QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides handle-to-DID resolution with Redis-backed caching and queue processing.

Compare changes

Choose any two refs to compare.

+37
.dockerignore
··· 1 + # Git 2 + .git 3 + .gitignore 4 + 5 + # Documentation 6 + *.md 7 + docs/ 8 + LICENSE 9 + 10 + # Development files 11 + .vscode/ 12 + .env 13 + .env.local 14 + *.log 15 + 16 + # Build artifacts 17 + target/ 18 + Dockerfile 19 + .dockerignore 20 + 21 + # Test files 22 + tests/ 23 + benches/ 24 + 25 + # Scripts (except the ones we need) 26 + *.sh 27 + 28 + # SQLite databases 29 + *.db 30 + *.db-* 31 + 32 + # OS files 33 + .DS_Store 34 + Thumbs.db 35 + 36 + # Keep the www directory for static files 37 + !www/
+12 -8
.env.example
··· 1 1 # QuickDID Environment Configuration Template 2 2 # Copy this file to .env and customize for your deployment 3 - # 4 - # IMPORTANT: Never commit .env files with real SERVICE_KEY values 5 3 6 4 # ============================================================================ 7 5 # REQUIRED CONFIGURATION ··· 13 11 # - quickdid.example.com:8080 14 12 # - localhost:3007 15 13 HTTP_EXTERNAL=quickdid.example.com 16 - 17 - # Private key for service identity (REQUIRED) 18 - # SECURITY: Generate a new key for each environment 19 - # NEVER commit real keys to version control 20 - SERVICE_KEY=did:key:YOUR_PRIVATE_KEY_HERE 21 14 22 15 # ============================================================================ 23 16 # NETWORK CONFIGURATION ··· 98 91 QUEUE_BUFFER_SIZE=1000 99 92 100 93 # ============================================================================ 94 + # STATIC FILES CONFIGURATION 95 + # ============================================================================ 96 + 97 + # Directory for serving static files (default: www) 98 + # This should contain: 99 + # - index.html (landing page) 100 + # - .well-known/atproto-did (service DID) 101 + # - .well-known/did.json (DID document) 102 + # Docker default: /app/www 103 + STATIC_FILES_DIR=www 104 + 105 + # ============================================================================ 101 106 # LOGGING 102 107 # ============================================================================ 103 108 ··· 112 117 # ============================================================================ 113 118 114 119 # HTTP_EXTERNAL=localhost:3007 115 - # SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 116 120 # RUST_LOG=debug 117 121 # CACHE_TTL_MEMORY=60 118 122 # CACHE_TTL_REDIS=300
+3
.gitignore
··· 7 7 8 8 # Docker 9 9 docker-compose.override.yml 10 + 11 + # Metrics dev 12 + /metrics-stack
+47
CHANGELOG.md
··· 7 7 8 8 ## [Unreleased] 9 9 10 + ## [1.0.0-rc.5] - 2025-09-10 11 + 12 + ### Added 13 + - Bidirectional caching support for handle-to-DID and DID-to-handle lookups in Redis resolver 14 + - `purge` method to HandleResolver trait for removing entries by handle or DID 15 + - `set` method to HandleResolver trait for manual cache updates 16 + - Jetstream consumer integration for real-time cache updates from AT Protocol firehose 17 + - QuickDidEventHandler module for processing Account and Identity events 18 + - Static file serving with www directory support for landing page and well-known files 19 + - Comprehensive test coverage for new bidirectional cache operations 20 + 21 + ### Changed 22 + - Handle normalization to lowercase throughout the system for consistency 23 + - Updated all resolver implementations to chain `purge` and `set` calls through the stack 24 + - Enhanced documentation to reflect Jetstream configuration and bidirectional caching 25 + - Improved production deployment guide with real-time sync recommendations 26 + 27 + ### Fixed 28 + - Handle case sensitivity issues - all handles now normalized to lowercase 29 + - Cache consistency between handle and DID lookups 30 + - Event processing error handling in Jetstream consumer 31 + 32 + ## [1.0.0-rc.4] - 2025-09-08 33 + 34 + ### Added 35 + - Metrics system with pluggable adapters (StatsD support) for monitoring and observability 36 + - Proactive refresh resolver for keeping cached entries fresh before expiration 37 + - Redis queue deduplication to prevent duplicate handle resolution work items 38 + - Configurable bind address for StatsD UDP socket supporting both IPv4 and IPv6 39 + - CORS headers support for cross-origin requests 40 + - OPTIONS method handling for preflight requests 41 + - Resolution timing measurements for performance monitoring 42 + - Comprehensive metrics tracking including counters, gauges, and timings 43 + - Telegraf and TimescaleDB integration guide for metrics aggregation 44 + - Railway deployment resources for production environments 45 + 46 + ### Changed 47 + - Replaced chrono with httpdate for more efficient HTTP date formatting 48 + - Refactored handle resolver to include resolution time measurements 49 + - Improved handle resolution view architecture 50 + - Enhanced documentation with metrics configuration and deployment guides 51 + 52 + ### Fixed 53 + - Minor typo in feature commit message ("fesature" corrected to "feature") 54 + 10 55 ## [1.0.0-rc.3] - 2025-09-06 11 56 12 57 ### Added ··· 80 125 - Unnecessary feature flags (axum macros, deadpool-redis script) 81 126 - 4 unused dependencies reducing compilation time 82 127 128 + [1.0.0-rc.5]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.5 129 + [1.0.0-rc.4]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.4 83 130 [1.0.0-rc.3]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.3 84 131 [1.0.0-rc.2]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.2 85 132 [1.0.0-rc.1]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.1
+109 -18
CLAUDE.md
··· 1 1 # QuickDID - Development Guide for Claude 2 2 3 3 ## Overview 4 - QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides handle-to-DID resolution with Redis-backed caching and queue processing. 4 + QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides bidirectional handle-to-DID and DID-to-handle resolution with multi-layer caching (Redis, SQLite, in-memory), queue processing, metrics support, proactive cache refreshing, and real-time cache updates via Jetstream consumer. 5 5 6 6 ## Configuration 7 7 ··· 21 21 cargo build 22 22 23 23 # Run in debug mode (requires environment variables) 24 - HTTP_EXTERNAL=localhost:3007 SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK cargo run 24 + HTTP_EXTERNAL=localhost:3007 cargo run 25 25 26 26 # Run tests 27 27 cargo test ··· 49 49 1. **Handle Resolution** (`src/handle_resolver/`) 50 50 - `BaseHandleResolver`: Core resolution using DNS and HTTP 51 51 - `RateLimitedHandleResolver`: Semaphore-based rate limiting with optional timeout 52 - - `CachingHandleResolver`: In-memory caching layer 53 - - `RedisHandleResolver`: Redis-backed persistent caching 54 - - `SqliteHandleResolver`: SQLite-backed persistent caching 52 + - `CachingHandleResolver`: In-memory caching layer with bidirectional support 53 + - `RedisHandleResolver`: Redis-backed persistent caching with bidirectional lookups 54 + - `SqliteHandleResolver`: SQLite-backed persistent caching with bidirectional support 55 + - `ProactiveRefreshResolver`: Automatically refreshes cache entries before expiration 56 + - All resolvers implement `HandleResolver` trait with: 57 + - `resolve`: Handle-to-DID resolution 58 + - `purge`: Remove entries by handle or DID 59 + - `set`: Manually update handle-to-DID mappings 55 60 - Uses binary serialization via `HandleResolutionResult` for space efficiency 56 - - Resolution stack: Cache โ†’ RateLimited (optional) โ†’ Base โ†’ DNS/HTTP 61 + - Resolution stack: Cache โ†’ ProactiveRefresh (optional) โ†’ RateLimited (optional) โ†’ Base โ†’ DNS/HTTP 62 + - Includes resolution timing measurements for metrics 57 63 58 64 2. **Binary Serialization** (`src/handle_resolution_result.rs`) 59 65 - Compact storage format using bincode ··· 69 75 4. **HTTP Server** (`src/http/`) 70 76 - XRPC endpoints for AT Protocol compatibility 71 77 - Health check endpoint 72 - - DID document serving via .well-known 78 + - Static file serving from configurable directory (default: www) 79 + - Serves .well-known files as static content 80 + - CORS headers support for cross-origin requests 81 + - Cache-Control headers with configurable max-age and stale directives 82 + - ETag support with configurable seed for cache invalidation 83 + 84 + 5. **Metrics System** (`src/metrics.rs`) 85 + - Pluggable metrics publishing with StatsD support 86 + - Tracks counters, gauges, and timings 87 + - Configurable tags for environment/service identification 88 + - No-op adapter for development environments 89 + - Metrics for Jetstream event processing 90 + 91 + 6. **Jetstream Consumer** (`src/jetstream_handler.rs`) 92 + - Consumes AT Protocol firehose events via WebSocket 93 + - Processes Account events (purges deleted/deactivated accounts) 94 + - Processes Identity events (updates handle-to-DID mappings) 95 + - Automatic reconnection with exponential backoff 96 + - Comprehensive metrics for event processing 97 + - Spawned as cancellable task using task manager 73 98 74 99 ## Key Technical Details 75 100 ··· 79 104 - Other DID methods stored with full identifier 80 105 81 106 ### Redis Integration 82 - - **Caching**: Uses MetroHash64 for key generation, stores binary data 107 + - **Bidirectional Caching**: 108 + - Stores both handleโ†’DID and DIDโ†’handle mappings 109 + - Uses MetroHash64 for key generation 110 + - Binary data storage for efficiency 111 + - Automatic synchronization of both directions 83 112 - **Queuing**: Reliable queue with processing/dead letter queues 84 113 - **Key Prefixes**: Configurable via `QUEUE_REDIS_PREFIX` environment variable 85 114 ··· 89 118 - Acquire semaphore permit (with optional timeout) 90 119 - If timeout configured and exceeded, return error 91 120 3. Perform DNS TXT lookup or HTTP well-known query 92 - 4. Cache result with appropriate TTL 121 + 4. Cache result with appropriate TTL in both directions (handleโ†’DID and DIDโ†’handle) 93 122 5. Return DID or error 94 123 124 + ### Cache Management Operations 125 + - **Purge**: Removes entries by either handle or DID 126 + - Uses `atproto_identity::resolve::parse_input` for identifier detection 127 + - Removes both handleโ†’DID and DIDโ†’handle mappings 128 + - Chains through all resolver layers 129 + - **Set**: Manually updates handle-to-DID mappings 130 + - Updates both directions in cache 131 + - Normalizes handles to lowercase 132 + - Chains through all resolver layers 133 + 95 134 ## Environment Variables 96 135 97 136 ### Required 98 137 - `HTTP_EXTERNAL`: External hostname for service endpoints (e.g., `localhost:3007`) 99 - - `SERVICE_KEY`: Private key for service identity (DID format) 100 138 101 - ### Optional 139 + ### Optional - Core Configuration 102 140 - `HTTP_PORT`: Server port (default: 8080) 103 141 - `PLC_HOSTNAME`: PLC directory hostname (default: plc.directory) 142 + - `RUST_LOG`: Logging level (e.g., debug, info) 143 + - `STATIC_FILES_DIR`: Directory for serving static files (default: www) 144 + 145 + ### Optional - Caching 104 146 - `REDIS_URL`: Redis connection URL for caching 105 147 - `SQLITE_URL`: SQLite database URL for caching (e.g., `sqlite:./quickdid.db`) 148 + - `CACHE_TTL_MEMORY`: TTL for in-memory cache in seconds (default: 600) 149 + - `CACHE_TTL_REDIS`: TTL for Redis cache in seconds (default: 7776000) 150 + - `CACHE_TTL_SQLITE`: TTL for SQLite cache in seconds (default: 7776000) 151 + 152 + ### Optional - Queue Configuration 106 153 - `QUEUE_ADAPTER`: Queue type - 'mpsc', 'redis', 'sqlite', 'noop', or 'none' (default: mpsc) 107 154 - `QUEUE_REDIS_PREFIX`: Redis key prefix for queues (default: queue:handleresolver:) 108 155 - `QUEUE_WORKER_ID`: Worker ID for queue operations (default: worker1) 109 156 - `QUEUE_BUFFER_SIZE`: Buffer size for MPSC queue (default: 1000) 110 157 - `QUEUE_SQLITE_MAX_SIZE`: Max queue size for SQLite work shedding (default: 10000) 111 - - `CACHE_TTL_MEMORY`: TTL for in-memory cache in seconds (default: 600) 112 - - `CACHE_TTL_REDIS`: TTL for Redis cache in seconds (default: 7776000) 113 - - `CACHE_TTL_SQLITE`: TTL for SQLite cache in seconds (default: 7776000) 114 158 - `QUEUE_REDIS_TIMEOUT`: Redis blocking timeout in seconds (default: 5) 159 + - `QUEUE_REDIS_DEDUP_ENABLED`: Enable queue deduplication to prevent duplicate handles (default: false) 160 + - `QUEUE_REDIS_DEDUP_TTL`: TTL for deduplication keys in seconds (default: 60) 161 + 162 + ### Optional - Rate Limiting 115 163 - `RESOLVER_MAX_CONCURRENT`: Maximum concurrent handle resolutions (default: 0 = disabled) 116 164 - `RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`: Timeout for acquiring rate limit permit in ms (default: 0 = no timeout) 117 - - `RUST_LOG`: Logging level (e.g., debug, info) 165 + 166 + ### Optional - HTTP Cache Control 167 + - `CACHE_MAX_AGE`: Max-age for Cache-Control header in seconds (default: 86400) 168 + - `CACHE_STALE_IF_ERROR`: Stale-if-error directive in seconds (default: 172800) 169 + - `CACHE_STALE_WHILE_REVALIDATE`: Stale-while-revalidate directive in seconds (default: 86400) 170 + - `CACHE_MAX_STALE`: Max-stale directive in seconds (default: 86400) 171 + - `ETAG_SEED`: Seed value for ETag generation (default: application version) 172 + 173 + ### Optional - Metrics 174 + - `METRICS_ADAPTER`: Metrics adapter type - 'noop' or 'statsd' (default: noop) 175 + - `METRICS_STATSD_HOST`: StatsD host and port (required when METRICS_ADAPTER=statsd, e.g., localhost:8125) 176 + - `METRICS_STATSD_BIND`: Bind address for StatsD UDP socket (default: [::]:0 for IPv6, can use 0.0.0.0:0 for IPv4) 177 + - `METRICS_PREFIX`: Prefix for all metrics (default: quickdid) 178 + - `METRICS_TAGS`: Comma-separated tags (e.g., env:prod,service:quickdid) 179 + 180 + ### Optional - Proactive Refresh 181 + - `PROACTIVE_REFRESH_ENABLED`: Enable proactive cache refreshing (default: false) 182 + - `PROACTIVE_REFRESH_THRESHOLD`: Refresh when TTL remaining is below this threshold (0.0-1.0, default: 0.8) 183 + 184 + ### Optional - Jetstream Consumer 185 + - `JETSTREAM_ENABLED`: Enable Jetstream consumer for real-time cache updates (default: false) 186 + - `JETSTREAM_HOSTNAME`: Jetstream WebSocket hostname (default: jetstream.atproto.tools) 118 187 119 188 ## Error Handling 120 189 ··· 152 221 ### Test Coverage Areas 153 222 - Handle resolution with various DID methods 154 223 - Binary serialization/deserialization 155 - - Redis caching and expiration 224 + - Redis caching and expiration with bidirectional lookups 156 225 - Queue processing logic 157 226 - HTTP endpoint responses 227 + - Jetstream event handler processing 228 + - Purge and set operations across resolver layers 158 229 159 230 ## Development Patterns 160 231 ··· 171 242 - Connection pooling for Redis 172 243 - Configurable TTLs for cache entries 173 244 - Rate limiting via semaphore-based concurrency control 245 + - HTTP caching with ETag and Cache-Control headers 246 + - Resolution timing metrics for performance monitoring 174 247 175 248 ### Code Style 176 249 - Follow existing Rust idioms and patterns 177 250 - Use `tracing` for logging, not `println!` 178 251 - Prefer `Arc` for shared state across async tasks 179 252 - Handle errors explicitly, avoid `.unwrap()` in production code 253 + - Use `httpdate` crate for HTTP date formatting (not `chrono`) 180 254 181 255 ## Common Tasks 182 256 ··· 189 263 - For in-memory: Set `CACHE_TTL_MEMORY` environment variable 190 264 - For Redis: Set `CACHE_TTL_REDIS` environment variable 191 265 - For SQLite: Set `CACHE_TTL_SQLITE` environment variable 266 + 267 + ### Configuring Metrics 268 + 1. Set `METRICS_ADAPTER=statsd` and `METRICS_STATSD_HOST=localhost:8125` 269 + 2. Configure tags with `METRICS_TAGS=env:prod,service:quickdid` 270 + 3. Use Telegraf + TimescaleDB for aggregation (see `docs/telegraf-timescaledb-metrics-guide.md`) 271 + 4. Railway deployment resources available in `railway-resources/telegraf/` 192 272 193 273 ### Debugging Resolution Issues 194 274 1. Enable debug logging: `RUST_LOG=debug` 195 - 2. Check Redis cache: `redis-cli GET "handle:<hash>"` 275 + 2. Check Redis cache: 276 + - Handle lookup: `redis-cli GET "handle:<hash>"` 277 + - DID lookup: `redis-cli GET "handle:<hash>"` (same key format) 196 278 3. Check SQLite cache: `sqlite3 quickdid.db "SELECT * FROM handle_resolution_cache;"` 197 279 4. Monitor queue processing in logs 198 280 5. Check rate limiting: Look for "Rate limit permit acquisition timed out" errors 199 281 6. Verify DNS/HTTP connectivity to AT Protocol infrastructure 282 + 7. Monitor metrics for resolution timing and cache hit rates 283 + 8. Check Jetstream consumer status: 284 + - Look for "Jetstream consumer" log entries 285 + - Monitor `jetstream.*` metrics 286 + - Check reconnection attempts in logs 200 287 201 288 ## Dependencies 202 289 - `atproto-identity`: Core AT Protocol identity resolution 290 + - `atproto-jetstream`: AT Protocol Jetstream event consumer 203 291 - `bincode`: Binary serialization 204 292 - `deadpool-redis`: Redis connection pooling 205 293 - `metrohash`: Fast non-cryptographic hashing 206 294 - `tokio`: Async runtime 207 - - `axum`: Web framework 295 + - `axum`: Web framework 296 + - `httpdate`: HTTP date formatting (replacing chrono) 297 + - `cadence`: StatsD metrics client 298 + - `thiserror`: Error handling
+647 -553
Cargo.lock
··· 3 3 version = 4 4 4 5 5 [[package]] 6 - name = "addr2line" 7 - version = "0.24.2" 8 - source = "registry+https://github.com/rust-lang/crates.io-index" 9 - checksum = "dfbe277e56a376000877090da837660b4427aad530e3028d44e0bffe4f89a1c1" 10 - dependencies = [ 11 - "gimli", 12 - ] 13 - 14 - [[package]] 15 - name = "adler2" 16 - version = "2.0.1" 17 - source = "registry+https://github.com/rust-lang/crates.io-index" 18 - checksum = "320119579fcad9c21884f5c4861d16174d0e06250625266f50fe6898340abefa" 19 - 20 - [[package]] 21 6 name = "aho-corasick" 22 - version = "1.1.3" 7 + version = "1.1.4" 23 8 source = "registry+https://github.com/rust-lang/crates.io-index" 24 - checksum = "8e60d3430d3a69478ad0993f19238d2df97c507009a52b3c10addcd7f6bcb916" 9 + checksum = "ddd31a130427c27518df266943a5308ed92d4b226cc639f5a8f1002816174301" 25 10 dependencies = [ 26 11 "memchr", 27 12 ] ··· 33 18 checksum = "683d7910e743518b0e34f1186f92494becacb047c7b6bf616c96772180fef923" 34 19 35 20 [[package]] 36 - name = "android-tzdata" 37 - version = "0.1.1" 38 - source = "registry+https://github.com/rust-lang/crates.io-index" 39 - checksum = "e999941b234f3131b00bc13c22d06e8c5ff726d1b6318ac7eb276997bbb4fef0" 40 - 41 - [[package]] 42 - name = "android_system_properties" 43 - version = "0.1.5" 44 - source = "registry+https://github.com/rust-lang/crates.io-index" 45 - checksum = "819e7219dbd41043ac279b19830f2efc897156490d7fd6ea916720117ee66311" 46 - dependencies = [ 47 - "libc", 48 - ] 49 - 50 - [[package]] 51 21 name = "anyhow" 52 - version = "1.0.99" 22 + version = "1.0.100" 53 23 source = "registry+https://github.com/rust-lang/crates.io-index" 54 - checksum = "b0674a1ddeecb70197781e945de4b3b8ffb61fa939a5597bcf48503737663100" 24 + checksum = "a23eb6b1614318a8071c9b2521f36b424b2c83db5eb3a0fead4a6c0809af6e61" 55 25 56 26 [[package]] 57 27 name = "arc-swap" ··· 67 37 dependencies = [ 68 38 "proc-macro2", 69 39 "quote", 70 - "syn", 40 + "syn 2.0.108", 71 41 ] 72 42 73 43 [[package]] ··· 86 56 checksum = "1505bd5d3d116872e7271a6d4e16d81d0c8570876c8de68093a09ac269d8aac0" 87 57 88 58 [[package]] 59 + name = "atproto-client" 60 + version = "0.13.0" 61 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 62 + dependencies = [ 63 + "anyhow", 64 + "async-trait", 65 + "atproto-identity", 66 + "atproto-oauth", 67 + "atproto-record", 68 + "bytes", 69 + "reqwest", 70 + "reqwest-chain", 71 + "reqwest-middleware", 72 + "serde", 73 + "serde_json", 74 + "thiserror 2.0.17", 75 + "tokio", 76 + "tracing", 77 + "urlencoding", 78 + ] 79 + 80 + [[package]] 89 81 name = "atproto-identity" 90 - version = "0.11.3" 91 - source = "registry+https://github.com/rust-lang/crates.io-index" 92 - checksum = "aaac8751c7e4329a95714c01d9e47d22d94bc8c96e78079098312235128acb9f" 82 + version = "0.13.0" 83 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 93 84 dependencies = [ 94 85 "anyhow", 95 86 "async-trait", ··· 106 97 "serde", 107 98 "serde_ipld_dagcbor", 108 99 "serde_json", 109 - "thiserror 2.0.16", 100 + "thiserror 2.0.17", 110 101 "tokio", 111 102 "tracing", 103 + "url", 104 + "urlencoding", 105 + ] 106 + 107 + [[package]] 108 + name = "atproto-jetstream" 109 + version = "0.13.0" 110 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 111 + dependencies = [ 112 + "anyhow", 113 + "async-trait", 114 + "atproto-identity", 115 + "futures", 116 + "http", 117 + "serde", 118 + "serde_json", 119 + "thiserror 2.0.17", 120 + "tokio", 121 + "tokio-util", 122 + "tokio-websockets", 123 + "tracing", 124 + "tracing-subscriber", 125 + "urlencoding", 126 + "zstd", 127 + ] 128 + 129 + [[package]] 130 + name = "atproto-lexicon" 131 + version = "0.13.0" 132 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 133 + dependencies = [ 134 + "anyhow", 135 + "async-trait", 136 + "atproto-client", 137 + "atproto-identity", 138 + "hickory-resolver", 139 + "reqwest", 140 + "serde", 141 + "serde_json", 142 + "thiserror 2.0.17", 143 + "tokio", 144 + "tracing", 145 + ] 146 + 147 + [[package]] 148 + name = "atproto-oauth" 149 + version = "0.13.0" 150 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 151 + dependencies = [ 152 + "anyhow", 153 + "async-trait", 154 + "atproto-identity", 155 + "base64", 156 + "chrono", 157 + "ecdsa", 158 + "elliptic-curve", 159 + "k256", 160 + "lru", 161 + "multibase", 162 + "p256", 163 + "p384", 164 + "rand 0.8.5", 165 + "reqwest", 166 + "reqwest-chain", 167 + "reqwest-middleware", 168 + "serde", 169 + "serde_ipld_dagcbor", 170 + "serde_json", 171 + "sha2", 172 + "thiserror 2.0.17", 173 + "tokio", 174 + "tracing", 175 + "ulid", 176 + ] 177 + 178 + [[package]] 179 + name = "atproto-record" 180 + version = "0.13.0" 181 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 182 + dependencies = [ 183 + "anyhow", 184 + "atproto-identity", 185 + "base64", 186 + "chrono", 187 + "cid", 188 + "multihash", 189 + "rand 0.8.5", 190 + "serde", 191 + "serde_ipld_dagcbor", 192 + "serde_json", 193 + "sha2", 194 + "thiserror 2.0.17", 112 195 ] 113 196 114 197 [[package]] ··· 119 202 120 203 [[package]] 121 204 name = "axum" 122 - version = "0.8.4" 205 + version = "0.8.6" 123 206 source = "registry+https://github.com/rust-lang/crates.io-index" 124 - checksum = "021e862c184ae977658b36c4500f7feac3221ca5da43e3f25bd04ab6c79a29b5" 207 + checksum = "8a18ed336352031311f4e0b4dd2ff392d4fbb370777c9d18d7fc9d7359f73871" 125 208 dependencies = [ 126 209 "axum-core", 127 210 "bytes", ··· 138 221 "mime", 139 222 "percent-encoding", 140 223 "pin-project-lite", 141 - "rustversion", 142 - "serde", 224 + "serde_core", 143 225 "serde_json", 144 226 "serde_path_to_error", 145 227 "serde_urlencoded", ··· 153 235 154 236 [[package]] 155 237 name = "axum-core" 156 - version = "0.5.2" 238 + version = "0.5.5" 157 239 source = "registry+https://github.com/rust-lang/crates.io-index" 158 - checksum = "68464cd0412f486726fb3373129ef5d2993f90c34bc2bc1c1e9943b2f4fc7ca6" 240 + checksum = "59446ce19cd142f8833f856eb31f3eb097812d1479ab224f54d72428ca21ea22" 159 241 dependencies = [ 160 242 "bytes", 161 243 "futures-core", ··· 164 246 "http-body-util", 165 247 "mime", 166 248 "pin-project-lite", 167 - "rustversion", 168 249 "sync_wrapper", 169 250 "tower-layer", 170 251 "tower-service", ··· 173 254 174 255 [[package]] 175 256 name = "backon" 176 - version = "1.5.2" 257 + version = "1.6.0" 177 258 source = "registry+https://github.com/rust-lang/crates.io-index" 178 - checksum = "592277618714fbcecda9a02ba7a8781f319d26532a88553bbacc77ba5d2b3a8d" 259 + checksum = "cffb0e931875b666fc4fcb20fee52e9bbd1ef836fd9e9e04ec21555f9f85f7ef" 179 260 dependencies = [ 180 261 "fastrand", 181 262 ] 182 263 183 264 [[package]] 184 - name = "backtrace" 185 - version = "0.3.75" 186 - source = "registry+https://github.com/rust-lang/crates.io-index" 187 - checksum = "6806a6321ec58106fea15becdad98371e28d92ccbc7c8f1b3b6dd724fe8f1002" 188 - dependencies = [ 189 - "addr2line", 190 - "cfg-if", 191 - "libc", 192 - "miniz_oxide", 193 - "object", 194 - "rustc-demangle", 195 - "windows-targets 0.52.6", 196 - ] 197 - 198 - [[package]] 199 265 name = "base-x" 200 266 version = "0.2.11" 201 267 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 206 272 version = "0.2.0" 207 273 source = "registry+https://github.com/rust-lang/crates.io-index" 208 274 checksum = "4c7f02d4ea65f2c1853089ffd8d2787bdbc63de2f0d29dedbcf8ccdfa0ccd4cf" 275 + 276 + [[package]] 277 + name = "base256emoji" 278 + version = "1.0.2" 279 + source = "registry+https://github.com/rust-lang/crates.io-index" 280 + checksum = "b5e9430d9a245a77c92176e649af6e275f20839a48389859d1661e9a128d077c" 281 + dependencies = [ 282 + "const-str", 283 + "match-lookup", 284 + ] 209 285 210 286 [[package]] 211 287 name = "base64" ··· 241 317 242 318 [[package]] 243 319 name = "bitflags" 244 - version = "2.9.4" 320 + version = "2.10.0" 245 321 source = "registry+https://github.com/rust-lang/crates.io-index" 246 - checksum = "2261d10cca569e4643e526d8dc2e62e433cc8aba21ab764233731f8d369bf394" 322 + checksum = "812e12b5285cc515a9c72a5c1d3b6d46a19dac5acfef5265968c166106e31dd3" 247 323 dependencies = [ 248 - "serde", 324 + "serde_core", 249 325 ] 250 326 251 327 [[package]] ··· 276 352 checksum = "d71b6127be86fdcfddb610f7182ac57211d4b18a3e9c82eb2d17662f2227ad6a" 277 353 278 354 [[package]] 355 + name = "cadence" 356 + version = "1.6.0" 357 + source = "registry+https://github.com/rust-lang/crates.io-index" 358 + checksum = "3075f133bee430b7644c54fb629b9b4420346ffa275a45c81a6babe8b09b4f51" 359 + dependencies = [ 360 + "crossbeam-channel", 361 + ] 362 + 363 + [[package]] 279 364 name = "cbor4ii" 280 365 version = "0.2.14" 281 366 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 286 371 287 372 [[package]] 288 373 name = "cc" 289 - version = "1.2.36" 374 + version = "1.2.44" 290 375 source = "registry+https://github.com/rust-lang/crates.io-index" 291 - checksum = "5252b3d2648e5eedbc1a6f501e3c795e07025c1e93bbf8bbdd6eef7f447a6d54" 376 + checksum = "37521ac7aabe3d13122dc382493e20c9416f299d2ccd5b3a5340a2570cdeb0f3" 292 377 dependencies = [ 293 378 "find-msvc-tools", 379 + "jobserver", 380 + "libc", 294 381 "shlex", 295 382 ] 296 383 297 384 [[package]] 298 385 name = "cfg-if" 299 - version = "1.0.3" 386 + version = "1.0.4" 300 387 source = "registry+https://github.com/rust-lang/crates.io-index" 301 - checksum = "2fd1289c04a9ea8cb22300a459a72a385d7c73d3259e2ed7dcb2af674838cfa9" 388 + checksum = "9330f8b2ff13f34540b44e946ef35111825727b38d33286ef986142615121801" 302 389 303 390 [[package]] 304 391 name = "cfg_aliases" ··· 308 395 309 396 [[package]] 310 397 name = "chrono" 311 - version = "0.4.41" 398 + version = "0.4.42" 312 399 source = "registry+https://github.com/rust-lang/crates.io-index" 313 - checksum = "c469d952047f47f91b68d1cba3f10d63c11d73e4636f24f08daf0278abf01c4d" 400 + checksum = "145052bdd345b87320e369255277e3fb5152762ad123a901ef5c262dd38fe8d2" 314 401 dependencies = [ 315 - "android-tzdata", 316 - "iana-time-zone", 317 402 "num-traits", 318 - "windows-link", 403 + "serde", 319 404 ] 320 405 321 406 [[package]] ··· 360 445 version = "0.9.6" 361 446 source = "registry+https://github.com/rust-lang/crates.io-index" 362 447 checksum = "c2459377285ad874054d797f3ccebf984978aa39129f6eafde5cdc8315b612f8" 448 + 449 + [[package]] 450 + name = "const-str" 451 + version = "0.4.3" 452 + source = "registry+https://github.com/rust-lang/crates.io-index" 453 + checksum = "2f421161cb492475f1661ddc9815a745a1c894592070661180fdec3d4872e9c3" 363 454 364 455 [[package]] 365 456 name = "core-foundation" ··· 504 595 checksum = "8d162beedaa69905488a8da94f5ac3edb4dd4788b732fadb7bd120b2625c1976" 505 596 dependencies = [ 506 597 "data-encoding", 507 - "syn", 598 + "syn 2.0.108", 508 599 ] 509 600 510 601 [[package]] ··· 569 660 dependencies = [ 570 661 "proc-macro2", 571 662 "quote", 572 - "syn", 663 + "syn 2.0.108", 573 664 ] 574 665 575 666 [[package]] ··· 588 679 "digest", 589 680 "elliptic-curve", 590 681 "rfc6979", 682 + "serdect", 591 683 "signature", 592 684 "spki", 593 685 ] ··· 643 735 "heck", 644 736 "proc-macro2", 645 737 "quote", 646 - "syn", 738 + "syn 2.0.108", 647 739 ] 648 740 649 741 [[package]] ··· 654 746 655 747 [[package]] 656 748 name = "errno" 657 - version = "0.3.13" 749 + version = "0.3.14" 658 750 source = "registry+https://github.com/rust-lang/crates.io-index" 659 - checksum = "778e2ac28f6c47af28e4907f13ffd1e1ddbd400980a9abd7c8df189bf578a5ad" 751 + checksum = "39cab71617ae0d63f51a36d69f866391735b51691dbda63cf6f96d042b63efeb" 660 752 dependencies = [ 661 753 "libc", 662 - "windows-sys 0.60.2", 754 + "windows-sys 0.61.2", 663 755 ] 664 756 665 757 [[package]] ··· 702 794 703 795 [[package]] 704 796 name = "find-msvc-tools" 705 - version = "0.1.1" 797 + version = "0.1.4" 706 798 source = "registry+https://github.com/rust-lang/crates.io-index" 707 - checksum = "7fd99930f64d146689264c637b5af2f0233a933bef0d8570e2526bf9e083192d" 799 + checksum = "52051878f80a721bb68ebfbc930e07b65ba72f2da88968ea5c06fd6ca3d3a127" 708 800 709 801 [[package]] 710 802 name = "flume" ··· 754 846 ] 755 847 756 848 [[package]] 849 + name = "futures" 850 + version = "0.3.31" 851 + source = "registry+https://github.com/rust-lang/crates.io-index" 852 + checksum = "65bc07b1a8bc7c85c5f2e110c476c7389b4554ba72af57d8445ea63a576b0876" 853 + dependencies = [ 854 + "futures-channel", 855 + "futures-core", 856 + "futures-executor", 857 + "futures-io", 858 + "futures-sink", 859 + "futures-task", 860 + "futures-util", 861 + ] 862 + 863 + [[package]] 757 864 name = "futures-channel" 758 865 version = "0.3.31" 759 866 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 805 912 dependencies = [ 806 913 "proc-macro2", 807 914 "quote", 808 - "syn", 915 + "syn 2.0.108", 809 916 ] 810 917 811 918 [[package]] ··· 826 933 source = "registry+https://github.com/rust-lang/crates.io-index" 827 934 checksum = "9fa08315bb612088cc391249efdc3bc77536f16c91f6cf495e6fbe85b20a4a81" 828 935 dependencies = [ 936 + "futures-channel", 829 937 "futures-core", 830 938 "futures-io", 831 939 "futures-macro", ··· 838 946 ] 839 947 840 948 [[package]] 841 - name = "generator" 842 - version = "0.8.7" 843 - source = "registry+https://github.com/rust-lang/crates.io-index" 844 - checksum = "605183a538e3e2a9c1038635cc5c2d194e2ee8fd0d1b66b8349fad7dbacce5a2" 845 - dependencies = [ 846 - "cc", 847 - "cfg-if", 848 - "libc", 849 - "log", 850 - "rustversion", 851 - "windows", 852 - ] 853 - 854 - [[package]] 855 949 name = "generic-array" 856 - version = "0.14.7" 950 + version = "0.14.9" 857 951 source = "registry+https://github.com/rust-lang/crates.io-index" 858 - checksum = "85649ca51fd72272d7821adaf274ad91c288277713d9c18820d8499a7ff69e9a" 952 + checksum = "4bb6743198531e02858aeaea5398fcc883e71851fcbcb5a2f773e2fb6cb1edf2" 859 953 dependencies = [ 860 954 "typenum", 861 955 "version_check", ··· 871 965 "cfg-if", 872 966 "js-sys", 873 967 "libc", 874 - "wasi 0.11.1+wasi-snapshot-preview1", 968 + "wasi", 875 969 "wasm-bindgen", 876 970 ] 877 971 878 972 [[package]] 879 973 name = "getrandom" 880 - version = "0.3.3" 974 + version = "0.3.4" 881 975 source = "registry+https://github.com/rust-lang/crates.io-index" 882 - checksum = "26145e563e54f2cadc477553f1ec5ee650b00862f0a58bcd12cbdc5f0ea2d2f4" 976 + checksum = "899def5c37c4fd7b2664648c28120ecec138e4d395b459e5ca34f9cce2dd77fd" 883 977 dependencies = [ 884 978 "cfg-if", 885 979 "js-sys", 886 980 "libc", 887 981 "r-efi", 888 - "wasi 0.14.3+wasi-0.2.4", 982 + "wasip2", 889 983 "wasm-bindgen", 890 984 ] 891 - 892 - [[package]] 893 - name = "gimli" 894 - version = "0.31.1" 895 - source = "registry+https://github.com/rust-lang/crates.io-index" 896 - checksum = "07e28edb80900c19c28f1072f2e8aeca7fa06b23cd4169cefe1af5aa3260783f" 897 985 898 986 [[package]] 899 987 name = "group" ··· 937 1025 ] 938 1026 939 1027 [[package]] 1028 + name = "hashbrown" 1029 + version = "0.16.0" 1030 + source = "registry+https://github.com/rust-lang/crates.io-index" 1031 + checksum = "5419bdc4f6a9207fbeba6d11b604d481addf78ecd10c11ad51e76c2f6482748d" 1032 + 1033 + [[package]] 940 1034 name = "hashlink" 941 1035 version = "0.10.0" 942 1036 source = "registry+https://github.com/rust-lang/crates.io-index" 943 1037 checksum = "7382cf6263419f2d8df38c55d7da83da5c18aef87fc7a7fc1fb1e344edfe14c1" 944 1038 dependencies = [ 945 - "hashbrown", 1039 + "hashbrown 0.15.5", 946 1040 ] 947 1041 948 1042 [[package]] ··· 981 1075 "once_cell", 982 1076 "rand 0.9.2", 983 1077 "ring", 984 - "thiserror 2.0.16", 1078 + "thiserror 2.0.17", 985 1079 "tinyvec", 986 1080 "tokio", 987 1081 "tracing", ··· 1004 1098 "rand 0.9.2", 1005 1099 "resolv-conf", 1006 1100 "smallvec", 1007 - "thiserror 2.0.16", 1101 + "thiserror 2.0.17", 1008 1102 "tokio", 1009 1103 "tracing", 1010 1104 ] ··· 1029 1123 1030 1124 [[package]] 1031 1125 name = "home" 1032 - version = "0.5.11" 1126 + version = "0.5.12" 1033 1127 source = "registry+https://github.com/rust-lang/crates.io-index" 1034 - checksum = "589533453244b0995c858700322199b2becb13b627df2851f64a2775d024abcf" 1128 + checksum = "cc627f471c528ff0c4a49e1d5e60450c8f6461dd6d10ba9dcd3a61d3dff7728d" 1035 1129 dependencies = [ 1036 - "windows-sys 0.59.0", 1130 + "windows-sys 0.61.2", 1037 1131 ] 1038 1132 1039 1133 [[package]] ··· 1071 1165 ] 1072 1166 1073 1167 [[package]] 1168 + name = "http-range-header" 1169 + version = "0.4.2" 1170 + source = "registry+https://github.com/rust-lang/crates.io-index" 1171 + checksum = "9171a2ea8a68358193d15dd5d70c1c10a2afc3e7e4c5bc92bc9f025cebd7359c" 1172 + 1173 + [[package]] 1074 1174 name = "httparse" 1075 1175 version = "1.10.1" 1076 1176 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 1140 1240 1141 1241 [[package]] 1142 1242 name = "hyper-util" 1143 - version = "0.1.16" 1243 + version = "0.1.17" 1144 1244 source = "registry+https://github.com/rust-lang/crates.io-index" 1145 - checksum = "8d9b05277c7e8da2c93a568989bb6207bef0112e8d17df7a6eda4a3cf143bc5e" 1245 + checksum = "3c6995591a8f1380fcb4ba966a252a4b29188d51d2b89e3a252f5305be65aea8" 1146 1246 dependencies = [ 1147 1247 "base64", 1148 1248 "bytes", ··· 1156 1256 "libc", 1157 1257 "percent-encoding", 1158 1258 "pin-project-lite", 1159 - "socket2 0.6.0", 1259 + "socket2 0.6.1", 1160 1260 "system-configuration", 1161 1261 "tokio", 1162 1262 "tower-service", ··· 1165 1265 ] 1166 1266 1167 1267 [[package]] 1168 - name = "iana-time-zone" 1169 - version = "0.1.63" 1170 - source = "registry+https://github.com/rust-lang/crates.io-index" 1171 - checksum = "b0c919e5debc312ad217002b8048a17b7d83f80703865bbfcfebb0458b0b27d8" 1172 - dependencies = [ 1173 - "android_system_properties", 1174 - "core-foundation-sys", 1175 - "iana-time-zone-haiku", 1176 - "js-sys", 1177 - "log", 1178 - "wasm-bindgen", 1179 - "windows-core", 1180 - ] 1181 - 1182 - [[package]] 1183 - name = "iana-time-zone-haiku" 1184 - version = "0.1.2" 1185 - source = "registry+https://github.com/rust-lang/crates.io-index" 1186 - checksum = "f31827a206f56af32e590ba56d5d2d085f558508192593743f16b2306495269f" 1187 - dependencies = [ 1188 - "cc", 1189 - ] 1190 - 1191 - [[package]] 1192 1268 name = "icu_collections" 1193 - version = "2.0.0" 1269 + version = "2.1.1" 1194 1270 source = "registry+https://github.com/rust-lang/crates.io-index" 1195 - checksum = "200072f5d0e3614556f94a9930d5dc3e0662a652823904c3a75dc3b0af7fee47" 1271 + checksum = "4c6b649701667bbe825c3b7e6388cb521c23d88644678e83c0c4d0a621a34b43" 1196 1272 dependencies = [ 1197 1273 "displaydoc", 1198 1274 "potential_utf", ··· 1203 1279 1204 1280 [[package]] 1205 1281 name = "icu_locale_core" 1206 - version = "2.0.0" 1282 + version = "2.1.1" 1207 1283 source = "registry+https://github.com/rust-lang/crates.io-index" 1208 - checksum = "0cde2700ccaed3872079a65fb1a78f6c0a36c91570f28755dda67bc8f7d9f00a" 1284 + checksum = "edba7861004dd3714265b4db54a3c390e880ab658fec5f7db895fae2046b5bb6" 1209 1285 dependencies = [ 1210 1286 "displaydoc", 1211 1287 "litemap", ··· 1216 1292 1217 1293 [[package]] 1218 1294 name = "icu_normalizer" 1219 - version = "2.0.0" 1295 + version = "2.1.1" 1220 1296 source = "registry+https://github.com/rust-lang/crates.io-index" 1221 - checksum = "436880e8e18df4d7bbc06d58432329d6458cc84531f7ac5f024e93deadb37979" 1297 + checksum = "5f6c8828b67bf8908d82127b2054ea1b4427ff0230ee9141c54251934ab1b599" 1222 1298 dependencies = [ 1223 - "displaydoc", 1224 1299 "icu_collections", 1225 1300 "icu_normalizer_data", 1226 1301 "icu_properties", ··· 1231 1306 1232 1307 [[package]] 1233 1308 name = "icu_normalizer_data" 1234 - version = "2.0.0" 1309 + version = "2.1.1" 1235 1310 source = "registry+https://github.com/rust-lang/crates.io-index" 1236 - checksum = "00210d6893afc98edb752b664b8890f0ef174c8adbb8d0be9710fa66fbbf72d3" 1311 + checksum = "7aedcccd01fc5fe81e6b489c15b247b8b0690feb23304303a9e560f37efc560a" 1237 1312 1238 1313 [[package]] 1239 1314 name = "icu_properties" 1240 - version = "2.0.1" 1315 + version = "2.1.1" 1241 1316 source = "registry+https://github.com/rust-lang/crates.io-index" 1242 - checksum = "016c619c1eeb94efb86809b015c58f479963de65bdb6253345c1a1276f22e32b" 1317 + checksum = "e93fcd3157766c0c8da2f8cff6ce651a31f0810eaa1c51ec363ef790bbb5fb99" 1243 1318 dependencies = [ 1244 - "displaydoc", 1245 1319 "icu_collections", 1246 1320 "icu_locale_core", 1247 1321 "icu_properties_data", 1248 1322 "icu_provider", 1249 - "potential_utf", 1250 1323 "zerotrie", 1251 1324 "zerovec", 1252 1325 ] 1253 1326 1254 1327 [[package]] 1255 1328 name = "icu_properties_data" 1256 - version = "2.0.1" 1329 + version = "2.1.1" 1257 1330 source = "registry+https://github.com/rust-lang/crates.io-index" 1258 - checksum = "298459143998310acd25ffe6810ed544932242d3f07083eee1084d83a71bd632" 1331 + checksum = "02845b3647bb045f1100ecd6480ff52f34c35f82d9880e029d329c21d1054899" 1259 1332 1260 1333 [[package]] 1261 1334 name = "icu_provider" 1262 - version = "2.0.0" 1335 + version = "2.1.1" 1263 1336 source = "registry+https://github.com/rust-lang/crates.io-index" 1264 - checksum = "03c80da27b5f4187909049ee2d72f276f0d9f99a42c306bd0131ecfe04d8e5af" 1337 + checksum = "85962cf0ce02e1e0a629cc34e7ca3e373ce20dda4c4d7294bbd0bf1fdb59e614" 1265 1338 dependencies = [ 1266 1339 "displaydoc", 1267 1340 "icu_locale_core", 1268 - "stable_deref_trait", 1269 - "tinystr", 1270 1341 "writeable", 1271 1342 "yoke", 1272 1343 "zerofrom", ··· 1297 1368 1298 1369 [[package]] 1299 1370 name = "indexmap" 1300 - version = "2.11.0" 1371 + version = "2.12.0" 1301 1372 source = "registry+https://github.com/rust-lang/crates.io-index" 1302 - checksum = "f2481980430f9f78649238835720ddccc57e52df14ffce1c6f37391d61b563e9" 1373 + checksum = "6717a8d2a5a929a1a2eb43a12812498ed141a0bcfb7e8f7844fbdbe4303bba9f" 1303 1374 dependencies = [ 1304 1375 "equivalent", 1305 - "hashbrown", 1306 - ] 1307 - 1308 - [[package]] 1309 - name = "io-uring" 1310 - version = "0.7.10" 1311 - source = "registry+https://github.com/rust-lang/crates.io-index" 1312 - checksum = "046fa2d4d00aea763528b4950358d0ead425372445dc8ff86312b3c69ff7727b" 1313 - dependencies = [ 1314 - "bitflags", 1315 - "cfg-if", 1316 - "libc", 1376 + "hashbrown 0.16.0", 1317 1377 ] 1318 1378 1319 1379 [[package]] ··· 1362 1422 checksum = "4a5f13b858c8d314ee3e8f639011f7ccefe71f97f96e50151fb991f267928e2c" 1363 1423 1364 1424 [[package]] 1425 + name = "jobserver" 1426 + version = "0.1.34" 1427 + source = "registry+https://github.com/rust-lang/crates.io-index" 1428 + checksum = "9afb3de4395d6b3e67a780b6de64b51c978ecf11cb9a462c66be7d4ca9039d33" 1429 + dependencies = [ 1430 + "getrandom 0.3.4", 1431 + "libc", 1432 + ] 1433 + 1434 + [[package]] 1365 1435 name = "js-sys" 1366 - version = "0.3.78" 1436 + version = "0.3.82" 1367 1437 source = "registry+https://github.com/rust-lang/crates.io-index" 1368 - checksum = "0c0b063578492ceec17683ef2f8c5e89121fbd0b172cbc280635ab7567db2738" 1438 + checksum = "b011eec8cc36da2aab2d5cff675ec18454fad408585853910a202391cf9f8e65" 1369 1439 dependencies = [ 1370 1440 "once_cell", 1371 1441 "wasm-bindgen", ··· 1396 1466 1397 1467 [[package]] 1398 1468 name = "libc" 1399 - version = "0.2.175" 1469 + version = "0.2.177" 1400 1470 source = "registry+https://github.com/rust-lang/crates.io-index" 1401 - checksum = "6a82ae493e598baaea5209805c49bbf2ea7de956d50d7da0da1164f9c6d28543" 1471 + checksum = "2874a2af47a2325c2001a6e6fad9b16a53b802102b528163885171cf92b15976" 1402 1472 1403 1473 [[package]] 1404 1474 name = "libm" ··· 1408 1478 1409 1479 [[package]] 1410 1480 name = "libredox" 1411 - version = "0.1.9" 1481 + version = "0.1.10" 1412 1482 source = "registry+https://github.com/rust-lang/crates.io-index" 1413 - checksum = "391290121bad3d37fbddad76d8f5d1c1c314cfc646d143d7e07a3086ddff0ce3" 1483 + checksum = "416f7e718bdb06000964960ffa43b4335ad4012ae8b99060261aa4a8088d5ccb" 1414 1484 dependencies = [ 1415 1485 "bitflags", 1416 1486 "libc", ··· 1430 1500 1431 1501 [[package]] 1432 1502 name = "linux-raw-sys" 1433 - version = "0.9.4" 1503 + version = "0.11.0" 1434 1504 source = "registry+https://github.com/rust-lang/crates.io-index" 1435 - checksum = "cd945864f07fe9f5371a27ad7b52a172b4b499999f1d97574c9fa68373937e12" 1505 + checksum = "df1d3c3b53da64cf5760482273a98e575c651a67eec7f77df96b5b642de8f039" 1436 1506 1437 1507 [[package]] 1438 1508 name = "litemap" 1439 - version = "0.8.0" 1509 + version = "0.8.1" 1440 1510 source = "registry+https://github.com/rust-lang/crates.io-index" 1441 - checksum = "241eaef5fd12c88705a01fc1066c48c4b36e0dd4377dcdc7ec3942cea7a69956" 1511 + checksum = "6373607a59f0be73a39b6fe456b8192fcc3585f602af20751600e974dd455e77" 1442 1512 1443 1513 [[package]] 1444 1514 name = "lock_api" 1445 - version = "0.4.13" 1515 + version = "0.4.14" 1446 1516 source = "registry+https://github.com/rust-lang/crates.io-index" 1447 - checksum = "96936507f153605bddfcda068dd804796c84324ed2510809e5b2a624c81da765" 1517 + checksum = "224399e74b87b5f3557511d98dff8b14089b3dadafcab6bb93eab67d3aace965" 1448 1518 dependencies = [ 1449 - "autocfg", 1450 1519 "scopeguard", 1451 1520 ] 1452 1521 ··· 1457 1526 checksum = "34080505efa8e45a4b816c349525ebe327ceaa8559756f0356cba97ef3bf7432" 1458 1527 1459 1528 [[package]] 1460 - name = "loom" 1461 - version = "0.7.2" 1462 - source = "registry+https://github.com/rust-lang/crates.io-index" 1463 - checksum = "419e0dc8046cb947daa77eb95ae174acfbddb7673b4151f56d1eed8e93fbfaca" 1464 - dependencies = [ 1465 - "cfg-if", 1466 - "generator", 1467 - "scoped-tls", 1468 - "tracing", 1469 - "tracing-subscriber", 1470 - ] 1471 - 1472 - [[package]] 1473 1529 name = "lru" 1474 1530 version = "0.12.5" 1475 1531 source = "registry+https://github.com/rust-lang/crates.io-index" 1476 1532 checksum = "234cf4f4a04dc1f57e24b96cc0cd600cf2af460d4161ac5ecdd0af8e1f3b2a38" 1477 1533 dependencies = [ 1478 - "hashbrown", 1534 + "hashbrown 0.15.5", 1479 1535 ] 1480 1536 1481 1537 [[package]] ··· 1485 1541 checksum = "112b39cec0b298b6c1999fee3e31427f74f676e4cb9879ed1a121b43661a4154" 1486 1542 1487 1543 [[package]] 1544 + name = "match-lookup" 1545 + version = "0.1.1" 1546 + source = "registry+https://github.com/rust-lang/crates.io-index" 1547 + checksum = "1265724d8cb29dbbc2b0f06fffb8bf1a8c0cf73a78eede9ba73a4a66c52a981e" 1548 + dependencies = [ 1549 + "proc-macro2", 1550 + "quote", 1551 + "syn 1.0.109", 1552 + ] 1553 + 1554 + [[package]] 1488 1555 name = "matchers" 1489 1556 version = "0.2.0" 1490 1557 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 1511 1578 1512 1579 [[package]] 1513 1580 name = "memchr" 1514 - version = "2.7.5" 1581 + version = "2.7.6" 1515 1582 source = "registry+https://github.com/rust-lang/crates.io-index" 1516 - checksum = "32a282da65faaf38286cf3be983213fcf1d2e2a58700e808f83f4ea9a4804bc0" 1583 + checksum = "f52b00d39961fc5b2736ea853c9cc86238e165017a493d1d5c8eac6bdc4cc273" 1517 1584 1518 1585 [[package]] 1519 1586 name = "metrohash" ··· 1528 1595 checksum = "6877bb514081ee2a7ff5ef9de3281f14a4dd4bceac4c09388074a6b5df8a139a" 1529 1596 1530 1597 [[package]] 1531 - name = "miniz_oxide" 1532 - version = "0.8.9" 1598 + name = "mime_guess" 1599 + version = "2.0.5" 1533 1600 source = "registry+https://github.com/rust-lang/crates.io-index" 1534 - checksum = "1fa76a2c86f704bdb222d66965fb3d63269ce38518b83cb0575fca855ebb6316" 1601 + checksum = "f7c44f8e672c00fe5308fa235f821cb4198414e1c77935c1ab6948d3fd78550e" 1535 1602 dependencies = [ 1536 - "adler2", 1603 + "mime", 1604 + "unicase", 1537 1605 ] 1538 1606 1539 1607 [[package]] 1540 1608 name = "mio" 1541 - version = "1.0.4" 1609 + version = "1.1.0" 1542 1610 source = "registry+https://github.com/rust-lang/crates.io-index" 1543 - checksum = "78bed444cc8a2160f01cbcf811ef18cac863ad68ae8ca62092e8db51d51c761c" 1611 + checksum = "69d83b0086dc8ecf3ce9ae2874b2d1290252e2a30720bea58a5c6639b0092873" 1544 1612 dependencies = [ 1545 1613 "libc", 1546 - "wasi 0.11.1+wasi-snapshot-preview1", 1547 - "windows-sys 0.59.0", 1614 + "wasi", 1615 + "windows-sys 0.61.2", 1548 1616 ] 1549 1617 1550 1618 [[package]] 1551 1619 name = "moka" 1552 - version = "0.12.10" 1620 + version = "0.12.11" 1553 1621 source = "registry+https://github.com/rust-lang/crates.io-index" 1554 - checksum = "a9321642ca94a4282428e6ea4af8cc2ca4eac48ac7a6a4ea8f33f76d0ce70926" 1622 + checksum = "8261cd88c312e0004c1d51baad2980c66528dfdb2bee62003e643a4d8f86b077" 1555 1623 dependencies = [ 1556 1624 "crossbeam-channel", 1557 1625 "crossbeam-epoch", 1558 1626 "crossbeam-utils", 1559 - "loom", 1627 + "equivalent", 1560 1628 "parking_lot", 1561 1629 "portable-atomic", 1562 1630 "rustc_version", 1563 1631 "smallvec", 1564 1632 "tagptr", 1565 - "thiserror 1.0.69", 1566 1633 "uuid", 1567 1634 ] 1568 1635 1569 1636 [[package]] 1570 1637 name = "multibase" 1571 - version = "0.9.1" 1638 + version = "0.9.2" 1572 1639 source = "registry+https://github.com/rust-lang/crates.io-index" 1573 - checksum = "9b3539ec3c1f04ac9748a260728e855f261b4977f5c3406612c884564f329404" 1640 + checksum = "8694bb4835f452b0e3bb06dbebb1d6fc5385b6ca1caf2e55fd165c042390ec77" 1574 1641 dependencies = [ 1575 1642 "base-x", 1643 + "base256emoji", 1576 1644 "data-encoding", 1577 1645 "data-encoding-macro", 1578 1646 ] ··· 1607 1675 1608 1676 [[package]] 1609 1677 name = "nu-ansi-term" 1610 - version = "0.50.1" 1678 + version = "0.50.3" 1611 1679 source = "registry+https://github.com/rust-lang/crates.io-index" 1612 - checksum = "d4a28e057d01f97e61255210fcff094d74ed0466038633e95017f5beb68e4399" 1680 + checksum = "7957b9740744892f114936ab4a57b3f487491bbeafaf8083688b16841a4240e5" 1613 1681 dependencies = [ 1614 - "windows-sys 0.52.0", 1682 + "windows-sys 0.61.2", 1615 1683 ] 1616 1684 1617 1685 [[package]] ··· 1626 1694 1627 1695 [[package]] 1628 1696 name = "num-bigint-dig" 1629 - version = "0.8.4" 1697 + version = "0.8.5" 1630 1698 source = "registry+https://github.com/rust-lang/crates.io-index" 1631 - checksum = "dc84195820f291c7697304f3cbdadd1cb7199c0efc917ff5eafd71225c136151" 1699 + checksum = "82c79c15c05d4bf82b6f5ef163104cc81a760d8e874d38ac50ab67c8877b647b" 1632 1700 dependencies = [ 1633 - "byteorder", 1634 1701 "lazy_static", 1635 1702 "libm", 1636 1703 "num-integer", ··· 1682 1749 ] 1683 1750 1684 1751 [[package]] 1685 - name = "object" 1686 - version = "0.36.7" 1687 - source = "registry+https://github.com/rust-lang/crates.io-index" 1688 - checksum = "62948e14d923ea95ea2c7c86c71013138b66525b86bdc08d2dcc262bdb497b87" 1689 - dependencies = [ 1690 - "memchr", 1691 - ] 1692 - 1693 - [[package]] 1694 1752 name = "once_cell" 1695 1753 version = "1.21.3" 1696 1754 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 1702 1760 1703 1761 [[package]] 1704 1762 name = "openssl" 1705 - version = "0.10.73" 1763 + version = "0.10.74" 1706 1764 source = "registry+https://github.com/rust-lang/crates.io-index" 1707 - checksum = "8505734d46c8ab1e19a1dce3aef597ad87dcb4c37e7188231769bd6bd51cebf8" 1765 + checksum = "24ad14dd45412269e1a30f52ad8f0664f0f4f4a89ee8fe28c3b3527021ebb654" 1708 1766 dependencies = [ 1709 1767 "bitflags", 1710 1768 "cfg-if", ··· 1723 1781 dependencies = [ 1724 1782 "proc-macro2", 1725 1783 "quote", 1726 - "syn", 1784 + "syn 2.0.108", 1727 1785 ] 1728 1786 1729 1787 [[package]] ··· 1734 1792 1735 1793 [[package]] 1736 1794 name = "openssl-sys" 1737 - version = "0.9.109" 1795 + version = "0.9.110" 1738 1796 source = "registry+https://github.com/rust-lang/crates.io-index" 1739 - checksum = "90096e2e47630d78b7d1c20952dc621f957103f8bc2c8359ec81290d75238571" 1797 + checksum = "0a9f0075ba3c21b09f8e8b2026584b1d18d49388648f2fbbf3c97ea8deced8e2" 1740 1798 dependencies = [ 1741 1799 "cc", 1742 1800 "libc", ··· 1753 1811 "ecdsa", 1754 1812 "elliptic-curve", 1755 1813 "primeorder", 1814 + "serdect", 1756 1815 "sha2", 1757 1816 ] 1758 1817 ··· 1765 1824 "ecdsa", 1766 1825 "elliptic-curve", 1767 1826 "primeorder", 1827 + "serdect", 1768 1828 "sha2", 1769 1829 ] 1770 1830 ··· 1776 1836 1777 1837 [[package]] 1778 1838 name = "parking_lot" 1779 - version = "0.12.4" 1839 + version = "0.12.5" 1780 1840 source = "registry+https://github.com/rust-lang/crates.io-index" 1781 - checksum = "70d58bf43669b5795d1576d0641cfb6fbb2057bf629506267a92807158584a13" 1841 + checksum = "93857453250e3077bd71ff98b6a65ea6621a19bb0f559a85248955ac12c45a1a" 1782 1842 dependencies = [ 1783 1843 "lock_api", 1784 1844 "parking_lot_core", ··· 1786 1846 1787 1847 [[package]] 1788 1848 name = "parking_lot_core" 1789 - version = "0.9.11" 1849 + version = "0.9.12" 1790 1850 source = "registry+https://github.com/rust-lang/crates.io-index" 1791 - checksum = "bc838d2a56b5b1a6c25f55575dfc605fabb63bb2365f6c2353ef9159aa69e4a5" 1851 + checksum = "2621685985a2ebf1c516881c026032ac7deafcda1a2c9b7850dc81e3dfcb64c1" 1792 1852 dependencies = [ 1793 1853 "cfg-if", 1794 1854 "libc", 1795 1855 "redox_syscall", 1796 1856 "smallvec", 1797 - "windows-targets 0.52.6", 1857 + "windows-link 0.2.1", 1798 1858 ] 1799 1859 1800 1860 [[package]] ··· 1859 1919 1860 1920 [[package]] 1861 1921 name = "potential_utf" 1862 - version = "0.1.3" 1922 + version = "0.1.4" 1863 1923 source = "registry+https://github.com/rust-lang/crates.io-index" 1864 - checksum = "84df19adbe5b5a0782edcab45899906947ab039ccf4573713735ee7de1e6b08a" 1924 + checksum = "b73949432f5e2a09657003c25bca5e19a0e9c84f8058ca374f49e0ebe605af77" 1865 1925 dependencies = [ 1866 1926 "zerovec", 1867 1927 ] ··· 1882 1942 checksum = "353e1ca18966c16d9deb1c69278edbc5f194139612772bd9537af60ac231e1e6" 1883 1943 dependencies = [ 1884 1944 "elliptic-curve", 1945 + "serdect", 1885 1946 ] 1886 1947 1887 1948 [[package]] 1888 1949 name = "proc-macro2" 1889 - version = "1.0.101" 1950 + version = "1.0.103" 1890 1951 source = "registry+https://github.com/rust-lang/crates.io-index" 1891 - checksum = "89ae43fd86e4158d6db51ad8e2b80f313af9cc74f5c0e03ccb87de09998732de" 1952 + checksum = "5ee95bc4ef87b8d5ba32e8b7714ccc834865276eab0aed5c9958d00ec45f49e8" 1892 1953 dependencies = [ 1893 1954 "unicode-ident", 1894 1955 ] 1895 1956 1896 1957 [[package]] 1897 1958 name = "quickdid" 1898 - version = "1.0.0-rc.3" 1959 + version = "1.0.0-rc.5" 1899 1960 dependencies = [ 1900 1961 "anyhow", 1901 1962 "async-trait", 1902 1963 "atproto-identity", 1964 + "atproto-jetstream", 1965 + "atproto-lexicon", 1903 1966 "axum", 1904 1967 "bincode", 1968 + "cadence", 1905 1969 "deadpool-redis", 1970 + "httpdate", 1906 1971 "metrohash", 1972 + "once_cell", 1907 1973 "reqwest", 1908 1974 "serde", 1909 1975 "serde_json", 1910 1976 "sqlx", 1911 - "thiserror 2.0.16", 1977 + "thiserror 2.0.17", 1912 1978 "tokio", 1913 1979 "tokio-util", 1980 + "tower-http", 1914 1981 "tracing", 1915 1982 "tracing-subscriber", 1916 1983 ] ··· 1928 1995 "quinn-udp", 1929 1996 "rustc-hash", 1930 1997 "rustls", 1931 - "socket2 0.6.0", 1932 - "thiserror 2.0.16", 1998 + "socket2 0.6.1", 1999 + "thiserror 2.0.17", 1933 2000 "tokio", 1934 2001 "tracing", 1935 2002 "web-time", ··· 1942 2009 checksum = "f1906b49b0c3bc04b5fe5d86a77925ae6524a19b816ae38ce1e426255f1d8a31" 1943 2010 dependencies = [ 1944 2011 "bytes", 1945 - "getrandom 0.3.3", 2012 + "getrandom 0.3.4", 1946 2013 "lru-slab", 1947 2014 "rand 0.9.2", 1948 2015 "ring", ··· 1950 2017 "rustls", 1951 2018 "rustls-pki-types", 1952 2019 "slab", 1953 - "thiserror 2.0.16", 2020 + "thiserror 2.0.17", 1954 2021 "tinyvec", 1955 2022 "tracing", 1956 2023 "web-time", ··· 1965 2032 "cfg_aliases", 1966 2033 "libc", 1967 2034 "once_cell", 1968 - "socket2 0.6.0", 2035 + "socket2 0.6.1", 1969 2036 "tracing", 1970 2037 "windows-sys 0.60.2", 1971 2038 ] 1972 2039 1973 2040 [[package]] 1974 2041 name = "quote" 1975 - version = "1.0.40" 2042 + version = "1.0.41" 1976 2043 source = "registry+https://github.com/rust-lang/crates.io-index" 1977 - checksum = "1885c039570dc00dcb4ff087a89e185fd56bae234ddc7f056a945bf36467248d" 2044 + checksum = "ce25767e7b499d1b604768e7cde645d14cc8584231ea6b295e9c9eb22c02e1d1" 1978 2045 dependencies = [ 1979 2046 "proc-macro2", 1980 2047 ] ··· 2041 2108 source = "registry+https://github.com/rust-lang/crates.io-index" 2042 2109 checksum = "99d9a13982dcf210057a8a78572b2217b667c3beacbf3a0d8b454f6f82837d38" 2043 2110 dependencies = [ 2044 - "getrandom 0.3.3", 2111 + "getrandom 0.3.4", 2045 2112 ] 2046 2113 2047 2114 [[package]] 2048 2115 name = "redis" 2049 - version = "0.32.5" 2116 + version = "0.32.7" 2050 2117 source = "registry+https://github.com/rust-lang/crates.io-index" 2051 - checksum = "7cd3650deebc68526b304898b192fa4102a4ef0b9ada24da096559cb60e0eef8" 2118 + checksum = "014cc767fefab6a3e798ca45112bccad9c6e0e218fbd49720042716c73cfef44" 2052 2119 dependencies = [ 2053 2120 "arc-swap", 2054 2121 "backon", ··· 2064 2131 "rustls", 2065 2132 "rustls-native-certs", 2066 2133 "ryu", 2067 - "socket2 0.6.0", 2134 + "socket2 0.6.1", 2068 2135 "tokio", 2069 2136 "tokio-rustls", 2070 2137 "tokio-util", ··· 2073 2140 2074 2141 [[package]] 2075 2142 name = "redox_syscall" 2076 - version = "0.5.17" 2143 + version = "0.5.18" 2077 2144 source = "registry+https://github.com/rust-lang/crates.io-index" 2078 - checksum = "5407465600fb0548f1442edf71dd20683c6ed326200ace4b1ef0763521bb3b77" 2145 + checksum = "ed2bf2547551a7053d6fdfafda3f938979645c44812fbfcda098faae3f1a362d" 2079 2146 dependencies = [ 2080 2147 "bitflags", 2081 2148 ] 2082 2149 2083 2150 [[package]] 2084 2151 name = "regex-automata" 2085 - version = "0.4.10" 2152 + version = "0.4.13" 2086 2153 source = "registry+https://github.com/rust-lang/crates.io-index" 2087 - checksum = "6b9458fa0bfeeac22b5ca447c63aaf45f28439a709ccd244698632f9aa6394d6" 2154 + checksum = "5276caf25ac86c8d810222b3dbb938e512c55c6831a10f3e6ed1c93b84041f1c" 2088 2155 dependencies = [ 2089 2156 "aho-corasick", 2090 2157 "memchr", ··· 2093 2160 2094 2161 [[package]] 2095 2162 name = "regex-syntax" 2096 - version = "0.8.6" 2163 + version = "0.8.8" 2097 2164 source = "registry+https://github.com/rust-lang/crates.io-index" 2098 - checksum = "caf4aa5b0f434c91fe5c7f1ecb6a5ece2130b02ad2a590589dda5146df959001" 2165 + checksum = "7a2d987857b319362043e95f5353c0535c1f58eec5336fdfcf626430af7def58" 2099 2166 2100 2167 [[package]] 2101 2168 name = "reqwest" 2102 - version = "0.12.23" 2169 + version = "0.12.24" 2103 2170 source = "registry+https://github.com/rust-lang/crates.io-index" 2104 - checksum = "d429f34c8092b2d42c7c93cec323bb4adeb7c67698f70839adec842ec10c7ceb" 2171 + checksum = "9d0946410b9f7b082a427e4ef5c8ff541a88b357bc6c637c40db3a68ac70a36f" 2105 2172 dependencies = [ 2106 2173 "base64", 2107 2174 "bytes", 2108 2175 "encoding_rs", 2109 2176 "futures-core", 2177 + "futures-util", 2110 2178 "h2", 2111 2179 "http", 2112 2180 "http-body", ··· 2118 2186 "js-sys", 2119 2187 "log", 2120 2188 "mime", 2189 + "mime_guess", 2121 2190 "native-tls", 2122 2191 "percent-encoding", 2123 2192 "pin-project-lite", ··· 2142 2211 ] 2143 2212 2144 2213 [[package]] 2214 + name = "reqwest-chain" 2215 + version = "1.0.0" 2216 + source = "registry+https://github.com/rust-lang/crates.io-index" 2217 + checksum = "da5c014fb79a8227db44a0433d748107750d2550b7fca55c59a3d7ee7d2ee2b2" 2218 + dependencies = [ 2219 + "anyhow", 2220 + "async-trait", 2221 + "http", 2222 + "reqwest-middleware", 2223 + ] 2224 + 2225 + [[package]] 2226 + name = "reqwest-middleware" 2227 + version = "0.4.2" 2228 + source = "registry+https://github.com/rust-lang/crates.io-index" 2229 + checksum = "57f17d28a6e6acfe1733fe24bcd30774d13bffa4b8a22535b4c8c98423088d4e" 2230 + dependencies = [ 2231 + "anyhow", 2232 + "async-trait", 2233 + "http", 2234 + "reqwest", 2235 + "serde", 2236 + "thiserror 1.0.69", 2237 + "tower-service", 2238 + ] 2239 + 2240 + [[package]] 2145 2241 name = "resolv-conf" 2146 - version = "0.7.4" 2242 + version = "0.7.5" 2147 2243 source = "registry+https://github.com/rust-lang/crates.io-index" 2148 - checksum = "95325155c684b1c89f7765e30bc1c42e4a6da51ca513615660cb8a62ef9a88e3" 2244 + checksum = "6b3789b30bd25ba102de4beabd95d21ac45b69b1be7d14522bab988c526d6799" 2149 2245 2150 2246 [[package]] 2151 2247 name = "rfc6979" ··· 2192 2288 ] 2193 2289 2194 2290 [[package]] 2195 - name = "rustc-demangle" 2196 - version = "0.1.26" 2197 - source = "registry+https://github.com/rust-lang/crates.io-index" 2198 - checksum = "56f7d92ca342cea22a06f2121d944b4fd82af56988c270852495420f961d4ace" 2199 - 2200 - [[package]] 2201 2291 name = "rustc-hash" 2202 2292 version = "2.1.1" 2203 2293 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 2214 2304 2215 2305 [[package]] 2216 2306 name = "rustix" 2217 - version = "1.0.8" 2307 + version = "1.1.2" 2218 2308 source = "registry+https://github.com/rust-lang/crates.io-index" 2219 - checksum = "11181fbabf243db407ef8df94a6ce0b2f9a733bd8be4ad02b4eda9602296cac8" 2309 + checksum = "cd15f8a2c5551a84d56efdc1cd049089e409ac19a3072d5037a17fd70719ff3e" 2220 2310 dependencies = [ 2221 2311 "bitflags", 2222 2312 "errno", 2223 2313 "libc", 2224 2314 "linux-raw-sys", 2225 - "windows-sys 0.60.2", 2315 + "windows-sys 0.61.2", 2226 2316 ] 2227 2317 2228 2318 [[package]] 2229 2319 name = "rustls" 2230 - version = "0.23.31" 2320 + version = "0.23.34" 2231 2321 source = "registry+https://github.com/rust-lang/crates.io-index" 2232 - checksum = "c0ebcbd2f03de0fc1122ad9bb24b127a5a6cd51d72604a3f3c50ac459762b6cc" 2322 + checksum = "6a9586e9ee2b4f8fab52a0048ca7334d7024eef48e2cb9407e3497bb7cab7fa7" 2233 2323 dependencies = [ 2234 2324 "once_cell", 2235 2325 "ring", ··· 2241 2331 2242 2332 [[package]] 2243 2333 name = "rustls-native-certs" 2244 - version = "0.8.1" 2334 + version = "0.8.2" 2245 2335 source = "registry+https://github.com/rust-lang/crates.io-index" 2246 - checksum = "7fcff2dd52b58a8d98a70243663a0d234c4e2b79235637849d15913394a247d3" 2336 + checksum = "9980d917ebb0c0536119ba501e90834767bffc3d60641457fd84a1f3fd337923" 2247 2337 dependencies = [ 2248 2338 "openssl-probe", 2249 2339 "rustls-pki-types", 2250 2340 "schannel", 2251 - "security-framework 3.3.0", 2341 + "security-framework 3.5.1", 2252 2342 ] 2253 2343 2254 2344 [[package]] 2255 2345 name = "rustls-pki-types" 2256 - version = "1.12.0" 2346 + version = "1.13.0" 2257 2347 source = "registry+https://github.com/rust-lang/crates.io-index" 2258 - checksum = "229a4a4c221013e7e1f1a043678c5cc39fe5171437c88fb47151a21e6f5b5c79" 2348 + checksum = "94182ad936a0c91c324cd46c6511b9510ed16af436d7b5bab34beab0afd55f7a" 2259 2349 dependencies = [ 2260 2350 "web-time", 2261 2351 "zeroize", ··· 2263 2353 2264 2354 [[package]] 2265 2355 name = "rustls-webpki" 2266 - version = "0.103.4" 2356 + version = "0.103.8" 2267 2357 source = "registry+https://github.com/rust-lang/crates.io-index" 2268 - checksum = "0a17884ae0c1b773f1ccd2bd4a8c72f16da897310a98b0e84bf349ad5ead92fc" 2358 + checksum = "2ffdfa2f5286e2247234e03f680868ac2815974dc39e00ea15adc445d0aafe52" 2269 2359 dependencies = [ 2270 2360 "ring", 2271 2361 "rustls-pki-types", ··· 2286 2376 2287 2377 [[package]] 2288 2378 name = "schannel" 2289 - version = "0.1.27" 2379 + version = "0.1.28" 2290 2380 source = "registry+https://github.com/rust-lang/crates.io-index" 2291 - checksum = "1f29ebaa345f945cec9fbbc532eb307f0fdad8161f281b6369539c8d84876b3d" 2381 + checksum = "891d81b926048e76efe18581bf793546b4c0eaf8448d72be8de2bbee5fd166e1" 2292 2382 dependencies = [ 2293 - "windows-sys 0.59.0", 2383 + "windows-sys 0.61.2", 2294 2384 ] 2295 2385 2296 2386 [[package]] 2297 - name = "scoped-tls" 2298 - version = "1.0.1" 2299 - source = "registry+https://github.com/rust-lang/crates.io-index" 2300 - checksum = "e1cf6437eb19a8f4a6cc0f7dca544973b0b78843adbfeb3683d1a94a0024a294" 2301 - 2302 - [[package]] 2303 2387 name = "scopeguard" 2304 2388 version = "1.2.0" 2305 2389 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 2335 2419 2336 2420 [[package]] 2337 2421 name = "security-framework" 2338 - version = "3.3.0" 2422 + version = "3.5.1" 2339 2423 source = "registry+https://github.com/rust-lang/crates.io-index" 2340 - checksum = "80fb1d92c5028aa318b4b8bd7302a5bfcf48be96a37fc6fc790f806b0004ee0c" 2424 + checksum = "b3297343eaf830f66ede390ea39da1d462b6b0c1b000f420d0a83f898bbbe6ef" 2341 2425 dependencies = [ 2342 2426 "bitflags", 2343 2427 "core-foundation 0.10.1", ··· 2348 2432 2349 2433 [[package]] 2350 2434 name = "security-framework-sys" 2351 - version = "2.14.0" 2435 + version = "2.15.0" 2352 2436 source = "registry+https://github.com/rust-lang/crates.io-index" 2353 - checksum = "49db231d56a190491cb4aeda9527f1ad45345af50b0851622a7adb8c03b01c32" 2437 + checksum = "cc1f0cbffaac4852523ce30d8bd3c5cdc873501d96ff467ca09b6767bb8cd5c0" 2354 2438 dependencies = [ 2355 2439 "core-foundation-sys", 2356 2440 "libc", ··· 2358 2442 2359 2443 [[package]] 2360 2444 name = "semver" 2361 - version = "1.0.26" 2445 + version = "1.0.27" 2362 2446 source = "registry+https://github.com/rust-lang/crates.io-index" 2363 - checksum = "56e6fa9c48d24d85fb3de5ad847117517440f6beceb7798af16b4a87d616b8d0" 2447 + checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2" 2364 2448 2365 2449 [[package]] 2366 2450 name = "serde" 2367 - version = "1.0.219" 2451 + version = "1.0.228" 2368 2452 source = "registry+https://github.com/rust-lang/crates.io-index" 2369 - checksum = "5f0e2c6ed6606019b4e29e69dbaba95b11854410e5347d525002456dbbb786b6" 2453 + checksum = "9a8e94ea7f378bd32cbbd37198a4a91436180c5bb472411e48b5ec2e2124ae9e" 2370 2454 dependencies = [ 2455 + "serde_core", 2371 2456 "serde_derive", 2372 2457 ] 2373 2458 2374 2459 [[package]] 2375 2460 name = "serde_bytes" 2376 - version = "0.11.17" 2461 + version = "0.11.19" 2377 2462 source = "registry+https://github.com/rust-lang/crates.io-index" 2378 - checksum = "8437fd221bde2d4ca316d61b90e337e9e702b3820b87d63caa9ba6c02bd06d96" 2463 + checksum = "a5d440709e79d88e51ac01c4b72fc6cb7314017bb7da9eeff678aa94c10e3ea8" 2379 2464 dependencies = [ 2380 2465 "serde", 2466 + "serde_core", 2467 + ] 2468 + 2469 + [[package]] 2470 + name = "serde_core" 2471 + version = "1.0.228" 2472 + source = "registry+https://github.com/rust-lang/crates.io-index" 2473 + checksum = "41d385c7d4ca58e59fc732af25c3983b67ac852c1a25000afe1175de458b67ad" 2474 + dependencies = [ 2475 + "serde_derive", 2381 2476 ] 2382 2477 2383 2478 [[package]] 2384 2479 name = "serde_derive" 2385 - version = "1.0.219" 2480 + version = "1.0.228" 2386 2481 source = "registry+https://github.com/rust-lang/crates.io-index" 2387 - checksum = "5b0276cf7f2c73365f7157c8123c21cd9a50fbbd844757af28ca1f5925fc2a00" 2482 + checksum = "d540f220d3187173da220f885ab66608367b6574e925011a9353e4badda91d79" 2388 2483 dependencies = [ 2389 2484 "proc-macro2", 2390 2485 "quote", 2391 - "syn", 2486 + "syn 2.0.108", 2392 2487 ] 2393 2488 2394 2489 [[package]] 2395 2490 name = "serde_ipld_dagcbor" 2396 - version = "0.6.3" 2491 + version = "0.6.4" 2397 2492 source = "registry+https://github.com/rust-lang/crates.io-index" 2398 - checksum = "99600723cf53fb000a66175555098db7e75217c415bdd9a16a65d52a19dcc4fc" 2493 + checksum = "46182f4f08349a02b45c998ba3215d3f9de826246ba02bb9dddfe9a2a2100778" 2399 2494 dependencies = [ 2400 2495 "cbor4ii", 2401 2496 "ipld-core", ··· 2405 2500 2406 2501 [[package]] 2407 2502 name = "serde_json" 2408 - version = "1.0.143" 2503 + version = "1.0.145" 2409 2504 source = "registry+https://github.com/rust-lang/crates.io-index" 2410 - checksum = "d401abef1d108fbd9cbaebc3e46611f4b1021f714a0597a71f41ee463f5f4a5a" 2505 + checksum = "402a6f66d8c709116cf22f558eab210f5a50187f702eb4d7e5ef38d9a7f1c79c" 2411 2506 dependencies = [ 2412 2507 "itoa", 2413 2508 "memchr", 2414 2509 "ryu", 2415 2510 "serde", 2511 + "serde_core", 2416 2512 ] 2417 2513 2418 2514 [[package]] 2419 2515 name = "serde_path_to_error" 2420 - version = "0.1.17" 2516 + version = "0.1.20" 2421 2517 source = "registry+https://github.com/rust-lang/crates.io-index" 2422 - checksum = "59fab13f937fa393d08645bf3a84bdfe86e296747b506ada67bb15f10f218b2a" 2518 + checksum = "10a9ff822e371bb5403e391ecd83e182e0e77ba7f6fe0160b795797109d1b457" 2423 2519 dependencies = [ 2424 2520 "itoa", 2425 2521 "serde", 2522 + "serde_core", 2426 2523 ] 2427 2524 2428 2525 [[package]] ··· 2504 2601 ] 2505 2602 2506 2603 [[package]] 2604 + name = "simdutf8" 2605 + version = "0.1.5" 2606 + source = "registry+https://github.com/rust-lang/crates.io-index" 2607 + checksum = "e3a9fe34e3e7a50316060351f37187a3f546bce95496156754b601a5fa71b76e" 2608 + 2609 + [[package]] 2507 2610 name = "slab" 2508 2611 version = "0.4.11" 2509 2612 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 2530 2633 2531 2634 [[package]] 2532 2635 name = "socket2" 2533 - version = "0.6.0" 2636 + version = "0.6.1" 2534 2637 source = "registry+https://github.com/rust-lang/crates.io-index" 2535 - checksum = "233504af464074f9d066d7b5416c5f9b894a5862a6506e306f7b816cdd6f1807" 2638 + checksum = "17129e116933cf371d018bb80ae557e889637989d8638274fb25622827b03881" 2536 2639 dependencies = [ 2537 2640 "libc", 2538 - "windows-sys 0.59.0", 2641 + "windows-sys 0.60.2", 2539 2642 ] 2540 2643 2541 2644 [[package]] ··· 2578 2681 dependencies = [ 2579 2682 "base64", 2580 2683 "bytes", 2581 - "chrono", 2582 2684 "crc", 2583 2685 "crossbeam-queue", 2584 2686 "either", ··· 2587 2689 "futures-intrusive", 2588 2690 "futures-io", 2589 2691 "futures-util", 2590 - "hashbrown", 2692 + "hashbrown 0.15.5", 2591 2693 "hashlink", 2592 2694 "indexmap", 2593 2695 "log", ··· 2598 2700 "serde_json", 2599 2701 "sha2", 2600 2702 "smallvec", 2601 - "thiserror 2.0.16", 2703 + "thiserror 2.0.17", 2602 2704 "tokio", 2603 2705 "tokio-stream", 2604 2706 "tracing", ··· 2615 2717 "quote", 2616 2718 "sqlx-core", 2617 2719 "sqlx-macros-core", 2618 - "syn", 2720 + "syn 2.0.108", 2619 2721 ] 2620 2722 2621 2723 [[package]] ··· 2638 2740 "sqlx-mysql", 2639 2741 "sqlx-postgres", 2640 2742 "sqlx-sqlite", 2641 - "syn", 2743 + "syn 2.0.108", 2642 2744 "tokio", 2643 2745 "url", 2644 2746 ] ··· 2654 2756 "bitflags", 2655 2757 "byteorder", 2656 2758 "bytes", 2657 - "chrono", 2658 2759 "crc", 2659 2760 "digest", 2660 2761 "dotenvy", ··· 2681 2782 "smallvec", 2682 2783 "sqlx-core", 2683 2784 "stringprep", 2684 - "thiserror 2.0.16", 2785 + "thiserror 2.0.17", 2685 2786 "tracing", 2686 2787 "whoami", 2687 2788 ] ··· 2696 2797 "base64", 2697 2798 "bitflags", 2698 2799 "byteorder", 2699 - "chrono", 2700 2800 "crc", 2701 2801 "dotenvy", 2702 2802 "etcetera", ··· 2719 2819 "smallvec", 2720 2820 "sqlx-core", 2721 2821 "stringprep", 2722 - "thiserror 2.0.16", 2822 + "thiserror 2.0.17", 2723 2823 "tracing", 2724 2824 "whoami", 2725 2825 ] ··· 2731 2831 checksum = "c2d12fe70b2c1b4401038055f90f151b78208de1f9f89a7dbfd41587a10c3eea" 2732 2832 dependencies = [ 2733 2833 "atoi", 2734 - "chrono", 2735 2834 "flume", 2736 2835 "futures-channel", 2737 2836 "futures-core", ··· 2744 2843 "serde", 2745 2844 "serde_urlencoded", 2746 2845 "sqlx-core", 2747 - "thiserror 2.0.16", 2846 + "thiserror 2.0.17", 2748 2847 "tracing", 2749 2848 "url", 2750 2849 ] 2751 2850 2752 2851 [[package]] 2753 2852 name = "stable_deref_trait" 2754 - version = "1.2.0" 2853 + version = "1.2.1" 2755 2854 source = "registry+https://github.com/rust-lang/crates.io-index" 2756 - checksum = "a8f112729512f8e442d81f95a8a7ddf2b7c6b8a1a6f509a95864142b30cab2d3" 2855 + checksum = "6ce2be8dc25455e1f91df71bfa12ad37d7af1092ae736f3a6cd0e37bc7810596" 2757 2856 2758 2857 [[package]] 2759 2858 name = "stringprep" ··· 2774 2873 2775 2874 [[package]] 2776 2875 name = "syn" 2777 - version = "2.0.106" 2876 + version = "1.0.109" 2778 2877 source = "registry+https://github.com/rust-lang/crates.io-index" 2779 - checksum = "ede7c438028d4436d71104916910f5bb611972c5cfd7f89b8300a8186e6fada6" 2878 + checksum = "72b64191b275b66ffe2469e8af2c1cfe3bafa67b529ead792a6d0160888b4237" 2879 + dependencies = [ 2880 + "proc-macro2", 2881 + "quote", 2882 + "unicode-ident", 2883 + ] 2884 + 2885 + [[package]] 2886 + name = "syn" 2887 + version = "2.0.108" 2888 + source = "registry+https://github.com/rust-lang/crates.io-index" 2889 + checksum = "da58917d35242480a05c2897064da0a80589a2a0476c9a3f2fdc83b53502e917" 2780 2890 dependencies = [ 2781 2891 "proc-macro2", 2782 2892 "quote", ··· 2800 2910 dependencies = [ 2801 2911 "proc-macro2", 2802 2912 "quote", 2803 - "syn", 2913 + "syn 2.0.108", 2804 2914 ] 2805 2915 2806 2916 [[package]] ··· 2832 2942 2833 2943 [[package]] 2834 2944 name = "tempfile" 2835 - version = "3.21.0" 2945 + version = "3.23.0" 2836 2946 source = "registry+https://github.com/rust-lang/crates.io-index" 2837 - checksum = "15b61f8f20e3a6f7e0649d825294eaf317edce30f82cf6026e7e4cb9222a7d1e" 2947 + checksum = "2d31c77bdf42a745371d260a26ca7163f1e0924b64afa0b688e61b5a9fa02f16" 2838 2948 dependencies = [ 2839 2949 "fastrand", 2840 - "getrandom 0.3.3", 2950 + "getrandom 0.3.4", 2841 2951 "once_cell", 2842 2952 "rustix", 2843 - "windows-sys 0.60.2", 2953 + "windows-sys 0.61.2", 2844 2954 ] 2845 2955 2846 2956 [[package]] ··· 2854 2964 2855 2965 [[package]] 2856 2966 name = "thiserror" 2857 - version = "2.0.16" 2967 + version = "2.0.17" 2858 2968 source = "registry+https://github.com/rust-lang/crates.io-index" 2859 - checksum = "3467d614147380f2e4e374161426ff399c91084acd2363eaf549172b3d5e60c0" 2969 + checksum = "f63587ca0f12b72a0600bcba1d40081f830876000bb46dd2337a3051618f4fc8" 2860 2970 dependencies = [ 2861 - "thiserror-impl 2.0.16", 2971 + "thiserror-impl 2.0.17", 2862 2972 ] 2863 2973 2864 2974 [[package]] ··· 2869 2979 dependencies = [ 2870 2980 "proc-macro2", 2871 2981 "quote", 2872 - "syn", 2982 + "syn 2.0.108", 2873 2983 ] 2874 2984 2875 2985 [[package]] 2876 2986 name = "thiserror-impl" 2877 - version = "2.0.16" 2987 + version = "2.0.17" 2878 2988 source = "registry+https://github.com/rust-lang/crates.io-index" 2879 - checksum = "6c5e1be1c48b9172ee610da68fd9cd2770e7a4056cb3fc98710ee6906f0c7960" 2989 + checksum = "3ff15c8ecd7de3849db632e14d18d2571fa09dfc5ed93479bc4485c7a517c913" 2880 2990 dependencies = [ 2881 2991 "proc-macro2", 2882 2992 "quote", 2883 - "syn", 2993 + "syn 2.0.108", 2884 2994 ] 2885 2995 2886 2996 [[package]] ··· 2894 3004 2895 3005 [[package]] 2896 3006 name = "tinystr" 2897 - version = "0.8.1" 3007 + version = "0.8.2" 2898 3008 source = "registry+https://github.com/rust-lang/crates.io-index" 2899 - checksum = "5d4f6d1145dcb577acf783d4e601bc1d76a13337bb54e6233add580b07344c8b" 3009 + checksum = "42d3e9c45c09de15d06dd8acf5f4e0e399e85927b7f00711024eb7ae10fa4869" 2900 3010 dependencies = [ 2901 3011 "displaydoc", 2902 3012 "zerovec", ··· 2919 3029 2920 3030 [[package]] 2921 3031 name = "tokio" 2922 - version = "1.47.1" 3032 + version = "1.48.0" 2923 3033 source = "registry+https://github.com/rust-lang/crates.io-index" 2924 - checksum = "89e49afdadebb872d3145a5638b59eb0691ea23e46ca484037cfab3b76b95038" 3034 + checksum = "ff360e02eab121e0bc37a2d3b4d4dc622e6eda3a8e5253d5435ecf5bd4c68408" 2925 3035 dependencies = [ 2926 - "backtrace", 2927 3036 "bytes", 2928 - "io-uring", 2929 3037 "libc", 2930 3038 "mio", 3039 + "parking_lot", 2931 3040 "pin-project-lite", 2932 3041 "signal-hook-registry", 2933 - "slab", 2934 - "socket2 0.6.0", 3042 + "socket2 0.6.1", 2935 3043 "tokio-macros", 2936 - "windows-sys 0.59.0", 3044 + "windows-sys 0.61.2", 2937 3045 ] 2938 3046 2939 3047 [[package]] 2940 3048 name = "tokio-macros" 2941 - version = "2.5.0" 3049 + version = "2.6.0" 2942 3050 source = "registry+https://github.com/rust-lang/crates.io-index" 2943 - checksum = "6e06d43f1345a3bcd39f6a56dbb7dcab2ba47e68e8ac134855e7e2bdbaf8cab8" 3051 + checksum = "af407857209536a95c8e56f8231ef2c2e2aff839b22e07a1ffcbc617e9db9fa5" 2944 3052 dependencies = [ 2945 3053 "proc-macro2", 2946 3054 "quote", 2947 - "syn", 3055 + "syn 2.0.108", 2948 3056 ] 2949 3057 2950 3058 [[package]] ··· 2959 3067 2960 3068 [[package]] 2961 3069 name = "tokio-rustls" 2962 - version = "0.26.2" 3070 + version = "0.26.4" 2963 3071 source = "registry+https://github.com/rust-lang/crates.io-index" 2964 - checksum = "8e727b36a1a0e8b74c376ac2211e40c2c8af09fb4013c60d910495810f008e9b" 3072 + checksum = "1729aa945f29d91ba541258c8df89027d5792d85a8841fb65e8bf0f4ede4ef61" 2965 3073 dependencies = [ 2966 3074 "rustls", 2967 3075 "tokio", ··· 2980 3088 2981 3089 [[package]] 2982 3090 name = "tokio-util" 2983 - version = "0.7.16" 3091 + version = "0.7.17" 2984 3092 source = "registry+https://github.com/rust-lang/crates.io-index" 2985 - checksum = "14307c986784f72ef81c89db7d9e28d6ac26d16213b109ea501696195e6e3ce5" 3093 + checksum = "2efa149fe76073d6e8fd97ef4f4eca7b67f599660115591483572e406e165594" 2986 3094 dependencies = [ 2987 3095 "bytes", 2988 3096 "futures-core", ··· 2993 3101 ] 2994 3102 2995 3103 [[package]] 3104 + name = "tokio-websockets" 3105 + version = "0.11.4" 3106 + source = "registry+https://github.com/rust-lang/crates.io-index" 3107 + checksum = "9fcaf159b4e7a376b05b5bfd77bfd38f3324f5fce751b4213bfc7eaa47affb4e" 3108 + dependencies = [ 3109 + "base64", 3110 + "bytes", 3111 + "futures-core", 3112 + "futures-sink", 3113 + "http", 3114 + "httparse", 3115 + "rand 0.9.2", 3116 + "ring", 3117 + "rustls-native-certs", 3118 + "rustls-pki-types", 3119 + "simdutf8", 3120 + "tokio", 3121 + "tokio-rustls", 3122 + "tokio-util", 3123 + ] 3124 + 3125 + [[package]] 2996 3126 name = "tower" 2997 3127 version = "0.5.2" 2998 3128 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 3016 3146 dependencies = [ 3017 3147 "bitflags", 3018 3148 "bytes", 3149 + "futures-core", 3019 3150 "futures-util", 3020 3151 "http", 3021 3152 "http-body", 3153 + "http-body-util", 3154 + "http-range-header", 3155 + "httpdate", 3022 3156 "iri-string", 3157 + "mime", 3158 + "mime_guess", 3159 + "percent-encoding", 3023 3160 "pin-project-lite", 3161 + "tokio", 3162 + "tokio-util", 3024 3163 "tower", 3025 3164 "tower-layer", 3026 3165 "tower-service", 3166 + "tracing", 3027 3167 ] 3028 3168 3029 3169 [[package]] ··· 3058 3198 dependencies = [ 3059 3199 "proc-macro2", 3060 3200 "quote", 3061 - "syn", 3201 + "syn 2.0.108", 3062 3202 ] 3063 3203 3064 3204 [[package]] ··· 3108 3248 3109 3249 [[package]] 3110 3250 name = "typenum" 3111 - version = "1.18.0" 3251 + version = "1.19.0" 3252 + source = "registry+https://github.com/rust-lang/crates.io-index" 3253 + checksum = "562d481066bde0658276a35467c4af00bdc6ee726305698a55b86e61d7ad82bb" 3254 + 3255 + [[package]] 3256 + name = "ulid" 3257 + version = "1.2.1" 3258 + source = "registry+https://github.com/rust-lang/crates.io-index" 3259 + checksum = "470dbf6591da1b39d43c14523b2b469c86879a53e8b758c8e090a470fe7b1fbe" 3260 + dependencies = [ 3261 + "rand 0.9.2", 3262 + "web-time", 3263 + ] 3264 + 3265 + [[package]] 3266 + name = "unicase" 3267 + version = "2.8.1" 3112 3268 source = "registry+https://github.com/rust-lang/crates.io-index" 3113 - checksum = "1dccffe3ce07af9386bfd29e80c0ab1a8205a2fc34e4bcd40364df902cfa8f3f" 3269 + checksum = "75b844d17643ee918803943289730bec8aac480150456169e647ed0b576ba539" 3114 3270 3115 3271 [[package]] 3116 3272 name = "unicode-bidi" ··· 3120 3276 3121 3277 [[package]] 3122 3278 name = "unicode-ident" 3123 - version = "1.0.18" 3279 + version = "1.0.22" 3124 3280 source = "registry+https://github.com/rust-lang/crates.io-index" 3125 - checksum = "5a5f39404a5da50712a4c1eecf25e90dd62b613502b7e925fd4e4d19b5c96512" 3281 + checksum = "9312f7c4f6ff9069b165498234ce8be658059c6728633667c526e27dc2cf1df5" 3126 3282 3127 3283 [[package]] 3128 3284 name = "unicode-normalization" 3129 - version = "0.1.24" 3285 + version = "0.1.25" 3130 3286 source = "registry+https://github.com/rust-lang/crates.io-index" 3131 - checksum = "5033c97c4262335cded6d6fc3e5c18ab755e1a3dc96376350f3d8e9f009ad956" 3287 + checksum = "5fd4f6878c9cb28d874b009da9e8d183b5abc80117c40bbd187a1fde336be6e8" 3132 3288 dependencies = [ 3133 3289 "tinyvec", 3134 3290 ] 3135 3291 3136 3292 [[package]] 3137 3293 name = "unicode-properties" 3138 - version = "0.1.3" 3294 + version = "0.1.4" 3139 3295 source = "registry+https://github.com/rust-lang/crates.io-index" 3140 - checksum = "e70f2a8b45122e719eb623c01822704c4e0907e7e426a05927e1a1cfff5b75d0" 3296 + checksum = "7df058c713841ad818f1dc5d3fd88063241cc61f49f5fbea4b951e8cf5a8d71d" 3141 3297 3142 3298 [[package]] 3143 3299 name = "unsigned-varint" ··· 3170 3326 ] 3171 3327 3172 3328 [[package]] 3329 + name = "urlencoding" 3330 + version = "2.1.3" 3331 + source = "registry+https://github.com/rust-lang/crates.io-index" 3332 + checksum = "daf8dba3b7eb870caf1ddeed7bc9d2a049f3cfdfae7cb521b087cc33ae4c49da" 3333 + 3334 + [[package]] 3173 3335 name = "utf8_iter" 3174 3336 version = "1.0.4" 3175 3337 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 3181 3343 source = "registry+https://github.com/rust-lang/crates.io-index" 3182 3344 checksum = "2f87b8aa10b915a06587d0dec516c282ff295b475d94abf425d62b57710070a2" 3183 3345 dependencies = [ 3184 - "getrandom 0.3.3", 3346 + "getrandom 0.3.4", 3185 3347 "js-sys", 3186 3348 "wasm-bindgen", 3187 3349 ] ··· 3226 3388 checksum = "ccf3ec651a847eb01de73ccad15eb7d99f80485de043efb2f370cd654f4ea44b" 3227 3389 3228 3390 [[package]] 3229 - name = "wasi" 3230 - version = "0.14.3+wasi-0.2.4" 3391 + name = "wasip2" 3392 + version = "1.0.1+wasi-0.2.4" 3231 3393 source = "registry+https://github.com/rust-lang/crates.io-index" 3232 - checksum = "6a51ae83037bdd272a9e28ce236db8c07016dd0d50c27038b3f407533c030c95" 3394 + checksum = "0562428422c63773dad2c345a1882263bbf4d65cf3f42e90921f787ef5ad58e7" 3233 3395 dependencies = [ 3234 3396 "wit-bindgen", 3235 3397 ] ··· 3242 3404 3243 3405 [[package]] 3244 3406 name = "wasm-bindgen" 3245 - version = "0.2.101" 3407 + version = "0.2.105" 3246 3408 source = "registry+https://github.com/rust-lang/crates.io-index" 3247 - checksum = "7e14915cadd45b529bb8d1f343c4ed0ac1de926144b746e2710f9cd05df6603b" 3409 + checksum = "da95793dfc411fbbd93f5be7715b0578ec61fe87cb1a42b12eb625caa5c5ea60" 3248 3410 dependencies = [ 3249 3411 "cfg-if", 3250 3412 "once_cell", ··· 3254 3416 ] 3255 3417 3256 3418 [[package]] 3257 - name = "wasm-bindgen-backend" 3258 - version = "0.2.101" 3259 - source = "registry+https://github.com/rust-lang/crates.io-index" 3260 - checksum = "e28d1ba982ca7923fd01448d5c30c6864d0a14109560296a162f80f305fb93bb" 3261 - dependencies = [ 3262 - "bumpalo", 3263 - "log", 3264 - "proc-macro2", 3265 - "quote", 3266 - "syn", 3267 - "wasm-bindgen-shared", 3268 - ] 3269 - 3270 - [[package]] 3271 3419 name = "wasm-bindgen-futures" 3272 - version = "0.4.51" 3420 + version = "0.4.55" 3273 3421 source = "registry+https://github.com/rust-lang/crates.io-index" 3274 - checksum = "0ca85039a9b469b38336411d6d6ced91f3fc87109a2a27b0c197663f5144dffe" 3422 + checksum = "551f88106c6d5e7ccc7cd9a16f312dd3b5d36ea8b4954304657d5dfba115d4a0" 3275 3423 dependencies = [ 3276 3424 "cfg-if", 3277 3425 "js-sys", ··· 3282 3430 3283 3431 [[package]] 3284 3432 name = "wasm-bindgen-macro" 3285 - version = "0.2.101" 3433 + version = "0.2.105" 3286 3434 source = "registry+https://github.com/rust-lang/crates.io-index" 3287 - checksum = "7c3d463ae3eff775b0c45df9da45d68837702ac35af998361e2c84e7c5ec1b0d" 3435 + checksum = "04264334509e04a7bf8690f2384ef5265f05143a4bff3889ab7a3269adab59c2" 3288 3436 dependencies = [ 3289 3437 "quote", 3290 3438 "wasm-bindgen-macro-support", ··· 3292 3440 3293 3441 [[package]] 3294 3442 name = "wasm-bindgen-macro-support" 3295 - version = "0.2.101" 3443 + version = "0.2.105" 3296 3444 source = "registry+https://github.com/rust-lang/crates.io-index" 3297 - checksum = "7bb4ce89b08211f923caf51d527662b75bdc9c9c7aab40f86dcb9fb85ac552aa" 3445 + checksum = "420bc339d9f322e562942d52e115d57e950d12d88983a14c79b86859ee6c7ebc" 3298 3446 dependencies = [ 3447 + "bumpalo", 3299 3448 "proc-macro2", 3300 3449 "quote", 3301 - "syn", 3302 - "wasm-bindgen-backend", 3450 + "syn 2.0.108", 3303 3451 "wasm-bindgen-shared", 3304 3452 ] 3305 3453 3306 3454 [[package]] 3307 3455 name = "wasm-bindgen-shared" 3308 - version = "0.2.101" 3456 + version = "0.2.105" 3309 3457 source = "registry+https://github.com/rust-lang/crates.io-index" 3310 - checksum = "f143854a3b13752c6950862c906306adb27c7e839f7414cec8fea35beab624c1" 3458 + checksum = "76f218a38c84bcb33c25ec7059b07847d465ce0e0a76b995e134a45adcb6af76" 3311 3459 dependencies = [ 3312 3460 "unicode-ident", 3313 3461 ] 3314 3462 3315 3463 [[package]] 3316 3464 name = "web-sys" 3317 - version = "0.3.78" 3465 + version = "0.3.82" 3318 3466 source = "registry+https://github.com/rust-lang/crates.io-index" 3319 - checksum = "77e4b637749ff0d92b8fad63aa1f7cff3cbe125fd49c175cd6345e7272638b12" 3467 + checksum = "3a1f95c0d03a47f4ae1f7a64643a6bb97465d9b740f0fa8f90ea33915c99a9a1" 3320 3468 dependencies = [ 3321 3469 "js-sys", 3322 3470 "wasm-bindgen", ··· 3334 3482 3335 3483 [[package]] 3336 3484 name = "webpki-roots" 3337 - version = "1.0.2" 3485 + version = "1.0.4" 3338 3486 source = "registry+https://github.com/rust-lang/crates.io-index" 3339 - checksum = "7e8983c3ab33d6fb807cfcdad2491c4ea8cbc8ed839181c7dfd9c67c83e261b2" 3487 + checksum = "b2878ef029c47c6e8cf779119f20fcf52bde7ad42a731b2a304bc221df17571e" 3340 3488 dependencies = [ 3341 3489 "rustls-pki-types", 3342 3490 ] ··· 3353 3501 3354 3502 [[package]] 3355 3503 name = "widestring" 3356 - version = "1.2.0" 3357 - source = "registry+https://github.com/rust-lang/crates.io-index" 3358 - checksum = "dd7cf3379ca1aac9eea11fba24fd7e315d621f8dfe35c8d7d2be8b793726e07d" 3359 - 3360 - [[package]] 3361 - name = "windows" 3362 - version = "0.61.3" 3363 - source = "registry+https://github.com/rust-lang/crates.io-index" 3364 - checksum = "9babd3a767a4c1aef6900409f85f5d53ce2544ccdfaa86dad48c91782c6d6893" 3365 - dependencies = [ 3366 - "windows-collections", 3367 - "windows-core", 3368 - "windows-future", 3369 - "windows-link", 3370 - "windows-numerics", 3371 - ] 3372 - 3373 - [[package]] 3374 - name = "windows-collections" 3375 - version = "0.2.0" 3376 - source = "registry+https://github.com/rust-lang/crates.io-index" 3377 - checksum = "3beeceb5e5cfd9eb1d76b381630e82c4241ccd0d27f1a39ed41b2760b255c5e8" 3378 - dependencies = [ 3379 - "windows-core", 3380 - ] 3381 - 3382 - [[package]] 3383 - name = "windows-core" 3384 - version = "0.61.2" 3385 - source = "registry+https://github.com/rust-lang/crates.io-index" 3386 - checksum = "c0fdd3ddb90610c7638aa2b3a3ab2904fb9e5cdbecc643ddb3647212781c4ae3" 3387 - dependencies = [ 3388 - "windows-implement", 3389 - "windows-interface", 3390 - "windows-link", 3391 - "windows-result", 3392 - "windows-strings", 3393 - ] 3394 - 3395 - [[package]] 3396 - name = "windows-future" 3397 - version = "0.2.1" 3504 + version = "1.2.1" 3398 3505 source = "registry+https://github.com/rust-lang/crates.io-index" 3399 - checksum = "fc6a41e98427b19fe4b73c550f060b59fa592d7d686537eebf9385621bfbad8e" 3400 - dependencies = [ 3401 - "windows-core", 3402 - "windows-link", 3403 - "windows-threading", 3404 - ] 3405 - 3406 - [[package]] 3407 - name = "windows-implement" 3408 - version = "0.60.0" 3409 - source = "registry+https://github.com/rust-lang/crates.io-index" 3410 - checksum = "a47fddd13af08290e67f4acabf4b459f647552718f683a7b415d290ac744a836" 3411 - dependencies = [ 3412 - "proc-macro2", 3413 - "quote", 3414 - "syn", 3415 - ] 3416 - 3417 - [[package]] 3418 - name = "windows-interface" 3419 - version = "0.59.1" 3420 - source = "registry+https://github.com/rust-lang/crates.io-index" 3421 - checksum = "bd9211b69f8dcdfa817bfd14bf1c97c9188afa36f4750130fcdf3f400eca9fa8" 3422 - dependencies = [ 3423 - "proc-macro2", 3424 - "quote", 3425 - "syn", 3426 - ] 3506 + checksum = "72069c3113ab32ab29e5584db3c6ec55d416895e60715417b5b883a357c3e471" 3427 3507 3428 3508 [[package]] 3429 3509 name = "windows-link" ··· 3432 3512 checksum = "5e6ad25900d524eaabdbbb96d20b4311e1e7ae1699af4fb28c17ae66c80d798a" 3433 3513 3434 3514 [[package]] 3435 - name = "windows-numerics" 3436 - version = "0.2.0" 3515 + name = "windows-link" 3516 + version = "0.2.1" 3437 3517 source = "registry+https://github.com/rust-lang/crates.io-index" 3438 - checksum = "9150af68066c4c5c07ddc0ce30421554771e528bde427614c61038bc2c92c2b1" 3439 - dependencies = [ 3440 - "windows-core", 3441 - "windows-link", 3442 - ] 3518 + checksum = "f0805222e57f7521d6a62e36fa9163bc891acd422f971defe97d64e70d0a4fe5" 3443 3519 3444 3520 [[package]] 3445 3521 name = "windows-registry" ··· 3447 3523 source = "registry+https://github.com/rust-lang/crates.io-index" 3448 3524 checksum = "5b8a9ed28765efc97bbc954883f4e6796c33a06546ebafacbabee9696967499e" 3449 3525 dependencies = [ 3450 - "windows-link", 3526 + "windows-link 0.1.3", 3451 3527 "windows-result", 3452 3528 "windows-strings", 3453 3529 ] ··· 3458 3534 source = "registry+https://github.com/rust-lang/crates.io-index" 3459 3535 checksum = "56f42bd332cc6c8eac5af113fc0c1fd6a8fd2aa08a0119358686e5160d0586c6" 3460 3536 dependencies = [ 3461 - "windows-link", 3537 + "windows-link 0.1.3", 3462 3538 ] 3463 3539 3464 3540 [[package]] ··· 3467 3543 source = "registry+https://github.com/rust-lang/crates.io-index" 3468 3544 checksum = "56e6c93f3a0c3b36176cb1327a4958a0353d5d166c2a35cb268ace15e91d3b57" 3469 3545 dependencies = [ 3470 - "windows-link", 3546 + "windows-link 0.1.3", 3471 3547 ] 3472 3548 3473 3549 [[package]] ··· 3490 3566 3491 3567 [[package]] 3492 3568 name = "windows-sys" 3493 - version = "0.59.0" 3569 + version = "0.60.2" 3494 3570 source = "registry+https://github.com/rust-lang/crates.io-index" 3495 - checksum = "1e38bc4d79ed67fd075bcc251a1c39b32a1776bbe92e5bef1f0bf1f8c531853b" 3571 + checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb" 3496 3572 dependencies = [ 3497 - "windows-targets 0.52.6", 3573 + "windows-targets 0.53.5", 3498 3574 ] 3499 3575 3500 3576 [[package]] 3501 3577 name = "windows-sys" 3502 - version = "0.60.2" 3578 + version = "0.61.2" 3503 3579 source = "registry+https://github.com/rust-lang/crates.io-index" 3504 - checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb" 3580 + checksum = "ae137229bcbd6cdf0f7b80a31df61766145077ddf49416a728b02cb3921ff3fc" 3505 3581 dependencies = [ 3506 - "windows-targets 0.53.3", 3582 + "windows-link 0.2.1", 3507 3583 ] 3508 3584 3509 3585 [[package]] ··· 3539 3615 3540 3616 [[package]] 3541 3617 name = "windows-targets" 3542 - version = "0.53.3" 3618 + version = "0.53.5" 3543 3619 source = "registry+https://github.com/rust-lang/crates.io-index" 3544 - checksum = "d5fe6031c4041849d7c496a8ded650796e7b6ecc19df1a431c1a363342e5dc91" 3620 + checksum = "4945f9f551b88e0d65f3db0bc25c33b8acea4d9e41163edf90dcd0b19f9069f3" 3545 3621 dependencies = [ 3546 - "windows-link", 3547 - "windows_aarch64_gnullvm 0.53.0", 3548 - "windows_aarch64_msvc 0.53.0", 3549 - "windows_i686_gnu 0.53.0", 3550 - "windows_i686_gnullvm 0.53.0", 3551 - "windows_i686_msvc 0.53.0", 3552 - "windows_x86_64_gnu 0.53.0", 3553 - "windows_x86_64_gnullvm 0.53.0", 3554 - "windows_x86_64_msvc 0.53.0", 3555 - ] 3556 - 3557 - [[package]] 3558 - name = "windows-threading" 3559 - version = "0.1.0" 3560 - source = "registry+https://github.com/rust-lang/crates.io-index" 3561 - checksum = "b66463ad2e0ea3bbf808b7f1d371311c80e115c0b71d60efc142cafbcfb057a6" 3562 - dependencies = [ 3563 - "windows-link", 3622 + "windows-link 0.2.1", 3623 + "windows_aarch64_gnullvm 0.53.1", 3624 + "windows_aarch64_msvc 0.53.1", 3625 + "windows_i686_gnu 0.53.1", 3626 + "windows_i686_gnullvm 0.53.1", 3627 + "windows_i686_msvc 0.53.1", 3628 + "windows_x86_64_gnu 0.53.1", 3629 + "windows_x86_64_gnullvm 0.53.1", 3630 + "windows_x86_64_msvc 0.53.1", 3564 3631 ] 3565 3632 3566 3633 [[package]] ··· 3577 3644 3578 3645 [[package]] 3579 3646 name = "windows_aarch64_gnullvm" 3580 - version = "0.53.0" 3647 + version = "0.53.1" 3581 3648 source = "registry+https://github.com/rust-lang/crates.io-index" 3582 - checksum = "86b8d5f90ddd19cb4a147a5fa63ca848db3df085e25fee3cc10b39b6eebae764" 3649 + checksum = "a9d8416fa8b42f5c947f8482c43e7d89e73a173cead56d044f6a56104a6d1b53" 3583 3650 3584 3651 [[package]] 3585 3652 name = "windows_aarch64_msvc" ··· 3595 3662 3596 3663 [[package]] 3597 3664 name = "windows_aarch64_msvc" 3598 - version = "0.53.0" 3665 + version = "0.53.1" 3599 3666 source = "registry+https://github.com/rust-lang/crates.io-index" 3600 - checksum = "c7651a1f62a11b8cbd5e0d42526e55f2c99886c77e007179efff86c2b137e66c" 3667 + checksum = "b9d782e804c2f632e395708e99a94275910eb9100b2114651e04744e9b125006" 3601 3668 3602 3669 [[package]] 3603 3670 name = "windows_i686_gnu" ··· 3613 3680 3614 3681 [[package]] 3615 3682 name = "windows_i686_gnu" 3616 - version = "0.53.0" 3683 + version = "0.53.1" 3617 3684 source = "registry+https://github.com/rust-lang/crates.io-index" 3618 - checksum = "c1dc67659d35f387f5f6c479dc4e28f1d4bb90ddd1a5d3da2e5d97b42d6272c3" 3685 + checksum = "960e6da069d81e09becb0ca57a65220ddff016ff2d6af6a223cf372a506593a3" 3619 3686 3620 3687 [[package]] 3621 3688 name = "windows_i686_gnullvm" ··· 3625 3692 3626 3693 [[package]] 3627 3694 name = "windows_i686_gnullvm" 3628 - version = "0.53.0" 3695 + version = "0.53.1" 3629 3696 source = "registry+https://github.com/rust-lang/crates.io-index" 3630 - checksum = "9ce6ccbdedbf6d6354471319e781c0dfef054c81fbc7cf83f338a4296c0cae11" 3697 + checksum = "fa7359d10048f68ab8b09fa71c3daccfb0e9b559aed648a8f95469c27057180c" 3631 3698 3632 3699 [[package]] 3633 3700 name = "windows_i686_msvc" ··· 3643 3710 3644 3711 [[package]] 3645 3712 name = "windows_i686_msvc" 3646 - version = "0.53.0" 3713 + version = "0.53.1" 3647 3714 source = "registry+https://github.com/rust-lang/crates.io-index" 3648 - checksum = "581fee95406bb13382d2f65cd4a908ca7b1e4c2f1917f143ba16efe98a589b5d" 3715 + checksum = "1e7ac75179f18232fe9c285163565a57ef8d3c89254a30685b57d83a38d326c2" 3649 3716 3650 3717 [[package]] 3651 3718 name = "windows_x86_64_gnu" ··· 3661 3728 3662 3729 [[package]] 3663 3730 name = "windows_x86_64_gnu" 3664 - version = "0.53.0" 3731 + version = "0.53.1" 3665 3732 source = "registry+https://github.com/rust-lang/crates.io-index" 3666 - checksum = "2e55b5ac9ea33f2fc1716d1742db15574fd6fc8dadc51caab1c16a3d3b4190ba" 3733 + checksum = "9c3842cdd74a865a8066ab39c8a7a473c0778a3f29370b5fd6b4b9aa7df4a499" 3667 3734 3668 3735 [[package]] 3669 3736 name = "windows_x86_64_gnullvm" ··· 3679 3746 3680 3747 [[package]] 3681 3748 name = "windows_x86_64_gnullvm" 3682 - version = "0.53.0" 3749 + version = "0.53.1" 3683 3750 source = "registry+https://github.com/rust-lang/crates.io-index" 3684 - checksum = "0a6e035dd0599267ce1ee132e51c27dd29437f63325753051e71dd9e42406c57" 3751 + checksum = "0ffa179e2d07eee8ad8f57493436566c7cc30ac536a3379fdf008f47f6bb7ae1" 3685 3752 3686 3753 [[package]] 3687 3754 name = "windows_x86_64_msvc" ··· 3697 3764 3698 3765 [[package]] 3699 3766 name = "windows_x86_64_msvc" 3700 - version = "0.53.0" 3767 + version = "0.53.1" 3701 3768 source = "registry+https://github.com/rust-lang/crates.io-index" 3702 - checksum = "271414315aff87387382ec3d271b52d7ae78726f5d44ac98b4f4030c91880486" 3769 + checksum = "d6bbff5f0aada427a1e5a6da5f1f98158182f26556f345ac9e04d36d0ebed650" 3703 3770 3704 3771 [[package]] 3705 3772 name = "winreg" ··· 3713 3780 3714 3781 [[package]] 3715 3782 name = "wit-bindgen" 3716 - version = "0.45.1" 3783 + version = "0.46.0" 3717 3784 source = "registry+https://github.com/rust-lang/crates.io-index" 3718 - checksum = "5c573471f125075647d03df72e026074b7203790d41351cd6edc96f46bcccd36" 3785 + checksum = "f17a85883d4e6d00e8a97c586de764dabcc06133f7f1d55dce5cdc070ad7fe59" 3719 3786 3720 3787 [[package]] 3721 3788 name = "writeable" 3722 - version = "0.6.1" 3789 + version = "0.6.2" 3723 3790 source = "registry+https://github.com/rust-lang/crates.io-index" 3724 - checksum = "ea2f10b9bb0928dfb1b42b65e1f9e36f7f54dbdf08457afefb38afcdec4fa2bb" 3791 + checksum = "9edde0db4769d2dc68579893f2306b26c6ecfbe0ef499b013d731b7b9247e0b9" 3725 3792 3726 3793 [[package]] 3727 3794 name = "yoke" 3728 - version = "0.8.0" 3795 + version = "0.8.1" 3729 3796 source = "registry+https://github.com/rust-lang/crates.io-index" 3730 - checksum = "5f41bb01b8226ef4bfd589436a297c53d118f65921786300e427be8d487695cc" 3797 + checksum = "72d6e5c6afb84d73944e5cedb052c4680d5657337201555f9f2a16b7406d4954" 3731 3798 dependencies = [ 3732 - "serde", 3733 3799 "stable_deref_trait", 3734 3800 "yoke-derive", 3735 3801 "zerofrom", ··· 3737 3803 3738 3804 [[package]] 3739 3805 name = "yoke-derive" 3740 - version = "0.8.0" 3806 + version = "0.8.1" 3741 3807 source = "registry+https://github.com/rust-lang/crates.io-index" 3742 - checksum = "38da3c9736e16c5d3c8c597a9aaa5d1fa565d0532ae05e27c24aa62fb32c0ab6" 3808 + checksum = "b659052874eb698efe5b9e8cf382204678a0086ebf46982b79d6ca3182927e5d" 3743 3809 dependencies = [ 3744 3810 "proc-macro2", 3745 3811 "quote", 3746 - "syn", 3812 + "syn 2.0.108", 3747 3813 "synstructure", 3748 3814 ] 3749 3815 3750 3816 [[package]] 3751 3817 name = "zerocopy" 3752 - version = "0.8.26" 3818 + version = "0.8.27" 3753 3819 source = "registry+https://github.com/rust-lang/crates.io-index" 3754 - checksum = "1039dd0d3c310cf05de012d8a39ff557cb0d23087fd44cad61df08fc31907a2f" 3820 + checksum = "0894878a5fa3edfd6da3f88c4805f4c8558e2b996227a3d864f47fe11e38282c" 3755 3821 dependencies = [ 3756 3822 "zerocopy-derive", 3757 3823 ] 3758 3824 3759 3825 [[package]] 3760 3826 name = "zerocopy-derive" 3761 - version = "0.8.26" 3827 + version = "0.8.27" 3762 3828 source = "registry+https://github.com/rust-lang/crates.io-index" 3763 - checksum = "9ecf5b4cc5364572d7f4c329661bcc82724222973f2cab6f050a4e5c22f75181" 3829 + checksum = "88d2b8d9c68ad2b9e4340d7832716a4d21a22a1154777ad56ea55c51a9cf3831" 3764 3830 dependencies = [ 3765 3831 "proc-macro2", 3766 3832 "quote", 3767 - "syn", 3833 + "syn 2.0.108", 3768 3834 ] 3769 3835 3770 3836 [[package]] ··· 3784 3850 dependencies = [ 3785 3851 "proc-macro2", 3786 3852 "quote", 3787 - "syn", 3853 + "syn 2.0.108", 3788 3854 "synstructure", 3789 3855 ] 3790 3856 3791 3857 [[package]] 3792 3858 name = "zeroize" 3793 - version = "1.8.1" 3859 + version = "1.8.2" 3794 3860 source = "registry+https://github.com/rust-lang/crates.io-index" 3795 - checksum = "ced3678a2879b30306d323f4542626697a464a97c0a07c9aebf7ebca65cd4dde" 3861 + checksum = "b97154e67e32c85465826e8bcc1c59429aaaf107c1e4a9e53c8d8ccd5eff88d0" 3796 3862 3797 3863 [[package]] 3798 3864 name = "zerotrie" 3799 - version = "0.2.2" 3865 + version = "0.2.3" 3800 3866 source = "registry+https://github.com/rust-lang/crates.io-index" 3801 - checksum = "36f0bbd478583f79edad978b407914f61b2972f5af6fa089686016be8f9af595" 3867 + checksum = "2a59c17a5562d507e4b54960e8569ebee33bee890c70aa3fe7b97e85a9fd7851" 3802 3868 dependencies = [ 3803 3869 "displaydoc", 3804 3870 "yoke", ··· 3807 3873 3808 3874 [[package]] 3809 3875 name = "zerovec" 3810 - version = "0.11.4" 3876 + version = "0.11.5" 3811 3877 source = "registry+https://github.com/rust-lang/crates.io-index" 3812 - checksum = "e7aa2bd55086f1ab526693ecbe444205da57e25f4489879da80635a46d90e73b" 3878 + checksum = "6c28719294829477f525be0186d13efa9a3c602f7ec202ca9e353d310fb9a002" 3813 3879 dependencies = [ 3814 3880 "yoke", 3815 3881 "zerofrom", ··· 3818 3884 3819 3885 [[package]] 3820 3886 name = "zerovec-derive" 3821 - version = "0.11.1" 3887 + version = "0.11.2" 3822 3888 source = "registry+https://github.com/rust-lang/crates.io-index" 3823 - checksum = "5b96237efa0c878c64bd89c436f661be4e46b2f3eff1ebb976f7ef2321d2f58f" 3889 + checksum = "eadce39539ca5cb3985590102671f2567e659fca9666581ad3411d59207951f3" 3824 3890 dependencies = [ 3825 3891 "proc-macro2", 3826 3892 "quote", 3827 - "syn", 3893 + "syn 2.0.108", 3894 + ] 3895 + 3896 + [[package]] 3897 + name = "zstd" 3898 + version = "0.13.3" 3899 + source = "registry+https://github.com/rust-lang/crates.io-index" 3900 + checksum = "e91ee311a569c327171651566e07972200e76fcfe2242a4fa446149a3881c08a" 3901 + dependencies = [ 3902 + "zstd-safe", 3903 + ] 3904 + 3905 + [[package]] 3906 + name = "zstd-safe" 3907 + version = "7.2.4" 3908 + source = "registry+https://github.com/rust-lang/crates.io-index" 3909 + checksum = "8f49c4d5f0abb602a93fb8736af2a4f4dd9512e36f7f570d66e65ff867ed3b9d" 3910 + dependencies = [ 3911 + "zstd-sys", 3912 + ] 3913 + 3914 + [[package]] 3915 + name = "zstd-sys" 3916 + version = "2.0.16+zstd.1.5.7" 3917 + source = "registry+https://github.com/rust-lang/crates.io-index" 3918 + checksum = "91e19ebc2adc8f83e43039e79776e3fda8ca919132d68a1fed6a5faca2683748" 3919 + dependencies = [ 3920 + "cc", 3921 + "pkg-config", 3828 3922 ]
+13 -5
Cargo.toml
··· 1 1 [package] 2 2 name = "quickdid" 3 - version = "1.0.0-rc.3" 3 + version = "1.0.0-rc.5" 4 4 edition = "2024" 5 5 authors = ["Nick Gerakines <nick.gerakines@gmail.com>"] 6 6 description = "A fast and scalable com.atproto.identity.resolveHandle service" ··· 16 16 [dependencies] 17 17 anyhow = "1.0" 18 18 async-trait = "0.1" 19 - atproto-identity = { version = "0.11.3" } 19 + atproto-identity = { git = "https://tangled.org/@smokesignal.events/atproto-identity-rs" } 20 + atproto-jetstream = { git = "https://tangled.org/@smokesignal.events/atproto-identity-rs" } 21 + atproto-lexicon = { git = "https://tangled.org/@smokesignal.events/atproto-identity-rs" } 20 22 axum = { version = "0.8" } 21 - bincode = { version = "2.0.1", features = ["serde"] } 23 + bincode = { version = "2.0", features = ["serde"] } 24 + cadence = "1.6" 22 25 deadpool-redis = { version = "0.22", features = ["connection-manager", "tokio-comp", "tokio-rustls-comp"] } 23 - metrohash = "1.0.7" 26 + httpdate = "1.0" 27 + metrohash = "1.0" 24 28 reqwest = { version = "0.12", features = ["json"] } 25 29 serde = { version = "1.0", features = ["derive"] } 26 30 serde_json = "1.0" 27 - sqlx = { version = "0.8", features = ["runtime-tokio", "sqlite", "chrono"] } 31 + sqlx = { version = "0.8", features = ["runtime-tokio", "sqlite"] } 28 32 thiserror = "2.0" 29 33 tokio = { version = "1.35", features = ["rt-multi-thread", "macros", "signal", "sync", "time", "net", "fs"] } 30 34 tokio-util = { version = "0.7", features = ["rt"] } 35 + tower-http = { version = "0.6", features = ["fs"] } 31 36 tracing = "0.1" 32 37 tracing-subscriber = { version = "0.3", features = ["env-filter"] } 38 + 39 + [dev-dependencies] 40 + once_cell = "1.20"
+6 -2
Dockerfile
··· 1 1 # syntax=docker/dockerfile:1.4 2 - FROM rust:1.89-slim AS builder 2 + FROM rust:1.90-slim-bookworm AS builder 3 3 4 4 RUN apt-get update && apt-get install -y \ 5 5 pkg-config \ ··· 19 19 LABEL org.opencontainers.image.licenses="MIT" 20 20 LABEL org.opencontainers.image.authors="Nick Gerakines <nick.gerakines@gmail.com>" 21 21 LABEL org.opencontainers.image.source="https://tangled.sh/@smokesignal.events/quickdid" 22 - LABEL org.opencontainers.image.version="1.0.0-rc.3" 22 + LABEL org.opencontainers.image.version="1.0.0-rc.5" 23 23 24 24 WORKDIR /app 25 25 COPY --from=builder /app/target/release/quickdid /app/quickdid 26 26 27 + # Copy static files for serving 28 + COPY www /app/www 29 + 27 30 ENV HTTP_PORT=8080 31 + ENV STATIC_FILES_DIR=/app/www 28 32 ENV RUST_LOG=info 29 33 ENV RUST_BACKTRACE=full 30 34
+101 -13
README.md
··· 1 1 # QuickDID 2 2 3 - QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides blazing-fast handle-to-DID resolution with intelligent caching strategies, supporting in-memory, Redis-backed, and SQLite-backed persistent caching with binary serialization for optimal storage efficiency. 3 + QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides blazing-fast handle-to-DID resolution with intelligent caching strategies, supporting in-memory, Redis-backed, and SQLite-backed persistent caching with binary serialization for optimal storage efficiency. The service includes proactive cache refreshing to maintain optimal performance and comprehensive metrics support for production monitoring. 4 4 5 5 Built following the 12-factor app methodology with minimal dependencies and optimized for production use, QuickDID delivers exceptional performance while maintaining a lean footprint. Configuration is handled exclusively through environment variables, with only `--version` and `--help` command-line arguments supported. 6 6 ··· 21 21 ## Features 22 22 23 23 - **Fast Handle Resolution**: Resolves AT Protocol handles to DIDs using DNS TXT records and HTTP well-known endpoints 24 + - **Bidirectional Caching**: Supports both handle-to-DID and DID-to-handle lookups with automatic cache synchronization 24 25 - **Multi-Layer Caching**: Flexible caching with three tiers: 25 26 - In-memory caching with configurable TTL (default: 600 seconds) 26 27 - Redis-backed persistent caching (default: 90-day TTL) 27 28 - SQLite-backed persistent caching (default: 90-day TTL) 29 + - **Jetstream Consumer**: Real-time cache updates from AT Protocol firehose: 30 + - Processes Account and Identity events 31 + - Automatically purges deleted/deactivated accounts 32 + - Updates handle-to-DID mappings in real-time 33 + - Comprehensive metrics for event processing 34 + - Automatic reconnection with backoff 35 + - **HTTP Caching**: Client-side caching support with: 36 + - ETag generation with configurable seed for cache invalidation 37 + - Cache-Control headers with max-age, stale-while-revalidate, and stale-if-error directives 38 + - CORS headers for cross-origin requests 28 39 - **Rate Limiting**: Semaphore-based concurrency control with optional timeout to protect upstream services 29 40 - **Binary Serialization**: Compact storage format reduces cache size by ~40% compared to JSON 30 41 - **Queue Processing**: Asynchronous handle resolution with multiple adapters: ··· 32 43 - Redis (distributed) 33 44 - SQLite (persistent with work shedding) 34 45 - No-op (testing) 46 + - **Metrics & Monitoring**: 47 + - StatsD metrics support for counters, gauges, and timings 48 + - Resolution timing measurements 49 + - Jetstream event processing metrics 50 + - Configurable tags for environment/service identification 51 + - Integration guides for Telegraf and TimescaleDB 52 + - Configurable bind address for StatsD UDP socket (IPv4/IPv6) 53 + - **Proactive Cache Refresh**: 54 + - Automatically refreshes cache entries before expiration 55 + - Configurable refresh threshold 56 + - Prevents cache misses for frequently accessed handles 57 + - Metrics tracking for refresh operations 58 + - **Queue Deduplication**: 59 + - Redis-based deduplication for queue items 60 + - Prevents duplicate handle resolution work 61 + - Configurable TTL for deduplication keys 62 + - **Cache Management APIs**: 63 + - `purge` method for removing entries by handle or DID 64 + - `set` method for manually updating handle-to-DID mappings 65 + - Chainable operations across resolver layers 35 66 - **AT Protocol Compatible**: Implements XRPC endpoints for seamless integration with AT Protocol infrastructure 36 67 - **Comprehensive Error Handling**: Structured errors with unique identifiers (e.g., `error-quickdid-config-1`), health checks, and graceful shutdown 37 68 - **12-Factor App**: Environment-based configuration following cloud-native best practices ··· 64 95 65 96 ## Minimum Configuration 66 97 67 - QuickDID requires the following environment variables to run. Configuration is validated at startup, and the service will exit with specific error codes if validation fails. 98 + QuickDID requires minimal configuration to run. Configuration is validated at startup, and the service will exit with specific error codes if validation fails. 68 99 69 100 ### Required 70 101 71 102 - `HTTP_EXTERNAL`: External hostname for service endpoints (e.g., `localhost:3007`) 72 - - `SERVICE_KEY`: Private key for service identity in DID format (e.g., `did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK`) 73 103 74 104 ### Example Minimal Setup 75 105 76 106 ```bash 77 - HTTP_EXTERNAL=localhost:3007 \ 78 - SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK \ 79 - cargo run 107 + HTTP_EXTERNAL=localhost:3007 cargo run 108 + ``` 109 + 110 + ### Static Files 111 + 112 + QuickDID serves static files from the `www` directory by default. This includes: 113 + - Landing page (`index.html`) 114 + - AT Protocol well-known files (`.well-known/atproto-did` and `.well-known/did.json`) 115 + 116 + Generate the `.well-known` files for your deployment: 117 + 118 + ```bash 119 + HTTP_EXTERNAL=your-domain.com ./generate-wellknown.sh 80 120 ``` 81 121 82 122 This will start QuickDID with: ··· 110 150 - `QUEUE_BUFFER_SIZE`: MPSC queue buffer size (default: 1000) 111 151 - `QUEUE_REDIS_PREFIX`: Redis key prefix for queues (default: queue:handleresolver:) 112 152 - `QUEUE_REDIS_TIMEOUT`: Redis blocking timeout in seconds (default: 5) 153 + - `QUEUE_REDIS_DEDUP_ENABLED`: Enable queue deduplication (default: false) 154 + - `QUEUE_REDIS_DEDUP_TTL`: TTL for deduplication keys in seconds (default: 60) 113 155 - `QUEUE_SQLITE_MAX_SIZE`: Max SQLite queue size for work shedding (default: 10000) 114 156 115 157 #### Rate Limiting 116 158 - `RESOLVER_MAX_CONCURRENT`: Maximum concurrent handle resolutions (default: 0 = disabled) 117 159 - `RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`: Timeout for acquiring rate limit permit in ms (default: 0 = no timeout) 118 160 161 + #### HTTP Cache Control 162 + - `CACHE_MAX_AGE`: Max-age for Cache-Control header in seconds (default: 86400) 163 + - `CACHE_STALE_IF_ERROR`: Stale-if-error directive in seconds (default: 172800) 164 + - `CACHE_STALE_WHILE_REVALIDATE`: Stale-while-revalidate in seconds (default: 86400) 165 + - `CACHE_MAX_STALE`: Max-stale directive in seconds (default: 86400) 166 + - `ETAG_SEED`: Seed value for ETag generation (default: application version) 167 + 168 + #### Metrics 169 + - `METRICS_ADAPTER`: Metrics adapter type - 'noop' or 'statsd' (default: noop) 170 + - `METRICS_STATSD_HOST`: StatsD host and port (required when METRICS_ADAPTER=statsd) 171 + - `METRICS_STATSD_BIND`: Bind address for StatsD UDP socket (default: [::]:0 for IPv6, can use 0.0.0.0:0 for IPv4) 172 + - `METRICS_PREFIX`: Prefix for all metrics (default: quickdid) 173 + - `METRICS_TAGS`: Comma-separated tags (e.g., env:prod,service:quickdid) 174 + 175 + #### Proactive Refresh 176 + - `PROACTIVE_REFRESH_ENABLED`: Enable proactive cache refreshing (default: false) 177 + - `PROACTIVE_REFRESH_THRESHOLD`: Refresh when TTL remaining is below this threshold (0.0-1.0, default: 0.8) 178 + 179 + #### Jetstream Consumer 180 + - `JETSTREAM_ENABLED`: Enable Jetstream consumer for real-time cache updates (default: false) 181 + - `JETSTREAM_HOSTNAME`: Jetstream WebSocket hostname (default: jetstream.atproto.tools) 182 + 183 + #### Static Files 184 + - `STATIC_FILES_DIR`: Directory for serving static files (default: www) 185 + 119 186 #### Logging 120 187 - `RUST_LOG`: Logging level (e.g., debug, info, warn, error) 121 188 122 189 ### Production Examples 123 190 124 - #### Redis-based (Multi-instance/HA) 191 + #### Redis-based with Metrics and Jetstream (Multi-instance/HA) 125 192 ```bash 126 193 HTTP_EXTERNAL=quickdid.example.com \ 127 - SERVICE_KEY=did:key:yourkeyhere \ 128 194 HTTP_PORT=3000 \ 129 195 REDIS_URL=redis://localhost:6379 \ 130 196 CACHE_TTL_REDIS=86400 \ ··· 132 198 QUEUE_WORKER_ID=prod-worker-1 \ 133 199 RESOLVER_MAX_CONCURRENT=100 \ 134 200 RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 \ 201 + METRICS_ADAPTER=statsd \ 202 + METRICS_STATSD_HOST=localhost:8125 \ 203 + METRICS_PREFIX=quickdid \ 204 + METRICS_TAGS=env:prod,service:quickdid \ 205 + CACHE_MAX_AGE=86400 \ 206 + JETSTREAM_ENABLED=true \ 207 + JETSTREAM_HOSTNAME=jetstream.atproto.tools \ 135 208 RUST_LOG=info \ 136 209 ./target/release/quickdid 137 210 ``` ··· 139 212 #### SQLite-based (Single-instance) 140 213 ```bash 141 214 HTTP_EXTERNAL=quickdid.example.com \ 142 - SERVICE_KEY=did:key:yourkeyhere \ 143 215 HTTP_PORT=3000 \ 144 216 SQLITE_URL=sqlite:./quickdid.db \ 145 217 CACHE_TTL_SQLITE=86400 \ ··· 155 227 QuickDID uses a layered architecture for optimal performance: 156 228 157 229 ``` 158 - Request โ†’ Cache Layer โ†’ Rate Limiter โ†’ Base Resolver โ†’ DNS/HTTP 159 - โ†“ โ†“ โ†“ 160 - Memory/Redis/ Semaphore AT Protocol 161 - SQLite (optional) Infrastructure 230 + Request โ†’ Cache Layer โ†’ Proactive Refresh โ†’ Rate Limiter โ†’ Base Resolver โ†’ DNS/HTTP 231 + โ†“ โ†“ โ†“ โ†“ 232 + Memory/Redis/ Background Semaphore AT Protocol 233 + SQLite Refresher (optional) Infrastructure 234 + โ†‘ 235 + Jetstream Consumer โ† Real-time Updates from AT Protocol Firehose 162 236 ``` 163 237 164 238 ### Cache Priority ··· 167 241 2. SQLite (if configured) - Best for single-instance with persistence 168 242 3. In-memory (fallback) - Always available 169 243 244 + ### Real-time Cache Updates 245 + When Jetstream is enabled, QuickDID maintains cache consistency by: 246 + - Processing Account events to purge deleted/deactivated accounts 247 + - Processing Identity events to update handle-to-DID mappings 248 + - Automatically reconnecting with exponential backoff on connection failures 249 + - Tracking metrics for successful and failed event processing 250 + 170 251 ### Deployment Strategies 171 252 172 253 - **Single-instance**: Use SQLite for both caching and queuing 173 254 - **Multi-instance/HA**: Use Redis for distributed caching and queuing 174 255 - **Development**: Use in-memory caching with MPSC queuing 256 + - **Real-time sync**: Enable Jetstream consumer for live cache updates 175 257 176 258 ## API Endpoints 177 259 178 260 - `GET /_health` - Health check endpoint 179 261 - `GET /xrpc/com.atproto.identity.resolveHandle` - Resolve handle to DID 180 262 - `GET /.well-known/atproto-did` - Serve DID document for the service 263 + - `OPTIONS /*` - CORS preflight support for all endpoints 181 264 182 265 ## Docker Deployment 183 266 ··· 201 284 202 285 - [Configuration Reference](docs/configuration-reference.md) - Complete list of all configuration options 203 286 - [Production Deployment Guide](docs/production-deployment.md) - Docker, monitoring, and production best practices 287 + - [Metrics Guide](docs/telegraf-timescaledb-metrics-guide.md) - Setting up metrics with Telegraf and TimescaleDB 204 288 - [Development Guide](CLAUDE.md) - Architecture details and development patterns 289 + 290 + ## Railway Deployment 291 + 292 + QuickDID includes Railway deployment resources in the `railway-resources/` directory for easy deployment with metrics support via Telegraf. See the deployment configurations for one-click deployment options. 205 293 206 294 ## License 207 295
+41
docker-compose.yml
··· 1 + version: '3.8' 2 + 3 + services: 4 + quickdid: 5 + image: quickdid:latest 6 + build: . 7 + ports: 8 + - "3007:8080" 9 + environment: 10 + - HTTP_EXTERNAL=localhost:3007 11 + - HTTP_PORT=8080 12 + - RUST_LOG=info 13 + # Optional: Override the static files directory 14 + # - STATIC_FILES_DIR=/app/custom-www 15 + volumes: 16 + # Optional: Mount custom static files from host 17 + # - ./custom-www:/app/custom-www:ro 18 + # Optional: Mount custom .well-known files 19 + # - ./www/.well-known:/app/www/.well-known:ro 20 + # Optional: Use SQLite for caching 21 + # - ./data:/app/data 22 + # environment: 23 + # SQLite cache configuration 24 + # - SQLITE_URL=sqlite:/app/data/quickdid.db 25 + # - CACHE_TTL_SQLITE=86400 26 + 27 + # Redis cache configuration (if using external Redis) 28 + # - REDIS_URL=redis://redis:6379 29 + # - CACHE_TTL_REDIS=86400 30 + # - QUEUE_ADAPTER=redis 31 + 32 + # Optional: Redis service for caching 33 + # redis: 34 + # image: redis:7-alpine 35 + # ports: 36 + # - "6379:6379" 37 + # volumes: 38 + # - redis-data:/data 39 + 40 + volumes: 41 + redis-data:
+439 -41
docs/configuration-reference.md
··· 10 10 - [Queue Configuration](#queue-configuration) 11 11 - [Rate Limiting Configuration](#rate-limiting-configuration) 12 12 - [HTTP Caching Configuration](#http-caching-configuration) 13 + - [Metrics Configuration](#metrics-configuration) 14 + - [Proactive Refresh Configuration](#proactive-refresh-configuration) 15 + - [Jetstream Consumer Configuration](#jetstream-consumer-configuration) 16 + - [Static Files Configuration](#static-files-configuration) 13 17 - [Configuration Examples](#configuration-examples) 14 18 - [Validation Rules](#validation-rules) 15 19 ··· 40 44 **Constraints**: 41 45 - Must be a valid hostname or hostname:port combination 42 46 - Port (if specified) must be between 1-65535 43 - - Used to generate service DID (did:web:{HTTP_EXTERNAL}) 44 - 45 - ### `SERVICE_KEY` 46 - 47 - **Required**: Yes 48 - **Type**: String 49 - **Format**: DID private key 50 - **Security**: SENSITIVE - Never commit to version control 51 - 52 - The private key for the service's AT Protocol identity. This key is used to sign responses and authenticate the service. 53 - 54 - **Examples**: 55 - ```bash 56 - # did:key format (Ed25519) 57 - SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 58 - 59 - # did:plc format 60 - SERVICE_KEY=did:plc:xyz123abc456def789 61 - ``` 62 - 63 - **Constraints**: 64 - - Must be a valid DID format 65 - - Must include the private key component 66 - - Should be stored securely (e.g., secrets manager, encrypted storage) 67 47 68 48 ## Network Configuration 69 49 ··· 378 358 QUEUE_REDIS_TIMEOUT=30 # Minimal polling, slow shutdown 379 359 ``` 380 360 361 + ### `QUEUE_REDIS_DEDUP_ENABLED` 362 + 363 + **Required**: No 364 + **Type**: Boolean 365 + **Default**: `false` 366 + 367 + Enable deduplication for Redis queue to prevent duplicate handles from being queued multiple times within the TTL window. When enabled, uses Redis SET with TTL to track handles currently being processed. 368 + 369 + **Examples**: 370 + ```bash 371 + # Enable deduplication (recommended for production) 372 + QUEUE_REDIS_DEDUP_ENABLED=true 373 + 374 + # Disable deduplication (default) 375 + QUEUE_REDIS_DEDUP_ENABLED=false 376 + ``` 377 + 378 + **Use cases**: 379 + - **Production**: Enable to prevent duplicate work and reduce load 380 + - **High-traffic**: Essential to avoid processing the same handle multiple times 381 + - **Development**: Can be disabled for simpler debugging 382 + 383 + ### `QUEUE_REDIS_DEDUP_TTL` 384 + 385 + **Required**: No 386 + **Type**: Integer (seconds) 387 + **Default**: `60` 388 + **Range**: 10-300 (recommended) 389 + **Constraints**: Must be > 0 when deduplication is enabled 390 + 391 + TTL for Redis queue deduplication keys in seconds. Determines how long to prevent duplicate handle resolution requests. 392 + 393 + **Examples**: 394 + ```bash 395 + # Quick deduplication window (10 seconds) 396 + QUEUE_REDIS_DEDUP_TTL=10 397 + 398 + # Default (1 minute) 399 + QUEUE_REDIS_DEDUP_TTL=60 400 + 401 + # Extended deduplication (5 minutes) 402 + QUEUE_REDIS_DEDUP_TTL=300 403 + ``` 404 + 405 + **Recommendations**: 406 + - **Fast processing**: 10-30 seconds 407 + - **Normal processing**: 60 seconds (default) 408 + - **Slow processing or high load**: 120-300 seconds 409 + 381 410 ### `QUEUE_WORKER_ID` 382 411 383 412 **Required**: No ··· 548 577 Rate limit permit acquisition timed out after {timeout}ms 549 578 ``` 550 579 580 + ## Metrics Configuration 581 + 582 + ### `METRICS_ADAPTER` 583 + 584 + **Required**: No 585 + **Type**: String 586 + **Default**: `noop` 587 + **Values**: `noop`, `statsd` 588 + 589 + Metrics adapter type for collecting and publishing metrics. 590 + 591 + **Options**: 592 + - `noop`: No metrics collection (default) 593 + - `statsd`: Send metrics to StatsD server 594 + 595 + **Examples**: 596 + ```bash 597 + # No metrics (default) 598 + METRICS_ADAPTER=noop 599 + 600 + # Enable StatsD metrics 601 + METRICS_ADAPTER=statsd 602 + ``` 603 + 604 + ### `METRICS_STATSD_HOST` 605 + 606 + **Required**: Yes (when METRICS_ADAPTER=statsd) 607 + **Type**: String 608 + **Format**: hostname:port 609 + 610 + StatsD server host and port for metrics collection. 611 + 612 + **Examples**: 613 + ```bash 614 + # Local StatsD 615 + METRICS_STATSD_HOST=localhost:8125 616 + 617 + # Remote StatsD 618 + METRICS_STATSD_HOST=statsd.example.com:8125 619 + 620 + # Docker network 621 + METRICS_STATSD_HOST=statsd:8125 622 + ``` 623 + 624 + ### `METRICS_STATSD_BIND` 625 + 626 + **Required**: No 627 + **Type**: String 628 + **Default**: `[::]:0` 629 + 630 + Bind address for StatsD UDP socket. Controls which local address to bind for sending UDP packets. 631 + 632 + **Examples**: 633 + ```bash 634 + # IPv6 any address, random port (default) 635 + METRICS_STATSD_BIND=[::]:0 636 + 637 + # IPv4 any address, random port 638 + METRICS_STATSD_BIND=0.0.0.0:0 639 + 640 + # Specific interface 641 + METRICS_STATSD_BIND=192.168.1.100:0 642 + 643 + # Specific port 644 + METRICS_STATSD_BIND=[::]:8126 645 + ``` 646 + 647 + ### `METRICS_PREFIX` 648 + 649 + **Required**: No 650 + **Type**: String 651 + **Default**: `quickdid` 652 + 653 + Prefix for all metrics. Used to namespace metrics in your monitoring system. 654 + 655 + **Examples**: 656 + ```bash 657 + # Default 658 + METRICS_PREFIX=quickdid 659 + 660 + # Environment-specific 661 + METRICS_PREFIX=prod.quickdid 662 + METRICS_PREFIX=staging.quickdid 663 + 664 + # Region-specific 665 + METRICS_PREFIX=us-east-1.quickdid 666 + METRICS_PREFIX=eu-west-1.quickdid 667 + 668 + # Service-specific 669 + METRICS_PREFIX=api.quickdid 670 + ``` 671 + 672 + ### `METRICS_TAGS` 673 + 674 + **Required**: No 675 + **Type**: String (comma-separated key:value pairs) 676 + **Default**: None 677 + 678 + Default tags for all metrics. Added to all metrics for filtering and grouping. 679 + 680 + **Examples**: 681 + ```bash 682 + # Basic tags 683 + METRICS_TAGS=env:production,service:quickdid 684 + 685 + # Detailed tags 686 + METRICS_TAGS=env:production,service:quickdid,region:us-east-1,version:1.0.0 687 + 688 + # Deployment-specific 689 + METRICS_TAGS=env:staging,cluster:k8s-staging,namespace:quickdid 690 + ``` 691 + 692 + **Common tag patterns**: 693 + - `env`: Environment (production, staging, development) 694 + - `service`: Service name 695 + - `region`: Geographic region 696 + - `version`: Application version 697 + - `cluster`: Kubernetes cluster name 698 + - `instance`: Instance identifier 699 + 700 + ## Proactive Refresh Configuration 701 + 702 + ### `PROACTIVE_REFRESH_ENABLED` 703 + 704 + **Required**: No 705 + **Type**: Boolean 706 + **Default**: `false` 707 + 708 + Enable proactive cache refresh for frequently accessed handles. When enabled, cache entries that have reached the refresh threshold will be queued for background refresh to keep the cache warm. 709 + 710 + **Examples**: 711 + ```bash 712 + # Enable proactive refresh (recommended for production) 713 + PROACTIVE_REFRESH_ENABLED=true 714 + 715 + # Disable proactive refresh (default) 716 + PROACTIVE_REFRESH_ENABLED=false 717 + ``` 718 + 719 + **Benefits**: 720 + - Prevents cache misses for popular handles 721 + - Maintains consistent response times 722 + - Reduces latency spikes during cache expiration 723 + 724 + **Considerations**: 725 + - Increases background processing load 726 + - More DNS/HTTP requests to upstream services 727 + - Best for high-traffic services with predictable access patterns 728 + 729 + ### `PROACTIVE_REFRESH_THRESHOLD` 730 + 731 + **Required**: No 732 + **Type**: Float 733 + **Default**: `0.8` 734 + **Range**: 0.0-1.0 735 + **Constraints**: Must be between 0.0 and 1.0 736 + 737 + Threshold as a percentage (0.0-1.0) of cache TTL when to trigger proactive refresh. For example, 0.8 means refresh when an entry has lived for 80% of its TTL. 738 + 739 + **Examples**: 740 + ```bash 741 + # Very aggressive (refresh at 50% of TTL) 742 + PROACTIVE_REFRESH_THRESHOLD=0.5 743 + 744 + # Moderate (refresh at 70% of TTL) 745 + PROACTIVE_REFRESH_THRESHOLD=0.7 746 + 747 + # Default (refresh at 80% of TTL) 748 + PROACTIVE_REFRESH_THRESHOLD=0.8 749 + 750 + # Conservative (refresh at 90% of TTL) 751 + PROACTIVE_REFRESH_THRESHOLD=0.9 752 + 753 + # Very conservative (refresh at 95% of TTL) 754 + PROACTIVE_REFRESH_THRESHOLD=0.95 755 + ``` 756 + 757 + **Recommendations**: 758 + - **High-traffic services**: 0.5-0.7 (aggressive refresh) 759 + - **Normal traffic**: 0.8 (default, balanced) 760 + - **Low traffic**: 0.9-0.95 (conservative) 761 + - **Development**: 0.5 (test refresh behavior) 762 + 763 + **Impact on different cache TTLs**: 764 + - TTL=600s (10 min), threshold=0.8: Refresh after 8 minutes 765 + - TTL=3600s (1 hour), threshold=0.8: Refresh after 48 minutes 766 + - TTL=86400s (1 day), threshold=0.8: Refresh after 19.2 hours 767 + 768 + ## Jetstream Consumer Configuration 769 + 770 + ### `JETSTREAM_ENABLED` 771 + 772 + **Required**: No 773 + **Type**: Boolean 774 + **Default**: `false` 775 + 776 + Enable Jetstream consumer for real-time cache updates from the AT Protocol firehose. When enabled, QuickDID connects to the Jetstream WebSocket service to receive live updates about account and identity changes. 777 + 778 + **How it works**: 779 + - Subscribes to Account and Identity events from the firehose 780 + - Processes Account events to purge deleted/deactivated accounts 781 + - Processes Identity events to update handle-to-DID mappings 782 + - Automatically reconnects with exponential backoff on connection failures 783 + - Tracks metrics for successful and failed event processing 784 + 785 + **Examples**: 786 + ```bash 787 + # Enable Jetstream consumer (recommended for production) 788 + JETSTREAM_ENABLED=true 789 + 790 + # Disable Jetstream consumer (default) 791 + JETSTREAM_ENABLED=false 792 + ``` 793 + 794 + **Benefits**: 795 + - Real-time cache synchronization with AT Protocol network 796 + - Automatic removal of deleted/deactivated accounts 797 + - Immediate handle change updates 798 + - Reduces stale data in cache 799 + 800 + **Considerations**: 801 + - Requires stable WebSocket connection 802 + - Increases network traffic (incoming events) 803 + - Best for services requiring up-to-date handle mappings 804 + - Automatically handles reconnection on failures 805 + 806 + ### `JETSTREAM_HOSTNAME` 807 + 808 + **Required**: No 809 + **Type**: String 810 + **Default**: `jetstream.atproto.tools` 811 + 812 + The hostname of the Jetstream WebSocket service to connect to for real-time AT Protocol events. Only used when `JETSTREAM_ENABLED=true`. 813 + 814 + **Examples**: 815 + ```bash 816 + # Production firehose (default) 817 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 818 + 819 + # Staging environment 820 + JETSTREAM_HOSTNAME=jetstream-staging.atproto.tools 821 + 822 + # Local development firehose 823 + JETSTREAM_HOSTNAME=localhost:6008 824 + 825 + # Custom deployment 826 + JETSTREAM_HOSTNAME=jetstream.example.com 827 + ``` 828 + 829 + **Event Processing**: 830 + - **Account events**: 831 + - `status: deleted` โ†’ Purges handle and DID from all caches 832 + - `status: deactivated` โ†’ Purges handle and DID from all caches 833 + - Other statuses โ†’ Ignored 834 + 835 + - **Identity events**: 836 + - Updates handle-to-DID mapping in cache 837 + - Removes old handle mapping if changed 838 + - Maintains bidirectional cache consistency 839 + 840 + **Metrics Tracked** (when metrics are enabled): 841 + - `jetstream.events.received`: Total events received 842 + - `jetstream.events.processed`: Successfully processed events 843 + - `jetstream.events.failed`: Failed event processing 844 + - `jetstream.connections.established`: Successful connections 845 + - `jetstream.connections.failed`: Failed connection attempts 846 + 847 + **Reconnection Behavior**: 848 + - Initial retry delay: 1 second 849 + - Maximum retry delay: 60 seconds 850 + - Exponential backoff with jitter 851 + - Automatic recovery on transient failures 852 + 853 + **Recommendations**: 854 + - **Production**: Use default `jetstream.atproto.tools` 855 + - **Development**: Consider local firehose for testing 856 + - **High availability**: Monitor connection metrics 857 + - **Network issues**: Check WebSocket connectivity 858 + 859 + ## Static Files Configuration 860 + 861 + ### `STATIC_FILES_DIR` 862 + 863 + **Required**: No 864 + **Type**: String (directory path) 865 + **Default**: `www` 866 + 867 + Directory path for serving static files. This directory should contain the landing page and AT Protocol well-known files. 868 + 869 + **Directory Structure**: 870 + ``` 871 + www/ 872 + โ”œโ”€โ”€ index.html # Landing page 873 + โ”œโ”€โ”€ .well-known/ 874 + โ”‚ โ”œโ”€โ”€ atproto-did # Service DID identifier 875 + โ”‚ โ””โ”€โ”€ did.json # DID document 876 + โ””โ”€โ”€ (other static assets) 877 + ``` 878 + 879 + **Examples**: 880 + ```bash 881 + # Default (relative to working directory) 882 + STATIC_FILES_DIR=www 883 + 884 + # Absolute path 885 + STATIC_FILES_DIR=/var/www/quickdid 886 + 887 + # Docker container path 888 + STATIC_FILES_DIR=/app/www 889 + 890 + # Custom directory 891 + STATIC_FILES_DIR=./public 892 + ``` 893 + 894 + **Docker Volume Mounting**: 895 + ```yaml 896 + volumes: 897 + # Mount entire custom directory 898 + - ./custom-www:/app/www:ro 899 + 900 + # Mount specific files 901 + - ./custom-index.html:/app/www/index.html:ro 902 + - ./well-known:/app/www/.well-known:ro 903 + ``` 904 + 905 + **Generating Well-Known Files**: 906 + ```bash 907 + # Generate .well-known files for your domain 908 + HTTP_EXTERNAL=your-domain.com ./generate-wellknown.sh 909 + ``` 910 + 551 911 ## HTTP Caching Configuration 552 912 553 913 ### `CACHE_MAX_AGE` ··· 721 1081 ```bash 722 1082 # .env.development 723 1083 HTTP_EXTERNAL=localhost:3007 724 - SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 725 1084 RUST_LOG=debug 726 1085 ``` 727 1086 ··· 731 1090 # .env.production.redis 732 1091 # Required 733 1092 HTTP_EXTERNAL=quickdid.example.com 734 - SERVICE_KEY=${SECRET_SERVICE_KEY} # From secrets manager 735 1093 736 1094 # Network 737 1095 HTTP_PORT=8080 ··· 746 1104 QUEUE_ADAPTER=redis 747 1105 QUEUE_REDIS_TIMEOUT=5 748 1106 QUEUE_BUFFER_SIZE=5000 1107 + QUEUE_REDIS_DEDUP_ENABLED=true # Prevent duplicate work 1108 + QUEUE_REDIS_DEDUP_TTL=60 749 1109 750 1110 # Rate Limiting (optional, recommended for production) 751 1111 RESOLVER_MAX_CONCURRENT=100 752 1112 RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 # 5 second timeout 753 1113 1114 + # Metrics (optional, recommended for production) 1115 + METRICS_ADAPTER=statsd 1116 + METRICS_STATSD_HOST=localhost:8125 1117 + METRICS_PREFIX=quickdid 1118 + METRICS_TAGS=env:prod,service:quickdid 1119 + 1120 + # Proactive Refresh (optional, recommended for high-traffic) 1121 + PROACTIVE_REFRESH_ENABLED=true 1122 + PROACTIVE_REFRESH_THRESHOLD=0.8 1123 + 1124 + # Jetstream Consumer (optional, recommended for real-time sync) 1125 + JETSTREAM_ENABLED=true 1126 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 1127 + 754 1128 # HTTP Caching (Cache-Control headers) 755 1129 CACHE_MAX_AGE=86400 # 24 hours 756 1130 CACHE_STALE_IF_ERROR=172800 # 48 hours ··· 766 1140 # .env.production.sqlite 767 1141 # Required 768 1142 HTTP_EXTERNAL=quickdid.example.com 769 - SERVICE_KEY=${SECRET_SERVICE_KEY} # From secrets manager 770 1143 771 1144 # Network 772 1145 HTTP_PORT=8080 ··· 786 1159 RESOLVER_MAX_CONCURRENT=100 787 1160 RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 # 5 second timeout 788 1161 1162 + # Jetstream Consumer (optional, recommended for real-time sync) 1163 + JETSTREAM_ENABLED=true 1164 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 1165 + 789 1166 # HTTP Caching (Cache-Control headers) 790 1167 CACHE_MAX_AGE=86400 # 24 hours 791 1168 CACHE_STALE_IF_ERROR=172800 # 48 hours ··· 801 1178 # .env.ha.redis 802 1179 # Required 803 1180 HTTP_EXTERNAL=quickdid.example.com 804 - SERVICE_KEY=${SECRET_SERVICE_KEY} 805 1181 806 1182 # Network 807 1183 HTTP_PORT=8080 ··· 818 1194 QUEUE_REDIS_PREFIX=prod:queue: 819 1195 QUEUE_WORKER_ID=${HOSTNAME:-worker1} 820 1196 QUEUE_REDIS_TIMEOUT=10 1197 + QUEUE_REDIS_DEDUP_ENABLED=true # Essential for multi-instance 1198 + QUEUE_REDIS_DEDUP_TTL=120 # Longer TTL for HA 821 1199 822 1200 # Performance 823 1201 QUEUE_BUFFER_SIZE=10000 ··· 826 1204 RESOLVER_MAX_CONCURRENT=500 827 1205 RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=10000 # 10 second timeout for HA 828 1206 1207 + # Metrics (recommended for HA monitoring) 1208 + METRICS_ADAPTER=statsd 1209 + METRICS_STATSD_HOST=statsd:8125 1210 + METRICS_PREFIX=quickdid.prod 1211 + METRICS_TAGS=env:prod,service:quickdid,cluster:ha 1212 + 1213 + # Proactive Refresh (recommended for HA) 1214 + PROACTIVE_REFRESH_ENABLED=true 1215 + PROACTIVE_REFRESH_THRESHOLD=0.7 # More aggressive for HA 1216 + 1217 + # Jetstream Consumer (recommended for real-time sync in HA) 1218 + JETSTREAM_ENABLED=true 1219 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 1220 + 829 1221 # Logging 830 1222 RUST_LOG=warn 831 1223 ``` ··· 836 1228 # .env.hybrid 837 1229 # Required 838 1230 HTTP_EXTERNAL=quickdid.example.com 839 - SERVICE_KEY=${SECRET_SERVICE_KEY} 840 1231 841 1232 # Network 842 1233 HTTP_PORT=8080 ··· 867 1258 image: quickdid:latest 868 1259 environment: 869 1260 HTTP_EXTERNAL: quickdid.example.com 870 - SERVICE_KEY: ${SERVICE_KEY} 871 1261 HTTP_PORT: 8080 872 1262 REDIS_URL: redis://redis:6379/0 873 1263 CACHE_TTL_MEMORY: 600 874 1264 CACHE_TTL_REDIS: 86400 875 1265 QUEUE_ADAPTER: redis 876 1266 QUEUE_REDIS_TIMEOUT: 5 1267 + JETSTREAM_ENABLED: true 1268 + JETSTREAM_HOSTNAME: jetstream.atproto.tools 877 1269 RUST_LOG: info 878 1270 ports: 879 1271 - "8080:8080" ··· 896 1288 image: quickdid:latest 897 1289 environment: 898 1290 HTTP_EXTERNAL: quickdid.example.com 899 - SERVICE_KEY: ${SERVICE_KEY} 900 1291 HTTP_PORT: 8080 901 1292 SQLITE_URL: sqlite:/data/quickdid.db 902 1293 CACHE_TTL_MEMORY: 600 ··· 904 1295 QUEUE_ADAPTER: sqlite 905 1296 QUEUE_BUFFER_SIZE: 5000 906 1297 QUEUE_SQLITE_MAX_SIZE: 10000 1298 + JETSTREAM_ENABLED: true 1299 + JETSTREAM_HOSTNAME: jetstream.atproto.tools 907 1300 RUST_LOG: info 908 1301 ports: 909 1302 - "8080:8080" ··· 922 1315 ### Required Fields 923 1316 924 1317 1. **HTTP_EXTERNAL**: Must be provided 925 - 2. **SERVICE_KEY**: Must be provided 1318 + 2. **HTTP_EXTERNAL**: Must be provided 926 1319 927 1320 ### Value Constraints 928 1321 ··· 967 1360 968 1361 ```bash 969 1362 # Validate configuration 970 - HTTP_EXTERNAL=test SERVICE_KEY=test quickdid --help 1363 + HTTP_EXTERNAL=test quickdid --help 971 1364 972 1365 # Test with specific values 973 1366 CACHE_TTL_MEMORY=0 quickdid --help # Will fail validation 974 1367 975 1368 # Check parsed configuration (with debug logging) 976 - RUST_LOG=debug HTTP_EXTERNAL=test SERVICE_KEY=test quickdid 1369 + RUST_LOG=debug HTTP_EXTERNAL=test quickdid 977 1370 ``` 978 1371 979 1372 ## Best Practices 980 1373 981 1374 ### Security 982 1375 983 - 1. **Never commit SERVICE_KEY** to version control 984 - 2. Use environment-specific key management (Vault, AWS Secrets, etc.) 985 - 3. Rotate SERVICE_KEY regularly 986 - 4. Use TLS for Redis connections in production (`rediss://`) 1376 + 1. Use environment-specific configuration management 1377 + 2. Use TLS for Redis connections in production (`rediss://`) 1378 + 3. Never commit sensitive configuration to version control 987 1379 5. Implement network segmentation for Redis access 988 1380 989 1381 ### Performance ··· 1000 1392 2. **Single-instance deployments**: Use SQLite for persistent caching and queuing 1001 1393 3. **Development/testing**: Use memory-only caching with MPSC queuing 1002 1394 4. **Hybrid setups**: Configure both Redis and SQLite for redundancy 1003 - 5. **Queue adapter guidelines**: 1395 + 5. **Real-time sync**: Enable Jetstream consumer for live cache updates 1396 + 6. **Queue adapter guidelines**: 1004 1397 - Redis: Best for multi-instance deployments with distributed processing 1005 1398 - SQLite: Best for single-instance deployments needing persistence 1006 1399 - MPSC: Best for single-instance deployments without persistence needs 1007 - 6. **Cache TTL guidelines**: 1400 + 7. **Cache TTL guidelines**: 1008 1401 - Redis: Shorter TTLs (1-7 days) for frequently updated handles 1009 1402 - SQLite: Longer TTLs (7-90 days) for stable single-instance caching 1010 1403 - Memory: Short TTLs (5-30 minutes) as fallback 1404 + 8. **Jetstream guidelines**: 1405 + - Production: Enable for real-time cache synchronization 1406 + - High-traffic: Essential for reducing stale data 1407 + - Development: Can be disabled for simpler testing 1408 + - Monitor WebSocket connection health in production 1011 1409 1012 1410 ### Monitoring 1013 1411 ··· 1019 1417 ### Deployment 1020 1418 1021 1419 1. Use `.env` files for local development 1022 - 2. Use secrets management for production SERVICE_KEY 1420 + 2. Use secrets management for production configurations 1023 1421 3. Set resource limits in container orchestration 1024 1422 4. Use health checks to monitor service availability 1025 1423 5. Implement gradual rollouts with feature flags
+117 -19
docs/production-deployment.md
··· 42 42 # - localhost:3007 (for testing only) 43 43 HTTP_EXTERNAL=quickdid.example.com 44 44 45 - # Private key for service identity (DID format) 46 - # Generate a new key for production using atproto-identity tools 47 - # SECURITY: Keep this key secure and never commit to version control 48 - # Example formats: 49 - # - did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 50 - # - did:plc:xyz123abc456 51 - SERVICE_KEY=did:key:YOUR_PRODUCTION_KEY_HERE 52 - 53 45 # ---------------------------------------------------------------------------- 54 46 # NETWORK CONFIGURATION 55 47 # ---------------------------------------------------------------------------- ··· 133 125 # Higher = less polling overhead, slower shutdown 134 126 QUEUE_REDIS_TIMEOUT=5 135 127 128 + # Enable deduplication for Redis queue to prevent duplicate handles (default: false) 129 + # When enabled, uses Redis SET with TTL to track handles being processed 130 + # Prevents the same handle from being queued multiple times within the TTL window 131 + QUEUE_REDIS_DEDUP_ENABLED=false 132 + 133 + # TTL for Redis queue deduplication keys in seconds (default: 60) 134 + # Range: 10-300 recommended 135 + # Determines how long to prevent duplicate handle resolution requests 136 + QUEUE_REDIS_DEDUP_TTL=60 137 + 136 138 # Worker ID for Redis queue (defaults to "worker1") 137 139 # Set this for predictable worker identification in multi-instance deployments 138 140 # Examples: worker-001, prod-us-east-1, $(hostname) ··· 158 160 # Identifies your service to other AT Protocol services 159 161 # Default: Auto-generated with current version from Cargo.toml 160 162 # Format: quickdid/{version} (+https://github.com/smokesignal.events/quickdid) 161 - USER_AGENT=quickdid/1.0.0-rc.3 (+https://quickdid.example.com) 163 + USER_AGENT=quickdid/1.0.0-rc.5 (+https://quickdid.example.com) 162 164 163 165 # Custom DNS nameservers (comma-separated) 164 166 # Use for custom DNS resolution or to bypass local DNS ··· 239 241 CACHE_MIN_FRESH=3600 240 242 241 243 # ---------------------------------------------------------------------------- 244 + # METRICS CONFIGURATION 245 + # ---------------------------------------------------------------------------- 246 + 247 + # Metrics adapter type: 'noop' or 'statsd' (default: noop) 248 + # - 'noop': No metrics collection (default) 249 + # - 'statsd': Send metrics to StatsD server 250 + METRICS_ADAPTER=statsd 251 + 252 + # StatsD host and port (required when METRICS_ADAPTER=statsd) 253 + # Format: hostname:port 254 + # Examples: 255 + # - localhost:8125 (local StatsD) 256 + # - statsd.example.com:8125 (remote StatsD) 257 + METRICS_STATSD_HOST=localhost:8125 258 + 259 + # Bind address for StatsD UDP socket (default: [::]:0) 260 + # Controls which local address to bind for sending UDP packets 261 + # Examples: 262 + # - [::]:0 (IPv6 any address, random port - default) 263 + # - 0.0.0.0:0 (IPv4 any address, random port) 264 + # - 192.168.1.100:0 (specific interface) 265 + METRICS_STATSD_BIND=[::]:0 266 + 267 + # Prefix for all metrics (default: quickdid) 268 + # Used to namespace metrics in your monitoring system 269 + # Examples: 270 + # - quickdid (default) 271 + # - prod.quickdid 272 + # - us-east-1.quickdid 273 + METRICS_PREFIX=quickdid 274 + 275 + # Tags for all metrics (comma-separated key:value pairs) 276 + # Added to all metrics for filtering and grouping 277 + # Examples: 278 + # - env:production,service:quickdid 279 + # - env:staging,region:us-east-1,version:1.0.0 280 + METRICS_TAGS=env:production,service:quickdid 281 + 282 + # ---------------------------------------------------------------------------- 283 + # PROACTIVE REFRESH CONFIGURATION 284 + # ---------------------------------------------------------------------------- 285 + 286 + # Enable proactive cache refresh (default: false) 287 + # When enabled, cache entries nearing expiration are automatically refreshed 288 + # in the background to prevent cache misses for frequently accessed handles 289 + PROACTIVE_REFRESH_ENABLED=false 290 + 291 + # Threshold for proactive refresh as percentage of TTL (default: 0.8) 292 + # Range: 0.0-1.0 (0% to 100% of TTL) 293 + # Example: 0.8 means refresh when 80% of TTL has elapsed 294 + # Lower values = more aggressive refreshing, higher load 295 + # Higher values = less aggressive refreshing, more cache misses 296 + PROACTIVE_REFRESH_THRESHOLD=0.8 297 + 298 + # ---------------------------------------------------------------------------- 299 + # JETSTREAM CONSUMER CONFIGURATION 300 + # ---------------------------------------------------------------------------- 301 + 302 + # Enable Jetstream consumer for real-time cache updates (default: false) 303 + # When enabled, connects to AT Protocol firehose for live updates 304 + # Processes Account events (deleted/deactivated) and Identity events (handle changes) 305 + # Automatically reconnects with exponential backoff on connection failures 306 + JETSTREAM_ENABLED=false 307 + 308 + # Jetstream WebSocket hostname (default: jetstream.atproto.tools) 309 + # The firehose service to connect to for real-time AT Protocol events 310 + # Examples: 311 + # - jetstream.atproto.tools (production firehose) 312 + # - jetstream-staging.atproto.tools (staging environment) 313 + # - localhost:6008 (local development) 314 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 315 + 316 + # ---------------------------------------------------------------------------- 317 + # STATIC FILES CONFIGURATION 318 + # ---------------------------------------------------------------------------- 319 + 320 + # Directory path for serving static files (default: www) 321 + # This directory should contain: 322 + # - index.html (landing page) 323 + # - .well-known/atproto-did (service DID identifier) 324 + # - .well-known/did.json (DID document) 325 + # In Docker, this defaults to /app/www 326 + # You can mount custom files via Docker volumes 327 + STATIC_FILES_DIR=/app/www 328 + 329 + # ---------------------------------------------------------------------------- 242 330 # PERFORMANCE TUNING 243 331 # ---------------------------------------------------------------------------- 244 332 ··· 343 431 344 432 ## Docker Compose Setup 345 433 346 - ### Redis-based Production Setup 434 + ### Redis-based Production Setup with Jetstream 347 435 348 - Create a `docker-compose.yml` file for a complete production setup with Redis: 436 + Create a `docker-compose.yml` file for a complete production setup with Redis and optional Jetstream consumer: 349 437 350 438 ```yaml 351 439 version: '3.8' ··· 434 522 driver: local 435 523 ``` 436 524 437 - ### SQLite-based Single-Instance Setup 525 + ### SQLite-based Single-Instance Setup with Jetstream 438 526 439 - For single-instance deployments without Redis, create a simpler `docker-compose.sqlite.yml`: 527 + For single-instance deployments without Redis, create a simpler `docker-compose.sqlite.yml` with optional Jetstream consumer: 440 528 441 529 ```yaml 442 530 version: '3.8' ··· 447 535 container_name: quickdid-sqlite 448 536 environment: 449 537 HTTP_EXTERNAL: quickdid.example.com 450 - SERVICE_KEY: ${SERVICE_KEY} 451 538 HTTP_PORT: 8080 452 539 SQLITE_URL: sqlite:/data/quickdid.db 453 540 CACHE_TTL_MEMORY: 600 ··· 455 542 QUEUE_ADAPTER: sqlite 456 543 QUEUE_BUFFER_SIZE: 5000 457 544 QUEUE_SQLITE_MAX_SIZE: 10000 545 + # Optional: Enable Jetstream for real-time cache updates 546 + # JETSTREAM_ENABLED: true 547 + # JETSTREAM_HOSTNAME: jetstream.atproto.tools 458 548 RUST_LOG: info 459 549 ports: 460 550 - "8080:8080" ··· 648 738 649 739 ### 1. Service Key Protection 650 740 651 - - **Never commit** the `SERVICE_KEY` to version control 741 + - **Never commit** sensitive configuration to version control 652 742 - Store keys in a secure secret management system (e.g., HashiCorp Vault, AWS Secrets Manager) 653 743 - Rotate keys regularly 654 744 - Use different keys for different environments ··· 693 783 docker logs quickdid 694 784 695 785 # Verify environment variables 696 - docker exec quickdid env | grep -E "HTTP_EXTERNAL|SERVICE_KEY" 786 + docker exec quickdid env | grep -E "HTTP_EXTERNAL|HTTP_PORT" 697 787 698 788 # Test Redis connectivity 699 789 docker exec quickdid redis-cli -h redis ping ··· 836 926 2. **SQLite** (persistent, best for single-instance) 837 927 3. **Memory** (fast, but lost on restart) 838 928 929 + **Real-time Updates with Jetstream**: When `JETSTREAM_ENABLED=true`, QuickDID: 930 + - Connects to AT Protocol firehose for live cache updates 931 + - Processes Account events to purge deleted/deactivated accounts 932 + - Processes Identity events to update handle-to-DID mappings 933 + - Automatically reconnects with exponential backoff on failures 934 + - Tracks metrics for successful and failed event processing 935 + 839 936 **Recommendations by Deployment Type**: 840 937 - **Single instance, persistent**: Use SQLite for both caching and queuing (`SQLITE_URL=sqlite:./quickdid.db`, `QUEUE_ADAPTER=sqlite`) 841 938 - **Multi-instance, HA**: Use Redis for both caching and queuing (`REDIS_URL=redis://redis:6379/0`, `QUEUE_ADAPTER=redis`) 939 + - **Real-time sync**: Enable Jetstream consumer (`JETSTREAM_ENABLED=true`) for live cache updates 842 940 - **Testing/development**: Use memory-only caching with MPSC queuing (`QUEUE_ADAPTER=mpsc`) 843 941 - **Hybrid**: Configure both Redis and SQLite for redundancy 844 942 ··· 878 976 ### Required Fields 879 977 880 978 - **HTTP_EXTERNAL**: Must be provided 881 - - **SERVICE_KEY**: Must be provided 979 + - **HTTP_EXTERNAL**: Must be provided 882 980 883 981 ### Value Constraints 884 982 ··· 917 1015 918 1016 ```bash 919 1017 # Validate configuration without starting service 920 - HTTP_EXTERNAL=test SERVICE_KEY=test quickdid --help 1018 + HTTP_EXTERNAL=test quickdid --help 921 1019 922 1020 # Test with specific values (will fail validation) 923 1021 CACHE_TTL_MEMORY=0 quickdid --help 924 1022 925 1023 # Debug configuration parsing 926 - RUST_LOG=debug HTTP_EXTERNAL=test SERVICE_KEY=test quickdid 1024 + RUST_LOG=debug HTTP_EXTERNAL=test quickdid 927 1025 ``` 928 1026 929 1027 ## Support and Resources
+714
docs/telegraf-timescaledb-metrics-guide.md
··· 1 + # Telegraf and TimescaleDB Metrics Collection Guide 2 + 3 + This guide demonstrates how to set up a metrics collection pipeline using Telegraf to collect StatsD metrics and store them in PostgreSQL with TimescaleDB using Docker Compose. 4 + 5 + ## Overview 6 + 7 + This setup creates a metrics pipeline that: 8 + - Collects StatsD metrics via Telegraf on UDP port 8125 9 + - Creates individual PostgreSQL tables for each metric type 10 + - Stores metric tags as JSONB for flexible querying 11 + - Automatically creates hypertables for time-series optimization 12 + - Provides a complete Docker Compose configuration for easy deployment 13 + 14 + ## Important Note on Table Structure 15 + 16 + The Telegraf PostgreSQL output plugin with the configuration in this guide creates **individual tables for each metric name**. For example: 17 + - `quickdid.http.request.count` becomes table `"quickdid.http.request.count"` 18 + - `quickdid.resolver.rate_limit.available_permits` becomes table `"quickdid.resolver.rate_limit.available_permits"` 19 + 20 + Each table has the following structure: 21 + - `time` (timestamptz) - The timestamp of the metric 22 + - `tags` (jsonb) - All tags stored as a JSON object 23 + - Metric-specific columns for values (e.g., `value`, `mean`, `p99`, etc.) 24 + 25 + ## Prerequisites 26 + 27 + - Docker and Docker Compose installed 28 + - Basic understanding of StatsD metrics format 29 + - Familiarity with PostgreSQL/TimescaleDB concepts 30 + 31 + ## Project Structure 32 + 33 + Create the following directory structure: 34 + 35 + ``` 36 + metrics-stack/ 37 + โ”œโ”€โ”€ docker-compose.yml 38 + โ”œโ”€โ”€ telegraf/ 39 + โ”‚ โ””โ”€โ”€ telegraf.conf 40 + โ”œโ”€โ”€ test-scripts/ 41 + โ”‚ โ”œโ”€โ”€ send-metrics.sh 42 + โ”‚ โ””โ”€โ”€ verify-queries.sql 43 + โ””โ”€โ”€ .env 44 + ``` 45 + 46 + ## Configuration Files 47 + 48 + ### 1. Environment Variables (.env) 49 + 50 + Create a `.env` file to store sensitive configuration: 51 + 52 + ```env 53 + # PostgreSQL/TimescaleDB Configuration 54 + POSTGRES_DB=metrics 55 + POSTGRES_USER=postgres 56 + POSTGRES_PASSWORD=secretpassword 57 + 58 + # Telegraf Database User 59 + TELEGRAF_DB_USER=postgres 60 + TELEGRAF_DB_PASSWORD=secretpassword 61 + 62 + # TimescaleDB Settings 63 + TIMESCALE_TELEMETRY=off 64 + ``` 65 + 66 + ### 2. Telegraf Configuration (telegraf/telegraf.conf) 67 + 68 + Create the Telegraf configuration file: 69 + 70 + ```toml 71 + # Global Telegraf Agent Configuration 72 + [agent] 73 + interval = "10s" 74 + round_interval = true 75 + metric_batch_size = 1000 76 + metric_buffer_limit = 10000 77 + collection_jitter = "0s" 78 + flush_interval = "10s" 79 + flush_jitter = "0s" 80 + precision = "" 81 + debug = false 82 + quiet = false 83 + hostname = "telegraf-agent" 84 + omit_hostname = false 85 + 86 + # StatsD Input Plugin 87 + [[inputs.statsd]] 88 + service_address = ":8125" # Listen on UDP port 8125 for StatsD metrics 89 + protocol = "udp" 90 + delete_gauges = true 91 + delete_counters = true 92 + delete_sets = true 93 + delete_timings = true 94 + percentiles = [50, 90, 95, 99] 95 + metric_separator = "." 96 + allowed_pending_messages = 10000 97 + datadog_extensions = true 98 + datadog_distributions = true 99 + 100 + # PostgreSQL (TimescaleDB) Output Plugin 101 + [[outputs.postgresql]] 102 + connection = "host=timescaledb user=${TELEGRAF_DB_USER} password=${TELEGRAF_DB_PASSWORD} dbname=${POSTGRES_DB} sslmode=disable" 103 + schema = "public" 104 + 105 + # Create individual tables for each metric with hypertable support 106 + create_templates = [ 107 + '''CREATE TABLE IF NOT EXISTS {{.table}} ({{.columns}})''', 108 + '''SELECT create_hypertable({{.table|quoteLiteral}}, 'time', if_not_exists => TRUE)''', 109 + ] 110 + 111 + # Store all tags as JSONB for flexible querying 112 + tags_as_jsonb = true 113 + 114 + # Keep fields as separate columns for better performance on aggregations 115 + fields_as_jsonb = false 116 + ``` 117 + 118 + ### 3. Docker Compose Configuration (docker-compose.yml) 119 + 120 + Create the Docker Compose file: 121 + 122 + ```yaml 123 + version: '3.8' 124 + 125 + services: 126 + timescaledb: 127 + image: timescale/timescaledb:latest-pg17 128 + container_name: timescaledb 129 + restart: unless-stopped 130 + environment: 131 + POSTGRES_DB: ${POSTGRES_DB} 132 + POSTGRES_USER: ${POSTGRES_USER} 133 + POSTGRES_PASSWORD: ${POSTGRES_PASSWORD} 134 + TIMESCALE_TELEMETRY: ${TIMESCALE_TELEMETRY} 135 + ports: 136 + - "5442:5432" 137 + volumes: 138 + - timescale_data:/home/postgres/pgdata/data 139 + - ./init-scripts:/docker-entrypoint-initdb.d:ro 140 + command: 141 + - postgres 142 + - -c 143 + - shared_buffers=1GB 144 + - -c 145 + - effective_cache_size=3GB 146 + - -c 147 + - maintenance_work_mem=512MB 148 + - -c 149 + - work_mem=32MB 150 + - -c 151 + - timescaledb.max_background_workers=8 152 + - -c 153 + - max_parallel_workers_per_gather=2 154 + - -c 155 + - max_parallel_workers=8 156 + healthcheck: 157 + test: ["CMD-SHELL", "pg_isready -U ${POSTGRES_USER} -d ${POSTGRES_DB}"] 158 + interval: 10s 159 + timeout: 5s 160 + retries: 5 161 + networks: 162 + - metrics_network 163 + 164 + telegraf: 165 + image: telegraf:1.35 166 + container_name: telegraf 167 + restart: unless-stopped 168 + environment: 169 + TELEGRAF_DB_USER: ${TELEGRAF_DB_USER} 170 + TELEGRAF_DB_PASSWORD: ${TELEGRAF_DB_PASSWORD} 171 + POSTGRES_DB: ${POSTGRES_DB} 172 + ports: 173 + - "8125:8125/udp" # StatsD UDP port 174 + volumes: 175 + - ./telegraf/telegraf.conf:/etc/telegraf/telegraf.conf:ro 176 + depends_on: 177 + timescaledb: 178 + condition: service_healthy 179 + networks: 180 + - metrics_network 181 + command: ["telegraf", "--config", "/etc/telegraf/telegraf.conf"] 182 + 183 + redis: 184 + image: redis:7-alpine 185 + container_name: redis 186 + restart: unless-stopped 187 + ports: 188 + - "6379:6379" 189 + volumes: 190 + - redis_data:/data 191 + command: redis-server --appendonly yes --appendfsync everysec 192 + healthcheck: 193 + test: ["CMD", "redis-cli", "ping"] 194 + interval: 10s 195 + timeout: 5s 196 + retries: 5 197 + networks: 198 + - metrics_network 199 + 200 + networks: 201 + metrics_network: 202 + driver: bridge 203 + 204 + volumes: 205 + timescale_data: 206 + redis_data: 207 + ``` 208 + 209 + ### 4. Database Initialization Script (optional) 210 + 211 + Create `init-scripts/01-init.sql` to set up the TimescaleDB extension: 212 + 213 + ```sql 214 + -- Enable TimescaleDB extension 215 + CREATE EXTENSION IF NOT EXISTS timescaledb; 216 + 217 + -- Enable additional useful extensions 218 + CREATE EXTENSION IF NOT EXISTS pg_stat_statements; 219 + ``` 220 + 221 + ## Test Scripts 222 + 223 + ### 1. Send Test Metrics Script (test-scripts/send-metrics.sh) 224 + 225 + Create a script to send various types of metrics: 226 + 227 + ```bash 228 + #!/bin/bash 229 + 230 + # Send test metrics to StatsD/Telegraf 231 + 232 + echo "Sending test metrics to StatsD on localhost:8125..." 233 + 234 + # Counter metrics 235 + for i in {1..10}; do 236 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 237 + echo "quickdid.http.request.count:1|c|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 238 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:404" | nc -u -w0 localhost 8125 239 + done 240 + 241 + # Gauge metrics 242 + echo "quickdid.resolver.rate_limit.available_permits:10|g" | nc -u -w0 localhost 8125 243 + echo "quickdid.resolver.rate_limit.available_permits:8|g" | nc -u -w0 localhost 8125 244 + echo "quickdid.resolver.rate_limit.available_permits:5|g" | nc -u -w0 localhost 8125 245 + 246 + # Timing metrics (in milliseconds) 247 + for i in {1..20}; do 248 + duration=$((RANDOM % 100 + 10)) 249 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 250 + done 251 + 252 + for i in {1..10}; do 253 + duration=$((RANDOM % 200 + 50)) 254 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 255 + done 256 + 257 + # Histogram metrics 258 + for i in {1..15}; do 259 + resolution_time=$((RANDOM % 500 + 50)) 260 + echo "quickdid.resolver.resolution_time:${resolution_time}|h|#resolver:redis" | nc -u -w0 localhost 8125 261 + echo "quickdid.resolver.resolution_time:$((resolution_time * 2))|h|#resolver:base" | nc -u -w0 localhost 8125 262 + done 263 + 264 + # Cache metrics 265 + echo "quickdid.cache.hit.count:45|c|#cache_type:redis" | nc -u -w0 localhost 8125 266 + echo "quickdid.cache.miss.count:5|c|#cache_type:redis" | nc -u -w0 localhost 8125 267 + echo "quickdid.cache.size:1024|g|#cache_type:memory" | nc -u -w0 localhost 8125 268 + 269 + echo "Metrics sent! Wait 15 seconds for Telegraf to flush..." 270 + sleep 15 271 + echo "Done!" 272 + ``` 273 + 274 + ### 2. Verify Queries Script (test-scripts/verify-queries.sql) 275 + 276 + Create a SQL script to verify all queries work correctly: 277 + 278 + ```sql 279 + -- Test script to verify all metrics queries work correctly 280 + -- Run this after sending test metrics with send-metrics.sh 281 + 282 + \echo '===== CHECKING AVAILABLE TABLES =====' 283 + SELECT table_name 284 + FROM information_schema.tables 285 + WHERE table_schema = 'public' 286 + AND table_name LIKE 'quickdid%' 287 + ORDER BY table_name; 288 + 289 + \echo '' 290 + \echo '===== CHECKING TABLE STRUCTURES =====' 291 + \echo 'Structure of quickdid.http.request.count table:' 292 + \d "quickdid.http.request.count" 293 + 294 + \echo '' 295 + \echo 'Structure of quickdid.http.request.duration_ms table:' 296 + \d "quickdid.http.request.duration_ms" 297 + 298 + \echo '' 299 + \echo '===== QUERY 1: Recent HTTP Request Counts =====' 300 + SELECT 301 + time, 302 + tags, 303 + tags->>'method' as method, 304 + tags->>'path' as path, 305 + tags->>'status' as status, 306 + value 307 + FROM "quickdid.http.request.count" 308 + WHERE time > NOW() - INTERVAL '1 hour' 309 + ORDER BY time DESC 310 + LIMIT 10; 311 + 312 + \echo '' 313 + \echo '===== QUERY 2: HTTP Request Duration Statistics by Endpoint =====' 314 + SELECT 315 + time_bucket('1 minute', time) AS minute, 316 + tags->>'method' as method, 317 + tags->>'path' as path, 318 + tags->>'status' as status, 319 + COUNT(*) as request_count, 320 + AVG(mean) as avg_duration_ms, 321 + MAX(p99) as p99_duration_ms, 322 + MIN(mean) as min_duration_ms 323 + FROM "quickdid.http.request.duration_ms" 324 + WHERE time > NOW() - INTERVAL '1 hour' 325 + AND tags IS NOT NULL 326 + GROUP BY minute, tags->>'method', tags->>'path', tags->>'status' 327 + ORDER BY minute DESC 328 + LIMIT 10; 329 + 330 + \echo '' 331 + \echo '===== QUERY 3: Rate Limiter Status Over Time =====' 332 + SELECT 333 + time, 334 + value as available_permits 335 + FROM "quickdid.resolver.rate_limit.available_permits" 336 + WHERE time > NOW() - INTERVAL '1 hour' 337 + ORDER BY time DESC 338 + LIMIT 10; 339 + 340 + \echo '' 341 + \echo '===== QUERY 4: Resolver Performance Comparison =====' 342 + SELECT 343 + tags->>'resolver' as resolver_type, 344 + COUNT(*) as sample_count, 345 + AVG(mean) as avg_resolution_time_ms, 346 + MAX(p99) as p99_resolution_time_ms, 347 + MIN(mean) as min_resolution_time_ms 348 + FROM "quickdid.resolver.resolution_time" 349 + WHERE time > NOW() - INTERVAL '1 hour' 350 + AND tags->>'resolver' IS NOT NULL 351 + GROUP BY tags->>'resolver' 352 + ORDER BY avg_resolution_time_ms; 353 + 354 + \echo '' 355 + \echo '===== QUERY 5: Cache Hit Rate Analysis =====' 356 + WITH cache_stats AS ( 357 + SELECT 358 + 'hits' as metric_type, 359 + SUM(value) as total_count 360 + FROM "quickdid.cache.hit.count" 361 + WHERE time > NOW() - INTERVAL '1 hour' 362 + UNION ALL 363 + SELECT 364 + 'misses' as metric_type, 365 + SUM(value) as total_count 366 + FROM "quickdid.cache.miss.count" 367 + WHERE time > NOW() - INTERVAL '1 hour' 368 + ) 369 + SELECT 370 + SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) as total_hits, 371 + SUM(CASE WHEN metric_type = 'misses' THEN total_count ELSE 0 END) as total_misses, 372 + CASE 373 + WHEN SUM(total_count) > 0 THEN 374 + ROUND(100.0 * SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) / SUM(total_count), 2) 375 + ELSE 0 376 + END as hit_rate_percentage 377 + FROM cache_stats; 378 + 379 + \echo '' 380 + \echo '===== QUERY 6: Hypertable Information =====' 381 + SELECT 382 + hypertable_schema, 383 + hypertable_name, 384 + owner, 385 + num_dimensions, 386 + num_chunks, 387 + compression_enabled 388 + FROM timescaledb_information.hypertables 389 + WHERE hypertable_name LIKE 'quickdid%' 390 + ORDER BY hypertable_name; 391 + 392 + \echo '' 393 + \echo '===== QUERY 7: HTTP Error Rate by Endpoint =====' 394 + WITH status_counts AS ( 395 + SELECT 396 + time_bucket('5 minutes', time) as period, 397 + tags->>'path' as path, 398 + CASE 399 + WHEN (tags->>'status')::int >= 400 THEN 'error' 400 + ELSE 'success' 401 + END as status_category, 402 + SUM(value) as request_count 403 + FROM "quickdid.http.request.count" 404 + WHERE time > NOW() - INTERVAL '1 hour' 405 + GROUP BY period, path, status_category 406 + ) 407 + SELECT 408 + period, 409 + path, 410 + SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) as error_count, 411 + SUM(CASE WHEN status_category = 'success' THEN request_count ELSE 0 END) as success_count, 412 + CASE 413 + WHEN SUM(request_count) > 0 THEN 414 + ROUND(100.0 * SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) / SUM(request_count), 2) 415 + ELSE 0 416 + END as error_rate_percentage 417 + FROM status_counts 418 + GROUP BY period, path 419 + HAVING SUM(request_count) > 0 420 + ORDER BY period DESC, error_rate_percentage DESC; 421 + 422 + \echo '' 423 + \echo '===== TEST COMPLETED =====' 424 + ``` 425 + 426 + ## Usage 427 + 428 + ### Starting the Stack 429 + 430 + 1. Navigate to your project directory: 431 + ```bash 432 + cd metrics-stack 433 + ``` 434 + 435 + 2. Make the test scripts executable: 436 + ```bash 437 + chmod +x test-scripts/send-metrics.sh 438 + ``` 439 + 440 + 3. Start the services: 441 + ```bash 442 + docker-compose up -d 443 + ``` 444 + 445 + 4. Check the logs to ensure everything is running: 446 + ```bash 447 + docker-compose logs -f 448 + ``` 449 + 450 + 5. Wait for services to be fully ready (about 30 seconds) 451 + 452 + ### Running the Test Suite 453 + 454 + 1. Send test metrics: 455 + ```bash 456 + ./test-scripts/send-metrics.sh 457 + ``` 458 + 459 + 2. Verify all queries work: 460 + ```bash 461 + docker exec -i timescaledb psql -U postgres -d metrics < test-scripts/verify-queries.sql 462 + ``` 463 + 464 + ### Manual Querying 465 + 466 + Connect to TimescaleDB to run queries manually: 467 + 468 + ```bash 469 + # Connect to the database 470 + docker exec -it timescaledb psql -U postgres -d metrics 471 + 472 + # List all metric tables 473 + \dt "quickdid*" 474 + 475 + # Describe a specific table structure 476 + \d "quickdid.http.request.duration_ms" 477 + 478 + # Query with JSONB tag filtering 479 + SELECT 480 + time, 481 + tags->>'method' as method, 482 + mean as avg_ms, 483 + '99_percentile' as p99_ms 484 + FROM "quickdid.http.request.duration_ms" 485 + WHERE tags @> '{"method": "GET"}'::jsonb 486 + AND time > NOW() - INTERVAL '1 hour' 487 + ORDER BY time DESC 488 + LIMIT 10; 489 + ``` 490 + 491 + ## Advanced Configuration 492 + 493 + ### Continuous Aggregates for Performance 494 + 495 + Create continuous aggregates for frequently queried data: 496 + 497 + ```sql 498 + -- Create hourly aggregates for HTTP metrics 499 + CREATE MATERIALIZED VIEW http_metrics_hourly 500 + WITH (timescaledb.continuous) AS 501 + SELECT 502 + time_bucket('1 hour', time) AS hour, 503 + tags->>'method' as method, 504 + tags->>'path' as path, 505 + tags->>'status' as status, 506 + COUNT(*) as request_count, 507 + AVG(mean) as avg_duration_ms, 508 + MAX('99_percentile') as p99_duration_ms, 509 + MIN(mean) as min_duration_ms 510 + FROM "quickdid.http.request.duration_ms" 511 + WHERE tags IS NOT NULL 512 + GROUP BY hour, method, path, status 513 + WITH NO DATA; 514 + 515 + -- Add refresh policy 516 + SELECT add_continuous_aggregate_policy('http_metrics_hourly', 517 + start_offset => INTERVAL '3 hours', 518 + end_offset => INTERVAL '1 hour', 519 + schedule_interval => INTERVAL '1 hour'); 520 + 521 + -- Manually refresh to populate initial data 522 + CALL refresh_continuous_aggregate('http_metrics_hourly', NULL, NULL); 523 + 524 + -- Query the aggregate 525 + SELECT * FROM http_metrics_hourly 526 + ORDER BY hour DESC, request_count DESC 527 + LIMIT 20; 528 + ``` 529 + 530 + ### Data Retention Policies 531 + 532 + Set up automatic data retention: 533 + 534 + ```sql 535 + -- Add retention policy to drop data older than 30 days 536 + SELECT add_retention_policy('"quickdid.http.request.count"', INTERVAL '30 days'); 537 + SELECT add_retention_policy('"quickdid.http.request.duration_ms"', INTERVAL '30 days'); 538 + 539 + -- View retention policies 540 + SELECT js.* FROM timescaledb_information.job_stats js 541 + JOIN timescaledb_information.jobs j ON js.job_id = j.job_id 542 + WHERE j.proc_name LIKE '%retention%'; 543 + ``` 544 + 545 + ### Compression for Storage Optimization 546 + 547 + Enable compression for older data: 548 + 549 + ```sql 550 + -- Enable compression on a hypertable 551 + ALTER TABLE "quickdid.http.request.duration_ms" SET ( 552 + timescaledb.compress, 553 + timescaledb.compress_segmentby = 'tags' 554 + ); 555 + 556 + -- Add compression policy (compress chunks older than 7 days) 557 + SELECT add_compression_policy('"quickdid.http.request.duration_ms"', INTERVAL '7 days'); 558 + 559 + -- Manually compress old chunks 560 + SELECT compress_chunk(format('%I.%I', c.chunk_schema, c.chunk_name)::regclass) 561 + FROM timescaledb_information.chunks c 562 + WHERE c.hypertable_name = 'quickdid.http.request.duration_ms' 563 + AND c.range_end < NOW() - INTERVAL '7 days' 564 + AND NOT c.is_compressed; 565 + 566 + -- Check compression status 567 + SELECT 568 + hypertable_name, 569 + uncompressed_total_bytes, 570 + compressed_total_bytes, 571 + compression_ratio 572 + FROM timescaledb_information.hypertable_compression_stats 573 + WHERE hypertable_name LIKE 'quickdid%'; 574 + ``` 575 + 576 + ## Monitoring and Maintenance 577 + 578 + ### Health Checks 579 + 580 + ```sql 581 + -- Check chunk distribution 582 + SELECT 583 + hypertable_name, 584 + chunk_name, 585 + range_start, 586 + range_end, 587 + is_compressed, 588 + pg_size_pretty(total_bytes) as size 589 + FROM timescaledb_information.chunks 590 + WHERE hypertable_name LIKE 'quickdid%' 591 + ORDER BY hypertable_name, range_start DESC 592 + LIMIT 20; 593 + 594 + -- Check background jobs 595 + SELECT 596 + job_id, 597 + application_name, 598 + job_type, 599 + schedule_interval, 600 + last_run_started_at, 601 + last_successful_finish, 602 + next_scheduled_run 603 + FROM timescaledb_information.job_stats 604 + ORDER BY job_id; 605 + 606 + -- Check table sizes 607 + SELECT 608 + hypertable_name, 609 + chunks_total_size, 610 + chunks_compressed_size, 611 + chunks_uncompressed_size 612 + FROM timescaledb_information.hypertables 613 + WHERE hypertable_name LIKE 'quickdid%'; 614 + ``` 615 + 616 + ### Troubleshooting 617 + 618 + 1. **Tables not being created:** 619 + - Check Telegraf logs: `docker-compose logs telegraf | grep -i error` 620 + - Verify PostgreSQL connectivity: `docker exec telegraf telegraf --test` 621 + - Ensure metrics are being received: `docker-compose logs telegraf | grep statsd` 622 + 623 + 2. **Queries returning no data:** 624 + - Verify tables exist: `\dt "quickdid*"` in psql 625 + - Check table contents: `SELECT COUNT(*) FROM "quickdid.http.request.count";` 626 + - Verify time ranges in WHERE clauses 627 + 628 + 3. **Performance issues:** 629 + - Check if hypertables are created: Query `timescaledb_information.hypertables` 630 + - Verify compression is working if enabled 631 + - Consider creating appropriate indexes on JSONB paths: 632 + ```sql 633 + CREATE INDEX idx_http_method ON "quickdid.http.request.duration_ms" ((tags->>'method')); 634 + CREATE INDEX idx_http_path ON "quickdid.http.request.duration_ms" ((tags->>'path')); 635 + ``` 636 + 637 + ## Integration with QuickDID 638 + 639 + To integrate with QuickDID, configure it to send metrics to the Telegraf StatsD endpoint: 640 + 641 + ```bash 642 + # Set environment variables for QuickDID 643 + export METRICS_ADAPTER=statsd 644 + export METRICS_STATSD_HOST=localhost:8125 645 + export METRICS_PREFIX=quickdid. 646 + export METRICS_TAGS=env:production,service:quickdid 647 + 648 + # Start QuickDID 649 + cargo run 650 + ``` 651 + 652 + QuickDID will automatically send metrics to Telegraf, which will store them in TimescaleDB for analysis. 653 + 654 + ## Key Differences from Generic Metrics Table Approach 655 + 656 + This configuration creates **individual tables per metric** instead of a single generic metrics table. Benefits include: 657 + 658 + 1. **Better performance**: Each metric has its own optimized schema 659 + 2. **Clearer data model**: Tables directly represent metrics 660 + 3. **Easier querying**: No need to filter by metric name 661 + 4. **Type safety**: Each metric's fields have appropriate types 662 + 5. **Efficient compression**: Per-metric compression strategies 663 + 664 + Trade-offs: 665 + - More tables to manage (mitigated by TimescaleDB automation) 666 + - Need to know metric names upfront for queries 667 + - Schema changes require table alterations 668 + 669 + ## Security Considerations 670 + 671 + 1. **Use strong passwords:** Update the default passwords in `.env` 672 + 2. **Enable SSL:** Configure `sslmode=require` in production 673 + 3. **Network isolation:** Use Docker networks to isolate services 674 + 4. **Access control:** Create separate database users with minimal permissions: 675 + ```sql 676 + CREATE USER metrics_reader WITH PASSWORD 'readonly_password'; 677 + GRANT CONNECT ON DATABASE metrics TO metrics_reader; 678 + GRANT USAGE ON SCHEMA public TO metrics_reader; 679 + GRANT SELECT ON ALL TABLES IN SCHEMA public TO metrics_reader; 680 + ``` 681 + 5. **Regular updates:** Keep Docker images updated for security patches 682 + 683 + ## Performance Tuning 684 + 685 + ### PostgreSQL/TimescaleDB Settings 686 + 687 + The docker-compose.yml includes optimized settings. Adjust based on your hardware: 688 + 689 + - `shared_buffers`: 25% of system RAM 690 + - `effective_cache_size`: 75% of system RAM 691 + - `maintenance_work_mem`: 5% of system RAM 692 + - `work_mem`: RAM / max_connections / 2 693 + 694 + ### Telegraf Buffer Settings 695 + 696 + For high-volume metrics, adjust in telegraf.conf: 697 + 698 + ```toml 699 + [agent] 700 + metric_batch_size = 5000 # Increase for high volume 701 + metric_buffer_limit = 100000 # Increase buffer size 702 + flush_interval = "5s" # Decrease for more frequent writes 703 + ``` 704 + 705 + ## Conclusion 706 + 707 + This setup provides a robust metrics collection and storage solution with: 708 + - **Individual metric tables** for optimal performance and clarity 709 + - **JSONB tag storage** for flexible querying 710 + - **TimescaleDB hypertables** for efficient time-series storage 711 + - **Comprehensive test suite** to verify functionality 712 + - **Production-ready configuration** with compression and retention policies 713 + 714 + The system correctly handles StatsD metrics from QuickDID and provides powerful querying capabilities through PostgreSQL's JSONB support and TimescaleDB's time-series functions.
+59
generate-wellknown.sh
··· 1 + #!/bin/bash 2 + 3 + # Script to generate .well-known static files based on QuickDID configuration 4 + # Usage: HTTP_EXTERNAL=quickdid.smokesignal.tools ./generate-wellknown.sh 5 + # 6 + # Note: Since we no longer process SERVICE_KEY, you'll need to manually 7 + # add the public key to the did.json file if you need DID document support. 8 + 9 + set -e 10 + 11 + # Check required environment variables 12 + if [ -z "$HTTP_EXTERNAL" ]; then 13 + echo "Error: HTTP_EXTERNAL environment variable is required" 14 + echo "Usage: HTTP_EXTERNAL=example.com ./generate-wellknown.sh" 15 + exit 1 16 + fi 17 + 18 + # Ensure www/.well-known directory exists 19 + mkdir -p www/.well-known 20 + 21 + # Generate service DID from HTTP_EXTERNAL 22 + if [[ "$HTTP_EXTERNAL" == *":"* ]]; then 23 + # Contains port - URL encode the colon 24 + SERVICE_DID="did:web:${HTTP_EXTERNAL//:/%3A}" 25 + else 26 + SERVICE_DID="did:web:$HTTP_EXTERNAL" 27 + fi 28 + 29 + echo "Generating .well-known files for $SERVICE_DID" 30 + 31 + # Write atproto-did file 32 + echo "$SERVICE_DID" > www/.well-known/atproto-did 33 + echo "Created: www/.well-known/atproto-did" 34 + 35 + # Create a basic did.json template 36 + # Note: You'll need to manually add the publicKeyMultibase if you need DID document support 37 + 38 + cat > www/.well-known/did.json <<EOF 39 + { 40 + "@context": [ 41 + "https://www.w3.org/ns/did/v1", 42 + "https://w3id.org/security/multikey/v1" 43 + ], 44 + "id": "$SERVICE_DID", 45 + "verificationMethod": [], 46 + "service": [ 47 + { 48 + "id": "${SERVICE_DID}#quickdid", 49 + "type": "QuickDIDService", 50 + "serviceEndpoint": "https://${HTTP_EXTERNAL}" 51 + } 52 + ] 53 + } 54 + EOF 55 + 56 + echo "Created: www/.well-known/did.json" 57 + echo "" 58 + echo "Note: The did.json file is a basic template. If you need DID document support," 59 + echo "you'll need to manually add the verificationMethod with your public key."
+18
railway-resources/telegraf/Dockerfile
··· 1 + # Telegraf Dockerfile for Railway Deployment 2 + FROM telegraf:1.33-alpine 3 + 4 + # Install additional packages for health checks 5 + RUN apk add --no-cache curl postgresql-client 6 + 7 + # Create directories for custom configs 8 + RUN mkdir -p /etc/telegraf/telegraf.d 9 + 10 + # Copy main configuration 11 + COPY railway-resources/telegraf/telegraf.conf /etc/telegraf/telegraf.conf 12 + 13 + # Health check - test configuration validity 14 + HEALTHCHECK --interval=30s --timeout=5s --start-period=10s --retries=3 \ 15 + CMD telegraf --config /etc/telegraf/telegraf.conf --test || exit 1 16 + 17 + # Run telegraf with custom config 18 + CMD ["telegraf", "--config", "/etc/telegraf/telegraf.conf", "--config-directory", "/etc/telegraf/telegraf.d"]
+48
railway-resources/telegraf/railway.toml
··· 1 + # Railway configuration for Telegraf service 2 + # This file configures how Railway builds and deploys the Telegraf metrics collector 3 + 4 + [build] 5 + # Use Dockerfile for building 6 + builder = "DOCKERFILE" 7 + dockerfilePath = "railway-resources/telegraf/Dockerfile" 8 + 9 + [deploy] 10 + # Start command (handled by Dockerfile CMD) 11 + startCommand = "telegraf --config /etc/telegraf/telegraf.conf" 12 + 13 + # No health check path for Telegraf (uses container health check) 14 + # healthcheckPath = "" 15 + 16 + # Restart policy 17 + restartPolicyType = "ALWAYS" 18 + restartPolicyMaxRetries = 10 19 + 20 + # Resource limits 21 + memoryLimitMB = 1024 22 + cpuLimitCores = 1 23 + 24 + # Scaling (Telegraf should be singleton) 25 + minReplicas = 1 26 + maxReplicas = 1 27 + 28 + # Graceful shutdown 29 + stopTimeout = 10 30 + 31 + # Service configuration for StatsD UDP endpoint 32 + [[services]] 33 + name = "telegraf-statsd" 34 + port = 8125 35 + protocol = "UDP" 36 + internalPort = 8125 37 + 38 + # Service configuration for Telegraf HTTP API (optional) 39 + [[services]] 40 + name = "telegraf-http" 41 + port = 8086 42 + protocol = "HTTP" 43 + internalPort = 8086 44 + 45 + # Environment-specific settings 46 + [environments.production] 47 + memoryLimitMB = 512 48 + cpuLimitCores = 1
+77
railway-resources/telegraf/telegraf.conf
··· 1 + # Telegraf Configuration for QuickDID Metrics Collection 2 + # Optimized for Railway deployment with TimescaleDB 3 + 4 + # Global tags applied to all metrics 5 + [global_tags] 6 + environment = "${ENVIRONMENT:-production}" 7 + service = "quickdid" 8 + region = "${RAILWAY_REGION:-us-west1}" 9 + deployment_id = "${RAILWAY_DEPLOYMENT_ID:-unknown}" 10 + 11 + # Agent configuration 12 + [agent] 13 + ## Default data collection interval 14 + interval = "10s" 15 + 16 + ## Rounds collection interval to interval 17 + round_interval = true 18 + 19 + ## Telegraf will send metrics to outputs in batches of at most metric_batch_size metrics. 20 + metric_batch_size = 1000 21 + 22 + ## Maximum number of unwritten metrics per output 23 + metric_buffer_limit = 10000 24 + 25 + ## Collection jitter is used to jitter the collection by a random amount 26 + collection_jitter = "0s" 27 + 28 + ## Default flushing interval for all outputs 29 + flush_interval = "10s" 30 + 31 + ## Jitter the flush interval by a random amount 32 + flush_jitter = "0s" 33 + 34 + ## Precision of timestamps 35 + precision = "1ms" 36 + 37 + ## Log level 38 + debug = ${TELEGRAF_DEBUG:-false} 39 + quiet = ${TELEGRAF_QUIET:-false} 40 + 41 + ## Override default hostname 42 + hostname = "${HOSTNAME:-telegraf}" 43 + 44 + ## If true, do not set the "host" tag in the telegraf agent 45 + omit_hostname = false 46 + 47 + ############################################################################### 48 + # INPUT PLUGINS # 49 + ############################################################################### 50 + 51 + # StatsD Server - receives metrics from QuickDID 52 + [[inputs.statsd]] 53 + service_address = ":8125" # Listen on UDP port 8125 for StatsD metrics 54 + protocol = "udp" 55 + delete_gauges = true 56 + delete_counters = true 57 + delete_sets = true 58 + delete_timings = true 59 + percentiles = [50, 90, 95, 99] 60 + metric_separator = "." 61 + allowed_pending_messages = 100 62 + datadog_extensions = true 63 + datadog_distributions = true 64 + 65 + [[outputs.postgresql]] 66 + connection = "${DATABASE_URL}" 67 + 68 + schema = "public" 69 + 70 + create_templates = [ 71 + '''CREATE TABLE IF NOT EXISTS {{.table}} ({{.columns}})''', 72 + '''SELECT create_hypertable({{.table|quoteLiteral}}, 'time', if_not_exists => TRUE)''', 73 + ] 74 + 75 + tags_as_jsonb = true 76 + 77 + fields_as_jsonb = false
+285 -65
src/bin/quickdid.rs
··· 1 1 use anyhow::Result; 2 2 use atproto_identity::{ 3 3 config::{CertificateBundles, DnsNameservers}, 4 - key::{identify_key, to_public}, 5 4 resolve::HickoryDnsResolver, 6 5 }; 6 + use atproto_jetstream::{Consumer as JetstreamConsumer, ConsumerTaskConfig}; 7 + use atproto_lexicon::resolve::{DefaultLexiconResolver, LexiconResolver}; 7 8 use quickdid::{ 8 9 cache::create_redis_pool, 9 10 config::Config, 10 11 handle_resolver::{ 11 - create_base_resolver, create_caching_resolver, create_rate_limited_resolver_with_timeout, 12 + create_base_resolver, create_caching_resolver, 13 + create_proactive_refresh_resolver_with_metrics, create_rate_limited_resolver_with_timeout, 12 14 create_redis_resolver_with_ttl, create_sqlite_resolver_with_ttl, 13 15 }, 14 16 handle_resolver_task::{HandleResolverTaskConfig, create_handle_resolver_task_with_config}, 15 17 http::{AppContext, create_router}, 18 + jetstream_handler::QuickDidEventHandler, 19 + lexicon_resolver::create_redis_lexicon_resolver_with_ttl, 20 + metrics::create_metrics_publisher, 16 21 queue::{ 17 22 HandleResolutionWork, QueueAdapter, create_mpsc_queue_from_channel, create_noop_queue, 18 - create_redis_queue, create_sqlite_queue, create_sqlite_queue_with_max_size, 23 + create_redis_queue, create_redis_queue_with_dedup, create_sqlite_queue, 24 + create_sqlite_queue_with_max_size, 19 25 }, 20 26 sqlite_schema::create_sqlite_pool, 21 27 task_manager::spawn_cancellable_task, 22 28 }; 23 - use serde_json::json; 24 29 use std::sync::Arc; 25 30 use tokio::signal; 26 31 use tokio_util::{sync::CancellationToken, task::TaskTracker}; ··· 76 81 println!(" -V, --version Print version information"); 77 82 println!(); 78 83 println!("ENVIRONMENT VARIABLES:"); 79 - println!(" SERVICE_KEY Private key for service identity (required)"); 80 84 println!( 81 85 " HTTP_EXTERNAL External hostname for service endpoints (required)" 82 86 ); ··· 114 118 " QUEUE_REDIS_PREFIX Redis key prefix for queues (default: queue:handleresolver:)" 115 119 ); 116 120 println!(" QUEUE_REDIS_TIMEOUT Queue blocking timeout in seconds (default: 5)"); 121 + println!( 122 + " QUEUE_REDIS_DEDUP_ENABLED Enable queue deduplication (default: false)" 123 + ); 124 + println!(" QUEUE_REDIS_DEDUP_TTL TTL for dedup keys in seconds (default: 60)"); 117 125 println!(" QUEUE_WORKER_ID Worker ID for Redis queue (default: worker1)"); 118 126 println!(" QUEUE_BUFFER_SIZE Buffer size for MPSC queue (default: 1000)"); 119 127 println!(" QUEUE_SQLITE_MAX_SIZE Maximum SQLite queue size (default: 10000)"); ··· 126 134 " RESOLVER_MAX_CONCURRENT_TIMEOUT_MS Timeout for acquiring permits in ms (default: 0 = no timeout)" 127 135 ); 128 136 println!(); 137 + println!(" METRICS:"); 138 + println!( 139 + " METRICS_ADAPTER Metrics adapter: 'noop' or 'statsd' (default: noop)" 140 + ); 141 + println!( 142 + " METRICS_STATSD_HOST StatsD host when using statsd adapter (e.g., localhost:8125)" 143 + ); 144 + println!( 145 + " METRICS_STATSD_BIND Bind address for StatsD UDP socket (default: [::]:0)" 146 + ); 147 + println!(" METRICS_PREFIX Prefix for all metrics (default: quickdid)"); 148 + println!( 149 + " METRICS_TAGS Default tags for metrics (comma-separated key:value pairs)" 150 + ); 151 + println!(); 152 + println!(" PROACTIVE CACHE REFRESH:"); 153 + println!( 154 + " PROACTIVE_REFRESH_ENABLED Enable proactive cache refresh (default: false)" 155 + ); 156 + println!( 157 + " PROACTIVE_REFRESH_THRESHOLD Threshold as percentage of TTL (0.0-1.0, default: 0.8)" 158 + ); 159 + println!(); 160 + println!(" JETSTREAM:"); 161 + println!(" JETSTREAM_ENABLED Enable Jetstream consumer (default: false)"); 162 + println!( 163 + " JETSTREAM_HOSTNAME Jetstream hostname (default: jetstream.atproto.tools)" 164 + ); 165 + println!(); 129 166 println!( 130 167 "For more information, visit: https://github.com/smokesignal.events/quickdid" 131 168 ); ··· 161 198 config.validate()?; 162 199 163 200 tracing::info!("Starting QuickDID service on port {}", config.http_port); 164 - tracing::info!("Service DID: {}", config.service_did); 165 201 tracing::info!( 166 202 "Cache TTL - Memory: {}s, Redis: {}s, SQLite: {}s", 167 203 config.cache_ttl_memory, ··· 196 232 // Create DNS resolver 197 233 let dns_resolver = HickoryDnsResolver::create_resolver(dns_nameservers.as_ref()); 198 234 199 - // Process service key 200 - let private_service_key_data = identify_key(&config.service_key)?; 201 - let public_service_key_data = to_public(&private_service_key_data)?; 202 - let public_service_key = public_service_key_data.to_string(); 203 - 204 - // Create service DID document 205 - let service_document = json!({ 206 - "@context": vec!["https://www.w3.org/ns/did/v1", "https://w3id.org/security/multikey/v1"], 207 - "id": config.service_did.clone(), 208 - "verificationMethod": [{ 209 - "id": format!("{}#atproto", config.service_did), 210 - "type": "Multikey", 211 - "controller": config.service_did.clone(), 212 - "publicKeyMultibase": public_service_key 213 - }], 214 - "service": [] 215 - }); 235 + // Clone DNS resolver for lexicon resolution before wrapping in Arc 236 + let lexicon_dns_resolver = dns_resolver.clone(); 216 237 217 - // Create DNS resolver Arc for sharing 238 + // Wrap DNS resolver in Arc for handle resolution 218 239 let dns_resolver_arc = Arc::new(dns_resolver); 219 240 241 + // Create metrics publisher based on configuration 242 + let metrics_publisher = create_metrics_publisher(&config).map_err(|e| { 243 + tracing::error!("Failed to create metrics publisher: {}", e); 244 + anyhow::anyhow!("Failed to create metrics publisher: {}", e) 245 + })?; 246 + 247 + tracing::info!( 248 + "Metrics publisher created with {} adapter", 249 + config.metrics_adapter 250 + ); 251 + 252 + metrics_publisher.gauge("server", 1).await; 253 + 220 254 // Create base handle resolver using factory function 221 - let mut base_handle_resolver = 222 - create_base_resolver(dns_resolver_arc.clone(), http_client.clone()); 255 + let mut base_handle_resolver = create_base_resolver( 256 + dns_resolver_arc.clone(), 257 + http_client.clone(), 258 + metrics_publisher.clone(), 259 + ); 223 260 224 261 // Apply rate limiting if configured 225 262 if config.resolver_max_concurrent > 0 { ··· 237 274 base_handle_resolver, 238 275 config.resolver_max_concurrent, 239 276 config.resolver_max_concurrent_timeout_ms, 277 + metrics_publisher.clone(), 240 278 ); 241 279 } 242 280 ··· 253 291 None 254 292 }; 255 293 256 - // Create handle resolver with cache priority: Redis > SQLite > In-memory 257 - let handle_resolver: Arc<dyn quickdid::handle_resolver::HandleResolver> = 258 - if let Some(pool) = redis_pool { 259 - tracing::info!( 260 - "Using Redis-backed handle resolver with {}-second cache TTL", 261 - config.cache_ttl_redis 262 - ); 263 - create_redis_resolver_with_ttl(base_handle_resolver, pool, config.cache_ttl_redis) 264 - } else if let Some(pool) = sqlite_pool { 265 - tracing::info!( 266 - "Using SQLite-backed handle resolver with {}-second cache TTL", 267 - config.cache_ttl_sqlite 268 - ); 269 - create_sqlite_resolver_with_ttl(base_handle_resolver, pool, config.cache_ttl_sqlite) 270 - } else { 271 - tracing::info!( 272 - "Using in-memory handle resolver with {}-second cache TTL", 273 - config.cache_ttl_memory 274 - ); 275 - create_caching_resolver(base_handle_resolver, config.cache_ttl_memory) 276 - }; 277 - 278 294 // Create task tracker and cancellation token 279 295 let tracker = TaskTracker::new(); 280 296 let token = CancellationToken::new(); 281 297 282 - // Setup background handle resolution task and get the queue adapter 298 + // Create the queue adapter first (needed for proactive refresh) 283 299 let handle_queue: Arc<dyn QueueAdapter<HandleResolutionWork>> = { 284 300 // Create queue adapter based on configuration 285 301 let adapter: Arc<dyn QueueAdapter<HandleResolutionWork>> = match config ··· 296 312 if let Some(url) = queue_redis_url { 297 313 if let Some(pool) = try_create_redis_pool(url, "queue adapter") { 298 314 tracing::info!( 299 - "Creating Redis queue adapter with prefix: {}", 300 - config.queue_redis_prefix 315 + "Creating Redis queue adapter with prefix: {}, dedup: {}, dedup_ttl: {}s", 316 + config.queue_redis_prefix, 317 + config.queue_redis_dedup_enabled, 318 + config.queue_redis_dedup_ttl 301 319 ); 302 - create_redis_queue::<HandleResolutionWork>( 303 - pool, 304 - config.queue_worker_id.clone(), 305 - config.queue_redis_prefix.clone(), 306 - config.queue_redis_timeout, 307 - ) 320 + if config.queue_redis_dedup_enabled { 321 + create_redis_queue_with_dedup::<HandleResolutionWork>( 322 + pool, 323 + config.queue_worker_id.clone(), 324 + config.queue_redis_prefix.clone(), 325 + config.queue_redis_timeout, 326 + true, 327 + config.queue_redis_dedup_ttl, 328 + ) 329 + } else { 330 + create_redis_queue::<HandleResolutionWork>( 331 + pool, 332 + config.queue_worker_id.clone(), 333 + config.queue_redis_prefix.clone(), 334 + config.queue_redis_timeout, 335 + ) 336 + } 308 337 } else { 309 338 tracing::warn!("Falling back to MPSC queue adapter"); 310 339 // Fall back to MPSC if Redis fails ··· 381 410 } 382 411 }; 383 412 384 - // Keep a reference to the adapter for the AppContext 385 - let adapter_for_context = adapter.clone(); 413 + adapter 414 + }; 415 + 416 + // Create handle resolver with cache priority: Redis > SQLite > In-memory 417 + let (mut handle_resolver, cache_ttl): ( 418 + Arc<dyn quickdid::handle_resolver::HandleResolver>, 419 + u64, 420 + ) = if let Some(ref pool) = redis_pool { 421 + tracing::info!( 422 + "Using Redis-backed handle resolver with {}-second cache TTL", 423 + config.cache_ttl_redis 424 + ); 425 + ( 426 + create_redis_resolver_with_ttl( 427 + base_handle_resolver, 428 + pool.clone(), 429 + config.cache_ttl_redis, 430 + metrics_publisher.clone(), 431 + ), 432 + config.cache_ttl_redis, 433 + ) 434 + } else if let Some(pool) = sqlite_pool { 435 + tracing::info!( 436 + "Using SQLite-backed handle resolver with {}-second cache TTL", 437 + config.cache_ttl_sqlite 438 + ); 439 + ( 440 + create_sqlite_resolver_with_ttl( 441 + base_handle_resolver, 442 + pool, 443 + config.cache_ttl_sqlite, 444 + metrics_publisher.clone(), 445 + ), 446 + config.cache_ttl_sqlite, 447 + ) 448 + } else { 449 + tracing::info!( 450 + "Using in-memory handle resolver with {}-second cache TTL", 451 + config.cache_ttl_memory 452 + ); 453 + ( 454 + create_caching_resolver( 455 + base_handle_resolver, 456 + config.cache_ttl_memory, 457 + metrics_publisher.clone(), 458 + ), 459 + config.cache_ttl_memory, 460 + ) 461 + }; 462 + 463 + // Apply proactive refresh if enabled 464 + if config.proactive_refresh_enabled && !matches!(config.queue_adapter.as_str(), "noop" | "none") 465 + { 466 + tracing::info!( 467 + "Enabling proactive cache refresh with {}% threshold", 468 + (config.proactive_refresh_threshold * 100.0) as u32 469 + ); 470 + handle_resolver = create_proactive_refresh_resolver_with_metrics( 471 + handle_resolver, 472 + handle_queue.clone(), 473 + metrics_publisher.clone(), 474 + cache_ttl, 475 + config.proactive_refresh_threshold, 476 + ); 477 + } else if config.proactive_refresh_enabled { 478 + tracing::warn!( 479 + "Proactive refresh enabled but queue adapter is no-op, skipping proactive refresh" 480 + ); 481 + } 482 + 483 + // Create lexicon resolver with Redis caching if available 484 + let lexicon_resolver: Arc<dyn LexiconResolver> = { 485 + let base_lexicon_resolver: Arc<dyn LexiconResolver> = Arc::new( 486 + DefaultLexiconResolver::new(http_client.clone(), lexicon_dns_resolver), 487 + ); 488 + 489 + if let Some(ref pool) = redis_pool { 490 + tracing::info!( 491 + "Using Redis-backed lexicon resolver with {}-second cache TTL", 492 + config.cache_ttl_redis 493 + ); 494 + create_redis_lexicon_resolver_with_ttl( 495 + base_lexicon_resolver, 496 + pool.clone(), 497 + config.cache_ttl_redis, 498 + metrics_publisher.clone(), 499 + ) 500 + } else { 501 + tracing::info!("Using base lexicon resolver without caching"); 502 + base_lexicon_resolver 503 + } 504 + }; 505 + 506 + // Setup background handle resolution task 507 + { 508 + let adapter_for_task = handle_queue.clone(); 386 509 387 510 // Only spawn handle resolver task if not using noop adapter 388 511 if !matches!(config.queue_adapter.as_str(), "noop" | "none") { ··· 393 516 394 517 // Create and start handle resolver task 395 518 let handle_task = create_handle_resolver_task_with_config( 396 - adapter, 519 + adapter_for_task, 397 520 handle_resolver.clone(), 398 521 token.clone(), 399 522 handle_task_config, 523 + metrics_publisher.clone(), 400 524 ); 401 525 402 526 // Spawn the handle resolver task ··· 429 553 } else { 430 554 tracing::info!("Background handle resolution task disabled (using no-op adapter)"); 431 555 } 432 - 433 - // Return the adapter to be used in AppContext 434 - adapter_for_context 435 556 }; 436 557 437 558 // Create app context with the queue adapter 438 559 let app_context = AppContext::new( 439 - service_document, 440 - config.service_did.clone(), 441 560 handle_resolver.clone(), 442 561 handle_queue, 562 + lexicon_resolver, 563 + metrics_publisher.clone(), 443 564 config.etag_seed.clone(), 444 565 config.cache_control_header.clone(), 566 + config.static_files_dir.clone(), 445 567 ); 446 568 447 569 // Create router ··· 488 610 signal_token.cancel(); 489 611 tracing::info!("Signal handler task completed"); 490 612 }); 613 + } 614 + 615 + // Start Jetstream consumer if enabled 616 + if config.jetstream_enabled { 617 + let jetstream_resolver = handle_resolver.clone(); 618 + let jetstream_metrics = metrics_publisher.clone(); 619 + let jetstream_hostname = config.jetstream_hostname.clone(); 620 + let jetstream_user_agent = config.user_agent.clone(); 621 + 622 + spawn_cancellable_task( 623 + &tracker, 624 + token.clone(), 625 + "jetstream_consumer", 626 + move |cancel_token| async move { 627 + tracing::info!(hostname = %jetstream_hostname, "Starting Jetstream consumer"); 628 + 629 + // Create event handler 630 + let event_handler = Arc::new(QuickDidEventHandler::new( 631 + jetstream_resolver, 632 + jetstream_metrics.clone(), 633 + )); 634 + 635 + // Reconnection loop 636 + let mut reconnect_count = 0u32; 637 + let max_reconnects_per_minute = 5; 638 + let reconnect_window = std::time::Duration::from_secs(60); 639 + let mut last_disconnect = std::time::Instant::now() - reconnect_window; 640 + 641 + while !cancel_token.is_cancelled() { 642 + let now = std::time::Instant::now(); 643 + if now.duration_since(last_disconnect) < reconnect_window { 644 + reconnect_count += 1; 645 + if reconnect_count > max_reconnects_per_minute { 646 + tracing::warn!( 647 + count = reconnect_count, 648 + "Too many Jetstream reconnects, waiting 60 seconds" 649 + ); 650 + tokio::time::sleep(reconnect_window).await; 651 + reconnect_count = 0; 652 + last_disconnect = now; 653 + continue; 654 + } 655 + } else { 656 + reconnect_count = 0; 657 + } 658 + 659 + // Create consumer configuration 660 + let consumer_config = ConsumerTaskConfig { 661 + user_agent: jetstream_user_agent.clone(), 662 + compression: false, 663 + zstd_dictionary_location: String::new(), 664 + jetstream_hostname: jetstream_hostname.clone(), 665 + // Listen to the "community.lexicon.collection.fake" collection 666 + // so that we keep an active connection open but only for 667 + // account and identity events. 668 + collections: vec!["community.lexicon.collection.fake".to_string()], // Listen to all collections 669 + dids: vec![], 670 + max_message_size_bytes: None, 671 + cursor: None, 672 + require_hello: true, 673 + }; 674 + 675 + let consumer = JetstreamConsumer::new(consumer_config); 676 + 677 + // Register event handler 678 + if let Err(e) = consumer.register_handler(event_handler.clone()).await { 679 + tracing::error!(error = ?e, "Failed to register Jetstream event handler"); 680 + continue; 681 + } 682 + 683 + // Run consumer with cancellation support 684 + match consumer.run_background(cancel_token.clone()).await { 685 + Ok(()) => { 686 + tracing::info!("Jetstream consumer stopped normally"); 687 + if cancel_token.is_cancelled() { 688 + break; 689 + } 690 + last_disconnect = std::time::Instant::now(); 691 + tokio::time::sleep(std::time::Duration::from_secs(5)).await; 692 + } 693 + Err(e) => { 694 + tracing::error!(error = ?e, "Jetstream consumer connection failed, will reconnect"); 695 + jetstream_metrics.incr("jetstream.connection.error").await; 696 + last_disconnect = std::time::Instant::now(); 697 + 698 + if !cancel_token.is_cancelled() { 699 + tokio::time::sleep(std::time::Duration::from_secs(5)).await; 700 + } 701 + } 702 + } 703 + } 704 + 705 + tracing::info!("Jetstream consumer task shutting down"); 706 + Ok(()) 707 + }, 708 + ); 709 + } else { 710 + tracing::info!("Jetstream consumer disabled"); 491 711 } 492 712 493 713 // Start HTTP server with cancellation support
+106 -32
src/config.rs
··· 13 13 //! ```bash 14 14 //! # Minimal configuration 15 15 //! HTTP_EXTERNAL=quickdid.example.com \ 16 - //! SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK \ 17 16 //! quickdid 18 17 //! 19 18 //! # Full configuration with Redis and custom settings 20 19 //! HTTP_EXTERNAL=quickdid.example.com \ 21 - //! SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK \ 22 20 //! HTTP_PORT=3000 \ 23 21 //! REDIS_URL=redis://localhost:6379 \ 24 22 //! CACHE_TTL_MEMORY=300 \ ··· 38 36 pub enum ConfigError { 39 37 /// Missing required environment variable or command-line argument 40 38 /// 41 - /// Example: When SERVICE_KEY or HTTP_EXTERNAL are not provided 39 + /// Example: When HTTP_EXTERNAL is not provided 42 40 #[error("error-quickdid-config-1 Missing required environment variable: {0}")] 43 41 MissingRequired(String), 44 42 ··· 97 95 /// config.validate()?; 98 96 /// 99 97 /// println!("Service running at: {}", config.http_external); 100 - /// println!("Service DID: {}", config.service_did); 101 98 /// # Ok(()) 102 99 /// # } 103 100 /// ``` ··· 112 109 /// External hostname for service endpoints (e.g., "quickdid.example.com") 113 110 pub http_external: String, 114 111 115 - /// Private key for service identity (e.g., "did:key:z42tm...") 116 - pub service_key: String, 117 - 118 112 /// HTTP User-Agent for outgoing requests (e.g., "quickdid/1.0.0 (+https://...)") 119 113 pub user_agent: String, 120 114 121 - /// Derived service DID (e.g., "did:web:quickdid.example.com") 122 - /// Automatically generated from http_external with proper encoding 123 - pub service_did: String, 124 - 125 115 /// Custom DNS nameservers, comma-separated (e.g., "8.8.8.8,8.8.4.4") 126 116 pub dns_nameservers: Option<String>, 127 117 ··· 161 151 /// Redis blocking timeout for queue operations in seconds (e.g., 5) 162 152 pub queue_redis_timeout: u64, 163 153 154 + /// Enable deduplication for Redis queue to prevent duplicate handles 155 + /// Default: false 156 + pub queue_redis_dedup_enabled: bool, 157 + 158 + /// TTL for Redis queue deduplication keys in seconds 159 + /// Default: 60 (1 minute) 160 + pub queue_redis_dedup_ttl: u64, 161 + 164 162 /// Maximum queue size for SQLite adapter work shedding (e.g., 10000) 165 163 /// When exceeded, oldest entries are deleted to maintain this limit. 166 164 /// Set to 0 to disable work shedding (unlimited queue size). ··· 211 209 /// Calculated at startup for efficiency. 212 210 /// None if cache_max_age is 0 (disabled). 213 211 pub cache_control_header: Option<String>, 212 + 213 + /// Metrics adapter type: "noop" or "statsd" 214 + /// Default: "noop" (no metrics collection) 215 + pub metrics_adapter: String, 216 + 217 + /// StatsD host for metrics collection (e.g., "localhost:8125") 218 + /// Required when metrics_adapter is "statsd" 219 + pub metrics_statsd_host: Option<String>, 220 + 221 + /// Bind address for StatsD UDP socket (e.g., "0.0.0.0:0" for IPv4 or "[::]:0" for IPv6) 222 + /// Default: "[::]:0" (IPv6 any address, random port) 223 + pub metrics_statsd_bind: String, 224 + 225 + /// Metrics prefix for all metrics (e.g., "quickdid") 226 + /// Default: "quickdid" 227 + pub metrics_prefix: String, 228 + 229 + /// Default tags for all metrics (comma-separated key:value pairs) 230 + /// Example: "env:production,service:quickdid" 231 + pub metrics_tags: Option<String>, 232 + 233 + /// Enable proactive cache refresh for frequently accessed handles. 234 + /// When enabled, cache entries that have reached the refresh threshold 235 + /// will be queued for background refresh to keep the cache warm. 236 + /// Default: false 237 + pub proactive_refresh_enabled: bool, 238 + 239 + /// Threshold as a percentage (0.0-1.0) of cache TTL when to trigger proactive refresh. 240 + /// For example, 0.8 means refresh when an entry has lived for 80% of its TTL. 241 + /// Default: 0.8 (80%) 242 + pub proactive_refresh_threshold: f64, 243 + 244 + /// Directory path for serving static files. 245 + /// When set, the root handler will serve files from this directory. 246 + /// Default: "www" (relative to working directory) 247 + pub static_files_dir: String, 248 + 249 + /// Enable Jetstream consumer for AT Protocol events. 250 + /// When enabled, the service will consume Account and Identity events 251 + /// to maintain cache consistency. 252 + /// Default: false 253 + pub jetstream_enabled: bool, 254 + 255 + /// Jetstream WebSocket hostname for consuming AT Protocol events. 256 + /// Example: "jetstream.atproto.tools" or "jetstream1.us-west.bsky.network" 257 + /// Default: "jetstream.atproto.tools" 258 + pub jetstream_hostname: String, 214 259 } 215 260 216 261 impl Config { ··· 218 263 /// 219 264 /// This method: 220 265 /// 1. Reads configuration from environment variables 221 - /// 2. Validates required fields (HTTP_EXTERNAL and SERVICE_KEY) 222 - /// 3. Generates derived values (service_did from http_external) 223 - /// 4. Applies defaults where appropriate 266 + /// 2. Validates required fields (HTTP_EXTERNAL) 267 + /// 3. Applies defaults where appropriate 224 268 /// 225 269 /// ## Example 226 270 /// ··· 231 275 /// // Parse from environment variables 232 276 /// let config = Config::from_env()?; 233 277 /// 234 - /// // The service DID is automatically generated from HTTP_EXTERNAL 235 - /// assert!(config.service_did.starts_with("did:web:")); 236 278 /// # Ok(()) 237 279 /// # } 238 280 /// ``` ··· 241 283 /// 242 284 /// Returns `ConfigError::MissingRequired` if: 243 285 /// - HTTP_EXTERNAL is not provided 244 - /// - SERVICE_KEY is not provided 245 286 pub fn from_env() -> Result<Self, ConfigError> { 246 287 // Required fields 247 288 let http_external = env::var("HTTP_EXTERNAL") ··· 249 290 .filter(|s| !s.is_empty()) 250 291 .ok_or_else(|| ConfigError::MissingRequired("HTTP_EXTERNAL".to_string()))?; 251 292 252 - let service_key = env::var("SERVICE_KEY") 253 - .ok() 254 - .filter(|s| !s.is_empty()) 255 - .ok_or_else(|| ConfigError::MissingRequired("SERVICE_KEY".to_string()))?; 256 - 257 293 // Generate default user agent 258 294 let default_user_agent = format!( 259 295 "quickdid/{} (+https://github.com/smokesignal.events/quickdid)", 260 296 env!("CARGO_PKG_VERSION") 261 297 ); 262 298 263 - // Generate service DID from http_external 264 - let service_did = if http_external.contains(':') { 265 - let encoded_external = http_external.replace(':', "%3A"); 266 - format!("did:web:{}", encoded_external) 267 - } else { 268 - format!("did:web:{}", http_external) 269 - }; 270 - 271 299 let mut config = Config { 272 300 http_port: get_env_or_default("HTTP_PORT", Some("8080")).unwrap(), 273 301 plc_hostname: get_env_or_default("PLC_HOSTNAME", Some("plc.directory")).unwrap(), 274 302 http_external, 275 - service_key, 276 303 user_agent: get_env_or_default("USER_AGENT", None).unwrap_or(default_user_agent), 277 - service_did, 278 304 dns_nameservers: get_env_or_default("DNS_NAMESERVERS", None), 279 305 certificate_bundles: get_env_or_default("CERTIFICATE_BUNDLES", None), 280 306 redis_url: get_env_or_default("REDIS_URL", None), ··· 292 318 cache_ttl_redis: parse_env("CACHE_TTL_REDIS", 7776000)?, 293 319 cache_ttl_sqlite: parse_env("CACHE_TTL_SQLITE", 7776000)?, 294 320 queue_redis_timeout: parse_env("QUEUE_REDIS_TIMEOUT", 5)?, 321 + queue_redis_dedup_enabled: parse_env("QUEUE_REDIS_DEDUP_ENABLED", false)?, 322 + queue_redis_dedup_ttl: parse_env("QUEUE_REDIS_DEDUP_TTL", 60)?, 295 323 queue_sqlite_max_size: parse_env("QUEUE_SQLITE_MAX_SIZE", 10000)?, 296 324 resolver_max_concurrent: parse_env("RESOLVER_MAX_CONCURRENT", 0)?, 297 325 resolver_max_concurrent_timeout_ms: parse_env("RESOLVER_MAX_CONCURRENT_TIMEOUT_MS", 0)?, ··· 302 330 cache_max_stale: parse_env("CACHE_MAX_STALE", 172800)?, // 48 hours 303 331 cache_min_fresh: parse_env("CACHE_MIN_FRESH", 3600)?, // 1 hour 304 332 cache_control_header: None, // Will be calculated below 333 + metrics_adapter: get_env_or_default("METRICS_ADAPTER", Some("noop")).unwrap(), 334 + metrics_statsd_host: get_env_or_default("METRICS_STATSD_HOST", None), 335 + metrics_statsd_bind: get_env_or_default("METRICS_STATSD_BIND", Some("[::]:0")).unwrap(), 336 + metrics_prefix: get_env_or_default("METRICS_PREFIX", Some("quickdid")).unwrap(), 337 + metrics_tags: get_env_or_default("METRICS_TAGS", None), 338 + proactive_refresh_enabled: parse_env("PROACTIVE_REFRESH_ENABLED", false)?, 339 + proactive_refresh_threshold: parse_env("PROACTIVE_REFRESH_THRESHOLD", 0.8)?, 340 + static_files_dir: get_env_or_default("STATIC_FILES_DIR", Some("www")).unwrap(), 341 + jetstream_enabled: parse_env("JETSTREAM_ENABLED", false)?, 342 + jetstream_hostname: get_env_or_default( 343 + "JETSTREAM_HOSTNAME", 344 + Some("jetstream.atproto.tools"), 345 + ) 346 + .unwrap(), 305 347 }; 306 348 307 349 // Calculate the Cache-Control header value if enabled ··· 371 413 "QUEUE_REDIS_TIMEOUT must be > 0".to_string(), 372 414 )); 373 415 } 416 + if self.queue_redis_dedup_enabled && self.queue_redis_dedup_ttl == 0 { 417 + return Err(ConfigError::InvalidTtl( 418 + "QUEUE_REDIS_DEDUP_TTL must be > 0 when deduplication is enabled".to_string(), 419 + )); 420 + } 374 421 match self.queue_adapter.as_str() { 375 422 "mpsc" | "redis" | "sqlite" | "noop" | "none" => {} 376 423 _ => { ··· 390 437 "RESOLVER_MAX_CONCURRENT_TIMEOUT_MS must be <= 60000 (60 seconds)".to_string(), 391 438 )); 392 439 } 440 + 441 + // Validate metrics configuration 442 + match self.metrics_adapter.as_str() { 443 + "noop" | "statsd" => {} 444 + _ => { 445 + return Err(ConfigError::InvalidValue(format!( 446 + "Invalid METRICS_ADAPTER '{}', must be 'noop' or 'statsd'", 447 + self.metrics_adapter 448 + ))); 449 + } 450 + } 451 + 452 + // If statsd is configured, ensure host is provided 453 + if self.metrics_adapter == "statsd" && self.metrics_statsd_host.is_none() { 454 + return Err(ConfigError::MissingRequired( 455 + "METRICS_STATSD_HOST is required when METRICS_ADAPTER is 'statsd'".to_string(), 456 + )); 457 + } 458 + 459 + // Validate proactive refresh threshold 460 + if self.proactive_refresh_threshold < 0.0 || self.proactive_refresh_threshold > 1.0 { 461 + return Err(ConfigError::InvalidValue(format!( 462 + "PROACTIVE_REFRESH_THRESHOLD must be between 0.0 and 1.0, got {}", 463 + self.proactive_refresh_threshold 464 + ))); 465 + } 466 + 393 467 Ok(()) 394 468 } 395 469 }
+50 -9
src/handle_resolver/base.rs
··· 5 5 6 6 use super::errors::HandleResolverError; 7 7 use super::traits::HandleResolver; 8 + use crate::metrics::SharedMetricsPublisher; 8 9 use async_trait::async_trait; 9 10 use atproto_identity::resolve::{DnsResolver, resolve_subject}; 10 11 use reqwest::Client; ··· 25 26 /// use reqwest::Client; 26 27 /// use atproto_identity::resolve::HickoryDnsResolver; 27 28 /// use quickdid::handle_resolver::{create_base_resolver, HandleResolver}; 29 + /// use quickdid::metrics::NoOpMetricsPublisher; 28 30 /// 29 31 /// # async fn example() { 30 32 /// let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 31 33 /// let http_client = Client::new(); 34 + /// let metrics = Arc::new(NoOpMetricsPublisher); 32 35 /// 33 36 /// let resolver = create_base_resolver( 34 37 /// dns_resolver, 35 38 /// http_client, 39 + /// metrics, 36 40 /// ); 37 41 /// 38 42 /// let (did, timestamp) = resolver.resolve("alice.bsky.social").await.unwrap(); ··· 45 49 46 50 /// HTTP client for DID document retrieval and well-known endpoint queries. 47 51 http_client: Client, 52 + 53 + /// Metrics publisher for telemetry. 54 + metrics: SharedMetricsPublisher, 48 55 } 49 56 50 57 #[async_trait] 51 58 impl HandleResolver for BaseHandleResolver { 52 59 async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 53 - let did = resolve_subject(&self.http_client, &*self.dns_resolver, s) 60 + let start_time = std::time::Instant::now(); 61 + 62 + // Perform DNS/HTTP resolution 63 + let result = resolve_subject(&self.http_client, &*self.dns_resolver, s) 54 64 .await 55 - .map_err(|e| HandleResolverError::ResolutionFailed(e.to_string()))?; 56 - 57 - let timestamp = SystemTime::now() 58 - .duration_since(UNIX_EPOCH) 59 - .map_err(|e| HandleResolverError::ResolutionFailed(format!("System time error: {}", e)))? 60 - .as_secs(); 61 - 62 - Ok((did, timestamp)) 65 + .map_err(|e| HandleResolverError::ResolutionFailed(e.to_string())); 66 + 67 + let duration_ms = start_time.elapsed().as_millis() as u64; 68 + 69 + // Publish metrics 70 + 71 + match result { 72 + Ok(did) => { 73 + self.metrics 74 + .time_with_tags( 75 + "resolver.base.duration_ms", 76 + duration_ms, 77 + &[("success", "1")], 78 + ) 79 + .await; 80 + 81 + let timestamp = SystemTime::now() 82 + .duration_since(UNIX_EPOCH) 83 + .map_err(|e| { 84 + HandleResolverError::ResolutionFailed(format!("System time error: {}", e)) 85 + })? 86 + .as_secs(); 87 + 88 + Ok((did, timestamp)) 89 + } 90 + Err(e) => { 91 + self.metrics 92 + .time_with_tags( 93 + "resolver.base.duration_ms", 94 + duration_ms, 95 + &[("success", "0")], 96 + ) 97 + .await; 98 + Err(e) 99 + } 100 + } 63 101 } 64 102 } 65 103 ··· 72 110 /// 73 111 /// * `dns_resolver` - DNS resolver for TXT record lookups 74 112 /// * `http_client` - HTTP client for well-known endpoint queries 113 + /// * `metrics` - Metrics publisher for telemetry 75 114 pub fn create_base_resolver( 76 115 dns_resolver: Arc<dyn DnsResolver>, 77 116 http_client: Client, 117 + metrics: SharedMetricsPublisher, 78 118 ) -> Arc<dyn HandleResolver> { 79 119 Arc::new(BaseHandleResolver { 80 120 dns_resolver, 81 121 http_client, 122 + metrics, 82 123 }) 83 124 }
+3
src/handle_resolver/errors.rs
··· 23 23 /// Mock resolver failure for testing 24 24 #[error("error-quickdid-resolve-4 Mock resolution failure")] 25 25 MockResolutionFailure, 26 + 27 + #[error("error-quickdid-resolve-5 Invalid subject: {0}")] 28 + InvalidSubject(String), 26 29 }
+62 -5
src/handle_resolver/memory.rs
··· 6 6 7 7 use super::errors::HandleResolverError; 8 8 use super::traits::HandleResolver; 9 + use crate::metrics::SharedMetricsPublisher; 9 10 use async_trait::async_trait; 10 11 use std::collections::HashMap; 11 12 use std::sync::Arc; ··· 32 33 /// ```no_run 33 34 /// use std::sync::Arc; 34 35 /// use quickdid::handle_resolver::{create_caching_resolver, create_base_resolver, HandleResolver}; 36 + /// use quickdid::metrics::NoOpMetricsPublisher; 35 37 /// 36 38 /// # async fn example() { 37 39 /// # use atproto_identity::resolve::HickoryDnsResolver; 38 40 /// # use reqwest::Client; 39 41 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 40 42 /// # let http_client = Client::new(); 41 - /// let base_resolver = create_base_resolver(dns_resolver, http_client); 43 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 44 + /// let base_resolver = create_base_resolver(dns_resolver, http_client, metrics.clone()); 42 45 /// let caching_resolver = create_caching_resolver( 43 46 /// base_resolver, 44 - /// 300 // 5 minute TTL 47 + /// 300, // 5 minute TTL 48 + /// metrics 45 49 /// ); 46 50 /// 47 51 /// // First call hits the underlying resolver ··· 55 59 inner: Arc<dyn HandleResolver>, 56 60 cache: Arc<RwLock<HashMap<String, ResolveHandleResult>>>, 57 61 ttl_seconds: u64, 62 + metrics: SharedMetricsPublisher, 58 63 } 59 64 60 65 impl CachingHandleResolver { ··· 64 69 /// 65 70 /// * `inner` - The underlying resolver to use for actual resolution 66 71 /// * `ttl_seconds` - How long to cache results in seconds 67 - pub fn new(inner: Arc<dyn HandleResolver>, ttl_seconds: u64) -> Self { 72 + /// * `metrics` - Metrics publisher for telemetry 73 + pub fn new( 74 + inner: Arc<dyn HandleResolver>, 75 + ttl_seconds: u64, 76 + metrics: SharedMetricsPublisher, 77 + ) -> Self { 68 78 Self { 69 79 inner, 70 80 cache: Arc::new(RwLock::new(HashMap::new())), 71 81 ttl_seconds, 82 + metrics, 72 83 } 73 84 } 74 85 ··· 98 109 ResolveHandleResult::Found(timestamp, did) => { 99 110 if !self.is_expired(*timestamp) { 100 111 tracing::debug!("Cache hit for handle {}: {}", handle, did); 112 + self.metrics.incr("resolver.memory.cache_hit").await; 101 113 return Ok((did.clone(), *timestamp)); 102 114 } 103 115 tracing::debug!("Cache entry expired for handle {}", handle); 116 + self.metrics.incr("resolver.memory.cache_expired").await; 104 117 } 105 118 ResolveHandleResult::NotFound(timestamp, error) => { 106 119 if !self.is_expired(*timestamp) { ··· 109 122 handle, 110 123 error 111 124 ); 125 + self.metrics 126 + .incr("resolver.memory.cache_hit_not_resolved") 127 + .await; 112 128 return Err(HandleResolverError::HandleNotFoundCached(error.clone())); 113 129 } 114 130 tracing::debug!("Cache entry expired for handle {}", handle); 131 + self.metrics.incr("resolver.memory.cache_expired").await; 115 132 } 116 133 } 117 134 } ··· 119 136 120 137 // Not in cache or expired, resolve through inner resolver 121 138 tracing::debug!("Cache miss for handle {}, resolving...", handle); 139 + self.metrics.incr("resolver.memory.cache_miss").await; 122 140 let result = self.inner.resolve(s).await; 123 141 124 142 // Store in cache ··· 130 148 handle.clone(), 131 149 ResolveHandleResult::Found(*timestamp, did.clone()), 132 150 ); 151 + self.metrics.incr("resolver.memory.cache_set").await; 133 152 tracing::debug!( 134 153 "Cached successful resolution for handle {}: {}", 135 154 handle, ··· 142 161 handle.clone(), 143 162 ResolveHandleResult::NotFound(timestamp, e.to_string()), 144 163 ); 164 + self.metrics.incr("resolver.memory.cache_set_error").await; 145 165 tracing::debug!("Cached failed resolution for handle {}: {}", handle, e); 146 166 } 147 167 } 168 + 169 + // Track cache size 170 + let cache_size = cache.len() as u64; 171 + self.metrics 172 + .gauge("resolver.memory.cache_entries", cache_size) 173 + .await; 148 174 } 149 175 150 176 result 151 177 } 178 + 179 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 180 + // Normalize the handle to lowercase 181 + let handle = handle.to_lowercase(); 182 + 183 + // Update the in-memory cache 184 + { 185 + let mut cache = self.cache.write().await; 186 + let timestamp = Self::current_timestamp(); 187 + cache.insert( 188 + handle.clone(), 189 + ResolveHandleResult::Found(timestamp, did.to_string()), 190 + ); 191 + self.metrics.incr("resolver.memory.set").await; 192 + tracing::debug!("Set handle {} -> DID {} in memory cache", handle, did); 193 + 194 + // Track cache size 195 + let cache_size = cache.len() as u64; 196 + self.metrics 197 + .gauge("resolver.memory.cache_entries", cache_size) 198 + .await; 199 + } 200 + 201 + // Chain to inner resolver 202 + self.inner.set(&handle, did).await 203 + } 152 204 } 153 205 154 206 /// Create a new in-memory caching handle resolver. ··· 160 212 /// 161 213 /// * `inner` - The underlying resolver to use for actual resolution 162 214 /// * `ttl_seconds` - How long to cache results in seconds 215 + /// * `metrics` - Metrics publisher for telemetry 163 216 /// 164 217 /// # Example 165 218 /// 166 219 /// ```no_run 167 220 /// use std::sync::Arc; 168 221 /// use quickdid::handle_resolver::{create_base_resolver, create_caching_resolver, HandleResolver}; 222 + /// use quickdid::metrics::NoOpMetricsPublisher; 169 223 /// 170 224 /// # async fn example() { 171 225 /// # use atproto_identity::resolve::HickoryDnsResolver; 172 226 /// # use reqwest::Client; 173 227 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 174 228 /// # let http_client = Client::new(); 229 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 175 230 /// let base = create_base_resolver( 176 231 /// dns_resolver, 177 232 /// http_client, 233 + /// metrics.clone(), 178 234 /// ); 179 235 /// 180 - /// let resolver = create_caching_resolver(base, 300); // 5 minute TTL 236 + /// let resolver = create_caching_resolver(base, 300, metrics); // 5 minute TTL 181 237 /// let did = resolver.resolve("alice.bsky.social").await.unwrap(); 182 238 /// # } 183 239 /// ``` 184 240 pub fn create_caching_resolver( 185 241 inner: Arc<dyn HandleResolver>, 186 242 ttl_seconds: u64, 243 + metrics: SharedMetricsPublisher, 187 244 ) -> Arc<dyn HandleResolver> { 188 - Arc::new(CachingHandleResolver::new(inner, ttl_seconds)) 245 + Arc::new(CachingHandleResolver::new(inner, ttl_seconds, metrics)) 189 246 }
+10 -1
src/handle_resolver/mod.rs
··· 19 19 //! ```no_run 20 20 //! use std::sync::Arc; 21 21 //! use quickdid::handle_resolver::{create_base_resolver, create_caching_resolver, HandleResolver}; 22 + //! use quickdid::metrics::NoOpMetricsPublisher; 22 23 //! 23 24 //! # async fn example() -> Result<(), Box<dyn std::error::Error>> { 24 25 //! # use atproto_identity::resolve::HickoryDnsResolver; 25 26 //! # use reqwest::Client; 26 27 //! # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 27 28 //! # let http_client = Client::new(); 29 + //! # let metrics = Arc::new(NoOpMetricsPublisher); 28 30 //! // Create base resolver using factory function 29 31 //! let base = create_base_resolver( 30 32 //! dns_resolver, 31 33 //! http_client, 34 + //! metrics.clone(), 32 35 //! ); 33 36 //! 34 37 //! // Wrap with in-memory caching 35 - //! let resolver = create_caching_resolver(base, 300); 38 + //! let resolver = create_caching_resolver(base, 300, metrics); 36 39 //! 37 40 //! // Resolve a handle 38 41 //! let did = resolver.resolve("alice.bsky.social").await?; ··· 44 47 mod base; 45 48 mod errors; 46 49 mod memory; 50 + mod proactive_refresh; 47 51 mod rate_limited; 48 52 mod redis; 49 53 mod sqlite; ··· 56 60 // Factory functions for creating resolvers 57 61 pub use base::create_base_resolver; 58 62 pub use memory::create_caching_resolver; 63 + pub use proactive_refresh::{ 64 + ProactiveRefreshResolver, create_proactive_refresh_resolver, 65 + create_proactive_refresh_resolver_dyn, create_proactive_refresh_resolver_with_metrics, 66 + create_proactive_refresh_resolver_with_threshold, 67 + }; 59 68 pub use rate_limited::{create_rate_limited_resolver, create_rate_limited_resolver_with_timeout}; 60 69 pub use redis::{create_redis_resolver, create_redis_resolver_with_ttl}; 61 70 pub use sqlite::{create_sqlite_resolver, create_sqlite_resolver_with_ttl};
+438
src/handle_resolver/proactive_refresh.rs
··· 1 + use crate::handle_resolution_result::HandleResolutionResult; 2 + use crate::handle_resolver::{HandleResolver, HandleResolverError}; 3 + use crate::metrics::MetricsPublisher; 4 + use crate::queue::{HandleResolutionWork, QueueAdapter}; 5 + use async_trait::async_trait; 6 + use std::sync::Arc; 7 + use std::time::{SystemTime, UNIX_EPOCH}; 8 + use tracing::{debug, trace}; 9 + 10 + /// Create a ProactiveRefreshResolver with default 80% threshold 11 + /// 12 + /// # Arguments 13 + /// * `inner` - The inner resolver to wrap 14 + /// * `queue` - The queue adapter for background refresh tasks 15 + /// * `cache_ttl` - The TTL in seconds for cache entries 16 + pub fn create_proactive_refresh_resolver<R, Q>( 17 + inner: Arc<R>, 18 + queue: Arc<Q>, 19 + cache_ttl: u64, 20 + ) -> Arc<ProactiveRefreshResolver<R, Q>> 21 + where 22 + R: HandleResolver + Send + Sync + 'static, 23 + Q: QueueAdapter<HandleResolutionWork> + Send + Sync + 'static, 24 + { 25 + Arc::new(ProactiveRefreshResolver::new(inner, queue, cache_ttl)) 26 + } 27 + 28 + /// Create a ProactiveRefreshResolver with custom threshold 29 + /// 30 + /// # Arguments 31 + /// * `inner` - The inner resolver to wrap 32 + /// * `queue` - The queue adapter for background refresh tasks 33 + /// * `cache_ttl` - The TTL in seconds for cache entries 34 + /// * `threshold` - The threshold as a percentage (0.0 to 1.0) of TTL when to trigger refresh 35 + pub fn create_proactive_refresh_resolver_with_threshold<R, Q>( 36 + inner: Arc<R>, 37 + queue: Arc<Q>, 38 + cache_ttl: u64, 39 + threshold: f64, 40 + ) -> Arc<ProactiveRefreshResolver<R, Q>> 41 + where 42 + R: HandleResolver + Send + Sync + 'static, 43 + Q: QueueAdapter<HandleResolutionWork> + Send + Sync + 'static, 44 + { 45 + Arc::new(ProactiveRefreshResolver::with_threshold( 46 + inner, queue, cache_ttl, threshold, 47 + )) 48 + } 49 + 50 + /// Wrapper struct for dynamic dispatch with proactive refresh 51 + /// This works with trait objects instead of concrete types 52 + pub struct DynProactiveRefreshResolver { 53 + inner: Arc<dyn HandleResolver>, 54 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 55 + metrics: Option<Arc<dyn MetricsPublisher>>, 56 + #[allow(dead_code)] 57 + cache_ttl: u64, 58 + #[allow(dead_code)] 59 + refresh_threshold: f64, 60 + } 61 + 62 + impl DynProactiveRefreshResolver { 63 + pub fn new( 64 + inner: Arc<dyn HandleResolver>, 65 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 66 + cache_ttl: u64, 67 + refresh_threshold: f64, 68 + ) -> Self { 69 + Self::with_metrics(inner, queue, None, cache_ttl, refresh_threshold) 70 + } 71 + 72 + pub fn with_metrics( 73 + inner: Arc<dyn HandleResolver>, 74 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 75 + metrics: Option<Arc<dyn MetricsPublisher>>, 76 + cache_ttl: u64, 77 + refresh_threshold: f64, 78 + ) -> Self { 79 + Self { 80 + inner, 81 + queue, 82 + metrics, 83 + cache_ttl, 84 + refresh_threshold: refresh_threshold.clamp(0.0, 1.0), 85 + } 86 + } 87 + 88 + async fn maybe_queue_for_refresh(&self, handle: &str, resolve_time: u64) { 89 + // If resolution took less than 5ms, it was probably a cache hit 90 + if resolve_time < 5000 { 91 + trace!( 92 + handle = handle, 93 + resolve_time_us = resolve_time, 94 + "Fast resolution detected, considering proactive refresh" 95 + ); 96 + 97 + if let Some(metrics) = &self.metrics { 98 + metrics.incr("proactive_refresh.cache_hit_detected").await; 99 + } 100 + 101 + // Simple heuristic: queue for refresh with some probability 102 + let now = SystemTime::now() 103 + .duration_since(UNIX_EPOCH) 104 + .unwrap_or_default() 105 + .as_secs(); 106 + 107 + // Queue every N seconds for frequently accessed handles 108 + if now % 60 == 0 { 109 + let work = HandleResolutionWork { 110 + handle: handle.to_string(), 111 + }; 112 + 113 + if let Err(e) = self.queue.push(work).await { 114 + debug!( 115 + handle = handle, 116 + error = %e, 117 + "Failed to queue handle for proactive refresh" 118 + ); 119 + if let Some(metrics) = &self.metrics { 120 + metrics.incr("proactive_refresh.queue_error").await; 121 + } 122 + } else { 123 + debug!(handle = handle, "Queued handle for proactive refresh"); 124 + if let Some(metrics) = &self.metrics { 125 + metrics.incr("proactive_refresh.queued").await; 126 + } 127 + } 128 + } 129 + } 130 + } 131 + } 132 + 133 + #[async_trait] 134 + impl HandleResolver for DynProactiveRefreshResolver { 135 + async fn resolve(&self, handle: &str) -> Result<(String, u64), HandleResolverError> { 136 + // Resolve through the inner resolver 137 + let (did, resolve_time) = self.inner.resolve(handle).await?; 138 + 139 + // Check if we should queue for refresh based on resolution time 140 + self.maybe_queue_for_refresh(handle, resolve_time).await; 141 + 142 + Ok((did, resolve_time)) 143 + } 144 + 145 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 146 + // Simply chain to inner resolver - no proactive refresh needed for manual sets 147 + self.inner.set(handle, did).await 148 + } 149 + } 150 + 151 + /// Create a ProactiveRefreshResolver with custom threshold using trait objects 152 + /// This version works with dyn HandleResolver and dyn QueueAdapter 153 + /// 154 + /// # Arguments 155 + /// * `inner` - The inner resolver to wrap 156 + /// * `queue` - The queue adapter for background refresh tasks 157 + /// * `cache_ttl` - The TTL in seconds for cache entries 158 + /// * `threshold` - The threshold as a percentage (0.0 to 1.0) of TTL when to trigger refresh 159 + pub fn create_proactive_refresh_resolver_dyn( 160 + inner: Arc<dyn HandleResolver>, 161 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 162 + cache_ttl: u64, 163 + threshold: f64, 164 + ) -> Arc<dyn HandleResolver> { 165 + Arc::new(DynProactiveRefreshResolver::new( 166 + inner, queue, cache_ttl, threshold, 167 + )) 168 + } 169 + 170 + /// Create a ProactiveRefreshResolver with metrics support 171 + pub fn create_proactive_refresh_resolver_with_metrics( 172 + inner: Arc<dyn HandleResolver>, 173 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 174 + metrics: Arc<dyn MetricsPublisher>, 175 + cache_ttl: u64, 176 + threshold: f64, 177 + ) -> Arc<dyn HandleResolver> { 178 + Arc::new(DynProactiveRefreshResolver::with_metrics( 179 + inner, 180 + queue, 181 + Some(metrics), 182 + cache_ttl, 183 + threshold, 184 + )) 185 + } 186 + 187 + /// A handle resolver that proactively refreshes cache entries when they reach 188 + /// a certain staleness threshold (default 80% of TTL). 189 + /// 190 + /// This resolver wraps another resolver and checks successful resolutions from cache. 191 + /// When a cached entry has lived for more than the threshold percentage of its TTL, 192 + /// it queues the handle for background refresh to keep the cache warm. 193 + /// 194 + /// Note: Due to the current trait design, this implementation uses the resolution time 195 + /// as a heuristic. When resolve_time is 0 (instant cache hit), it may queue for refresh. 196 + /// For full functionality, the trait would need to expose cache timestamps. 197 + pub struct ProactiveRefreshResolver<R: HandleResolver, Q: QueueAdapter<HandleResolutionWork>> { 198 + inner: Arc<R>, 199 + queue: Arc<Q>, 200 + /// TTL in seconds for cache entries 201 + cache_ttl: u64, 202 + /// Threshold as a percentage (0.0 to 1.0) of TTL when to trigger refresh 203 + /// Default is 0.8 (80%) 204 + refresh_threshold: f64, 205 + } 206 + 207 + impl<R: HandleResolver, Q: QueueAdapter<HandleResolutionWork>> ProactiveRefreshResolver<R, Q> { 208 + pub fn new(inner: Arc<R>, queue: Arc<Q>, cache_ttl: u64) -> Self { 209 + Self::with_threshold(inner, queue, cache_ttl, 0.8) 210 + } 211 + 212 + pub fn with_threshold( 213 + inner: Arc<R>, 214 + queue: Arc<Q>, 215 + cache_ttl: u64, 216 + refresh_threshold: f64, 217 + ) -> Self { 218 + Self { 219 + inner, 220 + queue, 221 + cache_ttl, 222 + refresh_threshold: refresh_threshold.clamp(0.0, 1.0), 223 + } 224 + } 225 + 226 + /// Check if a cached entry needs proactive refresh based on its age 227 + #[allow(dead_code)] 228 + fn needs_refresh(&self, result: &HandleResolutionResult) -> bool { 229 + let now = SystemTime::now() 230 + .duration_since(UNIX_EPOCH) 231 + .unwrap_or_default() 232 + .as_secs(); 233 + 234 + let age = now.saturating_sub(result.timestamp); 235 + let threshold = (self.cache_ttl as f64 * self.refresh_threshold) as u64; 236 + 237 + let needs_refresh = age >= threshold; 238 + 239 + if needs_refresh { 240 + debug!( 241 + handle = ?result.to_did(), 242 + age_seconds = age, 243 + threshold_seconds = threshold, 244 + cache_ttl = self.cache_ttl, 245 + "Cache entry needs proactive refresh" 246 + ); 247 + } else { 248 + trace!( 249 + handle = ?result.to_did(), 250 + age_seconds = age, 251 + threshold_seconds = threshold, 252 + "Cache entry still fresh" 253 + ); 254 + } 255 + 256 + needs_refresh 257 + } 258 + 259 + /// Queue a handle for background refresh 260 + async fn queue_for_refresh(&self, handle: &str) { 261 + let work = HandleResolutionWork { 262 + handle: handle.to_string(), 263 + }; 264 + 265 + match self.queue.push(work).await { 266 + Ok(_) => { 267 + debug!(handle = handle, "Queued handle for proactive refresh"); 268 + } 269 + Err(e) => { 270 + // Don't fail the request if we can't queue for refresh 271 + debug!( 272 + handle = handle, 273 + error = %e, 274 + "Failed to queue handle for proactive refresh" 275 + ); 276 + } 277 + } 278 + } 279 + 280 + /// Check if we should queue for refresh based on resolution time 281 + /// 282 + /// This is a heuristic approach: 283 + /// - If resolve_time is very low (< 5ms), it was likely a cache hit 284 + /// - We probabilistically queue for refresh based on time since service start 285 + /// 286 + /// For proper implementation, the HandleResolver trait would need to expose 287 + /// cache metadata or return HandleResolutionResult directly. 288 + async fn maybe_queue_for_refresh(&self, handle: &str, resolve_time: u64) { 289 + // If resolution took less than 5ms, it was probably a cache hit 290 + if resolve_time < 5000 { 291 + // Use a simple probabilistic approach for demonstration 292 + // In production, you'd want access to the actual cache timestamp 293 + trace!( 294 + handle = handle, 295 + resolve_time_us = resolve_time, 296 + "Fast resolution detected, considering proactive refresh" 297 + ); 298 + 299 + // Queue for refresh with some probability to avoid overwhelming the queue 300 + // This is a simplified approach - ideally we'd have access to cache metadata 301 + let now = SystemTime::now() 302 + .duration_since(UNIX_EPOCH) 303 + .unwrap_or_default() 304 + .as_secs(); 305 + 306 + // Simple heuristic: queue every N seconds for frequently accessed handles 307 + if now % 60 == 0 { 308 + self.queue_for_refresh(handle).await; 309 + } 310 + } 311 + } 312 + } 313 + 314 + #[async_trait] 315 + impl<R, Q> HandleResolver for ProactiveRefreshResolver<R, Q> 316 + where 317 + R: HandleResolver + Send + Sync, 318 + Q: QueueAdapter<HandleResolutionWork> + Send + Sync, 319 + { 320 + async fn resolve(&self, handle: &str) -> Result<(String, u64), HandleResolverError> { 321 + // Resolve through the inner resolver 322 + let (did, resolve_time) = self.inner.resolve(handle).await?; 323 + 324 + // Check if we should queue for refresh based on resolution time 325 + self.maybe_queue_for_refresh(handle, resolve_time).await; 326 + 327 + Ok((did, resolve_time)) 328 + } 329 + } 330 + 331 + #[cfg(test)] 332 + mod tests { 333 + use super::*; 334 + use crate::handle_resolution_result::DidMethodType; 335 + 336 + #[test] 337 + fn test_needs_refresh_calculation() { 338 + // Create a resolver with 100 second TTL and 80% threshold 339 + let inner = Arc::new(MockResolver); 340 + let queue = Arc::new(MockQueueAdapter); 341 + let resolver = ProactiveRefreshResolver::new(inner, queue, 100); 342 + 343 + let now = SystemTime::now() 344 + .duration_since(UNIX_EPOCH) 345 + .unwrap() 346 + .as_secs(); 347 + 348 + // Test entry that's 50% through TTL (should not refresh) 349 + let fresh_result = HandleResolutionResult { 350 + timestamp: now - 50, 351 + method_type: DidMethodType::Plc, 352 + payload: "alice123".to_string(), 353 + }; 354 + assert!(!resolver.needs_refresh(&fresh_result)); 355 + 356 + // Test entry that's 80% through TTL (should refresh) 357 + let stale_result = HandleResolutionResult { 358 + timestamp: now - 80, 359 + method_type: DidMethodType::Plc, 360 + payload: "alice123".to_string(), 361 + }; 362 + assert!(resolver.needs_refresh(&stale_result)); 363 + 364 + // Test entry that's 90% through TTL (should definitely refresh) 365 + let very_stale_result = HandleResolutionResult { 366 + timestamp: now - 90, 367 + method_type: DidMethodType::Plc, 368 + payload: "alice123".to_string(), 369 + }; 370 + assert!(resolver.needs_refresh(&very_stale_result)); 371 + } 372 + 373 + #[test] 374 + fn test_custom_threshold() { 375 + let inner = Arc::new(MockResolver); 376 + let queue = Arc::new(MockQueueAdapter); 377 + 378 + // Create resolver with 50% threshold 379 + let resolver = ProactiveRefreshResolver::with_threshold(inner, queue, 100, 0.5); 380 + 381 + let now = SystemTime::now() 382 + .duration_since(UNIX_EPOCH) 383 + .unwrap() 384 + .as_secs(); 385 + 386 + // Test entry that's 40% through TTL (should not refresh with 50% threshold) 387 + let result_40 = HandleResolutionResult { 388 + timestamp: now - 40, 389 + method_type: DidMethodType::Plc, 390 + payload: "alice123".to_string(), 391 + }; 392 + assert!(!resolver.needs_refresh(&result_40)); 393 + 394 + // Test entry that's 60% through TTL (should refresh with 50% threshold) 395 + let result_60 = HandleResolutionResult { 396 + timestamp: now - 60, 397 + method_type: DidMethodType::Plc, 398 + payload: "alice123".to_string(), 399 + }; 400 + assert!(resolver.needs_refresh(&result_60)); 401 + } 402 + 403 + // Mock resolver for testing 404 + struct MockResolver; 405 + 406 + #[async_trait] 407 + impl HandleResolver for MockResolver { 408 + async fn resolve(&self, handle: &str) -> Result<(String, u64), HandleResolverError> { 409 + Ok((format!("did:plc:{}", handle), 1000)) 410 + } 411 + } 412 + 413 + // Mock queue adapter for testing 414 + struct MockQueueAdapter; 415 + 416 + #[async_trait] 417 + impl QueueAdapter<HandleResolutionWork> for MockQueueAdapter { 418 + async fn pull(&self) -> Option<HandleResolutionWork> { 419 + None 420 + } 421 + 422 + async fn push(&self, _work: HandleResolutionWork) -> crate::queue::Result<()> { 423 + Ok(()) 424 + } 425 + 426 + async fn ack(&self, _item: &HandleResolutionWork) -> crate::queue::Result<()> { 427 + Ok(()) 428 + } 429 + 430 + async fn try_push(&self, _work: HandleResolutionWork) -> crate::queue::Result<()> { 431 + Ok(()) 432 + } 433 + 434 + async fn is_healthy(&self) -> bool { 435 + true 436 + } 437 + } 438 + }
+80 -15
src/handle_resolver/rate_limited.rs
··· 5 5 6 6 use super::errors::HandleResolverError; 7 7 use super::traits::HandleResolver; 8 + use crate::metrics::SharedMetricsPublisher; 8 9 use async_trait::async_trait; 9 10 use std::sync::Arc; 10 11 use std::time::Duration; ··· 34 35 /// create_rate_limited_resolver, 35 36 /// HandleResolver, 36 37 /// }; 38 + /// use quickdid::metrics::NoOpMetricsPublisher; 37 39 /// 38 40 /// # async fn example() { 39 41 /// # use atproto_identity::resolve::HickoryDnsResolver; 40 42 /// # use reqwest::Client; 41 43 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 42 44 /// # let http_client = Client::new(); 45 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 43 46 /// // Create base resolver 44 - /// let base = create_base_resolver(dns_resolver, http_client); 47 + /// let base = create_base_resolver(dns_resolver, http_client, metrics.clone()); 45 48 /// 46 49 /// // Wrap with rate limiting (max 10 concurrent resolutions) 47 - /// let rate_limited = create_rate_limited_resolver(base, 10); 50 + /// let rate_limited = create_rate_limited_resolver(base, 10, metrics); 48 51 /// 49 52 /// // Use the rate-limited resolver 50 53 /// let (did, timestamp) = rate_limited.resolve("alice.bsky.social").await.unwrap(); ··· 60 63 /// Optional timeout for acquiring permits (in milliseconds). 61 64 /// When None or 0, no timeout is applied. 62 65 timeout_ms: Option<u64>, 66 + 67 + /// Metrics publisher for telemetry. 68 + metrics: SharedMetricsPublisher, 63 69 } 64 70 65 71 impl RateLimitedHandleResolver { ··· 69 75 /// 70 76 /// * `inner` - The inner resolver to wrap 71 77 /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 72 - pub fn new(inner: Arc<dyn HandleResolver>, max_concurrent: usize) -> Self { 78 + /// * `metrics` - Metrics publisher for telemetry 79 + pub fn new( 80 + inner: Arc<dyn HandleResolver>, 81 + max_concurrent: usize, 82 + metrics: SharedMetricsPublisher, 83 + ) -> Self { 73 84 Self { 74 85 inner, 75 86 semaphore: Arc::new(Semaphore::new(max_concurrent)), 76 87 timeout_ms: None, 88 + metrics, 77 89 } 78 90 } 79 91 ··· 84 96 /// * `inner` - The inner resolver to wrap 85 97 /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 86 98 /// * `timeout_ms` - Timeout in milliseconds for acquiring permits (0 = no timeout) 99 + /// * `metrics` - Metrics publisher for telemetry 87 100 pub fn new_with_timeout( 88 101 inner: Arc<dyn HandleResolver>, 89 102 max_concurrent: usize, 90 103 timeout_ms: u64, 104 + metrics: SharedMetricsPublisher, 91 105 ) -> Self { 92 106 Self { 93 107 inner, ··· 97 111 } else { 98 112 None 99 113 }, 114 + metrics, 100 115 } 101 116 } 102 117 } ··· 104 119 #[async_trait] 105 120 impl HandleResolver for RateLimitedHandleResolver { 106 121 async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 122 + let permit_start = std::time::Instant::now(); 123 + 124 + // Track rate limiter queue depth 125 + let available_permits = self.semaphore.available_permits(); 126 + self.metrics 127 + .gauge( 128 + "resolver.rate_limit.available_permits", 129 + available_permits as u64, 130 + ) 131 + .await; 132 + 107 133 // Acquire a permit from the semaphore, with optional timeout 108 134 let _permit = match self.timeout_ms { 109 135 Some(timeout_ms) if timeout_ms > 0 => { 110 136 // Apply timeout when acquiring permit 111 137 let duration = Duration::from_millis(timeout_ms); 112 138 match timeout(duration, self.semaphore.acquire()).await { 113 - Ok(Ok(permit)) => permit, 139 + Ok(Ok(permit)) => { 140 + let wait_ms = permit_start.elapsed().as_millis() as u64; 141 + self.metrics 142 + .time("resolver.rate_limit.permit_acquired", wait_ms) 143 + .await; 144 + permit 145 + } 114 146 Ok(Err(e)) => { 115 147 // Semaphore error (e.g., closed) 148 + self.metrics.incr("resolver.rate_limit.permit_error").await; 116 149 return Err(HandleResolverError::ResolutionFailed(format!( 117 150 "Failed to acquire rate limit permit: {}", 118 151 e ··· 120 153 } 121 154 Err(_) => { 122 155 // Timeout occurred 156 + self.metrics 157 + .incr("resolver.rate_limit.permit_timeout") 158 + .await; 123 159 return Err(HandleResolverError::ResolutionFailed(format!( 124 160 "Rate limit permit acquisition timed out after {}ms", 125 161 timeout_ms ··· 129 165 } 130 166 _ => { 131 167 // No timeout configured, wait indefinitely 132 - self.semaphore.acquire().await.map_err(|e| { 133 - HandleResolverError::ResolutionFailed(format!( 134 - "Failed to acquire rate limit permit: {}", 135 - e 136 - )) 137 - })? 168 + match self.semaphore.acquire().await { 169 + Ok(permit) => { 170 + let wait_ms = permit_start.elapsed().as_millis() as u64; 171 + self.metrics 172 + .time("resolver.rate_limit.permit_acquired", wait_ms) 173 + .await; 174 + permit 175 + } 176 + Err(e) => { 177 + self.metrics.incr("resolver.rate_limit.permit_error").await; 178 + return Err(HandleResolverError::ResolutionFailed(format!( 179 + "Failed to acquire rate limit permit: {}", 180 + e 181 + ))); 182 + } 183 + } 138 184 } 139 185 }; 140 186 141 187 // With permit acquired, forward to inner resolver 142 188 self.inner.resolve(s).await 189 + } 190 + 191 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 192 + // Set operations don't need rate limiting since they're typically administrative 193 + // and don't involve network calls to external services 194 + self.inner.set(handle, did).await 143 195 } 144 196 } 145 197 ··· 152 204 /// 153 205 /// * `inner` - The resolver to wrap with rate limiting 154 206 /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 207 + /// * `metrics` - Metrics publisher for telemetry 155 208 /// 156 209 /// # Returns 157 210 /// ··· 169 222 /// # async fn example() { 170 223 /// # use atproto_identity::resolve::HickoryDnsResolver; 171 224 /// # use reqwest::Client; 225 + /// # use quickdid::metrics::NoOpMetricsPublisher; 172 226 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 173 227 /// # let http_client = Client::new(); 174 - /// let base = create_base_resolver(dns_resolver, http_client); 175 - /// let rate_limited = create_rate_limited_resolver(base, 10); 228 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 229 + /// let base = create_base_resolver(dns_resolver, http_client, metrics.clone()); 230 + /// let rate_limited = create_rate_limited_resolver(base, 10, metrics); 176 231 /// # } 177 232 /// ``` 178 233 pub fn create_rate_limited_resolver( 179 234 inner: Arc<dyn HandleResolver>, 180 235 max_concurrent: usize, 236 + metrics: SharedMetricsPublisher, 181 237 ) -> Arc<dyn HandleResolver> { 182 - Arc::new(RateLimitedHandleResolver::new(inner, max_concurrent)) 238 + Arc::new(RateLimitedHandleResolver::new( 239 + inner, 240 + max_concurrent, 241 + metrics, 242 + )) 183 243 } 184 244 185 245 /// Create a rate-limited handle resolver with timeout. ··· 192 252 /// * `inner` - The resolver to wrap with rate limiting 193 253 /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 194 254 /// * `timeout_ms` - Timeout in milliseconds for acquiring permits (0 = no timeout) 255 + /// * `metrics` - Metrics publisher for telemetry 195 256 /// 196 257 /// # Returns 197 258 /// ··· 209 270 /// # async fn example() { 210 271 /// # use atproto_identity::resolve::HickoryDnsResolver; 211 272 /// # use reqwest::Client; 273 + /// # use quickdid::metrics::NoOpMetricsPublisher; 212 274 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 213 275 /// # let http_client = Client::new(); 214 - /// let base = create_base_resolver(dns_resolver, http_client); 276 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 277 + /// let base = create_base_resolver(dns_resolver, http_client, metrics.clone()); 215 278 /// // Rate limit with 10 concurrent resolutions and 5 second timeout 216 - /// let rate_limited = create_rate_limited_resolver_with_timeout(base, 10, 5000); 279 + /// let rate_limited = create_rate_limited_resolver_with_timeout(base, 10, 5000, metrics); 217 280 /// # } 218 281 /// ``` 219 282 pub fn create_rate_limited_resolver_with_timeout( 220 283 inner: Arc<dyn HandleResolver>, 221 284 max_concurrent: usize, 222 285 timeout_ms: u64, 286 + metrics: SharedMetricsPublisher, 223 287 ) -> Arc<dyn HandleResolver> { 224 288 Arc::new(RateLimitedHandleResolver::new_with_timeout( 225 289 inner, 226 290 max_concurrent, 227 291 timeout_ms, 292 + metrics, 228 293 )) 229 294 }
+554 -9
src/handle_resolver/redis.rs
··· 7 7 use super::errors::HandleResolverError; 8 8 use super::traits::HandleResolver; 9 9 use crate::handle_resolution_result::HandleResolutionResult; 10 + use crate::metrics::SharedMetricsPublisher; 10 11 use async_trait::async_trait; 12 + use atproto_identity::resolve::{InputType, parse_input}; 11 13 use deadpool_redis::{Pool as RedisPool, redis::AsyncCommands}; 12 14 use metrohash::MetroHash64; 13 15 use std::hash::Hasher as _; ··· 33 35 /// use std::sync::Arc; 34 36 /// use deadpool_redis::Pool; 35 37 /// use quickdid::handle_resolver::{create_base_resolver, create_redis_resolver, HandleResolver}; 38 + /// use quickdid::metrics::NoOpMetricsPublisher; 36 39 /// 37 40 /// # async fn example() { 38 41 /// # use atproto_identity::resolve::HickoryDnsResolver; 39 42 /// # use reqwest::Client; 40 43 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 41 44 /// # let http_client = Client::new(); 42 - /// # let base_resolver = create_base_resolver(dns_resolver, http_client); 45 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 46 + /// # let base_resolver = create_base_resolver(dns_resolver, http_client, metrics.clone()); 43 47 /// # let redis_pool: Pool = todo!(); 44 48 /// // Create with default 90-day TTL 45 49 /// let resolver = create_redis_resolver( 46 50 /// base_resolver, 47 - /// redis_pool 51 + /// redis_pool, 52 + /// metrics 48 53 /// ); 49 54 /// # } 50 55 /// ``` ··· 57 62 key_prefix: String, 58 63 /// TTL for cache entries in seconds 59 64 ttl_seconds: u64, 65 + /// Metrics publisher for telemetry 66 + metrics: SharedMetricsPublisher, 60 67 } 61 68 62 69 impl RedisHandleResolver { 63 70 /// Create a new Redis-backed handle resolver with default 90-day TTL. 64 - fn new(inner: Arc<dyn HandleResolver>, pool: RedisPool) -> Self { 65 - Self::with_ttl(inner, pool, 90 * 24 * 60 * 60) // 90 days default 71 + fn new( 72 + inner: Arc<dyn HandleResolver>, 73 + pool: RedisPool, 74 + metrics: SharedMetricsPublisher, 75 + ) -> Self { 76 + Self::with_ttl(inner, pool, 90 * 24 * 60 * 60, metrics) // 90 days default 66 77 } 67 78 68 79 /// Create a new Redis-backed handle resolver with custom TTL. 69 - fn with_ttl(inner: Arc<dyn HandleResolver>, pool: RedisPool, ttl_seconds: u64) -> Self { 70 - Self::with_full_config(inner, pool, "handle:".to_string(), ttl_seconds) 80 + fn with_ttl( 81 + inner: Arc<dyn HandleResolver>, 82 + pool: RedisPool, 83 + ttl_seconds: u64, 84 + metrics: SharedMetricsPublisher, 85 + ) -> Self { 86 + Self::with_full_config(inner, pool, "handle:".to_string(), ttl_seconds, metrics) 71 87 } 72 88 73 89 /// Create a new Redis-backed handle resolver with full configuration. ··· 76 92 pool: RedisPool, 77 93 key_prefix: String, 78 94 ttl_seconds: u64, 95 + metrics: SharedMetricsPublisher, 79 96 ) -> Self { 80 97 Self { 81 98 inner, 82 99 pool, 83 100 key_prefix, 84 101 ttl_seconds, 102 + metrics, 85 103 } 86 104 } 87 105 ··· 100 118 fn ttl_seconds(&self) -> u64 { 101 119 self.ttl_seconds 102 120 } 121 + 122 + /// Purge a handle and its associated DID from the cache. 123 + /// 124 + /// This method removes both the handle->DID mapping and the reverse DID->handle mapping. 125 + async fn purge_handle(&self, handle: &str) -> Result<(), HandleResolverError> { 126 + let handle_key = self.make_key(handle); 127 + 128 + match self.pool.get().await { 129 + Ok(mut conn) => { 130 + // First, try to get the cached result to find the associated DID 131 + let cached: Option<Vec<u8>> = match conn.get(&handle_key).await { 132 + Ok(value) => value, 133 + Err(e) => { 134 + tracing::warn!("Failed to get handle from Redis for purging: {}", e); 135 + self.metrics.incr("resolver.redis.purge_get_error").await; 136 + None 137 + } 138 + }; 139 + 140 + // If we found a cached result, extract the DID and delete both keys 141 + if let Some(cached_bytes) = cached { 142 + if let Ok(cached_result) = HandleResolutionResult::from_bytes(&cached_bytes) { 143 + if let Some(did) = cached_result.to_did() { 144 + let did_key = self.make_key(&did); 145 + 146 + // Delete both the handle key and the DID key 147 + let _: Result<(), _> = conn.del(&[&handle_key, &did_key]).await; 148 + 149 + tracing::debug!("Purged handle {} and associated DID {}", handle, did); 150 + self.metrics 151 + .incr("resolver.redis.purge_handle_success") 152 + .await; 153 + } else { 154 + // Just delete the handle key if no DID was resolved 155 + let _: Result<(), _> = conn.del(&handle_key).await; 156 + tracing::debug!("Purged unresolved handle {}", handle); 157 + self.metrics 158 + .incr("resolver.redis.purge_handle_unresolved") 159 + .await; 160 + } 161 + } else { 162 + // If we can't deserialize, just delete the handle key 163 + let _: Result<(), _> = conn.del(&handle_key).await; 164 + tracing::warn!("Purged handle {} with undeserializable data", handle); 165 + self.metrics 166 + .incr("resolver.redis.purge_handle_corrupt") 167 + .await; 168 + } 169 + } else { 170 + tracing::debug!("Handle {} not found in cache for purging", handle); 171 + self.metrics 172 + .incr("resolver.redis.purge_handle_not_found") 173 + .await; 174 + } 175 + 176 + Ok(()) 177 + } 178 + Err(e) => { 179 + tracing::warn!("Failed to get Redis connection for purging: {}", e); 180 + self.metrics 181 + .incr("resolver.redis.purge_connection_error") 182 + .await; 183 + Err(HandleResolverError::ResolutionFailed(format!( 184 + "Redis connection error: {}", 185 + e 186 + ))) 187 + } 188 + } 189 + } 190 + 191 + /// Purge a DID and its associated handle from the cache. 192 + /// 193 + /// This method removes both the DID->handle mapping and the handle->DID mapping. 194 + async fn purge_did(&self, did: &str) -> Result<(), HandleResolverError> { 195 + let did_key = self.make_key(did); 196 + 197 + match self.pool.get().await { 198 + Ok(mut conn) => { 199 + // First, try to get the associated handle from the reverse mapping 200 + let handle_bytes: Option<Vec<u8>> = match conn.get(&did_key).await { 201 + Ok(value) => value, 202 + Err(e) => { 203 + tracing::warn!("Failed to get DID from Redis for purging: {}", e); 204 + self.metrics.incr("resolver.redis.purge_get_error").await; 205 + None 206 + } 207 + }; 208 + 209 + // If we found a handle, delete both keys 210 + if let Some(handle_bytes) = handle_bytes { 211 + if let Ok(handle) = String::from_utf8(handle_bytes) { 212 + let handle_key = self.make_key(&handle); 213 + 214 + // Delete both the DID key and the handle key 215 + let _: Result<(), _> = conn.del(&[&did_key, &handle_key]).await; 216 + 217 + tracing::debug!("Purged DID {} and associated handle {}", did, handle); 218 + self.metrics.incr("resolver.redis.purge_did_success").await; 219 + } else { 220 + // If we can't parse the handle, just delete the DID key 221 + let _: Result<(), _> = conn.del(&did_key).await; 222 + tracing::warn!("Purged DID {} with unparseable handle data", did); 223 + self.metrics.incr("resolver.redis.purge_did_corrupt").await; 224 + } 225 + } else { 226 + tracing::debug!("DID {} not found in cache for purging", did); 227 + self.metrics 228 + .incr("resolver.redis.purge_did_not_found") 229 + .await; 230 + } 231 + 232 + Ok(()) 233 + } 234 + Err(e) => { 235 + tracing::warn!("Failed to get Redis connection for purging: {}", e); 236 + self.metrics 237 + .incr("resolver.redis.purge_connection_error") 238 + .await; 239 + Err(HandleResolverError::ResolutionFailed(format!( 240 + "Redis connection error: {}", 241 + e 242 + ))) 243 + } 244 + } 245 + } 103 246 } 104 247 105 248 #[async_trait] ··· 115 258 let cached: Option<Vec<u8>> = match conn.get(&key).await { 116 259 Ok(value) => value, 117 260 Err(e) => { 261 + self.metrics.incr("resolver.redis.get_error").await; 118 262 tracing::warn!("Failed to get handle from Redis cache: {}", e); 119 263 None 120 264 } ··· 126 270 Ok(cached_result) => { 127 271 if let Some(did) = cached_result.to_did() { 128 272 tracing::debug!("Cache hit for handle {}: {}", handle, did); 273 + self.metrics.incr("resolver.redis.cache_hit").await; 129 274 return Ok((did, cached_result.timestamp)); 130 275 } else { 131 276 tracing::debug!("Cache hit (not resolved) for handle {}", handle); 277 + self.metrics 278 + .incr("resolver.redis.cache_hit_not_resolved") 279 + .await; 132 280 return Err(HandleResolverError::HandleNotFound); 133 281 } 134 282 } ··· 138 286 handle, 139 287 e 140 288 ); 289 + self.metrics.incr("resolver.redis.deserialize_error").await; 141 290 // Fall through to re-resolve if deserialization fails 142 291 } 143 292 } ··· 145 294 146 295 // Not in cache, resolve through inner resolver 147 296 tracing::debug!("Cache miss for handle {}, resolving...", handle); 297 + self.metrics.incr("resolver.redis.cache_miss").await; 148 298 let result = self.inner.resolve(s).await; 149 299 150 300 // Create and serialize resolution result ··· 159 309 Ok(res) => res, 160 310 Err(e) => { 161 311 tracing::warn!("Failed to create resolution result: {}", e); 312 + self.metrics 313 + .incr("resolver.redis.result_create_error") 314 + .await; 162 315 return result; 163 316 } 164 317 } ··· 169 322 Ok(res) => res, 170 323 Err(err) => { 171 324 tracing::warn!("Failed to create not_resolved result: {}", err); 325 + self.metrics 326 + .incr("resolver.redis.result_create_error") 327 + .await; 172 328 return result; 173 329 } 174 330 } ··· 184 340 .await 185 341 { 186 342 tracing::warn!("Failed to cache handle resolution in Redis: {}", e); 343 + self.metrics.incr("resolver.redis.cache_set_error").await; 344 + } else { 345 + self.metrics.incr("resolver.redis.cache_set").await; 346 + 347 + // For successful resolutions, also store reverse DID -> handle mapping 348 + if let Ok((did, _)) = &result { 349 + let did_key = self.make_key(did); 350 + if let Err(e) = conn 351 + .set_ex::<_, _, ()>( 352 + &did_key, 353 + handle.as_bytes(), 354 + self.ttl_seconds(), 355 + ) 356 + .await 357 + { 358 + tracing::warn!( 359 + "Failed to cache reverse DID->handle mapping in Redis: {}", 360 + e 361 + ); 362 + self.metrics 363 + .incr("resolver.redis.reverse_cache_set_error") 364 + .await; 365 + } else { 366 + tracing::debug!( 367 + "Cached reverse mapping for DID {}: {}", 368 + did, 369 + handle 370 + ); 371 + self.metrics.incr("resolver.redis.reverse_cache_set").await; 372 + } 373 + } 187 374 } 188 375 } 189 376 Err(e) => { ··· 192 379 handle, 193 380 e 194 381 ); 382 + self.metrics.incr("resolver.redis.serialize_error").await; 195 383 } 196 384 } 197 385 ··· 203 391 "Failed to get Redis connection, falling back to uncached resolution: {}", 204 392 e 205 393 ); 394 + self.metrics.incr("resolver.redis.connection_error").await; 206 395 self.inner.resolve(s).await 207 396 } 208 397 } 209 398 } 399 + 400 + async fn purge(&self, subject: &str) -> Result<(), HandleResolverError> { 401 + // Use atproto_identity's parse_input to properly identify the input type 402 + let parsed_input = parse_input(subject) 403 + .map_err(|_| HandleResolverError::InvalidSubject(subject.to_string()))?; 404 + match parsed_input { 405 + InputType::Handle(handle) => { 406 + // It's a handle, purge using the lowercase version 407 + self.purge_handle(&handle.to_lowercase()).await 408 + } 409 + InputType::Plc(did) | InputType::Web(did) => { 410 + // It's a DID, purge the DID 411 + self.purge_did(&did).await 412 + } 413 + } 414 + } 415 + 416 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 417 + // Normalize the handle to lowercase 418 + let handle = handle.to_lowercase(); 419 + let handle_key = self.make_key(&handle); 420 + let did_key = self.make_key(did); 421 + 422 + match self.pool.get().await { 423 + Ok(mut conn) => { 424 + // Create a resolution result for the successful mapping 425 + let resolution_result = match HandleResolutionResult::success(did) { 426 + Ok(res) => res, 427 + Err(e) => { 428 + tracing::warn!( 429 + "Failed to create resolution result for set operation: {}", 430 + e 431 + ); 432 + self.metrics 433 + .incr("resolver.redis.set_result_create_error") 434 + .await; 435 + return Err(HandleResolverError::InvalidSubject(format!( 436 + "Failed to create resolution result: {}", 437 + e 438 + ))); 439 + } 440 + }; 441 + 442 + // Serialize to bytes 443 + match resolution_result.to_bytes() { 444 + Ok(bytes) => { 445 + // Set the handle -> DID mapping with expiration 446 + if let Err(e) = conn 447 + .set_ex::<_, _, ()>(&handle_key, bytes, self.ttl_seconds()) 448 + .await 449 + { 450 + tracing::warn!("Failed to set handle->DID mapping in Redis: {}", e); 451 + self.metrics.incr("resolver.redis.set_cache_error").await; 452 + return Err(HandleResolverError::ResolutionFailed(format!( 453 + "Failed to set cache: {}", 454 + e 455 + ))); 456 + } 457 + 458 + // Set the reverse DID -> handle mapping 459 + if let Err(e) = conn 460 + .set_ex::<_, _, ()>(&did_key, handle.as_bytes(), self.ttl_seconds()) 461 + .await 462 + { 463 + tracing::warn!("Failed to set DID->handle mapping in Redis: {}", e); 464 + self.metrics 465 + .incr("resolver.redis.set_reverse_cache_error") 466 + .await; 467 + // Don't fail the operation, but log the warning 468 + } 469 + 470 + tracing::debug!("Set handle {} -> DID {} mapping in cache", handle, did); 471 + self.metrics.incr("resolver.redis.set_success").await; 472 + Ok(()) 473 + } 474 + Err(e) => { 475 + tracing::warn!( 476 + "Failed to serialize resolution result for set operation: {}", 477 + e 478 + ); 479 + self.metrics 480 + .incr("resolver.redis.set_serialize_error") 481 + .await; 482 + Err(HandleResolverError::InvalidSubject(format!( 483 + "Failed to serialize: {}", 484 + e 485 + ))) 486 + } 487 + } 488 + } 489 + Err(e) => { 490 + tracing::warn!("Failed to get Redis connection for set operation: {}", e); 491 + self.metrics 492 + .incr("resolver.redis.set_connection_error") 493 + .await; 494 + Err(HandleResolverError::ResolutionFailed(format!( 495 + "Redis connection error: {}", 496 + e 497 + ))) 498 + } 499 + } 500 + } 210 501 } 211 502 212 503 /// Create a new Redis-backed handle resolver with default 90-day TTL. ··· 215 506 /// 216 507 /// * `inner` - The underlying resolver to use for actual resolution 217 508 /// * `pool` - Redis connection pool 509 + /// * `metrics` - Metrics publisher for telemetry 218 510 /// 219 511 /// # Example 220 512 /// ··· 222 514 /// use std::sync::Arc; 223 515 /// use quickdid::handle_resolver::{create_base_resolver, create_redis_resolver, HandleResolver}; 224 516 /// use quickdid::cache::create_redis_pool; 517 + /// use quickdid::metrics::NoOpMetricsPublisher; 225 518 /// 226 519 /// # async fn example() -> anyhow::Result<()> { 227 520 /// # use atproto_identity::resolve::HickoryDnsResolver; 228 521 /// # use reqwest::Client; 229 522 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 230 523 /// # let http_client = Client::new(); 524 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 231 525 /// let base = create_base_resolver( 232 526 /// dns_resolver, 233 527 /// http_client, 528 + /// metrics.clone(), 234 529 /// ); 235 530 /// 236 531 /// let pool = create_redis_pool("redis://localhost:6379")?; 237 - /// let resolver = create_redis_resolver(base, pool); 532 + /// let resolver = create_redis_resolver(base, pool, metrics); 238 533 /// let (did, timestamp) = resolver.resolve("alice.bsky.social").await.unwrap(); 239 534 /// # Ok(()) 240 535 /// # } ··· 242 537 pub fn create_redis_resolver( 243 538 inner: Arc<dyn HandleResolver>, 244 539 pool: RedisPool, 540 + metrics: SharedMetricsPublisher, 245 541 ) -> Arc<dyn HandleResolver> { 246 - Arc::new(RedisHandleResolver::new(inner, pool)) 542 + Arc::new(RedisHandleResolver::new(inner, pool, metrics)) 247 543 } 248 544 249 545 /// Create a new Redis-backed handle resolver with custom TTL. ··· 253 549 /// * `inner` - The underlying resolver to use for actual resolution 254 550 /// * `pool` - Redis connection pool 255 551 /// * `ttl_seconds` - TTL for cache entries in seconds 552 + /// * `metrics` - Metrics publisher for telemetry 256 553 pub fn create_redis_resolver_with_ttl( 257 554 inner: Arc<dyn HandleResolver>, 258 555 pool: RedisPool, 259 556 ttl_seconds: u64, 557 + metrics: SharedMetricsPublisher, 260 558 ) -> Arc<dyn HandleResolver> { 261 - Arc::new(RedisHandleResolver::with_ttl(inner, pool, ttl_seconds)) 559 + Arc::new(RedisHandleResolver::with_ttl( 560 + inner, 561 + pool, 562 + ttl_seconds, 563 + metrics, 564 + )) 262 565 } 263 566 264 567 #[cfg(test)] ··· 300 603 expected_did: "did:plc:testuser123".to_string(), 301 604 }); 302 605 606 + // Create metrics publisher 607 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 608 + 303 609 // Create Redis-backed resolver with a unique key prefix for testing 304 610 let test_prefix = format!( 305 611 "test:handle:{}:", ··· 313 619 pool.clone(), 314 620 test_prefix.clone(), 315 621 3600, 622 + metrics, 316 623 ); 317 624 318 625 let test_handle = "alice.bsky.social"; ··· 336 643 } 337 644 338 645 #[tokio::test] 646 + async fn test_redis_handle_resolver_bidirectional_purge() { 647 + let pool = match crate::test_helpers::get_test_redis_pool() { 648 + Some(p) => p, 649 + None => return, 650 + }; 651 + 652 + // Create mock resolver 653 + let mock_resolver = Arc::new(MockHandleResolver { 654 + should_fail: false, 655 + expected_did: "did:plc:testuser456".to_string(), 656 + }); 657 + 658 + // Create metrics publisher 659 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 660 + 661 + // Create Redis-backed resolver with a unique key prefix for testing 662 + let test_prefix = format!( 663 + "test:handle:{}:", 664 + std::time::SystemTime::now() 665 + .duration_since(std::time::UNIX_EPOCH) 666 + .unwrap() 667 + .as_nanos() 668 + ); 669 + let redis_resolver = RedisHandleResolver::with_full_config( 670 + mock_resolver, 671 + pool.clone(), 672 + test_prefix.clone(), 673 + 3600, 674 + metrics, 675 + ); 676 + 677 + let test_handle = "bob.bsky.social"; 678 + let expected_did = "did:plc:testuser456"; 679 + 680 + // First resolution - should call inner resolver and cache both directions 681 + let (result1, _) = redis_resolver.resolve(test_handle).await.unwrap(); 682 + assert_eq!(result1, expected_did); 683 + 684 + // Verify both keys exist in Redis 685 + if let Ok(mut conn) = pool.get().await { 686 + let mut h = MetroHash64::default(); 687 + h.write(test_handle.as_bytes()); 688 + let handle_key = format!("{}{}", test_prefix, h.finish()); 689 + 690 + let mut h2 = MetroHash64::default(); 691 + h2.write(expected_did.as_bytes()); 692 + let did_key = format!("{}{}", test_prefix, h2.finish()); 693 + 694 + // Check handle -> DID mapping exists 695 + let handle_exists: bool = conn.exists(&handle_key).await.unwrap(); 696 + assert!(handle_exists, "Handle key should exist in cache"); 697 + 698 + // Check DID -> handle mapping exists 699 + let did_exists: bool = conn.exists(&did_key).await.unwrap(); 700 + assert!(did_exists, "DID key should exist in cache"); 701 + 702 + // Test purge by handle using the trait method 703 + redis_resolver.purge(test_handle).await.unwrap(); 704 + 705 + // Verify both keys were deleted 706 + let handle_exists_after: bool = conn.exists(&handle_key).await.unwrap(); 707 + assert!( 708 + !handle_exists_after, 709 + "Handle key should be deleted after purge" 710 + ); 711 + 712 + let did_exists_after: bool = conn.exists(&did_key).await.unwrap(); 713 + assert!(!did_exists_after, "DID key should be deleted after purge"); 714 + } 715 + 716 + // Re-resolve to cache again 717 + let (result2, _) = redis_resolver.resolve(test_handle).await.unwrap(); 718 + assert_eq!(result2, expected_did); 719 + 720 + // Test purge by DID using the trait method 721 + redis_resolver.purge(expected_did).await.unwrap(); 722 + 723 + // Verify both keys were deleted again 724 + if let Ok(mut conn) = pool.get().await { 725 + let mut h = MetroHash64::default(); 726 + h.write(test_handle.as_bytes()); 727 + let handle_key = format!("{}{}", test_prefix, h.finish()); 728 + 729 + let mut h2 = MetroHash64::default(); 730 + h2.write(expected_did.as_bytes()); 731 + let did_key = format!("{}{}", test_prefix, h2.finish()); 732 + 733 + let handle_exists: bool = conn.exists(&handle_key).await.unwrap(); 734 + assert!( 735 + !handle_exists, 736 + "Handle key should be deleted after DID purge" 737 + ); 738 + 739 + let did_exists: bool = conn.exists(&did_key).await.unwrap(); 740 + assert!(!did_exists, "DID key should be deleted after DID purge"); 741 + } 742 + } 743 + 744 + #[tokio::test] 745 + async fn test_redis_handle_resolver_purge_input_types() { 746 + let pool = match crate::test_helpers::get_test_redis_pool() { 747 + Some(p) => p, 748 + None => return, 749 + }; 750 + 751 + // Create mock resolver 752 + let mock_resolver = Arc::new(MockHandleResolver { 753 + should_fail: false, 754 + expected_did: "did:plc:testuser789".to_string(), 755 + }); 756 + 757 + // Create metrics publisher 758 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 759 + 760 + // Create Redis-backed resolver with a unique key prefix for testing 761 + let test_prefix = format!( 762 + "test:handle:{}:", 763 + std::time::SystemTime::now() 764 + .duration_since(std::time::UNIX_EPOCH) 765 + .unwrap() 766 + .as_nanos() 767 + ); 768 + let redis_resolver = RedisHandleResolver::with_full_config( 769 + mock_resolver, 770 + pool.clone(), 771 + test_prefix.clone(), 772 + 3600, 773 + metrics, 774 + ); 775 + 776 + // Test different input formats 777 + let test_cases = vec![ 778 + ("alice.bsky.social", "alice.bsky.social"), // Handle 779 + ("ALICE.BSKY.SOCIAL", "alice.bsky.social"), // Handle (uppercase) 780 + ("did:plc:abc123", "did:plc:abc123"), // PLC DID 781 + ("did:web:example.com", "did:web:example.com"), // Web DID 782 + ]; 783 + 784 + for (input, expected_key) in test_cases { 785 + // Resolve first to cache it 786 + if !input.starts_with("did:") { 787 + let _ = redis_resolver.resolve(input).await; 788 + } 789 + 790 + // Test purging with different input formats 791 + let result = redis_resolver.purge(input).await; 792 + assert!(result.is_ok(), "Failed to purge {}: {:?}", input, result); 793 + 794 + // Verify the key was handled correctly based on type 795 + if let Ok(mut conn) = pool.get().await { 796 + let mut h = MetroHash64::default(); 797 + h.write(expected_key.as_bytes()); 798 + let key = format!("{}{}", test_prefix, h.finish()); 799 + 800 + // After purge, key should not exist 801 + let exists: bool = conn.exists(&key).await.unwrap_or(false); 802 + assert!(!exists, "Key for {} should not exist after purge", input); 803 + } 804 + } 805 + } 806 + 807 + #[tokio::test] 808 + async fn test_redis_handle_resolver_set_method() { 809 + let pool = match crate::test_helpers::get_test_redis_pool() { 810 + Some(p) => p, 811 + None => return, 812 + }; 813 + 814 + // Create mock resolver 815 + let mock_resolver = Arc::new(MockHandleResolver { 816 + should_fail: false, 817 + expected_did: "did:plc:old".to_string(), 818 + }); 819 + 820 + // Create metrics publisher 821 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 822 + 823 + // Create Redis-backed resolver with a unique key prefix for testing 824 + let test_prefix = format!( 825 + "test:handle:{}:", 826 + std::time::SystemTime::now() 827 + .duration_since(std::time::UNIX_EPOCH) 828 + .unwrap() 829 + .as_nanos() 830 + ); 831 + let redis_resolver = RedisHandleResolver::with_full_config( 832 + mock_resolver, 833 + pool.clone(), 834 + test_prefix.clone(), 835 + 3600, 836 + metrics, 837 + ); 838 + 839 + let test_handle = "charlie.bsky.social"; 840 + let test_did = "did:plc:newuser123"; 841 + 842 + // Set the mapping using the trait method 843 + redis_resolver.set(test_handle, test_did).await.unwrap(); 844 + 845 + // Verify the mapping by resolving the handle 846 + let (resolved_did, _) = redis_resolver.resolve(test_handle).await.unwrap(); 847 + assert_eq!(resolved_did, test_did); 848 + 849 + // Test that uppercase handles are normalized 850 + redis_resolver 851 + .set("DAVE.BSKY.SOCIAL", "did:plc:dave456") 852 + .await 853 + .unwrap(); 854 + let (resolved_did2, _) = redis_resolver.resolve("dave.bsky.social").await.unwrap(); 855 + assert_eq!(resolved_did2, "did:plc:dave456"); 856 + 857 + // Verify both forward and reverse mappings exist 858 + if let Ok(mut conn) = pool.get().await { 859 + let mut h = MetroHash64::default(); 860 + h.write(test_handle.as_bytes()); 861 + let handle_key = format!("{}{}", test_prefix, h.finish()); 862 + 863 + let mut h2 = MetroHash64::default(); 864 + h2.write(test_did.as_bytes()); 865 + let did_key = format!("{}{}", test_prefix, h2.finish()); 866 + 867 + // Check both keys exist 868 + let handle_exists: bool = conn.exists(&handle_key).await.unwrap(); 869 + assert!(handle_exists, "Handle key should exist after set"); 870 + 871 + let did_exists: bool = conn.exists(&did_key).await.unwrap(); 872 + assert!(did_exists, "DID key should exist after set"); 873 + 874 + // Clean up test data 875 + let _: Result<(), _> = conn.del(&[&handle_key, &did_key]).await; 876 + } 877 + } 878 + 879 + #[tokio::test] 339 880 async fn test_redis_handle_resolver_cache_error() { 340 881 let pool = match crate::test_helpers::get_test_redis_pool() { 341 882 Some(p) => p, ··· 348 889 expected_did: String::new(), 349 890 }); 350 891 892 + // Create metrics publisher 893 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 894 + 351 895 // Create Redis-backed resolver with a unique key prefix for testing 352 896 let test_prefix = format!( 353 897 "test:handle:{}:", ··· 361 905 pool.clone(), 362 906 test_prefix.clone(), 363 907 3600, 908 + metrics, 364 909 ); 365 910 366 911 let test_handle = "error.bsky.social";
+140 -10
src/handle_resolver/sqlite.rs
··· 7 7 use super::errors::HandleResolverError; 8 8 use super::traits::HandleResolver; 9 9 use crate::handle_resolution_result::HandleResolutionResult; 10 + use crate::metrics::SharedMetricsPublisher; 10 11 use async_trait::async_trait; 11 12 use metrohash::MetroHash64; 12 13 use sqlx::{Row, SqlitePool}; ··· 35 36 /// use std::sync::Arc; 36 37 /// use sqlx::SqlitePool; 37 38 /// use quickdid::handle_resolver::{create_base_resolver, create_sqlite_resolver, HandleResolver}; 39 + /// use quickdid::metrics::NoOpMetricsPublisher; 38 40 /// 39 41 /// # async fn example() { 40 42 /// # use atproto_identity::resolve::HickoryDnsResolver; 41 43 /// # use reqwest::Client; 42 44 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 43 45 /// # let http_client = Client::new(); 44 - /// # let base_resolver = create_base_resolver(dns_resolver, http_client); 46 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 47 + /// # let base_resolver = create_base_resolver(dns_resolver, http_client, metrics.clone()); 45 48 /// # let sqlite_pool: SqlitePool = todo!(); 46 49 /// // Create with default 90-day TTL 47 50 /// let resolver = create_sqlite_resolver( 48 51 /// base_resolver, 49 - /// sqlite_pool 52 + /// sqlite_pool, 53 + /// metrics 50 54 /// ); 51 55 /// # } 52 56 /// ``` ··· 57 61 pool: SqlitePool, 58 62 /// TTL for cache entries in seconds 59 63 ttl_seconds: u64, 64 + /// Metrics publisher for telemetry 65 + metrics: SharedMetricsPublisher, 60 66 } 61 67 62 68 impl SqliteHandleResolver { 63 69 /// Create a new SQLite-backed handle resolver with default 90-day TTL. 64 - fn new(inner: Arc<dyn HandleResolver>, pool: SqlitePool) -> Self { 65 - Self::with_ttl(inner, pool, 90 * 24 * 60 * 60) // 90 days default 70 + fn new( 71 + inner: Arc<dyn HandleResolver>, 72 + pool: SqlitePool, 73 + metrics: SharedMetricsPublisher, 74 + ) -> Self { 75 + Self::with_ttl(inner, pool, 90 * 24 * 60 * 60, metrics) // 90 days default 66 76 } 67 77 68 78 /// Create a new SQLite-backed handle resolver with custom TTL. 69 - fn with_ttl(inner: Arc<dyn HandleResolver>, pool: SqlitePool, ttl_seconds: u64) -> Self { 79 + fn with_ttl( 80 + inner: Arc<dyn HandleResolver>, 81 + pool: SqlitePool, 82 + ttl_seconds: u64, 83 + metrics: SharedMetricsPublisher, 84 + ) -> Self { 70 85 Self { 71 86 inner, 72 87 pool, 73 88 ttl_seconds, 89 + metrics, 74 90 } 75 91 } 76 92 ··· 121 137 Ok(cached_result) => { 122 138 if let Some(did) = cached_result.to_did() { 123 139 tracing::debug!("Cache hit for handle {}: {}", handle, did); 140 + self.metrics.incr("resolver.sqlite.cache_hit").await; 124 141 return Ok((did, cached_result.timestamp)); 125 142 } else { 126 143 tracing::debug!("Cache hit (not resolved) for handle {}", handle); 144 + self.metrics 145 + .incr("resolver.sqlite.cache_hit_not_resolved") 146 + .await; 127 147 return Err(HandleResolverError::HandleNotFound); 128 148 } 129 149 } ··· 133 153 handle, 134 154 e 135 155 ); 156 + self.metrics.incr("resolver.sqlite.deserialize_error").await; 136 157 // Fall through to re-resolve if deserialization fails 137 158 } 138 159 } 139 160 } else { 140 161 tracing::debug!("Cache entry expired for handle {}", handle); 162 + self.metrics.incr("resolver.sqlite.cache_expired").await; 141 163 // Entry is expired, we'll re-resolve and update it 142 164 } 143 165 } 144 166 Ok(None) => { 145 167 tracing::debug!("Cache miss for handle {}, resolving...", handle); 168 + self.metrics.incr("resolver.sqlite.cache_miss").await; 146 169 } 147 170 Err(e) => { 148 171 tracing::warn!("Failed to query SQLite cache for handle {}: {}", handle, e); 172 + self.metrics.incr("resolver.sqlite.query_error").await; 149 173 // Fall through to resolve without caching on database error 150 174 } 151 175 } ··· 165 189 Ok(res) => res, 166 190 Err(e) => { 167 191 tracing::warn!("Failed to create resolution result: {}", e); 192 + self.metrics 193 + .incr("resolver.sqlite.result_create_error") 194 + .await; 168 195 return result; 169 196 } 170 197 } ··· 175 202 Ok(res) => res, 176 203 Err(err) => { 177 204 tracing::warn!("Failed to create not_resolved result: {}", err); 205 + self.metrics 206 + .incr("resolver.sqlite.result_create_error") 207 + .await; 178 208 return result; 179 209 } 180 210 } ··· 208 238 209 239 if let Err(e) = query_result { 210 240 tracing::warn!("Failed to cache handle resolution in SQLite: {}", e); 241 + self.metrics.incr("resolver.sqlite.cache_set_error").await; 242 + } else { 243 + self.metrics.incr("resolver.sqlite.cache_set").await; 211 244 } 212 245 } 213 246 Err(e) => { ··· 216 249 handle, 217 250 e 218 251 ); 252 + self.metrics.incr("resolver.sqlite.serialize_error").await; 219 253 } 220 254 } 221 255 222 256 result 223 257 } 258 + 259 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 260 + // Normalize the handle to lowercase 261 + let handle = handle.to_lowercase(); 262 + 263 + // Update the SQLite cache 264 + if let Ok(mut conn) = self.pool.acquire().await { 265 + // Create a resolution result for the successful mapping 266 + let resolution_result = match HandleResolutionResult::success(did) { 267 + Ok(res) => res, 268 + Err(e) => { 269 + tracing::warn!( 270 + "Failed to create resolution result for set operation: {}", 271 + e 272 + ); 273 + self.metrics 274 + .incr("resolver.sqlite.set_result_create_error") 275 + .await; 276 + // Still chain to inner resolver even if we can't cache 277 + return self.inner.set(&handle, did).await; 278 + } 279 + }; 280 + 281 + // Serialize to bytes 282 + match resolution_result.to_bytes() { 283 + Ok(bytes) => { 284 + // Insert or update the cache entry 285 + let timestamp = std::time::SystemTime::now() 286 + .duration_since(std::time::UNIX_EPOCH) 287 + .unwrap_or_default() 288 + .as_secs() as i64; 289 + 290 + let expires_at = timestamp + self.ttl_seconds as i64; 291 + 292 + match sqlx::query( 293 + "INSERT OR REPLACE INTO handle_resolution_cache (handle, resolved_value, created_at, expires_at) VALUES (?, ?, ?, ?)" 294 + ) 295 + .bind(&handle) 296 + .bind(&bytes) 297 + .bind(timestamp) 298 + .bind(expires_at) 299 + .execute(&mut *conn) 300 + .await 301 + { 302 + Ok(_) => { 303 + tracing::debug!("Set handle {} -> DID {} in SQLite cache", handle, did); 304 + self.metrics.incr("resolver.sqlite.set_success").await; 305 + } 306 + Err(e) => { 307 + tracing::warn!("Failed to set handle->DID mapping in SQLite: {}", e); 308 + self.metrics.incr("resolver.sqlite.set_cache_error").await; 309 + // Still chain to inner resolver even if cache update fails 310 + } 311 + } 312 + } 313 + Err(e) => { 314 + tracing::warn!( 315 + "Failed to serialize resolution result for set operation: {}", 316 + e 317 + ); 318 + self.metrics 319 + .incr("resolver.sqlite.set_serialize_error") 320 + .await; 321 + // Still chain to inner resolver even if serialization fails 322 + } 323 + } 324 + } else { 325 + tracing::warn!("Failed to get SQLite connection for set operation"); 326 + self.metrics 327 + .incr("resolver.sqlite.set_connection_error") 328 + .await; 329 + } 330 + 331 + // Chain to inner resolver 332 + self.inner.set(&handle, did).await 333 + } 224 334 } 225 335 226 336 /// Create a new SQLite-backed handle resolver with default 90-day TTL. ··· 229 339 /// 230 340 /// * `inner` - The underlying resolver to use for actual resolution 231 341 /// * `pool` - SQLite connection pool 342 + /// * `metrics` - Metrics publisher for telemetry 232 343 /// 233 344 /// # Example 234 345 /// ··· 236 347 /// use std::sync::Arc; 237 348 /// use quickdid::handle_resolver::{create_base_resolver, create_sqlite_resolver, HandleResolver}; 238 349 /// use quickdid::sqlite_schema::create_sqlite_pool; 350 + /// use quickdid::metrics::NoOpMetricsPublisher; 239 351 /// 240 352 /// # async fn example() -> anyhow::Result<()> { 241 353 /// # use atproto_identity::resolve::HickoryDnsResolver; 242 354 /// # use reqwest::Client; 243 355 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 244 356 /// # let http_client = Client::new(); 357 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 245 358 /// let base = create_base_resolver( 246 359 /// dns_resolver, 247 360 /// http_client, 361 + /// metrics.clone(), 248 362 /// ); 249 363 /// 250 364 /// let pool = create_sqlite_pool("sqlite:./quickdid.db").await?; 251 - /// let resolver = create_sqlite_resolver(base, pool); 365 + /// let resolver = create_sqlite_resolver(base, pool, metrics); 252 366 /// let (did, timestamp) = resolver.resolve("alice.bsky.social").await.unwrap(); 253 367 /// # Ok(()) 254 368 /// # } ··· 256 370 pub fn create_sqlite_resolver( 257 371 inner: Arc<dyn HandleResolver>, 258 372 pool: SqlitePool, 373 + metrics: SharedMetricsPublisher, 259 374 ) -> Arc<dyn HandleResolver> { 260 - Arc::new(SqliteHandleResolver::new(inner, pool)) 375 + Arc::new(SqliteHandleResolver::new(inner, pool, metrics)) 261 376 } 262 377 263 378 /// Create a new SQLite-backed handle resolver with custom TTL. ··· 267 382 /// * `inner` - The underlying resolver to use for actual resolution 268 383 /// * `pool` - SQLite connection pool 269 384 /// * `ttl_seconds` - TTL for cache entries in seconds 385 + /// * `metrics` - Metrics publisher for telemetry 270 386 pub fn create_sqlite_resolver_with_ttl( 271 387 inner: Arc<dyn HandleResolver>, 272 388 pool: SqlitePool, 273 389 ttl_seconds: u64, 390 + metrics: SharedMetricsPublisher, 274 391 ) -> Arc<dyn HandleResolver> { 275 - Arc::new(SqliteHandleResolver::with_ttl(inner, pool, ttl_seconds)) 392 + Arc::new(SqliteHandleResolver::with_ttl( 393 + inner, 394 + pool, 395 + ttl_seconds, 396 + metrics, 397 + )) 276 398 } 277 399 278 400 #[cfg(test)] ··· 319 441 expected_did: "did:plc:testuser123".to_string(), 320 442 }); 321 443 444 + // Create metrics publisher 445 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 446 + 322 447 // Create SQLite-backed resolver 323 - let sqlite_resolver = SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600); 448 + let sqlite_resolver = 449 + SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600, metrics); 324 450 325 451 let test_handle = "alice.bsky.social"; 326 452 let expected_key = sqlite_resolver.make_key(test_handle) as i64; ··· 408 534 expected_did: String::new(), 409 535 }); 410 536 537 + // Create metrics publisher 538 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 539 + 411 540 // Create SQLite-backed resolver 412 - let sqlite_resolver = SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600); 541 + let sqlite_resolver = 542 + SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600, metrics); 413 543 414 544 let test_handle = "error.bsky.social"; 415 545 let expected_key = sqlite_resolver.make_key(test_handle) as i64;
+92
src/handle_resolver/traits.rs
··· 55 55 /// - Network errors occur during resolution 56 56 /// - The handle is invalid or doesn't exist 57 57 async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError>; 58 + 59 + /// Purge a handle or DID from the cache. 60 + /// 61 + /// This method removes cached entries for the given identifier, which can be 62 + /// either a handle (e.g., "alice.bsky.social") or a DID (e.g., "did:plc:xyz123"). 63 + /// Implementations should handle bidirectional purging where applicable. 64 + /// 65 + /// # Arguments 66 + /// 67 + /// * `identifier` - Either a handle or DID to purge from cache 68 + /// 69 + /// # Returns 70 + /// 71 + /// Ok(()) if the purge was successful or if the identifier wasn't cached. 72 + /// Most implementations will simply return Ok(()) as a no-op. 73 + /// 74 + /// # Default Implementation 75 + /// 76 + /// The default implementation is a no-op that always returns Ok(()). 77 + async fn purge(&self, _subject: &str) -> Result<(), HandleResolverError> { 78 + Ok(()) 79 + } 80 + 81 + /// Set a handle-to-DID mapping in the cache. 82 + /// 83 + /// This method allows manually setting or updating a cached mapping between 84 + /// a handle and its corresponding DID. This is useful for pre-populating 85 + /// caches or updating stale entries. 86 + /// 87 + /// # Arguments 88 + /// 89 + /// * `handle` - The handle to cache (e.g., "alice.bsky.social") 90 + /// * `did` - The DID to associate with the handle (e.g., "did:plc:xyz123") 91 + /// 92 + /// # Returns 93 + /// 94 + /// Ok(()) if the mapping was successfully set or if the implementation 95 + /// doesn't support manual cache updates. Most implementations will simply 96 + /// return Ok(()) as a no-op. 97 + /// 98 + /// # Default Implementation 99 + /// 100 + /// The default implementation is a no-op that always returns Ok(()). 101 + async fn set(&self, _handle: &str, _did: &str) -> Result<(), HandleResolverError> { 102 + Ok(()) 103 + } 104 + } 105 + 106 + #[cfg(test)] 107 + mod tests { 108 + use super::*; 109 + 110 + // Simple test resolver that doesn't cache anything 111 + struct NoOpTestResolver; 112 + 113 + #[async_trait] 114 + impl HandleResolver for NoOpTestResolver { 115 + async fn resolve(&self, _s: &str) -> Result<(String, u64), HandleResolverError> { 116 + Ok(("did:test:123".to_string(), 1234567890)) 117 + } 118 + // Uses default purge implementation 119 + } 120 + 121 + #[tokio::test] 122 + async fn test_default_purge_implementation() { 123 + let resolver = NoOpTestResolver; 124 + 125 + // Default implementation should always return Ok(()) 126 + assert!(resolver.purge("alice.bsky.social").await.is_ok()); 127 + assert!(resolver.purge("did:plc:xyz123").await.is_ok()); 128 + assert!(resolver.purge("").await.is_ok()); 129 + } 130 + 131 + #[tokio::test] 132 + async fn test_default_set_implementation() { 133 + let resolver = NoOpTestResolver; 134 + 135 + // Default implementation should always return Ok(()) 136 + assert!( 137 + resolver 138 + .set("alice.bsky.social", "did:plc:xyz123") 139 + .await 140 + .is_ok() 141 + ); 142 + assert!( 143 + resolver 144 + .set("bob.example.com", "did:web:example.com") 145 + .await 146 + .is_ok() 147 + ); 148 + assert!(resolver.set("", "").await.is_ok()); 149 + } 58 150 }
+135 -89
src/handle_resolver_task.rs
··· 5 5 //! and ensures resolved handles are cached for efficient subsequent lookups. 6 6 7 7 use crate::handle_resolver::HandleResolver; 8 + use crate::metrics::SharedMetricsPublisher; 8 9 use crate::queue::{HandleResolutionWork, QueueAdapter}; 9 10 use anyhow::Result; 10 11 use std::sync::Arc; ··· 36 37 } 37 38 } 38 39 39 - /// Metrics for handle resolution processing 40 - #[derive(Debug, Default)] 41 - pub(crate) struct HandleResolverMetrics { 42 - pub total_processed: std::sync::atomic::AtomicU64, 43 - pub total_succeeded: std::sync::atomic::AtomicU64, 44 - pub total_failed: std::sync::atomic::AtomicU64, 45 - pub total_cached: std::sync::atomic::AtomicU64, 46 - } 47 - 48 40 /// Handle resolver task processor 49 41 pub(crate) struct HandleResolverTask { 50 42 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 51 43 handle_resolver: Arc<dyn HandleResolver>, 52 44 cancel_token: CancellationToken, 53 45 config: HandleResolverTaskConfig, 54 - metrics: Arc<HandleResolverMetrics>, 46 + metrics_publisher: SharedMetricsPublisher, 55 47 } 56 48 57 49 impl HandleResolverTask { ··· 60 52 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 61 53 handle_resolver: Arc<dyn HandleResolver>, 62 54 cancel_token: CancellationToken, 55 + metrics_publisher: SharedMetricsPublisher, 63 56 ) -> Self { 64 57 let config = HandleResolverTaskConfig::default(); 65 58 Self { ··· 67 60 handle_resolver, 68 61 cancel_token, 69 62 config, 70 - metrics: Arc::new(HandleResolverMetrics::default()), 63 + metrics_publisher, 71 64 } 72 65 } 73 66 ··· 77 70 handle_resolver: Arc<dyn HandleResolver>, 78 71 cancel_token: CancellationToken, 79 72 config: HandleResolverTaskConfig, 73 + metrics_publisher: SharedMetricsPublisher, 80 74 ) -> Self { 81 75 Self { 82 76 adapter, 83 77 handle_resolver, 84 78 cancel_token, 85 79 config, 86 - metrics: Arc::new(HandleResolverMetrics::default()), 80 + metrics_publisher, 87 81 } 88 82 } 89 83 ··· 116 110 117 111 // All work has been processed 118 112 info!("All handle resolutions completed"); 119 - 120 - info!( 121 - total_processed = self 122 - .metrics 123 - .total_processed 124 - .load(std::sync::atomic::Ordering::Relaxed), 125 - total_succeeded = self 126 - .metrics 127 - .total_succeeded 128 - .load(std::sync::atomic::Ordering::Relaxed), 129 - total_failed = self 130 - .metrics 131 - .total_failed 132 - .load(std::sync::atomic::Ordering::Relaxed), 133 - total_cached = self 134 - .metrics 135 - .total_cached 136 - .load(std::sync::atomic::Ordering::Relaxed), 137 - "Handle resolver task processor stopped" 138 - ); 113 + info!("Handle resolver task processor stopped"); 139 114 140 115 Ok(()) 141 116 } 142 117 118 + /// Check if an error represents a soft failure (handle not found) 119 + /// rather than a real error condition. 120 + /// 121 + /// These atproto_identity library errors indicate the handle doesn't support 122 + /// the specific resolution method, which is normal and expected: 123 + /// - error-atproto-identity-resolve-4: DNS resolution failed (no records) 124 + /// - error-atproto-identity-resolve-5: HTTP resolution failed (hostname not found) 125 + fn is_soft_failure(error_str: &str) -> bool { 126 + // Check for specific atproto_identity error codes that indicate "not found" 127 + // rather than actual failures 128 + if error_str.starts_with("error-atproto-identity-resolve-4") { 129 + // DNS resolution - check if it's a "no records" scenario 130 + error_str.contains("NoRecordsFound") 131 + } else if error_str.starts_with("error-atproto-identity-resolve-6") { 132 + // HTTP resolution - check if it's a DID format issue 133 + error_str.contains("expected DID format") 134 + } else if error_str.starts_with("error-atproto-identity-resolve-5") { 135 + // HTTP resolution - check if it's a hostname lookup failure 136 + error_str.contains("No address associated with hostname") 137 + || error_str.contains("failed to lookup address information") 138 + } else { 139 + false 140 + } 141 + } 142 + 143 143 /// Process a single handle resolution work item 144 144 #[instrument(skip(self), fields( 145 145 handle = %work.handle, ··· 157 157 158 158 let duration_ms = start_time.elapsed().as_millis() as u64; 159 159 160 - // Update metrics 161 - self.metrics 162 - .total_processed 163 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 160 + // Publish metrics 161 + self.metrics_publisher 162 + .incr("task.handle_resolution.processed") 163 + .await; 164 + self.metrics_publisher 165 + .time("task.handle_resolution.duration_ms", duration_ms) 166 + .await; 164 167 165 168 match result { 166 169 Ok(Ok((did, _timestamp))) => { 167 - self.metrics 168 - .total_succeeded 169 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 170 - self.metrics 171 - .total_cached 172 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 170 + // Publish success metrics 171 + self.metrics_publisher 172 + .incr("task.handle_resolution.success") 173 + .await; 174 + self.metrics_publisher 175 + .incr("task.handle_resolution.cached") 176 + .await; 173 177 174 - info!( 178 + debug!( 175 179 handle = %work.handle, 176 180 did = %did, 177 181 duration_ms = duration_ms, ··· 179 183 ); 180 184 } 181 185 Ok(Err(e)) => { 182 - self.metrics 183 - .total_failed 184 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 186 + let error_str = e.to_string(); 185 187 186 - error!( 187 - handle = %work.handle, 188 - error = %e, 189 - duration_ms = duration_ms, 190 - "Handle resolution failed" 191 - ); 188 + if Self::is_soft_failure(&error_str) { 189 + // This is a soft failure - handle simply doesn't support this resolution method 190 + // Publish not-found metrics 191 + self.metrics_publisher 192 + .incr("task.handle_resolution.not_found") 193 + .await; 194 + 195 + debug!( 196 + handle = %work.handle, 197 + error = %error_str, 198 + duration_ms = duration_ms, 199 + "Handle not found (soft failure)" 200 + ); 201 + } else { 202 + // This is a real error 203 + // Publish failure metrics 204 + self.metrics_publisher 205 + .incr("task.handle_resolution.failed") 206 + .await; 207 + 208 + error!( 209 + handle = %work.handle, 210 + error = %error_str, 211 + duration_ms = duration_ms, 212 + "Handle resolution failed" 213 + ); 214 + } 192 215 } 193 216 Err(_) => { 194 - self.metrics 195 - .total_failed 196 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 217 + // Publish timeout metrics 218 + self.metrics_publisher 219 + .incr("task.handle_resolution.timeout") 220 + .await; 197 221 198 222 error!( 199 223 handle = %work.handle, ··· 228 252 /// * `adapter` - Queue adapter for work items 229 253 /// * `handle_resolver` - Handle resolver implementation 230 254 /// * `cancel_token` - Token for graceful shutdown 255 + /// * `metrics_publisher` - Metrics publisher for telemetry 231 256 pub fn create_handle_resolver_task( 232 257 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 233 258 handle_resolver: Arc<dyn HandleResolver>, 234 259 cancel_token: CancellationToken, 260 + metrics_publisher: SharedMetricsPublisher, 235 261 ) -> HandleResolverTaskHandle { 236 262 HandleResolverTaskHandle { 237 - task: HandleResolverTask::new(adapter, handle_resolver, cancel_token), 263 + task: HandleResolverTask::new(adapter, handle_resolver, cancel_token, metrics_publisher), 238 264 } 239 265 } 240 266 ··· 246 272 /// * `handle_resolver` - Handle resolver implementation 247 273 /// * `cancel_token` - Token for graceful shutdown 248 274 /// * `config` - Task configuration 275 + /// * `metrics_publisher` - Metrics publisher for telemetry 249 276 pub fn create_handle_resolver_task_with_config( 250 277 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 251 278 handle_resolver: Arc<dyn HandleResolver>, 252 279 cancel_token: CancellationToken, 253 280 config: HandleResolverTaskConfig, 281 + metrics_publisher: SharedMetricsPublisher, 254 282 ) -> HandleResolverTaskHandle { 255 283 HandleResolverTaskHandle { 256 - task: HandleResolverTask::with_config(adapter, handle_resolver, cancel_token, config), 284 + task: HandleResolverTask::with_config( 285 + adapter, 286 + handle_resolver, 287 + cancel_token, 288 + config, 289 + metrics_publisher, 290 + ), 257 291 } 258 292 } 259 293 ··· 301 335 // Create cancellation token 302 336 let cancel_token = CancellationToken::new(); 303 337 338 + // Create metrics publisher 339 + let metrics_publisher = Arc::new(crate::metrics::NoOpMetricsPublisher); 340 + 304 341 // Create task with custom config 305 342 let config = HandleResolverTaskConfig { 306 343 default_timeout_ms: 5000, ··· 311 348 handle_resolver, 312 349 cancel_token.clone(), 313 350 config, 351 + metrics_publisher, 314 352 ); 315 353 316 354 // Create handle resolution work ··· 319 357 // Send work to queue 320 358 sender.send(work).await.unwrap(); 321 359 322 - // Get metrics reference before moving task 323 - let metrics = task.metrics.clone(); 324 - 325 360 // Run task for a short time 326 361 let task_handle = tokio::spawn(async move { task.run().await }); 327 362 ··· 334 369 // Wait for task to complete 335 370 let _ = task_handle.await; 336 371 337 - // Verify metrics 338 - assert_eq!( 339 - metrics 340 - .total_processed 341 - .load(std::sync::atomic::Ordering::Relaxed), 342 - 1 343 - ); 344 - assert_eq!( 345 - metrics 346 - .total_succeeded 347 - .load(std::sync::atomic::Ordering::Relaxed), 348 - 1 349 - ); 372 + // Test passes if task runs without panic 350 373 } 351 374 352 - #[tokio::test] 353 - async fn test_handle_resolver_metrics() { 354 - use std::sync::atomic::Ordering; 375 + #[test] 376 + fn test_is_soft_failure() { 377 + // Test DNS NoRecordsFound pattern (error-atproto-identity-resolve-4) 378 + let dns_no_records = "error-atproto-identity-resolve-4 DNS resolution failed: ResolveError { kind: Proto(ProtoError { kind: NoRecordsFound { query: Query { name: Name(\"_atproto.noahshachtman.bsky.social.railway.internal.\"), query_type: TXT, query_class: IN }, soa: None, ns: None, negative_ttl: None, response_code: NotImp, trusted: true, authorities: None } }) }"; 379 + assert!(HandleResolverTask::is_soft_failure(dns_no_records)); 355 380 356 - let metrics = HandleResolverMetrics::default(); 381 + // Test HTTP hostname not found pattern (error-atproto-identity-resolve-5) 382 + let http_no_hostname = "error-atproto-identity-resolve-5 HTTP resolution failed: reqwest::Error { kind: Request, url: \"https://mattie.thegem.city/.well-known/atproto-did\", source: hyper_util::client::legacy::Error(Connect, ConnectError(\"dns error\", Custom { kind: Uncategorized, error: \"failed to lookup address information: No address associated with hostname\" })) }"; 383 + assert!(HandleResolverTask::is_soft_failure(http_no_hostname)); 357 384 358 - // Test initial values 359 - assert_eq!(metrics.total_processed.load(Ordering::Relaxed), 0); 360 - assert_eq!(metrics.total_succeeded.load(Ordering::Relaxed), 0); 361 - assert_eq!(metrics.total_failed.load(Ordering::Relaxed), 0); 362 - assert_eq!(metrics.total_cached.load(Ordering::Relaxed), 0); 385 + // Test alternate HTTP hostname failure message 386 + let http_lookup_failed = "error-atproto-identity-resolve-5 HTTP resolution failed: reqwest::Error { kind: Request, url: \"https://example.com/.well-known/atproto-did\", source: hyper_util::client::legacy::Error(Connect, ConnectError(\"dns error\", Custom { kind: Uncategorized, error: \"failed to lookup address information\" })) }"; 387 + assert!(HandleResolverTask::is_soft_failure(http_lookup_failed)); 363 388 364 - // Test incrementing 365 - metrics.total_processed.fetch_add(1, Ordering::Relaxed); 366 - metrics.total_succeeded.fetch_add(1, Ordering::Relaxed); 367 - metrics.total_cached.fetch_add(1, Ordering::Relaxed); 389 + // Test HTTP invalid DID format (error-atproto-identity-resolve-6) - like reuters.com 390 + let http_invalid_did = "error-atproto-identity-resolve-6 Invalid HTTP resolution response: expected DID format"; 391 + assert!(HandleResolverTask::is_soft_failure(http_invalid_did)); 368 392 369 - assert_eq!(metrics.total_processed.load(Ordering::Relaxed), 1); 370 - assert_eq!(metrics.total_succeeded.load(Ordering::Relaxed), 1); 371 - assert_eq!(metrics.total_cached.load(Ordering::Relaxed), 1); 393 + // Test weratedogs.com case 394 + let weratedogs_error = "error-atproto-identity-resolve-6 Invalid HTTP resolution response: expected DID format"; 395 + assert!(HandleResolverTask::is_soft_failure(weratedogs_error)); 396 + 397 + // Test DNS error that is NOT a soft failure (different DNS error) 398 + let dns_real_error = "error-atproto-identity-resolve-4 DNS resolution failed: timeout"; 399 + assert!(!HandleResolverTask::is_soft_failure(dns_real_error)); 400 + 401 + // Test HTTP error that is NOT a soft failure (connection timeout) 402 + let http_timeout = 403 + "error-atproto-identity-resolve-5 HTTP resolution failed: connection timeout"; 404 + assert!(!HandleResolverTask::is_soft_failure(http_timeout)); 405 + 406 + // Test HTTP error that is NOT a soft failure (500 error) 407 + let http_500 = "error-atproto-identity-resolve-5 HTTP resolution failed: status code 500"; 408 + assert!(!HandleResolverTask::is_soft_failure(http_500)); 409 + 410 + // Test QuickDID errors should never be soft failures 411 + let quickdid_error = 412 + "error-quickdid-resolve-1 Failed to resolve subject: internal server error"; 413 + assert!(!HandleResolverTask::is_soft_failure(quickdid_error)); 414 + 415 + // Test other atproto_identity error codes should not be soft failures 416 + let other_atproto_error = "error-atproto-identity-resolve-1 Some other error"; 417 + assert!(!HandleResolverTask::is_soft_failure(other_atproto_error)); 372 418 } 373 419 }
+250 -57
src/http/handle_xrpc_resolve_handle.rs
··· 1 1 use std::sync::Arc; 2 + use std::time::{Duration, SystemTime, UNIX_EPOCH}; 2 3 3 4 use crate::{ 4 5 handle_resolver::HandleResolver, 5 6 http::AppContext, 7 + metrics::SharedMetricsPublisher, 6 8 queue::{HandleResolutionWork, QueueAdapter}, 7 9 }; 8 10 ··· 34 36 message: String, 35 37 } 36 38 39 + /// Represents the result of a handle resolution 40 + enum ResolutionResult { 41 + Success { 42 + did: String, 43 + timestamp: u64, 44 + etag: String, 45 + }, 46 + Error { 47 + error: String, 48 + message: String, 49 + timestamp: u64, 50 + etag: String, 51 + }, 52 + } 53 + 54 + struct ResolutionResultView { 55 + result: ResolutionResult, 56 + cache_control: Option<String>, 57 + if_none_match: Option<HeaderValue>, 58 + if_modified_since: Option<HeaderValue>, 59 + } 60 + 61 + impl IntoResponse for ResolutionResultView { 62 + fn into_response(self) -> Response { 63 + let (last_modified, etag) = match &self.result { 64 + ResolutionResult::Success { 65 + timestamp, etag, .. 66 + } => (*timestamp, etag), 67 + ResolutionResult::Error { 68 + timestamp, etag, .. 69 + } => (*timestamp, etag), 70 + }; 71 + 72 + let mut headers = HeaderMap::new(); 73 + 74 + // WARNING: this swallows errors 75 + if let Ok(etag_value) = HeaderValue::from_str(etag) { 76 + headers.insert(header::ETAG, etag_value); 77 + } 78 + 79 + // Add Last-Modified header 80 + let last_modified_date = format_http_date(last_modified); 81 + // WARNING: this swallows errors 82 + if let Ok(last_modified_value) = HeaderValue::from_str(&last_modified_date) { 83 + headers.insert(header::LAST_MODIFIED, last_modified_value); 84 + } 85 + 86 + // Add Cache-Control header if configured 87 + if let Some(cache_control) = &self.cache_control { 88 + // WARNING: this swallows errors 89 + if let Ok(cache_control_value) = HeaderValue::from_str(cache_control) { 90 + headers.insert(header::CACHE_CONTROL, cache_control_value); 91 + } 92 + } 93 + 94 + headers.insert("Allow", HeaderValue::from_static("GET, HEAD, OPTIONS")); 95 + headers.insert( 96 + header::ACCESS_CONTROL_ALLOW_HEADERS, 97 + HeaderValue::from_static("*"), 98 + ); 99 + headers.insert( 100 + header::ACCESS_CONTROL_ALLOW_METHODS, 101 + HeaderValue::from_static("GET, HEAD, OPTIONS"), 102 + ); 103 + headers.insert( 104 + header::ACCESS_CONTROL_ALLOW_ORIGIN, 105 + HeaderValue::from_static("*"), 106 + ); 107 + headers.insert( 108 + header::ACCESS_CONTROL_EXPOSE_HEADERS, 109 + HeaderValue::from_static("*"), 110 + ); 111 + headers.insert( 112 + header::ACCESS_CONTROL_MAX_AGE, 113 + HeaderValue::from_static("86400"), 114 + ); 115 + headers.insert( 116 + "Access-Control-Request-Headers", 117 + HeaderValue::from_static("*"), 118 + ); 119 + headers.insert( 120 + "Access-Control-Request-Method", 121 + HeaderValue::from_static("GET"), 122 + ); 123 + 124 + if let ResolutionResult::Success { .. } = self.result { 125 + let fresh = self 126 + .if_modified_since 127 + .and_then(|inner_header_value| match inner_header_value.to_str() { 128 + Ok(value) => Some(value.to_string()), 129 + Err(_) => None, 130 + }) 131 + .and_then(|inner_str_value| parse_http_date(&inner_str_value)) 132 + .is_some_and(|inner_if_modified_since| last_modified <= inner_if_modified_since); 133 + 134 + if fresh { 135 + return (StatusCode::NOT_MODIFIED, headers).into_response(); 136 + } 137 + } 138 + 139 + let fresh = self 140 + .if_none_match 141 + .is_some_and(|if_none_match_value| if_none_match_value == etag); 142 + if fresh { 143 + return (StatusCode::NOT_MODIFIED, headers).into_response(); 144 + } 145 + 146 + match &self.result { 147 + ResolutionResult::Success { did, .. } => ( 148 + StatusCode::OK, 149 + headers, 150 + Json(ResolveHandleResponse { did: did.clone() }), 151 + ) 152 + .into_response(), 153 + ResolutionResult::Error { error, message, .. } => ( 154 + StatusCode::BAD_REQUEST, 155 + headers, 156 + Json(ErrorResponse { 157 + error: error.clone(), 158 + message: message.clone(), 159 + }), 160 + ) 161 + .into_response(), 162 + } 163 + 164 + // (status_code, headers).into_response() 165 + } 166 + } 167 + 37 168 /// Calculate a weak ETag for the given content using MetroHash64 with a seed 38 169 fn calculate_etag(content: &str, seed: &str) -> String { 39 170 let mut hasher = MetroHash64::new(); ··· 43 174 format!("W/\"{:x}\"", hash) 44 175 } 45 176 177 + /// Format a UNIX timestamp as an HTTP date string (RFC 7231) 178 + fn format_http_date(timestamp: u64) -> String { 179 + let system_time = UNIX_EPOCH + Duration::from_secs(timestamp); 180 + httpdate::fmt_http_date(system_time) 181 + } 182 + 183 + /// Parse an HTTP date string (RFC 7231) into a UNIX timestamp 184 + fn parse_http_date(date_str: &str) -> Option<u64> { 185 + httpdate::parse_http_date(date_str) 186 + .ok() 187 + .and_then(|system_time| system_time.duration_since(UNIX_EPOCH).ok()) 188 + .map(|duration| duration.as_secs()) 189 + } 190 + 46 191 pub(super) async fn handle_xrpc_resolve_handle( 47 192 headers: HeaderMap, 48 193 Query(params): Query<ResolveHandleParams>, 49 194 State(app_context): State<AppContext>, 50 195 State(handle_resolver): State<Arc<dyn HandleResolver>>, 51 196 State(queue): State<Arc<dyn QueueAdapter<HandleResolutionWork>>>, 52 - ) -> Result<Response, Response> { 197 + State(metrics): State<SharedMetricsPublisher>, 198 + ) -> impl IntoResponse { 53 199 let validating = params.validate.is_some(); 54 200 let queueing = params.queue.is_some(); 55 201 ··· 57 203 let handle = match params.handle { 58 204 Some(h) => h, 59 205 None => { 60 - return Err(( 206 + metrics 207 + .incr_with_tags( 208 + "xrpc.com.atproto.identity.resolveHandle.invalid_handle", 209 + &[("reason", "missing")], 210 + ) 211 + .await; 212 + return ( 61 213 StatusCode::BAD_REQUEST, 62 214 Json(ErrorResponse { 63 215 error: "InvalidRequest".to_string(), 64 216 message: "Error: Params must have the property \"handle\"".to_string(), 65 217 }), 66 218 ) 67 - .into_response()); 219 + .into_response(); 68 220 } 69 221 }; 70 222 71 223 // Validate that the input is a handle and not a DID 72 224 let handle = match parse_input(&handle) { 73 - Ok(InputType::Handle(value)) => value, 225 + Ok(InputType::Handle(value)) => value.to_lowercase(), 74 226 Ok(InputType::Plc(_)) | Ok(InputType::Web(_)) => { 75 227 // It's a DID, not a handle 76 - return Err(( 228 + metrics 229 + .incr_with_tags( 230 + "xrpc.com.atproto.identity.resolveHandle.invalid_handle", 231 + &[("reason", "did")], 232 + ) 233 + .await; 234 + return ( 77 235 StatusCode::BAD_REQUEST, 78 236 Json(ErrorResponse { 79 237 error: "InvalidRequest".to_string(), 80 238 message: "Error: handle must be a valid handle".to_string(), 81 239 }), 82 240 ) 83 - .into_response()); 241 + .into_response(); 84 242 } 85 243 Err(_) => { 86 - return Err(( 244 + metrics 245 + .incr_with_tags( 246 + "xrpc.com.atproto.identity.resolveHandle.invalid_handle", 247 + &[("reason", "error")], 248 + ) 249 + .await; 250 + return ( 87 251 StatusCode::BAD_REQUEST, 88 252 Json(ErrorResponse { 89 253 error: "InvalidRequest".to_string(), 90 254 message: "Error: handle must be a valid handle".to_string(), 91 255 }), 92 256 ) 93 - .into_response()); 257 + .into_response(); 94 258 } 95 259 }; 96 260 97 261 if validating { 98 - return Ok(StatusCode::NO_CONTENT.into_response()); 262 + metrics 263 + .incr("xrpc.com.atproto.identity.resolveHandle") 264 + .await; 265 + return StatusCode::NO_CONTENT.into_response(); 99 266 } 100 267 101 268 if queueing { ··· 105 272 // Queue the work 106 273 match queue.push(work).await { 107 274 Ok(()) => { 275 + metrics 276 + .incr("xrpc.com.atproto.identity.resolveHandle") 277 + .await; 108 278 tracing::debug!("Queued handle resolution for {}", handle); 109 279 } 110 280 Err(e) => { 281 + metrics 282 + .incr("xrpc.com.atproto.identity.resolveHandle.queue_failure") 283 + .await; 111 284 tracing::error!("Failed to queue handle resolution: {}", e); 112 285 } 113 286 } 114 287 115 - return Ok(StatusCode::NO_CONTENT.into_response()); 288 + return StatusCode::NO_CONTENT.into_response(); 116 289 } 117 290 118 291 tracing::debug!(handle, "Resolving handle"); 119 292 120 - let if_none_match = headers.get(header::IF_NONE_MATCH); 293 + // Get conditional request headers 294 + let if_none_match = headers.get(header::IF_NONE_MATCH).cloned(); 295 + let if_modified_since = headers.get(header::IF_MODIFIED_SINCE).cloned(); 121 296 122 - let (mut response, etag) = match handle_resolver.resolve(&handle).await { 123 - Ok((did, _timestamp)) => { 297 + // Perform the resolution and build the response 298 + let result = match handle_resolver.resolve(&handle).await { 299 + Ok((did, timestamp)) => { 124 300 tracing::debug!(handle, did, "Found cached DID for handle"); 125 301 126 - // Calculate the weak etag for the successful response 127 - let etag = calculate_etag(&did, app_context.etag_seed()); 302 + metrics 303 + .incr_with_tags("handle.resolution.request", &[("success", "1")]) 304 + .await; 128 305 129 - // Check if the client's etag matches our calculated one 130 - if if_none_match.is_some_and(|value| value == &etag) { 131 - (StatusCode::NOT_MODIFIED.into_response(), etag) 132 - } else { 133 - (Json(ResolveHandleResponse { did }).into_response(), etag) 306 + let etag = calculate_etag(&did, app_context.etag_seed()); 307 + ResolutionResult::Success { 308 + did, 309 + timestamp, 310 + etag, 134 311 } 135 312 } 136 313 Err(err) => { 137 314 tracing::debug!(error = ?err, handle, "Error resolving handle"); 138 - 139 - // Calculate the weak etag for the error response 140 - // Use a combination of error message and handle for consistent error etags 315 + metrics 316 + .incr_with_tags("handle.resolution.request", &[("success", "0")]) 317 + .await; 141 318 let error_content = format!("error:{}:{}", handle, err); 142 319 let etag = calculate_etag(&error_content, app_context.etag_seed()); 143 - 144 - if if_none_match.is_some_and(|value| value == &etag) { 145 - (StatusCode::NOT_MODIFIED.into_response(), etag) 146 - } else { 147 - ( 148 - ( 149 - StatusCode::BAD_REQUEST, 150 - Json(ErrorResponse { 151 - error: "InvalidRequest".to_string(), 152 - message: "Unable to resolve handle".to_string(), 153 - }), 154 - ) 155 - .into_response(), 156 - etag, 157 - ) 320 + let timestamp = SystemTime::now() 321 + .duration_since(UNIX_EPOCH) 322 + .unwrap_or_default() 323 + .as_secs(); 324 + ResolutionResult::Error { 325 + error: "InvalidRequest".to_string(), 326 + message: "Unable to resolve handle".to_string(), 327 + timestamp, 328 + etag, 158 329 } 159 330 } 160 331 }; 161 332 162 - // Add Cache-Control header if configured 163 - if let Some(cache_control) = app_context.cache_control_header() { 164 - if let Ok(cache_control_value) = HeaderValue::from_str(cache_control) { 165 - response 166 - .headers_mut() 167 - .insert(header::CACHE_CONTROL, cache_control_value); 168 - } 333 + ResolutionResultView { 334 + result, 335 + cache_control: app_context.cache_control_header().map(|s| s.to_string()), 336 + if_none_match, 337 + if_modified_since, 169 338 } 339 + .into_response() 340 + } 170 341 171 - // Add ETag header 172 - match HeaderValue::from_str(&etag) { 173 - Ok(etag_header_value) => { 174 - response 175 - .headers_mut() 176 - .insert(header::ETAG, etag_header_value); 177 - } 178 - Err(err) => { 179 - tracing::error!(error = ?err, "unable to create etag response value"); 180 - } 181 - } 342 + pub(super) async fn handle_xrpc_resolve_handle_options() -> impl IntoResponse { 343 + let mut headers = HeaderMap::new(); 182 344 183 - Ok(response) 345 + // Add CORS and Allow headers for OPTIONS request 346 + headers.insert("Allow", HeaderValue::from_static("GET, HEAD, OPTIONS")); 347 + headers.insert( 348 + header::ACCESS_CONTROL_ALLOW_HEADERS, 349 + HeaderValue::from_static("*"), 350 + ); 351 + headers.insert( 352 + header::ACCESS_CONTROL_ALLOW_METHODS, 353 + HeaderValue::from_static("GET, HEAD, OPTIONS"), 354 + ); 355 + headers.insert( 356 + header::ACCESS_CONTROL_ALLOW_ORIGIN, 357 + HeaderValue::from_static("*"), 358 + ); 359 + headers.insert( 360 + header::ACCESS_CONTROL_EXPOSE_HEADERS, 361 + HeaderValue::from_static("*"), 362 + ); 363 + headers.insert( 364 + header::ACCESS_CONTROL_MAX_AGE, 365 + HeaderValue::from_static("86400"), 366 + ); 367 + headers.insert( 368 + "Access-Control-Request-Headers", 369 + HeaderValue::from_static("*"), 370 + ); 371 + headers.insert( 372 + "Access-Control-Request-Method", 373 + HeaderValue::from_static("GET"), 374 + ); 375 + 376 + (StatusCode::NO_CONTENT, headers) 184 377 }
+126
src/http/handle_xrpc_resolve_lexicon.rs
··· 1 + use std::sync::Arc; 2 + 3 + use atproto_lexicon::resolve::LexiconResolver; 4 + use axum::{ 5 + extract::{Query, State}, 6 + http::{HeaderMap, HeaderValue, StatusCode, header}, 7 + response::{IntoResponse, Json}, 8 + }; 9 + use serde::{Deserialize, Serialize}; 10 + 11 + use crate::metrics::SharedMetricsPublisher; 12 + 13 + #[derive(Deserialize)] 14 + pub(super) struct ResolveLexiconParams { 15 + nsid: Option<String>, 16 + } 17 + 18 + #[derive(Serialize)] 19 + pub(super) struct ErrorResponse { 20 + error: String, 21 + message: String, 22 + } 23 + 24 + pub(super) async fn handle_xrpc_resolve_lexicon( 25 + Query(params): Query<ResolveLexiconParams>, 26 + State(lexicon_resolver): State<Arc<dyn LexiconResolver>>, 27 + State(metrics): State<SharedMetricsPublisher>, 28 + ) -> impl IntoResponse { 29 + // Validate that nsid is provided 30 + let nsid = match params.nsid { 31 + Some(n) => n, 32 + None => { 33 + metrics 34 + .incr_with_tags( 35 + "xrpc.com.atproto.lexicon.resolveLexicon.invalid_nsid", 36 + &[("reason", "missing")], 37 + ) 38 + .await; 39 + return ( 40 + StatusCode::BAD_REQUEST, 41 + Json(ErrorResponse { 42 + error: "InvalidRequest".to_string(), 43 + message: "Error: Params must have the property \"nsid\"".to_string(), 44 + }), 45 + ) 46 + .into_response(); 47 + } 48 + }; 49 + 50 + tracing::debug!(nsid, "Resolving lexicon"); 51 + 52 + // Perform the lexicon resolution 53 + match lexicon_resolver.resolve(&nsid).await { 54 + Ok(resolved) => { 55 + tracing::debug!(nsid, "Successfully resolved lexicon"); 56 + 57 + metrics 58 + .incr_with_tags("lexicon.resolution.request", &[("success", "1")]) 59 + .await; 60 + 61 + let mut headers = HeaderMap::new(); 62 + add_cors_headers(&mut headers); 63 + 64 + // The resolved value is already a serde_json::Value, so just return it as JSON 65 + (StatusCode::OK, headers, Json(resolved)).into_response() 66 + } 67 + Err(err) => { 68 + tracing::debug!(error = ?err, nsid, "Error resolving lexicon"); 69 + 70 + metrics 71 + .incr_with_tags("lexicon.resolution.request", &[("success", "0")]) 72 + .await; 73 + 74 + let mut headers = HeaderMap::new(); 75 + add_cors_headers(&mut headers); 76 + 77 + ( 78 + StatusCode::BAD_REQUEST, 79 + headers, 80 + Json(ErrorResponse { 81 + error: "LexiconNotFound".to_string(), 82 + message: "No lexicon was resolved for the NSID".to_string(), 83 + }), 84 + ) 85 + .into_response() 86 + } 87 + } 88 + } 89 + 90 + pub(super) async fn handle_xrpc_resolve_lexicon_options() -> impl IntoResponse { 91 + let mut headers = HeaderMap::new(); 92 + add_cors_headers(&mut headers); 93 + (StatusCode::NO_CONTENT, headers) 94 + } 95 + 96 + fn add_cors_headers(headers: &mut HeaderMap) { 97 + headers.insert("Allow", HeaderValue::from_static("GET, HEAD, OPTIONS")); 98 + headers.insert( 99 + header::ACCESS_CONTROL_ALLOW_HEADERS, 100 + HeaderValue::from_static("*"), 101 + ); 102 + headers.insert( 103 + header::ACCESS_CONTROL_ALLOW_METHODS, 104 + HeaderValue::from_static("GET, HEAD, OPTIONS"), 105 + ); 106 + headers.insert( 107 + header::ACCESS_CONTROL_ALLOW_ORIGIN, 108 + HeaderValue::from_static("*"), 109 + ); 110 + headers.insert( 111 + header::ACCESS_CONTROL_EXPOSE_HEADERS, 112 + HeaderValue::from_static("*"), 113 + ); 114 + headers.insert( 115 + header::ACCESS_CONTROL_MAX_AGE, 116 + HeaderValue::from_static("86400"), 117 + ); 118 + headers.insert( 119 + "Access-Control-Request-Headers", 120 + HeaderValue::from_static("*"), 121 + ); 122 + headers.insert( 123 + "Access-Control-Request-Method", 124 + HeaderValue::from_static("GET"), 125 + ); 126 + }
+1
src/http/mod.rs
··· 1 1 mod handle_xrpc_resolve_handle; // Internal handler 2 + mod handle_xrpc_resolve_lexicon; // Internal handler 2 3 mod server; // Internal server module 3 4 4 5 // Re-export only what the binary needs
+74 -49
src/http/server.rs
··· 1 1 use crate::handle_resolver::HandleResolver; 2 + use crate::metrics::SharedMetricsPublisher; 2 3 use crate::queue::{HandleResolutionWork, QueueAdapter}; 4 + use atproto_lexicon::resolve::LexiconResolver; 3 5 use axum::{ 4 6 Router, 5 - extract::State, 6 - http::StatusCode, 7 - response::{Html, IntoResponse, Json, Response}, 7 + extract::{MatchedPath, State}, 8 + http::Request, 9 + middleware::{self, Next}, 10 + response::{Json, Response}, 8 11 routing::get, 9 12 }; 10 13 use serde_json::json; 11 14 use std::sync::Arc; 15 + use std::time::Instant; 16 + use tower_http::services::ServeDir; 12 17 13 18 pub(crate) struct InnerAppContext { 14 - pub(crate) service_document: serde_json::Value, 15 - pub(crate) service_did: String, 16 19 pub(crate) handle_resolver: Arc<dyn HandleResolver>, 17 20 pub(crate) handle_queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 21 + pub(crate) lexicon_resolver: Arc<dyn LexiconResolver>, 22 + pub(crate) metrics: SharedMetricsPublisher, 18 23 pub(crate) etag_seed: String, 19 24 pub(crate) cache_control_header: Option<String>, 25 + pub(crate) static_files_dir: String, 20 26 } 21 27 22 28 #[derive(Clone)] ··· 25 31 impl AppContext { 26 32 /// Create a new AppContext with the provided configuration. 27 33 pub fn new( 28 - service_document: serde_json::Value, 29 - service_did: String, 30 34 handle_resolver: Arc<dyn HandleResolver>, 31 35 handle_queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 36 + lexicon_resolver: Arc<dyn LexiconResolver>, 37 + metrics: SharedMetricsPublisher, 32 38 etag_seed: String, 33 39 cache_control_header: Option<String>, 40 + static_files_dir: String, 34 41 ) -> Self { 35 42 Self(Arc::new(InnerAppContext { 36 - service_document, 37 - service_did, 38 43 handle_resolver, 39 44 handle_queue, 45 + lexicon_resolver, 46 + metrics, 40 47 etag_seed, 41 48 cache_control_header, 49 + static_files_dir, 42 50 })) 43 51 } 44 52 45 53 // Internal accessor methods for handlers 46 - pub(super) fn service_document(&self) -> &serde_json::Value { 47 - &self.0.service_document 48 - } 49 - 50 - pub(super) fn service_did(&self) -> &str { 51 - &self.0.service_did 52 - } 53 - 54 54 pub(super) fn etag_seed(&self) -> &str { 55 55 &self.0.etag_seed 56 56 } 57 57 58 58 pub(super) fn cache_control_header(&self) -> Option<&str> { 59 59 self.0.cache_control_header.as_deref() 60 + } 61 + 62 + pub(super) fn static_files_dir(&self) -> &str { 63 + &self.0.static_files_dir 60 64 } 61 65 } 62 66 ··· 78 82 handle_queue, 79 83 Arc<dyn QueueAdapter<HandleResolutionWork>> 80 84 ); 85 + impl_from_ref!(AppContext, lexicon_resolver, Arc<dyn LexiconResolver>); 86 + impl_from_ref!(AppContext, metrics, SharedMetricsPublisher); 87 + 88 + /// Middleware to track HTTP request metrics 89 + async fn metrics_middleware( 90 + State(metrics): State<SharedMetricsPublisher>, 91 + matched_path: Option<MatchedPath>, 92 + request: Request<axum::body::Body>, 93 + next: Next, 94 + ) -> Response { 95 + let start = Instant::now(); 96 + let method = request.method().to_string(); 97 + let path = matched_path 98 + .as_ref() 99 + .map(|p| p.as_str().to_string()) 100 + .unwrap_or_else(|| "unknown".to_string()); 101 + 102 + // Process the request 103 + let response = next.run(request).await; 104 + 105 + // Calculate duration 106 + let duration_ms = start.elapsed().as_millis() as u64; 107 + let status_code = response.status().as_u16().to_string(); 108 + 109 + // Publish metrics with tags 110 + metrics 111 + .time_with_tags( 112 + "http.request.duration_ms", 113 + duration_ms, 114 + &[ 115 + ("method", &method), 116 + ("path", &path), 117 + ("status", &status_code), 118 + ], 119 + ) 120 + .await; 121 + 122 + response 123 + } 81 124 82 125 pub fn create_router(app_context: AppContext) -> Router { 126 + let static_dir = app_context.static_files_dir().to_string(); 127 + 83 128 Router::new() 84 - .route("/", get(handle_index)) 85 - .route("/.well-known/did.json", get(handle_wellknown_did_json)) 129 + .route("/xrpc/_health", get(handle_xrpc_health)) 86 130 .route( 87 - "/.well-known/atproto-did", 88 - get(handle_wellknown_atproto_did), 131 + "/xrpc/com.atproto.identity.resolveHandle", 132 + get(super::handle_xrpc_resolve_handle::handle_xrpc_resolve_handle) 133 + .options(super::handle_xrpc_resolve_handle::handle_xrpc_resolve_handle_options), 89 134 ) 90 - .route("/xrpc/_health", get(handle_xrpc_health)) 91 135 .route( 92 - "/xrpc/com.atproto.identity.resolveHandle", 93 - get(super::handle_xrpc_resolve_handle::handle_xrpc_resolve_handle), 136 + "/xrpc/com.atproto.lexicon.resolveLexicon", 137 + get(super::handle_xrpc_resolve_lexicon::handle_xrpc_resolve_lexicon) 138 + .options(super::handle_xrpc_resolve_lexicon::handle_xrpc_resolve_lexicon_options), 94 139 ) 140 + .fallback_service(ServeDir::new(static_dir)) 141 + .layer(middleware::from_fn_with_state( 142 + app_context.0.metrics.clone(), 143 + metrics_middleware, 144 + )) 95 145 .with_state(app_context) 96 - } 97 - 98 - pub(super) async fn handle_index() -> Html<&'static str> { 99 - Html( 100 - r#"<!DOCTYPE html> 101 - <html> 102 - <head> 103 - <title>QuickDID</title> 104 - </head> 105 - <body> 106 - <h1>QuickDID</h1> 107 - <p>AT Protocol Identity Resolution Service</p> 108 - </body> 109 - </html>"#, 110 - ) 111 - } 112 - 113 - pub(super) async fn handle_wellknown_did_json( 114 - State(context): State<AppContext>, 115 - ) -> Json<serde_json::Value> { 116 - Json(context.service_document().clone()) 117 - } 118 - 119 - pub(super) async fn handle_wellknown_atproto_did(State(context): State<AppContext>) -> Response { 120 - (StatusCode::OK, context.service_did().to_string()).into_response() 121 146 } 122 147 123 148 pub(super) async fn handle_xrpc_health() -> Json<serde_json::Value> {
+360
src/jetstream_handler.rs
··· 1 + //! Jetstream event handler for QuickDID 2 + //! 3 + //! This module provides the event handler for processing AT Protocol Jetstream events, 4 + //! specifically handling Account and Identity events to maintain cache consistency. 5 + 6 + use crate::handle_resolver::HandleResolver; 7 + use crate::metrics::MetricsPublisher; 8 + use anyhow::Result; 9 + use atproto_jetstream::{EventHandler, JetstreamEvent}; 10 + use std::sync::Arc; 11 + use tracing::{debug, info, warn}; 12 + 13 + /// Jetstream event handler for QuickDID 14 + /// 15 + /// This handler processes AT Protocol events from the Jetstream firehose to keep 16 + /// the handle resolver cache in sync with the network state. 17 + /// 18 + /// # Event Processing 19 + /// 20 + /// ## Account Events 21 + /// - When an account is marked as "deleted" or "deactivated", the DID is purged from the cache 22 + /// - Metrics are tracked for successful and failed purge operations 23 + /// 24 + /// ## Identity Events 25 + /// - When an identity event contains a handle, the handle-to-DID mapping is updated 26 + /// - When an identity event lacks a handle (indicating removal), the DID is purged 27 + /// - Metrics are tracked for successful and failed update/purge operations 28 + /// 29 + /// # Example 30 + /// 31 + /// ```no_run 32 + /// use quickdid::jetstream_handler::QuickDidEventHandler; 33 + /// use quickdid::handle_resolver::HandleResolver; 34 + /// use quickdid::metrics::MetricsPublisher; 35 + /// use std::sync::Arc; 36 + /// 37 + /// # async fn example(resolver: Arc<dyn HandleResolver>, metrics: Arc<dyn MetricsPublisher>) { 38 + /// let handler = QuickDidEventHandler::new(resolver, metrics); 39 + /// // Register with a JetstreamConsumer 40 + /// # } 41 + /// ``` 42 + pub struct QuickDidEventHandler { 43 + resolver: Arc<dyn HandleResolver>, 44 + metrics: Arc<dyn MetricsPublisher>, 45 + } 46 + 47 + impl QuickDidEventHandler { 48 + /// Create a new Jetstream event handler 49 + /// 50 + /// # Arguments 51 + /// 52 + /// * `resolver` - The handle resolver to use for cache operations 53 + /// * `metrics` - The metrics publisher for tracking event processing 54 + pub fn new(resolver: Arc<dyn HandleResolver>, metrics: Arc<dyn MetricsPublisher>) -> Self { 55 + Self { resolver, metrics } 56 + } 57 + } 58 + 59 + #[async_trait::async_trait] 60 + impl EventHandler for QuickDidEventHandler { 61 + fn handler_id(&self) -> String { 62 + "quickdid_handler".to_string() 63 + } 64 + 65 + async fn handle_event(&self, event: JetstreamEvent) -> Result<()> { 66 + match event { 67 + JetstreamEvent::Account { did, kind, .. } => { 68 + // If account kind is "deleted" or "deactivated", purge the DID 69 + if kind == "deleted" || kind == "deactivated" { 70 + info!(did = %did, kind = %kind, "Purging account"); 71 + match self.resolver.purge(&did).await { 72 + Ok(()) => { 73 + self.metrics.incr("jetstream.account.purged").await; 74 + } 75 + Err(e) => { 76 + warn!(did = %did, error = ?e, "Failed to purge DID"); 77 + self.metrics.incr("jetstream.account.purge_error").await; 78 + } 79 + } 80 + } 81 + self.metrics.incr("jetstream.account.processed").await; 82 + } 83 + JetstreamEvent::Identity { did, identity, .. } => { 84 + // Extract handle from identity JSON if available 85 + if !identity.is_null() { 86 + if let Some(handle_value) = identity.get("handle") { 87 + if let Some(handle) = handle_value.as_str() { 88 + info!(handle = %handle, did = %did, "Updating identity mapping"); 89 + match self.resolver.set(handle, &did).await { 90 + Ok(()) => { 91 + self.metrics.incr("jetstream.identity.updated").await; 92 + } 93 + Err(e) => { 94 + warn!(handle = %handle, did = %did, error = ?e, "Failed to update mapping"); 95 + self.metrics.incr("jetstream.identity.update_error").await; 96 + } 97 + } 98 + } else { 99 + // No handle or invalid handle, purge the DID 100 + info!(did = %did, "Purging identity without valid handle"); 101 + match self.resolver.purge(&did).await { 102 + Ok(()) => { 103 + self.metrics.incr("jetstream.identity.purged").await; 104 + } 105 + Err(e) => { 106 + warn!(did = %did, error = ?e, "Failed to purge DID"); 107 + self.metrics.incr("jetstream.identity.purge_error").await; 108 + } 109 + } 110 + } 111 + } else { 112 + // No handle field, purge the DID 113 + info!(did = %did, "Purging identity without handle field"); 114 + match self.resolver.purge(&did).await { 115 + Ok(()) => { 116 + self.metrics.incr("jetstream.identity.purged").await; 117 + } 118 + Err(e) => { 119 + warn!(did = %did, error = ?e, "Failed to purge DID"); 120 + self.metrics.incr("jetstream.identity.purge_error").await; 121 + } 122 + } 123 + } 124 + } else { 125 + // Null identity means removed, purge the DID 126 + info!(did = %did, "Purging identity with null info"); 127 + match self.resolver.purge(&did).await { 128 + Ok(()) => { 129 + self.metrics.incr("jetstream.identity.purged").await; 130 + } 131 + Err(e) => { 132 + warn!(did = %did, error = ?e, "Failed to purge DID"); 133 + self.metrics.incr("jetstream.identity.purge_error").await; 134 + } 135 + } 136 + } 137 + self.metrics.incr("jetstream.identity.processed").await; 138 + } 139 + _ => { 140 + // Other event types we don't care about 141 + debug!("Ignoring unhandled Jetstream event type"); 142 + } 143 + } 144 + Ok(()) 145 + } 146 + } 147 + 148 + #[cfg(test)] 149 + mod tests { 150 + use super::*; 151 + use crate::handle_resolver::HandleResolverError; 152 + use crate::metrics::NoOpMetricsPublisher; 153 + use async_trait::async_trait; 154 + use serde_json::json; 155 + 156 + /// Mock resolver for testing 157 + struct MockResolver { 158 + purge_called: std::sync::Arc<std::sync::Mutex<Vec<String>>>, 159 + set_called: std::sync::Arc<std::sync::Mutex<Vec<(String, String)>>>, 160 + } 161 + 162 + impl MockResolver { 163 + fn new() -> Self { 164 + Self { 165 + purge_called: std::sync::Arc::new(std::sync::Mutex::new(Vec::new())), 166 + set_called: std::sync::Arc::new(std::sync::Mutex::new(Vec::new())), 167 + } 168 + } 169 + 170 + fn get_purge_calls(&self) -> Vec<String> { 171 + self.purge_called.lock().unwrap().clone() 172 + } 173 + 174 + fn get_set_calls(&self) -> Vec<(String, String)> { 175 + self.set_called.lock().unwrap().clone() 176 + } 177 + } 178 + 179 + #[async_trait] 180 + impl HandleResolver for MockResolver { 181 + async fn resolve(&self, _handle: &str) -> Result<(String, u64), HandleResolverError> { 182 + unimplemented!("Not needed for tests") 183 + } 184 + 185 + async fn purge(&self, subject: &str) -> Result<(), HandleResolverError> { 186 + self.purge_called.lock().unwrap().push(subject.to_string()); 187 + Ok(()) 188 + } 189 + 190 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 191 + self.set_called 192 + .lock() 193 + .unwrap() 194 + .push((handle.to_string(), did.to_string())); 195 + Ok(()) 196 + } 197 + } 198 + 199 + #[tokio::test] 200 + async fn test_account_deleted_event() { 201 + let resolver = Arc::new(MockResolver::new()); 202 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 203 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 204 + 205 + // Create a deleted account event 206 + let event = JetstreamEvent::Account { 207 + did: "did:plc:test123".to_string(), 208 + kind: "deleted".to_string(), 209 + time_us: 0, 210 + account: json!(null), 211 + }; 212 + 213 + handler.handle_event(event).await.unwrap(); 214 + 215 + // Verify the DID was purged 216 + let purge_calls = resolver.get_purge_calls(); 217 + assert_eq!(purge_calls.len(), 1); 218 + assert_eq!(purge_calls[0], "did:plc:test123"); 219 + } 220 + 221 + #[tokio::test] 222 + async fn test_account_deactivated_event() { 223 + let resolver = Arc::new(MockResolver::new()); 224 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 225 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 226 + 227 + // Create a deactivated account event 228 + let event = JetstreamEvent::Account { 229 + did: "did:plc:test456".to_string(), 230 + kind: "deactivated".to_string(), 231 + time_us: 0, 232 + account: json!(null), 233 + }; 234 + 235 + handler.handle_event(event).await.unwrap(); 236 + 237 + // Verify the DID was purged 238 + let purge_calls = resolver.get_purge_calls(); 239 + assert_eq!(purge_calls.len(), 1); 240 + assert_eq!(purge_calls[0], "did:plc:test456"); 241 + } 242 + 243 + #[tokio::test] 244 + async fn test_account_active_event() { 245 + let resolver = Arc::new(MockResolver::new()); 246 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 247 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 248 + 249 + // Create an active account event (should not purge) 250 + let event = JetstreamEvent::Account { 251 + did: "did:plc:test789".to_string(), 252 + kind: "active".to_string(), 253 + time_us: 0, 254 + account: json!(null), 255 + }; 256 + 257 + handler.handle_event(event).await.unwrap(); 258 + 259 + // Verify the DID was NOT purged 260 + let purge_calls = resolver.get_purge_calls(); 261 + assert_eq!(purge_calls.len(), 0); 262 + } 263 + 264 + #[tokio::test] 265 + async fn test_identity_with_handle_event() { 266 + let resolver = Arc::new(MockResolver::new()); 267 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 268 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 269 + 270 + // Create an identity event with a handle 271 + let event = JetstreamEvent::Identity { 272 + did: "did:plc:testuser".to_string(), 273 + kind: "update".to_string(), 274 + time_us: 0, 275 + identity: json!({ 276 + "handle": "alice.bsky.social" 277 + }), 278 + }; 279 + 280 + handler.handle_event(event).await.unwrap(); 281 + 282 + // Verify the set method was called 283 + let set_calls = resolver.get_set_calls(); 284 + assert_eq!(set_calls.len(), 1); 285 + assert_eq!( 286 + set_calls[0], 287 + ( 288 + "alice.bsky.social".to_string(), 289 + "did:plc:testuser".to_string() 290 + ) 291 + ); 292 + 293 + // Verify no purge was called 294 + let purge_calls = resolver.get_purge_calls(); 295 + assert_eq!(purge_calls.len(), 0); 296 + } 297 + 298 + #[tokio::test] 299 + async fn test_identity_without_handle_event() { 300 + let resolver = Arc::new(MockResolver::new()); 301 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 302 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 303 + 304 + // Create an identity event without a handle field 305 + let event = JetstreamEvent::Identity { 306 + did: "did:plc:nohandle".to_string(), 307 + kind: "update".to_string(), 308 + time_us: 0, 309 + identity: json!({ 310 + "other_field": "value" 311 + }), 312 + }; 313 + 314 + handler.handle_event(event).await.unwrap(); 315 + 316 + // Verify the DID was purged 317 + let purge_calls = resolver.get_purge_calls(); 318 + assert_eq!(purge_calls.len(), 1); 319 + assert_eq!(purge_calls[0], "did:plc:nohandle"); 320 + 321 + // Verify set was not called 322 + let set_calls = resolver.get_set_calls(); 323 + assert_eq!(set_calls.len(), 0); 324 + } 325 + 326 + #[tokio::test] 327 + async fn test_identity_with_null_identity() { 328 + let resolver = Arc::new(MockResolver::new()); 329 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 330 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 331 + 332 + // Create an identity event with null identity 333 + let event = JetstreamEvent::Identity { 334 + did: "did:plc:nullidentity".to_string(), 335 + kind: "delete".to_string(), 336 + time_us: 0, 337 + identity: json!(null), 338 + }; 339 + 340 + handler.handle_event(event).await.unwrap(); 341 + 342 + // Verify the DID was purged 343 + let purge_calls = resolver.get_purge_calls(); 344 + assert_eq!(purge_calls.len(), 1); 345 + assert_eq!(purge_calls[0], "did:plc:nullidentity"); 346 + 347 + // Verify set was not called 348 + let set_calls = resolver.get_set_calls(); 349 + assert_eq!(set_calls.len(), 0); 350 + } 351 + 352 + #[tokio::test] 353 + async fn test_handler_id() { 354 + let resolver = Arc::new(MockResolver::new()); 355 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 356 + let handler = QuickDidEventHandler::new(resolver, metrics); 357 + 358 + assert_eq!(handler.handler_id(), "quickdid_handler"); 359 + } 360 + }
+8
src/lexicon_resolver/mod.rs
··· 1 + //! Lexicon resolution with caching support. 2 + //! 3 + //! This module provides implementations for resolving AT Protocol lexicons (NSIDs) 4 + //! to their schemas with various caching strategies. 5 + 6 + mod redis; 7 + 8 + pub use redis::{create_redis_lexicon_resolver, create_redis_lexicon_resolver_with_ttl};
+458
src/lexicon_resolver/redis.rs
··· 1 + //! Redis-backed caching lexicon resolver. 2 + //! 3 + //! This module provides a lexicon resolver that caches resolution results in Redis 4 + //! with configurable expiration times. Redis caching provides persistence across 5 + //! service restarts and allows sharing of cached results across multiple instances. 6 + 7 + use crate::metrics::SharedMetricsPublisher; 8 + use async_trait::async_trait; 9 + use atproto_lexicon::resolve::LexiconResolver; 10 + use deadpool_redis::{Pool as RedisPool, redis::AsyncCommands}; 11 + use metrohash::MetroHash64; 12 + use std::hash::Hasher as _; 13 + use std::sync::Arc; 14 + 15 + /// Redis-backed caching lexicon resolver. 16 + /// 17 + /// This resolver caches lexicon resolution results in Redis with a configurable TTL. 18 + /// Results are stored as JSON bytes to minimize storage overhead while maintaining 19 + /// the schema structure. 20 + /// 21 + /// # Features 22 + /// 23 + /// - Persistent caching across service restarts 24 + /// - Shared cache across multiple service instances 25 + /// - Configurable TTL (default: 90 days) 26 + /// - JSON storage format for lexicon schemas 27 + /// - Graceful fallback if Redis is unavailable 28 + /// 29 + /// # Example 30 + /// 31 + /// ```no_run 32 + /// use std::sync::Arc; 33 + /// use deadpool_redis::Pool; 34 + /// use atproto_lexicon::resolve::LexiconResolver; 35 + /// use quickdid::lexicon_resolver::create_redis_lexicon_resolver; 36 + /// use quickdid::metrics::NoOpMetricsPublisher; 37 + /// 38 + /// # async fn example() { 39 + /// # let inner_resolver: Arc<dyn LexiconResolver> = todo!(); 40 + /// # let redis_pool: Pool = todo!(); 41 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 42 + /// // Create with default 90-day TTL 43 + /// let resolver = create_redis_lexicon_resolver( 44 + /// inner_resolver, 45 + /// redis_pool, 46 + /// metrics 47 + /// ); 48 + /// # } 49 + /// ``` 50 + pub(super) struct RedisLexiconResolver { 51 + /// Base lexicon resolver to perform actual resolution 52 + inner: Arc<dyn LexiconResolver>, 53 + /// Redis connection pool 54 + pool: RedisPool, 55 + /// Redis key prefix for lexicon resolution cache 56 + key_prefix: String, 57 + /// TTL for cache entries in seconds 58 + ttl_seconds: u64, 59 + /// Metrics publisher for telemetry 60 + metrics: SharedMetricsPublisher, 61 + } 62 + 63 + impl RedisLexiconResolver { 64 + /// Create a new Redis-backed lexicon resolver with default 90-day TTL. 65 + fn new( 66 + inner: Arc<dyn LexiconResolver>, 67 + pool: RedisPool, 68 + metrics: SharedMetricsPublisher, 69 + ) -> Self { 70 + Self::with_ttl(inner, pool, 90 * 24 * 60 * 60, metrics) // 90 days default 71 + } 72 + 73 + /// Create a new Redis-backed lexicon resolver with custom TTL. 74 + fn with_ttl( 75 + inner: Arc<dyn LexiconResolver>, 76 + pool: RedisPool, 77 + ttl_seconds: u64, 78 + metrics: SharedMetricsPublisher, 79 + ) -> Self { 80 + Self::with_full_config(inner, pool, "lexicon:".to_string(), ttl_seconds, metrics) 81 + } 82 + 83 + /// Create a new Redis-backed lexicon resolver with full configuration. 84 + fn with_full_config( 85 + inner: Arc<dyn LexiconResolver>, 86 + pool: RedisPool, 87 + key_prefix: String, 88 + ttl_seconds: u64, 89 + metrics: SharedMetricsPublisher, 90 + ) -> Self { 91 + Self { 92 + inner, 93 + pool, 94 + key_prefix, 95 + ttl_seconds, 96 + metrics, 97 + } 98 + } 99 + 100 + /// Generate the Redis key for an NSID. 101 + /// 102 + /// Uses MetroHash64 to generate a consistent hash of the NSID 103 + /// for use as the Redis key. This provides better key distribution 104 + /// and avoids issues with special characters in NSIDs. 105 + fn make_key(&self, nsid: &str) -> String { 106 + let mut h = MetroHash64::default(); 107 + h.write(nsid.as_bytes()); 108 + format!("{}{}", self.key_prefix, h.finish()) 109 + } 110 + 111 + /// Get the TTL in seconds. 112 + fn ttl_seconds(&self) -> u64 { 113 + self.ttl_seconds 114 + } 115 + } 116 + 117 + #[async_trait] 118 + impl LexiconResolver for RedisLexiconResolver { 119 + async fn resolve(&self, nsid: &str) -> Result<serde_json::Value, anyhow::Error> { 120 + let key = self.make_key(nsid); 121 + 122 + // Try to get from Redis cache first 123 + match self.pool.get().await { 124 + Ok(mut conn) => { 125 + // Check if the key exists in Redis (stored as JSON bytes) 126 + let cached: Option<Vec<u8>> = match conn.get(&key).await { 127 + Ok(value) => value, 128 + Err(e) => { 129 + self.metrics.incr("lexicon_resolver.redis.get_error").await; 130 + tracing::warn!("Failed to get NSID from Redis cache: {}", e); 131 + None 132 + } 133 + }; 134 + 135 + if let Some(cached_bytes) = cached { 136 + // Deserialize the cached JSON 137 + match serde_json::from_slice::<serde_json::Value>(&cached_bytes) { 138 + Ok(cached_value) => { 139 + tracing::debug!("Cache hit for NSID {}", nsid); 140 + self.metrics.incr("lexicon_resolver.redis.cache_hit").await; 141 + return Ok(cached_value); 142 + } 143 + Err(e) => { 144 + tracing::warn!( 145 + "Failed to deserialize cached lexicon for NSID {}: {}", 146 + nsid, 147 + e 148 + ); 149 + self.metrics 150 + .incr("lexicon_resolver.redis.deserialize_error") 151 + .await; 152 + // Fall through to re-resolve if deserialization fails 153 + } 154 + } 155 + } 156 + 157 + // Not in cache, resolve through inner resolver 158 + tracing::debug!("Cache miss for NSID {}, resolving...", nsid); 159 + self.metrics.incr("lexicon_resolver.redis.cache_miss").await; 160 + let result = self.inner.resolve(nsid).await; 161 + 162 + // Cache successful result 163 + if let Ok(ref schema) = result { 164 + // Serialize to JSON bytes 165 + match serde_json::to_vec(schema) { 166 + Ok(bytes) => { 167 + // Set with expiration (ignore errors to not fail the resolution) 168 + if let Err(e) = conn 169 + .set_ex::<_, _, ()>(&key, bytes, self.ttl_seconds()) 170 + .await 171 + { 172 + tracing::warn!( 173 + "Failed to cache lexicon resolution in Redis: {}", 174 + e 175 + ); 176 + self.metrics 177 + .incr("lexicon_resolver.redis.cache_set_error") 178 + .await; 179 + } else { 180 + tracing::debug!("Cached lexicon for NSID {}", nsid); 181 + self.metrics.incr("lexicon_resolver.redis.cache_set").await; 182 + } 183 + } 184 + Err(e) => { 185 + tracing::warn!( 186 + "Failed to serialize lexicon result for NSID {}: {}", 187 + nsid, 188 + e 189 + ); 190 + self.metrics 191 + .incr("lexicon_resolver.redis.serialize_error") 192 + .await; 193 + } 194 + } 195 + } 196 + 197 + result 198 + } 199 + Err(e) => { 200 + // Redis connection failed, fall back to inner resolver 201 + tracing::warn!( 202 + "Failed to get Redis connection, falling back to uncached resolution: {}", 203 + e 204 + ); 205 + self.metrics 206 + .incr("lexicon_resolver.redis.connection_error") 207 + .await; 208 + self.inner.resolve(nsid).await 209 + } 210 + } 211 + } 212 + } 213 + 214 + /// Create a new Redis-backed lexicon resolver with default 90-day TTL. 215 + /// 216 + /// # Arguments 217 + /// 218 + /// * `inner` - The underlying resolver to use for actual resolution 219 + /// * `pool` - Redis connection pool 220 + /// * `metrics` - Metrics publisher for telemetry 221 + /// 222 + /// # Example 223 + /// 224 + /// ```no_run 225 + /// use std::sync::Arc; 226 + /// use atproto_lexicon::resolve::{DefaultLexiconResolver, LexiconResolver}; 227 + /// use quickdid::lexicon_resolver::create_redis_lexicon_resolver; 228 + /// use quickdid::cache::create_redis_pool; 229 + /// use quickdid::metrics::NoOpMetricsPublisher; 230 + /// 231 + /// # async fn example() -> anyhow::Result<()> { 232 + /// # use atproto_identity::resolve::HickoryDnsResolver; 233 + /// # use reqwest::Client; 234 + /// # let dns_resolver = HickoryDnsResolver::create_resolver(&[]); 235 + /// # let http_client = Client::new(); 236 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 237 + /// let base: Arc<dyn LexiconResolver> = Arc::new( 238 + /// DefaultLexiconResolver::new(http_client, dns_resolver) 239 + /// ); 240 + /// 241 + /// let pool = create_redis_pool("redis://localhost:6379")?; 242 + /// let resolver = create_redis_lexicon_resolver(base, pool, metrics); 243 + /// let schema = resolver.resolve("app.bsky.feed.post").await.unwrap(); 244 + /// # Ok(()) 245 + /// # } 246 + /// ``` 247 + pub fn create_redis_lexicon_resolver( 248 + inner: Arc<dyn LexiconResolver>, 249 + pool: RedisPool, 250 + metrics: SharedMetricsPublisher, 251 + ) -> Arc<dyn LexiconResolver> { 252 + Arc::new(RedisLexiconResolver::new(inner, pool, metrics)) 253 + } 254 + 255 + /// Create a new Redis-backed lexicon resolver with custom TTL. 256 + /// 257 + /// # Arguments 258 + /// 259 + /// * `inner` - The underlying resolver to use for actual resolution 260 + /// * `pool` - Redis connection pool 261 + /// * `ttl_seconds` - TTL for cache entries in seconds 262 + /// * `metrics` - Metrics publisher for telemetry 263 + pub fn create_redis_lexicon_resolver_with_ttl( 264 + inner: Arc<dyn LexiconResolver>, 265 + pool: RedisPool, 266 + ttl_seconds: u64, 267 + metrics: SharedMetricsPublisher, 268 + ) -> Arc<dyn LexiconResolver> { 269 + Arc::new(RedisLexiconResolver::with_ttl( 270 + inner, 271 + pool, 272 + ttl_seconds, 273 + metrics, 274 + )) 275 + } 276 + 277 + #[cfg(test)] 278 + mod tests { 279 + use super::*; 280 + 281 + // Mock lexicon resolver for testing 282 + #[derive(Clone)] 283 + struct MockLexiconResolver { 284 + should_fail: bool, 285 + expected_schema: serde_json::Value, 286 + } 287 + 288 + #[async_trait] 289 + impl LexiconResolver for MockLexiconResolver { 290 + async fn resolve(&self, _nsid: &str) -> Result<serde_json::Value, anyhow::Error> { 291 + if self.should_fail { 292 + Err(anyhow::anyhow!("Mock resolution failure")) 293 + } else { 294 + Ok(self.expected_schema.clone()) 295 + } 296 + } 297 + } 298 + 299 + #[tokio::test] 300 + async fn test_redis_lexicon_resolver_cache_hit() { 301 + let pool = match crate::test_helpers::get_test_redis_pool() { 302 + Some(p) => p, 303 + None => return, 304 + }; 305 + 306 + // Create mock resolver with sample schema 307 + let schema = serde_json::json!({ 308 + "lexicon": 1, 309 + "id": "app.bsky.feed.post", 310 + "defs": { 311 + "main": { 312 + "type": "record", 313 + "description": "A post record" 314 + } 315 + } 316 + }); 317 + 318 + let mock_resolver = Arc::new(MockLexiconResolver { 319 + should_fail: false, 320 + expected_schema: schema.clone(), 321 + }); 322 + 323 + // Create metrics publisher 324 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 325 + 326 + // Create Redis-backed resolver with a unique key prefix for testing 327 + let test_prefix = format!( 328 + "test:lexicon:{}:", 329 + std::time::SystemTime::now() 330 + .duration_since(std::time::UNIX_EPOCH) 331 + .unwrap() 332 + .as_nanos() 333 + ); 334 + let redis_resolver = RedisLexiconResolver::with_full_config( 335 + mock_resolver, 336 + pool.clone(), 337 + test_prefix.clone(), 338 + 3600, 339 + metrics, 340 + ); 341 + 342 + let test_nsid = "app.bsky.feed.post"; 343 + 344 + // First resolution - should call inner resolver 345 + let result1 = redis_resolver.resolve(test_nsid).await.unwrap(); 346 + assert_eq!(result1, schema); 347 + 348 + // Second resolution - should hit cache 349 + let result2 = redis_resolver.resolve(test_nsid).await.unwrap(); 350 + assert_eq!(result2, schema); 351 + 352 + // Clean up test data 353 + if let Ok(mut conn) = pool.get().await { 354 + let mut h = MetroHash64::default(); 355 + h.write(test_nsid.as_bytes()); 356 + let key = format!("{}{}", test_prefix, h.finish()); 357 + let _: Result<(), _> = conn.del(key).await; 358 + } 359 + } 360 + 361 + #[tokio::test] 362 + async fn test_redis_lexicon_resolver_cache_miss() { 363 + let pool = match crate::test_helpers::get_test_redis_pool() { 364 + Some(p) => p, 365 + None => return, 366 + }; 367 + 368 + let schema = serde_json::json!({ 369 + "lexicon": 1, 370 + "id": "com.example.test", 371 + }); 372 + 373 + let mock_resolver = Arc::new(MockLexiconResolver { 374 + should_fail: false, 375 + expected_schema: schema.clone(), 376 + }); 377 + 378 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 379 + 380 + let test_prefix = format!( 381 + "test:lexicon:{}:", 382 + std::time::SystemTime::now() 383 + .duration_since(std::time::UNIX_EPOCH) 384 + .unwrap() 385 + .as_nanos() 386 + ); 387 + let redis_resolver = RedisLexiconResolver::with_full_config( 388 + mock_resolver, 389 + pool.clone(), 390 + test_prefix.clone(), 391 + 3600, 392 + metrics, 393 + ); 394 + 395 + let test_nsid = "com.example.test"; 396 + 397 + // Ensure key doesn't exist 398 + if let Ok(mut conn) = pool.get().await { 399 + let mut h = MetroHash64::default(); 400 + h.write(test_nsid.as_bytes()); 401 + let key = format!("{}{}", test_prefix, h.finish()); 402 + let _: Result<(), _> = conn.del(&key).await; 403 + } 404 + 405 + // Resolution should succeed and cache the result 406 + let result = redis_resolver.resolve(test_nsid).await.unwrap(); 407 + assert_eq!(result, schema); 408 + 409 + // Verify the result was cached 410 + if let Ok(mut conn) = pool.get().await { 411 + let mut h = MetroHash64::default(); 412 + h.write(test_nsid.as_bytes()); 413 + let key = format!("{}{}", test_prefix, h.finish()); 414 + let exists: bool = conn.exists(&key).await.unwrap(); 415 + assert!(exists, "Result should be cached"); 416 + 417 + // Clean up 418 + let _: Result<(), _> = conn.del(key).await; 419 + } 420 + } 421 + 422 + #[tokio::test] 423 + async fn test_redis_lexicon_resolver_error_handling() { 424 + let pool = match crate::test_helpers::get_test_redis_pool() { 425 + Some(p) => p, 426 + None => return, 427 + }; 428 + 429 + // Create mock resolver that fails 430 + let mock_resolver = Arc::new(MockLexiconResolver { 431 + should_fail: true, 432 + expected_schema: serde_json::Value::Null, 433 + }); 434 + 435 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 436 + 437 + let test_prefix = format!( 438 + "test:lexicon:{}:", 439 + std::time::SystemTime::now() 440 + .duration_since(std::time::UNIX_EPOCH) 441 + .unwrap() 442 + .as_nanos() 443 + ); 444 + let redis_resolver = RedisLexiconResolver::with_full_config( 445 + mock_resolver, 446 + pool.clone(), 447 + test_prefix, 448 + 3600, 449 + metrics, 450 + ); 451 + 452 + let test_nsid = "com.example.nonexistent"; 453 + 454 + // Resolution should fail 455 + let result = redis_resolver.resolve(test_nsid).await; 456 + assert!(result.is_err()); 457 + } 458 + }
+3
src/lib.rs
··· 2 2 pub mod config; // Config and Args needed by binary 3 3 pub mod handle_resolver; // Only traits and factory functions exposed 4 4 pub mod http; // Only create_router exposed 5 + pub mod jetstream_handler; // Jetstream event handler for AT Protocol events 6 + pub mod lexicon_resolver; // Lexicon resolution with caching support 5 7 6 8 // Semi-public modules - needed by binary but with limited exposure 7 9 pub mod cache; // Only create_redis_pool exposed 8 10 pub mod handle_resolver_task; // Factory functions and TaskConfig exposed 11 + pub mod metrics; // Metrics publishing trait and implementations 9 12 pub mod queue; // Queue adapter system with trait and factory functions 10 13 pub mod sqlite_schema; // SQLite schema management functions exposed 11 14 pub mod task_manager; // Only spawn_cancellable_task exposed
+547
src/metrics.rs
··· 1 + use crate::config::Config; 2 + use async_trait::async_trait; 3 + use cadence::{ 4 + BufferedUdpMetricSink, Counted, CountedExt, Gauged, Metric, QueuingMetricSink, StatsdClient, 5 + Timed, 6 + }; 7 + use std::net::UdpSocket; 8 + use std::sync::Arc; 9 + use thiserror::Error; 10 + use tracing::{debug, error}; 11 + 12 + /// Trait for publishing metrics with counter and gauge support 13 + /// Designed for minimal compatibility with cadence-style metrics 14 + #[async_trait] 15 + pub trait MetricsPublisher: Send + Sync { 16 + /// Increment a counter by 1 17 + async fn incr(&self, key: &str); 18 + 19 + /// Increment a counter by a specific value 20 + async fn count(&self, key: &str, value: u64); 21 + 22 + /// Increment a counter with tags 23 + async fn incr_with_tags(&self, key: &str, tags: &[(&str, &str)]); 24 + 25 + /// Increment a counter by a specific value with tags 26 + async fn count_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]); 27 + 28 + /// Record a gauge value 29 + async fn gauge(&self, key: &str, value: u64); 30 + 31 + /// Record a gauge value with tags 32 + async fn gauge_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]); 33 + 34 + /// Record a timing in milliseconds 35 + async fn time(&self, key: &str, millis: u64); 36 + 37 + /// Record a timing with tags 38 + async fn time_with_tags(&self, key: &str, millis: u64, tags: &[(&str, &str)]); 39 + } 40 + 41 + /// No-op implementation for development and testing 42 + #[derive(Debug, Clone, Default)] 43 + pub struct NoOpMetricsPublisher; 44 + 45 + impl NoOpMetricsPublisher { 46 + pub fn new() -> Self { 47 + Self 48 + } 49 + } 50 + 51 + #[async_trait] 52 + impl MetricsPublisher for NoOpMetricsPublisher { 53 + async fn incr(&self, _key: &str) { 54 + // No-op 55 + } 56 + 57 + async fn count(&self, _key: &str, _value: u64) { 58 + // No-op 59 + } 60 + 61 + async fn incr_with_tags(&self, _key: &str, _tags: &[(&str, &str)]) { 62 + // No-op 63 + } 64 + 65 + async fn count_with_tags(&self, _key: &str, _value: u64, _tags: &[(&str, &str)]) { 66 + // No-op 67 + } 68 + 69 + async fn gauge(&self, _key: &str, _value: u64) { 70 + // No-op 71 + } 72 + 73 + async fn gauge_with_tags(&self, _key: &str, _value: u64, _tags: &[(&str, &str)]) { 74 + // No-op 75 + } 76 + 77 + async fn time(&self, _key: &str, _millis: u64) { 78 + // No-op 79 + } 80 + 81 + async fn time_with_tags(&self, _key: &str, _millis: u64, _tags: &[(&str, &str)]) { 82 + // No-op 83 + } 84 + } 85 + 86 + /// Statsd-backed metrics publisher using cadence 87 + pub struct StatsdMetricsPublisher { 88 + client: StatsdClient, 89 + default_tags: Vec<(String, String)>, 90 + } 91 + 92 + impl StatsdMetricsPublisher { 93 + /// Create a new StatsdMetricsPublisher with default configuration 94 + pub fn new(host: &str, prefix: &str) -> Result<Self, Box<dyn std::error::Error>> { 95 + Self::new_with_bind(host, prefix, "[::]:0") 96 + } 97 + 98 + /// Create a new StatsdMetricsPublisher with custom bind address 99 + pub fn new_with_bind( 100 + host: &str, 101 + prefix: &str, 102 + bind_addr: &str, 103 + ) -> Result<Self, Box<dyn std::error::Error>> { 104 + Self::new_with_bind_and_tags(host, prefix, bind_addr, vec![]) 105 + } 106 + 107 + /// Create a new StatsdMetricsPublisher with default tags 108 + pub fn new_with_tags( 109 + host: &str, 110 + prefix: &str, 111 + default_tags: Vec<(String, String)>, 112 + ) -> Result<Self, Box<dyn std::error::Error>> { 113 + Self::new_with_bind_and_tags(host, prefix, "[::]:0", default_tags) 114 + } 115 + 116 + /// Create a new StatsdMetricsPublisher with custom bind address and tags 117 + pub fn new_with_bind_and_tags( 118 + host: &str, 119 + prefix: &str, 120 + bind_addr: &str, 121 + default_tags: Vec<(String, String)>, 122 + ) -> Result<Self, Box<dyn std::error::Error>> { 123 + tracing::info!( 124 + "Creating StatsdMetricsPublisher: host={}, prefix={}, bind={}, tags={:?}", 125 + host, 126 + prefix, 127 + bind_addr, 128 + default_tags 129 + ); 130 + 131 + let socket = UdpSocket::bind(bind_addr)?; 132 + socket.set_nonblocking(true)?; 133 + 134 + let buffered_sink = BufferedUdpMetricSink::from(host, socket)?; 135 + let queuing_sink = QueuingMetricSink::builder() 136 + .with_error_handler(move |error| { 137 + error!("Failed to send metric via sink: {}", error); 138 + }) 139 + .build(buffered_sink); 140 + let client = StatsdClient::from_sink(prefix, queuing_sink); 141 + 142 + tracing::info!( 143 + "StatsdMetricsPublisher created successfully with bind address: {}", 144 + bind_addr 145 + ); 146 + Ok(Self { 147 + client, 148 + default_tags, 149 + }) 150 + } 151 + 152 + /// Create from an existing StatsdClient 153 + pub fn from_client(client: StatsdClient) -> Self { 154 + Self::from_client_with_tags(client, vec![]) 155 + } 156 + 157 + /// Create from an existing StatsdClient with default tags 158 + pub fn from_client_with_tags( 159 + client: StatsdClient, 160 + default_tags: Vec<(String, String)>, 161 + ) -> Self { 162 + Self { 163 + client, 164 + default_tags, 165 + } 166 + } 167 + 168 + /// Apply default tags to a builder 169 + fn apply_default_tags<'a, M>( 170 + &'a self, 171 + mut builder: cadence::MetricBuilder<'a, 'a, M>, 172 + ) -> cadence::MetricBuilder<'a, 'a, M> 173 + where 174 + M: Metric + From<String>, 175 + { 176 + for (k, v) in &self.default_tags { 177 + builder = builder.with_tag(k.as_str(), v.as_str()); 178 + } 179 + builder 180 + } 181 + } 182 + 183 + #[async_trait] 184 + impl MetricsPublisher for StatsdMetricsPublisher { 185 + async fn incr(&self, key: &str) { 186 + debug!("Sending metric incr: {}", key); 187 + if self.default_tags.is_empty() { 188 + match self.client.incr(key) { 189 + Ok(_) => debug!("Successfully sent metric: {}", key), 190 + Err(e) => error!("Failed to send metric {}: {}", key, e), 191 + } 192 + } else { 193 + let builder = self.client.incr_with_tags(key); 194 + let builder = self.apply_default_tags(builder); 195 + let _ = builder.send(); 196 + debug!("Sent metric with tags: {}", key); 197 + } 198 + } 199 + 200 + async fn count(&self, key: &str, value: u64) { 201 + if self.default_tags.is_empty() { 202 + let _ = self.client.count(key, value); 203 + } else { 204 + let builder = self.client.count_with_tags(key, value); 205 + let builder = self.apply_default_tags(builder); 206 + let _ = builder.send(); 207 + } 208 + } 209 + 210 + async fn incr_with_tags(&self, key: &str, tags: &[(&str, &str)]) { 211 + let mut builder = self.client.incr_with_tags(key); 212 + builder = self.apply_default_tags(builder); 213 + for (k, v) in tags { 214 + builder = builder.with_tag(k, v); 215 + } 216 + let _ = builder.send(); 217 + } 218 + 219 + async fn count_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]) { 220 + let mut builder = self.client.count_with_tags(key, value); 221 + builder = self.apply_default_tags(builder); 222 + for (k, v) in tags { 223 + builder = builder.with_tag(k, v); 224 + } 225 + let _ = builder.send(); 226 + } 227 + 228 + async fn gauge(&self, key: &str, value: u64) { 229 + debug!("Sending metric gauge: {} = {}", key, value); 230 + if self.default_tags.is_empty() { 231 + match self.client.gauge(key, value) { 232 + Ok(_) => debug!("Successfully sent gauge: {} = {}", key, value), 233 + Err(e) => error!("Failed to send gauge {} = {}: {}", key, value, e), 234 + } 235 + } else { 236 + let builder = self.client.gauge_with_tags(key, value); 237 + let builder = self.apply_default_tags(builder); 238 + builder.send(); 239 + debug!("Sent gauge with tags: {} = {}", key, value); 240 + } 241 + } 242 + 243 + async fn gauge_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]) { 244 + let mut builder = self.client.gauge_with_tags(key, value); 245 + builder = self.apply_default_tags(builder); 246 + for (k, v) in tags { 247 + builder = builder.with_tag(k, v); 248 + } 249 + let _ = builder.send(); 250 + } 251 + 252 + async fn time(&self, key: &str, millis: u64) { 253 + if self.default_tags.is_empty() { 254 + let _ = self.client.time(key, millis); 255 + } else { 256 + let builder = self.client.time_with_tags(key, millis); 257 + let builder = self.apply_default_tags(builder); 258 + let _ = builder.send(); 259 + } 260 + } 261 + 262 + async fn time_with_tags(&self, key: &str, millis: u64, tags: &[(&str, &str)]) { 263 + let mut builder = self.client.time_with_tags(key, millis); 264 + builder = self.apply_default_tags(builder); 265 + for (k, v) in tags { 266 + builder = builder.with_tag(k, v); 267 + } 268 + let _ = builder.send(); 269 + } 270 + } 271 + 272 + /// Type alias for shared metrics publisher 273 + pub type SharedMetricsPublisher = Arc<dyn MetricsPublisher>; 274 + 275 + /// Metrics-specific errors 276 + #[derive(Debug, Error)] 277 + pub enum MetricsError { 278 + /// Failed to create metrics publisher 279 + #[error("error-quickdid-metrics-1 Failed to create metrics publisher: {0}")] 280 + CreationFailed(String), 281 + 282 + /// Invalid configuration for metrics 283 + #[error("error-quickdid-metrics-2 Invalid metrics configuration: {0}")] 284 + InvalidConfig(String), 285 + } 286 + 287 + /// Create a metrics publisher based on configuration 288 + /// 289 + /// Returns either a no-op publisher or a StatsD publisher based on the 290 + /// `metrics_adapter` configuration value. 291 + /// 292 + /// ## Example 293 + /// 294 + /// ```rust,no_run 295 + /// use quickdid::config::Config; 296 + /// use quickdid::metrics::create_metrics_publisher; 297 + /// 298 + /// # async fn example() -> Result<(), Box<dyn std::error::Error>> { 299 + /// let config = Config::from_env()?; 300 + /// let metrics = create_metrics_publisher(&config)?; 301 + /// 302 + /// // Use the metrics publisher 303 + /// metrics.incr("request.count").await; 304 + /// # Ok(()) 305 + /// # } 306 + /// ``` 307 + pub fn create_metrics_publisher(config: &Config) -> Result<SharedMetricsPublisher, MetricsError> { 308 + match config.metrics_adapter.as_str() { 309 + "noop" => Ok(Arc::new(NoOpMetricsPublisher::new())), 310 + "statsd" => { 311 + let host = config.metrics_statsd_host.as_ref().ok_or_else(|| { 312 + MetricsError::InvalidConfig( 313 + "METRICS_STATSD_HOST is required when using statsd adapter".to_string(), 314 + ) 315 + })?; 316 + 317 + // Parse tags from comma-separated key:value pairs 318 + let default_tags = if let Some(tags_str) = &config.metrics_tags { 319 + tags_str 320 + .split(',') 321 + .filter_map(|tag| { 322 + let parts: Vec<&str> = tag.trim().split(':').collect(); 323 + if parts.len() == 2 { 324 + Some((parts[0].to_string(), parts[1].to_string())) 325 + } else { 326 + error!("Invalid tag format: {}", tag); 327 + None 328 + } 329 + }) 330 + .collect() 331 + } else { 332 + vec![] 333 + }; 334 + 335 + let publisher = StatsdMetricsPublisher::new_with_bind_and_tags( 336 + host, 337 + &config.metrics_prefix, 338 + &config.metrics_statsd_bind, 339 + default_tags, 340 + ) 341 + .map_err(|e| MetricsError::CreationFailed(e.to_string()))?; 342 + 343 + Ok(Arc::new(publisher)) 344 + } 345 + _ => Err(MetricsError::InvalidConfig(format!( 346 + "Unknown metrics adapter: {}", 347 + config.metrics_adapter 348 + ))), 349 + } 350 + } 351 + 352 + #[cfg(test)] 353 + mod tests { 354 + use super::*; 355 + use once_cell::sync::Lazy; 356 + use std::sync::Mutex; 357 + 358 + // Use a mutex to serialize tests that modify environment variables 359 + static ENV_MUTEX: Lazy<Mutex<()>> = Lazy::new(|| Mutex::new(())); 360 + 361 + #[tokio::test] 362 + async fn test_noop_metrics() { 363 + let metrics = NoOpMetricsPublisher::new(); 364 + 365 + // These should all be no-ops and not panic 366 + metrics.incr("test.counter").await; 367 + metrics.count("test.counter", 5).await; 368 + metrics 369 + .incr_with_tags("test.counter", &[("env", "test")]) 370 + .await; 371 + metrics 372 + .count_with_tags( 373 + "test.counter", 374 + 10, 375 + &[("env", "test"), ("service", "quickdid")], 376 + ) 377 + .await; 378 + metrics.gauge("test.gauge", 100).await; 379 + metrics 380 + .gauge_with_tags("test.gauge", 200, &[("host", "localhost")]) 381 + .await; 382 + metrics.time("test.timing", 42).await; 383 + metrics 384 + .time_with_tags("test.timing", 84, &[("endpoint", "/resolve")]) 385 + .await; 386 + } 387 + 388 + #[tokio::test] 389 + async fn test_shared_metrics() { 390 + let metrics: SharedMetricsPublisher = Arc::new(NoOpMetricsPublisher::new()); 391 + 392 + // Verify it can be used as a shared reference 393 + metrics.incr("shared.counter").await; 394 + metrics.gauge("shared.gauge", 50).await; 395 + 396 + // Verify it can be cloned 397 + let metrics2 = Arc::clone(&metrics); 398 + metrics2.count("cloned.counter", 3).await; 399 + } 400 + 401 + #[test] 402 + fn test_create_noop_publisher() { 403 + use std::env; 404 + 405 + // Lock mutex to prevent concurrent environment variable modification 406 + let _guard = ENV_MUTEX.lock().unwrap(); 407 + 408 + // Clean up any existing environment variables first 409 + unsafe { 410 + env::remove_var("METRICS_ADAPTER"); 411 + env::remove_var("METRICS_STATSD_HOST"); 412 + env::remove_var("METRICS_PREFIX"); 413 + env::remove_var("METRICS_TAGS"); 414 + } 415 + 416 + // Set up environment for noop adapter 417 + unsafe { 418 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 419 + env::set_var("METRICS_ADAPTER", "noop"); 420 + } 421 + 422 + let config = Config::from_env().unwrap(); 423 + let metrics = create_metrics_publisher(&config).unwrap(); 424 + 425 + // Should create successfully - actual type checking happens at compile time 426 + assert!(Arc::strong_count(&metrics) == 1); 427 + 428 + // Clean up 429 + unsafe { 430 + env::remove_var("METRICS_ADAPTER"); 431 + env::remove_var("HTTP_EXTERNAL"); 432 + } 433 + } 434 + 435 + #[test] 436 + fn test_create_statsd_publisher() { 437 + use std::env; 438 + 439 + // Lock mutex to prevent concurrent environment variable modification 440 + let _guard = ENV_MUTEX.lock().unwrap(); 441 + 442 + // Clean up any existing environment variables first 443 + unsafe { 444 + env::remove_var("METRICS_ADAPTER"); 445 + env::remove_var("METRICS_STATSD_HOST"); 446 + env::remove_var("METRICS_PREFIX"); 447 + env::remove_var("METRICS_TAGS"); 448 + } 449 + 450 + // Set up environment for statsd adapter 451 + unsafe { 452 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 453 + env::set_var("METRICS_ADAPTER", "statsd"); 454 + env::set_var("METRICS_STATSD_HOST", "localhost:8125"); 455 + env::set_var("METRICS_PREFIX", "test"); 456 + env::set_var("METRICS_TAGS", "env:test,service:quickdid"); 457 + } 458 + 459 + let config = Config::from_env().unwrap(); 460 + let metrics = create_metrics_publisher(&config).unwrap(); 461 + 462 + // Should create successfully 463 + assert!(Arc::strong_count(&metrics) == 1); 464 + 465 + // Clean up 466 + unsafe { 467 + env::remove_var("METRICS_ADAPTER"); 468 + env::remove_var("METRICS_STATSD_HOST"); 469 + env::remove_var("METRICS_PREFIX"); 470 + env::remove_var("METRICS_TAGS"); 471 + env::remove_var("HTTP_EXTERNAL"); 472 + } 473 + } 474 + 475 + #[test] 476 + fn test_missing_statsd_host() { 477 + use std::env; 478 + 479 + // Lock mutex to prevent concurrent environment variable modification 480 + let _guard = ENV_MUTEX.lock().unwrap(); 481 + 482 + // Clean up any existing environment variables first 483 + unsafe { 484 + env::remove_var("METRICS_ADAPTER"); 485 + env::remove_var("METRICS_STATSD_HOST"); 486 + env::remove_var("METRICS_PREFIX"); 487 + env::remove_var("METRICS_TAGS"); 488 + } 489 + 490 + // Set up environment for statsd adapter without host 491 + unsafe { 492 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 493 + env::set_var("METRICS_ADAPTER", "statsd"); 494 + env::remove_var("METRICS_STATSD_HOST"); 495 + } 496 + 497 + let config = Config::from_env().unwrap(); 498 + let result = create_metrics_publisher(&config); 499 + 500 + // Should fail with invalid config error 501 + assert!(result.is_err()); 502 + if let Err(e) = result { 503 + assert!(matches!(e, MetricsError::InvalidConfig(_))); 504 + } 505 + 506 + // Clean up 507 + unsafe { 508 + env::remove_var("METRICS_ADAPTER"); 509 + env::remove_var("HTTP_EXTERNAL"); 510 + } 511 + } 512 + 513 + #[test] 514 + fn test_invalid_adapter() { 515 + use std::env; 516 + 517 + // Lock mutex to prevent concurrent environment variable modification 518 + let _guard = ENV_MUTEX.lock().unwrap(); 519 + 520 + // Clean up any existing environment variables first 521 + unsafe { 522 + env::remove_var("METRICS_ADAPTER"); 523 + env::remove_var("METRICS_STATSD_HOST"); 524 + env::remove_var("METRICS_PREFIX"); 525 + env::remove_var("METRICS_TAGS"); 526 + } 527 + 528 + // Set up environment with invalid adapter 529 + unsafe { 530 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 531 + env::set_var("METRICS_ADAPTER", "invalid"); 532 + env::remove_var("METRICS_STATSD_HOST"); // Clean up from other tests 533 + } 534 + 535 + let config = Config::from_env().unwrap(); 536 + 537 + // Config validation should catch this 538 + let validation_result = config.validate(); 539 + assert!(validation_result.is_err()); 540 + 541 + // Clean up 542 + unsafe { 543 + env::remove_var("METRICS_ADAPTER"); 544 + env::remove_var("HTTP_EXTERNAL"); 545 + } 546 + } 547 + }
+60 -4
src/queue/factory.rs
··· 10 10 11 11 use super::{ 12 12 adapter::QueueAdapter, mpsc::MpscQueueAdapter, noop::NoopQueueAdapter, 13 - redis::RedisQueueAdapter, sqlite::SqliteQueueAdapter, 13 + redis::RedisQueueAdapter, sqlite::SqliteQueueAdapter, work::DedupKey, 14 14 }; 15 15 16 16 // ========= MPSC Queue Factories ========= ··· 81 81 /// # Examples 82 82 /// 83 83 /// ```no_run 84 - /// use quickdid::queue::create_redis_queue; 84 + /// use quickdid::queue::{create_redis_queue, HandleResolutionWork}; 85 85 /// use deadpool_redis::Config; 86 86 /// 87 87 /// # async fn example() -> anyhow::Result<()> { 88 88 /// let cfg = Config::from_url("redis://localhost:6379"); 89 89 /// let pool = cfg.create_pool(Some(deadpool_redis::Runtime::Tokio1))?; 90 90 /// 91 - /// let queue = create_redis_queue::<String>( 91 + /// let queue = create_redis_queue::<HandleResolutionWork>( 92 92 /// pool, 93 93 /// "worker-1".to_string(), 94 94 /// "queue:myapp:".to_string(), ··· 104 104 timeout_seconds: u64, 105 105 ) -> Arc<dyn QueueAdapter<T>> 106 106 where 107 - T: Send + Sync + Serialize + for<'de> Deserialize<'de> + 'static, 107 + T: Send + Sync + Serialize + for<'de> Deserialize<'de> + DedupKey + 'static, 108 108 { 109 109 Arc::new(RedisQueueAdapter::new( 110 110 pool, 111 111 worker_id, 112 112 key_prefix, 113 113 timeout_seconds, 114 + )) 115 + } 116 + 117 + /// Create a new Redis-backed queue adapter with deduplication. 118 + /// 119 + /// This creates a distributed queue with deduplication to prevent duplicate items 120 + /// from being queued within the specified TTL window. 121 + /// 122 + /// # Arguments 123 + /// 124 + /// * `pool` - Redis connection pool 125 + /// * `worker_id` - Worker identifier for this queue instance 126 + /// * `key_prefix` - Redis key prefix for queue operations 127 + /// * `timeout_seconds` - Timeout for blocking operations 128 + /// * `dedup_enabled` - Whether to enable deduplication 129 + /// * `dedup_ttl` - TTL for deduplication keys in seconds 130 + /// 131 + /// # Examples 132 + /// 133 + /// ```no_run 134 + /// use quickdid::queue::{create_redis_queue_with_dedup, HandleResolutionWork}; 135 + /// use deadpool_redis::Config; 136 + /// 137 + /// # async fn example() -> anyhow::Result<()> { 138 + /// let cfg = Config::from_url("redis://localhost:6379"); 139 + /// let pool = cfg.create_pool(Some(deadpool_redis::Runtime::Tokio1))?; 140 + /// 141 + /// let queue = create_redis_queue_with_dedup::<HandleResolutionWork>( 142 + /// pool, 143 + /// "worker-1".to_string(), 144 + /// "queue:myapp:".to_string(), 145 + /// 5, 146 + /// true, // Enable deduplication 147 + /// 60, // 60 second dedup window 148 + /// ); 149 + /// # Ok(()) 150 + /// # } 151 + /// ``` 152 + pub fn create_redis_queue_with_dedup<T>( 153 + pool: RedisPool, 154 + worker_id: String, 155 + key_prefix: String, 156 + timeout_seconds: u64, 157 + dedup_enabled: bool, 158 + dedup_ttl: u64, 159 + ) -> Arc<dyn QueueAdapter<T>> 160 + where 161 + T: Send + Sync + Serialize + for<'de> Deserialize<'de> + DedupKey + 'static, 162 + { 163 + Arc::new(RedisQueueAdapter::with_dedup( 164 + pool, 165 + worker_id, 166 + key_prefix, 167 + timeout_seconds, 168 + dedup_enabled, 169 + dedup_ttl, 114 170 )) 115 171 } 116 172
+2 -2
src/queue/mod.rs
··· 63 63 // Re-export core types 64 64 pub use adapter::QueueAdapter; 65 65 pub use error::{QueueError, Result}; 66 - pub use work::HandleResolutionWork; 66 + pub use work::{DedupKey, HandleResolutionWork}; 67 67 68 68 // Re-export implementations (with limited visibility) 69 69 pub use mpsc::MpscQueueAdapter; ··· 74 74 // Re-export factory functions 75 75 pub use factory::{ 76 76 create_mpsc_queue, create_mpsc_queue_from_channel, create_noop_queue, create_redis_queue, 77 - create_sqlite_queue, create_sqlite_queue_with_max_size, 77 + create_redis_queue_with_dedup, create_sqlite_queue, create_sqlite_queue_with_max_size, 78 78 };
+237 -5
src/queue/redis.rs
··· 10 10 11 11 use super::adapter::QueueAdapter; 12 12 use super::error::{QueueError, Result}; 13 + use super::work::DedupKey; 13 14 14 15 /// Redis-backed queue adapter implementation. 15 16 /// ··· 40 41 /// # Examples 41 42 /// 42 43 /// ```no_run 43 - /// use quickdid::queue::RedisQueueAdapter; 44 - /// use quickdid::queue::QueueAdapter; 44 + /// use quickdid::queue::{RedisQueueAdapter, QueueAdapter, HandleResolutionWork}; 45 45 /// use deadpool_redis::Config; 46 46 /// 47 47 /// # async fn example() -> anyhow::Result<()> { ··· 50 50 /// let pool = cfg.create_pool(Some(deadpool_redis::Runtime::Tokio1))?; 51 51 /// 52 52 /// // Create queue adapter 53 - /// let queue = RedisQueueAdapter::<String>::new( 53 + /// let queue = RedisQueueAdapter::<HandleResolutionWork>::new( 54 54 /// pool, 55 55 /// "worker-1".to_string(), 56 56 /// "queue:myapp:".to_string(), ··· 58 58 /// ); 59 59 /// 60 60 /// // Use the queue 61 - /// queue.push("work-item".to_string()).await?; 61 + /// let work = HandleResolutionWork::new("alice.bsky.social".to_string()); 62 + /// queue.push(work.clone()).await?; 62 63 /// if let Some(item) = queue.pull().await { 63 64 /// // Process item 64 65 /// queue.ack(&item).await?; ··· 78 79 key_prefix: String, 79 80 /// Timeout for blocking RPOPLPUSH operations (in seconds) 80 81 timeout_seconds: u64, 82 + /// Enable deduplication to prevent duplicate items in queue 83 + dedup_enabled: bool, 84 + /// TTL for deduplication keys in seconds 85 + dedup_ttl: u64, 81 86 /// Type marker for generic parameter 82 87 _phantom: std::marker::PhantomData<T>, 83 88 } ··· 120 125 key_prefix: String, 121 126 timeout_seconds: u64, 122 127 ) -> Self { 128 + Self::with_dedup( 129 + pool, 130 + worker_id, 131 + key_prefix, 132 + timeout_seconds, 133 + false, 134 + 60, // Default TTL of 60 seconds 135 + ) 136 + } 137 + 138 + /// Create a new Redis queue adapter with deduplication settings. 139 + /// 140 + /// # Arguments 141 + /// 142 + /// * `pool` - Redis connection pool 143 + /// * `worker_id` - Unique identifier for this worker instance 144 + /// * `key_prefix` - Redis key prefix for queue operations 145 + /// * `timeout_seconds` - Timeout for blocking pull operations 146 + /// * `dedup_enabled` - Whether to enable deduplication 147 + /// * `dedup_ttl` - TTL for deduplication keys in seconds 148 + pub fn with_dedup( 149 + pool: RedisPool, 150 + worker_id: String, 151 + key_prefix: String, 152 + timeout_seconds: u64, 153 + dedup_enabled: bool, 154 + dedup_ttl: u64, 155 + ) -> Self { 123 156 Self { 124 157 pool, 125 158 worker_id, 126 159 key_prefix, 127 160 timeout_seconds, 161 + dedup_enabled, 162 + dedup_ttl, 128 163 _phantom: std::marker::PhantomData, 129 164 } 130 165 } ··· 138 173 fn worker_queue_key(&self) -> String { 139 174 format!("{}{}", self.key_prefix, self.worker_id) 140 175 } 176 + 177 + /// Get the deduplication key for an item. 178 + /// This key is used to track if an item is already queued. 179 + fn dedup_key(&self, item_id: &str) -> String { 180 + format!("{}dedup:{}", self.key_prefix, item_id) 181 + } 182 + 183 + /// Check and mark an item for deduplication. 184 + /// Returns true if the item was successfully marked (not duplicate), 185 + /// false if it was already in the deduplication set (duplicate). 186 + async fn check_and_mark_dedup( 187 + &self, 188 + conn: &mut deadpool_redis::Connection, 189 + item_id: &str, 190 + ) -> Result<bool> { 191 + if !self.dedup_enabled { 192 + return Ok(true); // Always allow if dedup is disabled 193 + } 194 + 195 + let dedup_key = self.dedup_key(item_id); 196 + 197 + // Use SET NX EX to atomically set if not exists with expiry 198 + // Returns OK if the key was set, Nil if it already existed 199 + let result: Option<String> = deadpool_redis::redis::cmd("SET") 200 + .arg(&dedup_key) 201 + .arg("1") 202 + .arg("NX") // Only set if not exists 203 + .arg("EX") // Set expiry 204 + .arg(self.dedup_ttl) 205 + .query_async(conn) 206 + .await 207 + .map_err(|e| QueueError::RedisOperationFailed { 208 + operation: "SET NX EX".to_string(), 209 + details: e.to_string(), 210 + })?; 211 + 212 + // If result is Some("OK"), the key was set (not duplicate) 213 + // If result is None, the key already existed (duplicate) 214 + Ok(result.is_some()) 215 + } 141 216 } 142 217 143 218 #[async_trait] 144 219 impl<T> QueueAdapter<T> for RedisQueueAdapter<T> 145 220 where 146 - T: Send + Sync + Serialize + for<'de> Deserialize<'de> + 'static, 221 + T: Send + Sync + Serialize + for<'de> Deserialize<'de> + DedupKey + 'static, 147 222 { 148 223 async fn pull(&self) -> Option<T> { 149 224 match self.pool.get().await { ··· 198 273 .get() 199 274 .await 200 275 .map_err(|e| QueueError::RedisConnectionFailed(e.to_string()))?; 276 + 277 + // Check for deduplication if enabled 278 + if self.dedup_enabled { 279 + let dedup_id = work.dedup_key(); 280 + let is_new = self.check_and_mark_dedup(&mut conn, &dedup_id).await?; 281 + 282 + if !is_new { 283 + debug!( 284 + dedup_key = %dedup_id, 285 + "Item already queued, skipping duplicate" 286 + ); 287 + return Ok(()); // Successfully deduplicated 288 + } 289 + } 201 290 202 291 let data = serde_json::to_vec(&work) 203 292 .map_err(|e| QueueError::SerializationFailed(e.to_string()))?; ··· 429 518 430 519 // Should be healthy if Redis is running 431 520 assert!(adapter.is_healthy().await); 521 + } 522 + 523 + #[tokio::test] 524 + async fn test_redis_queue_deduplication() { 525 + use crate::queue::HandleResolutionWork; 526 + 527 + let pool = match crate::test_helpers::get_test_redis_pool() { 528 + Some(p) => p, 529 + None => { 530 + eprintln!("Skipping Redis test - no Redis connection available"); 531 + return; 532 + } 533 + }; 534 + 535 + let test_prefix = format!( 536 + "test:queue:dedup:{}:", 537 + std::time::SystemTime::now() 538 + .duration_since(std::time::UNIX_EPOCH) 539 + .unwrap() 540 + .as_nanos() 541 + ); 542 + 543 + // Create adapter with deduplication enabled 544 + let adapter = RedisQueueAdapter::<HandleResolutionWork>::with_dedup( 545 + pool.clone(), 546 + "test-worker-dedup".to_string(), 547 + test_prefix.clone(), 548 + 1, 549 + true, // Enable deduplication 550 + 2, // 2 second TTL for quick testing 551 + ); 552 + 553 + let work = HandleResolutionWork::new("alice.example.com".to_string()); 554 + 555 + // First push should succeed 556 + adapter 557 + .push(work.clone()) 558 + .await 559 + .expect("First push should succeed"); 560 + 561 + // Second push of same item should be deduplicated (but still return Ok) 562 + adapter 563 + .push(work.clone()) 564 + .await 565 + .expect("Second push should succeed (deduplicated)"); 566 + 567 + // Queue should only have one item 568 + let depth = adapter.depth().await; 569 + assert_eq!( 570 + depth, 571 + Some(1), 572 + "Queue should only have one item after deduplication" 573 + ); 574 + 575 + // Pull the item 576 + let pulled = adapter.pull().await; 577 + assert_eq!(pulled, Some(work.clone())); 578 + 579 + // Queue should now be empty 580 + let depth = adapter.depth().await; 581 + assert_eq!(depth, Some(0), "Queue should be empty after pulling"); 582 + 583 + // Wait for dedup TTL to expire 584 + tokio::time::sleep(tokio::time::Duration::from_secs(3)).await; 585 + 586 + // Should be able to push again after TTL expires 587 + adapter 588 + .push(work.clone()) 589 + .await 590 + .expect("Push after TTL expiry should succeed"); 591 + 592 + let depth = adapter.depth().await; 593 + assert_eq!( 594 + depth, 595 + Some(1), 596 + "Queue should have one item after TTL expiry" 597 + ); 598 + } 599 + 600 + #[tokio::test] 601 + async fn test_redis_queue_deduplication_disabled() { 602 + use crate::queue::HandleResolutionWork; 603 + 604 + let pool = match crate::test_helpers::get_test_redis_pool() { 605 + Some(p) => p, 606 + None => { 607 + eprintln!("Skipping Redis test - no Redis connection available"); 608 + return; 609 + } 610 + }; 611 + 612 + let test_prefix = format!( 613 + "test:queue:nodedup:{}:", 614 + std::time::SystemTime::now() 615 + .duration_since(std::time::UNIX_EPOCH) 616 + .unwrap() 617 + .as_nanos() 618 + ); 619 + 620 + // Create adapter with deduplication disabled 621 + let adapter = RedisQueueAdapter::<HandleResolutionWork>::with_dedup( 622 + pool.clone(), 623 + "test-worker-nodedup".to_string(), 624 + test_prefix.clone(), 625 + 1, 626 + false, // Disable deduplication 627 + 60, 628 + ); 629 + 630 + let work = HandleResolutionWork::new("bob.example.com".to_string()); 631 + 632 + // Push same item twice 633 + adapter 634 + .push(work.clone()) 635 + .await 636 + .expect("First push should succeed"); 637 + adapter 638 + .push(work.clone()) 639 + .await 640 + .expect("Second push should succeed"); 641 + 642 + // Queue should have two items (no deduplication) 643 + let depth = adapter.depth().await; 644 + assert_eq!( 645 + depth, 646 + Some(2), 647 + "Queue should have two items when deduplication is disabled" 648 + ); 649 + 650 + // Pull both items 651 + let pulled1 = adapter.pull().await; 652 + assert_eq!(pulled1, Some(work.clone())); 653 + 654 + let pulled2 = adapter.pull().await; 655 + assert_eq!(pulled2, Some(work.clone())); 656 + 657 + // Queue should now be empty 658 + let depth = adapter.depth().await; 659 + assert_eq!( 660 + depth, 661 + Some(0), 662 + "Queue should be empty after pulling all items" 663 + ); 432 664 } 433 665 434 666 #[tokio::test]
+38
src/queue/work.rs
··· 50 50 } 51 51 } 52 52 53 + /// Trait for getting a unique deduplication key from a work item. 54 + /// This is used by the Redis queue adapter to prevent duplicate items. 55 + pub trait DedupKey { 56 + /// Get a unique key for deduplication purposes. 57 + /// This should return a consistent identifier for equivalent work items. 58 + fn dedup_key(&self) -> String; 59 + } 60 + 61 + impl DedupKey for HandleResolutionWork { 62 + fn dedup_key(&self) -> String { 63 + // Use the handle itself as the dedup key 64 + self.handle.clone() 65 + } 66 + } 67 + 68 + // For testing purposes, implement DedupKey for String 69 + #[cfg(test)] 70 + impl DedupKey for String { 71 + fn dedup_key(&self) -> String { 72 + self.clone() 73 + } 74 + } 75 + 53 76 #[cfg(test)] 54 77 mod tests { 55 78 use super::*; ··· 91 114 92 115 assert_eq!(work1, work2); 93 116 assert_ne!(work1, work3); 117 + } 118 + 119 + #[test] 120 + fn test_handle_resolution_work_dedup_key() { 121 + let work1 = HandleResolutionWork::new("alice.example.com".to_string()); 122 + let work2 = HandleResolutionWork::new("alice.example.com".to_string()); 123 + let work3 = HandleResolutionWork::new("bob.example.com".to_string()); 124 + 125 + // Same handle should have same dedup key 126 + assert_eq!(work1.dedup_key(), work2.dedup_key()); 127 + assert_eq!(work1.dedup_key(), "alice.example.com"); 128 + 129 + // Different handle should have different dedup key 130 + assert_ne!(work1.dedup_key(), work3.dedup_key()); 131 + assert_eq!(work3.dedup_key(), "bob.example.com"); 94 132 } 95 133 }
+364
test-scripts/docker-test.sh
··· 1 + #!/bin/bash 2 + 3 + # Comprehensive test script for Telegraf/TimescaleDB metrics setup 4 + # This script validates the entire metrics pipeline 5 + 6 + set -e 7 + 8 + echo "=========================================" 9 + echo "Telegraf/TimescaleDB Metrics Test Suite" 10 + echo "=========================================" 11 + echo "" 12 + 13 + # Check if Docker is running 14 + if ! docker info > /dev/null 2>&1; then 15 + echo "โŒ Docker is not running. Please start Docker first." 16 + exit 1 17 + fi 18 + 19 + # Function to wait for a service to be healthy 20 + wait_for_service() { 21 + local service=$1 22 + local max_attempts=30 23 + local attempt=1 24 + 25 + echo -n "Waiting for $service to be healthy" 26 + while [ $attempt -le $max_attempts ]; do 27 + if docker-compose ps $service | grep -q "healthy"; then 28 + echo " โœ…" 29 + return 0 30 + fi 31 + echo -n "." 32 + sleep 2 33 + attempt=$((attempt + 1)) 34 + done 35 + echo " โŒ" 36 + echo "Service $service failed to become healthy after $max_attempts attempts" 37 + return 1 38 + } 39 + 40 + # Function to run SQL query 41 + run_query() { 42 + docker exec -i timescaledb psql -U postgres -d metrics -t -c "$1" 2>/dev/null 43 + } 44 + 45 + # Function to check table exists 46 + check_table() { 47 + local table=$1 48 + local result=$(run_query "SELECT EXISTS (SELECT 1 FROM information_schema.tables WHERE table_name = '$table');") 49 + if [[ "$result" =~ "t" ]]; then 50 + echo "โœ… Table '$table' exists" 51 + return 0 52 + else 53 + echo "โŒ Table '$table' does not exist" 54 + return 1 55 + fi 56 + } 57 + 58 + # Navigate to the metrics-stack directory (create if needed) 59 + if [ ! -d "metrics-stack" ]; then 60 + echo "Creating metrics-stack directory..." 61 + mkdir -p metrics-stack/telegraf 62 + mkdir -p metrics-stack/test-scripts 63 + mkdir -p metrics-stack/init-scripts 64 + fi 65 + 66 + cd metrics-stack 67 + 68 + # Create .env file if it doesn't exist 69 + if [ ! -f ".env" ]; then 70 + echo "Creating .env file..." 71 + cat > .env << 'EOF' 72 + # PostgreSQL/TimescaleDB Configuration 73 + POSTGRES_DB=metrics 74 + POSTGRES_USER=postgres 75 + POSTGRES_PASSWORD=secretpassword 76 + 77 + # Telegraf Database User 78 + TELEGRAF_DB_USER=postgres 79 + TELEGRAF_DB_PASSWORD=secretpassword 80 + 81 + # TimescaleDB Settings 82 + TIMESCALE_TELEMETRY=off 83 + EOF 84 + fi 85 + 86 + # Copy configuration files if they don't exist 87 + if [ ! -f "telegraf/telegraf.conf" ]; then 88 + echo "Creating telegraf.conf..." 89 + cat > telegraf/telegraf.conf << 'EOF' 90 + [agent] 91 + interval = "10s" 92 + round_interval = true 93 + metric_batch_size = 1000 94 + metric_buffer_limit = 10000 95 + collection_jitter = "0s" 96 + flush_interval = "10s" 97 + flush_jitter = "0s" 98 + precision = "" 99 + debug = false 100 + quiet = false 101 + hostname = "telegraf-agent" 102 + omit_hostname = false 103 + 104 + [[inputs.statsd]] 105 + service_address = ":8125" 106 + protocol = "udp" 107 + delete_gauges = true 108 + delete_counters = true 109 + delete_sets = true 110 + delete_timings = true 111 + percentiles = [50, 90, 95, 99] 112 + metric_separator = "." 113 + allowed_pending_messages = 10000 114 + datadog_extensions = true 115 + datadog_distributions = true 116 + 117 + [[outputs.postgresql]] 118 + connection = "host=timescaledb user=${TELEGRAF_DB_USER} password=${TELEGRAF_DB_PASSWORD} dbname=${POSTGRES_DB} sslmode=disable" 119 + schema = "public" 120 + create_templates = [ 121 + '''CREATE TABLE IF NOT EXISTS {{.table}} ({{.columns}})''', 122 + '''SELECT create_hypertable({{.table|quoteLiteral}}, 'time', if_not_exists => TRUE)''', 123 + ] 124 + tags_as_jsonb = true 125 + fields_as_jsonb = false 126 + EOF 127 + fi 128 + 129 + # Copy docker-compose.yml if it doesn't exist 130 + if [ ! -f "docker-compose.yml" ]; then 131 + echo "Creating docker-compose.yml..." 132 + cat > docker-compose.yml << 'EOF' 133 + version: '3.8' 134 + 135 + services: 136 + timescaledb: 137 + image: timescale/timescaledb:latest-pg17 138 + container_name: timescaledb 139 + restart: unless-stopped 140 + environment: 141 + POSTGRES_DB: ${POSTGRES_DB} 142 + POSTGRES_USER: ${POSTGRES_USER} 143 + POSTGRES_PASSWORD: ${POSTGRES_PASSWORD} 144 + TIMESCALE_TELEMETRY: ${TIMESCALE_TELEMETRY} 145 + ports: 146 + - "5442:5432" 147 + volumes: 148 + - timescale_data:/home/postgres/pgdata/data 149 + - ./init-scripts:/docker-entrypoint-initdb.d:ro 150 + command: 151 + - postgres 152 + - -c 153 + - shared_buffers=256MB 154 + - -c 155 + - effective_cache_size=1GB 156 + - -c 157 + - maintenance_work_mem=64MB 158 + - -c 159 + - work_mem=8MB 160 + healthcheck: 161 + test: ["CMD-SHELL", "pg_isready -U ${POSTGRES_USER} -d ${POSTGRES_DB}"] 162 + interval: 10s 163 + timeout: 5s 164 + retries: 5 165 + networks: 166 + - metrics_network 167 + 168 + telegraf: 169 + image: telegraf:1.35 170 + container_name: telegraf 171 + restart: unless-stopped 172 + environment: 173 + TELEGRAF_DB_USER: ${TELEGRAF_DB_USER} 174 + TELEGRAF_DB_PASSWORD: ${TELEGRAF_DB_PASSWORD} 175 + POSTGRES_DB: ${POSTGRES_DB} 176 + ports: 177 + - "8125:8125/udp" 178 + volumes: 179 + - ./telegraf/telegraf.conf:/etc/telegraf/telegraf.conf:ro 180 + depends_on: 181 + timescaledb: 182 + condition: service_healthy 183 + networks: 184 + - metrics_network 185 + command: ["telegraf", "--config", "/etc/telegraf/telegraf.conf"] 186 + 187 + networks: 188 + metrics_network: 189 + driver: bridge 190 + 191 + volumes: 192 + timescale_data: 193 + EOF 194 + fi 195 + 196 + # Create init script 197 + if [ ! -f "init-scripts/01-init.sql" ]; then 198 + echo "Creating init script..." 199 + cat > init-scripts/01-init.sql << 'EOF' 200 + -- Enable TimescaleDB extension 201 + CREATE EXTENSION IF NOT EXISTS timescaledb; 202 + CREATE EXTENSION IF NOT EXISTS pg_stat_statements; 203 + EOF 204 + fi 205 + 206 + echo "" 207 + echo "Step 1: Starting Docker services..." 208 + echo "=========================================" 209 + docker-compose down -v 2>/dev/null || true 210 + docker-compose up -d 211 + 212 + echo "" 213 + echo "Step 2: Waiting for services to be healthy..." 214 + echo "=========================================" 215 + wait_for_service timescaledb 216 + sleep 5 # Extra time for Telegraf to connect 217 + 218 + echo "" 219 + echo "Step 3: Sending test metrics..." 220 + echo "=========================================" 221 + 222 + # Send various types of metrics 223 + echo "Sending counter metrics..." 224 + for i in {1..5}; do 225 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 226 + echo "quickdid.http.request.count:1|c|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 227 + done 228 + 229 + echo "Sending gauge metrics..." 230 + echo "quickdid.resolver.rate_limit.available_permits:10|g" | nc -u -w0 localhost 8125 231 + sleep 1 232 + echo "quickdid.resolver.rate_limit.available_permits:5|g" | nc -u -w0 localhost 8125 233 + 234 + echo "Sending timing metrics..." 235 + for i in {1..10}; do 236 + duration=$((RANDOM % 100 + 10)) 237 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 238 + done 239 + 240 + echo "Sending histogram metrics..." 241 + for i in {1..5}; do 242 + resolution_time=$((RANDOM % 500 + 50)) 243 + echo "quickdid.resolver.resolution_time:${resolution_time}|h|#resolver:redis" | nc -u -w0 localhost 8125 244 + done 245 + 246 + echo "Waiting 15 seconds for Telegraf to flush metrics..." 247 + sleep 15 248 + 249 + echo "" 250 + echo "Step 4: Verifying table creation..." 251 + echo "=========================================" 252 + 253 + # Check if tables were created 254 + check_table "quickdid.http.request.count" 255 + check_table "quickdid.http.request.duration_ms" 256 + check_table "quickdid.resolver.rate_limit.available_permits" 257 + check_table "quickdid.resolver.resolution_time" 258 + 259 + echo "" 260 + echo "Step 5: Verifying data insertion..." 261 + echo "=========================================" 262 + 263 + # Check row counts 264 + for table in "quickdid.http.request.count" "quickdid.http.request.duration_ms" "quickdid.resolver.rate_limit.available_permits" "quickdid.resolver.resolution_time"; do 265 + count=$(run_query "SELECT COUNT(*) FROM \"$table\";" | tr -d ' ') 266 + if [ "$count" -gt 0 ]; then 267 + echo "โœ… Table '$table' has $count rows" 268 + else 269 + echo "โŒ Table '$table' is empty" 270 + fi 271 + done 272 + 273 + echo "" 274 + echo "Step 6: Testing JSONB tag queries..." 275 + echo "=========================================" 276 + 277 + # Test JSONB tag filtering 278 + result=$(run_query "SELECT COUNT(*) FROM \"quickdid.http.request.count\" WHERE tags->>'method' = 'GET';" | tr -d ' ') 279 + if [ "$result" -gt 0 ]; then 280 + echo "โœ… JSONB tag filtering works (found $result GET requests)" 281 + else 282 + echo "โŒ JSONB tag filtering failed" 283 + fi 284 + 285 + echo "" 286 + echo "Step 7: Testing TimescaleDB functions..." 287 + echo "=========================================" 288 + 289 + # Test time_bucket function 290 + result=$(run_query "SELECT COUNT(*) FROM (SELECT time_bucket('1 minute', time) FROM \"quickdid.http.request.count\" GROUP BY 1) t;" | tr -d ' ') 291 + if [ "$result" -gt 0 ]; then 292 + echo "โœ… time_bucket function works" 293 + else 294 + echo "โŒ time_bucket function failed" 295 + fi 296 + 297 + # Check if hypertables were created 298 + hypertable_count=$(run_query "SELECT COUNT(*) FROM timescaledb_information.hypertables WHERE hypertable_name LIKE 'quickdid%';" | tr -d ' ') 299 + if [ "$hypertable_count" -gt 0 ]; then 300 + echo "โœ… Found $hypertable_count hypertables" 301 + else 302 + echo "โŒ No hypertables found" 303 + fi 304 + 305 + echo "" 306 + echo "Step 8: Running comprehensive query tests..." 307 + echo "=========================================" 308 + 309 + # Run the verify-queries.sql script if it exists 310 + if [ -f "../test-scripts/verify-queries.sql" ]; then 311 + echo "Running verify-queries.sql..." 312 + docker exec -i timescaledb psql -U postgres -d metrics < ../test-scripts/verify-queries.sql > query_results.txt 2>&1 313 + if [ $? -eq 0 ]; then 314 + echo "โœ… All queries executed successfully" 315 + echo " Results saved to query_results.txt" 316 + else 317 + echo "โŒ Some queries failed. Check query_results.txt for details" 318 + fi 319 + else 320 + echo "โš ๏ธ verify-queries.sql not found, skipping comprehensive query tests" 321 + fi 322 + 323 + echo "" 324 + echo "=========================================" 325 + echo "Test Summary" 326 + echo "=========================================" 327 + 328 + # Generate summary 329 + failures=0 330 + successes=0 331 + 332 + # Count successes and failures from the output 333 + if check_table "quickdid.http.request.count" > /dev/null 2>&1; then 334 + successes=$((successes + 1)) 335 + else 336 + failures=$((failures + 1)) 337 + fi 338 + 339 + if [ "$hypertable_count" -gt 0 ]; then 340 + successes=$((successes + 1)) 341 + else 342 + failures=$((failures + 1)) 343 + fi 344 + 345 + echo "" 346 + if [ $failures -eq 0 ]; then 347 + echo "โœ… All tests passed successfully!" 348 + echo "" 349 + echo "You can now:" 350 + echo "1. Connect to the database: docker exec -it timescaledb psql -U postgres -d metrics" 351 + echo "2. View logs: docker-compose logs -f" 352 + echo "3. Send more metrics: echo 'metric.name:value|type|#tag:value' | nc -u -w0 localhost 8125" 353 + echo "4. Stop services: docker-compose down" 354 + else 355 + echo "โš ๏ธ Some tests failed. Please check the output above for details." 356 + echo "" 357 + echo "Troubleshooting tips:" 358 + echo "1. Check Telegraf logs: docker-compose logs telegraf" 359 + echo "2. Check TimescaleDB logs: docker-compose logs timescaledb" 360 + echo "3. Verify connectivity: docker exec telegraf telegraf --test" 361 + fi 362 + 363 + echo "" 364 + echo "Test complete!"
+44
test-scripts/send-metrics.sh
··· 1 + #!/bin/bash 2 + 3 + # Send test metrics to StatsD/Telegraf 4 + 5 + echo "Sending test metrics to StatsD on localhost:8125..." 6 + 7 + # Counter metrics 8 + for i in {1..10}; do 9 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 10 + echo "quickdid.http.request.count:1|c|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 11 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:404" | nc -u -w0 localhost 8125 12 + done 13 + 14 + # Gauge metrics 15 + echo "quickdid.resolver.rate_limit.available_permits:10|g" | nc -u -w0 localhost 8125 16 + echo "quickdid.resolver.rate_limit.available_permits:8|g" | nc -u -w0 localhost 8125 17 + echo "quickdid.resolver.rate_limit.available_permits:5|g" | nc -u -w0 localhost 8125 18 + 19 + # Timing metrics (in milliseconds) 20 + for i in {1..20}; do 21 + duration=$((RANDOM % 100 + 10)) 22 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 23 + done 24 + 25 + for i in {1..10}; do 26 + duration=$((RANDOM % 200 + 50)) 27 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 28 + done 29 + 30 + # Histogram metrics 31 + for i in {1..15}; do 32 + resolution_time=$((RANDOM % 500 + 50)) 33 + echo "quickdid.resolver.resolution_time:${resolution_time}|h|#resolver:redis" | nc -u -w0 localhost 8125 34 + echo "quickdid.resolver.resolution_time:$((resolution_time * 2))|h|#resolver:base" | nc -u -w0 localhost 8125 35 + done 36 + 37 + # Cache metrics 38 + echo "quickdid.cache.hit.count:45|c|#cache_type:redis" | nc -u -w0 localhost 8125 39 + echo "quickdid.cache.miss.count:5|c|#cache_type:redis" | nc -u -w0 localhost 8125 40 + echo "quickdid.cache.size:1024|g|#cache_type:memory" | nc -u -w0 localhost 8125 41 + 42 + echo "Metrics sent! Wait 15 seconds for Telegraf to flush..." 43 + sleep 15 44 + echo "Done!"
+145
test-scripts/verify-queries.sql
··· 1 + -- Test script to verify all metrics queries work correctly 2 + -- Run this after sending test metrics with send-metrics.sh 3 + 4 + \echo '===== CHECKING AVAILABLE TABLES =====' 5 + SELECT table_name 6 + FROM information_schema.tables 7 + WHERE table_schema = 'public' 8 + AND table_name LIKE 'quickdid%' 9 + ORDER BY table_name; 10 + 11 + \echo '' 12 + \echo '===== CHECKING TABLE STRUCTURES =====' 13 + \echo 'Structure of quickdid.http.request.count table:' 14 + \d "quickdid.http.request.count" 15 + 16 + \echo '' 17 + \echo 'Structure of quickdid.http.request.duration_ms table:' 18 + \d "quickdid.http.request.duration_ms" 19 + 20 + \echo '' 21 + \echo '===== QUERY 1: Recent HTTP Request Counts =====' 22 + SELECT 23 + time, 24 + tags, 25 + tags->>'method' as method, 26 + tags->>'path' as path, 27 + tags->>'status' as status, 28 + value 29 + FROM "quickdid.http.request.count" 30 + WHERE time > NOW() - INTERVAL '1 hour' 31 + ORDER BY time DESC 32 + LIMIT 10; 33 + 34 + \echo '' 35 + \echo '===== QUERY 2: HTTP Request Duration Statistics by Endpoint =====' 36 + SELECT 37 + time_bucket('1 minute', time) AS minute, 38 + tags->>'method' as method, 39 + tags->>'path' as path, 40 + tags->>'status' as status, 41 + COUNT(*) as request_count, 42 + AVG(mean) as avg_duration_ms, 43 + MAX(p99) as p99_duration_ms, 44 + MIN(mean) as min_duration_ms 45 + FROM "quickdid.http.request.duration_ms" 46 + WHERE time > NOW() - INTERVAL '1 hour' 47 + AND tags IS NOT NULL 48 + GROUP BY minute, tags->>'method', tags->>'path', tags->>'status' 49 + ORDER BY minute DESC 50 + LIMIT 10; 51 + 52 + \echo '' 53 + \echo '===== QUERY 3: Rate Limiter Status Over Time =====' 54 + SELECT 55 + time, 56 + value as available_permits 57 + FROM "quickdid.resolver.rate_limit.available_permits" 58 + WHERE time > NOW() - INTERVAL '1 hour' 59 + ORDER BY time DESC 60 + LIMIT 10; 61 + 62 + \echo '' 63 + \echo '===== QUERY 4: Resolver Performance Comparison =====' 64 + SELECT 65 + tags->>'resolver' as resolver_type, 66 + COUNT(*) as sample_count, 67 + AVG(mean) as avg_resolution_time_ms, 68 + MAX(p99) as p99_resolution_time_ms, 69 + MIN(mean) as min_resolution_time_ms 70 + FROM "quickdid.resolver.resolution_time" 71 + WHERE time > NOW() - INTERVAL '1 hour' 72 + AND tags->>'resolver' IS NOT NULL 73 + GROUP BY tags->>'resolver' 74 + ORDER BY avg_resolution_time_ms; 75 + 76 + \echo '' 77 + \echo '===== QUERY 5: Cache Hit Rate Analysis =====' 78 + WITH cache_stats AS ( 79 + SELECT 80 + 'hits' as metric_type, 81 + SUM(value) as total_count 82 + FROM "quickdid.cache.hit.count" 83 + WHERE time > NOW() - INTERVAL '1 hour' 84 + UNION ALL 85 + SELECT 86 + 'misses' as metric_type, 87 + SUM(value) as total_count 88 + FROM "quickdid.cache.miss.count" 89 + WHERE time > NOW() - INTERVAL '1 hour' 90 + ) 91 + SELECT 92 + SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) as total_hits, 93 + SUM(CASE WHEN metric_type = 'misses' THEN total_count ELSE 0 END) as total_misses, 94 + CASE 95 + WHEN SUM(total_count) > 0 THEN 96 + ROUND(100.0 * SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) / SUM(total_count), 2) 97 + ELSE 0 98 + END as hit_rate_percentage 99 + FROM cache_stats; 100 + 101 + \echo '' 102 + \echo '===== QUERY 6: Hypertable Information =====' 103 + SELECT 104 + hypertable_schema, 105 + hypertable_name, 106 + owner, 107 + num_dimensions, 108 + num_chunks, 109 + compression_enabled 110 + FROM timescaledb_information.hypertables 111 + WHERE hypertable_name LIKE 'quickdid%' 112 + ORDER BY hypertable_name; 113 + 114 + \echo '' 115 + \echo '===== QUERY 7: HTTP Error Rate by Endpoint =====' 116 + WITH status_counts AS ( 117 + SELECT 118 + time_bucket('5 minutes', time) as period, 119 + tags->>'path' as path, 120 + CASE 121 + WHEN (tags->>'status')::int >= 400 THEN 'error' 122 + ELSE 'success' 123 + END as status_category, 124 + SUM(value) as request_count 125 + FROM "quickdid.http.request.count" 126 + WHERE time > NOW() - INTERVAL '1 hour' 127 + GROUP BY period, path, status_category 128 + ) 129 + SELECT 130 + period, 131 + path, 132 + SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) as error_count, 133 + SUM(CASE WHEN status_category = 'success' THEN request_count ELSE 0 END) as success_count, 134 + CASE 135 + WHEN SUM(request_count) > 0 THEN 136 + ROUND(100.0 * SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) / SUM(request_count), 2) 137 + ELSE 0 138 + END as error_rate_percentage 139 + FROM status_counts 140 + GROUP BY period, path 141 + HAVING SUM(request_count) > 0 142 + ORDER BY period DESC, error_rate_percentage DESC; 143 + 144 + \echo '' 145 + \echo '===== TEST COMPLETED ====='
+1
www/.well-known/atproto-did
··· 1 + did:web:quickdid.smokesignal.tools
+15
www/.well-known/did.json
··· 1 + { 2 + "@context": [ 3 + "https://www.w3.org/ns/did/v1", 4 + "https://w3id.org/security/multikey/v1" 5 + ], 6 + "id": "did:web:quickdid.smokesignal.tools", 7 + "verificationMethod": [], 8 + "service": [ 9 + { 10 + "id": "#quickdid", 11 + "type": "QuickDIDService", 12 + "serviceEndpoint": "https://quickdid.smokesignal.tools" 13 + } 14 + ] 15 + }
+74
www/README.md
··· 1 + # QuickDID Static Files Directory 2 + 3 + This directory contains static files that are served by QuickDID. By default, QuickDID serves files from the `www` directory, but this can be configured using the `STATIC_FILES_DIR` environment variable. 4 + 5 + ## Directory Structure 6 + 7 + ``` 8 + www/ 9 + โ”œโ”€โ”€ .well-known/ 10 + โ”‚ โ”œโ”€โ”€ atproto-did # AT Protocol DID identifier 11 + โ”‚ โ””โ”€โ”€ did.json # DID document 12 + โ”œโ”€โ”€ index.html # Landing page 13 + โ””โ”€โ”€ README.md # This file 14 + ``` 15 + 16 + ## Files 17 + 18 + ### `.well-known/atproto-did` 19 + Contains the service's DID identifier (e.g., `did:web:example.com`). This file is used by AT Protocol clients to discover the service's DID. 20 + 21 + ### `.well-known/did.json` 22 + Contains the DID document with verification methods and service endpoints. This is a JSON-LD document following the W3C DID specification. 23 + 24 + ### `index.html` 25 + The landing page shown when users visit the root URL. This provides information about the service and available endpoints. 26 + 27 + ## Customization 28 + 29 + ### Using the Generation Script 30 + 31 + You can generate the `.well-known` files for your deployment using the provided script: 32 + 33 + ```bash 34 + HTTP_EXTERNAL=your-domain.com ./generate-wellknown.sh 35 + ``` 36 + 37 + This will create the appropriate files based on your domain. 38 + 39 + ### Manual Customization 40 + 41 + 1. **Update `.well-known/atproto-did`**: Replace with your service's DID 42 + 2. **Update `.well-known/did.json`**: Add your public key to the `verificationMethod` array if needed 43 + 3. **Customize `index.html`**: Modify the landing page to match your branding 44 + 45 + ### Docker Deployment 46 + 47 + When using Docker, you can mount custom static files: 48 + 49 + ```yaml 50 + volumes: 51 + - ./custom-www:/app/www:ro 52 + ``` 53 + 54 + Or just override specific files: 55 + 56 + ```yaml 57 + volumes: 58 + - ./custom-index.html:/app/www/index.html:ro 59 + - ./custom-wellknown:/app/www/.well-known:ro 60 + ``` 61 + 62 + ### Environment Variable 63 + 64 + You can change the static files directory using: 65 + 66 + ```bash 67 + STATIC_FILES_DIR=/path/to/custom/www 68 + ``` 69 + 70 + ## Security Notes 71 + 72 + - Static files are served with automatic MIME type detection 73 + - The `.well-known` files are crucial for AT Protocol compatibility 74 + - Ensure proper permissions on mounted volumes in production
+4
www/css/pico.classless.green.min.css
··· 1 + @charset "UTF-8";/*! 2 + * Pico CSS โœจ v2.1.1 (https://picocss.com) 3 + * Copyright 2019-2025 - Licensed under MIT 4 + */:host,:root{--pico-font-family-emoji:"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--pico-font-family-sans-serif:system-ui,"Segoe UI",Roboto,Oxygen,Ubuntu,Cantarell,Helvetica,Arial,"Helvetica Neue",sans-serif,var(--pico-font-family-emoji);--pico-font-family-monospace:ui-monospace,SFMono-Regular,"SF Mono",Menlo,Consolas,"Liberation Mono",monospace,var(--pico-font-family-emoji);--pico-font-family:var(--pico-font-family-sans-serif);--pico-line-height:1.5;--pico-font-weight:400;--pico-font-size:100%;--pico-text-underline-offset:0.1rem;--pico-border-radius:0.25rem;--pico-border-width:0.0625rem;--pico-outline-width:0.125rem;--pico-transition:0.2s ease-in-out;--pico-spacing:1rem;--pico-typography-spacing-vertical:1rem;--pico-block-spacing-vertical:var(--pico-spacing);--pico-block-spacing-horizontal:var(--pico-spacing);--pico-form-element-spacing-vertical:0.75rem;--pico-form-element-spacing-horizontal:1rem;--pico-group-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-primary-focus);--pico-group-box-shadow-focus-with-input:0 0 0 0.0625rem var(--pico-form-element-border-color);--pico-modal-overlay-backdrop-filter:blur(0.375rem);--pico-nav-element-spacing-vertical:1rem;--pico-nav-element-spacing-horizontal:0.5rem;--pico-nav-link-spacing-vertical:0.5rem;--pico-nav-link-spacing-horizontal:0.5rem;--pico-nav-breadcrumb-divider:">";--pico-icon-checkbox:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-minus:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='5' y1='12' x2='19' y2='12'%3E%3C/line%3E%3C/svg%3E");--pico-icon-chevron:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='6 9 12 15 18 9'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-date:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Crect x='3' y='4' width='18' height='18' rx='2' ry='2'%3E%3C/rect%3E%3Cline x1='16' y1='2' x2='16' y2='6'%3E%3C/line%3E%3Cline x1='8' y1='2' x2='8' y2='6'%3E%3C/line%3E%3Cline x1='3' y1='10' x2='21' y2='10'%3E%3C/line%3E%3C/svg%3E");--pico-icon-time:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cpolyline points='12 6 12 12 16 14'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-search:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='1.5' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E");--pico-icon-close:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");--pico-icon-loading:url("data:image/svg+xml,%3Csvg fill='none' height='24' width='24' viewBox='0 0 24 24' xmlns='http://www.w3.org/2000/svg' %3E%3Cstyle%3E g %7B animation: rotate 2s linear infinite; transform-origin: center center; %7D circle %7B stroke-dasharray: 75,100; stroke-dashoffset: -5; animation: dash 1.5s ease-in-out infinite; stroke-linecap: round; %7D @keyframes rotate %7B 0%25 %7B transform: rotate(0deg); %7D 100%25 %7B transform: rotate(360deg); %7D %7D @keyframes dash %7B 0%25 %7B stroke-dasharray: 1,100; stroke-dashoffset: 0; %7D 50%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -17.5; %7D 100%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -62; %7D %7D %3C/style%3E%3Cg%3E%3Ccircle cx='12' cy='12' r='10' fill='none' stroke='rgb(136, 145, 164)' stroke-width='4' /%3E%3C/g%3E%3C/svg%3E")}@media (min-width:576px){:host,:root{--pico-font-size:106.25%}}@media (min-width:768px){:host,:root{--pico-font-size:112.5%}}@media (min-width:1024px){:host,:root{--pico-font-size:118.75%}}@media (min-width:1280px){:host,:root{--pico-font-size:125%}}@media (min-width:1536px){:host,:root{--pico-font-size:131.25%}}a{--pico-text-decoration:underline}small{--pico-font-size:0.875em}h1,h2,h3,h4,h5,h6{--pico-font-weight:700}h1{--pico-font-size:2rem;--pico-line-height:1.125;--pico-typography-spacing-top:3rem}h2{--pico-font-size:1.75rem;--pico-line-height:1.15;--pico-typography-spacing-top:2.625rem}h3{--pico-font-size:1.5rem;--pico-line-height:1.175;--pico-typography-spacing-top:2.25rem}h4{--pico-font-size:1.25rem;--pico-line-height:1.2;--pico-typography-spacing-top:1.874rem}h5{--pico-font-size:1.125rem;--pico-line-height:1.225;--pico-typography-spacing-top:1.6875rem}h6{--pico-font-size:1rem;--pico-line-height:1.25;--pico-typography-spacing-top:1.5rem}tfoot td,tfoot th,thead td,thead th{--pico-font-weight:600;--pico-border-width:0.1875rem}code,kbd,pre,samp{--pico-font-family:var(--pico-font-family-monospace)}kbd{--pico-font-weight:bolder}:where(select,textarea),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-outline-width:0.0625rem}[type=search]{--pico-border-radius:5rem}[type=checkbox],[type=radio]{--pico-border-width:0.125rem}[type=checkbox][role=switch]{--pico-border-width:0.1875rem}[role=search]{--pico-border-radius:5rem}[role=group] [role=button],[role=group] [type=button],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=submit],[role=search] button{--pico-form-element-spacing-horizontal:2rem}details summary[role=button]::after{filter:brightness(0) invert(1)}[aria-busy=true]:not(input,select,textarea):is(button,[type=submit],[type=button],[type=reset],[role=button])::before{filter:brightness(0) invert(1)}:host(:not([data-theme=dark])),:root:not([data-theme=dark]),[data-theme=light]{color-scheme:light;--pico-background-color:#fff;--pico-color:#373c44;--pico-text-selection-color:rgba(71, 164, 23, 0.25);--pico-muted-color:#646b79;--pico-muted-border-color:rgb(231, 234, 239.5);--pico-primary:#33790f;--pico-primary-background:#398712;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(51, 121, 15, 0.5);--pico-primary-hover:#265e09;--pico-primary-hover-background:#33790f;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(71, 164, 23, 0.5);--pico-primary-inverse:#fff;--pico-secondary:#5d6b89;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(93, 107, 137, 0.5);--pico-secondary-hover:#48536b;--pico-secondary-hover-background:#48536b;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(93, 107, 137, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#181c25;--pico-contrast-background:#181c25;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(24, 28, 37, 0.5);--pico-contrast-hover:#000;--pico-contrast-hover-background:#000;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-secondary-hover);--pico-contrast-focus:rgba(93, 107, 137, 0.25);--pico-contrast-inverse:#fff;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(129, 145, 181, 0.01698),0.0335rem 0.067rem 0.402rem rgba(129, 145, 181, 0.024),0.0625rem 0.125rem 0.75rem rgba(129, 145, 181, 0.03),0.1125rem 0.225rem 1.35rem rgba(129, 145, 181, 0.036),0.2085rem 0.417rem 2.502rem rgba(129, 145, 181, 0.04302),0.5rem 1rem 6rem rgba(129, 145, 181, 0.06),0 0 0 0.0625rem rgba(129, 145, 181, 0.015);--pico-h1-color:#2d3138;--pico-h2-color:#373c44;--pico-h3-color:#424751;--pico-h4-color:#4d535e;--pico-h5-color:#5c6370;--pico-h6-color:#646b79;--pico-mark-background-color:rgb(252.5, 230.5, 191.5);--pico-mark-color:#0f1114;--pico-ins-color:rgb(28.5, 105.5, 84);--pico-del-color:rgb(136, 56.5, 53);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(243, 244.5, 246.75);--pico-code-color:#646b79;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(251, 251.5, 252.25);--pico-form-element-selected-background-color:#dfe3eb;--pico-form-element-border-color:#cfd5e2;--pico-form-element-color:#23262c;--pico-form-element-placeholder-color:var(--pico-muted-color);--pico-form-element-active-background-color:#fff;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(183.5, 105.5, 106.5);--pico-form-element-invalid-active-border-color:rgb(200.25, 79.25, 72.25);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:rgb(76, 154.5, 137.5);--pico-form-element-valid-active-border-color:rgb(39, 152.75, 118.75);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#bfc7d9;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#dfe3eb;--pico-range-active-border-color:#bfc7d9;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:var(--pico-background-color);--pico-card-border-color:var(--pico-muted-border-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(251, 251.5, 252.25);--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(232, 234, 237, 0.75);--pico-progress-background-color:#dfe3eb;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(76, 154.5, 137.5)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(200.25, 79.25, 72.25)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme=dark])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme=dark]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),[data-theme=light] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}@media only screen and (prefers-color-scheme:dark){:host(:not([data-theme])),:root:not([data-theme]){color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(78, 179, 27, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#4eb31b;--pico-primary-background:#398712;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(78, 179, 27, 0.5);--pico-primary-hover:#5dd121;--pico-primary-hover-background:#409614;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(78, 179, 27, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}}[data-theme=dark]{color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(78, 179, 27, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#4eb31b;--pico-primary-background:#398712;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(78, 179, 27, 0.5);--pico-primary-hover:#5dd121;--pico-primary-hover-background:#409614;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(78, 179, 27, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}[data-theme=dark] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}[type=checkbox],[type=radio],[type=range],progress{accent-color:var(--pico-primary)}*,::after,::before{box-sizing:border-box;background-repeat:no-repeat}::after,::before{text-decoration:inherit;vertical-align:inherit}:where(:host),:where(:root){-webkit-tap-highlight-color:transparent;-webkit-text-size-adjust:100%;-moz-text-size-adjust:100%;text-size-adjust:100%;background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family);text-underline-offset:var(--pico-text-underline-offset);text-rendering:optimizeLegibility;overflow-wrap:break-word;-moz-tab-size:4;-o-tab-size:4;tab-size:4}body{width:100%;margin:0}main{display:block}body>footer,body>header,body>main{width:100%;margin-right:auto;margin-left:auto;padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal)}@media (min-width:576px){body>footer,body>header,body>main{max-width:510px;padding-right:0;padding-left:0}}@media (min-width:768px){body>footer,body>header,body>main{max-width:700px}}@media (min-width:1024px){body>footer,body>header,body>main{max-width:950px}}@media (min-width:1280px){body>footer,body>header,body>main{max-width:1200px}}@media (min-width:1536px){body>footer,body>header,body>main{max-width:1450px}}section{margin-bottom:var(--pico-block-spacing-vertical)}b,strong{font-weight:bolder}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}address,blockquote,dl,ol,p,pre,table,ul{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-style:normal;font-weight:var(--pico-font-weight)}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family)}h1{--pico-color:var(--pico-h1-color)}h2{--pico-color:var(--pico-h2-color)}h3{--pico-color:var(--pico-h3-color)}h4{--pico-color:var(--pico-h4-color)}h5{--pico-color:var(--pico-h5-color)}h6{--pico-color:var(--pico-h6-color)}:where(article,address,blockquote,dl,figure,form,ol,p,pre,table,ul)~:is(h1,h2,h3,h4,h5,h6){margin-top:var(--pico-typography-spacing-top)}p{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup>*{margin-top:0;margin-bottom:0}hgroup>:not(:first-child):last-child{--pico-color:var(--pico-muted-color);--pico-font-weight:unset;font-size:1rem}:where(ol,ul) li{margin-bottom:calc(var(--pico-typography-spacing-vertical) * .25)}:where(dl,ol,ul) :where(dl,ol,ul){margin:0;margin-top:calc(var(--pico-typography-spacing-vertical) * .25)}ul li{list-style:square}mark{padding:.125rem .25rem;background-color:var(--pico-mark-background-color);color:var(--pico-mark-color);vertical-align:baseline}blockquote{display:block;margin:var(--pico-typography-spacing-vertical) 0;padding:var(--pico-spacing);border-right:none;border-left:.25rem solid var(--pico-blockquote-border-color);border-inline-start:0.25rem solid var(--pico-blockquote-border-color);border-inline-end:none}blockquote footer{margin-top:calc(var(--pico-typography-spacing-vertical) * .5);color:var(--pico-blockquote-footer-color)}abbr[title]{border-bottom:1px dotted;text-decoration:none;cursor:help}ins{color:var(--pico-ins-color);text-decoration:none}del{color:var(--pico-del-color)}::-moz-selection{background-color:var(--pico-text-selection-color)}::selection{background-color:var(--pico-text-selection-color)}:where(a:not([role=button])),[role=link]{--pico-color:var(--pico-primary);--pico-background-color:transparent;--pico-underline:var(--pico-primary-underline);outline:0;background-color:var(--pico-background-color);color:var(--pico-color);-webkit-text-decoration:var(--pico-text-decoration);text-decoration:var(--pico-text-decoration);text-decoration-color:var(--pico-underline);text-underline-offset:0.125em;transition:background-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition)}:where(a:not([role=button])):is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-primary-hover);--pico-underline:var(--pico-primary-hover-underline);--pico-text-decoration:underline}:where(a:not([role=button])):focus-visible,[role=link]:focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}a[role=button]{display:inline-block}button{margin:0;overflow:visible;font-family:inherit;text-transform:none}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[role=button],[type=button],[type=file]::file-selector-button,[type=reset],[type=submit],button{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);--pico-color:var(--pico-primary-inverse);--pico-box-shadow:var(--pico-button-box-shadow, 0 0 0 rgba(0, 0, 0, 0));padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:1rem;line-height:var(--pico-line-height);text-align:center;text-decoration:none;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}[role=button]:is(:hover,:active,:focus),[role=button]:is([aria-current]:not([aria-current=false])),[type=button]:is(:hover,:active,:focus),[type=button]:is([aria-current]:not([aria-current=false])),[type=file]::file-selector-button:is(:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])),[type=reset]:is(:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false])),[type=submit]:is(:hover,:active,:focus),[type=submit]:is([aria-current]:not([aria-current=false])),button:is(:hover,:active,:focus),button:is([aria-current]:not([aria-current=false])){--pico-background-color:var(--pico-primary-hover-background);--pico-border-color:var(--pico-primary-hover-border);--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0));--pico-color:var(--pico-primary-inverse)}[role=button]:focus,[role=button]:is([aria-current]:not([aria-current=false])):focus,[type=button]:focus,[type=button]:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus,[type=submit]:focus,[type=submit]:is([aria-current]:not([aria-current=false])):focus,button:focus,button:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}[type=button],[type=reset],[type=submit]{margin-bottom:var(--pico-spacing)}[type=file]::file-selector-button,[type=reset]{--pico-background-color:var(--pico-secondary-background);--pico-border-color:var(--pico-secondary-border);--pico-color:var(--pico-secondary-inverse);cursor:pointer}[type=file]::file-selector-button:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border);--pico-color:var(--pico-secondary-inverse)}[type=file]::file-selector-button:focus,[type=reset]:focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}:where(button,[type=submit],[type=reset],[type=button],[role=button])[disabled],:where(fieldset[disabled]) :is(button,[type=submit],[type=button],[type=reset],[role=button]){opacity:.5;pointer-events:none}:where(table){width:100%;border-collapse:collapse;border-spacing:0;text-indent:0}td,th{padding:calc(var(--pico-spacing)/ 2) var(--pico-spacing);border-bottom:var(--pico-border-width) solid var(--pico-table-border-color);background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);text-align:left;text-align:start}tfoot td,tfoot th{border-top:var(--pico-border-width) solid var(--pico-table-border-color);border-bottom:0}table.striped tbody tr:nth-child(odd) td,table.striped tbody tr:nth-child(odd) th{background-color:var(--pico-table-row-stripped-background-color)}:where(audio,canvas,iframe,img,svg,video){vertical-align:middle}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}:where(iframe){border-style:none}img{max-width:100%;height:auto;border-style:none}:where(svg:not([fill])){fill:currentColor}svg:not(:host),svg:not(:root){overflow:hidden}code,kbd,pre,samp{font-size:.875em;font-family:var(--pico-font-family)}pre code,pre samp{font-size:inherit;font-family:inherit}pre{-ms-overflow-style:scrollbar;overflow:auto}code,kbd,pre,samp{border-radius:var(--pico-border-radius);background:var(--pico-code-background-color);color:var(--pico-code-color);font-weight:var(--pico-font-weight);line-height:initial}code,kbd,samp{display:inline-block;padding:.375rem}pre{display:block;margin-bottom:var(--pico-spacing);overflow-x:auto}pre>code,pre>samp{display:block;padding:var(--pico-spacing);background:0 0;line-height:var(--pico-line-height)}kbd{background-color:var(--pico-code-kbd-background-color);color:var(--pico-code-kbd-color);vertical-align:baseline}figure{display:block;margin:0;padding:0}figure figcaption{padding:calc(var(--pico-spacing) * .5) 0;color:var(--pico-muted-color)}hr{height:0;margin:var(--pico-typography-spacing-vertical) 0;border:0;border-top:1px solid var(--pico-muted-border-color);color:inherit}[hidden],template{display:none!important}canvas{display:inline-block}input,optgroup,select,textarea{margin:0;font-size:1rem;line-height:var(--pico-line-height);font-family:inherit;letter-spacing:inherit}input{overflow:visible}select{text-transform:none}legend{max-width:100%;padding:0;color:inherit;white-space:normal}textarea{overflow:auto}[type=checkbox],[type=radio]{padding:0}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}::-moz-focus-inner{padding:0;border-style:none}:-moz-focusring{outline:0}:-moz-ui-invalid{box-shadow:none}::-ms-expand{display:none}[type=file],[type=range]{padding:0;border-width:0}input:not([type=checkbox],[type=radio],[type=range]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2)}fieldset{width:100%;margin:0;margin-bottom:var(--pico-spacing);padding:0;border:0}fieldset legend,label{display:block;margin-bottom:calc(var(--pico-spacing) * .375);color:var(--pico-color);font-weight:var(--pico-form-label-font-weight,var(--pico-font-weight))}fieldset legend{margin-bottom:calc(var(--pico-spacing) * .5)}button[type=submit],input:not([type=checkbox],[type=radio]),select,textarea{width:100%}input:not([type=checkbox],[type=radio],[type=range],[type=file]),select,textarea{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal)}input,select,textarea{--pico-background-color:var(--pico-form-element-background-color);--pico-border-color:var(--pico-form-element-border-color);--pico-color:var(--pico-form-element-color);--pico-box-shadow:none;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[readonly]):is(:active,:focus){--pico-background-color:var(--pico-form-element-active-background-color)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[role=switch],[readonly]):is(:active,:focus){--pico-border-color:var(--pico-form-element-active-border-color)}:where(select,textarea):not([readonly]):focus,input:not([type=submit],[type=button],[type=reset],[type=range],[type=file],[readonly]):focus{--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}:where(fieldset[disabled]) :is(input:not([type=submit],[type=button],[type=reset]),select,textarea),input:not([type=submit],[type=button],[type=reset])[disabled],label[aria-disabled=true],select[disabled],textarea[disabled]{opacity:var(--pico-form-element-disabled-opacity);pointer-events:none}label[aria-disabled=true] input[disabled]{opacity:1}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid]{padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal)!important;padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=false]:not(select){background-image:var(--pico-icon-valid)}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=true]:not(select){background-image:var(--pico-icon-invalid)}:where(input,select,textarea)[aria-invalid=false]{--pico-border-color:var(--pico-form-element-valid-border-color)}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus){--pico-border-color:var(--pico-form-element-valid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-valid-focus-color)!important}:where(input,select,textarea)[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus){--pico-border-color:var(--pico-form-element-invalid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-invalid-focus-color)!important}[dir=rtl] :where(input,select,textarea):not([type=checkbox],[type=radio]):is([aria-invalid],[aria-invalid=true],[aria-invalid=false]){background-position:center left .75rem}input::-webkit-input-placeholder,input::placeholder,select:invalid,textarea::-webkit-input-placeholder,textarea::placeholder{color:var(--pico-form-element-placeholder-color);opacity:1}input:not([type=checkbox],[type=radio]),select,textarea{margin-bottom:var(--pico-spacing)}select::-ms-expand{border:0;background-color:transparent}select:not([multiple],[size]){padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal);padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);background-image:var(--pico-icon-chevron);background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}select[multiple] option:checked{background:var(--pico-form-element-selected-background-color);color:var(--pico-form-element-color)}[dir=rtl] select:not([multiple],[size]){background-position:center left .75rem}textarea{display:block;resize:vertical}textarea[aria-invalid]{--pico-icon-height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);background-position:top right .75rem!important;background-size:1rem var(--pico-icon-height)!important}:where(input,select,textarea,fieldset)+small{display:block;width:100%;margin-top:calc(var(--pico-spacing) * -.75);margin-bottom:var(--pico-spacing);color:var(--pico-muted-color)}:where(input,select,textarea,fieldset)[aria-invalid=false]+small{color:var(--pico-ins-color)}:where(input,select,textarea,fieldset)[aria-invalid=true]+small{color:var(--pico-del-color)}label>:where(input,select,textarea){margin-top:calc(var(--pico-spacing) * .25)}label:has([type=checkbox],[type=radio]){width:-moz-fit-content;width:fit-content;cursor:pointer}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:1.25em;height:1.25em;margin-top:-.125em;margin-inline-end:.5em;border-width:var(--pico-border-width);vertical-align:middle;cursor:pointer}[type=checkbox]::-ms-check,[type=radio]::-ms-check{display:none}[type=checkbox]:checked,[type=checkbox]:checked:active,[type=checkbox]:checked:focus,[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-checkbox);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=checkbox]~label,[type=radio]~label{display:inline-block;margin-bottom:0;cursor:pointer}[type=checkbox]~label:not(:last-of-type),[type=radio]~label:not(:last-of-type){margin-inline-end:1em}[type=checkbox]:indeterminate{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-minus);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=radio]{border-radius:50%}[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-inverse);border-width:.35em;background-image:none}[type=checkbox][role=switch]{--pico-background-color:var(--pico-switch-background-color);--pico-color:var(--pico-switch-color);width:2.25em;height:1.25em;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:1.25em;background-color:var(--pico-background-color);line-height:1.25em}[type=checkbox][role=switch]:not([aria-invalid]){--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:before{display:block;aspect-ratio:1;height:100%;border-radius:50%;background-color:var(--pico-color);box-shadow:var(--pico-switch-thumb-box-shadow);content:"";transition:margin .1s ease-in-out}[type=checkbox][role=switch]:focus{--pico-background-color:var(--pico-switch-background-color);--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:checked{--pico-background-color:var(--pico-switch-checked-background-color);--pico-border-color:var(--pico-switch-checked-background-color);background-image:none}[type=checkbox][role=switch]:checked::before{margin-inline-start:calc(2.25em - 1.25em)}[type=checkbox][role=switch][disabled]{--pico-background-color:var(--pico-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus{--pico-background-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true]{--pico-background-color:var(--pico-form-element-invalid-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus,[type=radio][aria-invalid=false]:checked,[type=radio][aria-invalid=false]:checked:active,[type=radio][aria-invalid=false]:checked:focus{--pico-border-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true],[type=radio]:checked:active[aria-invalid=true],[type=radio]:checked:focus[aria-invalid=true],[type=radio]:checked[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}[type=color]::-webkit-color-swatch-wrapper{padding:0}[type=color]::-moz-focus-inner{padding:0}[type=color]::-webkit-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}[type=color]::-moz-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}input:not([type=checkbox],[type=radio],[type=range],[type=file]):is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){--pico-icon-position:0.75rem;--pico-icon-width:1rem;padding-right:calc(var(--pico-icon-width) + var(--pico-icon-position));background-image:var(--pico-icon-date);background-position:center right var(--pico-icon-position);background-size:var(--pico-icon-width) auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=time]{background-image:var(--pico-icon-time)}[type=date]::-webkit-calendar-picker-indicator,[type=datetime-local]::-webkit-calendar-picker-indicator,[type=month]::-webkit-calendar-picker-indicator,[type=time]::-webkit-calendar-picker-indicator,[type=week]::-webkit-calendar-picker-indicator{width:var(--pico-icon-width);margin-right:calc(var(--pico-icon-width) * -1);margin-left:var(--pico-icon-position);opacity:0}@-moz-document url-prefix(){[type=date],[type=datetime-local],[type=month],[type=time],[type=week]{padding-right:var(--pico-form-element-spacing-horizontal)!important;background-image:none!important}}[dir=rtl] :is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){text-align:right}[type=file]{--pico-color:var(--pico-muted-color);margin-left:calc(var(--pico-outline-width) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) 0;padding-left:var(--pico-outline-width);border:0;border-radius:0;background:0 0}[type=file]::file-selector-button{margin-right:calc(var(--pico-spacing)/ 2);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal)}[type=file]:is(:hover,:active,:focus)::file-selector-button{--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border)}[type=file]:focus::file-selector-button{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[type=range]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:100%;height:1.25rem;background:0 0}[type=range]::-webkit-slider-runnable-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-webkit-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-moz-range-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-moz-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-ms-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-ms-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-webkit-slider-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-webkit-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-moz-range-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-moz-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-ms-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-ms-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]:active,[type=range]:focus-within{--pico-range-border-color:var(--pico-range-active-border-color);--pico-range-thumb-color:var(--pico-range-thumb-active-color)}[type=range]:active::-webkit-slider-thumb{transform:scale(1.25)}[type=range]:active::-moz-range-thumb{transform:scale(1.25)}[type=range]:active::-ms-thumb{transform:scale(1.25)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem);background-image:var(--pico-icon-search);background-position:center left calc(var(--pico-form-element-spacing-horizontal) + .125rem);background-size:1rem auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem)!important;background-position:center left 1.125rem,center right .75rem}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=false]{background-image:var(--pico-icon-search),var(--pico-icon-valid)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=true]{background-image:var(--pico-icon-search),var(--pico-icon-invalid)}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{background-position:center right 1.125rem}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{background-position:center right 1.125rem,center left .75rem}details{display:block;margin-bottom:var(--pico-spacing)}details summary{line-height:1rem;list-style-type:none;cursor:pointer;transition:color var(--pico-transition)}details summary:not([role]){color:var(--pico-accordion-close-summary-color)}details summary::-webkit-details-marker{display:none}details summary::marker{display:none}details summary::-moz-list-bullet{list-style-type:none}details summary::after{display:block;width:1rem;height:1rem;margin-inline-start:calc(var(--pico-spacing,1rem) * .5);float:right;transform:rotate(-90deg);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:"";transition:transform var(--pico-transition)}details summary:focus{outline:0}details summary:focus:not([role]){color:var(--pico-accordion-active-summary-color)}details summary:focus-visible:not([role]){outline:var(--pico-outline-width) solid var(--pico-primary-focus);outline-offset:calc(var(--pico-spacing,1rem) * 0.5);color:var(--pico-primary)}details summary[role=button]{width:100%;text-align:left}details summary[role=button]::after{height:calc(1rem * var(--pico-line-height,1.5))}details[open]>summary{margin-bottom:var(--pico-spacing)}details[open]>summary:not([role]):not(:focus){color:var(--pico-accordion-open-summary-color)}details[open]>summary::after{transform:rotate(0)}[dir=rtl] details summary{text-align:right}[dir=rtl] details summary::after{float:left;background-position:left center}article{margin-bottom:var(--pico-block-spacing-vertical);padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal);border-radius:var(--pico-border-radius);background:var(--pico-card-background-color);box-shadow:var(--pico-card-box-shadow)}article>footer,article>header{margin-right:calc(var(--pico-block-spacing-horizontal) * -1);margin-left:calc(var(--pico-block-spacing-horizontal) * -1);padding:calc(var(--pico-block-spacing-vertical) * .66) var(--pico-block-spacing-horizontal);background-color:var(--pico-card-sectioning-background-color)}article>header{margin-top:calc(var(--pico-block-spacing-vertical) * -1);margin-bottom:var(--pico-block-spacing-vertical);border-bottom:var(--pico-border-width) solid var(--pico-card-border-color);border-top-right-radius:var(--pico-border-radius);border-top-left-radius:var(--pico-border-radius)}article>footer{margin-top:var(--pico-block-spacing-vertical);margin-bottom:calc(var(--pico-block-spacing-vertical) * -1);border-top:var(--pico-border-width) solid var(--pico-card-border-color);border-bottom-right-radius:var(--pico-border-radius);border-bottom-left-radius:var(--pico-border-radius)}[role=group],[role=search]{display:inline-flex;position:relative;width:100%;margin-bottom:var(--pico-spacing);border-radius:var(--pico-border-radius);box-shadow:var(--pico-group-box-shadow,0 0 0 transparent);vertical-align:middle;transition:box-shadow var(--pico-transition)}[role=group] input:not([type=checkbox],[type=radio]),[role=group] select,[role=group]>*,[role=search] input:not([type=checkbox],[type=radio]),[role=search] select,[role=search]>*{position:relative;flex:1 1 auto;margin-bottom:0}[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=group]>:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child),[role=search]>:not(:first-child){margin-left:0;border-top-left-radius:0;border-bottom-left-radius:0}[role=group] input:not([type=checkbox],[type=radio]):not(:last-child),[role=group] select:not(:last-child),[role=group]>:not(:last-child),[role=search] input:not([type=checkbox],[type=radio]):not(:last-child),[role=search] select:not(:last-child),[role=search]>:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}[role=group] input:not([type=checkbox],[type=radio]):focus,[role=group] select:focus,[role=group]>:focus,[role=search] input:not([type=checkbox],[type=radio]):focus,[role=search] select:focus,[role=search]>:focus{z-index:2}[role=group] [role=button]:not(:first-child),[role=group] [type=button]:not(:first-child),[role=group] [type=reset]:not(:first-child),[role=group] [type=submit]:not(:first-child),[role=group] button:not(:first-child),[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=search] [role=button]:not(:first-child),[role=search] [type=button]:not(:first-child),[role=search] [type=reset]:not(:first-child),[role=search] [type=submit]:not(:first-child),[role=search] button:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child){margin-left:calc(var(--pico-border-width) * -1)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=reset],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=reset],[role=search] [type=submit],[role=search] button{width:auto}@supports selector(:has(*)){[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-button)}[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select,[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select{border-color:transparent}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus),[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-input)}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) button,[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) button{--pico-button-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-border);--pico-button-hover-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-hover-border)}[role=group] [role=button]:focus,[role=group] [type=button]:focus,[role=group] [type=reset]:focus,[role=group] [type=submit]:focus,[role=group] button:focus,[role=search] [role=button]:focus,[role=search] [type=button]:focus,[role=search] [type=reset]:focus,[role=search] [type=submit]:focus,[role=search] button:focus{box-shadow:none}}[role=search]>:first-child{border-top-left-radius:5rem;border-bottom-left-radius:5rem}[role=search]>:last-child{border-top-right-radius:5rem;border-bottom-right-radius:5rem}[aria-busy=true]:not(input,select,textarea,html,form){white-space:nowrap}[aria-busy=true]:not(input,select,textarea,html,form)::before{display:inline-block;width:1em;height:1em;background-image:var(--pico-icon-loading);background-size:1em auto;background-repeat:no-repeat;content:"";vertical-align:-.125em}[aria-busy=true]:not(input,select,textarea,html,form):not(:empty)::before{margin-inline-end:calc(var(--pico-spacing) * .5)}[aria-busy=true]:not(input,select,textarea,html,form):empty{text-align:center}[role=button][aria-busy=true],[type=button][aria-busy=true],[type=reset][aria-busy=true],[type=submit][aria-busy=true],a[aria-busy=true],button[aria-busy=true]{pointer-events:none}:host,:root{--pico-scrollbar-width:0px}dialog{display:flex;z-index:999;position:fixed;top:0;right:0;bottom:0;left:0;align-items:center;justify-content:center;width:inherit;min-width:100%;height:inherit;min-height:100%;padding:0;border:0;-webkit-backdrop-filter:var(--pico-modal-overlay-backdrop-filter);backdrop-filter:var(--pico-modal-overlay-backdrop-filter);background-color:var(--pico-modal-overlay-background-color);color:var(--pico-color)}dialog>article{width:100%;max-height:calc(100vh - var(--pico-spacing) * 2);margin:var(--pico-spacing);overflow:auto}@media (min-width:576px){dialog>article{max-width:510px}}@media (min-width:768px){dialog>article{max-width:700px}}dialog>article>header>*{margin-bottom:0}dialog>article>header :is(a,button)[rel=prev]{margin:0;margin-left:var(--pico-spacing);padding:0;float:right}dialog>article>footer{text-align:right}dialog>article>footer [role=button],dialog>article>footer button{margin-bottom:0}dialog>article>footer [role=button]:not(:first-of-type),dialog>article>footer button:not(:first-of-type){margin-left:calc(var(--pico-spacing) * .5)}dialog>article :is(a,button)[rel=prev]{display:block;width:1rem;height:1rem;margin-top:calc(var(--pico-spacing) * -1);margin-bottom:var(--pico-spacing);margin-left:auto;border:none;background-image:var(--pico-icon-close);background-position:center;background-size:auto 1rem;background-repeat:no-repeat;background-color:transparent;opacity:.5;transition:opacity var(--pico-transition)}dialog>article :is(a,button)[rel=prev]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){opacity:1}dialog:not([open]),dialog[open=false]{display:none}:where(nav li)::before{float:left;content:"โ€‹"}nav,nav ul{display:flex}nav{justify-content:space-between;overflow:visible}nav ol,nav ul{align-items:center;margin-bottom:0;padding:0;list-style:none}nav ol:first-of-type,nav ul:first-of-type{margin-left:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav ol:last-of-type,nav ul:last-of-type{margin-right:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav li{display:inline-block;margin:0;padding:var(--pico-nav-element-spacing-vertical) var(--pico-nav-element-spacing-horizontal)}nav li :where(a,[role=link]){display:inline-block;margin:calc(var(--pico-nav-link-spacing-vertical) * -1) calc(var(--pico-nav-link-spacing-horizontal) * -1);padding:var(--pico-nav-link-spacing-vertical) var(--pico-nav-link-spacing-horizontal);border-radius:var(--pico-border-radius)}nav li :where(a,[role=link]):not(:hover){text-decoration:none}nav li [role=button],nav li [type=button],nav li button,nav li input:not([type=checkbox],[type=radio],[type=range],[type=file]),nav li select{height:auto;margin-right:inherit;margin-bottom:0;margin-left:inherit;padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb]{align-items:center;justify-content:start}nav[aria-label=breadcrumb] ul li:not(:first-child){margin-inline-start:var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb] ul li a{margin:calc(var(--pico-nav-link-spacing-vertical) * -1) 0;margin-inline-start:calc(var(--pico-nav-link-spacing-horizontal) * -1)}nav[aria-label=breadcrumb] ul li:not(:last-child)::after{display:inline-block;position:absolute;width:calc(var(--pico-nav-link-spacing-horizontal) * 4);margin:0 calc(var(--pico-nav-link-spacing-horizontal) * -1);content:var(--pico-nav-breadcrumb-divider);color:var(--pico-muted-color);text-align:center;text-decoration:none;white-space:nowrap}nav[aria-label=breadcrumb] a[aria-current]:not([aria-current=false]){background-color:transparent;color:inherit;text-decoration:none;pointer-events:none}aside li,aside nav,aside ol,aside ul{display:block}aside li{padding:calc(var(--pico-nav-element-spacing-vertical) * .5) var(--pico-nav-element-spacing-horizontal)}aside li a{display:block}aside li [role=button]{margin:inherit}[dir=rtl] nav[aria-label=breadcrumb] ul li:not(:last-child) ::after{content:"\\"}progress{display:inline-block;vertical-align:baseline}progress{-webkit-appearance:none;-moz-appearance:none;display:inline-block;appearance:none;width:100%;height:.5rem;margin-bottom:calc(var(--pico-spacing) * .5);overflow:hidden;border:0;border-radius:var(--pico-border-radius);background-color:var(--pico-progress-background-color);color:var(--pico-progress-color)}progress::-webkit-progress-bar{border-radius:var(--pico-border-radius);background:0 0}progress[value]::-webkit-progress-value{background-color:var(--pico-progress-color);-webkit-transition:inline-size var(--pico-transition);transition:inline-size var(--pico-transition)}progress::-moz-progress-bar{background-color:var(--pico-progress-color)}@media (prefers-reduced-motion:no-preference){progress:indeterminate{background:var(--pico-progress-background-color) linear-gradient(to right,var(--pico-progress-color) 30%,var(--pico-progress-background-color) 30%) top left/150% 150% no-repeat;animation:progress-indeterminate 1s linear infinite}progress:indeterminate[value]::-webkit-progress-value{background-color:transparent}progress:indeterminate::-moz-progress-bar{background-color:transparent}}@media (prefers-reduced-motion:no-preference){[dir=rtl] progress:indeterminate{animation-direction:reverse}}@keyframes progress-indeterminate{0%{background-position:200% 0}100%{background-position:-200% 0}}[data-tooltip]{position:relative}[data-tooltip]:not(a,button,input,[role=button]){border-bottom:1px dotted;text-decoration:none;cursor:help}[data-tooltip]::after,[data-tooltip]::before,[data-tooltip][data-placement=top]::after,[data-tooltip][data-placement=top]::before{display:block;z-index:99;position:absolute;bottom:100%;left:50%;padding:.25rem .5rem;overflow:hidden;transform:translate(-50%,-.25rem);border-radius:var(--pico-border-radius);background:var(--pico-tooltip-background-color);content:attr(data-tooltip);color:var(--pico-tooltip-color);font-style:normal;font-weight:var(--pico-font-weight);font-size:.875rem;text-decoration:none;text-overflow:ellipsis;white-space:nowrap;opacity:0;pointer-events:none}[data-tooltip]::after,[data-tooltip][data-placement=top]::after{padding:0;transform:translate(-50%,0);border-top:.3rem solid;border-right:.3rem solid transparent;border-left:.3rem solid transparent;border-radius:0;background-color:transparent;content:"";color:var(--pico-tooltip-background-color)}[data-tooltip][data-placement=bottom]::after,[data-tooltip][data-placement=bottom]::before{top:100%;bottom:auto;transform:translate(-50%,.25rem)}[data-tooltip][data-placement=bottom]:after{transform:translate(-50%,-.3rem);border:.3rem solid transparent;border-bottom:.3rem solid}[data-tooltip][data-placement=left]::after,[data-tooltip][data-placement=left]::before{top:50%;right:100%;bottom:auto;left:auto;transform:translate(-.25rem,-50%)}[data-tooltip][data-placement=left]:after{transform:translate(.3rem,-50%);border:.3rem solid transparent;border-left:.3rem solid}[data-tooltip][data-placement=right]::after,[data-tooltip][data-placement=right]::before{top:50%;right:auto;bottom:auto;left:100%;transform:translate(.25rem,-50%)}[data-tooltip][data-placement=right]:after{transform:translate(-.3rem,-50%);border:.3rem solid transparent;border-right:.3rem solid}[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{opacity:1}@media (hover:hover) and (pointer:fine){[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{--pico-tooltip-slide-to:translate(-50%, -0.25rem);transform:translate(-50%,.75rem);animation-duration:.2s;animation-fill-mode:forwards;animation-name:tooltip-slide;opacity:0}[data-tooltip]:focus::after,[data-tooltip]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, 0rem);transform:translate(-50%,-.25rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:focus::before,[data-tooltip][data-placement=bottom]:hover::after,[data-tooltip][data-placement=bottom]:hover::before{--pico-tooltip-slide-to:translate(-50%, 0.25rem);transform:translate(-50%,-.75rem);animation-name:tooltip-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, -0.3rem);transform:translate(-50%,-.5rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:focus::before,[data-tooltip][data-placement=left]:hover::after,[data-tooltip][data-placement=left]:hover::before{--pico-tooltip-slide-to:translate(-0.25rem, -50%);transform:translate(.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:hover::after{--pico-tooltip-caret-slide-to:translate(0.3rem, -50%);transform:translate(.05rem,-50%);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:focus::before,[data-tooltip][data-placement=right]:hover::after,[data-tooltip][data-placement=right]:hover::before{--pico-tooltip-slide-to:translate(0.25rem, -50%);transform:translate(-.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:hover::after{--pico-tooltip-caret-slide-to:translate(-0.3rem, -50%);transform:translate(-.05rem,-50%);animation-name:tooltip-caret-slide}}@keyframes tooltip-slide{to{transform:var(--pico-tooltip-slide-to);opacity:1}}@keyframes tooltip-caret-slide{50%{opacity:0}to{transform:var(--pico-tooltip-caret-slide-to);opacity:1}}[aria-controls]{cursor:pointer}[aria-disabled=true],[disabled]{cursor:not-allowed}[aria-hidden=false][hidden]{display:initial}[aria-hidden=false][hidden]:not(:focus){clip:rect(0,0,0,0);position:absolute}[tabindex],a,area,button,input,label,select,summary,textarea{-ms-touch-action:manipulation}[dir=rtl]{direction:rtl}@media (prefers-reduced-motion:reduce){:not([aria-busy=true]),:not([aria-busy=true])::after,:not([aria-busy=true])::before{background-attachment:initial!important;animation-duration:1ms!important;animation-delay:-1ms!important;animation-iteration-count:1!important;scroll-behavior:auto!important;transition-delay:0s!important;transition-duration:0s!important}}
+224
www/index.html
··· 1 + <!doctype html> 2 + <html lang="en"> 3 + 4 + <head> 5 + <meta charset="utf-8"> 6 + <meta name="viewport" content="width=device-width, initial-scale=1"> 7 + <meta name="color-scheme" content="light dark"> 8 + 9 + <!-- Primary Meta Tags --> 10 + <title>QuickDID - AT Protocol Identity Resolution Service</title> 11 + <meta name="title" content="QuickDID - AT Protocol Identity Resolution Service"> 12 + <meta name="description" content="High-performance handle-to-DID resolution service for the AT Protocol ecosystem. Resolve Bluesky and AT Protocol handles instantly."> 13 + <meta name="keywords" content="ATProtocol, Bluesky, DID, handle resolution, decentralized identity, atproto"> 14 + <meta name="author" content="Nick Gerakines"> 15 + 16 + <!-- Open Graph / Facebook --> 17 + <meta property="og:type" content="website"> 18 + <meta property="og:url" content="https://quickdid.smokesignal.tools/"> 19 + <meta property="og:title" content="QuickDID - AT Protocol Identity Resolution Service"> 20 + <meta property="og:description" content="High-performance handle-to-DID resolution service for the AT Protocol ecosystem. Resolve Bluesky and AT Protocol handles instantly."> 21 + <meta property="og:site_name" content="QuickDID"> 22 + 23 + <!-- Twitter --> 24 + <meta property="twitter:card" content="summary_large_image"> 25 + <meta property="twitter:url" content="https://quickdid.smokesignal.tools/"> 26 + <meta property="twitter:title" content="QuickDID - AT Protocol Identity Resolution Service"> 27 + <meta property="twitter:description" content="High-performance handle-to-DID resolution service for the AT Protocol ecosystem. Resolve Bluesky and AT Protocol handles instantly."> 28 + 29 + <!-- Additional Meta Tags --> 30 + <meta name="robots" content="index, follow"> 31 + <meta name="language" content="English"> 32 + <meta name="theme-color" content="#1976d2"> 33 + <link rel="canonical" href="https://quickdid.smokesignal.tools/"> 34 + 35 + <!-- Stylesheet --> 36 + <link rel="stylesheet" href="/css/pico.classless.green.min.css"> 37 + <style> 38 + .resolver-form { 39 + margin: 2rem 0; 40 + padding: 1.5rem; 41 + background: var(--card-background-color); 42 + border-radius: var(--border-radius); 43 + border: 1px solid var(--muted-border-color); 44 + } 45 + 46 + .resolver-result { 47 + margin-top: 1rem; 48 + padding: 1.5rem; 49 + background: var(--code-background-color); 50 + border-radius: var(--border-radius); 51 + border: 1px solid var(--muted-border-color); 52 + } 53 + 54 + .result-content { 55 + background: transparent; 56 + padding: 1rem; 57 + overflow-x: auto; 58 + white-space: pre-wrap; 59 + word-break: break-word; 60 + } 61 + 62 + code { 63 + padding: 0.25rem 0.5rem; 64 + background: var(--code-background-color); 65 + border-radius: var(--border-radius); 66 + } 67 + 68 + span { 69 + display: inline-block; 70 + padding: 0.25rem 0.5rem; 71 + background: var(--primary); 72 + color: var(--primary-inverse); 73 + border-radius: var(--border-radius); 74 + font-size: 0.875rem; 75 + font-weight: bold; 76 + margin-right: 0.5rem; 77 + } 78 + 79 + .endpoint-section { 80 + margin-bottom: 3rem; 81 + } 82 + </style> 83 + </head> 84 + 85 + <body> 86 + <header> 87 + <hgroup> 88 + <h1>QuickDID</h1> 89 + <p>AT Protocol Identity Resolution Service</p> 90 + </hgroup> 91 + </header> 92 + <main> 93 + <p>QuickDID provides high-performance resolution services for the AT Protocol ecosystem.</p> 94 + 95 + <h2>Available Endpoints</h2> 96 + 97 + <section class="endpoint-section"> 98 + <h3>GET /xrpc/com.atproto.identity.resolveHandle</h3> 99 + <p>Resolve an AT Protocol handle to its DID</p> 100 + <p>Parameters: <code>?handle={handle}</code></p> 101 + 102 + <h4>Try It Out</h4> 103 + <form id="handleResolveForm" class="resolver-form"> 104 + <label for="handleInput"> 105 + Enter an AT Protocol handle to resolve: 106 + <input type="text" id="handleInput" name="handle" placeholder="e.g., alice.bsky.social" required> 107 + </label> 108 + <button type="submit">Resolve Handle</button> 109 + </form> 110 + 111 + <div id="handleResult" class="resolver-result" style="display: none;"> 112 + <h4>Result</h4> 113 + <pre id="handleResultContent" class="result-content"></pre> 114 + </div> 115 + 116 + <h4>Example Usage</h4> 117 + <code>curl "https://quickdid.smokesignal.tools/xrpc/com.atproto.identity.resolveHandle?handle=ngerakines.me"</code> 118 + </section> 119 + 120 + <section class="endpoint-section"> 121 + <h3>GET /xrpc/com.atproto.lexicon.resolveLexicon</h3> 122 + <p>Resolve an AT Protocol lexicon (NSID) to its schema</p> 123 + <p>Parameters: <code>?nsid={nsid}</code></p> 124 + 125 + <h4>Try It Out</h4> 126 + <form id="lexiconResolveForm" class="resolver-form"> 127 + <label for="nsidInput"> 128 + Enter an AT Protocol NSID to resolve: 129 + <input type="text" id="nsidInput" name="nsid" placeholder="e.g., app.bsky.feed.post" required> 130 + </label> 131 + <button type="submit">Resolve Lexicon</button> 132 + </form> 133 + 134 + <div id="lexiconResult" class="resolver-result" style="display: none;"> 135 + <h4>Result</h4> 136 + <pre id="lexiconResultContent" class="result-content"></pre> 137 + </div> 138 + 139 + <h4>Example Usage</h4> 140 + <code>curl "https://quickdid.smokesignal.tools/xrpc/com.atproto.lexicon.resolveLexicon?nsid=app.bsky.feed.post"</code> 141 + </section> 142 + 143 + <h2>Documentation</h2> 144 + <p> 145 + For more information, visit the 146 + <a href="https://tangled.sh/@smokesignal.events/quickdid" target="_blank"> 147 + QuickDID repository 148 + </a> 149 + . 150 + </p> 151 + </main> 152 + 153 + <script> 154 + // Handle form submission for handle resolution 155 + document.getElementById('handleResolveForm').addEventListener('submit', async (e) => { 156 + e.preventDefault(); 157 + 158 + const handle = document.getElementById('handleInput').value.trim(); 159 + const resultDiv = document.getElementById('handleResult'); 160 + const resultContent = document.getElementById('handleResultContent'); 161 + 162 + // Show loading state 163 + resultDiv.style.display = 'block'; 164 + resultContent.textContent = 'Loading...'; 165 + 166 + try { 167 + // Build the request URL 168 + const url = `/xrpc/com.atproto.identity.resolveHandle?handle=${encodeURIComponent(handle)}`; 169 + 170 + // Make the GET request 171 + const response = await fetch(url); 172 + const data = await response.json(); 173 + 174 + // Display the result 175 + if (response.ok) { 176 + resultContent.textContent = JSON.stringify(data, null, 2); 177 + resultContent.style.color = ''; 178 + } else { 179 + resultContent.textContent = `Error: ${JSON.stringify(data, null, 2)}`; 180 + resultContent.style.color = '#d32f2f'; 181 + } 182 + } catch (error) { 183 + resultContent.textContent = `Network Error: ${error.message}`; 184 + resultContent.style.color = '#d32f2f'; 185 + } 186 + }); 187 + 188 + // Handle form submission for lexicon resolution 189 + document.getElementById('lexiconResolveForm').addEventListener('submit', async (e) => { 190 + e.preventDefault(); 191 + 192 + const nsid = document.getElementById('nsidInput').value.trim(); 193 + const resultDiv = document.getElementById('lexiconResult'); 194 + const resultContent = document.getElementById('lexiconResultContent'); 195 + 196 + // Show loading state 197 + resultDiv.style.display = 'block'; 198 + resultContent.textContent = 'Loading...'; 199 + 200 + try { 201 + // Build the request URL 202 + const url = `/xrpc/com.atproto.lexicon.resolveLexicon?nsid=${encodeURIComponent(nsid)}`; 203 + 204 + // Make the GET request 205 + const response = await fetch(url); 206 + const data = await response.json(); 207 + 208 + // Display the result 209 + if (response.ok) { 210 + resultContent.textContent = JSON.stringify(data, null, 2); 211 + resultContent.style.color = ''; 212 + } else { 213 + resultContent.textContent = `Error: ${JSON.stringify(data, null, 2)}`; 214 + resultContent.style.color = '#d32f2f'; 215 + } 216 + } catch (error) { 217 + resultContent.textContent = `Network Error: ${error.message}`; 218 + resultContent.style.color = '#d32f2f'; 219 + } 220 + }); 221 + </script> 222 + </body> 223 + 224 + </html>