, err := ecdsa.GenerateKey(elliptic.P256(), rand.Reader) 248 248 + if err != nil { 249 249 + return err 250 250 + } 251 251 + 252 252 + key, err := jwk.FromRaw(privKey) 253 253 + if err != nil { 254 254 + return err 255 255 + } 256 256 + 257 257 + kid := fmt.Sprintf("%d", time.Now().Unix()) 258 258 + 259 259 + if err := key.Set(jwk.KeyIDKey, kid); err != nil { 260 260 + return err 261 261 + } 262 262 + 263 263 + b, err := json.Marshal(key) 264 264 + if err != nil { 265 265 + return err 266 266 + } 267 267 + 268 268 + if err := os.WriteFile(cmd.String("out"), b, 0644); err != nil { 269 269 + return err 270 270 + } 271 271 + 272 272 + return nil 273 273 + }, 274 274 + } 275 275 + 276 276 + var runCreateInviteCode = &cli.Command{ 277 277 + Name: "create-invite-code", 278 278 + Usage: "creates an invite code", 279 279 + Flags: []cli.Flag{ 280 280 + &cli.StringFlag{ 281 281 + Name: "for", 282 282 + Usage: "optional did to assign the invite code to", 283 283 + }, 284 284 + &cli.IntFlag{ 285 285 + Name: "uses", 286 286 + Usage: "number of times the invite code can be used", 287 287 + Value: 1, 288 288 + }, 289 289 + }, 290 290 + Action: func(cmd *cli.Context) error { 291 291 + db, err := newDb() 292 292 + if err != nil { 293 293 + return err 294 294 + } 295 295 + 296 296 + forDid := "did:plc:123" 297 297 + if cmd.String("for") != "" { 298 298 + did, err := syntax.ParseDID(cmd.String("for")) 299 299 + if err != nil { 300 300 + return err 301 301 + } 302 302 + 303 303 + forDid = did.String() 304 304 + } 305 305 + 306 306 + uses := cmd.Int("uses") 307 307 + 308 308 + code := fmt.Sprintf("%s-%s", helpers.RandomVarchar(8), helpers.RandomVarchar(8)) 309 309 + 310 310 + if err := db.Exec("INSERT INTO invite_codes (did, code, remaining_use_count) VALUES (?, ?, ?)", forDid, code, uses).Error; err != nil { 311 311 + return err 312 312 + } 313 313 + 314 314 + fmt.Printf("New invite code created with %d uses: %s\n", uses, code) 315 315 + 316 316 + return nil 317 317 + }, 318 318 + } 319 319 + 320 320 + var runResetPassword = &cli.Command{ 321 321 + Name: "reset-password", 322 322 + Usage: "resets a password", 323 323 + Flags: []cli.Flag{ 324 324 + &cli.StringFlag{ 325 325 + Name: "did", 326 326 + Usage: "did of the user who's password you want to reset", 327 327 + }, 328 328 + }, 329 329 + Action: func(cmd *cli.Context) error { 330 330 + db, err := newDb() 331 331 + if err != nil { 332 332 + return err 333 333 + } 334 334 + 335 335 + didStr := cmd.String("did") 336 336 + did, err := syntax.ParseDID(didStr) 337 337 + if err != nil { 338 338 + return err 339 339 + } 340 340 + 341 341 + newPass := fmt.Sprintf("%s-%s", helpers.RandomVarchar(12), helpers.RandomVarchar(12)) 342 342 + hashed, err := bcrypt.GenerateFromPassword([]byte(newPass), 10) 343 343 + if err != nil { 344 344 + return err 345 345 + } 346 346 + 347 347 + if err := db.Exec("UPDATE repos SET password = ? WHERE did = ?", hashed, did.String()).Error; err != nil { 348 348 + return err 349 349 + } 350 350 + 351 351 + fmt.Printf("Password for %s has been reset to: %s", did.String(), newPass) 352 352 + 353 353 + return nil 354 354 + }, 355 355 + } 356 356 + 357 357 + func newDb() (*gorm.DB, error) { 358 358 + return gorm.Open(sqlite.Open("cocoon.db"), &gorm.Config{}) 359 359 + }

+45

cspell.json

··· 1 1 + { 2 2 + "version": "0.2", 3 3 + "language": "en", 4 4 + "words": [ 5 5 + "atproto", 6 6 + "bsky", 7 7 + "Cocoon", 8 8 + "PDS", 9 9 + "Plc", 10 10 + "plc", 11 11 + "repo", 12 12 + "InviteCodes", 13 13 + "InviteCode", 14 14 + "Invite", 15 15 + "Signin", 16 16 + "Signout", 17 17 + "JWKS", 18 18 + "dpop", 19 19 + "BGS", 20 20 + "pico", 21 21 + "picocss", 22 22 + "par", 23 23 + "blobs", 24 24 + "blob", 25 25 + "did", 26 26 + "DID", 27 27 + "OAuth", 28 28 + "oauth", 29 29 + "par", 30 30 + "Cocoon", 31 31 + "memcache", 32 32 + "db", 33 33 + "helpers", 34 34 + "middleware", 35 35 + "repo", 36 36 + "static", 37 37 + "pico", 38 38 + "picocss", 39 39 + "MIT", 40 40 + "Go" 41 41 + ], 42 42 + "ignorePaths": [ 43 43 + "server/static/pico.css" 44 44 + ] 45 45 + }

+20 -14

go.mod

··· 8 8 github.com/bluesky-social/indigo v0.0.0-20250414202759-826fcdeaa36b 9 9 github.com/btcsuite/websocket v0.0.0-20150119174127-31079b680792 10 10 github.com/domodwyer/mailyak/v3 v3.6.2 11 11 + github.com/go-pkgz/expirable-cache/v3 v3.0.0 11 12 github.com/go-playground/validator v9.31.0+incompatible 12 13 github.com/golang-jwt/jwt/v4 v4.5.2 13 14 github.com/google/uuid v1.4.0 15 15 + github.com/gorilla/sessions v1.4.0 14 16 github.com/gorilla/websocket v1.5.1 17 17 + github.com/hako/durafmt v0.0.0-20210608085754-5c1018a4e16b 15 18 github.com/hashicorp/golang-lru/v2 v2.0.7 16 19 github.com/ipfs/go-block-format v0.2.0 17 20 github.com/ipfs/go-cid v0.4.1 18 21 github.com/ipfs/go-ipld-cbor v0.1.0 19 22 github.com/ipld/go-car v0.6.1-0.20230509095817-92d28eb23ba4 20 23 github.com/joho/godotenv v1.5.1 24 24 + github.com/labstack/echo-contrib v0.17.4 21 25 github.com/labstack/echo/v4 v4.13.3 22 26 github.com/lestrrat-go/jwx/v2 v2.0.12 23 27 github.com/multiformats/go-multihash v0.2.3 ··· 25 29 github.com/urfave/cli/v2 v2.27.6 26 30 github.com/whyrusleeping/cbor-gen v0.2.1-0.20241030202151-b7a6831be65e 27 31 gitlab.com/yawning/secp256k1-voi v0.0.0-20230925100816-f2616030848b 28 28 - golang.org/x/crypto v0.36.0 32 32 + golang.org/x/crypto v0.38.0 29 33 gorm.io/driver/sqlite v1.5.7 30 34 gorm.io/gorm v1.25.12 31 35 ) ··· 35 39 github.com/RussellLuo/slidingwindow v0.0.0-20200528002341-535bb99d338b // indirect 36 40 github.com/beorn7/perks v1.0.1 // indirect 37 41 github.com/carlmjohnson/versioninfo v0.22.5 // indirect 38 38 - github.com/cespare/xxhash/v2 v2.2.0 // indirect 42 42 + github.com/cespare/xxhash/v2 v2.3.0 // indirect 39 43 github.com/cpuguy83/go-md2man/v2 v2.0.5 // indirect 40 44 github.com/decred/dcrd/dcrec/secp256k1/v4 v4.2.0 // indirect 41 45 github.com/felixge/httpsnoop v1.0.4 // indirect ··· 47 51 github.com/gocql/gocql v1.7.0 // indirect 48 52 github.com/gogo/protobuf v1.3.2 // indirect 49 53 github.com/golang/snappy v0.0.4 // indirect 54 54 + github.com/gorilla/context v1.1.2 // indirect 55 55 + github.com/gorilla/securecookie v1.1.2 // indirect 50 56 github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed // indirect 51 57 github.com/hashicorp/go-cleanhttp v0.5.2 // indirect 52 58 github.com/hashicorp/go-retryablehttp v0.7.5 // indirect ··· 84 90 github.com/lestrrat-go/httprc v1.0.4 // indirect 85 91 github.com/lestrrat-go/iter v1.0.2 // indirect 86 92 github.com/lestrrat-go/option v1.0.1 // indirect 87 87 - github.com/mattn/go-colorable v0.1.13 // indirect 93 93 + github.com/mattn/go-colorable v0.1.14 // indirect 88 94 github.com/mattn/go-isatty v0.0.20 // indirect 89 95 github.com/mattn/go-sqlite3 v1.14.22 // indirect 90 90 - github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0 // indirect 91 96 github.com/minio/sha256-simd v1.0.1 // indirect 92 97 github.com/mr-tron/base58 v1.2.0 // indirect 93 98 github.com/multiformats/go-base32 v0.1.0 // indirect 94 99 github.com/multiformats/go-base36 v0.2.0 // indirect 95 100 github.com/multiformats/go-multibase v0.2.0 // indirect 96 101 github.com/multiformats/go-varint v0.0.7 // indirect 102 102 + github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 // indirect 97 103 github.com/opentracing/opentracing-go v1.2.0 // indirect 98 104 github.com/polydawn/refmt v0.89.1-0.20221221234430-40501e09de1f // indirect 99 99 - github.com/prometheus/client_golang v1.17.0 // indirect 100 100 - github.com/prometheus/client_model v0.5.0 // indirect 101 101 - github.com/prometheus/common v0.45.0 // indirect 102 102 - github.com/prometheus/procfs v0.12.0 // indirect 105 105 + github.com/prometheus/client_golang v1.22.0 // indirect 106 106 + github.com/prometheus/client_model v0.6.2 // indirect 107 107 + github.com/prometheus/common v0.63.0 // indirect 108 108 + github.com/prometheus/procfs v0.16.1 // indirect 103 109 github.com/russross/blackfriday/v2 v2.1.0 // indirect 104 110 github.com/samber/lo v1.49.1 // indirect 105 111 github.com/segmentio/asm v1.2.0 // indirect ··· 115 121 go.uber.org/atomic v1.11.0 // indirect 116 122 go.uber.org/multierr v1.11.0 // indirect 117 123 go.uber.org/zap v1.26.0 // indirect 118 118 - golang.org/x/net v0.33.0 // indirect 119 119 - golang.org/x/sync v0.12.0 // indirect 120 120 - golang.org/x/sys v0.31.0 // indirect 121 121 - golang.org/x/text v0.23.0 // indirect 122 122 - golang.org/x/time v0.8.0 // indirect 124 124 + golang.org/x/net v0.40.0 // indirect 125 125 + golang.org/x/sync v0.14.0 // indirect 126 126 + golang.org/x/sys v0.33.0 // indirect 127 127 + golang.org/x/text v0.25.0 // indirect 128 128 + golang.org/x/time v0.11.0 // indirect 123 129 golang.org/x/xerrors v0.0.0-20231012003039-104605ab7028 // indirect 124 124 - google.golang.org/protobuf v1.33.0 // indirect 130 130 + google.golang.org/protobuf v1.36.6 // indirect 125 131 gopkg.in/go-playground/assert.v1 v1.2.1 // indirect 126 132 gopkg.in/inf.v0 v0.9.1 // indirect 127 133 gorm.io/driver/postgres v1.5.7 // indirect

+44 -32

go.sum

··· 24 24 github.com/btcsuite/websocket v0.0.0-20150119174127-31079b680792/go.mod h1:ghJtEyQwv5/p4Mg4C0fgbePVuGr935/5ddU9Z3TmDRY= 25 25 github.com/carlmjohnson/versioninfo v0.22.5 h1:O00sjOLUAFxYQjlN/bzYTuZiS0y6fWDQjMRvwtKgwwc= 26 26 github.com/carlmjohnson/versioninfo v0.22.5/go.mod h1:QT9mph3wcVfISUKd0i9sZfVrPviHuSF+cUtLjm2WSf8= 27 27 - github.com/cespare/xxhash/v2 v2.2.0 h1:DC2CZ1Ep5Y4k3ZQ899DldepgrayRUGE6BBZ/cd9Cj44= 28 28 - github.com/cespare/xxhash/v2 v2.2.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= 27 27 + github.com/cespare/xxhash/v2 v2.3.0 h1:UL815xU9SqsFlibzuggzjXhog7bL6oX9BbNZnL2UFvs= 28 28 + github.com/cespare/xxhash/v2 v2.3.0/go.mod h1:VGX0DQ3Q6kWi7AoAeZDth3/j3BFtOZR5XLFGgcrjCOs= 29 29 github.com/cpuguy83/go-md2man/v2 v2.0.0-20190314233015-f79a8a8ca69d/go.mod h1:maD7wRr/U5Z6m/iR4s+kqSMx2CaBsrgA7czyZG/E6dU= 30 30 github.com/cpuguy83/go-md2man/v2 v2.0.5 h1:ZtcqGrnekaHpVLArFSe4HK5DoKx1T0rq2DwVB0alcyc= 31 31 github.com/cpuguy83/go-md2man/v2 v2.0.5/go.mod h1:tgQtvFlXSQOSOSIRvRPT7W67SCa46tRHOmNcaadrF8o= ··· 48 48 github.com/go-logr/logr v1.4.2/go.mod h1:9T104GzyrTigFIr8wt5mBrctHMim0Nb2HLGrmQ40KvY= 49 49 github.com/go-logr/stdr v1.2.2 h1:hSWxHoqTgW2S2qGc0LTAI563KZ5YKYRhT3MFKZMbjag= 50 50 github.com/go-logr/stdr v1.2.2/go.mod h1:mMo/vtBO5dYbehREoey6XUKy/eSumjCCveDpRre4VKE= 51 51 + github.com/go-pkgz/expirable-cache/v3 v3.0.0 h1:u3/gcu3sabLYiTCevoRKv+WzjIn5oo7P8XtiXBeRDLw= 52 52 + github.com/go-pkgz/expirable-cache/v3 v3.0.0/go.mod h1:2OQiDyEGQalYecLWmXprm3maPXeVb5/6/X7yRPYTzec= 51 53 github.com/go-playground/locales v0.14.1 h1:EWaQ/wswjilfKLTECiXz7Rh+3BjFhfDFKv/oXslEjJA= 52 54 github.com/go-playground/locales v0.14.1/go.mod h1:hxrqLVvrK65+Rwrd5Fc6F2O76J/NuW9t0sjnWqG1slY= 53 55 github.com/go-playground/universal-translator v0.18.1 h1:Bcnm0ZwsGyWbCzImXv+pAJnYK9S473LQFuzCbDbfSFY= ··· 68 70 github.com/golang/snappy v0.0.3/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= 69 71 github.com/golang/snappy v0.0.4 h1:yAGX7huGHXlcLOEtBnF4w7FQwA26wojNCwOYAEhLjQM= 70 72 github.com/golang/snappy v0.0.4/go.mod h1:/XxbfmMg8lxefKM7IXC3fBNl/7bRcc72aCRzEWrmP2Q= 71 71 - github.com/google/go-cmp v0.6.0 h1:ofyhxvXcZhMsU5ulbFiLKl/XBFqE1GSq7atu8tAmTRI= 72 72 - github.com/google/go-cmp v0.6.0/go.mod h1:17dUlkBOakJ0+DkrSSNjCkIjxS6bF9zb3elmeNGIjoY= 73 73 + github.com/google/go-cmp v0.7.0 h1:wk8382ETsv4JYUZwIsn6YpYiWiBsYLSJiTsyBybVuN8= 74 74 + github.com/google/go-cmp v0.7.0/go.mod h1:pXiqmnSA92OHEEa9HXL2W4E7lf9JzCmGVUdgjX3N/iU= 75 75 + github.com/google/gofuzz v1.2.0 h1:xRy4A+RhZaiKjJ1bPfwQ8sedCA+YS2YcCHW6ec7JMi0= 76 76 + github.com/google/gofuzz v1.2.0/go.mod h1:dBl0BpW6vV/+mYPU4Po3pmUjxk6FQPldtuIdl/M65Eg= 73 77 github.com/google/gopacket v1.1.19 h1:ves8RnFZPGiFnTS0uPQStjwru6uO6h+nlr9j6fL7kF8= 74 78 github.com/google/gopacket v1.1.19/go.mod h1:iJ8V8n6KS+z2U1A8pUwu8bW5SyEMkXJB8Yo/Vo+TKTo= 75 79 github.com/google/renameio v0.1.0/go.mod h1:KWCgfxg9yswjAJkECMjeO8J8rahYeXnNhOm40UhjYkI= ··· 77 81 github.com/google/uuid v1.4.0/go.mod h1:TIyPZe4MgqvfeYDBFedMoGGpEw/LqOeaOT+nhxU+yHo= 78 82 github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1 h1:EGx4pi6eqNxGaHF6qqu48+N2wcFQ5qg5FXgOdqsJ5d8= 79 83 github.com/gopherjs/gopherjs v0.0.0-20181017120253-0766667cb4d1/go.mod h1:wJfORRmW1u3UXTncJ5qlYoELFm8eSnnEO6hX4iZ3EWY= 84 84 + github.com/gorilla/context v1.1.2 h1:WRkNAv2uoa03QNIc1A6u4O7DAGMUVoopZhkiXWA2V1o= 85 85 + github.com/gorilla/context v1.1.2/go.mod h1:KDPwT9i/MeWHiLl90fuTgrt4/wPcv75vFAZLaOOcbxM= 86 86 + github.com/gorilla/securecookie v1.1.2 h1:YCIWL56dvtr73r6715mJs5ZvhtnY73hBvEF8kXD8ePA= 87 87 + github.com/gorilla/securecookie v1.1.2/go.mod h1:NfCASbcHqRSY+3a8tlWJwsQap2VX5pwzwo4h3eOamfo= 88 88 + github.com/gorilla/sessions v1.4.0 h1:kpIYOp/oi6MG/p5PgxApU8srsSw9tuFbt46Lt7auzqQ= 89 89 + github.com/gorilla/sessions v1.4.0/go.mod h1:FLWm50oby91+hl7p/wRxDth9bWSuk0qVL2emc7lT5ik= 80 90 github.com/gorilla/websocket v1.5.1 h1:gmztn0JnHVt9JZquRuzLw3g4wouNVzKL15iLr/zn/QY= 81 91 github.com/gorilla/websocket v1.5.1/go.mod h1:x3kM2JMyaluk02fnUJpQuwD2dCS5NDG2ZHL0uE0tcaY= 82 92 github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed h1:5upAirOpQc1Q53c0bnx2ufif5kANL7bfZWcc6VJWJd8= 83 93 github.com/hailocab/go-hostpool v0.0.0-20160125115350-e80d13ce29ed/go.mod h1:tMWxXQ9wFIaZeTI9F+hmhFiGpFmhOHzyShyFUhRm0H4= 94 94 + github.com/hako/durafmt v0.0.0-20210608085754-5c1018a4e16b h1:wDUNC2eKiL35DbLvsDhiblTUXHxcOPwQSCzi7xpQUN4= 95 95 + github.com/hako/durafmt v0.0.0-20210608085754-5c1018a4e16b/go.mod h1:VzxiSdG6j1pi7rwGm/xYI5RbtpBgM8sARDXlvEvxlu0= 84 96 github.com/hashicorp/go-cleanhttp v0.5.2 h1:035FKYIWjmULyFRBKPs8TBQoi0x6d9G4xc9neXJWAZQ= 85 97 github.com/hashicorp/go-cleanhttp v0.5.2/go.mod h1:kO/YDlP8L1346E6Sodw+PrpBSV4/SoxCXGY6BqNFT48= 86 98 github.com/hashicorp/go-hclog v0.9.2 h1:CG6TE5H9/JXsFWJCfoIVpKFIkFe6ysEuHirp4DxCsHI= ··· 196 208 github.com/kr/text v0.1.0/go.mod h1:4Jbv+DJW3UT/LiOwJeYQe1efqtUx/iVham/4vfdArNI= 197 209 github.com/kr/text v0.2.0 h1:5Nx0Ya0ZqY2ygV366QzturHI13Jq95ApcVaJBhpS+AY= 198 210 github.com/kr/text v0.2.0/go.mod h1:eLer722TekiGuMkidMxC/pM04lWEeraHUUmBw8l2grE= 211 211 + github.com/labstack/echo-contrib v0.17.4 h1:g5mfsrJfJTKv+F5uNKCyrjLK7js+ZW6HTjg4FnDxxgk= 212 212 + github.com/labstack/echo-contrib v0.17.4/go.mod h1:9O7ZPAHUeMGTOAfg80YqQduHzt0CzLak36PZRldYrZ0= 199 213 github.com/labstack/echo/v4 v4.13.3 h1:pwhpCPrTl5qry5HRdM5FwdXnhXSLSY+WE+YQSeCaafY= 200 214 github.com/labstack/echo/v4 v4.13.3/go.mod h1:o90YNEeQWjDozo584l7AwhJMHN0bOC4tAfg+Xox9q5g= 201 215 github.com/labstack/gommon v0.4.2 h1:F8qTUNXgG1+6WQmqoUWnz8WiEU60mXVVw0P4ht1WRA0= ··· 233 247 github.com/libp2p/go-nat v0.1.0/go.mod h1:X7teVkwRHNInVNWQiO/tAiAVRwSr5zoRz4YSTC3uRBM= 234 248 github.com/libp2p/go-netroute v0.2.1 h1:V8kVrpD8GK0Riv15/7VN6RbUQ3URNZVosw7H2v9tksU= 235 249 github.com/libp2p/go-netroute v0.2.1/go.mod h1:hraioZr0fhBjG0ZRXJJ6Zj2IVEVNx6tDTFQfSmcq7mQ= 236 236 - github.com/mattn/go-colorable v0.1.13 h1:fFA4WZxdEF4tXPZVKMLwD8oUnCTTo08duU7wxecdEvA= 237 237 - github.com/mattn/go-colorable v0.1.13/go.mod h1:7S9/ev0klgBDR4GtXTXX8a3vIGJpMovkB8vQcUbaXHg= 250 250 + github.com/mattn/go-colorable v0.1.14 h1:9A9LHSqF/7dyVVX6g0U9cwm9pG3kP9gSzcuIPHPsaIE= 251 251 + github.com/mattn/go-colorable v0.1.14/go.mod h1:6LmQG8QLFO4G5z1gPvYEzlUgJ2wF+stgPZH1UqBm1s8= 238 252 github.com/mattn/go-isatty v0.0.14/go.mod h1:7GGIvUiUoEMVVmxf/4nioHXj79iQHKdU27kJ6hsGG94= 239 239 - github.com/mattn/go-isatty v0.0.16/go.mod h1:kYGgaQfpe5nmfYZH+SKPsOc2e4SrIfOl2e/yFXSvRLM= 240 253 github.com/mattn/go-isatty v0.0.20 h1:xfD0iDuEKnDkl03q4limB+vH+GxLEtL/jb4xVJSWWEY= 241 254 github.com/mattn/go-isatty v0.0.20/go.mod h1:W+V8PltTTMOvKvAeJH7IuucS94S2C6jfK/D7dTCTo3Y= 242 255 github.com/mattn/go-sqlite3 v1.14.22 h1:2gZY6PC6kBnID23Tichd1K+Z0oS6nE/XwU+Vz/5o4kU= 243 256 github.com/mattn/go-sqlite3 v1.14.22/go.mod h1:Uh1q+B4BYcTPb+yiD3kU8Ct7aC0hY9fxUwlHK0RXw+Y= 244 244 - github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0 h1:jWpvCLoY8Z/e3VKvlsiIGKtc+UG6U5vzxaoagmhXfyg= 245 245 - github.com/matttproud/golang_protobuf_extensions/v2 v2.0.0/go.mod h1:QUyp042oQthUoa9bqDv0ER0wrtXnBruoNd7aNjkbP+k= 246 257 github.com/miekg/dns v1.1.50 h1:DQUfb9uc6smULcREF09Uc+/Gd46YWqJd5DbpPE9xkcA= 247 258 github.com/miekg/dns v1.1.50/go.mod h1:e3IlAVfNqAllflbibAZEWOXOQ+Ynzk/dDozDxY7XnME= 248 259 github.com/minio/sha256-simd v1.0.1 h1:6kaan5IFmwTNynnKKpDHe6FWHohJOHhCPchzK49dzMM= ··· 269 280 github.com/multiformats/go-multistream v0.4.1/go.mod h1:Mz5eykRVAjJWckE2U78c6xqdtyNUEhKSM0Lwar2p77Q= 270 281 github.com/multiformats/go-varint v0.0.7 h1:sWSGR+f/eu5ABZA2ZpYKBILXTTs9JWpdEM/nEGOHFS8= 271 282 github.com/multiformats/go-varint v0.0.7/go.mod h1:r8PUYw/fD/SjBCiKOoDlGF6QawOELpZAu9eioSos/OU= 283 283 + github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822 h1:C3w9PqII01/Oq1c1nUAm88MOHcQC9l5mIlSMApZMrHA= 284 284 + github.com/munnerz/goautoneg v0.0.0-20191010083416-a7dc8b61c822/go.mod h1:+n7T8mK8HuQTcFwEeznm/DIxMOiR9yIdICNftLE1DvQ= 272 285 github.com/opentracing/opentracing-go v1.2.0 h1:uEJPy/1a5RIPAJ0Ov+OIO8OxWu77jEv+1B0VhjKrZUs= 273 286 github.com/opentracing/opentracing-go v1.2.0/go.mod h1:GxEUsuufX4nBwe+T+Wl9TAgYrxe9dPLANfrWvHYVTgc= 274 287 github.com/petar/GoLLRB v0.0.0-20210522233825-ae3b015fd3e9 h1:1/WtZae0yGtPq+TI6+Tv1WTxkukpXeMlviSxvL7SRgk= ··· 278 291 github.com/pmezard/go-difflib v1.0.0/go.mod h1:iKH77koFhYxTK1pcRnkKkqfTogsbg7gZNVY4sRDYZ/4= 279 292 github.com/polydawn/refmt v0.89.1-0.20221221234430-40501e09de1f h1:VXTQfuJj9vKR4TCkEuWIckKvdHFeJH/huIFJ9/cXOB0= 280 293 github.com/polydawn/refmt v0.89.1-0.20221221234430-40501e09de1f/go.mod h1:/zvteZs/GwLtCgZ4BL6CBsk9IKIlexP43ObX9AxTqTw= 281 281 - github.com/prometheus/client_golang v1.17.0 h1:rl2sfwZMtSthVU752MqfjQozy7blglC+1SOtjMAMh+Q= 282 282 - github.com/prometheus/client_golang v1.17.0/go.mod h1:VeL+gMmOAxkS2IqfCq0ZmHSL+LjWfWDUmp1mBz9JgUY= 283 283 - github.com/prometheus/client_model v0.5.0 h1:VQw1hfvPvk3Uv6Qf29VrPF32JB6rtbgI6cYPYQjL0Qw= 284 284 - github.com/prometheus/client_model v0.5.0/go.mod h1:dTiFglRmd66nLR9Pv9f0mZi7B7fk5Pm3gvsjB5tr+kI= 285 285 - github.com/prometheus/common v0.45.0 h1:2BGz0eBc2hdMDLnO/8n0jeB3oPrt2D08CekT0lneoxM= 286 286 - github.com/prometheus/common v0.45.0/go.mod h1:YJmSTw9BoKxJplESWWxlbyttQR4uaEcGyv9MZjVOJsY= 287 287 - github.com/prometheus/procfs v0.12.0 h1:jluTpSng7V9hY0O2R9DzzJHYb2xULk9VTR1V1R/k6Bo= 288 288 - github.com/prometheus/procfs v0.12.0/go.mod h1:pcuDEFsWDnvcgNzo4EEweacyhjeA9Zk3cnaOZAZEfOo= 294 294 + github.com/prometheus/client_golang v1.22.0 h1:rb93p9lokFEsctTys46VnV1kLCDpVZ0a/Y92Vm0Zc6Q= 295 295 + github.com/prometheus/client_golang v1.22.0/go.mod h1:R7ljNsLXhuQXYZYtw6GAE9AZg8Y7vEW5scdCXrWRXC0= 296 296 + github.com/prometheus/client_model v0.6.2 h1:oBsgwpGs7iVziMvrGhE53c/GrLUsZdHnqNwqPLxwZyk= 297 297 + github.com/prometheus/client_model v0.6.2/go.mod h1:y3m2F6Gdpfy6Ut/GBsUqTWZqCUvMVzSfMLjcu6wAwpE= 298 298 + github.com/prometheus/common v0.63.0 h1:YR/EIY1o3mEFP/kZCD7iDMnLPlGyuU2Gb3HIcXnA98k= 299 299 + github.com/prometheus/common v0.63.0/go.mod h1:VVFF/fBIoToEnWRVkYoXEkq3R3paCoxG9PXP74SnV18= 300 300 + github.com/prometheus/procfs v0.16.1 h1:hZ15bTNuirocR6u0JZ6BAHHmwS1p8B4P6MRqxtzMyRg= 301 301 + github.com/prometheus/procfs v0.16.1/go.mod h1:teAbpZRB1iIAJYREa1LsoWUXykVXA1KlTmWl8x/U+Is= 289 302 github.com/rogpeppe/go-internal v1.3.0/go.mod h1:M8bDsm7K2OlrFYOpmOWEs/qY81heoFRclV5y23lUDJ4= 290 303 github.com/rogpeppe/go-internal v1.10.0 h1:TMyTOH3F/DB16zRVcYyreMH6GnZZrwQVAoYjRBZyWFQ= 291 304 github.com/rogpeppe/go-internal v1.10.0/go.mod h1:UQnix2H7Ngw/k4C5ijL5+65zddjncjaFoBhdsK/akog= ··· 373 386 golang.org/x/crypto v0.0.0-20200622213623-75b288015ac9/go.mod h1:LzIPMQfyMNhhGPhUkYOs5KpL4U8rLKemX1yGLhDgUto= 374 387 golang.org/x/crypto v0.0.0-20210921155107-089bfa567519/go.mod h1:GvvjBRRGRdwPK5ydBHafDWAxML/pGHZbMvKqRZ5+Abc= 375 388 golang.org/x/crypto v0.12.0/go.mod h1:NF0Gs7EO5K4qLn+Ylc+fih8BSTeIjAP05siRnAh98yw= 376 376 - golang.org/x/crypto v0.36.0 h1:AnAEvhDddvBdpY+uR+MyHmuZzzNqXSe/GvuDeob5L34= 377 377 - golang.org/x/crypto v0.36.0/go.mod h1:Y4J0ReaxCR1IMaabaSMugxJES1EpwhBHhv2bDHklZvc= 389 389 + golang.org/x/crypto v0.38.0 h1:jt+WWG8IZlBnVbomuhg2Mdq0+BBQaHbtqHEFEigjUV8= 390 390 + golang.org/x/crypto v0.38.0/go.mod h1:MvrbAqul58NNYPKnOra203SB9vpuZW0e+RRZV+Ggqjw= 378 391 golang.org/x/exp v0.0.0-20231110203233-9a3e6036ecaa h1:FRnLl4eNAQl8hwxVVC17teOw8kdjVDVAiFMtgUdTSRQ= 379 392 golang.org/x/exp v0.0.0-20231110203233-9a3e6036ecaa/go.mod h1:zk2irFbV9DP96SEBUUAy67IdHUaZuSnrz1n472HUCLE= 380 393 golang.org/x/lint v0.0.0-20190930215403-16217165b5de/go.mod h1:6SW0HCj/g11FgYtHlgUYUwCkIfeOF89ocIRzGO/8vkc= ··· 396 409 golang.org/x/net v0.0.0-20220722155237-a158d28d115b/go.mod h1:XRhObCWvk6IyKnWLug+ECip1KBveYUHfp+8e9klMJ9c= 397 410 golang.org/x/net v0.6.0/go.mod h1:2Tu9+aMcznHK/AK1HMvgo6xiTLG5rD5rZLDS+rp2Bjs= 398 411 golang.org/x/net v0.10.0/go.mod h1:0qNGK6F8kojg2nk9dLZ2mShWaEBan6FAoqfSigmmuDg= 399 399 - golang.org/x/net v0.33.0 h1:74SYHlV8BIgHIFC/LrYkOGIwL19eTYXQ5wc6TBuO36I= 400 400 - golang.org/x/net v0.33.0/go.mod h1:HXLR5J+9DxmrqMwG9qjGCxZ+zKXxBru04zlTvWlWuN4= 412 412 + golang.org/x/net v0.40.0 h1:79Xs7wF06Gbdcg4kdCCIQArK11Z1hr5POQ6+fIYHNuY= 413 413 + golang.org/x/net v0.40.0/go.mod h1:y0hY0exeL2Pku80/zKK7tpntoX23cqL3Oa6njdgRtds= 401 414 golang.org/x/sync v0.0.0-20190423024810-112230192c58/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 402 415 golang.org/x/sync v0.0.0-20190911185100-cd5d95a43a6e/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 403 416 golang.org/x/sync v0.0.0-20201020160332-67f06af15bc9/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 404 417 golang.org/x/sync v0.0.0-20210220032951-036812b2e83c/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 405 418 golang.org/x/sync v0.0.0-20220722155255-886fb9371eb4/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 406 419 golang.org/x/sync v0.1.0/go.mod h1:RxMgew5VJxzue5/jJTE5uejpjVlOe/izrB70Jof72aM= 407 407 - golang.org/x/sync v0.12.0 h1:MHc5BpPuC30uJk597Ri8TV3CNZcTLu6B6z4lJy+g6Jw= 408 408 - golang.org/x/sync v0.12.0/go.mod h1:1dzgHSNfp02xaA81J2MS99Qcpr2w7fw1gpm99rleRqA= 420 420 + golang.org/x/sync v0.14.0 h1:woo0S4Yywslg6hp4eUFjTVOyKt0RookbpAHG4c1HmhQ= 421 421 + golang.org/x/sync v0.14.0/go.mod h1:1dzgHSNfp02xaA81J2MS99Qcpr2w7fw1gpm99rleRqA= 409 422 golang.org/x/sys v0.0.0-20190215142949-d0b11bdaac8a/go.mod h1:STP8DvDyc/dI5b8T5hshtkjS+E42TnysNCUPdjciGhY= 410 423 golang.org/x/sys v0.0.0-20190412213103-97732733099d/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= 411 424 golang.org/x/sys v0.0.0-20200930185726-fdedc70b468f/go.mod h1:h1NjWce9XRLGQEsW7wpKNCjG9DtNlClVuFLEZdDNbEs= ··· 417 430 golang.org/x/sys v0.0.0-20220412211240-33da011f77ad/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 418 431 golang.org/x/sys v0.0.0-20220520151302-bc2c85ada10a/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 419 432 golang.org/x/sys v0.0.0-20220722155257-8c9f86f7a55f/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 420 420 - golang.org/x/sys v0.0.0-20220811171246-fbc7d0a398ab/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 421 433 golang.org/x/sys v0.5.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 422 434 golang.org/x/sys v0.6.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 423 435 golang.org/x/sys v0.8.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 424 436 golang.org/x/sys v0.11.0/go.mod h1:oPkhp1MJrh7nUepCBck5+mAzfO9JrbApNNgaTdGDITg= 425 425 - golang.org/x/sys v0.31.0 h1:ioabZlmFYtWhL+TRYpcnNlLwhyxaM9kWTDEmfnprqik= 426 426 - golang.org/x/sys v0.31.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= 437 437 + golang.org/x/sys v0.33.0 h1:q3i8TbbEz+JRD9ywIRlyRAQbM0qF7hu24q3teo2hbuw= 438 438 + golang.org/x/sys v0.33.0/go.mod h1:BJP2sWEmIv4KK5OTEluFJCKSidICx8ciO85XgH3Ak8k= 427 439 golang.org/x/term v0.0.0-20201126162022-7de9c90e9dd1/go.mod h1:bj7SfCRtBDWHUb9snDiAeCFNEtKQo2Wmx5Cou7ajbmo= 428 440 golang.org/x/term v0.0.0-20210927222741-03fcf44c2211/go.mod h1:jbD1KX2456YbFQfuXm/mYQcufACuNUgVhRMnK/tPxf8= 429 441 golang.org/x/term v0.5.0/go.mod h1:jMB1sMXY+tzblOD4FWmEbocvup2/aLOaQEp7JmGp78k= ··· 435 447 golang.org/x/text v0.7.0/go.mod h1:mrYo+phRRbMaCq/xk9113O4dZlRixOauAjOtrjsXDZ8= 436 448 golang.org/x/text v0.9.0/go.mod h1:e1OnstbJyHTd6l/uOt8jFFHp6TRDWZR/bV3emEE/zU8= 437 449 golang.org/x/text v0.12.0/go.mod h1:TvPlkZtksWOMsz7fbANvkp4WM8x/WCo/om8BMLbz+aE= 438 438 - golang.org/x/text v0.23.0 h1:D71I7dUrlY+VX0gQShAThNGHFxZ13dGLBHQLVl1mJlY= 439 439 - golang.org/x/text v0.23.0/go.mod h1:/BLNzu4aZCJ1+kcD0DNRotWKage4q2rGVAg4o22unh4= 440 440 - golang.org/x/time v0.8.0 h1:9i3RxcPv3PZnitoVGMPDKZSq1xW1gK1Xy3ArNOGZfEg= 441 441 - golang.org/x/time v0.8.0/go.mod h1:3BpzKBy/shNhVucY/MWOyx10tF3SFh9QdLuxbVysPQM= 450 450 + golang.org/x/text v0.25.0 h1:qVyWApTSYLk/drJRO5mDlNYskwQznZmkpV2c8q9zls4= 451 451 + golang.org/x/text v0.25.0/go.mod h1:WEdwpYrmk1qmdHvhkSTNPm3app7v4rsT8F2UD6+VHIA= 452 452 + golang.org/x/time v0.11.0 h1:/bpjEDfN9tkoN/ryeYHnv5hcMlc8ncjMcM4XBk5NWV0= 453 453 + golang.org/x/time v0.11.0/go.mod h1:CDIdPxbZBQxdj6cxyCIdrNogrJKMJ7pr37NYpMcMDSg= 442 454 golang.org/x/tools v0.0.0-20180917221912-90fa682c2a6e/go.mod h1:n7NCudcB/nEzxVGmLbDWY5pfWTLqBcC2KZ6jyYvM4mQ= 443 455 golang.org/x/tools v0.0.0-20190311212946-11955173bddd/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= 444 456 golang.org/x/tools v0.0.0-20190328211700-ab21143f2384/go.mod h1:LCzVGOaR6xXOjkQ3onu1FJEFr0SW1gC7cKk1uF8kGRs= ··· 459 471 golang.org/x/xerrors v0.0.0-20200804184101-5ec99f83aff1/go.mod h1:I/5z698sn9Ka8TeJc9MKroUUfqBBauWjQqLJ2OPfmY0= 460 472 golang.org/x/xerrors v0.0.0-20231012003039-104605ab7028 h1:+cNy6SZtPcJQH3LJVLOSmiC7MMxXNOb3PU/VUEz+EhU= 461 473 golang.org/x/xerrors v0.0.0-20231012003039-104605ab7028/go.mod h1:NDW/Ps6MPRej6fsCIbMTohpP40sJ/P/vI1MoTEGwX90= 462 462 - google.golang.org/protobuf v1.33.0 h1:uNO2rsAINq/JlFpSdYEKIZ0uKD/R9cpdv0T+yoGwGmI= 463 463 - google.golang.org/protobuf v1.33.0/go.mod h1:c6P6GXX6sHbq/GpV6MGZEdwhWPcYBgnhAHhKbcUYpos= 474 474 + google.golang.org/protobuf v1.36.6 h1:z1NpPI8ku2WgiWnf+t9wTPsn6eP1L7ksHUlkfLvd9xY= 475 475 + google.golang.org/protobuf v1.36.6/go.mod h1:jduwjTPXsFjZGTmRluh+L6NjiWu7pchiJ2/5YcXBHnY= 464 476 gopkg.in/check.v1 v0.0.0-20161208181325-20d25e280405/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= 465 477 gopkg.in/check.v1 v1.0.0-20180628173108-788fd7840127/go.mod h1:Co6ibVJAznAaIkqp8huTwlJQCZ016jof/cbN4VW5Yz0= 466 478 gopkg.in/check.v1 v1.0.0-20201130134442-10cb98267c6c h1:Hei/4ADfdWqJk1ZMxUNpqntNwaWcugrBjAiHlqqRiVk=

+73 -54

identity/identity.go

··· 13 13 "github.com/bluesky-social/indigo/util" 14 14 ) 15 15 16 16 - func ResolveHandle(ctx context.Context, cli *http.Client, handle string) (string, error) { 17 17 - if cli == nil { 18 18 - cli = util.RobustHTTPClient() 19 19 - } 20 20 - 21 21 - var did string 22 22 - 23 23 - _, err := syntax.ParseHandle(handle) 16 16 + func ResolveHandleFromTXT(ctx context.Context, handle string) (string, error) { 17 17 + name := fmt.Sprintf("_atproto.%s", handle) 18 18 + recs, err := net.LookupTXT(name) 24 19 if err != nil { 25 25 - return "", err 20 20 + return "", fmt.Errorf("handle could not be resolved via txt: %w", err) 26 21 } 27 22 28 28 - recs, err := net.LookupTXT(fmt.Sprintf("_atproto.%s", handle)) 29 29 - if err == nil { 30 30 - for _, rec := range recs { 31 31 - if strings.HasPrefix(rec, "did=") { 32 32 - did = strings.Split(rec, "did=")[1] 33 33 - break 23 23 + for _, rec := range recs { 24 24 + if strings.HasPrefix(rec, "did=") { 25 25 + maybeDid := strings.Split(rec, "did=")[1] 26 26 + if _, err := syntax.ParseDID(maybeDid); err == nil { 27 27 + return maybeDid, nil 34 28 } 35 29 } 36 36 - } else { 37 37 - fmt.Printf("erorr getting txt records: %v\n", err) 38 30 } 39 31 40 40 - if did == "" { 41 41 - req, err := http.NewRequestWithContext( 42 42 - ctx, 43 43 - "GET", 44 44 - fmt.Sprintf("https://%s/.well-known/atproto-did", handle), 45 45 - nil, 46 46 - ) 47 47 - if err != nil { 48 48 - return "", nil 49 49 - } 32 32 + return "", fmt.Errorf("handle could not be resolved via txt: no record found") 33 33 + } 50 34 51 51 - resp, err := http.DefaultClient.Do(req) 52 52 - if err != nil { 53 53 - return "", nil 54 54 - } 55 55 - defer resp.Body.Close() 35 35 + func ResolveHandleFromWellKnown(ctx context.Context, cli *http.Client, handle string) (string, error) { 36 36 + ustr := fmt.Sprintf("https://%s/.well=known/atproto-did", handle) 37 37 + req, err := http.NewRequestWithContext( 38 38 + ctx, 39 39 + "GET", 40 40 + ustr, 41 41 + nil, 42 42 + ) 43 43 + if err != nil { 44 44 + return "", fmt.Errorf("handle could not be resolved via web: %w", err) 45 45 + } 56 46 57 57 - if resp.StatusCode != http.StatusOK { 58 58 - io.Copy(io.Discard, resp.Body) 59 59 - return "", fmt.Errorf("unable to resolve handle") 60 60 - } 47 47 + resp, err := cli.Do(req) 48 48 + if err != nil { 49 49 + return "", fmt.Errorf("handle could not be resolved via web: %w", err) 50 50 + } 51 51 + defer resp.Body.Close() 61 52 62 62 - b, err := io.ReadAll(resp.Body) 63 63 - if err != nil { 64 64 - return "", err 65 65 - } 53 53 + b, err := io.ReadAll(resp.Body) 54 54 + if err != nil { 55 55 + return "", fmt.Errorf("handle could not be resolved via web: %w", err) 56 56 + } 66 57 67 67 - maybeDid := string(b) 58 58 + if resp.StatusCode != http.StatusOK { 59 59 + return "", fmt.Errorf("handle could not be resolved via web: invalid status code %d", resp.StatusCode) 60 60 + } 68 61 69 69 - if _, err := syntax.ParseDID(maybeDid); err != nil { 70 70 - return "", fmt.Errorf("unable to resolve handle") 71 71 - } 62 62 + maybeDid := string(b) 72 63 73 73 - did = maybeDid 64 64 + if _, err := syntax.ParseDID(maybeDid); err != nil { 65 65 + return "", fmt.Errorf("handle could not be resolved via web: invalid did in document") 74 66 } 75 67 76 76 - return did, nil 68 68 + return maybeDid, nil 77 69 } 78 70 79 79 - func FetchDidDoc(ctx context.Context, cli *http.Client, did string) (*DidDoc, error) { 71 71 + func ResolveHandle(ctx context.Context, cli *http.Client, handle string) (string, error) { 80 72 if cli == nil { 81 73 cli = util.RobustHTTPClient() 82 74 } 83 75 84 84 - var ustr string 76 76 + _, err := syntax.ParseHandle(handle) 77 77 + if err != nil { 78 78 + return "", err 79 79 + } 80 80 + 81 81 + if maybeDidFromTxt, err := ResolveHandleFromTXT(ctx, handle); err == nil { 82 82 + return maybeDidFromTxt, nil 83 83 + } 84 84 + 85 85 + if maybeDidFromWeb, err := ResolveHandleFromWellKnown(ctx, cli, handle); err == nil { 86 86 + return maybeDidFromWeb, nil 87 87 + } 88 88 + 89 89 + return "", fmt.Errorf("handle could not be resolved") 90 90 + } 91 91 + 92 92 + func DidToDocUrl(did string) (string, error) { 85 93 if strings.HasPrefix(did, "did:plc:") { 86 86 - ustr = fmt.Sprintf("https://plc.directory/%s", did) 94 94 + return fmt.Sprintf("https://plc.directory/%s", did), nil 87 95 } else if strings.HasPrefix(did, "did:web:") { 88 88 - ustr = fmt.Sprintf("https://%s/.well-known/did.json", strings.TrimPrefix(did, "did:web:")) 96 96 + return fmt.Sprintf("https://%s/.well-known/did.json", strings.TrimPrefix(did, "did:web:")), nil 89 97 } else { 90 90 - return nil, fmt.Errorf("did was not a supported did type") 98 98 + return "", fmt.Errorf("did was not a supported did type") 99 99 + } 100 100 + } 101 101 + 102 102 + func FetchDidDoc(ctx context.Context, cli *http.Client, did string) (*DidDoc, error) { 103 103 + if cli == nil { 104 104 + cli = util.RobustHTTPClient() 105 105 + } 106 106 + 107 107 + ustr, err := DidToDocUrl(did) 108 108 + if err != nil { 109 109 + return nil, err 91 110 } 92 111 93 112 req, err := http.NewRequestWithContext(ctx, "GET", ustr, nil) ··· 95 114 return nil, err 96 115 } 97 116 98 98 - resp, err := http.DefaultClient.Do(req) 117 117 + resp, err := cli.Do(req) 99 118 if err != nil { 100 119 return nil, err 101 120 } ··· 103 122 104 123 if resp.StatusCode != 200 { 105 124 io.Copy(io.Discard, resp.Body) 106 106 - return nil, fmt.Errorf("could not find identity in plc registry") 125 125 + return nil, fmt.Errorf("unable to find did doc at url. did: %s. url: %s", did, ustr) 107 126 } 108 127 109 128 var diddoc DidDoc ··· 127 146 return nil, err 128 147 } 129 148 130 130 - resp, err := http.DefaultClient.Do(req) 149 149 + resp, err := cli.Do(req) 131 150 if err != nil { 132 151 return nil, err 133 152 }

+16 -5

identity/passport.go

··· 19 19 type Passport struct { 20 20 h *http.Client 21 21 bc BackingCache 22 22 - lk sync.Mutex 22 22 + mu sync.RWMutex 23 23 } 24 24 25 25 func NewPassport(h *http.Client, bc BackingCache) *Passport { ··· 30 30 return &Passport{ 31 31 h: h, 32 32 bc: bc, 33 33 - lk: sync.Mutex{}, 34 33 } 35 34 } 36 35 ··· 38 37 skipCache, _ := ctx.Value("skip-cache").(bool) 39 38 40 39 if !skipCache { 40 40 + p.mu.RLock() 41 41 cached, ok := p.bc.GetDoc(did) 42 42 + p.mu.RUnlock() 43 43 + 42 44 if ok { 43 45 return cached, nil 44 46 } 45 47 } 46 48 47 47 - p.lk.Lock() // this is pretty pathetic, and i should rethink this. but for now, fuck it 48 48 - defer p.lk.Unlock() 49 49 - 49 49 + // TODO: should coalesce requests here 50 50 doc, err := FetchDidDoc(ctx, p.h, did) 51 51 if err != nil { 52 52 return nil, err 53 53 } 54 54 55 55 + p.mu.Lock() 55 56 p.bc.PutDoc(did, doc) 57 57 + p.mu.Unlock() 56 58 57 59 return doc, nil 58 60 } ··· 61 63 skipCache, _ := ctx.Value("skip-cache").(bool) 62 64 63 65 if !skipCache { 66 66 + p.mu.RLock() 64 67 cached, ok := p.bc.GetDid(handle) 68 68 + p.mu.RUnlock() 69 69 + 65 70 if ok { 66 71 return cached, nil 67 72 } ··· 72 77 return "", err 73 78 } 74 79 80 80 + p.mu.Lock() 75 81 p.bc.PutDid(handle, did) 82 82 + p.mu.Unlock() 76 83 77 84 return did, nil 78 85 } 79 86 80 87 func (p *Passport) BustDoc(ctx context.Context, did string) error { 88 88 + p.mu.Lock() 89 89 + defer p.mu.Unlock() 81 90 return p.bc.BustDoc(did) 82 91 } 83 92 84 93 func (p *Passport) BustDid(ctx context.Context, handle string) error { 94 94 + p.mu.Lock() 95 95 + defer p.mu.Unlock() 85 96 return p.bc.BustDid(handle) 86 97 }

+60

internal/helpers/helpers.go

··· 1 1 package helpers 2 2 3 3 import ( 4 4 + crand "crypto/rand" 5 5 + "encoding/hex" 6 6 + "errors" 4 7 "math/rand" 8 8 + "net/url" 5 9 10 10 + "github.com/Azure/go-autorest/autorest/to" 6 11 "github.com/labstack/echo/v4" 12 12 + "github.com/lestrrat-go/jwx/v2/jwk" 7 13 ) 8 14 9 15 // This will confirm to the regex in the application if 5 chars are used for each side of the - ··· 26 32 return genericError(e, 400, msg) 27 33 } 28 34 35 35 + func InvalidTokenError(e echo.Context) error { 36 36 + return InputError(e, to.StringPtr("InvalidToken")) 37 37 + } 38 38 + 39 39 + func ExpiredTokenError(e echo.Context) error { 40 40 + // WARN: See https://github.com/bluesky-social/atproto/discussions/3319 41 41 + return e.JSON(400, map[string]string{ 42 42 + "error": "ExpiredToken", 43 43 + "message": "*", 44 44 + }) 45 45 + } 46 46 + 29 47 func genericError(e echo.Context, code int, msg string) error { 30 48 return e.JSON(code, map[string]string{ 31 49 "error": msg, ··· 39 57 } 40 58 return string(b) 41 59 } 60 60 + 61 61 + func RandomHex(n int) (string, error) { 62 62 + bytes := make([]byte, n) 63 63 + if _, err := crand.Read(bytes); err != nil { 64 64 + return "", err 65 65 + } 66 66 + return hex.EncodeToString(bytes), nil 67 67 + } 68 68 + 69 69 + func RandomBytes(n int) []byte { 70 70 + bs := make([]byte, n) 71 71 + crand.Read(bs) 72 72 + return bs 73 73 + } 74 74 + 75 75 + func ParseJWKFromBytes(b []byte) (jwk.Key, error) { 76 76 + return jwk.ParseKey(b) 77 77 + } 78 78 + 79 79 + func OauthParseHtu(htu string) (string, error) { 80 80 + u, err := url.Parse(htu) 81 81 + if err != nil { 82 82 + return "", errors.New("`htu` is not a valid URL") 83 83 + } 84 84 + 85 85 + if u.User != nil { 86 86 + _, containsPass := u.User.Password() 87 87 + if u.User.Username() != "" || containsPass { 88 88 + return "", errors.New("`htu` must not contain credentials") 89 89 + } 90 90 + } 91 91 + 92 92 + if u.Scheme != "http" && u.Scheme != "https" { 93 93 + return "", errors.New("`htu` must be http or https") 94 94 + } 95 95 + 96 96 + return OauthNormalizeHtu(u), nil 97 97 + } 98 98 + 99 99 + func OauthNormalizeHtu(u *url.URL) string { 100 100 + return u.Scheme + "://" + u.Host + u.RawPath 101 101 + }

+8

oauth/client/client.go

··· 1 1 + package client 2 2 + 3 3 + import "github.com/lestrrat-go/jwx/v2/jwk" 4 4 + 5 5 + type Client struct { 6 6 + Metadata *Metadata 7 7 + JWKS jwk.Key 8 8 + }

+389

oauth/client/manager.go

··· 1 1 + package client 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + "encoding/json" 6 6 + "errors" 7 7 + "fmt" 8 8 + "io" 9 9 + "log/slog" 10 10 + "net/http" 11 11 + "net/url" 12 12 + "slices" 13 13 + "strings" 14 14 + "time" 15 15 + 16 16 + cache "github.com/go-pkgz/expirable-cache/v3" 17 17 + "github.com/haileyok/cocoon/internal/helpers" 18 18 + "github.com/lestrrat-go/jwx/v2/jwk" 19 19 + ) 20 20 + 21 21 + type Manager struct { 22 22 + cli *http.Client 23 23 + logger *slog.Logger 24 24 + jwksCache cache.Cache[string, jwk.Key] 25 25 + metadataCache cache.Cache[string, Metadata] 26 26 + } 27 27 + 28 28 + type ManagerArgs struct { 29 29 + Cli *http.Client 30 30 + Logger *slog.Logger 31 31 + } 32 32 + 33 33 + func NewManager(args ManagerArgs) *Manager { 34 34 + if args.Logger == nil { 35 35 + args.Logger = slog.Default() 36 36 + } 37 37 + 38 38 + if args.Cli == nil { 39 39 + args.Cli = http.DefaultClient 40 40 + } 41 41 + 42 42 + jwksCache := cache.NewCache[string, jwk.Key]().WithLRU().WithMaxKeys(500).WithTTL(5 * time.Minute) 43 43 + metadataCache := cache.NewCache[string, Metadata]().WithLRU().WithMaxKeys(500).WithTTL(5 * time.Minute) 44 44 + 45 45 + return &Manager{ 46 46 + cli: args.Cli, 47 47 + logger: args.Logger, 48 48 + jwksCache: jwksCache, 49 49 + metadataCache: metadataCache, 50 50 + } 51 51 + } 52 52 + 53 53 + func (cm *Manager) GetClient(ctx context.Context, clientId string) (*Client, error) { 54 54 + metadata, err := cm.getClientMetadata(ctx, clientId) 55 55 + if err != nil { 56 56 + return nil, err 57 57 + } 58 58 + 59 59 + var jwks jwk.Key 60 60 + if metadata.JWKS != nil { 61 61 + // TODO: this is kinda bad but whatever for now. there could obviously be more than one jwk, and we need to 62 62 + // make sure we use the right one 63 63 + k, err := helpers.ParseJWKFromBytes((*metadata.JWKS)[0]) 64 64 + if err != nil { 65 65 + return nil, err 66 66 + } 67 67 + jwks = k 68 68 + } else if metadata.JWKSURI != nil { 69 69 + maybeJwks, err := cm.getClientJwks(ctx, clientId, *metadata.JWKSURI) 70 70 + if err != nil { 71 71 + return nil, err 72 72 + } 73 73 + 74 74 + jwks = maybeJwks 75 75 + } 76 76 + 77 77 + return &Client{ 78 78 + Metadata: metadata, 79 79 + JWKS: jwks, 80 80 + }, nil 81 81 + } 82 82 + 83 83 + func (cm *Manager) getClientMetadata(ctx context.Context, clientId string) (*Metadata, error) { 84 84 + metadataCached, ok := cm.metadataCache.Get(clientId) 85 85 + if !ok { 86 86 + req, err := http.NewRequestWithContext(ctx, "GET", clientId, nil) 87 87 + if err != nil { 88 88 + return nil, err 89 89 + } 90 90 + 91 91 + resp, err := cm.cli.Do(req) 92 92 + if err != nil { 93 93 + return nil, err 94 94 + } 95 95 + defer resp.Body.Close() 96 96 + 97 97 + if resp.StatusCode != http.StatusOK { 98 98 + io.Copy(io.Discard, resp.Body) 99 99 + return nil, fmt.Errorf("fetching client metadata returned response code %d", resp.StatusCode) 100 100 + } 101 101 + 102 102 + b, err := io.ReadAll(resp.Body) 103 103 + if err != nil { 104 104 + return nil, fmt.Errorf("error reading bytes from client response: %w", err) 105 105 + } 106 106 + 107 107 + validated, err := validateAndParseMetadata(clientId, b) 108 108 + if err != nil { 109 109 + return nil, err 110 110 + } 111 111 + 112 112 + return validated, nil 113 113 + } else { 114 114 + return &metadataCached, nil 115 115 + } 116 116 + } 117 117 + 118 118 + func (cm *Manager) getClientJwks(ctx context.Context, clientId, jwksUri string) (jwk.Key, error) { 119 119 + jwks, ok := cm.jwksCache.Get(clientId) 120 120 + if !ok { 121 121 + req, err := http.NewRequestWithContext(ctx, "GET", jwksUri, nil) 122 122 + if err != nil { 123 123 + return nil, err 124 124 + } 125 125 + 126 126 + resp, err := cm.cli.Do(req) 127 127 + if err != nil { 128 128 + return nil, err 129 129 + } 130 130 + defer resp.Body.Close() 131 131 + 132 132 + if resp.StatusCode != http.StatusOK { 133 133 + io.Copy(io.Discard, resp.Body) 134 134 + return nil, fmt.Errorf("fetching client jwks returned response code %d", resp.StatusCode) 135 135 + } 136 136 + 137 137 + type Keys struct { 138 138 + Keys []map[string]any `json:"keys"` 139 139 + } 140 140 + 141 141 + var keys Keys 142 142 + if err := json.NewDecoder(resp.Body).Decode(&keys); err != nil { 143 143 + return nil, fmt.Errorf("error unmarshaling keys response: %w", err) 144 144 + } 145 145 + 146 146 + if len(keys.Keys) == 0 { 147 147 + return nil, errors.New("no keys in jwks response") 148 148 + } 149 149 + 150 150 + // TODO: this is again bad, we should be figuring out which one we need to use... 151 151 + b, err := json.Marshal(keys.Keys[0]) 152 152 + if err != nil { 153 153 + return nil, fmt.Errorf("could not marshal key: %w", err) 154 154 + } 155 155 + 156 156 + k, err := helpers.ParseJWKFromBytes(b) 157 157 + if err != nil { 158 158 + return nil, err 159 159 + } 160 160 + 161 161 + jwks = k 162 162 + } 163 163 + 164 164 + return jwks, nil 165 165 + } 166 166 + 167 167 + func validateAndParseMetadata(clientId string, b []byte) (*Metadata, error) { 168 168 + var metadataMap map[string]any 169 169 + if err := json.Unmarshal(b, &metadataMap); err != nil { 170 170 + return nil, fmt.Errorf("error unmarshaling metadata: %w", err) 171 171 + } 172 172 + 173 173 + _, jwksOk := metadataMap["jwks"].(string) 174 174 + _, jwksUriOk := metadataMap["jwks_uri"].(string) 175 175 + if jwksOk && jwksUriOk { 176 176 + return nil, errors.New("jwks_uri and jwks are mutually exclusive") 177 177 + } 178 178 + 179 179 + for _, k := range []string{ 180 180 + "default_max_age", 181 181 + "userinfo_signed_response_alg", 182 182 + "id_token_signed_response_alg", 183 183 + "userinfo_encryhpted_response_alg", 184 184 + "authorization_encrypted_response_enc", 185 185 + "authorization_encrypted_response_alg", 186 186 + "tls_client_certificate_bound_access_tokens", 187 187 + } { 188 188 + _, kOk := metadataMap[k] 189 189 + if kOk { 190 190 + return nil, fmt.Errorf("unsupported `%s` parameter", k) 191 191 + } 192 192 + } 193 193 + 194 194 + var metadata Metadata 195 195 + if err := json.Unmarshal(b, &metadata); err != nil { 196 196 + return nil, fmt.Errorf("error unmarshaling metadata: %w", err) 197 197 + } 198 198 + 199 199 + u, err := url.Parse(metadata.ClientURI) 200 200 + if err != nil { 201 201 + return nil, fmt.Errorf("unable to parse client uri: %w", err) 202 202 + } 203 203 + 204 204 + if isLocalHostname(u.Hostname()) { 205 205 + return nil, errors.New("`client_uri` hostname is invalid") 206 206 + } 207 207 + 208 208 + if metadata.Scope == "" { 209 209 + return nil, errors.New("missing `scopes` scope") 210 210 + } 211 211 + 212 212 + scopes := strings.Split(metadata.Scope, " ") 213 213 + if !slices.Contains(scopes, "atproto") { 214 214 + return nil, errors.New("missing `atproto` scope") 215 215 + } 216 216 + 217 217 + scopesMap := map[string]bool{} 218 218 + for _, scope := range scopes { 219 219 + if scopesMap[scope] { 220 220 + return nil, fmt.Errorf("duplicate scope `%s`", scope) 221 221 + } 222 222 + 223 223 + // TODO: check for unsupported scopes 224 224 + 225 225 + scopesMap[scope] = true 226 226 + } 227 227 + 228 228 + grantTypesMap := map[string]bool{} 229 229 + for _, gt := range metadata.GrantTypes { 230 230 + if grantTypesMap[gt] { 231 231 + return nil, fmt.Errorf("duplicate grant type `%s`", gt) 232 232 + } 233 233 + 234 234 + switch gt { 235 235 + case "implicit": 236 236 + return nil, errors.New("grantg type `implicit` is not allowed") 237 237 + case "authorization_code", "refresh_token": 238 238 + // TODO check if this grant type is supported 239 239 + default: 240 240 + return nil, fmt.Errorf("grant tyhpe `%s` is not supported", gt) 241 241 + } 242 242 + 243 243 + grantTypesMap[gt] = true 244 244 + } 245 245 + 246 246 + if metadata.ClientID != clientId { 247 247 + return nil, errors.New("`client_id` does not match") 248 248 + } 249 249 + 250 250 + subjectType, subjectTypeOk := metadataMap["subject_type"].(string) 251 251 + if subjectTypeOk && subjectType != "public" { 252 252 + return nil, errors.New("only public `subject_type` is supported") 253 253 + } 254 254 + 255 255 + switch metadata.TokenEndpointAuthMethod { 256 256 + case "none": 257 257 + if metadata.TokenEndpointAuthSigningAlg != "" { 258 258 + return nil, errors.New("token_endpoint_auth_method `none` must not have token_endpoint_auth_signing_alg") 259 259 + } 260 260 + case "private_key_jwt": 261 261 + if metadata.JWKS == nil && metadata.JWKSURI == nil { 262 262 + return nil, errors.New("private_key_jwt auth method requires jwks or jwks_uri") 263 263 + } 264 264 + 265 265 + if metadata.JWKS != nil && len(*metadata.JWKS) == 0 { 266 266 + return nil, errors.New("private_key_jwt auth method requires atleast one key in jwks") 267 267 + } 268 268 + 269 269 + if metadata.TokenEndpointAuthSigningAlg == "" { 270 270 + return nil, errors.New("missing token_endpoint_auth_signing_alg in client metadata") 271 271 + } 272 272 + default: 273 273 + return nil, fmt.Errorf("unsupported client authentication method `%s`", metadata.TokenEndpointAuthMethod) 274 274 + } 275 275 + 276 276 + if !metadata.DpopBoundAccessTokens { 277 277 + return nil, errors.New("dpop_bound_access_tokens must be true") 278 278 + } 279 279 + 280 280 + if !slices.Contains(metadata.ResponseTypes, "code") { 281 281 + return nil, errors.New("response_types must inclue `code`") 282 282 + } 283 283 + 284 284 + if !slices.Contains(metadata.GrantTypes, "authorization_code") { 285 285 + return nil, errors.New("the `code` response type requires that `grant_types` contains `authorization_code`") 286 286 + } 287 287 + 288 288 + if len(metadata.RedirectURIs) == 0 { 289 289 + return nil, errors.New("at least one `redirect_uri` is required") 290 290 + } 291 291 + 292 292 + if metadata.ApplicationType == "native" && metadata.TokenEndpointAuthMethod != "none" { 293 293 + return nil, errors.New("native clients must authenticate using `none` method") 294 294 + } 295 295 + 296 296 + if metadata.ApplicationType == "web" && slices.Contains(metadata.GrantTypes, "implicit") { 297 297 + for _, ruri := range metadata.RedirectURIs { 298 298 + u, err := url.Parse(ruri) 299 299 + if err != nil { 300 300 + return nil, fmt.Errorf("error parsing redirect uri: %w", err) 301 301 + } 302 302 + 303 303 + if u.Scheme != "https" { 304 304 + return nil, errors.New("web clients must use https redirect uris") 305 305 + } 306 306 + 307 307 + if u.Hostname() == "localhost" { 308 308 + return nil, errors.New("web clients must not use localhost as the hostname") 309 309 + } 310 310 + } 311 311 + } 312 312 + 313 313 + for _, ruri := range metadata.RedirectURIs { 314 314 + u, err := url.Parse(ruri) 315 315 + if err != nil { 316 316 + return nil, fmt.Errorf("error parsing redirect uri: %w", err) 317 317 + } 318 318 + 319 319 + if u.User != nil { 320 320 + if u.User.Username() != "" { 321 321 + return nil, fmt.Errorf("redirect uri %s must not contain credentials", ruri) 322 322 + } 323 323 + 324 324 + if _, hasPass := u.User.Password(); hasPass { 325 325 + return nil, fmt.Errorf("redirect uri %s must not contain credentials", ruri) 326 326 + } 327 327 + } 328 328 + 329 329 + switch true { 330 330 + case u.Hostname() == "localhost": 331 331 + return nil, errors.New("loopback redirect uri is not allowed (use explicit ips instead)") 332 332 + case u.Hostname() == "127.0.0.1", u.Hostname() == "[::1]": 333 333 + if metadata.ApplicationType != "native" { 334 334 + return nil, errors.New("loopback redirect uris are only allowed for native apps") 335 335 + } 336 336 + 337 337 + if u.Port() != "" { 338 338 + // reference impl doesn't do anything with this? 339 339 + } 340 340 + 341 341 + if u.Scheme != "http" { 342 342 + return nil, fmt.Errorf("loopback redirect uri %s must use http", ruri) 343 343 + } 344 344 + 345 345 + break 346 346 + case u.Scheme == "http": 347 347 + return nil, errors.New("only loopbvack redirect uris are allowed to use the `http` scheme") 348 348 + case u.Scheme == "https": 349 349 + if isLocalHostname(u.Hostname()) { 350 350 + return nil, fmt.Errorf("redirect uri %s's domain must not be a local hostname", ruri) 351 351 + } 352 352 + break 353 353 + case strings.Contains(u.Scheme, "."): 354 354 + if metadata.ApplicationType != "native" { 355 355 + return nil, errors.New("private-use uri scheme redirect uris are only allowed for native apps") 356 356 + } 357 357 + 358 358 + revdomain := reverseDomain(u.Scheme) 359 359 + 360 360 + if isLocalHostname(revdomain) { 361 361 + return nil, errors.New("private use uri scheme redirect uris must not be local hostnames") 362 362 + } 363 363 + 364 364 + if strings.HasPrefix(u.String(), fmt.Sprintf("%s://", u.Scheme)) || u.Hostname() != "" || u.Port() != "" { 365 365 + return nil, fmt.Errorf("private use uri scheme must be in the form ") 366 366 + } 367 367 + default: 368 368 + return nil, fmt.Errorf("invalid redirect uri scheme `%s`", u.Scheme) 369 369 + } 370 370 + } 371 371 + 372 372 + return &metadata, nil 373 373 + } 374 374 + 375 375 + func isLocalHostname(hostname string) bool { 376 376 + pts := strings.Split(hostname, ".") 377 377 + if len(pts) < 2 { 378 378 + return true 379 379 + } 380 380 + 381 381 + tld := strings.ToLower(pts[len(pts)-1]) 382 382 + return tld == "test" || tld == "local" || tld == "localhost" || tld == "invalid" || tld == "example" 383 383 + } 384 384 + 385 385 + func reverseDomain(domain string) string { 386 386 + pts := strings.Split(domain, ".") 387 387 + slices.Reverse(pts) 388 388 + return strings.Join(pts, ".") 389 389 + }

+20

oauth/client/metadata.go

··· 1 1 + package client 2 2 + 3 3 + type Metadata struct { 4 4 + ClientID string `json:"client_id"` 5 5 + ClientName string `json:"client_name"` 6 6 + ClientURI string `json:"client_uri"` 7 7 + LogoURI string `json:"logo_uri"` 8 8 + TOSURI string `json:"tos_uri"` 9 9 + PolicyURI string `json:"policy_uri"` 10 10 + RedirectURIs []string `json:"redirect_uris"` 11 11 + GrantTypes []string `json:"grant_types"` 12 12 + ResponseTypes []string `json:"response_types"` 13 13 + ApplicationType string `json:"application_type"` 14 14 + DpopBoundAccessTokens bool `json:"dpop_bound_access_tokens"` 15 15 + JWKSURI *string `json:"jwks_uri,omitempty"` 16 16 + JWKS *[][]byte `json:"jwks,omitempty"` 17 17 + Scope string `json:"scope"` 18 18 + TokenEndpointAuthMethod string `json:"token_endpoint_auth_method"` 19 19 + TokenEndpointAuthSigningAlg string `json:"token_endpoint_auth_signing_alg"` 20 20 + }

+52

oauth/constants/constants.go

··· 1 1 + package constants 2 2 + 3 3 + import "time" 4 4 + 5 5 + const ( 6 6 + MaxDpopAge = 10 * time.Second 7 7 + DpopCheckTolerance = 5 * time.Second 8 8 + 9 9 + NonceSecretByteLength = 32 10 10 + 11 11 + NonceMaxRotationInterval = DpopNonceMaxAge / 3 12 12 + NonceMinRotationInterval = 1 * time.Second 13 13 + 14 14 + JTICacheSize = 100_000 15 15 + JTITtl = 24 * time.Hour 16 16 + 17 17 + ClientAssertionTypeJwtBearer = "urn:ietf:params:oauth:client-assertion-type:jwt-bearer" 18 18 + ParExpiresIn = 5 * time.Minute 19 19 + 20 20 + ClientAssertionMaxAge = 1 * time.Minute 21 21 + 22 22 + DeviceIdPrefix = "dev-" 23 23 + DeviceIdBytesLength = 16 24 24 + 25 25 + SessionIdPrefix = "ses-" 26 26 + SessionIdBytesLength = 16 27 27 + 28 28 + RefreshTokenPrefix = "ref-" 29 29 + RefreshTokenBytesLength = 32 30 30 + 31 31 + RequestIdPrefix = "req-" 32 32 + RequestIdBytesLength = 16 33 33 + RequestUriPrefix = "urn:ietf:params:oauth:request_uri:" 34 34 + 35 35 + CodePrefix = "cod-" 36 36 + CodeBytesLength = 32 37 37 + 38 38 + TokenIdPrefix = "tok-" 39 39 + TokenIdBytesLength = 16 40 40 + 41 41 + TokenMaxAge = 60 * time.Minute 42 42 + 43 43 + AuthorizationInactivityTimeout = 5 * time.Minute 44 44 + 45 45 + DpopNonceMaxAge = 3 * time.Minute 46 46 + 47 47 + ConfidentialClientSessionLifetime = 2 * 365 * 24 * time.Hour // 2 years 48 48 + ConfidentialClientRefreshLifetime = 3 * 30 * 24 * time.Hour // 3 months 49 49 + 50 50 + PublicClientSessionLifetime = 2 * 7 * 24 * time.Hour // 2 weeks 51 51 + PublicClientRefreshLifetime = PublicClientSessionLifetime 52 52 + )

+28

oauth/dpop/jti_cache.go

··· 1 1 + package dpop 2 2 + 3 3 + import ( 4 4 + "sync" 5 5 + "time" 6 6 + 7 7 + cache "github.com/go-pkgz/expirable-cache/v3" 8 8 + "github.com/haileyok/cocoon/oauth/constants" 9 9 + ) 10 10 + 11 11 + type jtiCache struct { 12 12 + mu sync.Mutex 13 13 + cache cache.Cache[string, bool] 14 14 + } 15 15 + 16 16 + func newJTICache(size int) *jtiCache { 17 17 + cache := cache.NewCache[string, bool]().WithTTL(24 * time.Hour).WithLRU().WithTTL(constants.JTITtl) 18 18 + return &jtiCache{ 19 19 + cache: cache, 20 20 + mu: sync.Mutex{}, 21 21 + } 22 22 + } 23 23 + 24 24 + func (c *jtiCache) add(jti string) bool { 25 25 + c.mu.Lock() 26 26 + defer c.mu.Unlock() 27 27 + return c.cache.Add(jti, true) 28 28 + }

+249

oauth/dpop/manager.go

··· 1 1 + package dpop 2 2 + 3 3 + import ( 4 4 + "crypto" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "encoding/json" 8 8 + "errors" 9 9 + "fmt" 10 10 + "log/slog" 11 11 + "net/http" 12 12 + "net/url" 13 13 + "strings" 14 14 + "time" 15 15 + 16 16 + "github.com/golang-jwt/jwt/v4" 17 17 + "github.com/haileyok/cocoon/internal/helpers" 18 18 + "github.com/haileyok/cocoon/oauth/constants" 19 19 + "github.com/lestrrat-go/jwx/v2/jwa" 20 20 + "github.com/lestrrat-go/jwx/v2/jwk" 21 21 + ) 22 22 + 23 23 + type Manager struct { 24 24 + nonce *Nonce 25 25 + jtiCache *jtiCache 26 26 + logger *slog.Logger 27 27 + hostname string 28 28 + } 29 29 + 30 30 + type ManagerArgs struct { 31 31 + NonceSecret []byte 32 32 + NonceRotationInterval time.Duration 33 33 + OnNonceSecretCreated func([]byte) 34 34 + JTICacheSize int 35 35 + Logger *slog.Logger 36 36 + Hostname string 37 37 + } 38 38 + 39 39 + func NewManager(args ManagerArgs) *Manager { 40 40 + if args.Logger == nil { 41 41 + args.Logger = slog.Default() 42 42 + } 43 43 + 44 44 + if args.JTICacheSize == 0 { 45 45 + args.JTICacheSize = 100_000 46 46 + } 47 47 + 48 48 + if args.NonceSecret == nil { 49 49 + args.Logger.Warn("nonce secret passed to dpop manager was nil. existing sessions may break. consider saving and restoring your nonce.") 50 50 + } 51 51 + 52 52 + return &Manager{ 53 53 + nonce: NewNonce(NonceArgs{ 54 54 + RotationInterval: args.NonceRotationInterval, 55 55 + Secret: args.NonceSecret, 56 56 + OnSecretCreated: args.OnNonceSecretCreated, 57 57 + }), 58 58 + jtiCache: newJTICache(args.JTICacheSize), 59 59 + logger: args.Logger, 60 60 + hostname: args.Hostname, 61 61 + } 62 62 + } 63 63 + 64 64 + func (dm *Manager) CheckProof(reqMethod, reqUrl string, headers http.Header, accessToken *string) (*Proof, error) { 65 65 + if reqMethod == "" { 66 66 + return nil, errors.New("HTTP method is required") 67 67 + } 68 68 + 69 69 + if !strings.HasPrefix(reqUrl, "https://") { 70 70 + reqUrl = "https://" + dm.hostname + reqUrl 71 71 + } 72 72 + 73 73 + proof := extractProof(headers) 74 74 + 75 75 + if proof == "" { 76 76 + return nil, nil 77 77 + } 78 78 + 79 79 + parser := jwt.NewParser(jwt.WithoutClaimsValidation()) 80 80 + var token *jwt.Token 81 81 + 82 82 + token, _, err := parser.ParseUnverified(proof, jwt.MapClaims{}) 83 83 + if err != nil { 84 84 + return nil, fmt.Errorf("could not parse dpop proof jwt: %w", err) 85 85 + } 86 86 + 87 87 + typ, _ := token.Header["typ"].(string) 88 88 + if typ != "dpop+jwt" { 89 89 + return nil, errors.New(`invalid dpop proof jwt: "typ" must be 'dpop+jwt'`) 90 90 + } 91 91 + 92 92 + dpopJwk, jwkOk := token.Header["jwk"].(map[string]any) 93 93 + if !jwkOk { 94 94 + return nil, errors.New(`invalid dpop proof jwt: "jwk" is missing in header`) 95 95 + } 96 96 + 97 97 + jwkb, err := json.Marshal(dpopJwk) 98 98 + if err != nil { 99 99 + return nil, fmt.Errorf("failed to marshal jwk: %w", err) 100 100 + } 101 101 + 102 102 + key, err := jwk.ParseKey(jwkb) 103 103 + if err != nil { 104 104 + return nil, fmt.Errorf("failed to parse jwk: %w", err) 105 105 + } 106 106 + 107 107 + var pubKey any 108 108 + if err := key.Raw(&pubKey); err != nil { 109 109 + return nil, fmt.Errorf("failed to get raw public key: %w", err) 110 110 + } 111 111 + 112 112 + token, err = jwt.Parse(proof, func(t *jwt.Token) (any, error) { 113 113 + alg := t.Header["alg"].(string) 114 114 + 115 115 + switch key.KeyType() { 116 116 + case jwa.EC: 117 117 + if !strings.HasPrefix(alg, "ES") { 118 118 + return nil, fmt.Errorf("algorithm %s doesn't match EC key type", alg) 119 119 + } 120 120 + case jwa.RSA: 121 121 + if !strings.HasPrefix(alg, "RS") && !strings.HasPrefix(alg, "PS") { 122 122 + return nil, fmt.Errorf("algorithm %s doesn't match RSA key type", alg) 123 123 + } 124 124 + case jwa.OKP: 125 125 + if alg != "EdDSA" { 126 126 + return nil, fmt.Errorf("algorithm %s doesn't match OKP key type", alg) 127 127 + } 128 128 + } 129 129 + 130 130 + return pubKey, nil 131 131 + }, jwt.WithValidMethods([]string{"ES256", "ES384", "ES512", "RS256", "RS384", "RS512", "PS256", "PS384", "PS512", "EdDSA"})) 132 132 + if err != nil { 133 133 + return nil, fmt.Errorf("could not verify dpop proof jwt: %w", err) 134 134 + } 135 135 + 136 136 + if !token.Valid { 137 137 + return nil, errors.New("dpop proof jwt is invalid") 138 138 + } 139 139 + 140 140 + claims, ok := token.Claims.(jwt.MapClaims) 141 141 + if !ok { 142 142 + return nil, errors.New("no claims in dpop proof jwt") 143 143 + } 144 144 + 145 145 + iat, iatOk := claims["iat"].(float64) 146 146 + if !iatOk { 147 147 + return nil, errors.New(`invalid dpop proof jwt: "iat" is missing`) 148 148 + } 149 149 + 150 150 + iatTime := time.Unix(int64(iat), 0) 151 151 + now := time.Now() 152 152 + 153 153 + if now.Sub(iatTime) > constants.DpopNonceMaxAge+constants.DpopCheckTolerance { 154 154 + return nil, errors.New("dpop proof too old") 155 155 + } 156 156 + 157 157 + if iatTime.Sub(now) > constants.DpopCheckTolerance { 158 158 + return nil, errors.New("dpop proof iat is in the future") 159 159 + } 160 160 + 161 161 + jti, _ := claims["jti"].(string) 162 162 + if jti == "" { 163 163 + return nil, errors.New(`invalid dpop proof jwt: "jti" is missing`) 164 164 + } 165 165 + 166 166 + if dm.jtiCache.add(jti) { 167 167 + return nil, errors.New("dpop proof replay detected") 168 168 + } 169 169 + 170 170 + htm, _ := claims["htm"].(string) 171 171 + if htm == "" { 172 172 + return nil, errors.New(`invalid dpop proof jwt: "htm" is missing`) 173 173 + } 174 174 + 175 175 + if htm != reqMethod { 176 176 + return nil, errors.New(`invalid dpop proof jwt: "htm" mismatch`) 177 177 + } 178 178 + 179 179 + htu, _ := claims["htu"].(string) 180 180 + if htu == "" { 181 181 + return nil, errors.New(`invalid dpop proof jwt: "htu" is missing`) 182 182 + } 183 183 + 184 184 + parsedHtu, err := helpers.OauthParseHtu(htu) 185 185 + if err != nil { 186 186 + return nil, errors.New(`invalid dpop proof jwt: "htu" could not be parsed`) 187 187 + } 188 188 + 189 189 + u, _ := url.Parse(reqUrl) 190 190 + if parsedHtu != helpers.OauthNormalizeHtu(u) { 191 191 + return nil, fmt.Errorf(`invalid dpop proof jwt: "htu" mismatch. reqUrl: %s, parsed: %s, normalized: %s`, reqUrl, parsedHtu, helpers.OauthNormalizeHtu(u)) 192 192 + } 193 193 + 194 194 + nonce, _ := claims["nonce"].(string) 195 195 + if nonce == "" { 196 196 + // WARN: this _must_ be `use_dpop_nonce` for clients know they should make another request 197 197 + return nil, errors.New("use_dpop_nonce") 198 198 + } 199 199 + 200 200 + if nonce != "" && !dm.nonce.Check(nonce) { 201 201 + // WARN: this _must_ be `use_dpop_nonce` so that clients will fetch a new nonce 202 202 + return nil, errors.New("use_dpop_nonce") 203 203 + } 204 204 + 205 205 + ath, _ := claims["ath"].(string) 206 206 + 207 207 + if accessToken != nil && *accessToken != "" { 208 208 + if ath == "" { 209 209 + return nil, errors.New(`invalid dpop proof jwt: "ath" is required with access token`) 210 210 + } 211 211 + 212 212 + hash := sha256.Sum256([]byte(*accessToken)) 213 213 + if ath != base64.RawURLEncoding.EncodeToString(hash[:]) { 214 214 + return nil, errors.New(`invalid dpop proof jwt: "ath" mismatch`) 215 215 + } 216 216 + } else if ath != "" { 217 217 + return nil, errors.New(`invalid dpop proof jwt: "ath" claim not allowed`) 218 218 + } 219 219 + 220 220 + thumbBytes, err := key.Thumbprint(crypto.SHA256) 221 221 + if err != nil { 222 222 + return nil, fmt.Errorf("failed to calculate thumbprint: %w", err) 223 223 + } 224 224 + 225 225 + thumb := base64.RawURLEncoding.EncodeToString(thumbBytes) 226 226 + 227 227 + return &Proof{ 228 228 + JTI: jti, 229 229 + JKT: thumb, 230 230 + HTM: htm, 231 231 + HTU: htu, 232 232 + }, nil 233 233 + } 234 234 + 235 235 + func extractProof(headers http.Header) string { 236 236 + dpopHeaders := headers["Dpop"] 237 237 + switch len(dpopHeaders) { 238 238 + case 0: 239 239 + return "" 240 240 + case 1: 241 241 + return dpopHeaders[0] 242 242 + default: 243 243 + return "" 244 244 + } 245 245 + } 246 246 + 247 247 + func (dm *Manager) NextNonce() string { 248 248 + return dm.nonce.NextNonce() 249 249 + }

+108

oauth/dpop/nonce.go

··· 1 1 + package dpop 2 2 + 3 3 + import ( 4 4 + "crypto/hmac" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "encoding/binary" 8 8 + "sync" 9 9 + "time" 10 10 + 11 11 + "github.com/haileyok/cocoon/internal/helpers" 12 12 + "github.com/haileyok/cocoon/oauth/constants" 13 13 + ) 14 14 + 15 15 + type Nonce struct { 16 16 + rotationInterval time.Duration 17 17 + secret []byte 18 18 + 19 19 + mu sync.RWMutex 20 20 + 21 21 + counter int64 22 22 + prev string 23 23 + curr string 24 24 + next string 25 25 + } 26 26 + 27 27 + type NonceArgs struct { 28 28 + RotationInterval time.Duration 29 29 + Secret []byte 30 30 + OnSecretCreated func([]byte) 31 31 + } 32 32 + 33 33 + func NewNonce(args NonceArgs) *Nonce { 34 34 + if args.RotationInterval == 0 { 35 35 + args.RotationInterval = constants.NonceMaxRotationInterval / 3 36 36 + } 37 37 + 38 38 + if args.RotationInterval > constants.NonceMaxRotationInterval { 39 39 + args.RotationInterval = constants.NonceMaxRotationInterval 40 40 + } 41 41 + 42 42 + if args.Secret == nil { 43 43 + args.Secret = helpers.RandomBytes(constants.NonceSecretByteLength) 44 44 + args.OnSecretCreated(args.Secret) 45 45 + } 46 46 + 47 47 + n := &Nonce{ 48 48 + rotationInterval: args.RotationInterval, 49 49 + secret: args.Secret, 50 50 + mu: sync.RWMutex{}, 51 51 + } 52 52 + 53 53 + n.counter = n.currentCounter() 54 54 + n.prev = n.compute(n.counter - 1) 55 55 + n.curr = n.compute(n.counter) 56 56 + n.next = n.compute(n.counter + 1) 57 57 + 58 58 + return n 59 59 + } 60 60 + 61 61 + func (n *Nonce) currentCounter() int64 { 62 62 + return time.Now().UnixNano() / int64(n.rotationInterval) 63 63 + } 64 64 + 65 65 + func (n *Nonce) compute(counter int64) string { 66 66 + h := hmac.New(sha256.New, n.secret) 67 67 + counterBytes := make([]byte, 8) 68 68 + binary.BigEndian.PutUint64(counterBytes, uint64(counter)) 69 69 + h.Write(counterBytes) 70 70 + return base64.RawURLEncoding.EncodeToString(h.Sum(nil)) 71 71 + } 72 72 + 73 73 + func (n *Nonce) rotate() { 74 74 + counter := n.currentCounter() 75 75 + diff := counter - n.counter 76 76 + 77 77 + switch diff { 78 78 + case 0: 79 79 + // counter == n.counter, do nothing 80 80 + case 1: 81 81 + n.prev = n.curr 82 82 + n.curr = n.next 83 83 + n.next = n.compute(counter + 1) 84 84 + case 2: 85 85 + n.prev = n.next 86 86 + n.curr = n.compute(counter) 87 87 + n.next = n.compute(counter + 1) 88 88 + default: 89 89 + n.prev = n.compute(counter - 1) 90 90 + n.curr = n.compute(counter) 91 91 + n.next = n.compute(counter + 1) 92 92 + } 93 93 + 94 94 + n.counter = counter 95 95 + } 96 96 + 97 97 + func (n *Nonce) NextNonce() string { 98 98 + n.mu.Lock() 99 99 + defer n.mu.Unlock() 100 100 + n.rotate() 101 101 + return n.next 102 102 + } 103 103 + 104 104 + func (n *Nonce) Check(nonce string) bool { 105 105 + n.mu.RLock() 106 106 + defer n.mu.RUnlock() 107 107 + return nonce == n.prev || nonce == n.curr || nonce == n.next 108 108 + }

+8

oauth/dpop/proof.go

··· 1 1 + package dpop 2 2 + 3 3 + type Proof struct { 4 4 + JTI string 5 5 + JKT string 6 6 + HTM string 7 7 + HTU string 8 8 + }

+80

oauth/helpers.go

··· 1 1 + package oauth 2 2 + 3 3 + import ( 4 4 + "errors" 5 5 + "fmt" 6 6 + "net/url" 7 7 + "time" 8 8 + 9 9 + "github.com/haileyok/cocoon/internal/helpers" 10 10 + "github.com/haileyok/cocoon/oauth/constants" 11 11 + "github.com/haileyok/cocoon/oauth/provider" 12 12 + ) 13 13 + 14 14 + func GenerateCode() string { 15 15 + h, _ := helpers.RandomHex(constants.CodeBytesLength) 16 16 + return constants.CodePrefix + h 17 17 + } 18 18 + 19 19 + func GenerateTokenId() string { 20 20 + h, _ := helpers.RandomHex(constants.TokenIdBytesLength) 21 21 + return constants.TokenIdPrefix + h 22 22 + } 23 23 + 24 24 + func GenerateRefreshToken() string { 25 25 + h, _ := helpers.RandomHex(constants.RefreshTokenBytesLength) 26 26 + return constants.RefreshTokenPrefix + h 27 27 + } 28 28 + 29 29 + func GenerateRequestId() string { 30 30 + h, _ := helpers.RandomHex(constants.RequestIdBytesLength) 31 31 + return constants.RequestIdPrefix + h 32 32 + } 33 33 + 34 34 + func EncodeRequestUri(reqId string) string { 35 35 + return constants.RequestUriPrefix + url.QueryEscape(reqId) 36 36 + } 37 37 + 38 38 + func DecodeRequestUri(reqUri string) (string, error) { 39 39 + if len(reqUri) < len(constants.RequestUriPrefix) { 40 40 + return "", errors.New("invalid request uri") 41 41 + } 42 42 + 43 43 + reqIdEnc := reqUri[len(constants.RequestUriPrefix):] 44 44 + reqId, err := url.QueryUnescape(reqIdEnc) 45 45 + if err != nil { 46 46 + return "", fmt.Errorf("could not unescape request id: %w", err) 47 47 + } 48 48 + 49 49 + return reqId, nil 50 50 + } 51 51 + 52 52 + type SessionAgeResult struct { 53 53 + SessionAge time.Duration 54 54 + RefreshAge time.Duration 55 55 + SessionExpired bool 56 56 + RefreshExpired bool 57 57 + } 58 58 + 59 59 + func GetSessionAgeFromToken(t provider.OauthToken) SessionAgeResult { 60 60 + sessionLifetime := constants.PublicClientSessionLifetime 61 61 + refreshLifetime := constants.PublicClientRefreshLifetime 62 62 + if t.ClientAuth.Method != "none" { 63 63 + sessionLifetime = constants.ConfidentialClientSessionLifetime 64 64 + refreshLifetime = constants.ConfidentialClientRefreshLifetime 65 65 + } 66 66 + 67 67 + res := SessionAgeResult{} 68 68 + 69 69 + res.SessionAge = time.Since(t.CreatedAt) 70 70 + if res.SessionAge > sessionLifetime { 71 71 + res.SessionExpired = true 72 72 + } 73 73 + 74 74 + refreshAge := time.Since(t.UpdatedAt) 75 75 + if refreshAge > refreshLifetime { 76 76 + res.RefreshExpired = true 77 77 + } 78 78 + 79 79 + return res 80 80 + }

+152

oauth/provider/client_auth.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + "crypto" 6 6 + "encoding/base64" 7 7 + "errors" 8 8 + "fmt" 9 9 + "time" 10 10 + 11 11 + "github.com/golang-jwt/jwt/v4" 12 12 + "github.com/haileyok/cocoon/oauth/client" 13 13 + "github.com/haileyok/cocoon/oauth/constants" 14 14 + "github.com/haileyok/cocoon/oauth/dpop" 15 15 + ) 16 16 + 17 17 + type AuthenticateClientOptions struct { 18 18 + AllowMissingDpopProof bool 19 19 + } 20 20 + 21 21 + type AuthenticateClientRequestBase struct { 22 22 + ClientID string `form:"client_id" json:"client_id" validate:"required"` 23 23 + ClientAssertionType *string `form:"client_assertion_type" json:"client_assertion_type,omitempty"` 24 24 + ClientAssertion *string `form:"client_assertion" json:"client_assertion,omitempty"` 25 25 + } 26 26 + 27 27 + func (p *Provider) AuthenticateClient(ctx context.Context, req AuthenticateClientRequestBase, proof *dpop.Proof, opts *AuthenticateClientOptions) (*client.Client, *ClientAuth, error) { 28 28 + client, err := p.ClientManager.GetClient(ctx, req.ClientID) 29 29 + if err != nil { 30 30 + return nil, nil, fmt.Errorf("failed to get client: %w", err) 31 31 + } 32 32 + 33 33 + if client.Metadata.DpopBoundAccessTokens && proof == nil && (opts == nil || !opts.AllowMissingDpopProof) { 34 34 + return nil, nil, errors.New("dpop proof required") 35 35 + } 36 36 + 37 37 + if proof != nil && !client.Metadata.DpopBoundAccessTokens { 38 38 + return nil, nil, errors.New("dpop proof not allowed for this client") 39 39 + } 40 40 + 41 41 + clientAuth, err := p.Authenticate(ctx, req, client) 42 42 + if err != nil { 43 43 + return nil, nil, err 44 44 + } 45 45 + 46 46 + return client, clientAuth, nil 47 47 + } 48 48 + 49 49 + func (p *Provider) Authenticate(_ context.Context, req AuthenticateClientRequestBase, client *client.Client) (*ClientAuth, error) { 50 50 + metadata := client.Metadata 51 51 + 52 52 + if metadata.TokenEndpointAuthMethod == "none" { 53 53 + return &ClientAuth{ 54 54 + Method: "none", 55 55 + }, nil 56 56 + } 57 57 + 58 58 + if metadata.TokenEndpointAuthMethod == "private_key_jwt" { 59 59 + if req.ClientAssertion == nil { 60 60 + return nil, errors.New(`client authentication method "private_key_jwt" requires a "client_assertion`) 61 61 + } 62 62 + 63 63 + if req.ClientAssertionType == nil || *req.ClientAssertionType != constants.ClientAssertionTypeJwtBearer { 64 64 + return nil, fmt.Errorf("unsupported client_assertion_type %s", *req.ClientAssertionType) 65 65 + } 66 66 + 67 67 + token, _, err := jwt.NewParser().ParseUnverified(*req.ClientAssertion, jwt.MapClaims{}) 68 68 + if err != nil { 69 69 + return nil, fmt.Errorf("error parsing client assertion: %w", err) 70 70 + } 71 71 + 72 72 + kid, ok := token.Header["kid"].(string) 73 73 + if !ok || kid == "" { 74 74 + return nil, errors.New(`"kid" required in client_assertion`) 75 75 + } 76 76 + 77 77 + var rawKey any 78 78 + if err := client.JWKS.Raw(&rawKey); err != nil { 79 79 + return nil, fmt.Errorf("failed to extract raw key: %w", err) 80 80 + } 81 81 + 82 82 + token, err = jwt.Parse(*req.ClientAssertion, func(token *jwt.Token) (any, error) { 83 83 + if token.Method.Alg() != jwt.SigningMethodES256.Alg() { 84 84 + return nil, fmt.Errorf("unexpected signing method: %v", token.Header["alg"]) 85 85 + } 86 86 + 87 87 + return rawKey, nil 88 88 + }) 89 89 + if err != nil { 90 90 + return nil, fmt.Errorf(`unable to verify "client_assertion" jwt: %w`, err) 91 91 + } 92 92 + 93 93 + if !token.Valid { 94 94 + return nil, errors.New("client_assertion jwt is invalid") 95 95 + } 96 96 + 97 97 + claims, ok := token.Claims.(jwt.MapClaims) 98 98 + if !ok { 99 99 + return nil, errors.New("no claims in client_assertion jwt") 100 100 + } 101 101 + 102 102 + sub, _ := claims["sub"].(string) 103 103 + if sub != metadata.ClientID { 104 104 + return nil, errors.New("subject must be client_id") 105 105 + } 106 106 + 107 107 + aud, _ := claims["aud"].(string) 108 108 + if aud != "" && aud != "https://"+p.hostname { 109 109 + return nil, fmt.Errorf("audience must be %s, got %s", "https://"+p.hostname, aud) 110 110 + } 111 111 + 112 112 + iat, iatOk := claims["iat"].(float64) 113 113 + if !iatOk { 114 114 + return nil, errors.New(`invalid client_assertion jwt: "iat" is missing`) 115 115 + } 116 116 + 117 117 + iatTime := time.Unix(int64(iat), 0) 118 118 + if time.Since(iatTime) > constants.ClientAssertionMaxAge { 119 119 + return nil, errors.New("client_assertion jwt too old") 120 120 + } 121 121 + 122 122 + jti, _ := claims["jti"].(string) 123 123 + if jti == "" { 124 124 + return nil, errors.New(`invalid client_assertion jwt: "jti" is missing`) 125 125 + } 126 126 + 127 127 + var exp *float64 128 128 + if maybeExp, ok := claims["exp"].(float64); ok { 129 129 + exp = &maybeExp 130 130 + } 131 131 + 132 132 + alg := token.Header["alg"].(string) 133 133 + 134 134 + thumbBytes, err := client.JWKS.Thumbprint(crypto.SHA256) 135 135 + if err != nil { 136 136 + return nil, fmt.Errorf("failed to calculate thumbprint: %w", err) 137 137 + } 138 138 + 139 139 + thumb := base64.RawURLEncoding.EncodeToString(thumbBytes) 140 140 + 141 141 + return &ClientAuth{ 142 142 + Method: "private_key_jwt", 143 143 + Jti: jti, 144 144 + Exp: exp, 145 145 + Jkt: thumb, 146 146 + Alg: alg, 147 147 + Kid: kid, 148 148 + }, nil 149 149 + } 150 150 + 151 151 + return nil, fmt.Errorf("auth method %s is not implemented in this pds", metadata.TokenEndpointAuthMethod) 152 152 + }

+20

oauth/provider/middleware.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "github.com/labstack/echo/v4" 5 5 + ) 6 6 + 7 7 + func (p *Provider) BaseMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 8 8 + return func(e echo.Context) error { 9 9 + e.Response().Header().Set("cache-control", "no-store") 10 10 + e.Response().Header().Set("pragma", "no-cache") 11 11 + 12 12 + nonce := p.NextNonce() 13 13 + if nonce != "" { 14 14 + e.Response().Header().Set("DPoP-Nonce", nonce) 15 15 + e.Response().Header().Add("access-control-expose-headers", "DPoP-Nonce") 16 16 + } 17 17 + 18 18 + return next(e) 19 19 + } 20 20 + }

+83

oauth/provider/models.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "database/sql/driver" 5 5 + "encoding/json" 6 6 + "fmt" 7 7 + "time" 8 8 + 9 9 + "gorm.io/gorm" 10 10 + ) 11 11 + 12 12 + type ClientAuth struct { 13 13 + Method string 14 14 + Alg string 15 15 + Kid string 16 16 + Jkt string 17 17 + Jti string 18 18 + Exp *float64 19 19 + } 20 20 + 21 21 + func (ca *ClientAuth) Scan(value any) error { 22 22 + b, ok := value.([]byte) 23 23 + if !ok { 24 24 + return fmt.Errorf("failed to unmarshal OauthParRequest value") 25 25 + } 26 26 + return json.Unmarshal(b, ca) 27 27 + } 28 28 + 29 29 + func (ca ClientAuth) Value() (driver.Value, error) { 30 30 + return json.Marshal(ca) 31 31 + } 32 32 + 33 33 + type ParRequest struct { 34 34 + AuthenticateClientRequestBase 35 35 + ResponseType string `form:"response_type" json:"response_type" validate:"required"` 36 36 + CodeChallenge *string `form:"code_challenge" json:"code_challenge" validate:"required"` 37 37 + CodeChallengeMethod string `form:"code_challenge_method" json:"code_challenge_method" validate:"required"` 38 38 + State string `form:"state" json:"state" validate:"required"` 39 39 + RedirectURI string `form:"redirect_uri" json:"redirect_uri" validate:"required"` 40 40 + Scope string `form:"scope" json:"scope" validate:"required"` 41 41 + LoginHint *string `form:"login_hint" json:"login_hint,omitempty"` 42 42 + DpopJkt *string `form:"dpop_jkt" json:"dpop_jkt,omitempty"` 43 43 + } 44 44 + 45 45 + func (opr *ParRequest) Scan(value any) error { 46 46 + b, ok := value.([]byte) 47 47 + if !ok { 48 48 + return fmt.Errorf("failed to unmarshal OauthParRequest value") 49 49 + } 50 50 + return json.Unmarshal(b, opr) 51 51 + } 52 52 + 53 53 + func (opr ParRequest) Value() (driver.Value, error) { 54 54 + return json.Marshal(opr) 55 55 + } 56 56 + 57 57 + type OauthToken struct { 58 58 + gorm.Model 59 59 + ClientId string `gorm:"index"` 60 60 + ClientAuth ClientAuth `gorm:"type:json"` 61 61 + Parameters ParRequest `gorm:"type:json"` 62 62 + ExpiresAt time.Time `gorm:"index"` 63 63 + DeviceId string 64 64 + Sub string `gorm:"index"` 65 65 + Code string `gorm:"index"` 66 66 + Token string `gorm:"uniqueIndex"` 67 67 + RefreshToken string `gorm:"uniqueIndex"` 68 68 + Ip string 69 69 + } 70 70 + 71 71 + type OauthAuthorizationRequest struct { 72 72 + gorm.Model 73 73 + RequestId string `gorm:"primaryKey"` 74 74 + ClientId string `gorm:"index"` 75 75 + ClientAuth ClientAuth `gorm:"type:json"` 76 76 + Parameters ParRequest `gorm:"type:json"` 77 77 + ExpiresAt time.Time `gorm:"index"` 78 78 + DeviceId *string 79 79 + Sub *string 80 80 + Code *string 81 81 + Accepted *bool 82 82 + Ip string 83 83 + }

+31

oauth/provider/provider.go

··· 1 1 + package provider 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/oauth/client" 5 5 + "github.com/haileyok/cocoon/oauth/dpop" 6 6 + ) 7 7 + 8 8 + type Provider struct { 9 9 + ClientManager *client.Manager 10 10 + DpopManager *dpop.Manager 11 11 + 12 12 + hostname string 13 13 + } 14 14 + 15 15 + type Args struct { 16 16 + Hostname string 17 17 + ClientManagerArgs client.ManagerArgs 18 18 + DpopManagerArgs dpop.ManagerArgs 19 19 + } 20 20 + 21 21 + func NewProvider(args Args) *Provider { 22 22 + return &Provider{ 23 23 + ClientManager: client.NewManager(args.ClientManagerArgs), 24 24 + DpopManager: dpop.NewManager(args.DpopManagerArgs), 25 25 + hostname: args.Hostname, 26 26 + } 27 27 + } 28 28 + 29 29 + func (p *Provider) NextNonce() string { 30 30 + return p.DpopManager.NextNonce() 31 31 + }

+77

recording_blockstore/recording_blockstore.go

··· 1 1 + package recording_blockstore 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + 6 6 + blockformat "github.com/ipfs/go-block-format" 7 7 + "github.com/ipfs/go-cid" 8 8 + blockstore "github.com/ipfs/go-ipfs-blockstore" 9 9 + ) 10 10 + 11 11 + type RecordingBlockstore struct { 12 12 + base blockstore.Blockstore 13 13 + 14 14 + inserts map[cid.Cid]blockformat.Block 15 15 + } 16 16 + 17 17 + func New(base blockstore.Blockstore) *RecordingBlockstore { 18 18 + return &RecordingBlockstore{ 19 19 + base: base, 20 20 + inserts: make(map[cid.Cid]blockformat.Block), 21 21 + } 22 22 + } 23 23 + 24 24 + func (bs *RecordingBlockstore) Has(ctx context.Context, c cid.Cid) (bool, error) { 25 25 + return bs.base.Has(ctx, c) 26 26 + } 27 27 + 28 28 + func (bs *RecordingBlockstore) Get(ctx context.Context, c cid.Cid) (blockformat.Block, error) { 29 29 + return bs.base.Get(ctx, c) 30 30 + } 31 31 + 32 32 + func (bs *RecordingBlockstore) GetSize(ctx context.Context, c cid.Cid) (int, error) { 33 33 + return bs.base.GetSize(ctx, c) 34 34 + } 35 35 + 36 36 + func (bs *RecordingBlockstore) DeleteBlock(ctx context.Context, c cid.Cid) error { 37 37 + return bs.base.DeleteBlock(ctx, c) 38 38 + } 39 39 + 40 40 + func (bs *RecordingBlockstore) Put(ctx context.Context, block blockformat.Block) error { 41 41 + if err := bs.base.Put(ctx, block); err != nil { 42 42 + return err 43 43 + } 44 44 + bs.inserts[block.Cid()] = block 45 45 + return nil 46 46 + } 47 47 + 48 48 + func (bs *RecordingBlockstore) PutMany(ctx context.Context, blocks []blockformat.Block) error { 49 49 + if err := bs.base.PutMany(ctx, blocks); err != nil { 50 50 + return err 51 51 + } 52 52 + 53 53 + for _, b := range blocks { 54 54 + bs.inserts[b.Cid()] = b 55 55 + } 56 56 + 57 57 + return nil 58 58 + } 59 59 + 60 60 + func (bs *RecordingBlockstore) AllKeysChan(ctx context.Context) (<-chan cid.Cid, error) { 61 61 + return bs.AllKeysChan(ctx) 62 62 + } 63 63 + 64 64 + func (bs *RecordingBlockstore) HashOnRead(enabled bool) { 65 65 + } 66 66 + 67 67 + func (bs *RecordingBlockstore) GetLogMap() map[cid.Cid]blockformat.Block { 68 68 + return bs.inserts 69 69 + } 70 70 + 71 71 + func (bs *RecordingBlockstore) GetLogArray() []blockformat.Block { 72 72 + var blocks []blockformat.Block 73 73 + for _, b := range bs.inserts { 74 74 + blocks = append(blocks, b) 75 75 + } 76 76 + return blocks 77 77 + }

+30

server/blockstore_variant.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/sqlite_blockstore" 5 5 + blockstore "github.com/ipfs/go-ipfs-blockstore" 6 6 + ) 7 7 + 8 8 + type BlockstoreVariant int 9 9 + 10 10 + const ( 11 11 + BlockstoreVariantSqlite = iota 12 12 + ) 13 13 + 14 14 + func MustReturnBlockstoreVariant(maybeBsv string) BlockstoreVariant { 15 15 + switch maybeBsv { 16 16 + case "sqlite": 17 17 + return BlockstoreVariantSqlite 18 18 + default: 19 19 + panic("invalid blockstore variant provided") 20 20 + } 21 21 + } 22 22 + 23 23 + func (s *Server) getBlockstore(did string) blockstore.Blockstore { 24 24 + switch s.config.BlockstoreVariant { 25 25 + case BlockstoreVariantSqlite: 26 26 + return sqlite_blockstore.New(did, s.db) 27 27 + default: 28 28 + return sqlite_blockstore.New(did, s.db) 29 29 + } 30 30 + }

+74

server/handle_account.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "time" 5 5 + 6 6 + "github.com/haileyok/cocoon/oauth" 7 7 + "github.com/haileyok/cocoon/oauth/constants" 8 8 + "github.com/haileyok/cocoon/oauth/provider" 9 9 + "github.com/hako/durafmt" 10 10 + "github.com/labstack/echo/v4" 11 11 + ) 12 12 + 13 13 + func (s *Server) handleAccount(e echo.Context) error { 14 14 + ctx := e.Request().Context() 15 15 + repo, sess, err := s.getSessionRepoOrErr(e) 16 16 + if err != nil { 17 17 + return e.Redirect(303, "/account/signin") 18 18 + } 19 19 + 20 20 + oldestPossibleSession := time.Now().Add(constants.ConfidentialClientSessionLifetime) 21 21 + 22 22 + var tokens []provider.OauthToken 23 23 + if err := s.db.Raw("SELECT * FROM oauth_tokens WHERE sub = ? AND created_at < ? ORDER BY created_at ASC", nil, repo.Repo.Did, oldestPossibleSession).Scan(&tokens).Error; err != nil { 24 24 + s.logger.Error("couldnt fetch oauth sessions for account", "did", repo.Repo.Did, "error", err) 25 25 + sess.AddFlash("Unable to fetch sessions. See server logs for more details.", "error") 26 26 + sess.Save(e.Request(), e.Response()) 27 27 + return e.Render(200, "account.html", map[string]any{ 28 28 + "flashes": getFlashesFromSession(e, sess), 29 29 + }) 30 30 + } 31 31 + 32 32 + var filtered []provider.OauthToken 33 33 + for _, t := range tokens { 34 34 + ageRes := oauth.GetSessionAgeFromToken(t) 35 35 + if ageRes.SessionExpired { 36 36 + continue 37 37 + } 38 38 + filtered = append(filtered, t) 39 39 + } 40 40 + 41 41 + now := time.Now() 42 42 + 43 43 + tokenInfo := []map[string]string{} 44 44 + for _, t := range tokens { 45 45 + ageRes := oauth.GetSessionAgeFromToken(t) 46 46 + maxTime := constants.PublicClientSessionLifetime 47 47 + if t.ClientAuth.Method != "none" { 48 48 + maxTime = constants.ConfidentialClientSessionLifetime 49 49 + } 50 50 + 51 51 + var clientName string 52 52 + metadata, err := s.oauthProvider.ClientManager.GetClient(ctx, t.ClientId) 53 53 + if err != nil { 54 54 + clientName = t.ClientId 55 55 + } else { 56 56 + clientName = metadata.Metadata.ClientName 57 57 + } 58 58 + 59 59 + tokenInfo = append(tokenInfo, map[string]string{ 60 60 + "ClientName": clientName, 61 61 + "Age": durafmt.Parse(ageRes.SessionAge).LimitFirstN(2).String(), 62 62 + "LastUpdated": durafmt.Parse(now.Sub(t.UpdatedAt)).LimitFirstN(2).String(), 63 63 + "ExpiresIn": durafmt.Parse(now.Add(maxTime).Sub(now)).LimitFirstN(2).String(), 64 64 + "Token": t.Token, 65 65 + "Ip": t.Ip, 66 66 + }) 67 67 + } 68 68 + 69 69 + return e.Render(200, "account.html", map[string]any{ 70 70 + "Repo": repo, 71 71 + "Tokens": tokenInfo, 72 72 + "flashes": getFlashesFromSession(e, sess), 73 73 + }) 74 74 + }

+34

server/handle_account_revoke.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/internal/helpers" 5 5 + "github.com/labstack/echo/v4" 6 6 + ) 7 7 + 8 8 + type AccountRevokeRequest struct { 9 9 + Token string `form:"token"` 10 10 + } 11 11 + 12 12 + func (s *Server) handleAccountRevoke(e echo.Context) error { 13 13 + var req AccountRevokeRequest 14 14 + if err := e.Bind(&req); err != nil { 15 15 + s.logger.Error("could not bind account revoke request", "error", err) 16 16 + return helpers.ServerError(e, nil) 17 17 + } 18 18 + 19 19 + repo, sess, err := s.getSessionRepoOrErr(e) 20 20 + if err != nil { 21 21 + return e.Redirect(303, "/account/signin") 22 22 + } 23 23 + 24 24 + if err := s.db.Exec("DELETE FROM oauth_tokens WHERE sub = ? AND token = ?", nil, repo.Repo.Did, req.Token).Error; err != nil { 25 25 + s.logger.Error("couldnt delete oauth session for account", "did", repo.Repo.Did, "token", req.Token, "error", err) 26 26 + sess.AddFlash("Unable to revoke session. See server logs for more details.", "error") 27 27 + sess.Save(e.Request(), e.Response()) 28 28 + return e.Redirect(303, "/account") 29 29 + } 30 30 + 31 31 + sess.AddFlash("Session successfully revoked!", "success") 32 32 + sess.Save(e.Request(), e.Response()) 33 33 + return e.Redirect(303, "/account") 34 34 + }

+130

server/handle_account_signin.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "errors" 5 5 + "strings" 6 6 + 7 7 + "github.com/bluesky-social/indigo/atproto/syntax" 8 8 + "github.com/gorilla/sessions" 9 9 + "github.com/haileyok/cocoon/internal/helpers" 10 10 + "github.com/haileyok/cocoon/models" 11 11 + "github.com/labstack/echo-contrib/session" 12 12 + "github.com/labstack/echo/v4" 13 13 + "golang.org/x/crypto/bcrypt" 14 14 + "gorm.io/gorm" 15 15 + ) 16 16 + 17 17 + type OauthSigninRequest struct { 18 18 + Username string `form:"username"` 19 19 + Password string `form:"password"` 20 20 + QueryParams string `form:"query_params"` 21 21 + } 22 22 + 23 23 + func (s *Server) getSessionRepoOrErr(e echo.Context) (*models.RepoActor, *sessions.Session, error) { 24 24 + sess, err := session.Get("session", e) 25 25 + if err != nil { 26 26 + return nil, nil, err 27 27 + } 28 28 + 29 29 + did, ok := sess.Values["did"].(string) 30 30 + if !ok { 31 31 + return nil, sess, errors.New("did was not set in session") 32 32 + } 33 33 + 34 34 + repo, err := s.getRepoActorByDid(did) 35 35 + if err != nil { 36 36 + return nil, sess, err 37 37 + } 38 38 + 39 39 + return repo, sess, nil 40 40 + } 41 41 + 42 42 + func getFlashesFromSession(e echo.Context, sess *sessions.Session) map[string]any { 43 43 + defer sess.Save(e.Request(), e.Response()) 44 44 + return map[string]any{ 45 45 + "errors": sess.Flashes("error"), 46 46 + "successes": sess.Flashes("success"), 47 47 + } 48 48 + } 49 49 + 50 50 + func (s *Server) handleAccountSigninGet(e echo.Context) error { 51 51 + _, sess, err := s.getSessionRepoOrErr(e) 52 52 + if err == nil { 53 53 + return e.Redirect(303, "/account") 54 54 + } 55 55 + 56 56 + return e.Render(200, "signin.html", map[string]any{ 57 57 + "flashes": getFlashesFromSession(e, sess), 58 58 + "QueryParams": e.QueryParams().Encode(), 59 59 + }) 60 60 + } 61 61 + 62 62 + func (s *Server) handleAccountSigninPost(e echo.Context) error { 63 63 + var req OauthSigninRequest 64 64 + if err := e.Bind(&req); err != nil { 65 65 + s.logger.Error("error binding sign in req", "error", err) 66 66 + return helpers.ServerError(e, nil) 67 67 + } 68 68 + 69 69 + sess, _ := session.Get("session", e) 70 70 + 71 71 + req.Username = strings.ToLower(req.Username) 72 72 + var idtype string 73 73 + if _, err := syntax.ParseDID(req.Username); err == nil { 74 74 + idtype = "did" 75 75 + } else if _, err := syntax.ParseHandle(req.Username); err == nil { 76 76 + idtype = "handle" 77 77 + } else { 78 78 + idtype = "email" 79 79 + } 80 80 + 81 81 + // TODO: we should make this a helper since we do it for the base create_session as well 82 82 + var repo models.RepoActor 83 83 + var err error 84 84 + switch idtype { 85 85 + case "did": 86 86 + err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.did = ?", nil, req.Username).Scan(&repo).Error 87 87 + case "handle": 88 88 + err = s.db.Raw("SELECT r.*, a.* FROM actors a LEFT JOIN repos r ON a.did = r.did WHERE a.handle = ?", nil, req.Username).Scan(&repo).Error 89 89 + case "email": 90 90 + err = s.db.Raw("SELECT r.*, a.* FROM repos r LEFT JOIN actors a ON r.did = a.did WHERE r.email = ?", nil, req.Username).Scan(&repo).Error 91 91 + } 92 92 + if err != nil { 93 93 + if err == gorm.ErrRecordNotFound { 94 94 + sess.AddFlash("Handle or password is incorrect", "error") 95 95 + } else { 96 96 + sess.AddFlash("Something went wrong!", "error") 97 97 + } 98 98 + sess.Save(e.Request(), e.Response()) 99 99 + return e.Redirect(303, "/account/signin") 100 100 + } 101 101 + 102 102 + if err := bcrypt.CompareHashAndPassword([]byte(repo.Password), []byte(req.Password)); err != nil { 103 103 + if err != bcrypt.ErrMismatchedHashAndPassword { 104 104 + sess.AddFlash("Handle or password is incorrect", "error") 105 105 + } else { 106 106 + sess.AddFlash("Something went wrong!", "error") 107 107 + } 108 108 + sess.Save(e.Request(), e.Response()) 109 109 + return e.Redirect(303, "/account/signin") 110 110 + } 111 111 + 112 112 + sess.Options = &sessions.Options{ 113 113 + Path: "/", 114 114 + MaxAge: int(AccountSessionMaxAge.Seconds()), 115 115 + HttpOnly: true, 116 116 + } 117 117 + 118 118 + sess.Values = map[any]any{} 119 119 + sess.Values["did"] = repo.Repo.Did 120 120 + 121 121 + if err := sess.Save(e.Request(), e.Response()); err != nil { 122 122 + return err 123 123 + } 124 124 + 125 125 + if req.QueryParams != "" { 126 126 + return e.Redirect(303, "/oauth/authorize?"+req.QueryParams) 127 127 + } else { 128 128 + return e.Redirect(303, "/account") 129 129 + } 130 130 + }

+35

server/handle_account_signout.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/gorilla/sessions" 5 5 + "github.com/labstack/echo-contrib/session" 6 6 + "github.com/labstack/echo/v4" 7 7 + ) 8 8 + 9 9 + func (s *Server) handleAccountSignout(e echo.Context) error { 10 10 + sess, err := session.Get("session", e) 11 11 + if err != nil { 12 12 + return err 13 13 + } 14 14 + 15 15 + sess.Options = &sessions.Options{ 16 16 + Path: "/", 17 17 + MaxAge: -1, 18 18 + HttpOnly: true, 19 19 + } 20 20 + 21 21 + sess.Values = map[any]any{} 22 22 + 23 23 + if err := sess.Save(e.Request(), e.Response()); err != nil { 24 24 + return err 25 25 + } 26 26 + 27 27 + reqUri := e.QueryParam("request_uri") 28 28 + 29 29 + redirect := "/account/signin" 30 30 + if reqUri != "" { 31 31 + redirect += "?" + e.QueryParams().Encode() 32 32 + } 33 33 + 34 34 + return e.Redirect(303, redirect) 35 35 + }

+2 -3

server/handle_import_repo.go

··· 9 9 10 10 "github.com/bluesky-social/indigo/atproto/syntax" 11 11 "github.com/bluesky-social/indigo/repo" 12 12 - "github.com/haileyok/cocoon/blockstore" 13 12 "github.com/haileyok/cocoon/internal/helpers" 14 13 "github.com/haileyok/cocoon/models" 15 14 blocks "github.com/ipfs/go-block-format" ··· 27 26 return helpers.ServerError(e, nil) 28 27 } 29 28 30 30 - bs := blockstore.New(urepo.Repo.Did, s.db) 29 29 + bs := s.getBlockstore(urepo.Repo.Did) 31 30 32 31 cs, err := car.NewCarReader(bytes.NewReader(b)) 33 32 if err != nil { ··· 107 106 return helpers.ServerError(e, nil) 108 107 } 109 108 110 110 - if err := bs.UpdateRepo(context.TODO(), root, rev); err != nil { 109 109 + if err := s.UpdateRepo(context.TODO(), urepo.Repo.Did, root, rev); err != nil { 111 110 s.logger.Error("error updating repo after commit", "error", err) 112 111 return helpers.ServerError(e, nil) 113 112 }

+132

server/handle_oauth_authorize.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "net/url" 5 5 + "strings" 6 6 + "time" 7 7 + 8 8 + "github.com/Azure/go-autorest/autorest/to" 9 9 + "github.com/haileyok/cocoon/internal/helpers" 10 10 + "github.com/haileyok/cocoon/oauth" 11 11 + "github.com/haileyok/cocoon/oauth/provider" 12 12 + "github.com/labstack/echo/v4" 13 13 + ) 14 14 + 15 15 + func (s *Server) handleOauthAuthorizeGet(e echo.Context) error { 16 16 + reqUri := e.QueryParam("request_uri") 17 17 + if reqUri == "" { 18 18 + // render page for logged out dev 19 19 + if s.config.Version == "dev" { 20 20 + return e.Render(200, "authorize.html", map[string]any{ 21 21 + "Scopes": []string{"atproto", "transition:generic"}, 22 22 + "AppName": "DEV MODE AUTHORIZATION PAGE", 23 23 + "Handle": "paula.cocoon.social", 24 24 + "RequestUri": "", 25 25 + }) 26 26 + } 27 27 + return helpers.InputError(e, to.StringPtr("no request uri")) 28 28 + } 29 29 + 30 30 + repo, _, err := s.getSessionRepoOrErr(e) 31 31 + if err != nil { 32 32 + return e.Redirect(303, "/account/signin?"+e.QueryParams().Encode()) 33 33 + } 34 34 + 35 35 + reqId, err := oauth.DecodeRequestUri(reqUri) 36 36 + if err != nil { 37 37 + return helpers.InputError(e, to.StringPtr(err.Error())) 38 38 + } 39 39 + 40 40 + var req provider.OauthAuthorizationRequest 41 41 + if err := s.db.Raw("SELECT * FROM oauth_authorization_requests WHERE request_id = ?", nil, reqId).Scan(&req).Error; err != nil { 42 42 + return helpers.ServerError(e, to.StringPtr(err.Error())) 43 43 + } 44 44 + 45 45 + clientId := e.QueryParam("client_id") 46 46 + if clientId != req.ClientId { 47 47 + return helpers.InputError(e, to.StringPtr("client id does not match the client id for the supplied request")) 48 48 + } 49 49 + 50 50 + client, err := s.oauthProvider.ClientManager.GetClient(e.Request().Context(), req.ClientId) 51 51 + if err != nil { 52 52 + return helpers.ServerError(e, to.StringPtr(err.Error())) 53 53 + } 54 54 + 55 55 + scopes := strings.Split(req.Parameters.Scope, " ") 56 56 + appName := client.Metadata.ClientName 57 57 + 58 58 + data := map[string]any{ 59 59 + "Scopes": scopes, 60 60 + "AppName": appName, 61 61 + "RequestUri": reqUri, 62 62 + "QueryParams": e.QueryParams().Encode(), 63 63 + "Handle": repo.Actor.Handle, 64 64 + } 65 65 + 66 66 + return e.Render(200, "authorize.html", data) 67 67 + } 68 68 + 69 69 + type OauthAuthorizePostRequest struct { 70 70 + RequestUri string `form:"request_uri"` 71 71 + AcceptOrRejct string `form:"accept_or_reject"` 72 72 + } 73 73 + 74 74 + func (s *Server) handleOauthAuthorizePost(e echo.Context) error { 75 75 + repo, _, err := s.getSessionRepoOrErr(e) 76 76 + if err != nil { 77 77 + return e.Redirect(303, "/account/signin") 78 78 + } 79 79 + 80 80 + var req OauthAuthorizePostRequest 81 81 + if err := e.Bind(&req); err != nil { 82 82 + s.logger.Error("error binding authorize post request", "error", err) 83 83 + return helpers.InputError(e, nil) 84 84 + } 85 85 + 86 86 + reqId, err := oauth.DecodeRequestUri(req.RequestUri) 87 87 + if err != nil { 88 88 + return helpers.InputError(e, to.StringPtr(err.Error())) 89 89 + } 90 90 + 91 91 + var authReq provider.OauthAuthorizationRequest 92 92 + if err := s.db.Raw("SELECT * FROM oauth_authorization_requests WHERE request_id = ?", nil, reqId).Scan(&authReq).Error; err != nil { 93 93 + return helpers.ServerError(e, to.StringPtr(err.Error())) 94 94 + } 95 95 + 96 96 + client, err := s.oauthProvider.ClientManager.GetClient(e.Request().Context(), authReq.ClientId) 97 97 + if err != nil { 98 98 + return helpers.ServerError(e, to.StringPtr(err.Error())) 99 99 + } 100 100 + 101 101 + // TODO: figure out how im supposed to actually redirect 102 102 + if req.AcceptOrRejct == "reject" { 103 103 + return e.Redirect(303, client.Metadata.ClientURI) 104 104 + } 105 105 + 106 106 + if time.Now().After(authReq.ExpiresAt) { 107 107 + return helpers.InputError(e, to.StringPtr("the request has expired")) 108 108 + } 109 109 + 110 110 + if authReq.Sub != nil || authReq.Code != nil { 111 111 + return helpers.InputError(e, to.StringPtr("this request was already authorized")) 112 112 + } 113 113 + 114 114 + code := oauth.GenerateCode() 115 115 + 116 116 + if err := s.db.Exec("UPDATE oauth_authorization_requests SET sub = ?, code = ?, accepted = ?, ip = ? WHERE request_id = ?", nil, repo.Repo.Did, code, true, e.RealIP(), reqId).Error; err != nil { 117 117 + s.logger.Error("error updating authorization request", "error", err) 118 118 + return helpers.ServerError(e, nil) 119 119 + } 120 120 + 121 121 + q := url.Values{} 122 122 + q.Set("state", authReq.Parameters.State) 123 123 + q.Set("iss", "https://"+s.config.Hostname) 124 124 + q.Set("code", code) 125 125 + 126 126 + hashOrQuestion := "?" 127 127 + if authReq.ClientAuth.Method != "private_key_jwt" { 128 128 + hashOrQuestion = "#" 129 129 + } 130 130 + 131 131 + return e.Redirect(303, authReq.Parameters.RedirectURI+hashOrQuestion+q.Encode()) 132 132 + }

+12

server/handle_oauth_jwks.go

··· 1 1 + package server 2 2 + 3 3 + import "github.com/labstack/echo/v4" 4 4 + 5 5 + type OauthJwksResponse struct { 6 6 + Keys []any `json:"keys"` 7 7 + } 8 8 + 9 9 + // TODO: ? 10 10 + func (s *Server) handleOauthJwks(e echo.Context) error { 11 11 + return e.JSON(200, OauthJwksResponse{Keys: []any{}}) 12 12 + }

+88

server/handle_oauth_par.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "time" 5 5 + 6 6 + "github.com/Azure/go-autorest/autorest/to" 7 7 + "github.com/haileyok/cocoon/internal/helpers" 8 8 + "github.com/haileyok/cocoon/oauth" 9 9 + "github.com/haileyok/cocoon/oauth/constants" 10 10 + "github.com/haileyok/cocoon/oauth/provider" 11 11 + "github.com/labstack/echo/v4" 12 12 + ) 13 13 + 14 14 + type OauthParResponse struct { 15 15 + ExpiresIn int64 `json:"expires_in"` 16 16 + RequestURI string `json:"request_uri"` 17 17 + } 18 18 + 19 19 + func (s *Server) handleOauthPar(e echo.Context) error { 20 20 + var parRequest provider.ParRequest 21 21 + if err := e.Bind(&parRequest); err != nil { 22 22 + s.logger.Error("error binding for par request", "error", err) 23 23 + return helpers.ServerError(e, nil) 24 24 + } 25 25 + 26 26 + if err := e.Validate(parRequest); err != nil { 27 27 + s.logger.Error("missing parameters for par request", "error", err) 28 28 + return helpers.InputError(e, nil) 29 29 + } 30 30 + 31 31 + // TODO: this seems wrong. should be a way to get the entire request url i believe, but this will work for now 32 32 + dpopProof, err := s.oauthProvider.DpopManager.CheckProof(e.Request().Method, "https://"+s.config.Hostname+e.Request().URL.String(), e.Request().Header, nil) 33 33 + if err != nil { 34 34 + s.logger.Error("error getting dpop proof", "error", err) 35 35 + return helpers.InputError(e, to.StringPtr(err.Error())) 36 36 + } 37 37 + 38 38 + client, clientAuth, err := s.oauthProvider.AuthenticateClient(e.Request().Context(), parRequest.AuthenticateClientRequestBase, dpopProof, &provider.AuthenticateClientOptions{ 39 39 + // rfc9449 40 40 + // https://github.com/bluesky-social/atproto/blob/main/packages/oauth/oauth-provider/src/oauth-provider.ts#L473 41 41 + AllowMissingDpopProof: true, 42 42 + }) 43 43 + if err != nil { 44 44 + s.logger.Error("error authenticating client", "error", err) 45 45 + return helpers.InputError(e, to.StringPtr(err.Error())) 46 46 + } 47 47 + 48 48 + if parRequest.DpopJkt == nil { 49 49 + if client.Metadata.DpopBoundAccessTokens { 50 50 + parRequest.DpopJkt = to.StringPtr(dpopProof.JKT) 51 51 + } 52 52 + } else { 53 53 + if !client.Metadata.DpopBoundAccessTokens { 54 54 + msg := "dpop bound access tokens are not enabled for this client" 55 55 + s.logger.Error(msg) 56 56 + return helpers.InputError(e, &msg) 57 57 + } 58 58 + 59 59 + if dpopProof.JKT != *parRequest.DpopJkt { 60 60 + msg := "supplied dpop jkt does not match header dpop jkt" 61 61 + s.logger.Error(msg) 62 62 + return helpers.InputError(e, &msg) 63 63 + } 64 64 + } 65 65 + 66 66 + eat := time.Now().Add(constants.ParExpiresIn) 67 67 + id := oauth.GenerateRequestId() 68 68 + 69 69 + authRequest := &provider.OauthAuthorizationRequest{ 70 70 + RequestId: id, 71 71 + ClientId: client.Metadata.ClientID, 72 72 + ClientAuth: *clientAuth, 73 73 + Parameters: parRequest, 74 74 + ExpiresAt: eat, 75 75 + } 76 76 + 77 77 + if err := s.db.Create(authRequest, nil).Error; err != nil { 78 78 + s.logger.Error("error creating auth request in db", "error", err) 79 79 + return helpers.ServerError(e, nil) 80 80 + } 81 81 + 82 82 + uri := oauth.EncodeRequestUri(id) 83 83 + 84 84 + return e.JSON(201, OauthParResponse{ 85 85 + ExpiresIn: int64(constants.ParExpiresIn.Seconds()), 86 86 + RequestURI: uri, 87 87 + }) 88 88 + }

+270

server/handle_oauth_token.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "bytes" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "fmt" 8 8 + "slices" 9 9 + "time" 10 10 + 11 11 + "github.com/Azure/go-autorest/autorest/to" 12 12 + "github.com/golang-jwt/jwt/v4" 13 13 + "github.com/haileyok/cocoon/internal/helpers" 14 14 + "github.com/haileyok/cocoon/oauth" 15 15 + "github.com/haileyok/cocoon/oauth/constants" 16 16 + "github.com/haileyok/cocoon/oauth/provider" 17 17 + "github.com/labstack/echo/v4" 18 18 + ) 19 19 + 20 20 + type OauthTokenRequest struct { 21 21 + provider.AuthenticateClientRequestBase 22 22 + GrantType string `form:"grant_type" json:"grant_type"` 23 23 + Code *string `form:"code" json:"code,omitempty"` 24 24 + CodeVerifier *string `form:"code_verifier" json:"code_verifier,omitempty"` 25 25 + RedirectURI *string `form:"redirect_uri" json:"redirect_uri,omitempty"` 26 26 + RefreshToken *string `form:"refresh_token" json:"refresh_token,omitempty"` 27 27 + } 28 28 + 29 29 + type OauthTokenResponse struct { 30 30 + AccessToken string `json:"access_token"` 31 31 + TokenType string `json:"token_type"` 32 32 + RefreshToken string `json:"refresh_token"` 33 33 + Scope string `json:"scope"` 34 34 + ExpiresIn int64 `json:"expires_in"` 35 35 + Sub string `json:"sub"` 36 36 + } 37 37 + 38 38 + func (s *Server) handleOauthToken(e echo.Context) error { 39 39 + var req OauthTokenRequest 40 40 + if err := e.Bind(&req); err != nil { 41 41 + s.logger.Error("error binding token request", "error", err) 42 42 + return helpers.ServerError(e, nil) 43 43 + } 44 44 + 45 45 + proof, err := s.oauthProvider.DpopManager.CheckProof(e.Request().Method, e.Request().URL.String(), e.Request().Header, nil) 46 46 + if err != nil { 47 47 + s.logger.Error("error getting dpop proof", "error", err) 48 48 + return helpers.InputError(e, to.StringPtr(err.Error())) 49 49 + } 50 50 + 51 51 + client, clientAuth, err := s.oauthProvider.AuthenticateClient(e.Request().Context(), req.AuthenticateClientRequestBase, proof, &provider.AuthenticateClientOptions{ 52 52 + AllowMissingDpopProof: true, 53 53 + }) 54 54 + if err != nil { 55 55 + s.logger.Error("error authenticating client", "error", err) 56 56 + return helpers.InputError(e, to.StringPtr(err.Error())) 57 57 + } 58 58 + 59 59 + // TODO: this should come from an oauth provier config 60 60 + if !slices.Contains([]string{"authorization_code", "refresh_token"}, req.GrantType) { 61 61 + return helpers.InputError(e, to.StringPtr(fmt.Sprintf(`"%s" grant type is not supported by the server`, req.GrantType))) 62 62 + } 63 63 + 64 64 + if !slices.Contains(client.Metadata.GrantTypes, req.GrantType) { 65 65 + return helpers.InputError(e, to.StringPtr(fmt.Sprintf(`"%s" grant type is not supported by the client`, req.GrantType))) 66 66 + } 67 67 + 68 68 + if req.GrantType == "authorization_code" { 69 69 + if req.Code == nil { 70 70 + return helpers.InputError(e, to.StringPtr(`"code" is required"`)) 71 71 + } 72 72 + 73 73 + var authReq provider.OauthAuthorizationRequest 74 74 + // get the lil guy and delete him 75 75 + if err := s.db.Raw("DELETE FROM oauth_authorization_requests WHERE code = ? RETURNING *", nil, *req.Code).Scan(&authReq).Error; err != nil { 76 76 + s.logger.Error("error finding authorization request", "error", err) 77 77 + return helpers.ServerError(e, nil) 78 78 + } 79 79 + 80 80 + if req.RedirectURI == nil || *req.RedirectURI != authReq.Parameters.RedirectURI { 81 81 + return helpers.InputError(e, to.StringPtr(`"redirect_uri" mismatch`)) 82 82 + } 83 83 + 84 84 + if authReq.Parameters.CodeChallenge != nil { 85 85 + if req.CodeVerifier == nil { 86 86 + return helpers.InputError(e, to.StringPtr(`"code_verifier" is required`)) 87 87 + } 88 88 + 89 89 + if len(*req.CodeVerifier) < 43 { 90 90 + return helpers.InputError(e, to.StringPtr(`"code_verifier" is too short`)) 91 91 + } 92 92 + 93 93 + switch *&authReq.Parameters.CodeChallengeMethod { 94 94 + case "", "plain": 95 95 + if authReq.Parameters.CodeChallenge != req.CodeVerifier { 96 96 + return helpers.InputError(e, to.StringPtr("invalid code_verifier")) 97 97 + } 98 98 + case "S256": 99 99 + inputChal, err := base64.RawURLEncoding.DecodeString(*authReq.Parameters.CodeChallenge) 100 100 + if err != nil { 101 101 + s.logger.Error("error decoding code challenge", "error", err) 102 102 + return helpers.ServerError(e, nil) 103 103 + } 104 104 + 105 105 + h := sha256.New() 106 106 + h.Write([]byte(*req.CodeVerifier)) 107 107 + compdChal := h.Sum(nil) 108 108 + 109 109 + if !bytes.Equal(inputChal, compdChal) { 110 110 + return helpers.InputError(e, to.StringPtr("invalid code_verifier")) 111 111 + } 112 112 + default: 113 113 + return helpers.InputError(e, to.StringPtr("unsupported code_challenge_method "+*&authReq.Parameters.CodeChallengeMethod)) 114 114 + } 115 115 + } else if req.CodeVerifier != nil { 116 116 + return helpers.InputError(e, to.StringPtr("code_challenge parameter wasn't provided")) 117 117 + } 118 118 + 119 119 + repo, err := s.getRepoActorByDid(*authReq.Sub) 120 120 + if err != nil { 121 121 + helpers.InputError(e, to.StringPtr("unable to find actor")) 122 122 + } 123 123 + 124 124 + now := time.Now() 125 125 + eat := now.Add(constants.TokenMaxAge) 126 126 + id := oauth.GenerateTokenId() 127 127 + 128 128 + refreshToken := oauth.GenerateRefreshToken() 129 129 + 130 130 + accessClaims := jwt.MapClaims{ 131 131 + "scope": authReq.Parameters.Scope, 132 132 + "aud": s.config.Did, 133 133 + "sub": repo.Repo.Did, 134 134 + "iat": now.Unix(), 135 135 + "exp": eat.Unix(), 136 136 + "jti": id, 137 137 + "client_id": authReq.ClientId, 138 138 + } 139 139 + 140 140 + if authReq.Parameters.DpopJkt != nil { 141 141 + accessClaims["cnf"] = *authReq.Parameters.DpopJkt 142 142 + } 143 143 + 144 144 + accessToken := jwt.NewWithClaims(jwt.SigningMethodES256, accessClaims) 145 145 + accessString, err := accessToken.SignedString(s.privateKey) 146 146 + if err != nil { 147 147 + return err 148 148 + } 149 149 + 150 150 + if err := s.db.Create(&provider.OauthToken{ 151 151 + ClientId: authReq.ClientId, 152 152 + ClientAuth: *clientAuth, 153 153 + Parameters: authReq.Parameters, 154 154 + ExpiresAt: eat, 155 155 + DeviceId: "", 156 156 + Sub: repo.Repo.Did, 157 157 + Code: *authReq.Code, 158 158 + Token: accessString, 159 159 + RefreshToken: refreshToken, 160 160 + Ip: authReq.Ip, 161 161 + }, nil).Error; err != nil { 162 162 + s.logger.Error("error creating token in db", "error", err) 163 163 + return helpers.ServerError(e, nil) 164 164 + } 165 165 + 166 166 + // prob not needed 167 167 + tokenType := "Bearer" 168 168 + if authReq.Parameters.DpopJkt != nil { 169 169 + tokenType = "DPoP" 170 170 + } 171 171 + 172 172 + e.Response().Header().Set("content-type", "application/json") 173 173 + 174 174 + return e.JSON(200, OauthTokenResponse{ 175 175 + AccessToken: accessString, 176 176 + RefreshToken: refreshToken, 177 177 + TokenType: tokenType, 178 178 + Scope: authReq.Parameters.Scope, 179 179 + ExpiresIn: int64(eat.Sub(time.Now()).Seconds()), 180 180 + Sub: repo.Repo.Did, 181 181 + }) 182 182 + } 183 183 + 184 184 + if req.GrantType == "refresh_token" { 185 185 + if req.RefreshToken == nil { 186 186 + return helpers.InputError(e, to.StringPtr(`"refresh_token" is required`)) 187 187 + } 188 188 + 189 189 + var oauthToken provider.OauthToken 190 190 + if err := s.db.Raw("SELECT * FROM oauth_tokens WHERE refresh_token = ?", nil, req.RefreshToken).Scan(&oauthToken).Error; err != nil { 191 191 + s.logger.Error("error finding oauth token by refresh token", "error", err, "refresh_token", req.RefreshToken) 192 192 + return helpers.ServerError(e, nil) 193 193 + } 194 194 + 195 195 + if client.Metadata.ClientID != oauthToken.ClientId { 196 196 + return helpers.InputError(e, to.StringPtr(`"client_id" mismatch`)) 197 197 + } 198 198 + 199 199 + if clientAuth.Method != oauthToken.ClientAuth.Method { 200 200 + return helpers.InputError(e, to.StringPtr(`"client authentication method mismatch`)) 201 201 + } 202 202 + 203 203 + if *oauthToken.Parameters.DpopJkt != proof.JKT { 204 204 + return helpers.InputError(e, to.StringPtr("dpop proof does not match expected jkt")) 205 205 + } 206 206 + 207 207 + ageRes := oauth.GetSessionAgeFromToken(oauthToken) 208 208 + 209 209 + if ageRes.SessionExpired { 210 210 + return helpers.InputError(e, to.StringPtr("Session expired")) 211 211 + } 212 212 + 213 213 + if ageRes.RefreshExpired { 214 214 + return helpers.InputError(e, to.StringPtr("Refresh token expired")) 215 215 + } 216 216 + 217 217 + if client.Metadata.DpopBoundAccessTokens && oauthToken.Parameters.DpopJkt == nil { 218 218 + // why? ref impl 219 219 + return helpers.InputError(e, to.StringPtr("dpop jkt is required for dpop bound access tokens")) 220 220 + } 221 221 + 222 222 + nextTokenId := oauth.GenerateTokenId() 223 223 + nextRefreshToken := oauth.GenerateRefreshToken() 224 224 + 225 225 + now := time.Now() 226 226 + eat := now.Add(constants.TokenMaxAge) 227 227 + 228 228 + accessClaims := jwt.MapClaims{ 229 229 + "scope": oauthToken.Parameters.Scope, 230 230 + "aud": s.config.Did, 231 231 + "sub": oauthToken.Sub, 232 232 + "iat": now.Unix(), 233 233 + "exp": eat.Unix(), 234 234 + "jti": nextTokenId, 235 235 + "client_id": oauthToken.ClientId, 236 236 + } 237 237 + 238 238 + if oauthToken.Parameters.DpopJkt != nil { 239 239 + accessClaims["cnf"] = *&oauthToken.Parameters.DpopJkt 240 240 + } 241 241 + 242 242 + accessToken := jwt.NewWithClaims(jwt.SigningMethodES256, accessClaims) 243 243 + accessString, err := accessToken.SignedString(s.privateKey) 244 244 + if err != nil { 245 245 + return err 246 246 + } 247 247 + 248 248 + if err := s.db.Exec("UPDATE oauth_tokens SET token = ?, refresh_token = ?, expires_at = ?, updated_at = ? WHERE refresh_token = ?", nil, accessString, nextRefreshToken, eat, now, *req.RefreshToken).Error; err != nil { 249 249 + s.logger.Error("error updating token", "error", err) 250 250 + return helpers.ServerError(e, nil) 251 251 + } 252 252 + 253 253 + // prob not needed 254 254 + tokenType := "Bearer" 255 255 + if oauthToken.Parameters.DpopJkt != nil { 256 256 + tokenType = "DPoP" 257 257 + } 258 258 + 259 259 + return e.JSON(200, OauthTokenResponse{ 260 260 + AccessToken: accessString, 261 261 + RefreshToken: nextRefreshToken, 262 262 + TokenType: tokenType, 263 263 + Scope: oauthToken.Parameters.Scope, 264 264 + ExpiresIn: int64(eat.Sub(time.Now()).Seconds()), 265 265 + Sub: oauthToken.Sub, 266 266 + }) 267 267 + } 268 268 + 269 269 + return helpers.InputError(e, to.StringPtr(fmt.Sprintf(`grant type "%s" is not supported`, req.GrantType))) 270 270 + }

+27 -15

server/handle_proxy.go

··· 17 17 secp256k1secec "gitlab.com/yawning/secp256k1-voi/secec" 18 18 ) 19 19 20 20 - func (s *Server) handleProxy(e echo.Context) error { 21 21 - repo, isAuthed := e.Get("repo").(*models.RepoActor) 22 22 - 23 23 - pts := strings.Split(e.Request().URL.Path, "/") 24 24 - if len(pts) != 3 { 25 25 - return fmt.Errorf("incorrect number of parts") 26 26 - } 27 27 - 20 20 + func (s *Server) getAtprotoProxyEndpointFromRequest(e echo.Context) (string, string, error) { 28 21 svc := e.Request().Header.Get("atproto-proxy") 29 22 if svc == "" { 30 30 - svc = "did:web:api.bsky.app#bsky_appview" // TODO: should be a config var probably 23 23 + svc = s.config.DefaultAtprotoProxy 31 24 } 32 25 33 26 svcPts := strings.Split(svc, "#") 34 27 if len(svcPts) != 2 { 35 35 - return fmt.Errorf("invalid service header") 28 28 + return "", "", fmt.Errorf("invalid service header") 36 29 } 37 30 38 31 svcDid := svcPts[0] ··· 40 33 41 34 doc, err := s.passport.FetchDoc(e.Request().Context(), svcDid) 42 35 if err != nil { 43 43 - return err 36 36 + return "", "", err 44 37 } 45 38 46 39 var endpoint string ··· 50 43 } 51 44 } 52 45 46 46 + return endpoint, svcDid, nil 47 47 + } 48 48 + 49 49 + func (s *Server) handleProxy(e echo.Context) error { 50 50 + lgr := s.logger.With("handler", "handleProxy") 51 51 + 52 52 + repo, isAuthed := e.Get("repo").(*models.RepoActor) 53 53 + 54 54 + pts := strings.Split(e.Request().URL.Path, "/") 55 55 + if len(pts) != 3 { 56 56 + return fmt.Errorf("incorrect number of parts") 57 57 + } 58 58 + 59 59 + endpoint, svcDid, err := s.getAtprotoProxyEndpointFromRequest(e) 60 60 + if err != nil { 61 61 + lgr.Error("could not get atproto proxy", "error", err) 62 62 + return helpers.ServerError(e, nil) 63 63 + } 64 64 + 53 65 requrl := e.Request().URL 54 66 requrl.Host = strings.TrimPrefix(endpoint, "https://") 55 67 requrl.Scheme = "https" ··· 78 90 } 79 91 hj, err := json.Marshal(header) 80 92 if err != nil { 81 81 - s.logger.Error("error marshaling header", "error", err) 93 93 + lgr.Error("error marshaling header", "error", err) 82 94 return helpers.ServerError(e, nil) 83 95 } 84 96 ··· 93 105 } 94 106 pj, err := json.Marshal(payload) 95 107 if err != nil { 96 96 - s.logger.Error("error marashaling payload", "error", err) 108 108 + lgr.Error("error marashaling payload", "error", err) 97 109 return helpers.ServerError(e, nil) 98 110 } 99 111 ··· 104 116 105 117 sk, err := secp256k1secec.NewPrivateKey(repo.SigningKey) 106 118 if err != nil { 107 107 - s.logger.Error("can't load private key", "error", err) 119 119 + lgr.Error("can't load private key", "error", err) 108 120 return err 109 121 } 110 122 111 123 R, S, _, err := sk.SignRaw(rand.Reader, hash[:]) 112 124 if err != nil { 113 113 - s.logger.Error("error signing", "error", err) 125 125 + lgr.Error("error signing", "error", err) 114 126 } 115 127 116 128 rBytes := R.Bytes()

+38 -9

server/handle_repo_list_records.go

··· 2 2 3 3 import ( 4 4 "strconv" 5 5 - "strings" 6 5 7 6 "github.com/Azure/go-autorest/autorest/to" 8 7 "github.com/bluesky-social/indigo/atproto/data" 8 8 + "github.com/bluesky-social/indigo/atproto/syntax" 9 9 "github.com/haileyok/cocoon/internal/helpers" 10 10 "github.com/haileyok/cocoon/models" 11 11 "github.com/labstack/echo/v4" 12 12 ) 13 13 + 14 14 + type ComAtprotoRepoListRecordsRequest struct { 15 15 + Repo string `query:"repo" validate:"required"` 16 16 + Collection string `query:"collection" validate:"required,atproto-nsid"` 17 17 + Limit int64 `query:"limit"` 18 18 + Cursor string `query:"cursor"` 19 19 + Reverse bool `query:"reverse"` 20 20 + } 13 21 14 22 type ComAtprotoRepoListRecordsResponse struct { 15 23 Cursor *string `json:"cursor,omitempty"` ··· 38 46 } 39 47 40 48 func (s *Server) handleListRecords(e echo.Context) error { 41 41 - did := e.QueryParam("repo") 42 42 - collection := e.QueryParam("collection") 43 43 - cursor := e.QueryParam("cursor") 44 44 - reverse := e.QueryParam("reverse") 49 49 + var req ComAtprotoRepoListRecordsRequest 50 50 + if err := e.Bind(&req); err != nil { 51 51 + s.logger.Error("could not bind list records request", "error", err) 52 52 + return helpers.ServerError(e, nil) 53 53 + } 54 54 + 55 55 + if err := e.Validate(req); err != nil { 56 56 + return helpers.InputError(e, nil) 57 57 + } 58 58 + 59 59 + if req.Limit <= 0 { 60 60 + req.Limit = 50 61 61 + } else if req.Limit > 100 { 62 62 + req.Limit = 100 63 63 + } 64 64 + 45 65 limit, err := getLimitFromContext(e, 50) 46 66 if err != nil { 47 67 return helpers.InputError(e, nil) ··· 51 71 dir := "<" 52 72 cursorquery := "" 53 73 54 54 - if strings.ToLower(reverse) == "true" { 74 74 + if req.Reverse { 55 75 sort = "ASC" 56 76 dir = ">" 57 77 } 58 78 59 59 - params := []any{did, collection} 60 60 - if cursor != "" { 61 61 - params = append(params, cursor) 79 79 + did := req.Repo 80 80 + if _, err := syntax.ParseDID(did); err != nil { 81 81 + actor, err := s.getActorByHandle(req.Repo) 82 82 + if err != nil { 83 83 + return helpers.InputError(e, to.StringPtr("RepoNotFound")) 84 84 + } 85 85 + did = actor.Did 86 86 + } 87 87 + 88 88 + params := []any{did, req.Collection} 89 89 + if req.Cursor != "" { 90 90 + params = append(params, req.Cursor) 62 91 cursorquery = "AND created_at " + dir + " ?" 63 92 } 64 93 params = append(params, limit)

+65

server/handle_server_check_account_status.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "github.com/haileyok/cocoon/internal/helpers" 5 5 + "github.com/haileyok/cocoon/models" 6 6 + "github.com/ipfs/go-cid" 7 7 + "github.com/labstack/echo/v4" 8 8 + ) 9 9 + 10 10 + type ComAtprotoServerCheckAccountStatusResponse struct { 11 11 + Activated bool `json:"activated"` 12 12 + ValidDid bool `json:"validDid"` 13 13 + RepoCommit string `json:"repoCommit"` 14 14 + RepoRev string `json:"repoRev"` 15 15 + RepoBlocks int64 `json:"repoBlocks"` 16 16 + IndexedRecords int64 `json:"indexedRecords"` 17 17 + PrivateStateValues int64 `json:"privateStateValues"` 18 18 + ExpectedBlobs int64 `json:"expectedBlobs"` 19 19 + ImportedBlobs int64 `json:"importedBlobs"` 20 20 + } 21 21 + 22 22 + func (s *Server) handleServerCheckAccountStatus(e echo.Context) error { 23 23 + urepo := e.Get("repo").(*models.RepoActor) 24 24 + 25 25 + resp := ComAtprotoServerCheckAccountStatusResponse{ 26 26 + Activated: true, // TODO: should allow for deactivation etc. 27 27 + ValidDid: true, // TODO: should probably verify? 28 28 + RepoRev: urepo.Rev, 29 29 + ImportedBlobs: 0, // TODO: ??? 30 30 + } 31 31 + 32 32 + rootcid, err := cid.Cast(urepo.Root) 33 33 + if err != nil { 34 34 + s.logger.Error("error casting cid", "error", err) 35 35 + return helpers.ServerError(e, nil) 36 36 + } 37 37 + resp.RepoCommit = rootcid.String() 38 38 + 39 39 + type CountResp struct { 40 40 + Ct int64 41 41 + } 42 42 + 43 43 + var blockCtResp CountResp 44 44 + if err := s.db.Raw("SELECT COUNT(*) AS ct FROM blocks WHERE did = ?", nil, urepo.Repo.Did).Scan(&blockCtResp).Error; err != nil { 45 45 + s.logger.Error("error getting block count", "error", err) 46 46 + return helpers.ServerError(e, nil) 47 47 + } 48 48 + resp.RepoBlocks = blockCtResp.Ct 49 49 + 50 50 + var recCtResp CountResp 51 51 + if err := s.db.Raw("SELECT COUNT(*) AS ct FROM records WHERE did = ?", nil, urepo.Repo.Did).Scan(&recCtResp).Error; err != nil { 52 52 + s.logger.Error("error getting record count", "error", err) 53 53 + return helpers.ServerError(e, nil) 54 54 + } 55 55 + resp.IndexedRecords = recCtResp.Ct 56 56 + 57 57 + var blobCtResp CountResp 58 58 + if err := s.db.Raw("SELECT COUNT(*) AS ct FROM blobs WHERE did = ?", nil, urepo.Repo.Did).Scan(&blobCtResp).Error; err != nil { 59 59 + s.logger.Error("error getting record count", "error", err) 60 60 + return helpers.ServerError(e, nil) 61 61 + } 62 62 + resp.ExpectedBlobs = blobCtResp.Ct 63 63 + 64 64 + return e.JSON(200, resp) 65 65 + }

+2 -2

server/handle_server_confirm_email.go

··· 28 28 } 29 29 30 30 if urepo.EmailVerificationCode == nil || urepo.EmailVerificationCodeExpiresAt == nil { 31 31 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 31 31 + return helpers.ExpiredTokenError(e) 32 32 } 33 33 34 34 if *urepo.EmailVerificationCode != req.Token { ··· 36 36 } 37 37 38 38 if time.Now().UTC().After(*urepo.EmailVerificationCodeExpiresAt) { 39 39 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 39 39 + return helpers.ExpiredTokenError(e) 40 40 } 41 41 42 42 now := time.Now().UTC()

+2 -3

server/handle_server_create_account.go

··· 14 14 "github.com/bluesky-social/indigo/events" 15 15 "github.com/bluesky-social/indigo/repo" 16 16 "github.com/bluesky-social/indigo/util" 17 17 - "github.com/haileyok/cocoon/blockstore" 18 17 "github.com/haileyok/cocoon/internal/helpers" 19 18 "github.com/haileyok/cocoon/models" 20 19 "github.com/labstack/echo/v4" ··· 177 176 } 178 177 179 178 if customDidHeader == "" { 180 180 - bs := blockstore.New(signupDid, s.db) 179 179 + bs := s.getBlockstore(signupDid) 181 180 r := repo.NewRepo(context.TODO(), signupDid, bs) 182 181 183 182 root, rev, err := r.Commit(context.TODO(), urepo.SignFor) ··· 186 185 return helpers.ServerError(e, nil) 187 186 } 188 187 189 189 - if err := bs.UpdateRepo(context.TODO(), root, rev); err != nil { 188 188 + if err := s.UpdateRepo(context.TODO(), urepo.Did, root, rev); err != nil { 190 189 s.logger.Error("error updating repo after commit", "error", err) 191 190 return helpers.ServerError(e, nil) 192 191 }

+114

server/handle_server_get_service_auth.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "crypto/rand" 5 5 + "crypto/sha256" 6 6 + "encoding/base64" 7 7 + "encoding/json" 8 8 + "fmt" 9 9 + "strings" 10 10 + "time" 11 11 + 12 12 + "github.com/Azure/go-autorest/autorest/to" 13 13 + "github.com/google/uuid" 14 14 + "github.com/haileyok/cocoon/internal/helpers" 15 15 + "github.com/haileyok/cocoon/models" 16 16 + "github.com/labstack/echo/v4" 17 17 + secp256k1secec "gitlab.com/yawning/secp256k1-voi/secec" 18 18 + ) 19 19 + 20 20 + type ServerGetServiceAuthRequest struct { 21 21 + Aud string `query:"aud" validate:"required,atproto-did"` 22 22 + // exp should be a float, as some clients will send a non-integer expiration 23 23 + Exp float64 `query:"exp"` 24 24 + Lxm string `query:"lxm" validate:"required,atproto-nsid"` 25 25 + } 26 26 + 27 27 + func (s *Server) handleServerGetServiceAuth(e echo.Context) error { 28 28 + var req ServerGetServiceAuthRequest 29 29 + if err := e.Bind(&req); err != nil { 30 30 + s.logger.Error("could not bind service auth request", "error", err) 31 31 + return helpers.ServerError(e, nil) 32 32 + } 33 33 + 34 34 + if err := e.Validate(req); err != nil { 35 35 + return helpers.InputError(e, nil) 36 36 + } 37 37 + 38 38 + exp := int64(req.Exp) 39 39 + now := time.Now().Unix() 40 40 + if exp == 0 { 41 41 + exp = now + 60 // default 42 42 + } 43 43 + 44 44 + if req.Lxm == "com.atproto.server.getServiceAuth" { 45 45 + return helpers.InputError(e, to.StringPtr("may not generate auth tokens recursively")) 46 46 + } 47 47 + 48 48 + maxExp := now + (60 * 30) 49 49 + if exp > maxExp { 50 50 + return helpers.InputError(e, to.StringPtr("expiration too big. smoller please")) 51 51 + } 52 52 + 53 53 + repo := e.Get("repo").(*models.RepoActor) 54 54 + 55 55 + header := map[string]string{ 56 56 + "alg": "ES256K", 57 57 + "crv": "secp256k1", 58 58 + "typ": "JWT", 59 59 + } 60 60 + hj, err := json.Marshal(header) 61 61 + if err != nil { 62 62 + s.logger.Error("error marshaling header", "error", err) 63 63 + return helpers.ServerError(e, nil) 64 64 + } 65 65 + 66 66 + encheader := strings.TrimRight(base64.RawURLEncoding.EncodeToString(hj), "=") 67 67 + 68 68 + payload := map[string]any{ 69 69 + "iss": repo.Repo.Did, 70 70 + "aud": req.Aud, 71 71 + "lxm": req.Lxm, 72 72 + "jti": uuid.NewString(), 73 73 + "exp": exp, 74 74 + "iat": now, 75 75 + } 76 76 + pj, err := json.Marshal(payload) 77 77 + if err != nil { 78 78 + s.logger.Error("error marashaling payload", "error", err) 79 79 + return helpers.ServerError(e, nil) 80 80 + } 81 81 + 82 82 + encpayload := strings.TrimRight(base64.RawURLEncoding.EncodeToString(pj), "=") 83 83 + 84 84 + input := fmt.Sprintf("%s.%s", encheader, encpayload) 85 85 + hash := sha256.Sum256([]byte(input)) 86 86 + 87 87 + sk, err := secp256k1secec.NewPrivateKey(repo.SigningKey) 88 88 + if err != nil { 89 89 + s.logger.Error("can't load private key", "error", err) 90 90 + return err 91 91 + } 92 92 + 93 93 + R, S, _, err := sk.SignRaw(rand.Reader, hash[:]) 94 94 + if err != nil { 95 95 + s.logger.Error("error signing", "error", err) 96 96 + return helpers.ServerError(e, nil) 97 97 + } 98 98 + 99 99 + rBytes := R.Bytes() 100 100 + sBytes := S.Bytes() 101 101 + 102 102 + rPadded := make([]byte, 32) 103 103 + sPadded := make([]byte, 32) 104 104 + copy(rPadded[32-len(rBytes):], rBytes) 105 105 + copy(sPadded[32-len(sBytes):], sBytes) 106 106 + 107 107 + rawsig := append(rPadded, sPadded...) 108 108 + encsig := strings.TrimRight(base64.RawURLEncoding.EncodeToString(rawsig), "=") 109 109 + token := fmt.Sprintf("%s.%s", input, encsig) 110 110 + 111 111 + return e.JSON(200, map[string]string{ 112 112 + "token": token, 113 113 + }) 114 114 + }

+2 -2

server/handle_server_reset_password.go

··· 33 33 } 34 34 35 35 if *urepo.PasswordResetCode != req.Token { 36 36 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 36 36 + return helpers.InvalidTokenError(e) 37 37 } 38 38 39 39 if time.Now().UTC().After(*urepo.PasswordResetCodeExpiresAt) { 40 40 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 40 40 + return helpers.ExpiredTokenError(e) 41 41 } 42 42 43 43 hash, err := bcrypt.GenerateFromPassword([]byte(req.Password), 10)

+3 -4

server/handle_server_update_email.go

··· 3 3 import ( 4 4 "time" 5 5 6 6 - "github.com/Azure/go-autorest/autorest/to" 7 6 "github.com/haileyok/cocoon/internal/helpers" 8 7 "github.com/haileyok/cocoon/models" 9 8 "github.com/labstack/echo/v4" ··· 29 28 } 30 29 31 30 if urepo.EmailUpdateCode == nil || urepo.EmailUpdateCodeExpiresAt == nil { 32 32 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 31 31 + return helpers.InvalidTokenError(e) 33 32 } 34 33 35 34 if *urepo.EmailUpdateCode != req.Token { 36 36 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 35 35 + return helpers.InvalidTokenError(e) 37 36 } 38 37 39 38 if time.Now().UTC().After(*urepo.EmailUpdateCodeExpiresAt) { 40 40 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 39 39 + return helpers.ExpiredTokenError(e) 41 40 } 42 41 43 42 if err := s.db.Exec("UPDATE repos SET email_update_code = NULL, email_update_code_expires_at = NULL, email_confirmed_at = NULL, email = ? WHERE did = ?", nil, req.Email, urepo.Repo.Did).Error; err != nil {

+1 -2

server/handle_sync_get_blocks.go

··· 6 6 "strings" 7 7 8 8 "github.com/bluesky-social/indigo/carstore" 9 9 - "github.com/haileyok/cocoon/blockstore" 10 9 "github.com/haileyok/cocoon/internal/helpers" 11 10 "github.com/ipfs/go-cid" 12 11 cbor "github.com/ipfs/go-ipld-cbor" ··· 54 53 return helpers.ServerError(e, nil) 55 54 } 56 55 57 57 - bs := blockstore.New(urepo.Repo.Did, s.db) 56 56 + bs := s.getBlockstore(urepo.Repo.Did) 58 57 59 58 for _, c := range cids { 60 59 b, err := bs.Get(context.TODO(), c)

+88

server/handle_well_known.go

··· 1 1 package server 2 2 3 3 import ( 4 4 + "fmt" 5 5 + 6 6 + "github.com/Azure/go-autorest/autorest/to" 4 7 "github.com/labstack/echo/v4" 5 8 ) 6 9 10 10 + var ( 11 11 + CocoonSupportedScopes = []string{ 12 12 + "atproto", 13 13 + "transition:email", 14 14 + "transition:generic", 15 15 + "transition:chat.bsky", 16 16 + } 17 17 + ) 18 18 + 19 19 + type OauthAuthorizationMetadata struct { 20 20 + Issuer string `json:"issuer"` 21 21 + RequestParameterSupported bool `json:"request_parameter_supported"` 22 22 + RequestUriParameterSupported bool `json:"request_uri_parameter_supported"` 23 23 + RequireRequestUriRegistration *bool `json:"require_request_uri_registration,omitempty"` 24 24 + ScopesSupported []string `json:"scopes_supported"` 25 25 + SubjectTypesSupported []string `json:"subject_types_supported"` 26 26 + ResponseTypesSupported []string `json:"response_types_supported"` 27 27 + ResponseModesSupported []string `json:"response_modes_supported"` 28 28 + GrantTypesSupported []string `json:"grant_types_supported"` 29 29 + CodeChallengeMethodsSupported []string `json:"code_challenge_methods_supported"` 30 30 + UILocalesSupported []string `json:"ui_locales_supported"` 31 31 + DisplayValuesSupported []string `json:"display_values_supported"` 32 32 + RequestObjectSigningAlgValuesSupported []string `json:"request_object_signing_alg_values_supported"` 33 33 + AuthorizationResponseISSParameterSupported bool `json:"authorization_response_iss_parameter_supported"` 34 34 + RequestObjectEncryptionAlgValuesSupported []string `json:"request_object_encryption_alg_values_supported"` 35 35 + RequestObjectEncryptionEncValuesSupported []string `json:"request_object_encryption_enc_values_supported"` 36 36 + JwksUri string `json:"jwks_uri"` 37 37 + AuthorizationEndpoint string `json:"authorization_endpoint"` 38 38 + TokenEndpoint string `json:"token_endpoint"` 39 39 + TokenEndpointAuthMethodsSupported []string `json:"token_endpoint_auth_methods_supported"` 40 40 + TokenEndpointAuthSigningAlgValuesSupported []string `json:"token_endpoint_auth_signing_alg_values_supported"` 41 41 + RevocationEndpoint string `json:"revocation_endpoint"` 42 42 + IntrospectionEndpoint string `json:"introspection_endpoint"` 43 43 + PushedAuthorizationRequestEndpoint string `json:"pushed_authorization_request_endpoint"` 44 44 + RequirePushedAuthorizationRequests bool `json:"require_pushed_authorization_requests"` 45 45 + DpopSigningAlgValuesSupported []string `json:"dpop_signing_alg_values_supported"` 46 46 + ProtectedResources []string `json:"protected_resources"` 47 47 + ClientIDMetadataDocumentSupported bool `json:"client_id_metadata_document_supported"` 48 48 + } 49 49 + 7 50 func (s *Server) handleWellKnown(e echo.Context) error { 8 51 return e.JSON(200, map[string]any{ 9 52 "@context": []string{ ··· 19 62 }, 20 63 }) 21 64 } 65 65 + 66 66 + func (s *Server) handleOauthProtectedResource(e echo.Context) error { 67 67 + return e.JSON(200, map[string]any{ 68 68 + "resource": "https://" + s.config.Hostname, 69 69 + "authorization_servers": []string{ 70 70 + "https://" + s.config.Hostname, 71 71 + }, 72 72 + "scopes_supported": []string{}, 73 73 + "bearer_methods_supported": []string{"header"}, 74 74 + "resource_documentation": "https://atproto.com", 75 75 + }) 76 76 + } 77 77 + 78 78 + func (s *Server) handleOauthAuthorizationServer(e echo.Context) error { 79 79 + return e.JSON(200, OauthAuthorizationMetadata{ 80 80 + Issuer: "https://" + s.config.Hostname, 81 81 + RequestParameterSupported: true, 82 82 + RequestUriParameterSupported: true, 83 83 + RequireRequestUriRegistration: to.BoolPtr(true), 84 84 + ScopesSupported: CocoonSupportedScopes, 85 85 + SubjectTypesSupported: []string{"public"}, 86 86 + ResponseTypesSupported: []string{"code"}, 87 87 + ResponseModesSupported: []string{"query", "fragment", "form_post"}, 88 88 + GrantTypesSupported: []string{"authorization_code", "refresh_token"}, 89 89 + CodeChallengeMethodsSupported: []string{"S256"}, 90 90 + UILocalesSupported: []string{"en-US"}, 91 91 + DisplayValuesSupported: []string{"page", "popup", "touch"}, 92 92 + RequestObjectSigningAlgValuesSupported: []string{"ES256"}, // only es256 for now... 93 93 + AuthorizationResponseISSParameterSupported: true, 94 94 + RequestObjectEncryptionAlgValuesSupported: []string{}, 95 95 + RequestObjectEncryptionEncValuesSupported: []string{}, 96 96 + JwksUri: fmt.Sprintf("https://%s/oauth/jwks", s.config.Hostname), 97 97 + AuthorizationEndpoint: fmt.Sprintf("https://%s/oauth/authorize", s.config.Hostname), 98 98 + TokenEndpoint: fmt.Sprintf("https://%s/oauth/token", s.config.Hostname), 99 99 + TokenEndpointAuthMethodsSupported: []string{"none", "private_key_jwt"}, 100 100 + TokenEndpointAuthSigningAlgValuesSupported: []string{"ES256"}, // Same as above, just es256 101 101 + RevocationEndpoint: fmt.Sprintf("https://%s/oauth/revoke", s.config.Hostname), 102 102 + IntrospectionEndpoint: fmt.Sprintf("https://%s/oauth/introspect", s.config.Hostname), 103 103 + PushedAuthorizationRequestEndpoint: fmt.Sprintf("https://%s/oauth/par", s.config.Hostname), 104 104 + RequirePushedAuthorizationRequests: true, 105 105 + DpopSigningAlgValuesSupported: []string{"ES256"}, // again same as above 106 106 + ProtectedResources: []string{"https://" + s.config.Hostname}, 107 107 + ClientIDMetadataDocumentSupported: true, 108 108 + }) 109 109 + }

+16

server/mail.go

··· 3 3 import "fmt" 4 4 5 5 func (s *Server) sendWelcomeMail(email, handle string) error { 6 6 + if s.mail == nil { 7 7 + return nil 8 8 + } 9 9 + 6 10 s.mailLk.Lock() 7 11 defer s.mailLk.Unlock() 8 12 ··· 18 22 } 19 23 20 24 func (s *Server) sendPasswordReset(email, handle, code string) error { 25 25 + if s.mail == nil { 26 26 + return nil 27 27 + } 28 28 + 21 29 s.mailLk.Lock() 22 30 defer s.mailLk.Unlock() 23 31 ··· 33 41 } 34 42 35 43 func (s *Server) sendEmailUpdate(email, handle, code string) error { 44 44 + if s.mail == nil { 45 45 + return nil 46 46 + } 47 47 + 36 48 s.mailLk.Lock() 37 49 defer s.mailLk.Unlock() 38 50 ··· 48 60 } 49 61 50 62 func (s *Server) sendEmailVerification(email, handle, code string) error { 63 63 + if s.mail == nil { 64 64 + return nil 65 65 + } 66 66 + 51 67 s.mailLk.Lock() 52 68 defer s.mailLk.Unlock() 53 69

+268

server/middleware.go

··· 1 1 + package server 2 2 + 3 3 + import ( 4 4 + "crypto/sha256" 5 5 + "encoding/base64" 6 6 + "fmt" 7 7 + "strings" 8 8 + "time" 9 9 + 10 10 + "github.com/Azure/go-autorest/autorest/to" 11 11 + "github.com/golang-jwt/jwt/v4" 12 12 + "github.com/haileyok/cocoon/internal/helpers" 13 13 + "github.com/haileyok/cocoon/models" 14 14 + "github.com/haileyok/cocoon/oauth/provider" 15 15 + "github.com/labstack/echo/v4" 16 16 + "gitlab.com/yawning/secp256k1-voi" 17 17 + secp256k1secec "gitlab.com/yawning/secp256k1-voi/secec" 18 18 + "gorm.io/gorm" 19 19 + ) 20 20 + 21 21 + func (s *Server) handleAdminMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 22 22 + return func(e echo.Context) error { 23 23 + username, password, ok := e.Request().BasicAuth() 24 24 + if !ok || username != "admin" || password != s.config.AdminPassword { 25 25 + return helpers.InputError(e, to.StringPtr("Unauthorized")) 26 26 + } 27 27 + 28 28 + if err := next(e); err != nil { 29 29 + e.Error(err) 30 30 + } 31 31 + 32 32 + return nil 33 33 + } 34 34 + } 35 35 + 36 36 + func (s *Server) handleLegacySessionMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 37 37 + return func(e echo.Context) error { 38 38 + authheader := e.Request().Header.Get("authorization") 39 39 + if authheader == "" { 40 40 + return e.JSON(401, map[string]string{"error": "Unauthorized"}) 41 41 + } 42 42 + 43 43 + pts := strings.Split(authheader, " ") 44 44 + if len(pts) != 2 { 45 45 + return helpers.ServerError(e, nil) 46 46 + } 47 47 + 48 48 + // move on to oauth session middleware if this is a dpop token 49 49 + if pts[0] == "DPoP" { 50 50 + return next(e) 51 51 + } 52 52 + 53 53 + tokenstr := pts[1] 54 54 + token, _, err := new(jwt.Parser).ParseUnverified(tokenstr, jwt.MapClaims{}) 55 55 + claims, ok := token.Claims.(jwt.MapClaims) 56 56 + if !ok { 57 57 + return helpers.InvalidTokenError(e) 58 58 + } 59 59 + 60 60 + var did string 61 61 + var repo *models.RepoActor 62 62 + 63 63 + // service auth tokens 64 64 + lxm, hasLxm := claims["lxm"] 65 65 + if hasLxm { 66 66 + pts := strings.Split(e.Request().URL.String(), "/") 67 67 + if lxm != pts[len(pts)-1] { 68 68 + s.logger.Error("service auth lxm incorrect", "lxm", lxm, "expected", pts[len(pts)-1], "error", err) 69 69 + return helpers.InputError(e, nil) 70 70 + } 71 71 + 72 72 + maybeDid, ok := claims["iss"].(string) 73 73 + if !ok { 74 74 + s.logger.Error("no iss in service auth token", "error", err) 75 75 + return helpers.InputError(e, nil) 76 76 + } 77 77 + did = maybeDid 78 78 + 79 79 + maybeRepo, err := s.getRepoActorByDid(did) 80 80 + if err != nil { 81 81 + s.logger.Error("error fetching repo", "error", err) 82 82 + return helpers.ServerError(e, nil) 83 83 + } 84 84 + repo = maybeRepo 85 85 + } 86 86 + 87 87 + if token.Header["alg"] != "ES256K" { 88 88 + token, err = new(jwt.Parser).Parse(tokenstr, func(t *jwt.Token) (any, error) { 89 89 + if _, ok := t.Method.(*jwt.SigningMethodECDSA); !ok { 90 90 + return nil, fmt.Errorf("unsupported signing method: %v", t.Header["alg"]) 91 91 + } 92 92 + return s.privateKey.Public(), nil 93 93 + }) 94 94 + if err != nil { 95 95 + s.logger.Error("error parsing jwt", "error", err) 96 96 + return helpers.ExpiredTokenError(e) 97 97 + } 98 98 + 99 99 + if !token.Valid { 100 100 + return helpers.InvalidTokenError(e) 101 101 + } 102 102 + } else { 103 103 + kpts := strings.Split(tokenstr, ".") 104 104 + signingInput := kpts[0] + "." + kpts[1] 105 105 + hash := sha256.Sum256([]byte(signingInput)) 106 106 + sigBytes, err := base64.RawURLEncoding.DecodeString(kpts[2]) 107 107 + if err != nil { 108 108 + s.logger.Error("error decoding signature bytes", "error", err) 109 109 + return helpers.ServerError(e, nil) 110 110 + } 111 111 + 112 112 + if len(sigBytes) != 64 { 113 113 + s.logger.Error("incorrect sigbytes length", "length", len(sigBytes)) 114 114 + return helpers.ServerError(e, nil) 115 115 + } 116 116 + 117 117 + rBytes := sigBytes[:32] 118 118 + sBytes := sigBytes[32:] 119 119 + rr, _ := secp256k1.NewScalarFromBytes((*[32]byte)(rBytes)) 120 120 + ss, _ := secp256k1.NewScalarFromBytes((*[32]byte)(sBytes)) 121 121 + 122 122 + sk, err := secp256k1secec.NewPrivateKey(repo.SigningKey) 123 123 + if err != nil { 124 124 + s.logger.Error("can't load private key", "error", err) 125 125 + return err 126 126 + } 127 127 + 128 128 + pubKey, ok := sk.Public().(*secp256k1secec.PublicKey) 129 129 + if !ok { 130 130 + s.logger.Error("error getting public key from sk") 131 131 + return helpers.ServerError(e, nil) 132 132 + } 133 133 + 134 134 + verified := pubKey.VerifyRaw(hash[:], rr, ss) 135 135 + if !verified { 136 136 + s.logger.Error("error verifying", "error", err) 137 137 + return helpers.ServerError(e, nil) 138 138 + } 139 139 + } 140 140 + 141 141 + isRefresh := e.Request().URL.Path == "/xrpc/com.atproto.server.refreshSession" 142 142 + scope, _ := claims["scope"].(string) 143 143 + 144 144 + if isRefresh && scope != "com.atproto.refresh" { 145 145 + return helpers.InvalidTokenError(e) 146 146 + } else if !hasLxm && !isRefresh && scope != "com.atproto.access" { 147 147 + return helpers.InvalidTokenError(e) 148 148 + } 149 149 + 150 150 + table := "tokens" 151 151 + if isRefresh { 152 152 + table = "refresh_tokens" 153 153 + } 154 154 + 155 155 + if isRefresh { 156 156 + type Result struct { 157 157 + Found bool 158 158 + } 159 159 + var result Result 160 160 + if err := s.db.Raw("SELECT EXISTS(SELECT 1 FROM "+table+" WHERE token = ?) AS found", nil, tokenstr).Scan(&result).Error; err != nil { 161 161 + if err == gorm.ErrRecordNotFound { 162 162 + return helpers.InvalidTokenError(e) 163 163 + } 164 164 + 165 165 + s.logger.Error("error getting token from db", "error", err) 166 166 + return helpers.ServerError(e, nil) 167 167 + } 168 168 + 169 169 + if !result.Found { 170 170 + return helpers.InvalidTokenError(e) 171 171 + } 172 172 + } 173 173 + 174 174 + exp, ok := claims["exp"].(float64) 175 175 + if !ok { 176 176 + s.logger.Error("error getting iat from token") 177 177 + return helpers.ServerError(e, nil) 178 178 + } 179 179 + 180 180 + if exp < float64(time.Now().UTC().Unix()) { 181 181 + return helpers.ExpiredTokenError(e) 182 182 + } 183 183 + 184 184 + if repo == nil { 185 185 + maybeRepo, err := s.getRepoActorByDid(claims["sub"].(string)) 186 186 + if err != nil { 187 187 + s.logger.Error("error fetching repo", "error", err) 188 188 + return helpers.ServerError(e, nil) 189 189 + } 190 190 + repo = maybeRepo 191 191 + did = repo.Repo.Did 192 192 + } 193 193 + 194 194 + e.Set("repo", repo) 195 195 + e.Set("did", did) 196 196 + e.Set("token", tokenstr) 197 197 + 198 198 + if err := next(e); err != nil { 199 199 + return helpers.InvalidTokenError(e) 200 200 + } 201 201 + 202 202 + return nil 203 203 + } 204 204 + } 205 205 + 206 206 + func (s *Server) handleOauthSessionMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 207 207 + return func(e echo.Context) error { 208 208 + authheader := e.Request().Header.Get("authorization") 209 209 + if authheader == "" { 210 210 + return e.JSON(401, map[string]string{"error": "Unauthorized"}) 211 211 + } 212 212 + 213 213 + pts := strings.Split(authheader, " ") 214 214 + if len(pts) != 2 { 215 215 + return helpers.ServerError(e, nil) 216 216 + } 217 217 + 218 218 + if pts[0] != "DPoP" { 219 219 + return next(e) 220 220 + } 221 221 + 222 222 + accessToken := pts[1] 223 223 + 224 224 + nonce := s.oauthProvider.NextNonce() 225 225 + if nonce != "" { 226 226 + e.Response().Header().Set("DPoP-Nonce", nonce) 227 227 + e.Response().Header().Add("access-control-expose-headers", "DPoP-Nonce") 228 228 + } 229 229 + 230 230 + proof, err := s.oauthProvider.DpopManager.CheckProof(e.Request().Method, "https://"+s.config.Hostname+e.Request().URL.String(), e.Request().Header, to.StringPtr(accessToken)) 231 231 + if err != nil { 232 232 + s.logger.Error("invalid dpop proof", "error", err) 233 233 + return helpers.InputError(e, to.StringPtr(err.Error())) 234 234 + } 235 235 + 236 236 + var oauthToken provider.OauthToken 237 237 + if err := s.db.Raw("SELECT * FROM oauth_tokens WHERE token = ?", nil, accessToken).Scan(&oauthToken).Error; err != nil { 238 238 + s.logger.Error("error finding access token in db", "error", err) 239 239 + return helpers.InputError(e, nil) 240 240 + } 241 241 + 242 242 + if oauthToken.Token == "" { 243 243 + return helpers.InvalidTokenError(e) 244 244 + } 245 245 + 246 246 + if *oauthToken.Parameters.DpopJkt != proof.JKT { 247 247 + s.logger.Error("jkt mismatch", "token", oauthToken.Parameters.DpopJkt, "proof", proof.JKT) 248 248 + return helpers.InputError(e, to.StringPtr("dpop jkt mismatch")) 249 249 + } 250 250 + 251 251 + if time.Now().After(oauthToken.ExpiresAt) { 252 252 + return helpers.ExpiredTokenError(e) 253 253 + } 254 254 + 255 255 + repo, err := s.getRepoActorByDid(oauthToken.Sub) 256 256 + if err != nil { 257 257 + s.logger.Error("could not find actor in db", "error", err) 258 258 + return helpers.ServerError(e, nil) 259 259 + } 260 260 + 261 261 + e.Set("repo", repo) 262 262 + e.Set("did", repo.Repo.Did) 263 263 + e.Set("token", accessToken) 264 264 + e.Set("scopes", strings.Split(oauthToken.Parameters.Scope, " ")) 265 265 + 266 266 + return next(e) 267 267 + } 268 268 + }

+13 -13

server/repo.go

··· 16 16 "github.com/bluesky-social/indigo/events" 17 17 lexutil "github.com/bluesky-social/indigo/lex/util" 18 18 "github.com/bluesky-social/indigo/repo" 19 19 - "github.com/bluesky-social/indigo/util" 20 20 - "github.com/haileyok/cocoon/blockstore" 21 19 "github.com/haileyok/cocoon/internal/db" 22 20 "github.com/haileyok/cocoon/models" 21 21 + "github.com/haileyok/cocoon/recording_blockstore" 23 22 blocks "github.com/ipfs/go-block-format" 24 23 "github.com/ipfs/go-cid" 25 24 cbor "github.com/ipfs/go-ipld-cbor" ··· 103 102 return nil, err 104 103 } 105 104 106 106 - dbs := blockstore.New(urepo.Did, rm.db) 105 105 + dbs := rm.s.getBlockstore(urepo.Did) 106 106 + bs := recording_blockstore.New(dbs) 107 107 r, err := repo.OpenRepo(context.TODO(), dbs, rootcid) 108 108 109 109 entries := []models.Record{} ··· 274 274 } 275 275 } 276 276 277 277 - for _, op := range dbs.GetLog() { 277 277 + for _, op := range bs.GetLogMap() { 278 278 if _, err := carstore.LdWrite(buf, op.Cid().Bytes(), op.RawData()); err != nil { 279 279 return nil, err 280 280 } ··· 318 318 Rev: rev, 319 319 Since: &urepo.Rev, 320 320 Commit: lexutil.LexLink(newroot), 321 321 - Time: time.Now().Format(util.ISO8601), 321 321 + Time: time.Now().Format(time.RFC3339Nano), 322 322 Ops: ops, 323 323 TooBig: false, 324 324 }, 325 325 }) 326 326 327 327 - if err := dbs.UpdateRepo(context.TODO(), newroot, rev); err != nil { 327 327 + if err := rm.s.UpdateRepo(context.TODO(), urepo.Did, newroot, rev); err != nil { 328 328 return nil, err 329 329 } 330 330 ··· 345 345 return cid.Undef, nil, err 346 346 } 347 347 348 348 - dbs := blockstore.New(urepo.Did, rm.db) 349 349 - bs := util.NewLoggingBstore(dbs) 348 348 + dbs := rm.s.getBlockstore(urepo.Did) 349 349 + bs := recording_blockstore.New(dbs) 350 350 351 351 r, err := repo.OpenRepo(context.TODO(), bs, c) 352 352 if err != nil { ··· 358 358 return cid.Undef, nil, err 359 359 } 360 360 361 361 - return c, bs.GetLoggedBlocks(), nil 361 361 + return c, bs.GetLogArray(), nil 362 362 } 363 363 364 364 func (rm *RepoMan) incrementBlobRefs(urepo models.Repo, cbor []byte) ([]cid.Cid, error) { ··· 414 414 return nil, fmt.Errorf("error unmarshaling cbor: %w", err) 415 415 } 416 416 417 417 - var deepiter func(interface{}) error 418 418 - deepiter = func(item interface{}) error { 417 417 + var deepiter func(any) error 418 418 + deepiter = func(item any) error { 419 419 switch val := item.(type) { 420 420 - case map[string]interface{}: 420 420 + case map[string]any: 421 421 if val["$type"] == "blob" { 422 422 if ref, ok := val["ref"].(string); ok { 423 423 c, err := cid.Parse(ref) ··· 430 430 return deepiter(v) 431 431 } 432 432 } 433 433 - case []interface{}: 433 433 + case []any: 434 434 for _, v := range val { 435 435 deepiter(v) 436 436 }

+186 -150

server/server.go

··· 4 4 "bytes" 5 5 "context" 6 6 "crypto/ecdsa" 7 7 + "embed" 7 8 "errors" 8 9 "fmt" 9 10 "io" ··· 11 12 "net/http" 12 13 "net/smtp" 13 14 "os" 14 14 - "strings" 15 15 + "path/filepath" 15 16 "sync" 17 17 + "text/template" 16 18 "time" 17 19 18 18 - "github.com/Azure/go-autorest/autorest/to" 19 20 "github.com/aws/aws-sdk-go/aws" 20 21 "github.com/aws/aws-sdk-go/aws/credentials" 21 22 "github.com/aws/aws-sdk-go/aws/session" ··· 27 28 "github.com/bluesky-social/indigo/xrpc" 28 29 "github.com/domodwyer/mailyak/v3" 29 30 "github.com/go-playground/validator" 30 30 - "github.com/golang-jwt/jwt/v4" 31 31 + "github.com/gorilla/sessions" 31 32 "github.com/haileyok/cocoon/identity" 32 33 "github.com/haileyok/cocoon/internal/db" 33 34 "github.com/haileyok/cocoon/internal/helpers" 34 35 "github.com/haileyok/cocoon/models" 36 36 + "github.com/haileyok/cocoon/oauth/client" 37 37 + "github.com/haileyok/cocoon/oauth/constants" 38 38 + "github.com/haileyok/cocoon/oauth/dpop" 39 39 + "github.com/haileyok/cocoon/oauth/provider" 35 40 "github.com/haileyok/cocoon/plc" 41 41 + "github.com/ipfs/go-cid" 42 42 + echo_session "github.com/labstack/echo-contrib/session" 36 43 "github.com/labstack/echo/v4" 37 44 "github.com/labstack/echo/v4/middleware" 38 38 - "github.com/lestrrat-go/jwx/v2/jwk" 39 45 slogecho "github.com/samber/slog-echo" 40 46 "gorm.io/driver/sqlite" 41 47 "gorm.io/gorm" 48 48 + ) 49 49 + 50 50 + const ( 51 51 + AccountSessionMaxAge = 30 * 24 * time.Hour // one week 42 52 ) 43 53 44 54 type S3Config struct { ··· 51 61 } 52 62 53 63 type Server struct { 54 54 - http *http.Client 55 55 - httpd *http.Server 56 56 - mail *mailyak.MailYak 57 57 - mailLk *sync.Mutex 58 58 - echo *echo.Echo 59 59 - db *db.DB 60 60 - plcClient *plc.Client 61 61 - logger *slog.Logger 62 62 - config *config 63 63 - privateKey *ecdsa.PrivateKey 64 64 - repoman *RepoMan 65 65 - evtman *events.EventManager 66 66 - passport *identity.Passport 64 64 + http *http.Client 65 65 + httpd *http.Server 66 66 + mail *mailyak.MailYak 67 67 + mailLk *sync.Mutex 68 68 + echo *echo.Echo 69 69 + db *db.DB 70 70 + plcClient *plc.Client 71 71 + logger *slog.Logger 72 72 + config *config 73 73 + privateKey *ecdsa.PrivateKey 74 74 + repoman *RepoMan 75 75 + oauthProvider *provider.Provider 76 76 + evtman *events.EventManager 77 77 + passport *identity.Passport 67 78 68 79 dbName string 69 80 s3Config *S3Config ··· 90 101 SmtpName string 91 102 92 103 S3Config *S3Config 104 104 + 105 105 + SessionSecret string 106 106 + 107 107 + DefaultAtprotoProxy string 108 108 + 109 109 + BlockstoreVariant BlockstoreVariant 93 110 } 94 111 95 112 type config struct { 96 96 - Version string 97 97 - Did string 98 98 - Hostname string 99 99 - ContactEmail string 100 100 - EnforcePeering bool 101 101 - Relays []string 102 102 - AdminPassword string 103 103 - SmtpEmail string 104 104 - SmtpName string 113 113 + Version string 114 114 + Did string 115 115 + Hostname string 116 116 + ContactEmail string 117 117 + EnforcePeering bool 118 118 + Relays []string 119 119 + AdminPassword string 120 120 + SmtpEmail string 121 121 + SmtpName string 122 122 + DefaultAtprotoProxy string 123 123 + BlockstoreVariant BlockstoreVariant 105 124 } 106 125 107 126 type CustomValidator struct { ··· 132 151 return nil 133 152 } 134 153 135 135 - func (s *Server) handleAdminMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 136 136 - return func(e echo.Context) error { 137 137 - username, password, ok := e.Request().BasicAuth() 138 138 - if !ok || username != "admin" || password != s.config.AdminPassword { 139 139 - return helpers.InputError(e, to.StringPtr("Unauthorized")) 140 140 - } 154 154 + //go:embed templates/* 155 155 + var templateFS embed.FS 141 156 142 142 - if err := next(e); err != nil { 143 143 - e.Error(err) 144 144 - } 157 157 + //go:embed static/* 158 158 + var staticFS embed.FS 145 159 146 146 - return nil 147 147 - } 160 160 + type TemplateRenderer struct { 161 161 + templates *template.Template 162 162 + isDev bool 163 163 + templatePath string 148 164 } 149 165 150 150 - func (s *Server) handleSessionMiddleware(next echo.HandlerFunc) echo.HandlerFunc { 151 151 - return func(e echo.Context) error { 152 152 - authheader := e.Request().Header.Get("authorization") 153 153 - if authheader == "" { 154 154 - return e.JSON(401, map[string]string{"error": "Unauthorized"}) 155 155 - } 156 156 - 157 157 - pts := strings.Split(authheader, " ") 158 158 - if len(pts) != 2 { 159 159 - return helpers.ServerError(e, nil) 160 160 - } 161 161 - 162 162 - tokenstr := pts[1] 163 163 - 164 164 - token, err := new(jwt.Parser).Parse(tokenstr, func(t *jwt.Token) (any, error) { 165 165 - if _, ok := t.Method.(*jwt.SigningMethodECDSA); !ok { 166 166 - return nil, fmt.Errorf("unsupported signing method: %v", t.Header["alg"]) 167 167 - } 168 168 - 169 169 - return s.privateKey.Public(), nil 170 170 - }) 171 171 - if err != nil { 172 172 - s.logger.Error("error parsing jwt", "error", err) 173 173 - // NOTE: https://github.com/bluesky-social/atproto/discussions/3319 174 174 - return e.JSON(400, map[string]string{"error": "ExpiredToken", "message": "token has expired"}) 175 175 - } 176 176 - 177 177 - claims, ok := token.Claims.(jwt.MapClaims) 178 178 - if !ok || !token.Valid { 179 179 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 180 180 - } 181 181 - 182 182 - isRefresh := e.Request().URL.Path == "/xrpc/com.atproto.server.refreshSession" 183 183 - scope := claims["scope"].(string) 184 184 - 185 185 - if isRefresh && scope != "com.atproto.refresh" { 186 186 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 187 187 - } else if !isRefresh && scope != "com.atproto.access" { 188 188 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 189 189 - } 190 190 - 191 191 - table := "tokens" 192 192 - if isRefresh { 193 193 - table = "refresh_tokens" 194 194 - } 195 195 - 196 196 - type Result struct { 197 197 - Found bool 198 198 - } 199 199 - var result Result 200 200 - if err := s.db.Raw("SELECT EXISTS(SELECT 1 FROM "+table+" WHERE token = ?) AS found", nil, tokenstr).Scan(&result).Error; err != nil { 201 201 - if err == gorm.ErrRecordNotFound { 202 202 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 203 203 - } 204 204 - 205 205 - s.logger.Error("error getting token from db", "error", err) 206 206 - return helpers.ServerError(e, nil) 166 166 + func (s *Server) loadTemplates() { 167 167 + absPath, _ := filepath.Abs("server/templates/*.html") 168 168 + if s.config.Version == "dev" { 169 169 + tmpl := template.Must(template.ParseGlob(absPath)) 170 170 + s.echo.Renderer = &TemplateRenderer{ 171 171 + templates: tmpl, 172 172 + isDev: true, 173 173 + templatePath: absPath, 207 174 } 208 208 - 209 209 - if !result.Found { 210 210 - return helpers.InputError(e, to.StringPtr("InvalidToken")) 211 211 - } 212 212 - 213 213 - exp, ok := claims["exp"].(float64) 214 214 - if !ok { 215 215 - s.logger.Error("error getting iat from token") 216 216 - return helpers.ServerError(e, nil) 217 217 - } 218 218 - 219 219 - if exp < float64(time.Now().UTC().Unix()) { 220 220 - return helpers.InputError(e, to.StringPtr("ExpiredToken")) 175 175 + } else { 176 176 + tmpl := template.Must(template.ParseFS(templateFS, "templates/*.html")) 177 177 + s.echo.Renderer = &TemplateRenderer{ 178 178 + templates: tmpl, 179 179 + isDev: false, 221 180 } 181 181 + } 182 182 + } 222 183 223 223 - repo, err := s.getRepoActorByDid(claims["sub"].(string)) 184 184 + func (t *TemplateRenderer) Render(w io.Writer, name string, data any, c echo.Context) error { 185 185 + if t.isDev { 186 186 + tmpl, err := template.ParseGlob(t.templatePath) 224 187 if err != nil { 225 225 - s.logger.Error("error fetching repo", "error", err) 226 226 - return helpers.ServerError(e, nil) 227 227 - } 228 228 - 229 229 - e.Set("repo", repo) 230 230 - e.Set("did", claims["sub"]) 231 231 - e.Set("token", tokenstr) 232 232 - 233 233 - if err := next(e); err != nil { 234 234 - e.Error(err) 188 188 + return err 235 189 } 190 190 + t.templates = tmpl 191 191 + } 236 192 237 237 - return nil 193 193 + if viewContext, isMap := data.(map[string]any); isMap { 194 194 + viewContext["reverse"] = c.Echo().Reverse 238 195 } 196 196 + 197 197 + return t.templates.ExecuteTemplate(w, name, data) 239 198 } 240 199 241 200 func New(args *Args) (*Server, error) { ··· 271 230 args.Logger = slog.New(slog.NewTextHandler(os.Stdout, &slog.HandlerOptions{})) 272 231 } 273 232 233 233 + if args.SessionSecret == "" { 234 234 + panic("SESSION SECRET WAS NOT SET. THIS IS REQUIRED. ") 235 235 + } 236 236 + 274 237 e := echo.New() 275 238 276 239 e.Pre(middleware.RemoveTrailingSlash()) 277 240 e.Pre(slogecho.New(args.Logger)) 241 241 + e.Use(echo_session.Middleware(sessions.NewCookieStore([]byte(args.SessionSecret)))) 278 242 e.Use(middleware.CORSWithConfig(middleware.CORSConfig{ 279 243 AllowOrigins: []string{"*"}, 280 244 AllowHeaders: []string{"*"}, ··· 348 312 return nil, err 349 313 } 350 314 351 351 - key, err := jwk.ParseKey(jwkbytes) 315 315 + key, err := helpers.ParseJWKFromBytes(jwkbytes) 352 316 if err != nil { 353 317 return nil, err 354 318 } ··· 358 322 return nil, err 359 323 } 360 324 325 325 + oauthCli := &http.Client{ 326 326 + Timeout: 10 * time.Second, 327 327 + } 328 328 + 329 329 + var nonceSecret []byte 330 330 + maybeSecret, err := os.ReadFile("nonce.secret") 331 331 + if err != nil && !os.IsNotExist(err) { 332 332 + args.Logger.Error("error attempting to read nonce secret", "error", err) 333 333 + } else { 334 334 + nonceSecret = maybeSecret 335 335 + } 336 336 + 361 337 s := &Server{ 362 338 http: h, 363 339 httpd: httpd, ··· 367 343 plcClient: plcClient, 368 344 privateKey: &pkey, 369 345 config: &config{ 370 370 - Version: args.Version, 371 371 - Did: args.Did, 372 372 - Hostname: args.Hostname, 373 373 - ContactEmail: args.ContactEmail, 374 374 - EnforcePeering: false, 375 375 - Relays: args.Relays, 376 376 - AdminPassword: args.AdminPassword, 377 377 - SmtpName: args.SmtpName, 378 378 - SmtpEmail: args.SmtpEmail, 346 346 + Version: args.Version, 347 347 + Did: args.Did, 348 348 + Hostname: args.Hostname, 349 349 + ContactEmail: args.ContactEmail, 350 350 + EnforcePeering: false, 351 351 + Relays: args.Relays, 352 352 + AdminPassword: args.AdminPassword, 353 353 + SmtpName: args.SmtpName, 354 354 + SmtpEmail: args.SmtpEmail, 355 355 + DefaultAtprotoProxy: args.DefaultAtprotoProxy, 356 356 + BlockstoreVariant: args.BlockstoreVariant, 379 357 }, 380 358 evtman: events.NewEventManager(events.NewMemPersister()), 381 359 passport: identity.NewPassport(h, identity.NewMemCache(10_000)), 382 360 383 361 dbName: args.DbName, 384 362 s3Config: args.S3Config, 363 363 + 364 364 + oauthProvider: provider.NewProvider(provider.Args{ 365 365 + Hostname: args.Hostname, 366 366 + ClientManagerArgs: client.ManagerArgs{ 367 367 + Cli: oauthCli, 368 368 + Logger: args.Logger, 369 369 + }, 370 370 + DpopManagerArgs: dpop.ManagerArgs{ 371 371 + NonceSecret: nonceSecret, 372 372 + NonceRotationInterval: constants.NonceMaxRotationInterval / 3, 373 373 + OnNonceSecretCreated: func(newNonce []byte) { 374 374 + if err := os.WriteFile("nonce.secret", newNonce, 0644); err != nil { 375 375 + args.Logger.Error("error writing new nonce secret", "error", err) 376 376 + } 377 377 + }, 378 378 + Logger: args.Logger, 379 379 + Hostname: args.Hostname, 380 380 + }, 381 381 + }), 385 382 } 383 383 + 384 384 + s.loadTemplates() 386 385 387 386 s.repoman = NewRepoMan(s) // TODO: this is way too lazy, stop it 388 387 ··· 402 401 } 403 402 404 403 func (s *Server) addRoutes() { 404 404 + // static 405 405 + if s.config.Version == "dev" { 406 406 + s.echo.Static("/static", "server/static") 407 407 + } else { 408 408 + s.echo.GET("/static/*", echo.WrapHandler(http.FileServer(http.FS(staticFS)))) 409 409 + } 410 410 + 405 411 // random stuff 406 412 s.echo.GET("/", s.handleRoot) 407 413 s.echo.GET("/xrpc/_health", s.handleHealth) 408 414 s.echo.GET("/.well-known/did.json", s.handleWellKnown) 415 415 + s.echo.GET("/.well-known/oauth-protected-resource", s.handleOauthProtectedResource) 416 416 + s.echo.GET("/.well-known/oauth-authorization-server", s.handleOauthAuthorizationServer) 409 417 s.echo.GET("/robots.txt", s.handleRobots) 410 418 411 419 // public ··· 428 436 s.echo.GET("/xrpc/com.atproto.sync.listBlobs", s.handleSyncListBlobs) 429 437 s.echo.GET("/xrpc/com.atproto.sync.getBlob", s.handleSyncGetBlob) 430 438 439 439 + // account 440 440 + s.echo.GET("/account", s.handleAccount) 441 441 + s.echo.POST("/account/revoke", s.handleAccountRevoke) 442 442 + s.echo.GET("/account/signin", s.handleAccountSigninGet) 443 443 + s.echo.POST("/account/signin", s.handleAccountSigninPost) 444 444 + s.echo.GET("/account/signout", s.handleAccountSignout) 445 445 + 446 446 + // oauth account 447 447 + s.echo.GET("/oauth/jwks", s.handleOauthJwks) 448 448 + s.echo.GET("/oauth/authorize", s.handleOauthAuthorizeGet) 449 449 + s.echo.POST("/oauth/authorize", s.handleOauthAuthorizePost) 450 450 + 451 451 + // oauth authorization 452 452 + s.echo.POST("/oauth/par", s.handleOauthPar, s.oauthProvider.BaseMiddleware) 453 453 + s.echo.POST("/oauth/token", s.handleOauthToken, s.oauthProvider.BaseMiddleware) 454 454 + 431 455 // authed 432 432 - s.echo.GET("/xrpc/com.atproto.server.getSession", s.handleGetSession, s.handleSessionMiddleware) 433 433 - s.echo.POST("/xrpc/com.atproto.server.refreshSession", s.handleRefreshSession, s.handleSessionMiddleware) 434 434 - s.echo.POST("/xrpc/com.atproto.server.deleteSession", s.handleDeleteSession, s.handleSessionMiddleware) 435 435 - s.echo.POST("/xrpc/com.atproto.identity.updateHandle", s.handleIdentityUpdateHandle, s.handleSessionMiddleware) 436 436 - s.echo.POST("/xrpc/com.atproto.server.confirmEmail", s.handleServerConfirmEmail, s.handleSessionMiddleware) 437 437 - s.echo.POST("/xrpc/com.atproto.server.requestEmailConfirmation", s.handleServerRequestEmailConfirmation, s.handleSessionMiddleware) 456 456 + s.echo.GET("/xrpc/com.atproto.server.getSession", s.handleGetSession, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 457 457 + s.echo.POST("/xrpc/com.atproto.server.refreshSession", s.handleRefreshSession, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 458 458 + s.echo.POST("/xrpc/com.atproto.server.deleteSession", s.handleDeleteSession, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 459 459 + s.echo.POST("/xrpc/com.atproto.identity.updateHandle", s.handleIdentityUpdateHandle, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 460 460 + s.echo.POST("/xrpc/com.atproto.server.confirmEmail", s.handleServerConfirmEmail, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 461 461 + s.echo.POST("/xrpc/com.atproto.server.requestEmailConfirmation", s.handleServerRequestEmailConfirmation, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 438 462 s.echo.POST("/xrpc/com.atproto.server.requestPasswordReset", s.handleServerRequestPasswordReset) // AUTH NOT REQUIRED FOR THIS ONE 439 439 - s.echo.POST("/xrpc/com.atproto.server.requestEmailUpdate", s.handleServerRequestEmailUpdate, s.handleSessionMiddleware) 440 440 - s.echo.POST("/xrpc/com.atproto.server.resetPassword", s.handleServerResetPassword, s.handleSessionMiddleware) 441 441 - s.echo.POST("/xrpc/com.atproto.server.updateEmail", s.handleServerUpdateEmail, s.handleSessionMiddleware) 463 463 + s.echo.POST("/xrpc/com.atproto.server.requestEmailUpdate", s.handleServerRequestEmailUpdate, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 464 464 + s.echo.POST("/xrpc/com.atproto.server.resetPassword", s.handleServerResetPassword, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 465 465 + s.echo.POST("/xrpc/com.atproto.server.updateEmail", s.handleServerUpdateEmail, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 466 466 + s.echo.GET("/xrpc/com.atproto.server.getServiceAuth", s.handleServerGetServiceAuth, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 467 467 + s.echo.GET("/xrpc/com.atproto.server.checkAccountStatus", s.handleServerCheckAccountStatus, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 442 468 443 469 // repo 444 444 - s.echo.POST("/xrpc/com.atproto.repo.createRecord", s.handleCreateRecord, s.handleSessionMiddleware) 445 445 - s.echo.POST("/xrpc/com.atproto.repo.putRecord", s.handlePutRecord, s.handleSessionMiddleware) 446 446 - s.echo.POST("/xrpc/com.atproto.repo.deleteRecord", s.handleDeleteRecord, s.handleSessionMiddleware) 447 447 - s.echo.POST("/xrpc/com.atproto.repo.applyWrites", s.handleApplyWrites, s.handleSessionMiddleware) 448 448 - s.echo.POST("/xrpc/com.atproto.repo.uploadBlob", s.handleRepoUploadBlob, s.handleSessionMiddleware) 449 449 - s.echo.POST("/xrpc/com.atproto.repo.importRepo", s.handleRepoImportRepo, s.handleSessionMiddleware) 470 470 + s.echo.POST("/xrpc/com.atproto.repo.createRecord", s.handleCreateRecord, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 471 471 + s.echo.POST("/xrpc/com.atproto.repo.putRecord", s.handlePutRecord, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 472 472 + s.echo.POST("/xrpc/com.atproto.repo.deleteRecord", s.handleDeleteRecord, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 473 473 + s.echo.POST("/xrpc/com.atproto.repo.applyWrites", s.handleApplyWrites, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 474 474 + s.echo.POST("/xrpc/com.atproto.repo.uploadBlob", s.handleRepoUploadBlob, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 475 475 + s.echo.POST("/xrpc/com.atproto.repo.importRepo", s.handleRepoImportRepo, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 450 476 451 477 // stupid silly endpoints 452 452 - s.echo.GET("/xrpc/app.bsky.actor.getPreferences", s.handleActorGetPreferences, s.handleSessionMiddleware) 453 453 - s.echo.POST("/xrpc/app.bsky.actor.putPreferences", s.handleActorPutPreferences, s.handleSessionMiddleware) 454 454 - 455 455 - // are there any routes that we should be allowing without auth? i dont think so but idk 456 456 - s.echo.GET("/xrpc/*", s.handleProxy, s.handleSessionMiddleware) 457 457 - s.echo.POST("/xrpc/*", s.handleProxy, s.handleSessionMiddleware) 478 478 + s.echo.GET("/xrpc/app.bsky.actor.getPreferences", s.handleActorGetPreferences, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 479 479 + s.echo.POST("/xrpc/app.bsky.actor.putPreferences", s.handleActorPutPreferences, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 458 480 459 481 // admin routes 460 482 s.echo.POST("/xrpc/com.atproto.server.createInviteCode", s.handleCreateInviteCode, s.handleAdminMiddleware) 461 483 s.echo.POST("/xrpc/com.atproto.server.createInviteCodes", s.handleCreateInviteCodes, s.handleAdminMiddleware) 484 484 + 485 485 + // are there any routes that we should be allowing without auth? i dont think so but idk 486 486 + s.echo.GET("/xrpc/*", s.handleProxy, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 487 487 + s.echo.POST("/xrpc/*", s.handleProxy, s.handleLegacySessionMiddleware, s.handleOauthSessionMiddleware) 462 488 } 463 489 464 490 func (s *Server) Serve(ctx context.Context) error { ··· 476 502 &models.Record{}, 477 503 &models.Blob{}, 478 504 &models.BlobPart{}, 505 505 + &provider.OauthToken{}, 506 506 + &provider.OauthAuthorizationRequest{}, 479 507 ) 480 508 481 509 s.logger.Info("starting cocoon") ··· 618 646 go s.doBackup() 619 647 } 620 648 } 649 649 + 650 650 + func (s *Server) UpdateRepo(ctx context.Context, did string, root cid.Cid, rev string) error { 651 651 + if err := s.db.Exec("UPDATE repos SET root = ?, rev = ? WHERE did = ?", nil, root.Bytes(), rev, did).Error; err != nil { 652 652 + return err 653 653 + } 654 654 + 655 655 + return nil 656 656 + }

+4

server/static/pico.css

··· 1 1 + @charset "UTF-8";/*! 2 2 + * Pico CSS ✨ v2.1.1 (https://picocss.com) 3 3 + * Copyright 2019-2025 - Licensed under MIT 4 4 + */:host,:root{--pico-font-family-emoji:"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--pico-font-family-sans-serif:system-ui,"Segoe UI",Roboto,Oxygen,Ubuntu,Cantarell,Helvetica,Arial,"Helvetica Neue",sans-serif,var(--pico-font-family-emoji);--pico-font-family-monospace:ui-monospace,SFMono-Regular,"SF Mono",Menlo,Consolas,"Liberation Mono",monospace,var(--pico-font-family-emoji);--pico-font-family:var(--pico-font-family-sans-serif);--pico-line-height:1.5;--pico-font-weight:400;--pico-font-size:100%;--pico-text-underline-offset:0.1rem;--pico-border-radius:0.25rem;--pico-border-width:0.0625rem;--pico-outline-width:0.125rem;--pico-transition:0.2s ease-in-out;--pico-spacing:1rem;--pico-typography-spacing-vertical:1rem;--pico-block-spacing-vertical:var(--pico-spacing);--pico-block-spacing-horizontal:var(--pico-spacing);--pico-grid-column-gap:var(--pico-spacing);--pico-grid-row-gap:var(--pico-spacing);--pico-form-element-spacing-vertical:0.75rem;--pico-form-element-spacing-horizontal:1rem;--pico-group-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-primary-focus);--pico-group-box-shadow-focus-with-input:0 0 0 0.0625rem var(--pico-form-element-border-color);--pico-modal-overlay-backdrop-filter:blur(0.375rem);--pico-nav-element-spacing-vertical:1rem;--pico-nav-element-spacing-horizontal:0.5rem;--pico-nav-link-spacing-vertical:0.5rem;--pico-nav-link-spacing-horizontal:0.5rem;--pico-nav-breadcrumb-divider:">";--pico-icon-checkbox:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-minus:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='5' y1='12' x2='19' y2='12'%3E%3C/line%3E%3C/svg%3E");--pico-icon-chevron:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='6 9 12 15 18 9'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-date:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Crect x='3' y='4' width='18' height='18' rx='2' ry='2'%3E%3C/rect%3E%3Cline x1='16' y1='2' x2='16' y2='6'%3E%3C/line%3E%3Cline x1='8' y1='2' x2='8' y2='6'%3E%3C/line%3E%3Cline x1='3' y1='10' x2='21' y2='10'%3E%3C/line%3E%3C/svg%3E");--pico-icon-time:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cpolyline points='12 6 12 12 16 14'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-search:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='1.5' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E");--pico-icon-close:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");--pico-icon-loading:url("data:image/svg+xml,%3Csvg fill='none' height='24' width='24' viewBox='0 0 24 24' xmlns='http://www.w3.org/2000/svg' %3E%3Cstyle%3E g %7B animation: rotate 2s linear infinite; transform-origin: center center; %7D circle %7B stroke-dasharray: 75,100; stroke-dashoffset: -5; animation: dash 1.5s ease-in-out infinite; stroke-linecap: round; %7D @keyframes rotate %7B 0%25 %7B transform: rotate(0deg); %7D 100%25 %7B transform: rotate(360deg); %7D %7D @keyframes dash %7B 0%25 %7B stroke-dasharray: 1,100; stroke-dashoffset: 0; %7D 50%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -17.5; %7D 100%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -62; %7D %7D %3C/style%3E%3Cg%3E%3Ccircle cx='12' cy='12' r='10' fill='none' stroke='rgb(136, 145, 164)' stroke-width='4' /%3E%3C/g%3E%3C/svg%3E")}@media (min-width:576px){:host,:root{--pico-font-size:106.25%}}@media (min-width:768px){:host,:root{--pico-font-size:112.5%}}@media (min-width:1024px){:host,:root{--pico-font-size:118.75%}}@media (min-width:1280px){:host,:root{--pico-font-size:125%}}@media (min-width:1536px){:host,:root{--pico-font-size:131.25%}}a{--pico-text-decoration:underline}a.contrast,a.secondary{--pico-text-decoration:underline}small{--pico-font-size:0.875em}h1,h2,h3,h4,h5,h6{--pico-font-weight:700}h1{--pico-font-size:2rem;--pico-line-height:1.125;--pico-typography-spacing-top:3rem}h2{--pico-font-size:1.75rem;--pico-line-height:1.15;--pico-typography-spacing-top:2.625rem}h3{--pico-font-size:1.5rem;--pico-line-height:1.175;--pico-typography-spacing-top:2.25rem}h4{--pico-font-size:1.25rem;--pico-line-height:1.2;--pico-typography-spacing-top:1.874rem}h5{--pico-font-size:1.125rem;--pico-line-height:1.225;--pico-typography-spacing-top:1.6875rem}h6{--pico-font-size:1rem;--pico-line-height:1.25;--pico-typography-spacing-top:1.5rem}tfoot td,tfoot th,thead td,thead th{--pico-font-weight:600;--pico-border-width:0.1875rem}code,kbd,pre,samp{--pico-font-family:var(--pico-font-family-monospace)}kbd{--pico-font-weight:bolder}:where(select,textarea),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-outline-width:0.0625rem}[type=search]{--pico-border-radius:5rem}[type=checkbox],[type=radio]{--pico-border-width:0.125rem}[type=checkbox][role=switch]{--pico-border-width:0.1875rem}details.dropdown summary:not([role=button]){--pico-outline-width:0.0625rem}nav details.dropdown summary:focus-visible{--pico-outline-width:0.125rem}[role=search]{--pico-border-radius:5rem}[role=group]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus),[role=search]:has(button.secondary:focus,[type=submit].secondary:focus,[type=button].secondary:focus,[role=button].secondary:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[role=group]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus),[role=search]:has(button.contrast:focus,[type=submit].contrast:focus,[type=button].contrast:focus,[role=button].contrast:focus){--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=submit],[role=search] button{--pico-form-element-spacing-horizontal:2rem}details summary[role=button]:not(.outline)::after{filter:brightness(0) invert(1)}[aria-busy=true]:not(input,select,textarea):is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0) invert(1)}:host(:not([data-theme=dark])),:root:not([data-theme=dark]),[data-theme=light]{color-scheme:light;--pico-background-color:#fff;--pico-color:#373c44;--pico-text-selection-color:rgba(116, 139, 248, 0.25);--pico-muted-color:#646b79;--pico-muted-border-color:rgb(231, 234, 239.5);--pico-primary:#2060df;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(32, 96, 223, 0.5);--pico-primary-hover:#184eb8;--pico-primary-hover-background:#1d59d0;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(116, 139, 248, 0.5);--pico-primary-inverse:#fff;--pico-secondary:#5d6b89;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(93, 107, 137, 0.5);--pico-secondary-hover:#48536b;--pico-secondary-hover-background:#48536b;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(93, 107, 137, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#181c25;--pico-contrast-background:#181c25;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(24, 28, 37, 0.5);--pico-contrast-hover:#000;--pico-contrast-hover-background:#000;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-secondary-hover);--pico-contrast-focus:rgba(93, 107, 137, 0.25);--pico-contrast-inverse:#fff;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(129, 145, 181, 0.01698),0.0335rem 0.067rem 0.402rem rgba(129, 145, 181, 0.024),0.0625rem 0.125rem 0.75rem rgba(129, 145, 181, 0.03),0.1125rem 0.225rem 1.35rem rgba(129, 145, 181, 0.036),0.2085rem 0.417rem 2.502rem rgba(129, 145, 181, 0.04302),0.5rem 1rem 6rem rgba(129, 145, 181, 0.06),0 0 0 0.0625rem rgba(129, 145, 181, 0.015);--pico-h1-color:#2d3138;--pico-h2-color:#373c44;--pico-h3-color:#424751;--pico-h4-color:#4d535e;--pico-h5-color:#5c6370;--pico-h6-color:#646b79;--pico-mark-background-color:rgb(252.5, 230.5, 191.5);--pico-mark-color:#0f1114;--pico-ins-color:rgb(28.5, 105.5, 84);--pico-del-color:rgb(136, 56.5, 53);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(243, 244.5, 246.75);--pico-code-color:#646b79;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(251, 251.5, 252.25);--pico-form-element-selected-background-color:#dfe3eb;--pico-form-element-border-color:#cfd5e2;--pico-form-element-color:#23262c;--pico-form-element-placeholder-color:var(--pico-muted-color);--pico-form-element-active-background-color:#fff;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(183.5, 105.5, 106.5);--pico-form-element-invalid-active-border-color:rgb(200.25, 79.25, 72.25);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:rgb(76, 154.5, 137.5);--pico-form-element-valid-active-border-color:rgb(39, 152.75, 118.75);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#bfc7d9;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#dfe3eb;--pico-range-active-border-color:#bfc7d9;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:var(--pico-background-color);--pico-card-border-color:var(--pico-muted-border-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(251, 251.5, 252.25);--pico-dropdown-background-color:#fff;--pico-dropdown-border-color:#eff1f4;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#eff1f4;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(232, 234, 237, 0.75);--pico-progress-background-color:#dfe3eb;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(76, 154.5, 137.5)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(200.25, 79.25, 72.25)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme=dark])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme=dark]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),[data-theme=light] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}@media only screen and (prefers-color-scheme:dark){:host(:not([data-theme])),:root:not([data-theme]){color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(137, 153, 249, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#8999f9;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(137, 153, 249, 0.5);--pico-primary-hover:#aeb5fb;--pico-primary-hover-background:#3c71f7;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(137, 153, 249, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}:host(:not([data-theme])) details summary[role=button].contrast:not(.outline)::after,:root:not([data-theme]) details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}:host(:not([data-theme])) [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before,:root:not([data-theme]) [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}}[data-theme=dark]{color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(137, 153, 249, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#8999f9;--pico-primary-background:#2060df;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(137, 153, 249, 0.5);--pico-primary-hover:#aeb5fb;--pico-primary-hover-background:#3c71f7;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(137, 153, 249, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-dropdown-background-color:#181c25;--pico-dropdown-border-color:#202632;--pico-dropdown-box-shadow:var(--pico-box-shadow);--pico-dropdown-color:var(--pico-color);--pico-dropdown-hover-background-color:#202632;--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}[data-theme=dark] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}[data-theme=dark] details summary[role=button].contrast:not(.outline)::after{filter:brightness(0)}[data-theme=dark] [aria-busy=true]:not(input,select,textarea).contrast:is(button,[type=submit],[type=button],[type=reset],[role=button]):not(.outline)::before{filter:brightness(0)}[type=checkbox],[type=radio],[type=range],progress{accent-color:var(--pico-primary)}*,::after,::before{box-sizing:border-box;background-repeat:no-repeat}::after,::before{text-decoration:inherit;vertical-align:inherit}:where(:host),:where(:root){-webkit-tap-highlight-color:transparent;-webkit-text-size-adjust:100%;-moz-text-size-adjust:100%;text-size-adjust:100%;background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family);text-underline-offset:var(--pico-text-underline-offset);text-rendering:optimizeLegibility;overflow-wrap:break-word;-moz-tab-size:4;-o-tab-size:4;tab-size:4}body{width:100%;margin:0}main{display:block}body>footer,body>header,body>main{padding-block:var(--pico-block-spacing-vertical)}section{margin-bottom:var(--pico-block-spacing-vertical)}.container,.container-fluid{width:100%;margin-right:auto;margin-left:auto;padding-right:var(--pico-spacing);padding-left:var(--pico-spacing)}@media (min-width:576px){.container{max-width:510px;padding-right:0;padding-left:0}}@media (min-width:768px){.container{max-width:700px}}@media (min-width:1024px){.container{max-width:950px}}@media (min-width:1280px){.container{max-width:1200px}}@media (min-width:1536px){.container{max-width:1450px}}.grid{grid-column-gap:var(--pico-grid-column-gap);grid-row-gap:var(--pico-grid-row-gap);display:grid;grid-template-columns:1fr}@media (min-width:768px){.grid{grid-template-columns:repeat(auto-fit,minmax(0%,1fr))}}.grid>*{min-width:0}.overflow-auto{overflow:auto}b,strong{font-weight:bolder}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}address,blockquote,dl,ol,p,pre,table,ul{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-style:normal;font-weight:var(--pico-font-weight)}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family)}h1{--pico-color:var(--pico-h1-color)}h2{--pico-color:var(--pico-h2-color)}h3{--pico-color:var(--pico-h3-color)}h4{--pico-color:var(--pico-h4-color)}h5{--pico-color:var(--pico-h5-color)}h6{--pico-color:var(--pico-h6-color)}:where(article,address,blockquote,dl,figure,form,ol,p,pre,table,ul)~:is(h1,h2,h3,h4,h5,h6){margin-top:var(--pico-typography-spacing-top)}p{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup>*{margin-top:0;margin-bottom:0}hgroup>:not(:first-child):last-child{--pico-color:var(--pico-muted-color);--pico-font-weight:unset;font-size:1rem}:where(ol,ul) li{margin-bottom:calc(var(--pico-typography-spacing-vertical) * .25)}:where(dl,ol,ul) :where(dl,ol,ul){margin:0;margin-top:calc(var(--pico-typography-spacing-vertical) * .25)}ul li{list-style:square}mark{padding:.125rem .25rem;background-color:var(--pico-mark-background-color);color:var(--pico-mark-color);vertical-align:baseline}blockquote{display:block;margin:var(--pico-typography-spacing-vertical) 0;padding:var(--pico-spacing);border-right:none;border-left:.25rem solid var(--pico-blockquote-border-color);border-inline-start:0.25rem solid var(--pico-blockquote-border-color);border-inline-end:none}blockquote footer{margin-top:calc(var(--pico-typography-spacing-vertical) * .5);color:var(--pico-blockquote-footer-color)}abbr[title]{border-bottom:1px dotted;text-decoration:none;cursor:help}ins{color:var(--pico-ins-color);text-decoration:none}del{color:var(--pico-del-color)}::-moz-selection{background-color:var(--pico-text-selection-color)}::selection{background-color:var(--pico-text-selection-color)}:where(a:not([role=button])),[role=link]{--pico-color:var(--pico-primary);--pico-background-color:transparent;--pico-underline:var(--pico-primary-underline);outline:0;background-color:var(--pico-background-color);color:var(--pico-color);-webkit-text-decoration:var(--pico-text-decoration);text-decoration:var(--pico-text-decoration);text-decoration-color:var(--pico-underline);text-underline-offset:0.125em;transition:background-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition)}:where(a:not([role=button])):is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-primary-hover);--pico-underline:var(--pico-primary-hover-underline);--pico-text-decoration:underline}:where(a:not([role=button])):focus-visible,[role=link]:focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}:where(a:not([role=button])).secondary,[role=link].secondary{--pico-color:var(--pico-secondary);--pico-underline:var(--pico-secondary-underline)}:where(a:not([role=button])).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-underline:var(--pico-secondary-hover-underline)}:where(a:not([role=button])).contrast,[role=link].contrast{--pico-color:var(--pico-contrast);--pico-underline:var(--pico-contrast-underline)}:where(a:not([role=button])).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link].contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-underline:var(--pico-contrast-hover-underline)}a[role=button]{display:inline-block}button{margin:0;overflow:visible;font-family:inherit;text-transform:none}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[role=button],[type=button],[type=file]::file-selector-button,[type=reset],[type=submit],button{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);--pico-color:var(--pico-primary-inverse);--pico-box-shadow:var(--pico-button-box-shadow, 0 0 0 rgba(0, 0, 0, 0));padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:1rem;line-height:var(--pico-line-height);text-align:center;text-decoration:none;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}[role=button]:is(:hover,:active,:focus),[role=button]:is([aria-current]:not([aria-current=false])),[type=button]:is(:hover,:active,:focus),[type=button]:is([aria-current]:not([aria-current=false])),[type=file]::file-selector-button:is(:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])),[type=reset]:is(:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false])),[type=submit]:is(:hover,:active,:focus),[type=submit]:is([aria-current]:not([aria-current=false])),button:is(:hover,:active,:focus),button:is([aria-current]:not([aria-current=false])){--pico-background-color:var(--pico-primary-hover-background);--pico-border-color:var(--pico-primary-hover-border);--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0));--pico-color:var(--pico-primary-inverse)}[role=button]:focus,[role=button]:is([aria-current]:not([aria-current=false])):focus,[type=button]:focus,[type=button]:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus,[type=submit]:focus,[type=submit]:is([aria-current]:not([aria-current=false])):focus,button:focus,button:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}[type=button],[type=reset],[type=submit]{margin-bottom:var(--pico-spacing)}:is(button,[type=submit],[type=button],[role=button]).secondary,[type=file]::file-selector-button,[type=reset]{--pico-background-color:var(--pico-secondary-background);--pico-border-color:var(--pico-secondary-border);--pico-color:var(--pico-secondary-inverse);cursor:pointer}:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border);--pico-color:var(--pico-secondary-inverse)}:is(button,[type=submit],[type=button],[role=button]).secondary:focus,:is(button,[type=submit],[type=button],[role=button]).secondary:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}:is(button,[type=submit],[type=button],[role=button]).contrast{--pico-background-color:var(--pico-contrast-background);--pico-border-color:var(--pico-contrast-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-contrast-hover-background);--pico-border-color:var(--pico-contrast-hover-border);--pico-color:var(--pico-contrast-inverse)}:is(button,[type=submit],[type=button],[role=button]).contrast:focus,:is(button,[type=submit],[type=button],[role=button]).contrast:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-contrast-focus)}:is(button,[type=submit],[type=button],[role=button]).outline,[type=reset].outline{--pico-background-color:transparent;--pico-color:var(--pico-primary);--pico-border-color:var(--pico-primary)}:is(button,[type=submit],[type=button],[role=button]).outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:transparent;--pico-color:var(--pico-primary-hover);--pico-border-color:var(--pico-primary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary,[type=reset].outline{--pico-color:var(--pico-secondary);--pico-border-color:var(--pico-secondary)}:is(button,[type=submit],[type=button],[role=button]).outline.secondary:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset].outline:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-secondary-hover);--pico-border-color:var(--pico-secondary-hover)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast{--pico-color:var(--pico-contrast);--pico-border-color:var(--pico-contrast)}:is(button,[type=submit],[type=button],[role=button]).outline.contrast:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-contrast-hover);--pico-border-color:var(--pico-contrast-hover)}:where(button,[type=submit],[type=reset],[type=button],[role=button])[disabled],:where(fieldset[disabled]) :is(button,[type=submit],[type=button],[type=reset],[role=button]){opacity:.5;pointer-events:none}:where(table){width:100%;border-collapse:collapse;border-spacing:0;text-indent:0}td,th{padding:calc(var(--pico-spacing)/ 2) var(--pico-spacing);border-bottom:var(--pico-border-width) solid var(--pico-table-border-color);background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);text-align:left;text-align:start}tfoot td,tfoot th{border-top:var(--pico-border-width) solid var(--pico-table-border-color);border-bottom:0}table.striped tbody tr:nth-child(odd) td,table.striped tbody tr:nth-child(odd) th{background-color:var(--pico-table-row-stripped-background-color)}:where(audio,canvas,iframe,img,svg,video){vertical-align:middle}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}:where(iframe){border-style:none}img{max-width:100%;height:auto;border-style:none}:where(svg:not([fill])){fill:currentColor}svg:not(:host),svg:not(:root){overflow:hidden}code,kbd,pre,samp{font-size:.875em;font-family:var(--pico-font-family)}pre code,pre samp{font-size:inherit;font-family:inherit}pre{-ms-overflow-style:scrollbar;overflow:auto}code,kbd,pre,samp{border-radius:var(--pico-border-radius);background:var(--pico-code-background-color);color:var(--pico-code-color);font-weight:var(--pico-font-weight);line-height:initial}code,kbd,samp{display:inline-block;padding:.375rem}pre{display:block;margin-bottom:var(--pico-spacing);overflow-x:auto}pre>code,pre>samp{display:block;padding:var(--pico-spacing);background:0 0;line-height:var(--pico-line-height)}kbd{background-color:var(--pico-code-kbd-background-color);color:var(--pico-code-kbd-color);vertical-align:baseline}figure{display:block;margin:0;padding:0}figure figcaption{padding:calc(var(--pico-spacing) * .5) 0;color:var(--pico-muted-color)}hr{height:0;margin:var(--pico-typography-spacing-vertical) 0;border:0;border-top:1px solid var(--pico-muted-border-color);color:inherit}[hidden],template{display:none!important}canvas{display:inline-block}input,optgroup,select,textarea{margin:0;font-size:1rem;line-height:var(--pico-line-height);font-family:inherit;letter-spacing:inherit}input{overflow:visible}select{text-transform:none}legend{max-width:100%;padding:0;color:inherit;white-space:normal}textarea{overflow:auto}[type=checkbox],[type=radio]{padding:0}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}::-moz-focus-inner{padding:0;border-style:none}:-moz-focusring{outline:0}:-moz-ui-invalid{box-shadow:none}::-ms-expand{display:none}[type=file],[type=range]{padding:0;border-width:0}input:not([type=checkbox],[type=radio],[type=range]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2)}fieldset{width:100%;margin:0;margin-bottom:var(--pico-spacing);padding:0;border:0}fieldset legend,label{display:block;margin-bottom:calc(var(--pico-spacing) * .375);color:var(--pico-color);font-weight:var(--pico-form-label-font-weight,var(--pico-font-weight))}fieldset legend{margin-bottom:calc(var(--pico-spacing) * .5)}button[type=submit],input:not([type=checkbox],[type=radio]),select,textarea{width:100%}input:not([type=checkbox],[type=radio],[type=range],[type=file]),select,textarea{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal)}input,select,textarea{--pico-background-color:var(--pico-form-element-background-color);--pico-border-color:var(--pico-form-element-border-color);--pico-color:var(--pico-form-element-color);--pico-box-shadow:none;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[readonly]):is(:active,:focus){--pico-background-color:var(--pico-form-element-active-background-color)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[role=switch],[readonly]):is(:active,:focus){--pico-border-color:var(--pico-form-element-active-border-color)}:where(select,textarea):not([readonly]):focus,input:not([type=submit],[type=button],[type=reset],[type=range],[type=file],[readonly]):focus{--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}:where(fieldset[disabled]) :is(input:not([type=submit],[type=button],[type=reset]),select,textarea),input:not([type=submit],[type=button],[type=reset])[disabled],label[aria-disabled=true],select[disabled],textarea[disabled]{opacity:var(--pico-form-element-disabled-opacity);pointer-events:none}label[aria-disabled=true] input[disabled]{opacity:1}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid]{padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal)!important;padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=false]:not(select){background-image:var(--pico-icon-valid)}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=true]:not(select){background-image:var(--pico-icon-invalid)}:where(input,select,textarea)[aria-invalid=false]{--pico-border-color:var(--pico-form-element-valid-border-color)}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus){--pico-border-color:var(--pico-form-element-valid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-valid-focus-color)!important}:where(input,select,textarea)[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus){--pico-border-color:var(--pico-form-element-invalid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-invalid-focus-color)!important}[dir=rtl] :where(input,select,textarea):not([type=checkbox],[type=radio]):is([aria-invalid],[aria-invalid=true],[aria-invalid=false]){background-position:center left .75rem}input::-webkit-input-placeholder,input::placeholder,select:invalid,textarea::-webkit-input-placeholder,textarea::placeholder{color:var(--pico-form-element-placeholder-color);opacity:1}input:not([type=checkbox],[type=radio]),select,textarea{margin-bottom:var(--pico-spacing)}select::-ms-expand{border:0;background-color:transparent}select:not([multiple],[size]){padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal);padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);background-image:var(--pico-icon-chevron);background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}select[multiple] option:checked{background:var(--pico-form-element-selected-background-color);color:var(--pico-form-element-color)}[dir=rtl] select:not([multiple],[size]){background-position:center left .75rem}textarea{display:block;resize:vertical}textarea[aria-invalid]{--pico-icon-height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);background-position:top right .75rem!important;background-size:1rem var(--pico-icon-height)!important}:where(input,select,textarea,fieldset,.grid)+small{display:block;width:100%;margin-top:calc(var(--pico-spacing) * -.75);margin-bottom:var(--pico-spacing);color:var(--pico-muted-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=false]+small{color:var(--pico-ins-color)}:where(input,select,textarea,fieldset,.grid)[aria-invalid=true]+small{color:var(--pico-del-color)}label>:where(input,select,textarea){margin-top:calc(var(--pico-spacing) * .25)}label:has([type=checkbox],[type=radio]){width:-moz-fit-content;width:fit-content;cursor:pointer}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:1.25em;height:1.25em;margin-top:-.125em;margin-inline-end:.5em;border-width:var(--pico-border-width);vertical-align:middle;cursor:pointer}[type=checkbox]::-ms-check,[type=radio]::-ms-check{display:none}[type=checkbox]:checked,[type=checkbox]:checked:active,[type=checkbox]:checked:focus,[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-checkbox);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=checkbox]~label,[type=radio]~label{display:inline-block;margin-bottom:0;cursor:pointer}[type=checkbox]~label:not(:last-of-type),[type=radio]~label:not(:last-of-type){margin-inline-end:1em}[type=checkbox]:indeterminate{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-minus);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=radio]{border-radius:50%}[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-inverse);border-width:.35em;background-image:none}[type=checkbox][role=switch]{--pico-background-color:var(--pico-switch-background-color);--pico-color:var(--pico-switch-color);width:2.25em;height:1.25em;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:1.25em;background-color:var(--pico-background-color);line-height:1.25em}[type=checkbox][role=switch]:not([aria-invalid]){--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:before{display:block;aspect-ratio:1;height:100%;border-radius:50%;background-color:var(--pico-color);box-shadow:var(--pico-switch-thumb-box-shadow);content:"";transition:margin .1s ease-in-out}[type=checkbox][role=switch]:focus{--pico-background-color:var(--pico-switch-background-color);--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:checked{--pico-background-color:var(--pico-switch-checked-background-color);--pico-border-color:var(--pico-switch-checked-background-color);background-image:none}[type=checkbox][role=switch]:checked::before{margin-inline-start:calc(2.25em - 1.25em)}[type=checkbox][role=switch][disabled]{--pico-background-color:var(--pico-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus{--pico-background-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true]{--pico-background-color:var(--pico-form-element-invalid-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus,[type=radio][aria-invalid=false]:checked,[type=radio][aria-invalid=false]:checked:active,[type=radio][aria-invalid=false]:checked:focus{--pico-border-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true],[type=radio]:checked:active[aria-invalid=true],[type=radio]:checked:focus[aria-invalid=true],[type=radio]:checked[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}[type=color]::-webkit-color-swatch-wrapper{padding:0}[type=color]::-moz-focus-inner{padding:0}[type=color]::-webkit-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}[type=color]::-moz-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}input:not([type=checkbox],[type=radio],[type=range],[type=file]):is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){--pico-icon-position:0.75rem;--pico-icon-width:1rem;padding-right:calc(var(--pico-icon-width) + var(--pico-icon-position));background-image:var(--pico-icon-date);background-position:center right var(--pico-icon-position);background-size:var(--pico-icon-width) auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=time]{background-image:var(--pico-icon-time)}[type=date]::-webkit-calendar-picker-indicator,[type=datetime-local]::-webkit-calendar-picker-indicator,[type=month]::-webkit-calendar-picker-indicator,[type=time]::-webkit-calendar-picker-indicator,[type=week]::-webkit-calendar-picker-indicator{width:var(--pico-icon-width);margin-right:calc(var(--pico-icon-width) * -1);margin-left:var(--pico-icon-position);opacity:0}@-moz-document url-prefix(){[type=date],[type=datetime-local],[type=month],[type=time],[type=week]{padding-right:var(--pico-form-element-spacing-horizontal)!important;background-image:none!important}}[dir=rtl] :is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){text-align:right}[type=file]{--pico-color:var(--pico-muted-color);margin-left:calc(var(--pico-outline-width) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) 0;padding-left:var(--pico-outline-width);border:0;border-radius:0;background:0 0}[type=file]::file-selector-button{margin-right:calc(var(--pico-spacing)/ 2);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal)}[type=file]:is(:hover,:active,:focus)::file-selector-button{--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border)}[type=file]:focus::file-selector-button{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[type=range]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:100%;height:1.25rem;background:0 0}[type=range]::-webkit-slider-runnable-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-webkit-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-moz-range-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-moz-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-ms-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-ms-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-webkit-slider-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-webkit-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-moz-range-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-moz-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-ms-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-ms-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]:active,[type=range]:focus-within{--pico-range-border-color:var(--pico-range-active-border-color);--pico-range-thumb-color:var(--pico-range-thumb-active-color)}[type=range]:active::-webkit-slider-thumb{transform:scale(1.25)}[type=range]:active::-moz-range-thumb{transform:scale(1.25)}[type=range]:active::-ms-thumb{transform:scale(1.25)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem);background-image:var(--pico-icon-search);background-position:center left calc(var(--pico-form-element-spacing-horizontal) + .125rem);background-size:1rem auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem)!important;background-position:center left 1.125rem,center right .75rem}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=false]{background-image:var(--pico-icon-search),var(--pico-icon-valid)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=true]{background-image:var(--pico-icon-search),var(--pico-icon-invalid)}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{background-position:center right 1.125rem}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{background-position:center right 1.125rem,center left .75rem}details{display:block;margin-bottom:var(--pico-spacing)}details summary{line-height:1rem;list-style-type:none;cursor:pointer;transition:color var(--pico-transition)}details summary:not([role]){color:var(--pico-accordion-close-summary-color)}details summary::-webkit-details-marker{display:none}details summary::marker{display:none}details summary::-moz-list-bullet{list-style-type:none}details summary::after{display:block;width:1rem;height:1rem;margin-inline-start:calc(var(--pico-spacing,1rem) * .5);float:right;transform:rotate(-90deg);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:"";transition:transform var(--pico-transition)}details summary:focus{outline:0}details summary:focus:not([role]){color:var(--pico-accordion-active-summary-color)}details summary:focus-visible:not([role]){outline:var(--pico-outline-width) solid var(--pico-primary-focus);outline-offset:calc(var(--pico-spacing,1rem) * 0.5);color:var(--pico-primary)}details summary[role=button]{width:100%;text-align:left}details summary[role=button]::after{height:calc(1rem * var(--pico-line-height,1.5))}details[open]>summary{margin-bottom:var(--pico-spacing)}details[open]>summary:not([role]):not(:focus){color:var(--pico-accordion-open-summary-color)}details[open]>summary::after{transform:rotate(0)}[dir=rtl] details summary{text-align:right}[dir=rtl] details summary::after{float:left;background-position:left center}article{margin-bottom:var(--pico-block-spacing-vertical);padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal);border-radius:var(--pico-border-radius);background:var(--pico-card-background-color);box-shadow:var(--pico-card-box-shadow)}article>footer,article>header{margin-right:calc(var(--pico-block-spacing-horizontal) * -1);margin-left:calc(var(--pico-block-spacing-horizontal) * -1);padding:calc(var(--pico-block-spacing-vertical) * .66) var(--pico-block-spacing-horizontal);background-color:var(--pico-card-sectioning-background-color)}article>header{margin-top:calc(var(--pico-block-spacing-vertical) * -1);margin-bottom:var(--pico-block-spacing-vertical);border-bottom:var(--pico-border-width) solid var(--pico-card-border-color);border-top-right-radius:var(--pico-border-radius);border-top-left-radius:var(--pico-border-radius)}article>footer{margin-top:var(--pico-block-spacing-vertical);margin-bottom:calc(var(--pico-block-spacing-vertical) * -1);border-top:var(--pico-border-width) solid var(--pico-card-border-color);border-bottom-right-radius:var(--pico-border-radius);border-bottom-left-radius:var(--pico-border-radius)}details.dropdown{position:relative;border-bottom:none}details.dropdown>a::after,details.dropdown>button::after,details.dropdown>summary::after{display:block;width:1rem;height:calc(1rem * var(--pico-line-height,1.5));margin-inline-start:.25rem;float:right;transform:rotate(0) translateX(.2rem);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:""}nav details.dropdown{margin-bottom:0}details.dropdown>summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-form-element-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-form-element-background-color);color:var(--pico-form-element-placeholder-color);line-height:inherit;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}details.dropdown>summary:not([role]):active,details.dropdown>summary:not([role]):focus{border-color:var(--pico-form-element-active-border-color);background-color:var(--pico-form-element-active-background-color)}details.dropdown>summary:not([role]):focus{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}details.dropdown>summary:not([role]):focus-visible{outline:0}details.dropdown>summary:not([role])[aria-invalid=false]{--pico-form-element-border-color:var(--pico-form-element-valid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-valid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-valid-focus-color)}details.dropdown>summary:not([role])[aria-invalid=true]{--pico-form-element-border-color:var(--pico-form-element-invalid-border-color);--pico-form-element-active-border-color:var(--pico-form-element-invalid-focus-color);--pico-form-element-focus-color:var(--pico-form-element-invalid-focus-color)}nav details.dropdown{display:inline;margin:calc(var(--pico-nav-element-spacing-vertical) * -1) 0}nav details.dropdown>summary::after{transform:rotate(0) translateX(0)}nav details.dropdown>summary:not([role]){height:calc(1rem * var(--pico-line-height) + var(--pico-nav-link-spacing-vertical) * 2);padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav details.dropdown>summary:not([role]):focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}details.dropdown>summary+ul{display:flex;z-index:99;position:absolute;left:0;flex-direction:column;width:100%;min-width:-moz-fit-content;min-width:fit-content;margin:0;margin-top:var(--pico-outline-width);padding:0;border:var(--pico-border-width) solid var(--pico-dropdown-border-color);border-radius:var(--pico-border-radius);background-color:var(--pico-dropdown-background-color);box-shadow:var(--pico-dropdown-box-shadow);color:var(--pico-dropdown-color);white-space:nowrap;opacity:0;transition:opacity var(--pico-transition),transform 0s ease-in-out 1s}details.dropdown>summary+ul[dir=rtl]{right:0;left:auto}details.dropdown>summary+ul li{width:100%;margin-bottom:0;padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);list-style:none}details.dropdown>summary+ul li:first-of-type{margin-top:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown>summary+ul li:last-of-type{margin-bottom:calc(var(--pico-form-element-spacing-vertical) * .5)}details.dropdown>summary+ul li a{display:block;margin:calc(var(--pico-form-element-spacing-vertical) * -.5) calc(var(--pico-form-element-spacing-horizontal) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal);overflow:hidden;border-radius:0;color:var(--pico-dropdown-color);text-decoration:none;text-overflow:ellipsis}details.dropdown>summary+ul li a:active,details.dropdown>summary+ul li a:focus,details.dropdown>summary+ul li a:focus-visible,details.dropdown>summary+ul li a:hover,details.dropdown>summary+ul li a[aria-current]:not([aria-current=false]){background-color:var(--pico-dropdown-hover-background-color)}details.dropdown>summary+ul li label{width:100%}details.dropdown>summary+ul li:has(label):hover{background-color:var(--pico-dropdown-hover-background-color)}details.dropdown[open]>summary{margin-bottom:0}details.dropdown[open]>summary+ul{transform:scaleY(1);opacity:1;transition:opacity var(--pico-transition),transform 0s ease-in-out 0s}details.dropdown[open]>summary::before{display:block;z-index:1;position:fixed;width:100vw;height:100vh;inset:0;background:0 0;content:"";cursor:default}label>details.dropdown{margin-top:calc(var(--pico-spacing) * .25)}[role=group],[role=search]{display:inline-flex;position:relative;width:100%;margin-bottom:var(--pico-spacing);border-radius:var(--pico-border-radius);box-shadow:var(--pico-group-box-shadow,0 0 0 transparent);vertical-align:middle;transition:box-shadow var(--pico-transition)}[role=group] input:not([type=checkbox],[type=radio]),[role=group] select,[role=group]>*,[role=search] input:not([type=checkbox],[type=radio]),[role=search] select,[role=search]>*{position:relative;flex:1 1 auto;margin-bottom:0}[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=group]>:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child),[role=search]>:not(:first-child){margin-left:0;border-top-left-radius:0;border-bottom-left-radius:0}[role=group] input:not([type=checkbox],[type=radio]):not(:last-child),[role=group] select:not(:last-child),[role=group]>:not(:last-child),[role=search] input:not([type=checkbox],[type=radio]):not(:last-child),[role=search] select:not(:last-child),[role=search]>:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}[role=group] input:not([type=checkbox],[type=radio]):focus,[role=group] select:focus,[role=group]>:focus,[role=search] input:not([type=checkbox],[type=radio]):focus,[role=search] select:focus,[role=search]>:focus{z-index:2}[role=group] [role=button]:not(:first-child),[role=group] [type=button]:not(:first-child),[role=group] [type=reset]:not(:first-child),[role=group] [type=submit]:not(:first-child),[role=group] button:not(:first-child),[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=search] [role=button]:not(:first-child),[role=search] [type=button]:not(:first-child),[role=search] [type=reset]:not(:first-child),[role=search] [type=submit]:not(:first-child),[role=search] button:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child){margin-left:calc(var(--pico-border-width) * -1)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=reset],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=reset],[role=search] [type=submit],[role=search] button{width:auto}@supports selector(:has(*)){[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-button)}[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select,[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select{border-color:transparent}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus),[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-input)}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) button,[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) button{--pico-button-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-border);--pico-button-hover-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-hover-border)}[role=group] [role=button]:focus,[role=group] [type=button]:focus,[role=group] [type=reset]:focus,[role=group] [type=submit]:focus,[role=group] button:focus,[role=search] [role=button]:focus,[role=search] [type=button]:focus,[role=search] [type=reset]:focus,[role=search] [type=submit]:focus,[role=search] button:focus{box-shadow:none}}[role=search]>:first-child{border-top-left-radius:5rem;border-bottom-left-radius:5rem}[role=search]>:last-child{border-top-right-radius:5rem;border-bottom-right-radius:5rem}[aria-busy=true]:not(input,select,textarea,html,form){white-space:nowrap}[aria-busy=true]:not(input,select,textarea,html,form)::before{display:inline-block;width:1em;height:1em;background-image:var(--pico-icon-loading);background-size:1em auto;background-repeat:no-repeat;content:"";vertical-align:-.125em}[aria-busy=true]:not(input,select,textarea,html,form):not(:empty)::before{margin-inline-end:calc(var(--pico-spacing) * .5)}[aria-busy=true]:not(input,select,textarea,html,form):empty{text-align:center}[role=button][aria-busy=true],[type=button][aria-busy=true],[type=reset][aria-busy=true],[type=submit][aria-busy=true],a[aria-busy=true],button[aria-busy=true]{pointer-events:none}:host,:root{--pico-scrollbar-width:0px}dialog{display:flex;z-index:999;position:fixed;top:0;right:0;bottom:0;left:0;align-items:center;justify-content:center;width:inherit;min-width:100%;height:inherit;min-height:100%;padding:0;border:0;-webkit-backdrop-filter:var(--pico-modal-overlay-backdrop-filter);backdrop-filter:var(--pico-modal-overlay-backdrop-filter);background-color:var(--pico-modal-overlay-background-color);color:var(--pico-color)}dialog>article{width:100%;max-height:calc(100vh - var(--pico-spacing) * 2);margin:var(--pico-spacing);overflow:auto}@media (min-width:576px){dialog>article{max-width:510px}}@media (min-width:768px){dialog>article{max-width:700px}}dialog>article>header>*{margin-bottom:0}dialog>article>header .close,dialog>article>header :is(a,button)[rel=prev]{margin:0;margin-left:var(--pico-spacing);padding:0;float:right}dialog>article>footer{text-align:right}dialog>article>footer [role=button],dialog>article>footer button{margin-bottom:0}dialog>article>footer [role=button]:not(:first-of-type),dialog>article>footer button:not(:first-of-type){margin-left:calc(var(--pico-spacing) * .5)}dialog>article .close,dialog>article :is(a,button)[rel=prev]{display:block;width:1rem;height:1rem;margin-top:calc(var(--pico-spacing) * -1);margin-bottom:var(--pico-spacing);margin-left:auto;border:none;background-image:var(--pico-icon-close);background-position:center;background-size:auto 1rem;background-repeat:no-repeat;background-color:transparent;opacity:.5;transition:opacity var(--pico-transition)}dialog>article .close:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),dialog>article :is(a,button)[rel=prev]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){opacity:1}dialog:not([open]),dialog[open=false]{display:none}.modal-is-open{padding-right:var(--pico-scrollbar-width,0);overflow:hidden;pointer-events:none;touch-action:none}.modal-is-open dialog{pointer-events:auto;touch-action:auto}:where(.modal-is-opening,.modal-is-closing) dialog,:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-duration:.2s;animation-timing-function:ease-in-out;animation-fill-mode:both}:where(.modal-is-opening,.modal-is-closing) dialog{animation-duration:.8s;animation-name:modal-overlay}:where(.modal-is-opening,.modal-is-closing) dialog>article{animation-delay:.2s;animation-name:modal}.modal-is-closing dialog,.modal-is-closing dialog>article{animation-delay:0s;animation-direction:reverse}@keyframes modal-overlay{from{-webkit-backdrop-filter:none;backdrop-filter:none;background-color:transparent}}@keyframes modal{from{transform:translateY(-100%);opacity:0}}:where(nav li)::before{float:left;content:"​"}nav,nav ul{display:flex}nav{justify-content:space-between;overflow:visible}nav ol,nav ul{align-items:center;margin-bottom:0;padding:0;list-style:none}nav ol:first-of-type,nav ul:first-of-type{margin-left:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav ol:last-of-type,nav ul:last-of-type{margin-right:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav li{display:inline-block;margin:0;padding:var(--pico-nav-element-spacing-vertical) var(--pico-nav-element-spacing-horizontal)}nav li :where(a,[role=link]){display:inline-block;margin:calc(var(--pico-nav-link-spacing-vertical) * -1) calc(var(--pico-nav-link-spacing-horizontal) * -1);padding:var(--pico-nav-link-spacing-vertical) var(--pico-nav-link-spacing-horizontal);border-radius:var(--pico-border-radius)}nav li :where(a,[role=link]):not(:hover){text-decoration:none}nav li [role=button],nav li [type=button],nav li button,nav li input:not([type=checkbox],[type=radio],[type=range],[type=file]),nav li select{height:auto;margin-right:inherit;margin-bottom:0;margin-left:inherit;padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb]{align-items:center;justify-content:start}nav[aria-label=breadcrumb] ul li:not(:first-child){margin-inline-start:var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb] ul li a{margin:calc(var(--pico-nav-link-spacing-vertical) * -1) 0;margin-inline-start:calc(var(--pico-nav-link-spacing-horizontal) * -1)}nav[aria-label=breadcrumb] ul li:not(:last-child)::after{display:inline-block;position:absolute;width:calc(var(--pico-nav-link-spacing-horizontal) * 4);margin:0 calc(var(--pico-nav-link-spacing-horizontal) * -1);content:var(--pico-nav-breadcrumb-divider);color:var(--pico-muted-color);text-align:center;text-decoration:none;white-space:nowrap}nav[aria-label=breadcrumb] a[aria-current]:not([aria-current=false]){background-color:transparent;color:inherit;text-decoration:none;pointer-events:none}aside li,aside nav,aside ol,aside ul{display:block}aside li{padding:calc(var(--pico-nav-element-spacing-vertical) * .5) var(--pico-nav-element-spacing-horizontal)}aside li a{display:block}aside li [role=button]{margin:inherit}[dir=rtl] nav[aria-label=breadcrumb] ul li:not(:last-child) ::after{content:"\\"}progress{display:inline-block;vertical-align:baseline}progress{-webkit-appearance:none;-moz-appearance:none;display:inline-block;appearance:none;width:100%;height:.5rem;margin-bottom:calc(var(--pico-spacing) * .5);overflow:hidden;border:0;border-radius:var(--pico-border-radius);background-color:var(--pico-progress-background-color);color:var(--pico-progress-color)}progress::-webkit-progress-bar{border-radius:var(--pico-border-radius);background:0 0}progress[value]::-webkit-progress-value{background-color:var(--pico-progress-color);-webkit-transition:inline-size var(--pico-transition);transition:inline-size var(--pico-transition)}progress::-moz-progress-bar{background-color:var(--pico-progress-color)}@media (prefers-reduced-motion:no-preference){progress:indeterminate{background:var(--pico-progress-background-color) linear-gradient(to right,var(--pico-progress-color) 30%,var(--pico-progress-background-color) 30%) top left/150% 150% no-repeat;animation:progress-indeterminate 1s linear infinite}progress:indeterminate[value]::-webkit-progress-value{background-color:transparent}progress:indeterminate::-moz-progress-bar{background-color:transparent}}@media (prefers-reduced-motion:no-preference){[dir=rtl] progress:indeterminate{animation-direction:reverse}}@keyframes progress-indeterminate{0%{background-position:200% 0}100%{background-position:-200% 0}}[data-tooltip]{position:relative}[data-tooltip]:not(a,button,input,[role=button]){border-bottom:1px dotted;text-decoration:none;cursor:help}[data-tooltip]::after,[data-tooltip]::before,[data-tooltip][data-placement=top]::after,[data-tooltip][data-placement=top]::before{display:block;z-index:99;position:absolute;bottom:100%;left:50%;padding:.25rem .5rem;overflow:hidden;transform:translate(-50%,-.25rem);border-radius:var(--pico-border-radius);background:var(--pico-tooltip-background-color);content:attr(data-tooltip);color:var(--pico-tooltip-color);font-style:normal;font-weight:var(--pico-font-weight);font-size:.875rem;text-decoration:none;text-overflow:ellipsis;white-space:nowrap;opacity:0;pointer-events:none}[data-tooltip]::after,[data-tooltip][data-placement=top]::after{padding:0;transform:translate(-50%,0);border-top:.3rem solid;border-right:.3rem solid transparent;border-left:.3rem solid transparent;border-radius:0;background-color:transparent;content:"";color:var(--pico-tooltip-background-color)}[data-tooltip][data-placement=bottom]::after,[data-tooltip][data-placement=bottom]::before{top:100%;bottom:auto;transform:translate(-50%,.25rem)}[data-tooltip][data-placement=bottom]:after{transform:translate(-50%,-.3rem);border:.3rem solid transparent;border-bottom:.3rem solid}[data-tooltip][data-placement=left]::after,[data-tooltip][data-placement=left]::before{top:50%;right:100%;bottom:auto;left:auto;transform:translate(-.25rem,-50%)}[data-tooltip][data-placement=left]:after{transform:translate(.3rem,-50%);border:.3rem solid transparent;border-left:.3rem solid}[data-tooltip][data-placement=right]::after,[data-tooltip][data-placement=right]::before{top:50%;right:auto;bottom:auto;left:100%;transform:translate(.25rem,-50%)}[data-tooltip][data-placement=right]:after{transform:translate(-.3rem,-50%);border:.3rem solid transparent;border-right:.3rem solid}[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{opacity:1}@media (hover:hover) and (pointer:fine){[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{--pico-tooltip-slide-to:translate(-50%, -0.25rem);transform:translate(-50%,.75rem);animation-duration:.2s;animation-fill-mode:forwards;animation-name:tooltip-slide;opacity:0}[data-tooltip]:focus::after,[data-tooltip]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, 0rem);transform:translate(-50%,-.25rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:focus::before,[data-tooltip][data-placement=bottom]:hover::after,[data-tooltip][data-placement=bottom]:hover::before{--pico-tooltip-slide-to:translate(-50%, 0.25rem);transform:translate(-50%,-.75rem);animation-name:tooltip-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, -0.3rem);transform:translate(-50%,-.5rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:focus::before,[data-tooltip][data-placement=left]:hover::after,[data-tooltip][data-placement=left]:hover::before{--pico-tooltip-slide-to:translate(-0.25rem, -50%);transform:translate(.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:hover::after{--pico-tooltip-caret-slide-to:translate(0.3rem, -50%);transform:translate(.05rem,-50%);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:focus::before,[data-tooltip][data-placement=right]:hover::after,[data-tooltip][data-placement=right]:hover::before{--pico-tooltip-slide-to:translate(0.25rem, -50%);transform:translate(-.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:hover::after{--pico-tooltip-caret-slide-to:translate(-0.3rem, -50%);transform:translate(-.05rem,-50%);animation-name:tooltip-caret-slide}}@keyframes tooltip-slide{to{transform:var(--pico-tooltip-slide-to);opacity:1}}@keyframes tooltip-caret-slide{50%{opacity:0}to{transform:var(--pico-tooltip-caret-slide-to);opacity:1}}[aria-controls]{cursor:pointer}[aria-disabled=true],[disabled]{cursor:not-allowed}[aria-hidden=false][hidden]{display:initial}[aria-hidden=false][hidden]:not(:focus){clip:rect(0,0,0,0);position:absolute}[tabindex],a,area,button,input,label,select,summary,textarea{-ms-touch-action:manipulation}[dir=rtl]{direction:rtl}@media (prefers-reduced-motion:reduce){:not([aria-busy=true]),:not([aria-busy=true])::after,:not([aria-busy=true])::before{background-attachment:initial!important;animation-duration:1ms!important;animation-delay:-1ms!important;animation-iteration-count:1!important;scroll-behavior:auto!important;transition-delay:0s!important;transition-duration:0s!important}}

+83

server/static/style.css

··· 1 1 + :root { 2 2 + --zinc-700: rgb(66, 71, 81); 3 3 + --success: rgb(0, 166, 110); 4 4 + --danger: rgb(155, 35, 24); 5 5 + } 6 6 + 7 7 + body { 8 8 + display: flex; 9 9 + flex-direction: column; 10 10 + } 11 11 + 12 12 + main { 13 13 + } 14 14 + 15 15 + .margin-top-sm { 16 16 + margin-top: 2em; 17 17 + } 18 18 + 19 19 + .margin-top-md { 20 20 + margin-top: 2.5em; 21 21 + } 22 22 + 23 23 + .margin-bottom-xs { 24 24 + margin-bottom: 1.5em; 25 25 + } 26 26 + 27 27 + .centered-body { 28 28 + min-height: 100vh; 29 29 + justify-content: center; 30 30 + } 31 31 + 32 32 + .base-container { 33 33 + border: 1px solid var(--zinc-700); 34 34 + border-radius: 10px; 35 35 + padding: 1.75em 1.2em; 36 36 + } 37 37 + 38 38 + .box-shadow-container { 39 39 + box-shadow: 1px 1px 52px 2px rgba(0, 0, 0, 0.42); 40 40 + } 41 41 + 42 42 + .login-container { 43 43 + max-width: 50ch; 44 44 + form :last-child { 45 45 + margin-bottom: 0; 46 46 + } 47 47 + form button { 48 48 + float: right; 49 49 + } 50 50 + } 51 51 + 52 52 + .authorize-container { 53 53 + max-width: 100ch; 54 54 + } 55 55 + 56 56 + button { 57 57 + width: unset; 58 58 + min-width: 16ch; 59 59 + } 60 60 + 61 61 + .button-row { 62 62 + display: flex; 63 63 + gap: 1ch; 64 64 + justify-content: end; 65 65 + } 66 66 + 67 67 + .alert { 68 68 + border: 1px solid var(--zinc-700); 69 69 + border-radius: 10px; 70 70 + padding: 1em 1em; 71 71 + p { 72 72 + color: white; 73 73 + margin-bottom: unset; 74 74 + } 75 75 + } 76 76 + 77 77 + .alert-success { 78 78 + background-color: var(--success); 79 79 + } 80 80 + 81 81 + .alert-danger { 82 82 + background-color: var(--danger); 83 83 + }

+40

server/templates/account.html

··· 1 1 + <!doctype html> 2 2 + <html lang="en"> 3 3 + <head> 4 4 + <meta charset="utf-8" /> 5 5 + <meta name="viewport" content="width=device-width, initial-scale=1" /> 6 6 + <meta name="color-scheme" content="light dark" /> 7 7 + <link rel="stylesheet" href="/static/pico.css" /> 8 8 + <link rel="stylesheet" href="/static/style.css" /> 9 9 + <title>Your Account</title> 10 10 + </head> 11 11 + <body class="margin-top-md"> 12 12 + <main class="container base-container authorize-container margin-top-xl"> 13 13 + <h2>Welcome, {{ .Repo.Handle }}</h2> 14 14 + <ul> 15 15 + <li><a href="/account/signout">Sign Out</a></li> 16 16 + </ul> 17 17 + {{ if .flashes.successes }} 18 18 + <div class="alert alert-success margin-bottom-xs"> 19 19 + <p>{{ index .flashes.successes 0 }}</p> 20 20 + </div> 21 21 + {{ end }} {{ if eq (len .Tokens) 0 }} 22 22 + <div class="alert alert-success" role="alert"> 23 23 + <p class="alert-message">You do not have any active OAuth sessions!</p> 24 24 + </div> 25 25 + {{ else }} {{ range .Tokens }} 26 26 + <div class="base-container"> 27 27 + <h4>{{ .ClientName }}</h4> 28 28 + <p>Session Age: {{ .Age}}</p> 29 29 + <p>Last Updated: {{ .LastUpdated }} ago</p> 30 30 + <p>Expires In: {{ .ExpiresIn }}</p> 31 31 + <p>IP Address: {{ .Ip }}</p> 32 32 + <form action="/account/revoke" method="post"> 33 33 + <input type="hidden" name="token" value="{{ .Token }}" /> 34 34 + <button type="submit" value="">Revoke</button> 35 35 + </form> 36 36 + </div> 37 37 + {{ end }} {{ end }} 38 38 + </main> 39 39 + </body> 40 40 + </html>

+4

server/templates/alert.html

··· 1 1 + <!doctype html> 2 2 + <div class="alert alert-success" role="alert"> 3 3 + <p class="alert-message"></p> 4 4 + </div>

+44

server/templates/authorize.html

··· 1 1 + <!doctype html> 2 2 + <html lang="en"> 3 3 + <head> 4 4 + <meta charset="utf-8" /> 5 5 + <meta name="viewport" content="width=device-width, initial-scale=1" /> 6 6 + <meta name="color-scheme" content="light dark" /> 7 7 + <link rel="stylesheet" href="/static/pico.css" /> 8 8 + <link rel="stylesheet" href="/static/style.css" /> 9 9 + <title>Application Authorization</title> 10 10 + </head> 11 11 + <body class="centered-body"> 12 12 + <main 13 13 + class="container base-container box-shadow-container authorizer-container" 14 14 + > 15 15 + <h2>Authorizing with {{ .AppName }}</h2> 16 16 + <p> 17 17 + You are signed in as <b>{{ .Handle }}</b>. 18 18 + <a href="/account/signout?{{ .QueryParams }}">Switch Account</a> 19 19 + </p> 20 20 + <p><b>{{ .AppName }}</b> is asking for you to grant it these scopes:</p> 21 21 + <ul> 22 22 + {{ range .Scopes }} 23 23 + <li><b>{{.}}</b></li> 24 24 + {{ end }} 25 25 + </ul> 26 26 + <p> 27 27 + If you press Accept, the application will be granted permissions for 28 28 + these scopes with your account <b>{{ .Handle }}</b>. If you reject, you 29 29 + will be sent back to the application. 30 30 + </p> 31 31 + <form action="/oauth/authorize" method="post"> 32 32 + <div class="button-row"> 33 33 + <input type="hidden" name="request_uri" value="{{ .RequestUri }}" /> 34 34 + <button class="secondary" name="accept_or_reject" value="reject"> 35 35 + Reject 36 36 + </button> 37 37 + <button class="primary" name="accept_or_reject" value="accept"> 38 38 + Accept 39 39 + </button> 40 40 + </div> 41 41 + </form> 42 42 + </main> 43 43 + </body> 44 44 + </html>

+34

server/templates/signin.html

··· 1 1 + <!doctype html> 2 2 + <html lang="en"> 3 3 + <head> 4 4 + <meta charset="utf-8" /> 5 5 + <meta name="viewport" content="width=device-width, initial-scale=1" /> 6 6 + <meta name="color-scheme" content="light dark" /> 7 7 + <link rel="stylesheet" href="/static/pico.css" /> 8 8 + <link rel="stylesheet" href="/static/style.css" /> 9 9 + <title>PDS Authentication</title> 10 10 + </head> 11 11 + <body class="centered-body"> 12 12 + <main class="container base-container box-shadow-container login-container"> 13 13 + <h2>Sign into your account</h2> 14 14 + <p>Enter your handle and password below.</p> 15 15 + {{ if .flashes.errors }} 16 16 + <div class="alert alert-danger margin-bottom-xs"> 17 17 + <p>{{ index .flashes.errors 0 }}</p> 18 18 + </div> 19 19 + {{ end }} 20 20 + <form action="/account/signin" method="post"> 21 21 + <input name="username" id="username" placeholder="Handle" /> 22 22 + <br /> 23 23 + <input 24 24 + name="password" 25 25 + id="password" 26 26 + type="password" 27 27 + placeholder="Password" 28 28 + /> 29 29 + <input name="query_params" type="hidden" value="{{ .QueryParams }}" /> 30 30 + <button class="primary" type="submit" value="Login">Login</button> 31 31 + </form> 32 32 + </main> 33 33 + </body> 34 34 + </html>

+155

sqlite_blockstore/sqlite_blockstore.go

··· 1 1 + package sqlite_blockstore 2 2 + 3 3 + import ( 4 4 + "context" 5 5 + "fmt" 6 6 + 7 7 + "github.com/bluesky-social/indigo/atproto/syntax" 8 8 + "github.com/haileyok/cocoon/internal/db" 9 9 + "github.com/haileyok/cocoon/models" 10 10 + blocks "github.com/ipfs/go-block-format" 11 11 + "github.com/ipfs/go-cid" 12 12 + "gorm.io/gorm/clause" 13 13 + ) 14 14 + 15 15 + type SqliteBlockstore struct { 16 16 + db *db.DB 17 17 + did string 18 18 + readonly bool 19 19 + inserts map[cid.Cid]blocks.Block 20 20 + } 21 21 + 22 22 + func New(did string, db *db.DB) *SqliteBlockstore { 23 23 + return &SqliteBlockstore{ 24 24 + did: did, 25 25 + db: db, 26 26 + readonly: false, 27 27 + inserts: map[cid.Cid]blocks.Block{}, 28 28 + } 29 29 + } 30 30 + 31 31 + func NewReadOnly(did string, db *db.DB) *SqliteBlockstore { 32 32 + return &SqliteBlockstore{ 33 33 + did: did, 34 34 + db: db, 35 35 + readonly: true, 36 36 + inserts: map[cid.Cid]blocks.Block{}, 37 37 + } 38 38 + } 39 39 + 40 40 + func (bs *SqliteBlockstore) Get(ctx context.Context, cid cid.Cid) (blocks.Block, error) { 41 41 + var block models.Block 42 42 + 43 43 + maybeBlock, ok := bs.inserts[cid] 44 44 + if ok { 45 45 + return maybeBlock, nil 46 46 + } 47 47 + 48 48 + if err := bs.db.Raw("SELECT * FROM blocks WHERE did = ? AND cid = ?", nil, bs.did, cid.Bytes()).Scan(&block).Error; err != nil { 49 49 + return nil, err 50 50 + } 51 51 + 52 52 + b, err := blocks.NewBlockWithCid(block.Value, cid) 53 53 + if err != nil { 54 54 + return nil, err 55 55 + } 56 56 + 57 57 + return b, nil 58 58 + } 59 59 + 60 60 + func (bs *SqliteBlockstore) Put(ctx context.Context, block blocks.Block) error { 61 61 + bs.inserts[block.Cid()] = block 62 62 + 63 63 + if bs.readonly { 64 64 + return nil 65 65 + } 66 66 + 67 67 + b := models.Block{ 68 68 + Did: bs.did, 69 69 + Cid: block.Cid().Bytes(), 70 70 + Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 71 71 + Value: block.RawData(), 72 72 + } 73 73 + 74 74 + if err := bs.db.Create(&b, []clause.Expression{clause.OnConflict{ 75 75 + Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 76 76 + UpdateAll: true, 77 77 + }}).Error; err != nil { 78 78 + return err 79 79 + } 80 80 + 81 81 + return nil 82 82 + } 83 83 + 84 84 + func (bs *SqliteBlockstore) DeleteBlock(context.Context, cid.Cid) error { 85 85 + panic("not implemented") 86 86 + } 87 87 + 88 88 + func (bs *SqliteBlockstore) Has(context.Context, cid.Cid) (bool, error) { 89 89 + panic("not implemented") 90 90 + } 91 91 + 92 92 + func (bs *SqliteBlockstore) GetSize(context.Context, cid.Cid) (int, error) { 93 93 + panic("not implemented") 94 94 + } 95 95 + 96 96 + func (bs *SqliteBlockstore) PutMany(ctx context.Context, blocks []blocks.Block) error { 97 97 + tx := bs.db.BeginDangerously() 98 98 + 99 99 + for _, block := range blocks { 100 100 + bs.inserts[block.Cid()] = block 101 101 + 102 102 + if bs.readonly { 103 103 + continue 104 104 + } 105 105 + 106 106 + b := models.Block{ 107 107 + Did: bs.did, 108 108 + Cid: block.Cid().Bytes(), 109 109 + Rev: syntax.NewTIDNow(0).String(), // TODO: WARN, this is bad. don't do this 110 110 + Value: block.RawData(), 111 111 + } 112 112 + 113 113 + if err := tx.Clauses(clause.OnConflict{ 114 114 + Columns: []clause.Column{{Name: "did"}, {Name: "cid"}}, 115 115 + UpdateAll: true, 116 116 + }).Create(&b).Error; err != nil { 117 117 + tx.Rollback() 118 118 + return err 119 119 + } 120 120 + } 121 121 + 122 122 + if bs.readonly { 123 123 + return nil 124 124 + } 125 125 + 126 126 + tx.Commit() 127 127 + 128 128 + return nil 129 129 + } 130 130 + 131 131 + func (bs *SqliteBlockstore) AllKeysChan(ctx context.Context) (<-chan cid.Cid, error) { 132 132 + panic("not implemented") 133 133 + } 134 134 + 135 135 + func (bs *SqliteBlockstore) HashOnRead(enabled bool) { 136 136 + panic("not implemented") 137 137 + } 138 138 + 139 139 + func (bs *SqliteBlockstore) Execute(ctx context.Context) error { 140 140 + if !bs.readonly { 141 141 + return fmt.Errorf("blockstore was not readonly") 142 142 + } 143 143 + 144 144 + bs.readonly = false 145 145 + for _, b := range bs.inserts { 146 146 + bs.Put(ctx, b) 147 147 + } 148 148 + bs.readonly = true 149 149 + 150 150 + return nil 151 151 + } 152 152 + 153 153 + func (bs *SqliteBlockstore) GetLog() map[cid.Cid]blocks.Block { 154 154 + return bs.inserts 155 155 + }