QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides handle-to-DID resolution with Redis-backed caching and queue processing.

Compare changes

Choose any two refs to compare.

+37
.dockerignore
··· 1 + # Git 2 + .git 3 + .gitignore 4 + 5 + # Documentation 6 + *.md 7 + docs/ 8 + LICENSE 9 + 10 + # Development files 11 + .vscode/ 12 + .env 13 + .env.local 14 + *.log 15 + 16 + # Build artifacts 17 + target/ 18 + Dockerfile 19 + .dockerignore 20 + 21 + # Test files 22 + tests/ 23 + benches/ 24 + 25 + # Scripts (except the ones we need) 26 + *.sh 27 + 28 + # SQLite databases 29 + *.db 30 + *.db-* 31 + 32 + # OS files 33 + .DS_Store 34 + Thumbs.db 35 + 36 + # Keep the www directory for static files 37 + !www/
+12 -8
.env.example
··· 1 1 # QuickDID Environment Configuration Template 2 2 # Copy this file to .env and customize for your deployment 3 - # 4 - # IMPORTANT: Never commit .env files with real SERVICE_KEY values 5 3 6 4 # ============================================================================ 7 5 # REQUIRED CONFIGURATION ··· 13 11 # - quickdid.example.com:8080 14 12 # - localhost:3007 15 13 HTTP_EXTERNAL=quickdid.example.com 16 - 17 - # Private key for service identity (REQUIRED) 18 - # SECURITY: Generate a new key for each environment 19 - # NEVER commit real keys to version control 20 - SERVICE_KEY=did:key:YOUR_PRIVATE_KEY_HERE 21 14 22 15 # ============================================================================ 23 16 # NETWORK CONFIGURATION ··· 98 91 QUEUE_BUFFER_SIZE=1000 99 92 100 93 # ============================================================================ 94 + # STATIC FILES CONFIGURATION 95 + # ============================================================================ 96 + 97 + # Directory for serving static files (default: www) 98 + # This should contain: 99 + # - index.html (landing page) 100 + # - .well-known/atproto-did (service DID) 101 + # - .well-known/did.json (DID document) 102 + # Docker default: /app/www 103 + STATIC_FILES_DIR=www 104 + 105 + # ============================================================================ 101 106 # LOGGING 102 107 # ============================================================================ 103 108 ··· 112 117 # ============================================================================ 113 118 114 119 # HTTP_EXTERNAL=localhost:3007 115 - # SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 116 120 # RUST_LOG=debug 117 121 # CACHE_TTL_MEMORY=60 118 122 # CACHE_TTL_REDIS=300
+3
.gitignore
··· 7 7 8 8 # Docker 9 9 docker-compose.override.yml 10 + 11 + # Metrics dev 12 + /metrics-stack
+77
CHANGELOG.md
··· 7 7 8 8 ## [Unreleased] 9 9 10 + ## [1.0.0-rc.5] - 2025-09-10 11 + 12 + ### Added 13 + - Bidirectional caching support for handle-to-DID and DID-to-handle lookups in Redis resolver 14 + - `purge` method to HandleResolver trait for removing entries by handle or DID 15 + - `set` method to HandleResolver trait for manual cache updates 16 + - Jetstream consumer integration for real-time cache updates from AT Protocol firehose 17 + - QuickDidEventHandler module for processing Account and Identity events 18 + - Static file serving with www directory support for landing page and well-known files 19 + - Comprehensive test coverage for new bidirectional cache operations 20 + 21 + ### Changed 22 + - Handle normalization to lowercase throughout the system for consistency 23 + - Updated all resolver implementations to chain `purge` and `set` calls through the stack 24 + - Enhanced documentation to reflect Jetstream configuration and bidirectional caching 25 + - Improved production deployment guide with real-time sync recommendations 26 + 27 + ### Fixed 28 + - Handle case sensitivity issues - all handles now normalized to lowercase 29 + - Cache consistency between handle and DID lookups 30 + - Event processing error handling in Jetstream consumer 31 + 32 + ## [1.0.0-rc.4] - 2025-09-08 33 + 34 + ### Added 35 + - Metrics system with pluggable adapters (StatsD support) for monitoring and observability 36 + - Proactive refresh resolver for keeping cached entries fresh before expiration 37 + - Redis queue deduplication to prevent duplicate handle resolution work items 38 + - Configurable bind address for StatsD UDP socket supporting both IPv4 and IPv6 39 + - CORS headers support for cross-origin requests 40 + - OPTIONS method handling for preflight requests 41 + - Resolution timing measurements for performance monitoring 42 + - Comprehensive metrics tracking including counters, gauges, and timings 43 + - Telegraf and TimescaleDB integration guide for metrics aggregation 44 + - Railway deployment resources for production environments 45 + 46 + ### Changed 47 + - Replaced chrono with httpdate for more efficient HTTP date formatting 48 + - Refactored handle resolver to include resolution time measurements 49 + - Improved handle resolution view architecture 50 + - Enhanced documentation with metrics configuration and deployment guides 51 + 52 + ### Fixed 53 + - Minor typo in feature commit message ("fesature" corrected to "feature") 54 + 55 + ## [1.0.0-rc.3] - 2025-09-06 56 + 57 + ### Added 58 + - SQLite support for persistent caching and queue processing 59 + - Rate limiting with semaphore-based concurrency control (`RESOLVER_MAX_CONCURRENT`) 60 + - Timeout support for rate limit permit acquisition (`RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`) 61 + - SQLite queue adapter with work shedding capabilities (`QUEUE_SQLITE_MAX_SIZE`) 62 + - Comprehensive error system with unique identifiers (e.g., `error-quickdid-config-1`) 63 + - 12-factor app compliance with environment-only configuration 64 + 65 + ### Changed 66 + - Configuration now exclusively uses environment variables (removed clap dependency) 67 + - Command-line arguments limited to `--version` and `--help` only 68 + - Improved error handling with strongly-typed errors using `thiserror` throughout 69 + - Enhanced documentation with accurate configuration defaults and examples 70 + - Updated README with complete architecture overview and deployment strategies 71 + - Cache priority system: Redis โ†’ SQLite โ†’ Memory (first available) 72 + 73 + ### Fixed 74 + - Error messages now consistently follow `error-quickdid-<domain>-<number>` format 75 + - Configuration validation for all TTL and timeout values 76 + - Documentation inconsistencies in CLAUDE.md development guide 77 + - Queue adapter validation to include 'sqlite' option 78 + 79 + ### Removed 80 + - `clap` crate dependency (replaced with simple argument handling) 81 + - `anyhow!()` macro usage in favor of proper error types 82 + - Command-line configuration options (following 12-factor methodology) 83 + 10 84 ## [1.0.0-rc.2] - 2025-09-05 11 85 12 86 ### Changed ··· 51 125 - Unnecessary feature flags (axum macros, deadpool-redis script) 52 126 - 4 unused dependencies reducing compilation time 53 127 128 + [1.0.0-rc.5]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.5 129 + [1.0.0-rc.4]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.4 130 + [1.0.0-rc.3]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.3 54 131 [1.0.0-rc.2]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.2 55 132 [1.0.0-rc.1]: https://tangled.sh/@smokesignal.events/quickdid/tree/v1.0.0-rc.1
+164 -33
CLAUDE.md
··· 1 1 # QuickDID - Development Guide for Claude 2 2 3 3 ## Overview 4 - QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides handle-to-DID resolution with Redis-backed caching and queue processing. 4 + QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides bidirectional handle-to-DID and DID-to-handle resolution with multi-layer caching (Redis, SQLite, in-memory), queue processing, metrics support, proactive cache refreshing, and real-time cache updates via Jetstream consumer. 5 + 6 + ## Configuration 7 + 8 + QuickDID follows the 12-factor app methodology and uses environment variables exclusively for configuration. There are no command-line arguments except for `--version` and `--help`. 9 + 10 + Configuration is validated at startup, and the service will exit with specific error codes if validation fails: 11 + - `error-quickdid-config-1`: Missing required environment variable 12 + - `error-quickdid-config-2`: Invalid configuration value 13 + - `error-quickdid-config-3`: Invalid TTL value (must be positive) 14 + - `error-quickdid-config-4`: Invalid timeout value (must be positive) 5 15 6 16 ## Common Commands 7 17 ··· 10 20 # Build the project 11 21 cargo build 12 22 13 - # Run in debug mode 14 - cargo run 23 + # Run in debug mode (requires environment variables) 24 + HTTP_EXTERNAL=localhost:3007 cargo run 15 25 16 26 # Run tests 17 27 cargo test ··· 19 29 # Type checking 20 30 cargo check 21 31 22 - # Run with environment variables 23 - HTTP_EXTERNAL=localhost:3007 SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK cargo run 32 + # Linting 33 + cargo clippy 34 + 35 + # Show version 36 + cargo run -- --version 37 + 38 + # Show help 39 + cargo run -- --help 24 40 ``` 25 41 26 42 ### Development with VS Code ··· 30 46 31 47 ### Core Components 32 48 33 - 1. **Handle Resolution** (`src/handle_resolver.rs`) 49 + 1. **Handle Resolution** (`src/handle_resolver/`) 34 50 - `BaseHandleResolver`: Core resolution using DNS and HTTP 35 - - `CachingHandleResolver`: In-memory caching layer 36 - - `RedisHandleResolver`: Redis-backed persistent caching with 90-day TTL 51 + - `RateLimitedHandleResolver`: Semaphore-based rate limiting with optional timeout 52 + - `CachingHandleResolver`: In-memory caching layer with bidirectional support 53 + - `RedisHandleResolver`: Redis-backed persistent caching with bidirectional lookups 54 + - `SqliteHandleResolver`: SQLite-backed persistent caching with bidirectional support 55 + - `ProactiveRefreshResolver`: Automatically refreshes cache entries before expiration 56 + - All resolvers implement `HandleResolver` trait with: 57 + - `resolve`: Handle-to-DID resolution 58 + - `purge`: Remove entries by handle or DID 59 + - `set`: Manually update handle-to-DID mappings 37 60 - Uses binary serialization via `HandleResolutionResult` for space efficiency 61 + - Resolution stack: Cache โ†’ ProactiveRefresh (optional) โ†’ RateLimited (optional) โ†’ Base โ†’ DNS/HTTP 62 + - Includes resolution timing measurements for metrics 38 63 39 64 2. **Binary Serialization** (`src/handle_resolution_result.rs`) 40 65 - Compact storage format using bincode 41 66 - Strips DID prefixes for did:web and did:plc methods 42 67 - Stores: timestamp (u64), method type (i16), payload (String) 43 68 44 - 3. **Queue System** (`src/queue_adapter.rs`) 45 - - Supports MPSC (in-process) and Redis adapters 69 + 3. **Queue System** (`src/queue/`) 70 + - Supports MPSC (in-process), Redis, SQLite, and no-op adapters 46 71 - `HandleResolutionWork` items processed asynchronously 47 72 - Redis uses reliable queue pattern (LPUSH/RPOPLPUSH/LREM) 73 + - SQLite provides persistent queue with work shedding capabilities 48 74 49 75 4. **HTTP Server** (`src/http/`) 50 76 - XRPC endpoints for AT Protocol compatibility 51 77 - Health check endpoint 52 - - DID document serving via .well-known 78 + - Static file serving from configurable directory (default: www) 79 + - Serves .well-known files as static content 80 + - CORS headers support for cross-origin requests 81 + - Cache-Control headers with configurable max-age and stale directives 82 + - ETag support with configurable seed for cache invalidation 83 + 84 + 5. **Metrics System** (`src/metrics.rs`) 85 + - Pluggable metrics publishing with StatsD support 86 + - Tracks counters, gauges, and timings 87 + - Configurable tags for environment/service identification 88 + - No-op adapter for development environments 89 + - Metrics for Jetstream event processing 90 + 91 + 6. **Jetstream Consumer** (`src/jetstream_handler.rs`) 92 + - Consumes AT Protocol firehose events via WebSocket 93 + - Processes Account events (purges deleted/deactivated accounts) 94 + - Processes Identity events (updates handle-to-DID mappings) 95 + - Automatic reconnection with exponential backoff 96 + - Comprehensive metrics for event processing 97 + - Spawned as cancellable task using task manager 53 98 54 99 ## Key Technical Details 55 100 ··· 59 104 - Other DID methods stored with full identifier 60 105 61 106 ### Redis Integration 62 - - **Caching**: Uses MetroHash64 for key generation, stores binary data 107 + - **Bidirectional Caching**: 108 + - Stores both handleโ†’DID and DIDโ†’handle mappings 109 + - Uses MetroHash64 for key generation 110 + - Binary data storage for efficiency 111 + - Automatic synchronization of both directions 63 112 - **Queuing**: Reliable queue with processing/dead letter queues 64 113 - **Key Prefixes**: Configurable via `QUEUE_REDIS_PREFIX` environment variable 65 114 66 115 ### Handle Resolution Flow 67 - 1. Check Redis cache (if configured) 68 - 2. Fall back to in-memory cache 116 + 1. Check cache (Redis/SQLite/in-memory based on configuration) 117 + 2. If cache miss and rate limiting enabled: 118 + - Acquire semaphore permit (with optional timeout) 119 + - If timeout configured and exceeded, return error 69 120 3. Perform DNS TXT lookup or HTTP well-known query 70 - 4. Cache result with appropriate TTL 121 + 4. Cache result with appropriate TTL in both directions (handleโ†’DID and DIDโ†’handle) 71 122 5. Return DID or error 72 123 124 + ### Cache Management Operations 125 + - **Purge**: Removes entries by either handle or DID 126 + - Uses `atproto_identity::resolve::parse_input` for identifier detection 127 + - Removes both handleโ†’DID and DIDโ†’handle mappings 128 + - Chains through all resolver layers 129 + - **Set**: Manually updates handle-to-DID mappings 130 + - Updates both directions in cache 131 + - Normalizes handles to lowercase 132 + - Chains through all resolver layers 133 + 73 134 ## Environment Variables 74 135 75 136 ### Required 76 137 - `HTTP_EXTERNAL`: External hostname for service endpoints (e.g., `localhost:3007`) 77 - - `SERVICE_KEY`: Private key for service identity (DID format) 78 138 79 - ### Optional 139 + ### Optional - Core Configuration 80 140 - `HTTP_PORT`: Server port (default: 8080) 81 141 - `PLC_HOSTNAME`: PLC directory hostname (default: plc.directory) 142 + - `RUST_LOG`: Logging level (e.g., debug, info) 143 + - `STATIC_FILES_DIR`: Directory for serving static files (default: www) 144 + 145 + ### Optional - Caching 82 146 - `REDIS_URL`: Redis connection URL for caching 83 - - `QUEUE_ADAPTER`: Queue type - 'mpsc' or 'redis' (default: mpsc) 147 + - `SQLITE_URL`: SQLite database URL for caching (e.g., `sqlite:./quickdid.db`) 148 + - `CACHE_TTL_MEMORY`: TTL for in-memory cache in seconds (default: 600) 149 + - `CACHE_TTL_REDIS`: TTL for Redis cache in seconds (default: 7776000) 150 + - `CACHE_TTL_SQLITE`: TTL for SQLite cache in seconds (default: 7776000) 151 + 152 + ### Optional - Queue Configuration 153 + - `QUEUE_ADAPTER`: Queue type - 'mpsc', 'redis', 'sqlite', 'noop', or 'none' (default: mpsc) 84 154 - `QUEUE_REDIS_PREFIX`: Redis key prefix for queues (default: queue:handleresolver:) 85 - - `QUEUE_WORKER_ID`: Worker ID for Redis queue (auto-generated if not set) 86 - - `RUST_LOG`: Logging level (e.g., debug, info) 155 + - `QUEUE_WORKER_ID`: Worker ID for queue operations (default: worker1) 156 + - `QUEUE_BUFFER_SIZE`: Buffer size for MPSC queue (default: 1000) 157 + - `QUEUE_SQLITE_MAX_SIZE`: Max queue size for SQLite work shedding (default: 10000) 158 + - `QUEUE_REDIS_TIMEOUT`: Redis blocking timeout in seconds (default: 5) 159 + - `QUEUE_REDIS_DEDUP_ENABLED`: Enable queue deduplication to prevent duplicate handles (default: false) 160 + - `QUEUE_REDIS_DEDUP_TTL`: TTL for deduplication keys in seconds (default: 60) 161 + 162 + ### Optional - Rate Limiting 163 + - `RESOLVER_MAX_CONCURRENT`: Maximum concurrent handle resolutions (default: 0 = disabled) 164 + - `RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`: Timeout for acquiring rate limit permit in ms (default: 0 = no timeout) 165 + 166 + ### Optional - HTTP Cache Control 167 + - `CACHE_MAX_AGE`: Max-age for Cache-Control header in seconds (default: 86400) 168 + - `CACHE_STALE_IF_ERROR`: Stale-if-error directive in seconds (default: 172800) 169 + - `CACHE_STALE_WHILE_REVALIDATE`: Stale-while-revalidate directive in seconds (default: 86400) 170 + - `CACHE_MAX_STALE`: Max-stale directive in seconds (default: 86400) 171 + - `ETAG_SEED`: Seed value for ETag generation (default: application version) 172 + 173 + ### Optional - Metrics 174 + - `METRICS_ADAPTER`: Metrics adapter type - 'noop' or 'statsd' (default: noop) 175 + - `METRICS_STATSD_HOST`: StatsD host and port (required when METRICS_ADAPTER=statsd, e.g., localhost:8125) 176 + - `METRICS_STATSD_BIND`: Bind address for StatsD UDP socket (default: [::]:0 for IPv6, can use 0.0.0.0:0 for IPv4) 177 + - `METRICS_PREFIX`: Prefix for all metrics (default: quickdid) 178 + - `METRICS_TAGS`: Comma-separated tags (e.g., env:prod,service:quickdid) 179 + 180 + ### Optional - Proactive Refresh 181 + - `PROACTIVE_REFRESH_ENABLED`: Enable proactive cache refreshing (default: false) 182 + - `PROACTIVE_REFRESH_THRESHOLD`: Refresh when TTL remaining is below this threshold (0.0-1.0, default: 0.8) 183 + 184 + ### Optional - Jetstream Consumer 185 + - `JETSTREAM_ENABLED`: Enable Jetstream consumer for real-time cache updates (default: false) 186 + - `JETSTREAM_HOSTNAME`: Jetstream WebSocket hostname (default: jetstream.atproto.tools) 87 187 88 188 ## Error Handling 89 189 ··· 91 191 92 192 error-quickdid-<domain>-<number> <message>: <details> 93 193 94 - Example errors: 194 + Current error domains and examples: 95 195 96 - * error-quickdid-resolve-1 Multiple DIDs resolved for method 97 - * error-quickdid-plc-1 HTTP request failed: https://google.com/ Not Found 98 - * error-quickdid-key-1 Error decoding key: invalid 196 + * `config`: Configuration errors (e.g., error-quickdid-config-1 Missing required environment variable) 197 + * `resolve`: Handle resolution errors (e.g., error-quickdid-resolve-1 Failed to resolve subject) 198 + * `queue`: Queue operation errors (e.g., error-quickdid-queue-1 Failed to push to queue) 199 + * `cache`: Cache-related errors (e.g., error-quickdid-cache-1 Redis pool creation failed) 200 + * `result`: Serialization errors (e.g., error-quickdid-result-1 System time error) 201 + * `task`: Task processing errors (e.g., error-quickdid-task-1 Queue adapter health check failed) 99 202 100 203 Errors should be represented as enums using the `thiserror` library. 101 204 ··· 118 221 ### Test Coverage Areas 119 222 - Handle resolution with various DID methods 120 223 - Binary serialization/deserialization 121 - - Redis caching and expiration 224 + - Redis caching and expiration with bidirectional lookups 122 225 - Queue processing logic 123 226 - HTTP endpoint responses 227 + - Jetstream event handler processing 228 + - Purge and set operations across resolver layers 124 229 125 230 ## Development Patterns 126 231 127 232 ### Error Handling 128 - - Uses `anyhow::Result` for error propagation 129 - - Graceful fallbacks when Redis is unavailable 233 + - Uses strongly-typed errors with `thiserror` for all modules 234 + - Each error has a unique identifier following the pattern `error-quickdid-<domain>-<number>` 235 + - Graceful fallbacks when Redis/SQLite is unavailable 130 236 - Detailed tracing for debugging 237 + - Avoid using `anyhow!()` or `bail!()` macros - use proper error types instead 131 238 132 239 ### Performance Optimizations 133 240 - Binary serialization reduces storage by ~40% 134 241 - MetroHash64 for fast key generation 135 242 - Connection pooling for Redis 136 243 - Configurable TTLs for cache entries 244 + - Rate limiting via semaphore-based concurrency control 245 + - HTTP caching with ETag and Cache-Control headers 246 + - Resolution timing metrics for performance monitoring 137 247 138 248 ### Code Style 139 249 - Follow existing Rust idioms and patterns 140 250 - Use `tracing` for logging, not `println!` 141 251 - Prefer `Arc` for shared state across async tasks 142 252 - Handle errors explicitly, avoid `.unwrap()` in production code 253 + - Use `httpdate` crate for HTTP date formatting (not `chrono`) 143 254 144 255 ## Common Tasks 145 256 ··· 149 260 3. Add test cases for the new method type 150 261 151 262 ### Modifying Cache TTL 152 - - For in-memory: Pass TTL to `CachingHandleResolver::new()` 153 - - For Redis: Modify `RedisHandleResolver::ttl_seconds()` 263 + - For in-memory: Set `CACHE_TTL_MEMORY` environment variable 264 + - For Redis: Set `CACHE_TTL_REDIS` environment variable 265 + - For SQLite: Set `CACHE_TTL_SQLITE` environment variable 266 + 267 + ### Configuring Metrics 268 + 1. Set `METRICS_ADAPTER=statsd` and `METRICS_STATSD_HOST=localhost:8125` 269 + 2. Configure tags with `METRICS_TAGS=env:prod,service:quickdid` 270 + 3. Use Telegraf + TimescaleDB for aggregation (see `docs/telegraf-timescaledb-metrics-guide.md`) 271 + 4. Railway deployment resources available in `railway-resources/telegraf/` 154 272 155 273 ### Debugging Resolution Issues 156 274 1. Enable debug logging: `RUST_LOG=debug` 157 - 2. Check Redis cache: `redis-cli GET "handle:<hash>"` 158 - 3. Monitor queue processing in logs 159 - 4. Verify DNS/HTTP connectivity to AT Protocol infrastructure 275 + 2. Check Redis cache: 276 + - Handle lookup: `redis-cli GET "handle:<hash>"` 277 + - DID lookup: `redis-cli GET "handle:<hash>"` (same key format) 278 + 3. Check SQLite cache: `sqlite3 quickdid.db "SELECT * FROM handle_resolution_cache;"` 279 + 4. Monitor queue processing in logs 280 + 5. Check rate limiting: Look for "Rate limit permit acquisition timed out" errors 281 + 6. Verify DNS/HTTP connectivity to AT Protocol infrastructure 282 + 7. Monitor metrics for resolution timing and cache hit rates 283 + 8. Check Jetstream consumer status: 284 + - Look for "Jetstream consumer" log entries 285 + - Monitor `jetstream.*` metrics 286 + - Check reconnection attempts in logs 160 287 161 288 ## Dependencies 162 289 - `atproto-identity`: Core AT Protocol identity resolution 290 + - `atproto-jetstream`: AT Protocol Jetstream event consumer 163 291 - `bincode`: Binary serialization 164 292 - `deadpool-redis`: Redis connection pooling 165 293 - `metrohash`: Fast non-cryptographic hashing 166 294 - `tokio`: Async runtime 167 - - `axum`: Web framework 295 + - `axum`: Web framework 296 + - `httpdate`: HTTP date formatting (replacing chrono) 297 + - `cadence`: StatsD metrics client 298 + - `thiserror`: Error handling
+647 -674
Cargo.lock
··· 3 3 version = 4 4 4 5 5 [[package]] 6 - name = "addr2line" 7 - version = "0.24.2" 8 - source = "registry+https://github.com/rust-lang/crates.io-index" 9 - checksum = "dfbe277e56a376000877090da837660b4427aad530e3028d44e0bffe4f89a1c1" 10 - dependencies = [ 11 - "gimli", 12 - ] 13 - 14 - [[package]] 15 - name = "adler2" 16 - version = "2.0.1" 17 - source = "registry+https://github.com/rust-lang/crates.io-index" 18 - checksum = "320119579fcad9c21884f5c4861d16174d0e06250625266f50fe6898340abefa" 19 - 20 - [[package]] 21 6 name = "aho-corasick" 22 - version = "1.1.3" 7 + version = "1.1.4" 23 8 source = "registry+https://github.com/rust-lang/crates.io-index" 24 - checksum = "8e60d3430d3a69478ad0993f19238d2df97c507009a52b3c10addcd7f6bcb916" 9 + checksum = "ddd31a130427c27518df266943a5308ed92d4b226cc639f5a8f1002816174301" 25 10 dependencies = [ 26 11 "memchr", 27 12 ] ··· 33 18 checksum = "683d7910e743518b0e34f1186f92494becacb047c7b6bf616c96772180fef923" 34 19 35 20 [[package]] 36 - name = "android-tzdata" 37 - version = "0.1.1" 38 - source = "registry+https://github.com/rust-lang/crates.io-index" 39 - checksum = "e999941b234f3131b00bc13c22d06e8c5ff726d1b6318ac7eb276997bbb4fef0" 40 - 41 - [[package]] 42 - name = "android_system_properties" 43 - version = "0.1.5" 44 - source = "registry+https://github.com/rust-lang/crates.io-index" 45 - checksum = "819e7219dbd41043ac279b19830f2efc897156490d7fd6ea916720117ee66311" 46 - dependencies = [ 47 - "libc", 48 - ] 49 - 50 - [[package]] 51 - name = "anstream" 52 - version = "0.6.20" 53 - source = "registry+https://github.com/rust-lang/crates.io-index" 54 - checksum = "3ae563653d1938f79b1ab1b5e668c87c76a9930414574a6583a7b7e11a8e6192" 55 - dependencies = [ 56 - "anstyle", 57 - "anstyle-parse", 58 - "anstyle-query", 59 - "anstyle-wincon", 60 - "colorchoice", 61 - "is_terminal_polyfill", 62 - "utf8parse", 63 - ] 64 - 65 - [[package]] 66 - name = "anstyle" 67 - version = "1.0.11" 68 - source = "registry+https://github.com/rust-lang/crates.io-index" 69 - checksum = "862ed96ca487e809f1c8e5a8447f6ee2cf102f846893800b20cebdf541fc6bbd" 70 - 71 - [[package]] 72 - name = "anstyle-parse" 73 - version = "0.2.7" 74 - source = "registry+https://github.com/rust-lang/crates.io-index" 75 - checksum = "4e7644824f0aa2c7b9384579234ef10eb7efb6a0deb83f9630a49594dd9c15c2" 76 - dependencies = [ 77 - "utf8parse", 78 - ] 79 - 80 - [[package]] 81 - name = "anstyle-query" 82 - version = "1.1.4" 83 - source = "registry+https://github.com/rust-lang/crates.io-index" 84 - checksum = "9e231f6134f61b71076a3eab506c379d4f36122f2af15a9ff04415ea4c3339e2" 85 - dependencies = [ 86 - "windows-sys 0.60.2", 87 - ] 88 - 89 - [[package]] 90 - name = "anstyle-wincon" 91 - version = "3.0.10" 92 - source = "registry+https://github.com/rust-lang/crates.io-index" 93 - checksum = "3e0633414522a32ffaac8ac6cc8f748e090c5717661fddeea04219e2344f5f2a" 94 - dependencies = [ 95 - "anstyle", 96 - "once_cell_polyfill", 97 - "windows-sys 0.60.2", 98 - ] 99 - 100 - [[package]] 101 21 name = "anyhow" 102 - version = "1.0.99" 22 + version = "1.0.100" 103 23 source = "registry+https://github.com/rust-lang/crates.io-index" 104 - checksum = "b0674a1ddeecb70197781e945de4b3b8ffb61fa939a5597bcf48503737663100" 24 + checksum = "a23eb6b1614318a8071c9b2521f36b424b2c83db5eb3a0fead4a6c0809af6e61" 105 25 106 26 [[package]] 107 27 name = "arc-swap" ··· 117 37 dependencies = [ 118 38 "proc-macro2", 119 39 "quote", 120 - "syn", 40 + "syn 2.0.108", 121 41 ] 122 42 123 43 [[package]] ··· 136 56 checksum = "1505bd5d3d116872e7271a6d4e16d81d0c8570876c8de68093a09ac269d8aac0" 137 57 138 58 [[package]] 59 + name = "atproto-client" 60 + version = "0.13.0" 61 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 62 + dependencies = [ 63 + "anyhow", 64 + "async-trait", 65 + "atproto-identity", 66 + "atproto-oauth", 67 + "atproto-record", 68 + "bytes", 69 + "reqwest", 70 + "reqwest-chain", 71 + "reqwest-middleware", 72 + "serde", 73 + "serde_json", 74 + "thiserror 2.0.17", 75 + "tokio", 76 + "tracing", 77 + "urlencoding", 78 + ] 79 + 80 + [[package]] 139 81 name = "atproto-identity" 140 - version = "0.11.3" 141 - source = "registry+https://github.com/rust-lang/crates.io-index" 142 - checksum = "aaac8751c7e4329a95714c01d9e47d22d94bc8c96e78079098312235128acb9f" 82 + version = "0.13.0" 83 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 143 84 dependencies = [ 144 85 "anyhow", 145 86 "async-trait", ··· 156 97 "serde", 157 98 "serde_ipld_dagcbor", 158 99 "serde_json", 159 - "thiserror 2.0.16", 100 + "thiserror 2.0.17", 101 + "tokio", 102 + "tracing", 103 + "url", 104 + "urlencoding", 105 + ] 106 + 107 + [[package]] 108 + name = "atproto-jetstream" 109 + version = "0.13.0" 110 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 111 + dependencies = [ 112 + "anyhow", 113 + "async-trait", 114 + "atproto-identity", 115 + "futures", 116 + "http", 117 + "serde", 118 + "serde_json", 119 + "thiserror 2.0.17", 120 + "tokio", 121 + "tokio-util", 122 + "tokio-websockets", 123 + "tracing", 124 + "tracing-subscriber", 125 + "urlencoding", 126 + "zstd", 127 + ] 128 + 129 + [[package]] 130 + name = "atproto-lexicon" 131 + version = "0.13.0" 132 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 133 + dependencies = [ 134 + "anyhow", 135 + "async-trait", 136 + "atproto-client", 137 + "atproto-identity", 138 + "hickory-resolver", 139 + "reqwest", 140 + "serde", 141 + "serde_json", 142 + "thiserror 2.0.17", 143 + "tokio", 144 + "tracing", 145 + ] 146 + 147 + [[package]] 148 + name = "atproto-oauth" 149 + version = "0.13.0" 150 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 151 + dependencies = [ 152 + "anyhow", 153 + "async-trait", 154 + "atproto-identity", 155 + "base64", 156 + "chrono", 157 + "ecdsa", 158 + "elliptic-curve", 159 + "k256", 160 + "lru", 161 + "multibase", 162 + "p256", 163 + "p384", 164 + "rand 0.8.5", 165 + "reqwest", 166 + "reqwest-chain", 167 + "reqwest-middleware", 168 + "serde", 169 + "serde_ipld_dagcbor", 170 + "serde_json", 171 + "sha2", 172 + "thiserror 2.0.17", 160 173 "tokio", 161 174 "tracing", 175 + "ulid", 176 + ] 177 + 178 + [[package]] 179 + name = "atproto-record" 180 + version = "0.13.0" 181 + source = "git+https://tangled.org/@smokesignal.events/atproto-identity-rs#8a38edecc8ebebd74d511ae7863c7eecd0b877ad" 182 + dependencies = [ 183 + "anyhow", 184 + "atproto-identity", 185 + "base64", 186 + "chrono", 187 + "cid", 188 + "multihash", 189 + "rand 0.8.5", 190 + "serde", 191 + "serde_ipld_dagcbor", 192 + "serde_json", 193 + "sha2", 194 + "thiserror 2.0.17", 162 195 ] 163 196 164 197 [[package]] ··· 169 202 170 203 [[package]] 171 204 name = "axum" 172 - version = "0.8.4" 205 + version = "0.8.6" 173 206 source = "registry+https://github.com/rust-lang/crates.io-index" 174 - checksum = "021e862c184ae977658b36c4500f7feac3221ca5da43e3f25bd04ab6c79a29b5" 207 + checksum = "8a18ed336352031311f4e0b4dd2ff392d4fbb370777c9d18d7fc9d7359f73871" 175 208 dependencies = [ 176 209 "axum-core", 177 210 "bytes", ··· 188 221 "mime", 189 222 "percent-encoding", 190 223 "pin-project-lite", 191 - "rustversion", 192 - "serde", 224 + "serde_core", 193 225 "serde_json", 194 226 "serde_path_to_error", 195 227 "serde_urlencoded", ··· 203 235 204 236 [[package]] 205 237 name = "axum-core" 206 - version = "0.5.2" 238 + version = "0.5.5" 207 239 source = "registry+https://github.com/rust-lang/crates.io-index" 208 - checksum = "68464cd0412f486726fb3373129ef5d2993f90c34bc2bc1c1e9943b2f4fc7ca6" 240 + checksum = "59446ce19cd142f8833f856eb31f3eb097812d1479ab224f54d72428ca21ea22" 209 241 dependencies = [ 210 242 "bytes", 211 243 "futures-core", ··· 214 246 "http-body-util", 215 247 "mime", 216 248 "pin-project-lite", 217 - "rustversion", 218 249 "sync_wrapper", 219 250 "tower-layer", 220 251 "tower-service", ··· 223 254 224 255 [[package]] 225 256 name = "backon" 226 - version = "1.5.2" 257 + version = "1.6.0" 227 258 source = "registry+https://github.com/rust-lang/crates.io-index" 228 - checksum = "592277618714fbcecda9a02ba7a8781f319d26532a88553bbacc77ba5d2b3a8d" 259 + checksum = "cffb0e931875b666fc4fcb20fee52e9bbd1ef836fd9e9e04ec21555f9f85f7ef" 229 260 dependencies = [ 230 261 "fastrand", 231 262 ] 232 263 233 264 [[package]] 234 - name = "backtrace" 235 - version = "0.3.75" 236 - source = "registry+https://github.com/rust-lang/crates.io-index" 237 - checksum = "6806a6321ec58106fea15becdad98371e28d92ccbc7c8f1b3b6dd724fe8f1002" 238 - dependencies = [ 239 - "addr2line", 240 - "cfg-if", 241 - "libc", 242 - "miniz_oxide", 243 - "object", 244 - "rustc-demangle", 245 - "windows-targets 0.52.6", 246 - ] 247 - 248 - [[package]] 249 265 name = "base-x" 250 266 version = "0.2.11" 251 267 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 258 274 checksum = "4c7f02d4ea65f2c1853089ffd8d2787bdbc63de2f0d29dedbcf8ccdfa0ccd4cf" 259 275 260 276 [[package]] 277 + name = "base256emoji" 278 + version = "1.0.2" 279 + source = "registry+https://github.com/rust-lang/crates.io-index" 280 + checksum = "b5e9430d9a245a77c92176e649af6e275f20839a48389859d1661e9a128d077c" 281 + dependencies = [ 282 + "const-str", 283 + "match-lookup", 284 + ] 285 + 286 + [[package]] 261 287 name = "base64" 262 288 version = "0.22.1" 263 289 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 291 317 292 318 [[package]] 293 319 name = "bitflags" 294 - version = "2.9.4" 320 + version = "2.10.0" 295 321 source = "registry+https://github.com/rust-lang/crates.io-index" 296 - checksum = "2261d10cca569e4643e526d8dc2e62e433cc8aba21ab764233731f8d369bf394" 322 + checksum = "812e12b5285cc515a9c72a5c1d3b6d46a19dac5acfef5265968c166106e31dd3" 297 323 dependencies = [ 298 - "serde", 324 + "serde_core", 299 325 ] 300 326 301 327 [[package]] ··· 326 352 checksum = "d71b6127be86fdcfddb610f7182ac57211d4b18a3e9c82eb2d17662f2227ad6a" 327 353 328 354 [[package]] 355 + name = "cadence" 356 + version = "1.6.0" 357 + source = "registry+https://github.com/rust-lang/crates.io-index" 358 + checksum = "3075f133bee430b7644c54fb629b9b4420346ffa275a45c81a6babe8b09b4f51" 359 + dependencies = [ 360 + "crossbeam-channel", 361 + ] 362 + 363 + [[package]] 329 364 name = "cbor4ii" 330 365 version = "0.2.14" 331 366 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 336 371 337 372 [[package]] 338 373 name = "cc" 339 - version = "1.2.36" 374 + version = "1.2.44" 340 375 source = "registry+https://github.com/rust-lang/crates.io-index" 341 - checksum = "5252b3d2648e5eedbc1a6f501e3c795e07025c1e93bbf8bbdd6eef7f447a6d54" 376 + checksum = "37521ac7aabe3d13122dc382493e20c9416f299d2ccd5b3a5340a2570cdeb0f3" 342 377 dependencies = [ 343 378 "find-msvc-tools", 379 + "jobserver", 380 + "libc", 344 381 "shlex", 345 382 ] 346 383 347 384 [[package]] 348 385 name = "cfg-if" 349 - version = "1.0.3" 386 + version = "1.0.4" 350 387 source = "registry+https://github.com/rust-lang/crates.io-index" 351 - checksum = "2fd1289c04a9ea8cb22300a459a72a385d7c73d3259e2ed7dcb2af674838cfa9" 388 + checksum = "9330f8b2ff13f34540b44e946ef35111825727b38d33286ef986142615121801" 352 389 353 390 [[package]] 354 391 name = "cfg_aliases" ··· 358 395 359 396 [[package]] 360 397 name = "chrono" 361 - version = "0.4.41" 398 + version = "0.4.42" 362 399 source = "registry+https://github.com/rust-lang/crates.io-index" 363 - checksum = "c469d952047f47f91b68d1cba3f10d63c11d73e4636f24f08daf0278abf01c4d" 400 + checksum = "145052bdd345b87320e369255277e3fb5152762ad123a901ef5c262dd38fe8d2" 364 401 dependencies = [ 365 - "android-tzdata", 366 - "iana-time-zone", 367 402 "num-traits", 368 - "windows-link", 403 + "serde", 369 404 ] 370 405 371 406 [[package]] ··· 381 416 "serde_bytes", 382 417 "unsigned-varint", 383 418 ] 384 - 385 - [[package]] 386 - name = "clap" 387 - version = "4.5.47" 388 - source = "registry+https://github.com/rust-lang/crates.io-index" 389 - checksum = "7eac00902d9d136acd712710d71823fb8ac8004ca445a89e73a41d45aa712931" 390 - dependencies = [ 391 - "clap_builder", 392 - "clap_derive", 393 - ] 394 - 395 - [[package]] 396 - name = "clap_builder" 397 - version = "4.5.47" 398 - source = "registry+https://github.com/rust-lang/crates.io-index" 399 - checksum = "2ad9bbf750e73b5884fb8a211a9424a1906c1e156724260fdae972f31d70e1d6" 400 - dependencies = [ 401 - "anstream", 402 - "anstyle", 403 - "clap_lex", 404 - "strsim", 405 - ] 406 - 407 - [[package]] 408 - name = "clap_derive" 409 - version = "4.5.47" 410 - source = "registry+https://github.com/rust-lang/crates.io-index" 411 - checksum = "bbfd7eae0b0f1a6e63d4b13c9c478de77c2eb546fba158ad50b4203dc24b9f9c" 412 - dependencies = [ 413 - "heck", 414 - "proc-macro2", 415 - "quote", 416 - "syn", 417 - ] 418 - 419 - [[package]] 420 - name = "clap_lex" 421 - version = "0.7.5" 422 - source = "registry+https://github.com/rust-lang/crates.io-index" 423 - checksum = "b94f61472cee1439c0b966b47e3aca9ae07e45d070759512cd390ea2bebc6675" 424 - 425 - [[package]] 426 - name = "colorchoice" 427 - version = "1.0.4" 428 - source = "registry+https://github.com/rust-lang/crates.io-index" 429 - checksum = "b05b61dc5112cbb17e4b6cd61790d9845d13888356391624cbe7e41efeac1e75" 430 419 431 420 [[package]] 432 421 name = "combine" ··· 458 447 checksum = "c2459377285ad874054d797f3ccebf984978aa39129f6eafde5cdc8315b612f8" 459 448 460 449 [[package]] 450 + name = "const-str" 451 + version = "0.4.3" 452 + source = "registry+https://github.com/rust-lang/crates.io-index" 453 + checksum = "2f421161cb492475f1661ddc9815a745a1c894592070661180fdec3d4872e9c3" 454 + 455 + [[package]] 461 456 name = "core-foundation" 462 457 version = "0.9.4" 463 458 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 600 595 checksum = "8d162beedaa69905488a8da94f5ac3edb4dd4788b732fadb7bd120b2625c1976" 601 596 dependencies = [ 602 597 "data-encoding", 603 - "syn", 598 + "syn 2.0.108", 604 599 ] 605 600 606 601 [[package]] ··· 665 660 dependencies = [ 666 661 "proc-macro2", 667 662 "quote", 668 - "syn", 663 + "syn 2.0.108", 669 664 ] 670 665 671 666 [[package]] ··· 684 679 "digest", 685 680 "elliptic-curve", 686 681 "rfc6979", 682 + "serdect", 687 683 "signature", 688 684 "spki", 689 685 ] ··· 739 735 "heck", 740 736 "proc-macro2", 741 737 "quote", 742 - "syn", 738 + "syn 2.0.108", 743 739 ] 744 740 745 741 [[package]] ··· 750 746 751 747 [[package]] 752 748 name = "errno" 753 - version = "0.3.13" 749 + version = "0.3.14" 754 750 source = "registry+https://github.com/rust-lang/crates.io-index" 755 - checksum = "778e2ac28f6c47af28e4907f13ffd1e1ddbd400980a9abd7c8df189bf578a5ad" 751 + checksum = "39cab71617ae0d63f51a36d69f866391735b51691dbda63cf6f96d042b63efeb" 756 752 dependencies = [ 757 753 "libc", 758 - "windows-sys 0.60.2", 754 + "windows-sys 0.61.2", 759 755 ] 760 756 761 757 [[package]] ··· 798 794 799 795 [[package]] 800 796 name = "find-msvc-tools" 801 - version = "0.1.1" 797 + version = "0.1.4" 802 798 source = "registry+https://github.com/rust-lang/crates.io-index" 803 - checksum = "7fd99930f64d146689264c637b5af2f0233a933bef0d8570e2526bf9e083192d" 799 + checksum = "52051878f80a721bb68ebfbc930e07b65ba72f2da88968ea5c06fd6ca3d3a127" 804 800 805 801 [[package]] 806 802 name = "flume" ··· 850 846 ] 851 847 852 848 [[package]] 849 + name = "futures" 850 + version = "0.3.31" 851 + source = "registry+https://github.com/rust-lang/crates.io-index" 852 + checksum = "65bc07b1a8bc7c85c5f2e110c476c7389b4554ba72af57d8445ea63a576b0876" 853 + dependencies = [ 854 + "futures-channel", 855 + "futures-core", 856 + "futures-executor", 857 + "futures-io", 858 + "futures-sink", 859 + "futures-task", 860 + "futures-util", 861 + ] 862 + 863 + [[package]] 853 864 name = "futures-channel" 854 865 version = "0.3.31" 855 866 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 901 912 dependencies = [ 902 913 "proc-macro2", 903 914 "quote", 904 - "syn", 915 + "syn 2.0.108", 905 916 ] 906 917 907 918 [[package]] ··· 922 933 source = "registry+https://github.com/rust-lang/crates.io-index" 923 934 checksum = "9fa08315bb612088cc391249efdc3bc77536f16c91f6cf495e6fbe85b20a4a81" 924 935 dependencies = [ 936 + "futures-channel", 925 937 "futures-core", 926 938 "futures-io", 927 939 "futures-macro", ··· 934 946 ] 935 947 936 948 [[package]] 937 - name = "generator" 938 - version = "0.8.7" 939 - source = "registry+https://github.com/rust-lang/crates.io-index" 940 - checksum = "605183a538e3e2a9c1038635cc5c2d194e2ee8fd0d1b66b8349fad7dbacce5a2" 941 - dependencies = [ 942 - "cc", 943 - "cfg-if", 944 - "libc", 945 - "log", 946 - "rustversion", 947 - "windows", 948 - ] 949 - 950 - [[package]] 951 949 name = "generic-array" 952 - version = "0.14.7" 950 + version = "0.14.9" 953 951 source = "registry+https://github.com/rust-lang/crates.io-index" 954 - checksum = "85649ca51fd72272d7821adaf274ad91c288277713d9c18820d8499a7ff69e9a" 952 + checksum = "4bb6743198531e02858aeaea5398fcc883e71851fcbcb5a2f773e2fb6cb1edf2" 955 953 dependencies = [ 956 954 "typenum", 957 955 "version_check", ··· 967 965 "cfg-if", 968 966 "js-sys", 969 967 "libc", 970 - "wasi 0.11.1+wasi-snapshot-preview1", 968 + "wasi", 971 969 "wasm-bindgen", 972 970 ] 973 971 974 972 [[package]] 975 973 name = "getrandom" 976 - version = "0.3.3" 974 + version = "0.3.4" 977 975 source = "registry+https://github.com/rust-lang/crates.io-index" 978 - checksum = "26145e563e54f2cadc477553f1ec5ee650b00862f0a58bcd12cbdc5f0ea2d2f4" 976 + checksum = "899def5c37c4fd7b2664648c28120ecec138e4d395b459e5ca34f9cce2dd77fd" 979 977 dependencies = [ 980 978 "cfg-if", 981 979 "js-sys", 982 980 "libc", 983 981 "r-efi", 984 - "wasi 0.14.3+wasi-0.2.4", 982 + "wasip2", 985 983 "wasm-bindgen", 986 984 ] 987 - 988 - [[package]] 989 - name = "gimli" 990 - version = "0.31.1" 991 - source = "registry+https://github.com/rust-lang/crates.io-index" 992 - checksum = "07e28edb80900c19c28f1072f2e8aeca7fa06b23cd4169cefe1af5aa3260783f" 993 985 994 986 [[package]] 995 987 name = "group" ··· 1033 1025 ] 1034 1026 1035 1027 [[package]] 1028 + name = "hashbrown" 1029 + version = "0.16.0" 1030 + source = "registry+https://github.com/rust-lang/crates.io-index" 1031 + checksum = "5419bdc4f6a9207fbeba6d11b604d481addf78ecd10c11ad51e76c2f6482748d" 1032 + 1033 + [[package]] 1036 1034 name = "hashlink" 1037 1035 version = "0.10.0" 1038 1036 source = "registry+https://github.com/rust-lang/crates.io-index" 1039 1037 checksum = "7382cf6263419f2d8df38c55d7da83da5c18aef87fc7a7fc1fb1e344edfe14c1" 1040 1038 dependencies = [ 1041 - "hashbrown", 1039 + "hashbrown 0.15.5", 1042 1040 ] 1043 1041 1044 1042 [[package]] ··· 1077 1075 "once_cell", 1078 1076 "rand 0.9.2", 1079 1077 "ring", 1080 - "thiserror 2.0.16", 1078 + "thiserror 2.0.17", 1081 1079 "tinyvec", 1082 1080 "tokio", 1083 1081 "tracing", ··· 1100 1098 "rand 0.9.2", 1101 1099 "resolv-conf", 1102 1100 "smallvec", 1103 - "thiserror 2.0.16", 1101 + "thiserror 2.0.17", 1104 1102 "tokio", 1105 1103 "tracing", 1106 1104 ] ··· 1125 1123 1126 1124 [[package]] 1127 1125 name = "home" 1128 - version = "0.5.11" 1126 + version = "0.5.12" 1129 1127 source = "registry+https://github.com/rust-lang/crates.io-index" 1130 - checksum = "589533453244b0995c858700322199b2becb13b627df2851f64a2775d024abcf" 1128 + checksum = "cc627f471c528ff0c4a49e1d5e60450c8f6461dd6d10ba9dcd3a61d3dff7728d" 1131 1129 dependencies = [ 1132 - "windows-sys 0.59.0", 1130 + "windows-sys 0.61.2", 1133 1131 ] 1134 1132 1135 1133 [[package]] ··· 1167 1165 ] 1168 1166 1169 1167 [[package]] 1168 + name = "http-range-header" 1169 + version = "0.4.2" 1170 + source = "registry+https://github.com/rust-lang/crates.io-index" 1171 + checksum = "9171a2ea8a68358193d15dd5d70c1c10a2afc3e7e4c5bc92bc9f025cebd7359c" 1172 + 1173 + [[package]] 1170 1174 name = "httparse" 1171 1175 version = "1.10.1" 1172 1176 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 1236 1240 1237 1241 [[package]] 1238 1242 name = "hyper-util" 1239 - version = "0.1.16" 1243 + version = "0.1.17" 1240 1244 source = "registry+https://github.com/rust-lang/crates.io-index" 1241 - checksum = "8d9b05277c7e8da2c93a568989bb6207bef0112e8d17df7a6eda4a3cf143bc5e" 1245 + checksum = "3c6995591a8f1380fcb4ba966a252a4b29188d51d2b89e3a252f5305be65aea8" 1242 1246 dependencies = [ 1243 1247 "base64", 1244 1248 "bytes", ··· 1252 1256 "libc", 1253 1257 "percent-encoding", 1254 1258 "pin-project-lite", 1255 - "socket2 0.6.0", 1259 + "socket2 0.6.1", 1256 1260 "system-configuration", 1257 1261 "tokio", 1258 1262 "tower-service", ··· 1261 1265 ] 1262 1266 1263 1267 [[package]] 1264 - name = "iana-time-zone" 1265 - version = "0.1.63" 1266 - source = "registry+https://github.com/rust-lang/crates.io-index" 1267 - checksum = "b0c919e5debc312ad217002b8048a17b7d83f80703865bbfcfebb0458b0b27d8" 1268 - dependencies = [ 1269 - "android_system_properties", 1270 - "core-foundation-sys", 1271 - "iana-time-zone-haiku", 1272 - "js-sys", 1273 - "log", 1274 - "wasm-bindgen", 1275 - "windows-core", 1276 - ] 1277 - 1278 - [[package]] 1279 - name = "iana-time-zone-haiku" 1280 - version = "0.1.2" 1281 - source = "registry+https://github.com/rust-lang/crates.io-index" 1282 - checksum = "f31827a206f56af32e590ba56d5d2d085f558508192593743f16b2306495269f" 1283 - dependencies = [ 1284 - "cc", 1285 - ] 1286 - 1287 - [[package]] 1288 1268 name = "icu_collections" 1289 - version = "2.0.0" 1269 + version = "2.1.1" 1290 1270 source = "registry+https://github.com/rust-lang/crates.io-index" 1291 - checksum = "200072f5d0e3614556f94a9930d5dc3e0662a652823904c3a75dc3b0af7fee47" 1271 + checksum = "4c6b649701667bbe825c3b7e6388cb521c23d88644678e83c0c4d0a621a34b43" 1292 1272 dependencies = [ 1293 1273 "displaydoc", 1294 1274 "potential_utf", ··· 1299 1279 1300 1280 [[package]] 1301 1281 name = "icu_locale_core" 1302 - version = "2.0.0" 1282 + version = "2.1.1" 1303 1283 source = "registry+https://github.com/rust-lang/crates.io-index" 1304 - checksum = "0cde2700ccaed3872079a65fb1a78f6c0a36c91570f28755dda67bc8f7d9f00a" 1284 + checksum = "edba7861004dd3714265b4db54a3c390e880ab658fec5f7db895fae2046b5bb6" 1305 1285 dependencies = [ 1306 1286 "displaydoc", 1307 1287 "litemap", ··· 1312 1292 1313 1293 [[package]] 1314 1294 name = "icu_normalizer" 1315 - version = "2.0.0" 1295 + version = "2.1.1" 1316 1296 source = "registry+https://github.com/rust-lang/crates.io-index" 1317 - checksum = "436880e8e18df4d7bbc06d58432329d6458cc84531f7ac5f024e93deadb37979" 1297 + checksum = "5f6c8828b67bf8908d82127b2054ea1b4427ff0230ee9141c54251934ab1b599" 1318 1298 dependencies = [ 1319 - "displaydoc", 1320 1299 "icu_collections", 1321 1300 "icu_normalizer_data", 1322 1301 "icu_properties", ··· 1327 1306 1328 1307 [[package]] 1329 1308 name = "icu_normalizer_data" 1330 - version = "2.0.0" 1309 + version = "2.1.1" 1331 1310 source = "registry+https://github.com/rust-lang/crates.io-index" 1332 - checksum = "00210d6893afc98edb752b664b8890f0ef174c8adbb8d0be9710fa66fbbf72d3" 1311 + checksum = "7aedcccd01fc5fe81e6b489c15b247b8b0690feb23304303a9e560f37efc560a" 1333 1312 1334 1313 [[package]] 1335 1314 name = "icu_properties" 1336 - version = "2.0.1" 1315 + version = "2.1.1" 1337 1316 source = "registry+https://github.com/rust-lang/crates.io-index" 1338 - checksum = "016c619c1eeb94efb86809b015c58f479963de65bdb6253345c1a1276f22e32b" 1317 + checksum = "e93fcd3157766c0c8da2f8cff6ce651a31f0810eaa1c51ec363ef790bbb5fb99" 1339 1318 dependencies = [ 1340 - "displaydoc", 1341 1319 "icu_collections", 1342 1320 "icu_locale_core", 1343 1321 "icu_properties_data", 1344 1322 "icu_provider", 1345 - "potential_utf", 1346 1323 "zerotrie", 1347 1324 "zerovec", 1348 1325 ] 1349 1326 1350 1327 [[package]] 1351 1328 name = "icu_properties_data" 1352 - version = "2.0.1" 1329 + version = "2.1.1" 1353 1330 source = "registry+https://github.com/rust-lang/crates.io-index" 1354 - checksum = "298459143998310acd25ffe6810ed544932242d3f07083eee1084d83a71bd632" 1331 + checksum = "02845b3647bb045f1100ecd6480ff52f34c35f82d9880e029d329c21d1054899" 1355 1332 1356 1333 [[package]] 1357 1334 name = "icu_provider" 1358 - version = "2.0.0" 1335 + version = "2.1.1" 1359 1336 source = "registry+https://github.com/rust-lang/crates.io-index" 1360 - checksum = "03c80da27b5f4187909049ee2d72f276f0d9f99a42c306bd0131ecfe04d8e5af" 1337 + checksum = "85962cf0ce02e1e0a629cc34e7ca3e373ce20dda4c4d7294bbd0bf1fdb59e614" 1361 1338 dependencies = [ 1362 1339 "displaydoc", 1363 1340 "icu_locale_core", 1364 - "stable_deref_trait", 1365 - "tinystr", 1366 1341 "writeable", 1367 1342 "yoke", 1368 1343 "zerofrom", ··· 1393 1368 1394 1369 [[package]] 1395 1370 name = "indexmap" 1396 - version = "2.11.0" 1371 + version = "2.12.0" 1397 1372 source = "registry+https://github.com/rust-lang/crates.io-index" 1398 - checksum = "f2481980430f9f78649238835720ddccc57e52df14ffce1c6f37391d61b563e9" 1373 + checksum = "6717a8d2a5a929a1a2eb43a12812498ed141a0bcfb7e8f7844fbdbe4303bba9f" 1399 1374 dependencies = [ 1400 1375 "equivalent", 1401 - "hashbrown", 1402 - ] 1403 - 1404 - [[package]] 1405 - name = "io-uring" 1406 - version = "0.7.10" 1407 - source = "registry+https://github.com/rust-lang/crates.io-index" 1408 - checksum = "046fa2d4d00aea763528b4950358d0ead425372445dc8ff86312b3c69ff7727b" 1409 - dependencies = [ 1410 - "bitflags", 1411 - "cfg-if", 1412 - "libc", 1376 + "hashbrown 0.16.0", 1413 1377 ] 1414 1378 1415 1379 [[package]] ··· 1452 1416 ] 1453 1417 1454 1418 [[package]] 1455 - name = "is_terminal_polyfill" 1456 - version = "1.70.1" 1457 - source = "registry+https://github.com/rust-lang/crates.io-index" 1458 - checksum = "7943c866cc5cd64cbc25b2e01621d07fa8eb2a1a23160ee81ce38704e97b8ecf" 1459 - 1460 - [[package]] 1461 1419 name = "itoa" 1462 1420 version = "1.0.15" 1463 1421 source = "registry+https://github.com/rust-lang/crates.io-index" 1464 1422 checksum = "4a5f13b858c8d314ee3e8f639011f7ccefe71f97f96e50151fb991f267928e2c" 1465 1423 1466 1424 [[package]] 1425 + name = "jobserver" 1426 + version = "0.1.34" 1427 + source = "registry+https://github.com/rust-lang/crates.io-index" 1428 + checksum = "9afb3de4395d6b3e67a780b6de64b51c978ecf11cb9a462c66be7d4ca9039d33" 1429 + dependencies = [ 1430 + "getrandom 0.3.4", 1431 + "libc", 1432 + ] 1433 + 1434 + [[package]] 1467 1435 name = "js-sys" 1468 - version = "0.3.78" 1436 + version = "0.3.82" 1469 1437 source = "registry+https://github.com/rust-lang/crates.io-index" 1470 - checksum = "0c0b063578492ceec17683ef2f8c5e89121fbd0b172cbc280635ab7567db2738" 1438 + checksum = "b011eec8cc36da2aab2d5cff675ec18454fad408585853910a202391cf9f8e65" 1471 1439 dependencies = [ 1472 1440 "once_cell", 1473 1441 "wasm-bindgen", ··· 1498 1466 1499 1467 [[package]] 1500 1468 name = "libc" 1501 - version = "0.2.175" 1469 + version = "0.2.177" 1502 1470 source = "registry+https://github.com/rust-lang/crates.io-index" 1503 - checksum = "6a82ae493e598baaea5209805c49bbf2ea7de956d50d7da0da1164f9c6d28543" 1471 + checksum = "2874a2af47a2325c2001a6e6fad9b16a53b802102b528163885171cf92b15976" 1504 1472 1505 1473 [[package]] 1506 1474 name = "libm" ··· 1510 1478 1511 1479 [[package]] 1512 1480 name = "libredox" 1513 - version = "0.1.9" 1481 + version = "0.1.10" 1514 1482 source = "registry+https://github.com/rust-lang/crates.io-index" 1515 - checksum = "391290121bad3d37fbddad76d8f5d1c1c314cfc646d143d7e07a3086ddff0ce3" 1483 + checksum = "416f7e718bdb06000964960ffa43b4335ad4012ae8b99060261aa4a8088d5ccb" 1516 1484 dependencies = [ 1517 1485 "bitflags", 1518 1486 "libc", ··· 1532 1500 1533 1501 [[package]] 1534 1502 name = "linux-raw-sys" 1535 - version = "0.9.4" 1503 + version = "0.11.0" 1536 1504 source = "registry+https://github.com/rust-lang/crates.io-index" 1537 - checksum = "cd945864f07fe9f5371a27ad7b52a172b4b499999f1d97574c9fa68373937e12" 1505 + checksum = "df1d3c3b53da64cf5760482273a98e575c651a67eec7f77df96b5b642de8f039" 1538 1506 1539 1507 [[package]] 1540 1508 name = "litemap" 1541 - version = "0.8.0" 1509 + version = "0.8.1" 1542 1510 source = "registry+https://github.com/rust-lang/crates.io-index" 1543 - checksum = "241eaef5fd12c88705a01fc1066c48c4b36e0dd4377dcdc7ec3942cea7a69956" 1511 + checksum = "6373607a59f0be73a39b6fe456b8192fcc3585f602af20751600e974dd455e77" 1544 1512 1545 1513 [[package]] 1546 1514 name = "lock_api" 1547 - version = "0.4.13" 1515 + version = "0.4.14" 1548 1516 source = "registry+https://github.com/rust-lang/crates.io-index" 1549 - checksum = "96936507f153605bddfcda068dd804796c84324ed2510809e5b2a624c81da765" 1517 + checksum = "224399e74b87b5f3557511d98dff8b14089b3dadafcab6bb93eab67d3aace965" 1550 1518 dependencies = [ 1551 - "autocfg", 1552 1519 "scopeguard", 1553 1520 ] 1554 1521 ··· 1559 1526 checksum = "34080505efa8e45a4b816c349525ebe327ceaa8559756f0356cba97ef3bf7432" 1560 1527 1561 1528 [[package]] 1562 - name = "loom" 1563 - version = "0.7.2" 1564 - source = "registry+https://github.com/rust-lang/crates.io-index" 1565 - checksum = "419e0dc8046cb947daa77eb95ae174acfbddb7673b4151f56d1eed8e93fbfaca" 1566 - dependencies = [ 1567 - "cfg-if", 1568 - "generator", 1569 - "scoped-tls", 1570 - "tracing", 1571 - "tracing-subscriber", 1572 - ] 1573 - 1574 - [[package]] 1575 1529 name = "lru" 1576 1530 version = "0.12.5" 1577 1531 source = "registry+https://github.com/rust-lang/crates.io-index" 1578 1532 checksum = "234cf4f4a04dc1f57e24b96cc0cd600cf2af460d4161ac5ecdd0af8e1f3b2a38" 1579 1533 dependencies = [ 1580 - "hashbrown", 1534 + "hashbrown 0.15.5", 1581 1535 ] 1582 1536 1583 1537 [[package]] ··· 1585 1539 version = "0.1.2" 1586 1540 source = "registry+https://github.com/rust-lang/crates.io-index" 1587 1541 checksum = "112b39cec0b298b6c1999fee3e31427f74f676e4cb9879ed1a121b43661a4154" 1542 + 1543 + [[package]] 1544 + name = "match-lookup" 1545 + version = "0.1.1" 1546 + source = "registry+https://github.com/rust-lang/crates.io-index" 1547 + checksum = "1265724d8cb29dbbc2b0f06fffb8bf1a8c0cf73a78eede9ba73a4a66c52a981e" 1548 + dependencies = [ 1549 + "proc-macro2", 1550 + "quote", 1551 + "syn 1.0.109", 1552 + ] 1588 1553 1589 1554 [[package]] 1590 1555 name = "matchers" ··· 1613 1578 1614 1579 [[package]] 1615 1580 name = "memchr" 1616 - version = "2.7.5" 1581 + version = "2.7.6" 1617 1582 source = "registry+https://github.com/rust-lang/crates.io-index" 1618 - checksum = "32a282da65faaf38286cf3be983213fcf1d2e2a58700e808f83f4ea9a4804bc0" 1583 + checksum = "f52b00d39961fc5b2736ea853c9cc86238e165017a493d1d5c8eac6bdc4cc273" 1619 1584 1620 1585 [[package]] 1621 1586 name = "metrohash" ··· 1630 1595 checksum = "6877bb514081ee2a7ff5ef9de3281f14a4dd4bceac4c09388074a6b5df8a139a" 1631 1596 1632 1597 [[package]] 1633 - name = "miniz_oxide" 1634 - version = "0.8.9" 1598 + name = "mime_guess" 1599 + version = "2.0.5" 1635 1600 source = "registry+https://github.com/rust-lang/crates.io-index" 1636 - checksum = "1fa76a2c86f704bdb222d66965fb3d63269ce38518b83cb0575fca855ebb6316" 1601 + checksum = "f7c44f8e672c00fe5308fa235f821cb4198414e1c77935c1ab6948d3fd78550e" 1637 1602 dependencies = [ 1638 - "adler2", 1603 + "mime", 1604 + "unicase", 1639 1605 ] 1640 1606 1641 1607 [[package]] 1642 1608 name = "mio" 1643 - version = "1.0.4" 1609 + version = "1.1.0" 1644 1610 source = "registry+https://github.com/rust-lang/crates.io-index" 1645 - checksum = "78bed444cc8a2160f01cbcf811ef18cac863ad68ae8ca62092e8db51d51c761c" 1611 + checksum = "69d83b0086dc8ecf3ce9ae2874b2d1290252e2a30720bea58a5c6639b0092873" 1646 1612 dependencies = [ 1647 1613 "libc", 1648 - "wasi 0.11.1+wasi-snapshot-preview1", 1649 - "windows-sys 0.59.0", 1614 + "wasi", 1615 + "windows-sys 0.61.2", 1650 1616 ] 1651 1617 1652 1618 [[package]] 1653 1619 name = "moka" 1654 - version = "0.12.10" 1620 + version = "0.12.11" 1655 1621 source = "registry+https://github.com/rust-lang/crates.io-index" 1656 - checksum = "a9321642ca94a4282428e6ea4af8cc2ca4eac48ac7a6a4ea8f33f76d0ce70926" 1622 + checksum = "8261cd88c312e0004c1d51baad2980c66528dfdb2bee62003e643a4d8f86b077" 1657 1623 dependencies = [ 1658 1624 "crossbeam-channel", 1659 1625 "crossbeam-epoch", 1660 1626 "crossbeam-utils", 1661 - "loom", 1627 + "equivalent", 1662 1628 "parking_lot", 1663 1629 "portable-atomic", 1664 1630 "rustc_version", 1665 1631 "smallvec", 1666 1632 "tagptr", 1667 - "thiserror 1.0.69", 1668 1633 "uuid", 1669 1634 ] 1670 1635 1671 1636 [[package]] 1672 1637 name = "multibase" 1673 - version = "0.9.1" 1638 + version = "0.9.2" 1674 1639 source = "registry+https://github.com/rust-lang/crates.io-index" 1675 - checksum = "9b3539ec3c1f04ac9748a260728e855f261b4977f5c3406612c884564f329404" 1640 + checksum = "8694bb4835f452b0e3bb06dbebb1d6fc5385b6ca1caf2e55fd165c042390ec77" 1676 1641 dependencies = [ 1677 1642 "base-x", 1643 + "base256emoji", 1678 1644 "data-encoding", 1679 1645 "data-encoding-macro", 1680 1646 ] ··· 1709 1675 1710 1676 [[package]] 1711 1677 name = "nu-ansi-term" 1712 - version = "0.50.1" 1678 + version = "0.50.3" 1713 1679 source = "registry+https://github.com/rust-lang/crates.io-index" 1714 - checksum = "d4a28e057d01f97e61255210fcff094d74ed0466038633e95017f5beb68e4399" 1680 + checksum = "7957b9740744892f114936ab4a57b3f487491bbeafaf8083688b16841a4240e5" 1715 1681 dependencies = [ 1716 - "windows-sys 0.52.0", 1682 + "windows-sys 0.61.2", 1717 1683 ] 1718 1684 1719 1685 [[package]] ··· 1728 1694 1729 1695 [[package]] 1730 1696 name = "num-bigint-dig" 1731 - version = "0.8.4" 1697 + version = "0.8.5" 1732 1698 source = "registry+https://github.com/rust-lang/crates.io-index" 1733 - checksum = "dc84195820f291c7697304f3cbdadd1cb7199c0efc917ff5eafd71225c136151" 1699 + checksum = "82c79c15c05d4bf82b6f5ef163104cc81a760d8e874d38ac50ab67c8877b647b" 1734 1700 dependencies = [ 1735 - "byteorder", 1736 1701 "lazy_static", 1737 1702 "libm", 1738 1703 "num-integer", ··· 1784 1749 ] 1785 1750 1786 1751 [[package]] 1787 - name = "object" 1788 - version = "0.36.7" 1789 - source = "registry+https://github.com/rust-lang/crates.io-index" 1790 - checksum = "62948e14d923ea95ea2c7c86c71013138b66525b86bdc08d2dcc262bdb497b87" 1791 - dependencies = [ 1792 - "memchr", 1793 - ] 1794 - 1795 - [[package]] 1796 1752 name = "once_cell" 1797 1753 version = "1.21.3" 1798 1754 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 1803 1759 ] 1804 1760 1805 1761 [[package]] 1806 - name = "once_cell_polyfill" 1807 - version = "1.70.1" 1808 - source = "registry+https://github.com/rust-lang/crates.io-index" 1809 - checksum = "a4895175b425cb1f87721b59f0f286c2092bd4af812243672510e1ac53e2e0ad" 1810 - 1811 - [[package]] 1812 1762 name = "openssl" 1813 - version = "0.10.73" 1763 + version = "0.10.74" 1814 1764 source = "registry+https://github.com/rust-lang/crates.io-index" 1815 - checksum = "8505734d46c8ab1e19a1dce3aef597ad87dcb4c37e7188231769bd6bd51cebf8" 1765 + checksum = "24ad14dd45412269e1a30f52ad8f0664f0f4f4a89ee8fe28c3b3527021ebb654" 1816 1766 dependencies = [ 1817 1767 "bitflags", 1818 1768 "cfg-if", ··· 1831 1781 dependencies = [ 1832 1782 "proc-macro2", 1833 1783 "quote", 1834 - "syn", 1784 + "syn 2.0.108", 1835 1785 ] 1836 1786 1837 1787 [[package]] ··· 1842 1792 1843 1793 [[package]] 1844 1794 name = "openssl-sys" 1845 - version = "0.9.109" 1795 + version = "0.9.110" 1846 1796 source = "registry+https://github.com/rust-lang/crates.io-index" 1847 - checksum = "90096e2e47630d78b7d1c20952dc621f957103f8bc2c8359ec81290d75238571" 1797 + checksum = "0a9f0075ba3c21b09f8e8b2026584b1d18d49388648f2fbbf3c97ea8deced8e2" 1848 1798 dependencies = [ 1849 1799 "cc", 1850 1800 "libc", ··· 1861 1811 "ecdsa", 1862 1812 "elliptic-curve", 1863 1813 "primeorder", 1814 + "serdect", 1864 1815 "sha2", 1865 1816 ] 1866 1817 ··· 1873 1824 "ecdsa", 1874 1825 "elliptic-curve", 1875 1826 "primeorder", 1827 + "serdect", 1876 1828 "sha2", 1877 1829 ] 1878 1830 ··· 1884 1836 1885 1837 [[package]] 1886 1838 name = "parking_lot" 1887 - version = "0.12.4" 1839 + version = "0.12.5" 1888 1840 source = "registry+https://github.com/rust-lang/crates.io-index" 1889 - checksum = "70d58bf43669b5795d1576d0641cfb6fbb2057bf629506267a92807158584a13" 1841 + checksum = "93857453250e3077bd71ff98b6a65ea6621a19bb0f559a85248955ac12c45a1a" 1890 1842 dependencies = [ 1891 1843 "lock_api", 1892 1844 "parking_lot_core", ··· 1894 1846 1895 1847 [[package]] 1896 1848 name = "parking_lot_core" 1897 - version = "0.9.11" 1849 + version = "0.9.12" 1898 1850 source = "registry+https://github.com/rust-lang/crates.io-index" 1899 - checksum = "bc838d2a56b5b1a6c25f55575dfc605fabb63bb2365f6c2353ef9159aa69e4a5" 1851 + checksum = "2621685985a2ebf1c516881c026032ac7deafcda1a2c9b7850dc81e3dfcb64c1" 1900 1852 dependencies = [ 1901 1853 "cfg-if", 1902 1854 "libc", 1903 1855 "redox_syscall", 1904 1856 "smallvec", 1905 - "windows-targets 0.52.6", 1857 + "windows-link 0.2.1", 1906 1858 ] 1907 1859 1908 1860 [[package]] ··· 1967 1919 1968 1920 [[package]] 1969 1921 name = "potential_utf" 1970 - version = "0.1.3" 1922 + version = "0.1.4" 1971 1923 source = "registry+https://github.com/rust-lang/crates.io-index" 1972 - checksum = "84df19adbe5b5a0782edcab45899906947ab039ccf4573713735ee7de1e6b08a" 1924 + checksum = "b73949432f5e2a09657003c25bca5e19a0e9c84f8058ca374f49e0ebe605af77" 1973 1925 dependencies = [ 1974 1926 "zerovec", 1975 1927 ] ··· 1990 1942 checksum = "353e1ca18966c16d9deb1c69278edbc5f194139612772bd9537af60ac231e1e6" 1991 1943 dependencies = [ 1992 1944 "elliptic-curve", 1945 + "serdect", 1993 1946 ] 1994 1947 1995 1948 [[package]] 1996 1949 name = "proc-macro2" 1997 - version = "1.0.101" 1950 + version = "1.0.103" 1998 1951 source = "registry+https://github.com/rust-lang/crates.io-index" 1999 - checksum = "89ae43fd86e4158d6db51ad8e2b80f313af9cc74f5c0e03ccb87de09998732de" 1952 + checksum = "5ee95bc4ef87b8d5ba32e8b7714ccc834865276eab0aed5c9958d00ec45f49e8" 2000 1953 dependencies = [ 2001 1954 "unicode-ident", 2002 1955 ] 2003 1956 2004 1957 [[package]] 2005 1958 name = "quickdid" 2006 - version = "1.0.0-rc.2" 1959 + version = "1.0.0-rc.5" 2007 1960 dependencies = [ 2008 1961 "anyhow", 2009 1962 "async-trait", 2010 1963 "atproto-identity", 1964 + "atproto-jetstream", 1965 + "atproto-lexicon", 2011 1966 "axum", 2012 1967 "bincode", 2013 - "clap", 1968 + "cadence", 2014 1969 "deadpool-redis", 1970 + "httpdate", 2015 1971 "metrohash", 1972 + "once_cell", 2016 1973 "reqwest", 2017 1974 "serde", 2018 1975 "serde_json", 2019 1976 "sqlx", 2020 - "thiserror 2.0.16", 1977 + "thiserror 2.0.17", 2021 1978 "tokio", 2022 1979 "tokio-util", 1980 + "tower-http", 2023 1981 "tracing", 2024 1982 "tracing-subscriber", 2025 1983 ] ··· 2037 1995 "quinn-udp", 2038 1996 "rustc-hash", 2039 1997 "rustls", 2040 - "socket2 0.6.0", 2041 - "thiserror 2.0.16", 1998 + "socket2 0.6.1", 1999 + "thiserror 2.0.17", 2042 2000 "tokio", 2043 2001 "tracing", 2044 2002 "web-time", ··· 2051 2009 checksum = "f1906b49b0c3bc04b5fe5d86a77925ae6524a19b816ae38ce1e426255f1d8a31" 2052 2010 dependencies = [ 2053 2011 "bytes", 2054 - "getrandom 0.3.3", 2012 + "getrandom 0.3.4", 2055 2013 "lru-slab", 2056 2014 "rand 0.9.2", 2057 2015 "ring", ··· 2059 2017 "rustls", 2060 2018 "rustls-pki-types", 2061 2019 "slab", 2062 - "thiserror 2.0.16", 2020 + "thiserror 2.0.17", 2063 2021 "tinyvec", 2064 2022 "tracing", 2065 2023 "web-time", ··· 2074 2032 "cfg_aliases", 2075 2033 "libc", 2076 2034 "once_cell", 2077 - "socket2 0.6.0", 2035 + "socket2 0.6.1", 2078 2036 "tracing", 2079 2037 "windows-sys 0.60.2", 2080 2038 ] 2081 2039 2082 2040 [[package]] 2083 2041 name = "quote" 2084 - version = "1.0.40" 2042 + version = "1.0.41" 2085 2043 source = "registry+https://github.com/rust-lang/crates.io-index" 2086 - checksum = "1885c039570dc00dcb4ff087a89e185fd56bae234ddc7f056a945bf36467248d" 2044 + checksum = "ce25767e7b499d1b604768e7cde645d14cc8584231ea6b295e9c9eb22c02e1d1" 2087 2045 dependencies = [ 2088 2046 "proc-macro2", 2089 2047 ] ··· 2150 2108 source = "registry+https://github.com/rust-lang/crates.io-index" 2151 2109 checksum = "99d9a13982dcf210057a8a78572b2217b667c3beacbf3a0d8b454f6f82837d38" 2152 2110 dependencies = [ 2153 - "getrandom 0.3.3", 2111 + "getrandom 0.3.4", 2154 2112 ] 2155 2113 2156 2114 [[package]] 2157 2115 name = "redis" 2158 - version = "0.32.5" 2116 + version = "0.32.7" 2159 2117 source = "registry+https://github.com/rust-lang/crates.io-index" 2160 - checksum = "7cd3650deebc68526b304898b192fa4102a4ef0b9ada24da096559cb60e0eef8" 2118 + checksum = "014cc767fefab6a3e798ca45112bccad9c6e0e218fbd49720042716c73cfef44" 2161 2119 dependencies = [ 2162 2120 "arc-swap", 2163 2121 "backon", ··· 2173 2131 "rustls", 2174 2132 "rustls-native-certs", 2175 2133 "ryu", 2176 - "socket2 0.6.0", 2134 + "socket2 0.6.1", 2177 2135 "tokio", 2178 2136 "tokio-rustls", 2179 2137 "tokio-util", ··· 2182 2140 2183 2141 [[package]] 2184 2142 name = "redox_syscall" 2185 - version = "0.5.17" 2143 + version = "0.5.18" 2186 2144 source = "registry+https://github.com/rust-lang/crates.io-index" 2187 - checksum = "5407465600fb0548f1442edf71dd20683c6ed326200ace4b1ef0763521bb3b77" 2145 + checksum = "ed2bf2547551a7053d6fdfafda3f938979645c44812fbfcda098faae3f1a362d" 2188 2146 dependencies = [ 2189 2147 "bitflags", 2190 2148 ] 2191 2149 2192 2150 [[package]] 2193 2151 name = "regex-automata" 2194 - version = "0.4.10" 2152 + version = "0.4.13" 2195 2153 source = "registry+https://github.com/rust-lang/crates.io-index" 2196 - checksum = "6b9458fa0bfeeac22b5ca447c63aaf45f28439a709ccd244698632f9aa6394d6" 2154 + checksum = "5276caf25ac86c8d810222b3dbb938e512c55c6831a10f3e6ed1c93b84041f1c" 2197 2155 dependencies = [ 2198 2156 "aho-corasick", 2199 2157 "memchr", ··· 2202 2160 2203 2161 [[package]] 2204 2162 name = "regex-syntax" 2205 - version = "0.8.6" 2163 + version = "0.8.8" 2206 2164 source = "registry+https://github.com/rust-lang/crates.io-index" 2207 - checksum = "caf4aa5b0f434c91fe5c7f1ecb6a5ece2130b02ad2a590589dda5146df959001" 2165 + checksum = "7a2d987857b319362043e95f5353c0535c1f58eec5336fdfcf626430af7def58" 2208 2166 2209 2167 [[package]] 2210 2168 name = "reqwest" 2211 - version = "0.12.23" 2169 + version = "0.12.24" 2212 2170 source = "registry+https://github.com/rust-lang/crates.io-index" 2213 - checksum = "d429f34c8092b2d42c7c93cec323bb4adeb7c67698f70839adec842ec10c7ceb" 2171 + checksum = "9d0946410b9f7b082a427e4ef5c8ff541a88b357bc6c637c40db3a68ac70a36f" 2214 2172 dependencies = [ 2215 2173 "base64", 2216 2174 "bytes", 2217 2175 "encoding_rs", 2218 2176 "futures-core", 2177 + "futures-util", 2219 2178 "h2", 2220 2179 "http", 2221 2180 "http-body", ··· 2227 2186 "js-sys", 2228 2187 "log", 2229 2188 "mime", 2189 + "mime_guess", 2230 2190 "native-tls", 2231 2191 "percent-encoding", 2232 2192 "pin-project-lite", ··· 2251 2211 ] 2252 2212 2253 2213 [[package]] 2214 + name = "reqwest-chain" 2215 + version = "1.0.0" 2216 + source = "registry+https://github.com/rust-lang/crates.io-index" 2217 + checksum = "da5c014fb79a8227db44a0433d748107750d2550b7fca55c59a3d7ee7d2ee2b2" 2218 + dependencies = [ 2219 + "anyhow", 2220 + "async-trait", 2221 + "http", 2222 + "reqwest-middleware", 2223 + ] 2224 + 2225 + [[package]] 2226 + name = "reqwest-middleware" 2227 + version = "0.4.2" 2228 + source = "registry+https://github.com/rust-lang/crates.io-index" 2229 + checksum = "57f17d28a6e6acfe1733fe24bcd30774d13bffa4b8a22535b4c8c98423088d4e" 2230 + dependencies = [ 2231 + "anyhow", 2232 + "async-trait", 2233 + "http", 2234 + "reqwest", 2235 + "serde", 2236 + "thiserror 1.0.69", 2237 + "tower-service", 2238 + ] 2239 + 2240 + [[package]] 2254 2241 name = "resolv-conf" 2255 - version = "0.7.4" 2242 + version = "0.7.5" 2256 2243 source = "registry+https://github.com/rust-lang/crates.io-index" 2257 - checksum = "95325155c684b1c89f7765e30bc1c42e4a6da51ca513615660cb8a62ef9a88e3" 2244 + checksum = "6b3789b30bd25ba102de4beabd95d21ac45b69b1be7d14522bab988c526d6799" 2258 2245 2259 2246 [[package]] 2260 2247 name = "rfc6979" ··· 2301 2288 ] 2302 2289 2303 2290 [[package]] 2304 - name = "rustc-demangle" 2305 - version = "0.1.26" 2306 - source = "registry+https://github.com/rust-lang/crates.io-index" 2307 - checksum = "56f7d92ca342cea22a06f2121d944b4fd82af56988c270852495420f961d4ace" 2308 - 2309 - [[package]] 2310 2291 name = "rustc-hash" 2311 2292 version = "2.1.1" 2312 2293 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 2323 2304 2324 2305 [[package]] 2325 2306 name = "rustix" 2326 - version = "1.0.8" 2307 + version = "1.1.2" 2327 2308 source = "registry+https://github.com/rust-lang/crates.io-index" 2328 - checksum = "11181fbabf243db407ef8df94a6ce0b2f9a733bd8be4ad02b4eda9602296cac8" 2309 + checksum = "cd15f8a2c5551a84d56efdc1cd049089e409ac19a3072d5037a17fd70719ff3e" 2329 2310 dependencies = [ 2330 2311 "bitflags", 2331 2312 "errno", 2332 2313 "libc", 2333 2314 "linux-raw-sys", 2334 - "windows-sys 0.60.2", 2315 + "windows-sys 0.61.2", 2335 2316 ] 2336 2317 2337 2318 [[package]] 2338 2319 name = "rustls" 2339 - version = "0.23.31" 2320 + version = "0.23.34" 2340 2321 source = "registry+https://github.com/rust-lang/crates.io-index" 2341 - checksum = "c0ebcbd2f03de0fc1122ad9bb24b127a5a6cd51d72604a3f3c50ac459762b6cc" 2322 + checksum = "6a9586e9ee2b4f8fab52a0048ca7334d7024eef48e2cb9407e3497bb7cab7fa7" 2342 2323 dependencies = [ 2343 2324 "once_cell", 2344 2325 "ring", ··· 2350 2331 2351 2332 [[package]] 2352 2333 name = "rustls-native-certs" 2353 - version = "0.8.1" 2334 + version = "0.8.2" 2354 2335 source = "registry+https://github.com/rust-lang/crates.io-index" 2355 - checksum = "7fcff2dd52b58a8d98a70243663a0d234c4e2b79235637849d15913394a247d3" 2336 + checksum = "9980d917ebb0c0536119ba501e90834767bffc3d60641457fd84a1f3fd337923" 2356 2337 dependencies = [ 2357 2338 "openssl-probe", 2358 2339 "rustls-pki-types", 2359 2340 "schannel", 2360 - "security-framework 3.3.0", 2341 + "security-framework 3.5.1", 2361 2342 ] 2362 2343 2363 2344 [[package]] 2364 2345 name = "rustls-pki-types" 2365 - version = "1.12.0" 2346 + version = "1.13.0" 2366 2347 source = "registry+https://github.com/rust-lang/crates.io-index" 2367 - checksum = "229a4a4c221013e7e1f1a043678c5cc39fe5171437c88fb47151a21e6f5b5c79" 2348 + checksum = "94182ad936a0c91c324cd46c6511b9510ed16af436d7b5bab34beab0afd55f7a" 2368 2349 dependencies = [ 2369 2350 "web-time", 2370 2351 "zeroize", ··· 2372 2353 2373 2354 [[package]] 2374 2355 name = "rustls-webpki" 2375 - version = "0.103.4" 2356 + version = "0.103.8" 2376 2357 source = "registry+https://github.com/rust-lang/crates.io-index" 2377 - checksum = "0a17884ae0c1b773f1ccd2bd4a8c72f16da897310a98b0e84bf349ad5ead92fc" 2358 + checksum = "2ffdfa2f5286e2247234e03f680868ac2815974dc39e00ea15adc445d0aafe52" 2378 2359 dependencies = [ 2379 2360 "ring", 2380 2361 "rustls-pki-types", ··· 2395 2376 2396 2377 [[package]] 2397 2378 name = "schannel" 2398 - version = "0.1.27" 2379 + version = "0.1.28" 2399 2380 source = "registry+https://github.com/rust-lang/crates.io-index" 2400 - checksum = "1f29ebaa345f945cec9fbbc532eb307f0fdad8161f281b6369539c8d84876b3d" 2381 + checksum = "891d81b926048e76efe18581bf793546b4c0eaf8448d72be8de2bbee5fd166e1" 2401 2382 dependencies = [ 2402 - "windows-sys 0.59.0", 2383 + "windows-sys 0.61.2", 2403 2384 ] 2404 2385 2405 2386 [[package]] 2406 - name = "scoped-tls" 2407 - version = "1.0.1" 2408 - source = "registry+https://github.com/rust-lang/crates.io-index" 2409 - checksum = "e1cf6437eb19a8f4a6cc0f7dca544973b0b78843adbfeb3683d1a94a0024a294" 2410 - 2411 - [[package]] 2412 2387 name = "scopeguard" 2413 2388 version = "1.2.0" 2414 2389 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 2444 2419 2445 2420 [[package]] 2446 2421 name = "security-framework" 2447 - version = "3.3.0" 2422 + version = "3.5.1" 2448 2423 source = "registry+https://github.com/rust-lang/crates.io-index" 2449 - checksum = "80fb1d92c5028aa318b4b8bd7302a5bfcf48be96a37fc6fc790f806b0004ee0c" 2424 + checksum = "b3297343eaf830f66ede390ea39da1d462b6b0c1b000f420d0a83f898bbbe6ef" 2450 2425 dependencies = [ 2451 2426 "bitflags", 2452 2427 "core-foundation 0.10.1", ··· 2457 2432 2458 2433 [[package]] 2459 2434 name = "security-framework-sys" 2460 - version = "2.14.0" 2435 + version = "2.15.0" 2461 2436 source = "registry+https://github.com/rust-lang/crates.io-index" 2462 - checksum = "49db231d56a190491cb4aeda9527f1ad45345af50b0851622a7adb8c03b01c32" 2437 + checksum = "cc1f0cbffaac4852523ce30d8bd3c5cdc873501d96ff467ca09b6767bb8cd5c0" 2463 2438 dependencies = [ 2464 2439 "core-foundation-sys", 2465 2440 "libc", ··· 2467 2442 2468 2443 [[package]] 2469 2444 name = "semver" 2470 - version = "1.0.26" 2445 + version = "1.0.27" 2471 2446 source = "registry+https://github.com/rust-lang/crates.io-index" 2472 - checksum = "56e6fa9c48d24d85fb3de5ad847117517440f6beceb7798af16b4a87d616b8d0" 2447 + checksum = "d767eb0aabc880b29956c35734170f26ed551a859dbd361d140cdbeca61ab1e2" 2473 2448 2474 2449 [[package]] 2475 2450 name = "serde" 2476 - version = "1.0.219" 2451 + version = "1.0.228" 2477 2452 source = "registry+https://github.com/rust-lang/crates.io-index" 2478 - checksum = "5f0e2c6ed6606019b4e29e69dbaba95b11854410e5347d525002456dbbb786b6" 2453 + checksum = "9a8e94ea7f378bd32cbbd37198a4a91436180c5bb472411e48b5ec2e2124ae9e" 2479 2454 dependencies = [ 2455 + "serde_core", 2480 2456 "serde_derive", 2481 2457 ] 2482 2458 2483 2459 [[package]] 2484 2460 name = "serde_bytes" 2485 - version = "0.11.17" 2461 + version = "0.11.19" 2486 2462 source = "registry+https://github.com/rust-lang/crates.io-index" 2487 - checksum = "8437fd221bde2d4ca316d61b90e337e9e702b3820b87d63caa9ba6c02bd06d96" 2463 + checksum = "a5d440709e79d88e51ac01c4b72fc6cb7314017bb7da9eeff678aa94c10e3ea8" 2488 2464 dependencies = [ 2489 2465 "serde", 2466 + "serde_core", 2467 + ] 2468 + 2469 + [[package]] 2470 + name = "serde_core" 2471 + version = "1.0.228" 2472 + source = "registry+https://github.com/rust-lang/crates.io-index" 2473 + checksum = "41d385c7d4ca58e59fc732af25c3983b67ac852c1a25000afe1175de458b67ad" 2474 + dependencies = [ 2475 + "serde_derive", 2490 2476 ] 2491 2477 2492 2478 [[package]] 2493 2479 name = "serde_derive" 2494 - version = "1.0.219" 2480 + version = "1.0.228" 2495 2481 source = "registry+https://github.com/rust-lang/crates.io-index" 2496 - checksum = "5b0276cf7f2c73365f7157c8123c21cd9a50fbbd844757af28ca1f5925fc2a00" 2482 + checksum = "d540f220d3187173da220f885ab66608367b6574e925011a9353e4badda91d79" 2497 2483 dependencies = [ 2498 2484 "proc-macro2", 2499 2485 "quote", 2500 - "syn", 2486 + "syn 2.0.108", 2501 2487 ] 2502 2488 2503 2489 [[package]] 2504 2490 name = "serde_ipld_dagcbor" 2505 - version = "0.6.3" 2491 + version = "0.6.4" 2506 2492 source = "registry+https://github.com/rust-lang/crates.io-index" 2507 - checksum = "99600723cf53fb000a66175555098db7e75217c415bdd9a16a65d52a19dcc4fc" 2493 + checksum = "46182f4f08349a02b45c998ba3215d3f9de826246ba02bb9dddfe9a2a2100778" 2508 2494 dependencies = [ 2509 2495 "cbor4ii", 2510 2496 "ipld-core", ··· 2514 2500 2515 2501 [[package]] 2516 2502 name = "serde_json" 2517 - version = "1.0.143" 2503 + version = "1.0.145" 2518 2504 source = "registry+https://github.com/rust-lang/crates.io-index" 2519 - checksum = "d401abef1d108fbd9cbaebc3e46611f4b1021f714a0597a71f41ee463f5f4a5a" 2505 + checksum = "402a6f66d8c709116cf22f558eab210f5a50187f702eb4d7e5ef38d9a7f1c79c" 2520 2506 dependencies = [ 2521 2507 "itoa", 2522 2508 "memchr", 2523 2509 "ryu", 2524 2510 "serde", 2511 + "serde_core", 2525 2512 ] 2526 2513 2527 2514 [[package]] 2528 2515 name = "serde_path_to_error" 2529 - version = "0.1.17" 2516 + version = "0.1.20" 2530 2517 source = "registry+https://github.com/rust-lang/crates.io-index" 2531 - checksum = "59fab13f937fa393d08645bf3a84bdfe86e296747b506ada67bb15f10f218b2a" 2518 + checksum = "10a9ff822e371bb5403e391ecd83e182e0e77ba7f6fe0160b795797109d1b457" 2532 2519 dependencies = [ 2533 2520 "itoa", 2534 2521 "serde", 2522 + "serde_core", 2535 2523 ] 2536 2524 2537 2525 [[package]] ··· 2613 2601 ] 2614 2602 2615 2603 [[package]] 2604 + name = "simdutf8" 2605 + version = "0.1.5" 2606 + source = "registry+https://github.com/rust-lang/crates.io-index" 2607 + checksum = "e3a9fe34e3e7a50316060351f37187a3f546bce95496156754b601a5fa71b76e" 2608 + 2609 + [[package]] 2616 2610 name = "slab" 2617 2611 version = "0.4.11" 2618 2612 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 2639 2633 2640 2634 [[package]] 2641 2635 name = "socket2" 2642 - version = "0.6.0" 2636 + version = "0.6.1" 2643 2637 source = "registry+https://github.com/rust-lang/crates.io-index" 2644 - checksum = "233504af464074f9d066d7b5416c5f9b894a5862a6506e306f7b816cdd6f1807" 2638 + checksum = "17129e116933cf371d018bb80ae557e889637989d8638274fb25622827b03881" 2645 2639 dependencies = [ 2646 2640 "libc", 2647 - "windows-sys 0.59.0", 2641 + "windows-sys 0.60.2", 2648 2642 ] 2649 2643 2650 2644 [[package]] ··· 2687 2681 dependencies = [ 2688 2682 "base64", 2689 2683 "bytes", 2690 - "chrono", 2691 2684 "crc", 2692 2685 "crossbeam-queue", 2693 2686 "either", ··· 2696 2689 "futures-intrusive", 2697 2690 "futures-io", 2698 2691 "futures-util", 2699 - "hashbrown", 2692 + "hashbrown 0.15.5", 2700 2693 "hashlink", 2701 2694 "indexmap", 2702 2695 "log", ··· 2707 2700 "serde_json", 2708 2701 "sha2", 2709 2702 "smallvec", 2710 - "thiserror 2.0.16", 2703 + "thiserror 2.0.17", 2711 2704 "tokio", 2712 2705 "tokio-stream", 2713 2706 "tracing", ··· 2724 2717 "quote", 2725 2718 "sqlx-core", 2726 2719 "sqlx-macros-core", 2727 - "syn", 2720 + "syn 2.0.108", 2728 2721 ] 2729 2722 2730 2723 [[package]] ··· 2747 2740 "sqlx-mysql", 2748 2741 "sqlx-postgres", 2749 2742 "sqlx-sqlite", 2750 - "syn", 2743 + "syn 2.0.108", 2751 2744 "tokio", 2752 2745 "url", 2753 2746 ] ··· 2763 2756 "bitflags", 2764 2757 "byteorder", 2765 2758 "bytes", 2766 - "chrono", 2767 2759 "crc", 2768 2760 "digest", 2769 2761 "dotenvy", ··· 2790 2782 "smallvec", 2791 2783 "sqlx-core", 2792 2784 "stringprep", 2793 - "thiserror 2.0.16", 2785 + "thiserror 2.0.17", 2794 2786 "tracing", 2795 2787 "whoami", 2796 2788 ] ··· 2805 2797 "base64", 2806 2798 "bitflags", 2807 2799 "byteorder", 2808 - "chrono", 2809 2800 "crc", 2810 2801 "dotenvy", 2811 2802 "etcetera", ··· 2828 2819 "smallvec", 2829 2820 "sqlx-core", 2830 2821 "stringprep", 2831 - "thiserror 2.0.16", 2822 + "thiserror 2.0.17", 2832 2823 "tracing", 2833 2824 "whoami", 2834 2825 ] ··· 2840 2831 checksum = "c2d12fe70b2c1b4401038055f90f151b78208de1f9f89a7dbfd41587a10c3eea" 2841 2832 dependencies = [ 2842 2833 "atoi", 2843 - "chrono", 2844 2834 "flume", 2845 2835 "futures-channel", 2846 2836 "futures-core", ··· 2853 2843 "serde", 2854 2844 "serde_urlencoded", 2855 2845 "sqlx-core", 2856 - "thiserror 2.0.16", 2846 + "thiserror 2.0.17", 2857 2847 "tracing", 2858 2848 "url", 2859 2849 ] 2860 2850 2861 2851 [[package]] 2862 2852 name = "stable_deref_trait" 2863 - version = "1.2.0" 2853 + version = "1.2.1" 2864 2854 source = "registry+https://github.com/rust-lang/crates.io-index" 2865 - checksum = "a8f112729512f8e442d81f95a8a7ddf2b7c6b8a1a6f509a95864142b30cab2d3" 2855 + checksum = "6ce2be8dc25455e1f91df71bfa12ad37d7af1092ae736f3a6cd0e37bc7810596" 2866 2856 2867 2857 [[package]] 2868 2858 name = "stringprep" ··· 2876 2866 ] 2877 2867 2878 2868 [[package]] 2879 - name = "strsim" 2880 - version = "0.11.1" 2869 + name = "subtle" 2870 + version = "2.6.1" 2881 2871 source = "registry+https://github.com/rust-lang/crates.io-index" 2882 - checksum = "7da8b5736845d9f2fcb837ea5d9e2628564b3b043a70948a3f0b778838c5fb4f" 2872 + checksum = "13c2bddecc57b384dee18652358fb23172facb8a2c51ccc10d74c157bdea3292" 2883 2873 2884 2874 [[package]] 2885 - name = "subtle" 2886 - version = "2.6.1" 2875 + name = "syn" 2876 + version = "1.0.109" 2887 2877 source = "registry+https://github.com/rust-lang/crates.io-index" 2888 - checksum = "13c2bddecc57b384dee18652358fb23172facb8a2c51ccc10d74c157bdea3292" 2878 + checksum = "72b64191b275b66ffe2469e8af2c1cfe3bafa67b529ead792a6d0160888b4237" 2879 + dependencies = [ 2880 + "proc-macro2", 2881 + "quote", 2882 + "unicode-ident", 2883 + ] 2889 2884 2890 2885 [[package]] 2891 2886 name = "syn" 2892 - version = "2.0.106" 2887 + version = "2.0.108" 2893 2888 source = "registry+https://github.com/rust-lang/crates.io-index" 2894 - checksum = "ede7c438028d4436d71104916910f5bb611972c5cfd7f89b8300a8186e6fada6" 2889 + checksum = "da58917d35242480a05c2897064da0a80589a2a0476c9a3f2fdc83b53502e917" 2895 2890 dependencies = [ 2896 2891 "proc-macro2", 2897 2892 "quote", ··· 2915 2910 dependencies = [ 2916 2911 "proc-macro2", 2917 2912 "quote", 2918 - "syn", 2913 + "syn 2.0.108", 2919 2914 ] 2920 2915 2921 2916 [[package]] ··· 2947 2942 2948 2943 [[package]] 2949 2944 name = "tempfile" 2950 - version = "3.21.0" 2945 + version = "3.23.0" 2951 2946 source = "registry+https://github.com/rust-lang/crates.io-index" 2952 - checksum = "15b61f8f20e3a6f7e0649d825294eaf317edce30f82cf6026e7e4cb9222a7d1e" 2947 + checksum = "2d31c77bdf42a745371d260a26ca7163f1e0924b64afa0b688e61b5a9fa02f16" 2953 2948 dependencies = [ 2954 2949 "fastrand", 2955 - "getrandom 0.3.3", 2950 + "getrandom 0.3.4", 2956 2951 "once_cell", 2957 2952 "rustix", 2958 - "windows-sys 0.60.2", 2953 + "windows-sys 0.61.2", 2959 2954 ] 2960 2955 2961 2956 [[package]] ··· 2969 2964 2970 2965 [[package]] 2971 2966 name = "thiserror" 2972 - version = "2.0.16" 2967 + version = "2.0.17" 2973 2968 source = "registry+https://github.com/rust-lang/crates.io-index" 2974 - checksum = "3467d614147380f2e4e374161426ff399c91084acd2363eaf549172b3d5e60c0" 2969 + checksum = "f63587ca0f12b72a0600bcba1d40081f830876000bb46dd2337a3051618f4fc8" 2975 2970 dependencies = [ 2976 - "thiserror-impl 2.0.16", 2971 + "thiserror-impl 2.0.17", 2977 2972 ] 2978 2973 2979 2974 [[package]] ··· 2984 2979 dependencies = [ 2985 2980 "proc-macro2", 2986 2981 "quote", 2987 - "syn", 2982 + "syn 2.0.108", 2988 2983 ] 2989 2984 2990 2985 [[package]] 2991 2986 name = "thiserror-impl" 2992 - version = "2.0.16" 2987 + version = "2.0.17" 2993 2988 source = "registry+https://github.com/rust-lang/crates.io-index" 2994 - checksum = "6c5e1be1c48b9172ee610da68fd9cd2770e7a4056cb3fc98710ee6906f0c7960" 2989 + checksum = "3ff15c8ecd7de3849db632e14d18d2571fa09dfc5ed93479bc4485c7a517c913" 2995 2990 dependencies = [ 2996 2991 "proc-macro2", 2997 2992 "quote", 2998 - "syn", 2993 + "syn 2.0.108", 2999 2994 ] 3000 2995 3001 2996 [[package]] ··· 3009 3004 3010 3005 [[package]] 3011 3006 name = "tinystr" 3012 - version = "0.8.1" 3007 + version = "0.8.2" 3013 3008 source = "registry+https://github.com/rust-lang/crates.io-index" 3014 - checksum = "5d4f6d1145dcb577acf783d4e601bc1d76a13337bb54e6233add580b07344c8b" 3009 + checksum = "42d3e9c45c09de15d06dd8acf5f4e0e399e85927b7f00711024eb7ae10fa4869" 3015 3010 dependencies = [ 3016 3011 "displaydoc", 3017 3012 "zerovec", ··· 3034 3029 3035 3030 [[package]] 3036 3031 name = "tokio" 3037 - version = "1.47.1" 3032 + version = "1.48.0" 3038 3033 source = "registry+https://github.com/rust-lang/crates.io-index" 3039 - checksum = "89e49afdadebb872d3145a5638b59eb0691ea23e46ca484037cfab3b76b95038" 3034 + checksum = "ff360e02eab121e0bc37a2d3b4d4dc622e6eda3a8e5253d5435ecf5bd4c68408" 3040 3035 dependencies = [ 3041 - "backtrace", 3042 3036 "bytes", 3043 - "io-uring", 3044 3037 "libc", 3045 3038 "mio", 3039 + "parking_lot", 3046 3040 "pin-project-lite", 3047 3041 "signal-hook-registry", 3048 - "slab", 3049 - "socket2 0.6.0", 3042 + "socket2 0.6.1", 3050 3043 "tokio-macros", 3051 - "windows-sys 0.59.0", 3044 + "windows-sys 0.61.2", 3052 3045 ] 3053 3046 3054 3047 [[package]] 3055 3048 name = "tokio-macros" 3056 - version = "2.5.0" 3049 + version = "2.6.0" 3057 3050 source = "registry+https://github.com/rust-lang/crates.io-index" 3058 - checksum = "6e06d43f1345a3bcd39f6a56dbb7dcab2ba47e68e8ac134855e7e2bdbaf8cab8" 3051 + checksum = "af407857209536a95c8e56f8231ef2c2e2aff839b22e07a1ffcbc617e9db9fa5" 3059 3052 dependencies = [ 3060 3053 "proc-macro2", 3061 3054 "quote", 3062 - "syn", 3055 + "syn 2.0.108", 3063 3056 ] 3064 3057 3065 3058 [[package]] ··· 3074 3067 3075 3068 [[package]] 3076 3069 name = "tokio-rustls" 3077 - version = "0.26.2" 3070 + version = "0.26.4" 3078 3071 source = "registry+https://github.com/rust-lang/crates.io-index" 3079 - checksum = "8e727b36a1a0e8b74c376ac2211e40c2c8af09fb4013c60d910495810f008e9b" 3072 + checksum = "1729aa945f29d91ba541258c8df89027d5792d85a8841fb65e8bf0f4ede4ef61" 3080 3073 dependencies = [ 3081 3074 "rustls", 3082 3075 "tokio", ··· 3095 3088 3096 3089 [[package]] 3097 3090 name = "tokio-util" 3098 - version = "0.7.16" 3091 + version = "0.7.17" 3099 3092 source = "registry+https://github.com/rust-lang/crates.io-index" 3100 - checksum = "14307c986784f72ef81c89db7d9e28d6ac26d16213b109ea501696195e6e3ce5" 3093 + checksum = "2efa149fe76073d6e8fd97ef4f4eca7b67f599660115591483572e406e165594" 3101 3094 dependencies = [ 3102 3095 "bytes", 3103 3096 "futures-core", ··· 3108 3101 ] 3109 3102 3110 3103 [[package]] 3104 + name = "tokio-websockets" 3105 + version = "0.11.4" 3106 + source = "registry+https://github.com/rust-lang/crates.io-index" 3107 + checksum = "9fcaf159b4e7a376b05b5bfd77bfd38f3324f5fce751b4213bfc7eaa47affb4e" 3108 + dependencies = [ 3109 + "base64", 3110 + "bytes", 3111 + "futures-core", 3112 + "futures-sink", 3113 + "http", 3114 + "httparse", 3115 + "rand 0.9.2", 3116 + "ring", 3117 + "rustls-native-certs", 3118 + "rustls-pki-types", 3119 + "simdutf8", 3120 + "tokio", 3121 + "tokio-rustls", 3122 + "tokio-util", 3123 + ] 3124 + 3125 + [[package]] 3111 3126 name = "tower" 3112 3127 version = "0.5.2" 3113 3128 source = "registry+https://github.com/rust-lang/crates.io-index" ··· 3131 3146 dependencies = [ 3132 3147 "bitflags", 3133 3148 "bytes", 3149 + "futures-core", 3134 3150 "futures-util", 3135 3151 "http", 3136 3152 "http-body", 3153 + "http-body-util", 3154 + "http-range-header", 3155 + "httpdate", 3137 3156 "iri-string", 3157 + "mime", 3158 + "mime_guess", 3159 + "percent-encoding", 3138 3160 "pin-project-lite", 3161 + "tokio", 3162 + "tokio-util", 3139 3163 "tower", 3140 3164 "tower-layer", 3141 3165 "tower-service", 3166 + "tracing", 3142 3167 ] 3143 3168 3144 3169 [[package]] ··· 3173 3198 dependencies = [ 3174 3199 "proc-macro2", 3175 3200 "quote", 3176 - "syn", 3201 + "syn 2.0.108", 3177 3202 ] 3178 3203 3179 3204 [[package]] ··· 3223 3248 3224 3249 [[package]] 3225 3250 name = "typenum" 3226 - version = "1.18.0" 3251 + version = "1.19.0" 3227 3252 source = "registry+https://github.com/rust-lang/crates.io-index" 3228 - checksum = "1dccffe3ce07af9386bfd29e80c0ab1a8205a2fc34e4bcd40364df902cfa8f3f" 3253 + checksum = "562d481066bde0658276a35467c4af00bdc6ee726305698a55b86e61d7ad82bb" 3254 + 3255 + [[package]] 3256 + name = "ulid" 3257 + version = "1.2.1" 3258 + source = "registry+https://github.com/rust-lang/crates.io-index" 3259 + checksum = "470dbf6591da1b39d43c14523b2b469c86879a53e8b758c8e090a470fe7b1fbe" 3260 + dependencies = [ 3261 + "rand 0.9.2", 3262 + "web-time", 3263 + ] 3264 + 3265 + [[package]] 3266 + name = "unicase" 3267 + version = "2.8.1" 3268 + source = "registry+https://github.com/rust-lang/crates.io-index" 3269 + checksum = "75b844d17643ee918803943289730bec8aac480150456169e647ed0b576ba539" 3229 3270 3230 3271 [[package]] 3231 3272 name = "unicode-bidi" ··· 3235 3276 3236 3277 [[package]] 3237 3278 name = "unicode-ident" 3238 - version = "1.0.18" 3279 + version = "1.0.22" 3239 3280 source = "registry+https://github.com/rust-lang/crates.io-index" 3240 - checksum = "5a5f39404a5da50712a4c1eecf25e90dd62b613502b7e925fd4e4d19b5c96512" 3281 + checksum = "9312f7c4f6ff9069b165498234ce8be658059c6728633667c526e27dc2cf1df5" 3241 3282 3242 3283 [[package]] 3243 3284 name = "unicode-normalization" 3244 - version = "0.1.24" 3285 + version = "0.1.25" 3245 3286 source = "registry+https://github.com/rust-lang/crates.io-index" 3246 - checksum = "5033c97c4262335cded6d6fc3e5c18ab755e1a3dc96376350f3d8e9f009ad956" 3287 + checksum = "5fd4f6878c9cb28d874b009da9e8d183b5abc80117c40bbd187a1fde336be6e8" 3247 3288 dependencies = [ 3248 3289 "tinyvec", 3249 3290 ] 3250 3291 3251 3292 [[package]] 3252 3293 name = "unicode-properties" 3253 - version = "0.1.3" 3294 + version = "0.1.4" 3254 3295 source = "registry+https://github.com/rust-lang/crates.io-index" 3255 - checksum = "e70f2a8b45122e719eb623c01822704c4e0907e7e426a05927e1a1cfff5b75d0" 3296 + checksum = "7df058c713841ad818f1dc5d3fd88063241cc61f49f5fbea4b951e8cf5a8d71d" 3256 3297 3257 3298 [[package]] 3258 3299 name = "unsigned-varint" ··· 3285 3326 ] 3286 3327 3287 3328 [[package]] 3329 + name = "urlencoding" 3330 + version = "2.1.3" 3331 + source = "registry+https://github.com/rust-lang/crates.io-index" 3332 + checksum = "daf8dba3b7eb870caf1ddeed7bc9d2a049f3cfdfae7cb521b087cc33ae4c49da" 3333 + 3334 + [[package]] 3288 3335 name = "utf8_iter" 3289 3336 version = "1.0.4" 3290 3337 source = "registry+https://github.com/rust-lang/crates.io-index" 3291 3338 checksum = "b6c140620e7ffbb22c2dee59cafe6084a59b5ffc27a8859a5f0d494b5d52b6be" 3292 3339 3293 3340 [[package]] 3294 - name = "utf8parse" 3295 - version = "0.2.2" 3296 - source = "registry+https://github.com/rust-lang/crates.io-index" 3297 - checksum = "06abde3611657adf66d383f00b093d7faecc7fa57071cce2578660c9f1010821" 3298 - 3299 - [[package]] 3300 3341 name = "uuid" 3301 3342 version = "1.18.1" 3302 3343 source = "registry+https://github.com/rust-lang/crates.io-index" 3303 3344 checksum = "2f87b8aa10b915a06587d0dec516c282ff295b475d94abf425d62b57710070a2" 3304 3345 dependencies = [ 3305 - "getrandom 0.3.3", 3346 + "getrandom 0.3.4", 3306 3347 "js-sys", 3307 3348 "wasm-bindgen", 3308 3349 ] ··· 3347 3388 checksum = "ccf3ec651a847eb01de73ccad15eb7d99f80485de043efb2f370cd654f4ea44b" 3348 3389 3349 3390 [[package]] 3350 - name = "wasi" 3351 - version = "0.14.3+wasi-0.2.4" 3391 + name = "wasip2" 3392 + version = "1.0.1+wasi-0.2.4" 3352 3393 source = "registry+https://github.com/rust-lang/crates.io-index" 3353 - checksum = "6a51ae83037bdd272a9e28ce236db8c07016dd0d50c27038b3f407533c030c95" 3394 + checksum = "0562428422c63773dad2c345a1882263bbf4d65cf3f42e90921f787ef5ad58e7" 3354 3395 dependencies = [ 3355 3396 "wit-bindgen", 3356 3397 ] ··· 3363 3404 3364 3405 [[package]] 3365 3406 name = "wasm-bindgen" 3366 - version = "0.2.101" 3407 + version = "0.2.105" 3367 3408 source = "registry+https://github.com/rust-lang/crates.io-index" 3368 - checksum = "7e14915cadd45b529bb8d1f343c4ed0ac1de926144b746e2710f9cd05df6603b" 3409 + checksum = "da95793dfc411fbbd93f5be7715b0578ec61fe87cb1a42b12eb625caa5c5ea60" 3369 3410 dependencies = [ 3370 3411 "cfg-if", 3371 3412 "once_cell", ··· 3375 3416 ] 3376 3417 3377 3418 [[package]] 3378 - name = "wasm-bindgen-backend" 3379 - version = "0.2.101" 3380 - source = "registry+https://github.com/rust-lang/crates.io-index" 3381 - checksum = "e28d1ba982ca7923fd01448d5c30c6864d0a14109560296a162f80f305fb93bb" 3382 - dependencies = [ 3383 - "bumpalo", 3384 - "log", 3385 - "proc-macro2", 3386 - "quote", 3387 - "syn", 3388 - "wasm-bindgen-shared", 3389 - ] 3390 - 3391 - [[package]] 3392 3419 name = "wasm-bindgen-futures" 3393 - version = "0.4.51" 3420 + version = "0.4.55" 3394 3421 source = "registry+https://github.com/rust-lang/crates.io-index" 3395 - checksum = "0ca85039a9b469b38336411d6d6ced91f3fc87109a2a27b0c197663f5144dffe" 3422 + checksum = "551f88106c6d5e7ccc7cd9a16f312dd3b5d36ea8b4954304657d5dfba115d4a0" 3396 3423 dependencies = [ 3397 3424 "cfg-if", 3398 3425 "js-sys", ··· 3403 3430 3404 3431 [[package]] 3405 3432 name = "wasm-bindgen-macro" 3406 - version = "0.2.101" 3433 + version = "0.2.105" 3407 3434 source = "registry+https://github.com/rust-lang/crates.io-index" 3408 - checksum = "7c3d463ae3eff775b0c45df9da45d68837702ac35af998361e2c84e7c5ec1b0d" 3435 + checksum = "04264334509e04a7bf8690f2384ef5265f05143a4bff3889ab7a3269adab59c2" 3409 3436 dependencies = [ 3410 3437 "quote", 3411 3438 "wasm-bindgen-macro-support", ··· 3413 3440 3414 3441 [[package]] 3415 3442 name = "wasm-bindgen-macro-support" 3416 - version = "0.2.101" 3443 + version = "0.2.105" 3417 3444 source = "registry+https://github.com/rust-lang/crates.io-index" 3418 - checksum = "7bb4ce89b08211f923caf51d527662b75bdc9c9c7aab40f86dcb9fb85ac552aa" 3445 + checksum = "420bc339d9f322e562942d52e115d57e950d12d88983a14c79b86859ee6c7ebc" 3419 3446 dependencies = [ 3447 + "bumpalo", 3420 3448 "proc-macro2", 3421 3449 "quote", 3422 - "syn", 3423 - "wasm-bindgen-backend", 3450 + "syn 2.0.108", 3424 3451 "wasm-bindgen-shared", 3425 3452 ] 3426 3453 3427 3454 [[package]] 3428 3455 name = "wasm-bindgen-shared" 3429 - version = "0.2.101" 3456 + version = "0.2.105" 3430 3457 source = "registry+https://github.com/rust-lang/crates.io-index" 3431 - checksum = "f143854a3b13752c6950862c906306adb27c7e839f7414cec8fea35beab624c1" 3458 + checksum = "76f218a38c84bcb33c25ec7059b07847d465ce0e0a76b995e134a45adcb6af76" 3432 3459 dependencies = [ 3433 3460 "unicode-ident", 3434 3461 ] 3435 3462 3436 3463 [[package]] 3437 3464 name = "web-sys" 3438 - version = "0.3.78" 3465 + version = "0.3.82" 3439 3466 source = "registry+https://github.com/rust-lang/crates.io-index" 3440 - checksum = "77e4b637749ff0d92b8fad63aa1f7cff3cbe125fd49c175cd6345e7272638b12" 3467 + checksum = "3a1f95c0d03a47f4ae1f7a64643a6bb97465d9b740f0fa8f90ea33915c99a9a1" 3441 3468 dependencies = [ 3442 3469 "js-sys", 3443 3470 "wasm-bindgen", ··· 3455 3482 3456 3483 [[package]] 3457 3484 name = "webpki-roots" 3458 - version = "1.0.2" 3485 + version = "1.0.4" 3459 3486 source = "registry+https://github.com/rust-lang/crates.io-index" 3460 - checksum = "7e8983c3ab33d6fb807cfcdad2491c4ea8cbc8ed839181c7dfd9c67c83e261b2" 3487 + checksum = "b2878ef029c47c6e8cf779119f20fcf52bde7ad42a731b2a304bc221df17571e" 3461 3488 dependencies = [ 3462 3489 "rustls-pki-types", 3463 3490 ] ··· 3474 3501 3475 3502 [[package]] 3476 3503 name = "widestring" 3477 - version = "1.2.0" 3478 - source = "registry+https://github.com/rust-lang/crates.io-index" 3479 - checksum = "dd7cf3379ca1aac9eea11fba24fd7e315d621f8dfe35c8d7d2be8b793726e07d" 3480 - 3481 - [[package]] 3482 - name = "windows" 3483 - version = "0.61.3" 3484 - source = "registry+https://github.com/rust-lang/crates.io-index" 3485 - checksum = "9babd3a767a4c1aef6900409f85f5d53ce2544ccdfaa86dad48c91782c6d6893" 3486 - dependencies = [ 3487 - "windows-collections", 3488 - "windows-core", 3489 - "windows-future", 3490 - "windows-link", 3491 - "windows-numerics", 3492 - ] 3493 - 3494 - [[package]] 3495 - name = "windows-collections" 3496 - version = "0.2.0" 3497 - source = "registry+https://github.com/rust-lang/crates.io-index" 3498 - checksum = "3beeceb5e5cfd9eb1d76b381630e82c4241ccd0d27f1a39ed41b2760b255c5e8" 3499 - dependencies = [ 3500 - "windows-core", 3501 - ] 3502 - 3503 - [[package]] 3504 - name = "windows-core" 3505 - version = "0.61.2" 3506 - source = "registry+https://github.com/rust-lang/crates.io-index" 3507 - checksum = "c0fdd3ddb90610c7638aa2b3a3ab2904fb9e5cdbecc643ddb3647212781c4ae3" 3508 - dependencies = [ 3509 - "windows-implement", 3510 - "windows-interface", 3511 - "windows-link", 3512 - "windows-result", 3513 - "windows-strings", 3514 - ] 3515 - 3516 - [[package]] 3517 - name = "windows-future" 3518 - version = "0.2.1" 3504 + version = "1.2.1" 3519 3505 source = "registry+https://github.com/rust-lang/crates.io-index" 3520 - checksum = "fc6a41e98427b19fe4b73c550f060b59fa592d7d686537eebf9385621bfbad8e" 3521 - dependencies = [ 3522 - "windows-core", 3523 - "windows-link", 3524 - "windows-threading", 3525 - ] 3526 - 3527 - [[package]] 3528 - name = "windows-implement" 3529 - version = "0.60.0" 3530 - source = "registry+https://github.com/rust-lang/crates.io-index" 3531 - checksum = "a47fddd13af08290e67f4acabf4b459f647552718f683a7b415d290ac744a836" 3532 - dependencies = [ 3533 - "proc-macro2", 3534 - "quote", 3535 - "syn", 3536 - ] 3537 - 3538 - [[package]] 3539 - name = "windows-interface" 3540 - version = "0.59.1" 3541 - source = "registry+https://github.com/rust-lang/crates.io-index" 3542 - checksum = "bd9211b69f8dcdfa817bfd14bf1c97c9188afa36f4750130fcdf3f400eca9fa8" 3543 - dependencies = [ 3544 - "proc-macro2", 3545 - "quote", 3546 - "syn", 3547 - ] 3506 + checksum = "72069c3113ab32ab29e5584db3c6ec55d416895e60715417b5b883a357c3e471" 3548 3507 3549 3508 [[package]] 3550 3509 name = "windows-link" ··· 3553 3512 checksum = "5e6ad25900d524eaabdbbb96d20b4311e1e7ae1699af4fb28c17ae66c80d798a" 3554 3513 3555 3514 [[package]] 3556 - name = "windows-numerics" 3557 - version = "0.2.0" 3515 + name = "windows-link" 3516 + version = "0.2.1" 3558 3517 source = "registry+https://github.com/rust-lang/crates.io-index" 3559 - checksum = "9150af68066c4c5c07ddc0ce30421554771e528bde427614c61038bc2c92c2b1" 3560 - dependencies = [ 3561 - "windows-core", 3562 - "windows-link", 3563 - ] 3518 + checksum = "f0805222e57f7521d6a62e36fa9163bc891acd422f971defe97d64e70d0a4fe5" 3564 3519 3565 3520 [[package]] 3566 3521 name = "windows-registry" ··· 3568 3523 source = "registry+https://github.com/rust-lang/crates.io-index" 3569 3524 checksum = "5b8a9ed28765efc97bbc954883f4e6796c33a06546ebafacbabee9696967499e" 3570 3525 dependencies = [ 3571 - "windows-link", 3526 + "windows-link 0.1.3", 3572 3527 "windows-result", 3573 3528 "windows-strings", 3574 3529 ] ··· 3579 3534 source = "registry+https://github.com/rust-lang/crates.io-index" 3580 3535 checksum = "56f42bd332cc6c8eac5af113fc0c1fd6a8fd2aa08a0119358686e5160d0586c6" 3581 3536 dependencies = [ 3582 - "windows-link", 3537 + "windows-link 0.1.3", 3583 3538 ] 3584 3539 3585 3540 [[package]] ··· 3588 3543 source = "registry+https://github.com/rust-lang/crates.io-index" 3589 3544 checksum = "56e6c93f3a0c3b36176cb1327a4958a0353d5d166c2a35cb268ace15e91d3b57" 3590 3545 dependencies = [ 3591 - "windows-link", 3546 + "windows-link 0.1.3", 3592 3547 ] 3593 3548 3594 3549 [[package]] ··· 3611 3566 3612 3567 [[package]] 3613 3568 name = "windows-sys" 3614 - version = "0.59.0" 3569 + version = "0.60.2" 3615 3570 source = "registry+https://github.com/rust-lang/crates.io-index" 3616 - checksum = "1e38bc4d79ed67fd075bcc251a1c39b32a1776bbe92e5bef1f0bf1f8c531853b" 3571 + checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb" 3617 3572 dependencies = [ 3618 - "windows-targets 0.52.6", 3573 + "windows-targets 0.53.5", 3619 3574 ] 3620 3575 3621 3576 [[package]] 3622 3577 name = "windows-sys" 3623 - version = "0.60.2" 3578 + version = "0.61.2" 3624 3579 source = "registry+https://github.com/rust-lang/crates.io-index" 3625 - checksum = "f2f500e4d28234f72040990ec9d39e3a6b950f9f22d3dba18416c35882612bcb" 3580 + checksum = "ae137229bcbd6cdf0f7b80a31df61766145077ddf49416a728b02cb3921ff3fc" 3626 3581 dependencies = [ 3627 - "windows-targets 0.53.3", 3582 + "windows-link 0.2.1", 3628 3583 ] 3629 3584 3630 3585 [[package]] ··· 3660 3615 3661 3616 [[package]] 3662 3617 name = "windows-targets" 3663 - version = "0.53.3" 3618 + version = "0.53.5" 3664 3619 source = "registry+https://github.com/rust-lang/crates.io-index" 3665 - checksum = "d5fe6031c4041849d7c496a8ded650796e7b6ecc19df1a431c1a363342e5dc91" 3620 + checksum = "4945f9f551b88e0d65f3db0bc25c33b8acea4d9e41163edf90dcd0b19f9069f3" 3666 3621 dependencies = [ 3667 - "windows-link", 3668 - "windows_aarch64_gnullvm 0.53.0", 3669 - "windows_aarch64_msvc 0.53.0", 3670 - "windows_i686_gnu 0.53.0", 3671 - "windows_i686_gnullvm 0.53.0", 3672 - "windows_i686_msvc 0.53.0", 3673 - "windows_x86_64_gnu 0.53.0", 3674 - "windows_x86_64_gnullvm 0.53.0", 3675 - "windows_x86_64_msvc 0.53.0", 3676 - ] 3677 - 3678 - [[package]] 3679 - name = "windows-threading" 3680 - version = "0.1.0" 3681 - source = "registry+https://github.com/rust-lang/crates.io-index" 3682 - checksum = "b66463ad2e0ea3bbf808b7f1d371311c80e115c0b71d60efc142cafbcfb057a6" 3683 - dependencies = [ 3684 - "windows-link", 3622 + "windows-link 0.2.1", 3623 + "windows_aarch64_gnullvm 0.53.1", 3624 + "windows_aarch64_msvc 0.53.1", 3625 + "windows_i686_gnu 0.53.1", 3626 + "windows_i686_gnullvm 0.53.1", 3627 + "windows_i686_msvc 0.53.1", 3628 + "windows_x86_64_gnu 0.53.1", 3629 + "windows_x86_64_gnullvm 0.53.1", 3630 + "windows_x86_64_msvc 0.53.1", 3685 3631 ] 3686 3632 3687 3633 [[package]] ··· 3698 3644 3699 3645 [[package]] 3700 3646 name = "windows_aarch64_gnullvm" 3701 - version = "0.53.0" 3647 + version = "0.53.1" 3702 3648 source = "registry+https://github.com/rust-lang/crates.io-index" 3703 - checksum = "86b8d5f90ddd19cb4a147a5fa63ca848db3df085e25fee3cc10b39b6eebae764" 3649 + checksum = "a9d8416fa8b42f5c947f8482c43e7d89e73a173cead56d044f6a56104a6d1b53" 3704 3650 3705 3651 [[package]] 3706 3652 name = "windows_aarch64_msvc" ··· 3716 3662 3717 3663 [[package]] 3718 3664 name = "windows_aarch64_msvc" 3719 - version = "0.53.0" 3665 + version = "0.53.1" 3720 3666 source = "registry+https://github.com/rust-lang/crates.io-index" 3721 - checksum = "c7651a1f62a11b8cbd5e0d42526e55f2c99886c77e007179efff86c2b137e66c" 3667 + checksum = "b9d782e804c2f632e395708e99a94275910eb9100b2114651e04744e9b125006" 3722 3668 3723 3669 [[package]] 3724 3670 name = "windows_i686_gnu" ··· 3734 3680 3735 3681 [[package]] 3736 3682 name = "windows_i686_gnu" 3737 - version = "0.53.0" 3683 + version = "0.53.1" 3738 3684 source = "registry+https://github.com/rust-lang/crates.io-index" 3739 - checksum = "c1dc67659d35f387f5f6c479dc4e28f1d4bb90ddd1a5d3da2e5d97b42d6272c3" 3685 + checksum = "960e6da069d81e09becb0ca57a65220ddff016ff2d6af6a223cf372a506593a3" 3740 3686 3741 3687 [[package]] 3742 3688 name = "windows_i686_gnullvm" ··· 3746 3692 3747 3693 [[package]] 3748 3694 name = "windows_i686_gnullvm" 3749 - version = "0.53.0" 3695 + version = "0.53.1" 3750 3696 source = "registry+https://github.com/rust-lang/crates.io-index" 3751 - checksum = "9ce6ccbdedbf6d6354471319e781c0dfef054c81fbc7cf83f338a4296c0cae11" 3697 + checksum = "fa7359d10048f68ab8b09fa71c3daccfb0e9b559aed648a8f95469c27057180c" 3752 3698 3753 3699 [[package]] 3754 3700 name = "windows_i686_msvc" ··· 3764 3710 3765 3711 [[package]] 3766 3712 name = "windows_i686_msvc" 3767 - version = "0.53.0" 3713 + version = "0.53.1" 3768 3714 source = "registry+https://github.com/rust-lang/crates.io-index" 3769 - checksum = "581fee95406bb13382d2f65cd4a908ca7b1e4c2f1917f143ba16efe98a589b5d" 3715 + checksum = "1e7ac75179f18232fe9c285163565a57ef8d3c89254a30685b57d83a38d326c2" 3770 3716 3771 3717 [[package]] 3772 3718 name = "windows_x86_64_gnu" ··· 3782 3728 3783 3729 [[package]] 3784 3730 name = "windows_x86_64_gnu" 3785 - version = "0.53.0" 3731 + version = "0.53.1" 3786 3732 source = "registry+https://github.com/rust-lang/crates.io-index" 3787 - checksum = "2e55b5ac9ea33f2fc1716d1742db15574fd6fc8dadc51caab1c16a3d3b4190ba" 3733 + checksum = "9c3842cdd74a865a8066ab39c8a7a473c0778a3f29370b5fd6b4b9aa7df4a499" 3788 3734 3789 3735 [[package]] 3790 3736 name = "windows_x86_64_gnullvm" ··· 3800 3746 3801 3747 [[package]] 3802 3748 name = "windows_x86_64_gnullvm" 3803 - version = "0.53.0" 3749 + version = "0.53.1" 3804 3750 source = "registry+https://github.com/rust-lang/crates.io-index" 3805 - checksum = "0a6e035dd0599267ce1ee132e51c27dd29437f63325753051e71dd9e42406c57" 3751 + checksum = "0ffa179e2d07eee8ad8f57493436566c7cc30ac536a3379fdf008f47f6bb7ae1" 3806 3752 3807 3753 [[package]] 3808 3754 name = "windows_x86_64_msvc" ··· 3818 3764 3819 3765 [[package]] 3820 3766 name = "windows_x86_64_msvc" 3821 - version = "0.53.0" 3767 + version = "0.53.1" 3822 3768 source = "registry+https://github.com/rust-lang/crates.io-index" 3823 - checksum = "271414315aff87387382ec3d271b52d7ae78726f5d44ac98b4f4030c91880486" 3769 + checksum = "d6bbff5f0aada427a1e5a6da5f1f98158182f26556f345ac9e04d36d0ebed650" 3824 3770 3825 3771 [[package]] 3826 3772 name = "winreg" ··· 3834 3780 3835 3781 [[package]] 3836 3782 name = "wit-bindgen" 3837 - version = "0.45.1" 3783 + version = "0.46.0" 3838 3784 source = "registry+https://github.com/rust-lang/crates.io-index" 3839 - checksum = "5c573471f125075647d03df72e026074b7203790d41351cd6edc96f46bcccd36" 3785 + checksum = "f17a85883d4e6d00e8a97c586de764dabcc06133f7f1d55dce5cdc070ad7fe59" 3840 3786 3841 3787 [[package]] 3842 3788 name = "writeable" 3843 - version = "0.6.1" 3789 + version = "0.6.2" 3844 3790 source = "registry+https://github.com/rust-lang/crates.io-index" 3845 - checksum = "ea2f10b9bb0928dfb1b42b65e1f9e36f7f54dbdf08457afefb38afcdec4fa2bb" 3791 + checksum = "9edde0db4769d2dc68579893f2306b26c6ecfbe0ef499b013d731b7b9247e0b9" 3846 3792 3847 3793 [[package]] 3848 3794 name = "yoke" 3849 - version = "0.8.0" 3795 + version = "0.8.1" 3850 3796 source = "registry+https://github.com/rust-lang/crates.io-index" 3851 - checksum = "5f41bb01b8226ef4bfd589436a297c53d118f65921786300e427be8d487695cc" 3797 + checksum = "72d6e5c6afb84d73944e5cedb052c4680d5657337201555f9f2a16b7406d4954" 3852 3798 dependencies = [ 3853 - "serde", 3854 3799 "stable_deref_trait", 3855 3800 "yoke-derive", 3856 3801 "zerofrom", ··· 3858 3803 3859 3804 [[package]] 3860 3805 name = "yoke-derive" 3861 - version = "0.8.0" 3806 + version = "0.8.1" 3862 3807 source = "registry+https://github.com/rust-lang/crates.io-index" 3863 - checksum = "38da3c9736e16c5d3c8c597a9aaa5d1fa565d0532ae05e27c24aa62fb32c0ab6" 3808 + checksum = "b659052874eb698efe5b9e8cf382204678a0086ebf46982b79d6ca3182927e5d" 3864 3809 dependencies = [ 3865 3810 "proc-macro2", 3866 3811 "quote", 3867 - "syn", 3812 + "syn 2.0.108", 3868 3813 "synstructure", 3869 3814 ] 3870 3815 3871 3816 [[package]] 3872 3817 name = "zerocopy" 3873 - version = "0.8.26" 3818 + version = "0.8.27" 3874 3819 source = "registry+https://github.com/rust-lang/crates.io-index" 3875 - checksum = "1039dd0d3c310cf05de012d8a39ff557cb0d23087fd44cad61df08fc31907a2f" 3820 + checksum = "0894878a5fa3edfd6da3f88c4805f4c8558e2b996227a3d864f47fe11e38282c" 3876 3821 dependencies = [ 3877 3822 "zerocopy-derive", 3878 3823 ] 3879 3824 3880 3825 [[package]] 3881 3826 name = "zerocopy-derive" 3882 - version = "0.8.26" 3827 + version = "0.8.27" 3883 3828 source = "registry+https://github.com/rust-lang/crates.io-index" 3884 - checksum = "9ecf5b4cc5364572d7f4c329661bcc82724222973f2cab6f050a4e5c22f75181" 3829 + checksum = "88d2b8d9c68ad2b9e4340d7832716a4d21a22a1154777ad56ea55c51a9cf3831" 3885 3830 dependencies = [ 3886 3831 "proc-macro2", 3887 3832 "quote", 3888 - "syn", 3833 + "syn 2.0.108", 3889 3834 ] 3890 3835 3891 3836 [[package]] ··· 3905 3850 dependencies = [ 3906 3851 "proc-macro2", 3907 3852 "quote", 3908 - "syn", 3853 + "syn 2.0.108", 3909 3854 "synstructure", 3910 3855 ] 3911 3856 3912 3857 [[package]] 3913 3858 name = "zeroize" 3914 - version = "1.8.1" 3859 + version = "1.8.2" 3915 3860 source = "registry+https://github.com/rust-lang/crates.io-index" 3916 - checksum = "ced3678a2879b30306d323f4542626697a464a97c0a07c9aebf7ebca65cd4dde" 3861 + checksum = "b97154e67e32c85465826e8bcc1c59429aaaf107c1e4a9e53c8d8ccd5eff88d0" 3917 3862 3918 3863 [[package]] 3919 3864 name = "zerotrie" 3920 - version = "0.2.2" 3865 + version = "0.2.3" 3921 3866 source = "registry+https://github.com/rust-lang/crates.io-index" 3922 - checksum = "36f0bbd478583f79edad978b407914f61b2972f5af6fa089686016be8f9af595" 3867 + checksum = "2a59c17a5562d507e4b54960e8569ebee33bee890c70aa3fe7b97e85a9fd7851" 3923 3868 dependencies = [ 3924 3869 "displaydoc", 3925 3870 "yoke", ··· 3928 3873 3929 3874 [[package]] 3930 3875 name = "zerovec" 3931 - version = "0.11.4" 3876 + version = "0.11.5" 3932 3877 source = "registry+https://github.com/rust-lang/crates.io-index" 3933 - checksum = "e7aa2bd55086f1ab526693ecbe444205da57e25f4489879da80635a46d90e73b" 3878 + checksum = "6c28719294829477f525be0186d13efa9a3c602f7ec202ca9e353d310fb9a002" 3934 3879 dependencies = [ 3935 3880 "yoke", 3936 3881 "zerofrom", ··· 3939 3884 3940 3885 [[package]] 3941 3886 name = "zerovec-derive" 3942 - version = "0.11.1" 3887 + version = "0.11.2" 3943 3888 source = "registry+https://github.com/rust-lang/crates.io-index" 3944 - checksum = "5b96237efa0c878c64bd89c436f661be4e46b2f3eff1ebb976f7ef2321d2f58f" 3889 + checksum = "eadce39539ca5cb3985590102671f2567e659fca9666581ad3411d59207951f3" 3945 3890 dependencies = [ 3946 3891 "proc-macro2", 3947 3892 "quote", 3948 - "syn", 3893 + "syn 2.0.108", 3894 + ] 3895 + 3896 + [[package]] 3897 + name = "zstd" 3898 + version = "0.13.3" 3899 + source = "registry+https://github.com/rust-lang/crates.io-index" 3900 + checksum = "e91ee311a569c327171651566e07972200e76fcfe2242a4fa446149a3881c08a" 3901 + dependencies = [ 3902 + "zstd-safe", 3903 + ] 3904 + 3905 + [[package]] 3906 + name = "zstd-safe" 3907 + version = "7.2.4" 3908 + source = "registry+https://github.com/rust-lang/crates.io-index" 3909 + checksum = "8f49c4d5f0abb602a93fb8736af2a4f4dd9512e36f7f570d66e65ff867ed3b9d" 3910 + dependencies = [ 3911 + "zstd-sys", 3912 + ] 3913 + 3914 + [[package]] 3915 + name = "zstd-sys" 3916 + version = "2.0.16+zstd.1.5.7" 3917 + source = "registry+https://github.com/rust-lang/crates.io-index" 3918 + checksum = "91e19ebc2adc8f83e43039e79776e3fda8ca919132d68a1fed6a5faca2683748" 3919 + dependencies = [ 3920 + "cc", 3921 + "pkg-config", 3949 3922 ]
+13 -6
Cargo.toml
··· 1 1 [package] 2 2 name = "quickdid" 3 - version = "1.0.0-rc.2" 3 + version = "1.0.0-rc.5" 4 4 edition = "2024" 5 5 authors = ["Nick Gerakines <nick.gerakines@gmail.com>"] 6 6 description = "A fast and scalable com.atproto.identity.resolveHandle service" ··· 16 16 [dependencies] 17 17 anyhow = "1.0" 18 18 async-trait = "0.1" 19 - atproto-identity = { version = "0.11.3" } 19 + atproto-identity = { git = "https://tangled.org/@smokesignal.events/atproto-identity-rs" } 20 + atproto-jetstream = { git = "https://tangled.org/@smokesignal.events/atproto-identity-rs" } 21 + atproto-lexicon = { git = "https://tangled.org/@smokesignal.events/atproto-identity-rs" } 20 22 axum = { version = "0.8" } 21 - bincode = { version = "2.0.1", features = ["serde"] } 22 - clap = { version = "4", features = ["derive", "env"] } 23 + bincode = { version = "2.0", features = ["serde"] } 24 + cadence = "1.6" 23 25 deadpool-redis = { version = "0.22", features = ["connection-manager", "tokio-comp", "tokio-rustls-comp"] } 24 - metrohash = "1.0.7" 26 + httpdate = "1.0" 27 + metrohash = "1.0" 25 28 reqwest = { version = "0.12", features = ["json"] } 26 29 serde = { version = "1.0", features = ["derive"] } 27 30 serde_json = "1.0" 28 - sqlx = { version = "0.8", features = ["runtime-tokio", "sqlite", "chrono"] } 31 + sqlx = { version = "0.8", features = ["runtime-tokio", "sqlite"] } 29 32 thiserror = "2.0" 30 33 tokio = { version = "1.35", features = ["rt-multi-thread", "macros", "signal", "sync", "time", "net", "fs"] } 31 34 tokio-util = { version = "0.7", features = ["rt"] } 35 + tower-http = { version = "0.6", features = ["fs"] } 32 36 tracing = "0.1" 33 37 tracing-subscriber = { version = "0.3", features = ["env-filter"] } 38 + 39 + [dev-dependencies] 40 + once_cell = "1.20"
+6 -5
Dockerfile
··· 1 1 # syntax=docker/dockerfile:1.4 2 - FROM rust:1.89-slim AS builder 2 + FROM rust:1.90-slim-bookworm AS builder 3 3 4 4 RUN apt-get update && apt-get install -y \ 5 5 pkg-config \ ··· 9 9 WORKDIR /app 10 10 COPY Cargo.lock Cargo.toml ./ 11 11 12 - ARG GIT_HASH=0 13 - ENV GIT_HASH=$GIT_HASH 14 - 15 12 COPY src ./src 16 13 RUN cargo build --bin quickdid --release 17 14 ··· 22 19 LABEL org.opencontainers.image.licenses="MIT" 23 20 LABEL org.opencontainers.image.authors="Nick Gerakines <nick.gerakines@gmail.com>" 24 21 LABEL org.opencontainers.image.source="https://tangled.sh/@smokesignal.events/quickdid" 25 - LABEL org.opencontainers.image.version="1.0.0-rc.2" 22 + LABEL org.opencontainers.image.version="1.0.0-rc.5" 26 23 27 24 WORKDIR /app 28 25 COPY --from=builder /app/target/release/quickdid /app/quickdid 29 26 27 + # Copy static files for serving 28 + COPY www /app/www 29 + 30 30 ENV HTTP_PORT=8080 31 + ENV STATIC_FILES_DIR=/app/www 31 32 ENV RUST_LOG=info 32 33 ENV RUST_BACKTRACE=full 33 34
+211 -17
README.md
··· 1 1 # QuickDID 2 2 3 - QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides blazing-fast handle-to-DID resolution with intelligent caching strategies, supporting both in-memory and Redis-backed persistent caching with binary serialization for optimal storage efficiency. 3 + QuickDID is a high-performance AT Protocol identity resolution service written in Rust. It provides blazing-fast handle-to-DID resolution with intelligent caching strategies, supporting in-memory, Redis-backed, and SQLite-backed persistent caching with binary serialization for optimal storage efficiency. The service includes proactive cache refreshing to maintain optimal performance and comprehensive metrics support for production monitoring. 4 4 5 - Built with minimal dependencies and optimized for production use, QuickDID delivers exceptional performance while maintaining a lean footprint. 5 + Built following the 12-factor app methodology with minimal dependencies and optimized for production use, QuickDID delivers exceptional performance while maintaining a lean footprint. Configuration is handled exclusively through environment variables, with only `--version` and `--help` command-line arguments supported. 6 6 7 7 ## โš ๏ธ Production Disclaimer 8 8 9 9 **This project is a release candidate and has not been fully vetted for production use.** While it includes comprehensive error handling and has been designed with production features in mind, more thorough testing is necessary before deploying in critical environments. Use at your own risk and conduct appropriate testing for your use case. 10 10 11 + ## Performance 12 + 13 + QuickDID is designed for high throughput and low latency: 14 + 15 + - **Binary serialization** reduces cache storage by ~40% compared to JSON 16 + - **Rate limiting** protects upstream services from being overwhelmed 17 + - **Work shedding** in SQLite queue adapter prevents unbounded growth 18 + - **Configurable TTLs** allow fine-tuning cache freshness vs. performance 19 + - **Connection pooling** for Redis minimizes connection overhead 20 + 11 21 ## Features 12 22 13 23 - **Fast Handle Resolution**: Resolves AT Protocol handles to DIDs using DNS TXT records and HTTP well-known endpoints 14 - - **Multi-Layer Caching**: In-memory caching with configurable TTL and Redis-backed persistent caching (90-day TTL) 24 + - **Bidirectional Caching**: Supports both handle-to-DID and DID-to-handle lookups with automatic cache synchronization 25 + - **Multi-Layer Caching**: Flexible caching with three tiers: 26 + - In-memory caching with configurable TTL (default: 600 seconds) 27 + - Redis-backed persistent caching (default: 90-day TTL) 28 + - SQLite-backed persistent caching (default: 90-day TTL) 29 + - **Jetstream Consumer**: Real-time cache updates from AT Protocol firehose: 30 + - Processes Account and Identity events 31 + - Automatically purges deleted/deactivated accounts 32 + - Updates handle-to-DID mappings in real-time 33 + - Comprehensive metrics for event processing 34 + - Automatic reconnection with backoff 35 + - **HTTP Caching**: Client-side caching support with: 36 + - ETag generation with configurable seed for cache invalidation 37 + - Cache-Control headers with max-age, stale-while-revalidate, and stale-if-error directives 38 + - CORS headers for cross-origin requests 39 + - **Rate Limiting**: Semaphore-based concurrency control with optional timeout to protect upstream services 15 40 - **Binary Serialization**: Compact storage format reduces cache size by ~40% compared to JSON 16 - - **Queue Processing**: Asynchronous handle resolution with support for MPSC, Redis, and no-op queue adapters 41 + - **Queue Processing**: Asynchronous handle resolution with multiple adapters: 42 + - MPSC (in-memory, default) 43 + - Redis (distributed) 44 + - SQLite (persistent with work shedding) 45 + - No-op (testing) 46 + - **Metrics & Monitoring**: 47 + - StatsD metrics support for counters, gauges, and timings 48 + - Resolution timing measurements 49 + - Jetstream event processing metrics 50 + - Configurable tags for environment/service identification 51 + - Integration guides for Telegraf and TimescaleDB 52 + - Configurable bind address for StatsD UDP socket (IPv4/IPv6) 53 + - **Proactive Cache Refresh**: 54 + - Automatically refreshes cache entries before expiration 55 + - Configurable refresh threshold 56 + - Prevents cache misses for frequently accessed handles 57 + - Metrics tracking for refresh operations 58 + - **Queue Deduplication**: 59 + - Redis-based deduplication for queue items 60 + - Prevents duplicate handle resolution work 61 + - Configurable TTL for deduplication keys 62 + - **Cache Management APIs**: 63 + - `purge` method for removing entries by handle or DID 64 + - `set` method for manually updating handle-to-DID mappings 65 + - Chainable operations across resolver layers 17 66 - **AT Protocol Compatible**: Implements XRPC endpoints for seamless integration with AT Protocol infrastructure 18 - - **Comprehensive Error Handling**: Includes health checks and graceful shutdown support 67 + - **Comprehensive Error Handling**: Structured errors with unique identifiers (e.g., `error-quickdid-config-1`), health checks, and graceful shutdown 68 + - **12-Factor App**: Environment-based configuration following cloud-native best practices 19 69 - **Minimal Dependencies**: Optimized dependency tree for faster compilation and reduced attack surface 20 - - **Predictable Worker IDs**: Simple default worker identification for distributed deployments 21 70 22 71 ## Building 23 72 ··· 25 74 26 75 - Rust 1.70 or later 27 76 - Redis (optional, for persistent caching and distributed queuing) 77 + - SQLite 3.35+ (optional, for single-instance persistent caching) 28 78 29 79 ### Build Commands 30 80 ··· 45 95 46 96 ## Minimum Configuration 47 97 48 - QuickDID requires the following environment variables to run: 98 + QuickDID requires minimal configuration to run. Configuration is validated at startup, and the service will exit with specific error codes if validation fails. 49 99 50 100 ### Required 51 101 52 102 - `HTTP_EXTERNAL`: External hostname for service endpoints (e.g., `localhost:3007`) 53 - - `SERVICE_KEY`: Private key for service identity in DID format (e.g., `did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK`) 54 103 55 104 ### Example Minimal Setup 56 105 57 106 ```bash 58 - HTTP_EXTERNAL=localhost:3007 \ 59 - SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK \ 60 - cargo run 107 + HTTP_EXTERNAL=localhost:3007 cargo run 108 + ``` 109 + 110 + ### Static Files 111 + 112 + QuickDID serves static files from the `www` directory by default. This includes: 113 + - Landing page (`index.html`) 114 + - AT Protocol well-known files (`.well-known/atproto-did` and `.well-known/did.json`) 115 + 116 + Generate the `.well-known` files for your deployment: 117 + 118 + ```bash 119 + HTTP_EXTERNAL=your-domain.com ./generate-wellknown.sh 61 120 ``` 62 121 63 122 This will start QuickDID with: 64 123 - HTTP server on port 8080 (default) 65 - - In-memory caching only (300-second TTL) 124 + - In-memory caching only (600-second TTL default) 66 125 - MPSC queue adapter for async processing 67 126 - Default worker ID: "worker1" 68 127 - Connection to plc.directory for DID resolution 128 + - Rate limiting disabled (default) 69 129 70 130 ### Optional Configuration 71 131 72 132 For production deployments, consider these additional environment variables: 73 133 134 + #### Network & Service 74 135 - `HTTP_PORT`: Server port (default: 8080) 75 - - `REDIS_URL`: Redis connection URL for persistent caching (e.g., `redis://localhost:6379`) 76 - - `QUEUE_ADAPTER`: Queue type - 'mpsc', 'redis', or 'noop' (default: mpsc) 77 - - `QUEUE_WORKER_ID`: Worker identifier for distributed queue processing (default: worker1) 78 136 - `PLC_HOSTNAME`: PLC directory hostname (default: plc.directory) 137 + - `USER_AGENT`: HTTP User-Agent for outgoing requests 138 + - `DNS_NAMESERVERS`: Custom DNS servers (comma-separated) 139 + 140 + #### Caching 141 + - `REDIS_URL`: Redis connection URL (e.g., `redis://localhost:6379`) 142 + - `SQLITE_URL`: SQLite database URL (e.g., `sqlite:./quickdid.db`) 143 + - `CACHE_TTL_MEMORY`: In-memory cache TTL in seconds (default: 600) 144 + - `CACHE_TTL_REDIS`: Redis cache TTL in seconds (default: 7776000 = 90 days) 145 + - `CACHE_TTL_SQLITE`: SQLite cache TTL in seconds (default: 7776000 = 90 days) 146 + 147 + #### Queue Processing 148 + - `QUEUE_ADAPTER`: Queue type - 'mpsc', 'redis', 'sqlite', 'noop', or 'none' (default: mpsc) 149 + - `QUEUE_WORKER_ID`: Worker identifier (default: worker1) 150 + - `QUEUE_BUFFER_SIZE`: MPSC queue buffer size (default: 1000) 151 + - `QUEUE_REDIS_PREFIX`: Redis key prefix for queues (default: queue:handleresolver:) 152 + - `QUEUE_REDIS_TIMEOUT`: Redis blocking timeout in seconds (default: 5) 153 + - `QUEUE_REDIS_DEDUP_ENABLED`: Enable queue deduplication (default: false) 154 + - `QUEUE_REDIS_DEDUP_TTL`: TTL for deduplication keys in seconds (default: 60) 155 + - `QUEUE_SQLITE_MAX_SIZE`: Max SQLite queue size for work shedding (default: 10000) 156 + 157 + #### Rate Limiting 158 + - `RESOLVER_MAX_CONCURRENT`: Maximum concurrent handle resolutions (default: 0 = disabled) 159 + - `RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`: Timeout for acquiring rate limit permit in ms (default: 0 = no timeout) 160 + 161 + #### HTTP Cache Control 162 + - `CACHE_MAX_AGE`: Max-age for Cache-Control header in seconds (default: 86400) 163 + - `CACHE_STALE_IF_ERROR`: Stale-if-error directive in seconds (default: 172800) 164 + - `CACHE_STALE_WHILE_REVALIDATE`: Stale-while-revalidate in seconds (default: 86400) 165 + - `CACHE_MAX_STALE`: Max-stale directive in seconds (default: 86400) 166 + - `ETAG_SEED`: Seed value for ETag generation (default: application version) 167 + 168 + #### Metrics 169 + - `METRICS_ADAPTER`: Metrics adapter type - 'noop' or 'statsd' (default: noop) 170 + - `METRICS_STATSD_HOST`: StatsD host and port (required when METRICS_ADAPTER=statsd) 171 + - `METRICS_STATSD_BIND`: Bind address for StatsD UDP socket (default: [::]:0 for IPv6, can use 0.0.0.0:0 for IPv4) 172 + - `METRICS_PREFIX`: Prefix for all metrics (default: quickdid) 173 + - `METRICS_TAGS`: Comma-separated tags (e.g., env:prod,service:quickdid) 174 + 175 + #### Proactive Refresh 176 + - `PROACTIVE_REFRESH_ENABLED`: Enable proactive cache refreshing (default: false) 177 + - `PROACTIVE_REFRESH_THRESHOLD`: Refresh when TTL remaining is below this threshold (0.0-1.0, default: 0.8) 178 + 179 + #### Jetstream Consumer 180 + - `JETSTREAM_ENABLED`: Enable Jetstream consumer for real-time cache updates (default: false) 181 + - `JETSTREAM_HOSTNAME`: Jetstream WebSocket hostname (default: jetstream.atproto.tools) 182 + 183 + #### Static Files 184 + - `STATIC_FILES_DIR`: Directory for serving static files (default: www) 185 + 186 + #### Logging 79 187 - `RUST_LOG`: Logging level (e.g., debug, info, warn, error) 80 188 81 - ### Production Example 189 + ### Production Examples 82 190 191 + #### Redis-based with Metrics and Jetstream (Multi-instance/HA) 83 192 ```bash 84 193 HTTP_EXTERNAL=quickdid.example.com \ 85 - SERVICE_KEY=did:key:yourkeyhere \ 86 194 HTTP_PORT=3000 \ 87 195 REDIS_URL=redis://localhost:6379 \ 196 + CACHE_TTL_REDIS=86400 \ 88 197 QUEUE_ADAPTER=redis \ 89 198 QUEUE_WORKER_ID=prod-worker-1 \ 199 + RESOLVER_MAX_CONCURRENT=100 \ 200 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 \ 201 + METRICS_ADAPTER=statsd \ 202 + METRICS_STATSD_HOST=localhost:8125 \ 203 + METRICS_PREFIX=quickdid \ 204 + METRICS_TAGS=env:prod,service:quickdid \ 205 + CACHE_MAX_AGE=86400 \ 206 + JETSTREAM_ENABLED=true \ 207 + JETSTREAM_HOSTNAME=jetstream.atproto.tools \ 90 208 RUST_LOG=info \ 91 209 ./target/release/quickdid 92 210 ``` 93 211 212 + #### SQLite-based (Single-instance) 213 + ```bash 214 + HTTP_EXTERNAL=quickdid.example.com \ 215 + HTTP_PORT=3000 \ 216 + SQLITE_URL=sqlite:./quickdid.db \ 217 + CACHE_TTL_SQLITE=86400 \ 218 + QUEUE_ADAPTER=sqlite \ 219 + QUEUE_SQLITE_MAX_SIZE=10000 \ 220 + RESOLVER_MAX_CONCURRENT=50 \ 221 + RUST_LOG=info \ 222 + ./target/release/quickdid 223 + ``` 224 + 225 + ## Architecture 226 + 227 + QuickDID uses a layered architecture for optimal performance: 228 + 229 + ``` 230 + Request โ†’ Cache Layer โ†’ Proactive Refresh โ†’ Rate Limiter โ†’ Base Resolver โ†’ DNS/HTTP 231 + โ†“ โ†“ โ†“ โ†“ 232 + Memory/Redis/ Background Semaphore AT Protocol 233 + SQLite Refresher (optional) Infrastructure 234 + โ†‘ 235 + Jetstream Consumer โ† Real-time Updates from AT Protocol Firehose 236 + ``` 237 + 238 + ### Cache Priority 239 + QuickDID checks caches in this order: 240 + 1. Redis (if configured) - Best for distributed deployments 241 + 2. SQLite (if configured) - Best for single-instance with persistence 242 + 3. In-memory (fallback) - Always available 243 + 244 + ### Real-time Cache Updates 245 + When Jetstream is enabled, QuickDID maintains cache consistency by: 246 + - Processing Account events to purge deleted/deactivated accounts 247 + - Processing Identity events to update handle-to-DID mappings 248 + - Automatically reconnecting with exponential backoff on connection failures 249 + - Tracking metrics for successful and failed event processing 250 + 251 + ### Deployment Strategies 252 + 253 + - **Single-instance**: Use SQLite for both caching and queuing 254 + - **Multi-instance/HA**: Use Redis for distributed caching and queuing 255 + - **Development**: Use in-memory caching with MPSC queuing 256 + - **Real-time sync**: Enable Jetstream consumer for live cache updates 257 + 94 258 ## API Endpoints 95 259 96 260 - `GET /_health` - Health check endpoint 97 261 - `GET /xrpc/com.atproto.identity.resolveHandle` - Resolve handle to DID 98 262 - `GET /.well-known/atproto-did` - Serve DID document for the service 263 + - `OPTIONS /*` - CORS preflight support for all endpoints 264 + 265 + ## Docker Deployment 266 + 267 + QuickDID can be deployed using Docker. See the [production deployment guide](docs/production-deployment.md) for detailed Docker and Docker Compose configurations. 268 + 269 + ### Quick Docker Setup 270 + 271 + ```bash 272 + # Build the image 273 + docker build -t quickdid:latest . 274 + 275 + # Run with environment file 276 + docker run -d \ 277 + --name quickdid \ 278 + --env-file .env \ 279 + -p 8080:8080 \ 280 + quickdid:latest 281 + ``` 282 + 283 + ## Documentation 284 + 285 + - [Configuration Reference](docs/configuration-reference.md) - Complete list of all configuration options 286 + - [Production Deployment Guide](docs/production-deployment.md) - Docker, monitoring, and production best practices 287 + - [Metrics Guide](docs/telegraf-timescaledb-metrics-guide.md) - Setting up metrics with Telegraf and TimescaleDB 288 + - [Development Guide](CLAUDE.md) - Architecture details and development patterns 289 + 290 + ## Railway Deployment 291 + 292 + QuickDID includes Railway deployment resources in the `railway-resources/` directory for easy deployment with metrics support via Telegraf. See the deployment configurations for one-click deployment options. 99 293 100 294 ## License 101 295
+41
docker-compose.yml
··· 1 + version: '3.8' 2 + 3 + services: 4 + quickdid: 5 + image: quickdid:latest 6 + build: . 7 + ports: 8 + - "3007:8080" 9 + environment: 10 + - HTTP_EXTERNAL=localhost:3007 11 + - HTTP_PORT=8080 12 + - RUST_LOG=info 13 + # Optional: Override the static files directory 14 + # - STATIC_FILES_DIR=/app/custom-www 15 + volumes: 16 + # Optional: Mount custom static files from host 17 + # - ./custom-www:/app/custom-www:ro 18 + # Optional: Mount custom .well-known files 19 + # - ./www/.well-known:/app/www/.well-known:ro 20 + # Optional: Use SQLite for caching 21 + # - ./data:/app/data 22 + # environment: 23 + # SQLite cache configuration 24 + # - SQLITE_URL=sqlite:/app/data/quickdid.db 25 + # - CACHE_TTL_SQLITE=86400 26 + 27 + # Redis cache configuration (if using external Redis) 28 + # - REDIS_URL=redis://redis:6379 29 + # - CACHE_TTL_REDIS=86400 30 + # - QUEUE_ADAPTER=redis 31 + 32 + # Optional: Redis service for caching 33 + # redis: 34 + # image: redis:7-alpine 35 + # ports: 36 + # - "6379:6379" 37 + # volumes: 38 + # - redis-data:/data 39 + 40 + volumes: 41 + redis-data:
+735 -44
docs/configuration-reference.md
··· 8 8 - [Network Configuration](#network-configuration) 9 9 - [Caching Configuration](#caching-configuration) 10 10 - [Queue Configuration](#queue-configuration) 11 - - [Security Configuration](#security-configuration) 12 - - [Advanced Configuration](#advanced-configuration) 11 + - [Rate Limiting Configuration](#rate-limiting-configuration) 12 + - [HTTP Caching Configuration](#http-caching-configuration) 13 + - [Metrics Configuration](#metrics-configuration) 14 + - [Proactive Refresh Configuration](#proactive-refresh-configuration) 15 + - [Jetstream Consumer Configuration](#jetstream-consumer-configuration) 16 + - [Static Files Configuration](#static-files-configuration) 13 17 - [Configuration Examples](#configuration-examples) 14 18 - [Validation Rules](#validation-rules) 15 19 ··· 40 44 **Constraints**: 41 45 - Must be a valid hostname or hostname:port combination 42 46 - Port (if specified) must be between 1-65535 43 - - Used to generate service DID (did:web:{HTTP_EXTERNAL}) 44 - 45 - ### `SERVICE_KEY` 46 - 47 - **Required**: Yes 48 - **Type**: String 49 - **Format**: DID private key 50 - **Security**: SENSITIVE - Never commit to version control 51 - 52 - The private key for the service's AT Protocol identity. This key is used to sign responses and authenticate the service. 53 - 54 - **Examples**: 55 - ```bash 56 - # did:key format (Ed25519) 57 - SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 58 - 59 - # did:plc format 60 - SERVICE_KEY=did:plc:xyz123abc456def789 61 - ``` 62 - 63 - **Constraints**: 64 - - Must be a valid DID format 65 - - Must include the private key component 66 - - Should be stored securely (e.g., secrets manager, encrypted storage) 67 47 68 48 ## Network Configuration 69 49 ··· 378 358 QUEUE_REDIS_TIMEOUT=30 # Minimal polling, slow shutdown 379 359 ``` 380 360 361 + ### `QUEUE_REDIS_DEDUP_ENABLED` 362 + 363 + **Required**: No 364 + **Type**: Boolean 365 + **Default**: `false` 366 + 367 + Enable deduplication for Redis queue to prevent duplicate handles from being queued multiple times within the TTL window. When enabled, uses Redis SET with TTL to track handles currently being processed. 368 + 369 + **Examples**: 370 + ```bash 371 + # Enable deduplication (recommended for production) 372 + QUEUE_REDIS_DEDUP_ENABLED=true 373 + 374 + # Disable deduplication (default) 375 + QUEUE_REDIS_DEDUP_ENABLED=false 376 + ``` 377 + 378 + **Use cases**: 379 + - **Production**: Enable to prevent duplicate work and reduce load 380 + - **High-traffic**: Essential to avoid processing the same handle multiple times 381 + - **Development**: Can be disabled for simpler debugging 382 + 383 + ### `QUEUE_REDIS_DEDUP_TTL` 384 + 385 + **Required**: No 386 + **Type**: Integer (seconds) 387 + **Default**: `60` 388 + **Range**: 10-300 (recommended) 389 + **Constraints**: Must be > 0 when deduplication is enabled 390 + 391 + TTL for Redis queue deduplication keys in seconds. Determines how long to prevent duplicate handle resolution requests. 392 + 393 + **Examples**: 394 + ```bash 395 + # Quick deduplication window (10 seconds) 396 + QUEUE_REDIS_DEDUP_TTL=10 397 + 398 + # Default (1 minute) 399 + QUEUE_REDIS_DEDUP_TTL=60 400 + 401 + # Extended deduplication (5 minutes) 402 + QUEUE_REDIS_DEDUP_TTL=300 403 + ``` 404 + 405 + **Recommendations**: 406 + - **Fast processing**: 10-30 seconds 407 + - **Normal processing**: 60 seconds (default) 408 + - **Slow processing or high load**: 120-300 seconds 409 + 381 410 ### `QUEUE_WORKER_ID` 382 411 383 412 **Required**: No ··· 453 482 - **Disk space concerns**: Lower values (1000-5000) 454 483 - **High ingestion rate**: Higher values (50000-1000000) 455 484 485 + ## Rate Limiting Configuration 486 + 487 + ### `RESOLVER_MAX_CONCURRENT` 488 + 489 + **Required**: No 490 + **Type**: Integer 491 + **Default**: `0` (disabled) 492 + **Range**: 0-10000 493 + **Constraints**: Must be between 0 and 10000 494 + 495 + Maximum concurrent handle resolutions allowed. When set to a value greater than 0, enables semaphore-based rate limiting to protect upstream DNS and HTTP services from being overwhelmed. 496 + 497 + **How it works**: 498 + - Uses a semaphore to limit concurrent resolutions 499 + - Applied between the base resolver and caching layers 500 + - Requests wait for an available permit before resolution 501 + - Helps prevent overwhelming upstream services 502 + 503 + **Examples**: 504 + ```bash 505 + # Disabled (default) 506 + RESOLVER_MAX_CONCURRENT=0 507 + 508 + # Light rate limiting 509 + RESOLVER_MAX_CONCURRENT=10 510 + 511 + # Moderate rate limiting 512 + RESOLVER_MAX_CONCURRENT=50 513 + 514 + # Heavy traffic with rate limiting 515 + RESOLVER_MAX_CONCURRENT=100 516 + 517 + # Maximum allowed 518 + RESOLVER_MAX_CONCURRENT=10000 519 + ``` 520 + 521 + **Recommendations**: 522 + - **Development**: 0 (disabled) or 10-50 for testing 523 + - **Production (low traffic)**: 50-100 524 + - **Production (high traffic)**: 100-500 525 + - **Production (very high traffic)**: 500-1000 526 + - **Testing rate limiting**: 1-5 to observe behavior 527 + 528 + **Placement in resolver stack**: 529 + ``` 530 + Request โ†’ Cache โ†’ RateLimited โ†’ Base โ†’ DNS/HTTP 531 + ``` 532 + 533 + ### `RESOLVER_MAX_CONCURRENT_TIMEOUT_MS` 534 + 535 + **Required**: No 536 + **Type**: Integer (milliseconds) 537 + **Default**: `0` (no timeout) 538 + **Range**: 0-60000 539 + **Constraints**: Must be between 0 and 60000 (60 seconds max) 540 + 541 + Timeout for acquiring a rate limit permit in milliseconds. When set to a value greater than 0, requests will timeout if they cannot acquire a permit within the specified time, preventing them from waiting indefinitely when the rate limiter is at capacity. 542 + 543 + **How it works**: 544 + - Applied when `RESOLVER_MAX_CONCURRENT` is enabled (> 0) 545 + - Uses `tokio::time::timeout` to limit permit acquisition time 546 + - Returns an error if timeout expires before permit is acquired 547 + - Prevents request queue buildup during high load 548 + 549 + **Examples**: 550 + ```bash 551 + # No timeout (default) 552 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=0 553 + 554 + # Quick timeout for responsive failures (100ms) 555 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=100 556 + 557 + # Moderate timeout (1 second) 558 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=1000 559 + 560 + # Longer timeout for production (5 seconds) 561 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 562 + 563 + # Maximum allowed (60 seconds) 564 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=60000 565 + ``` 566 + 567 + **Recommendations**: 568 + - **Development**: 100-1000ms for quick feedback 569 + - **Production (low latency)**: 1000-5000ms 570 + - **Production (high latency tolerance)**: 5000-30000ms 571 + - **Testing**: 100ms to quickly identify bottlenecks 572 + - **0**: Use when you want requests to wait indefinitely 573 + 574 + **Error behavior**: 575 + When a timeout occurs, the request fails with: 576 + ``` 577 + Rate limit permit acquisition timed out after {timeout}ms 578 + ``` 579 + 580 + ## Metrics Configuration 581 + 582 + ### `METRICS_ADAPTER` 583 + 584 + **Required**: No 585 + **Type**: String 586 + **Default**: `noop` 587 + **Values**: `noop`, `statsd` 588 + 589 + Metrics adapter type for collecting and publishing metrics. 590 + 591 + **Options**: 592 + - `noop`: No metrics collection (default) 593 + - `statsd`: Send metrics to StatsD server 594 + 595 + **Examples**: 596 + ```bash 597 + # No metrics (default) 598 + METRICS_ADAPTER=noop 599 + 600 + # Enable StatsD metrics 601 + METRICS_ADAPTER=statsd 602 + ``` 603 + 604 + ### `METRICS_STATSD_HOST` 605 + 606 + **Required**: Yes (when METRICS_ADAPTER=statsd) 607 + **Type**: String 608 + **Format**: hostname:port 609 + 610 + StatsD server host and port for metrics collection. 611 + 612 + **Examples**: 613 + ```bash 614 + # Local StatsD 615 + METRICS_STATSD_HOST=localhost:8125 616 + 617 + # Remote StatsD 618 + METRICS_STATSD_HOST=statsd.example.com:8125 619 + 620 + # Docker network 621 + METRICS_STATSD_HOST=statsd:8125 622 + ``` 623 + 624 + ### `METRICS_STATSD_BIND` 625 + 626 + **Required**: No 627 + **Type**: String 628 + **Default**: `[::]:0` 629 + 630 + Bind address for StatsD UDP socket. Controls which local address to bind for sending UDP packets. 631 + 632 + **Examples**: 633 + ```bash 634 + # IPv6 any address, random port (default) 635 + METRICS_STATSD_BIND=[::]:0 636 + 637 + # IPv4 any address, random port 638 + METRICS_STATSD_BIND=0.0.0.0:0 639 + 640 + # Specific interface 641 + METRICS_STATSD_BIND=192.168.1.100:0 642 + 643 + # Specific port 644 + METRICS_STATSD_BIND=[::]:8126 645 + ``` 646 + 647 + ### `METRICS_PREFIX` 648 + 649 + **Required**: No 650 + **Type**: String 651 + **Default**: `quickdid` 652 + 653 + Prefix for all metrics. Used to namespace metrics in your monitoring system. 654 + 655 + **Examples**: 656 + ```bash 657 + # Default 658 + METRICS_PREFIX=quickdid 659 + 660 + # Environment-specific 661 + METRICS_PREFIX=prod.quickdid 662 + METRICS_PREFIX=staging.quickdid 663 + 664 + # Region-specific 665 + METRICS_PREFIX=us-east-1.quickdid 666 + METRICS_PREFIX=eu-west-1.quickdid 667 + 668 + # Service-specific 669 + METRICS_PREFIX=api.quickdid 670 + ``` 671 + 672 + ### `METRICS_TAGS` 673 + 674 + **Required**: No 675 + **Type**: String (comma-separated key:value pairs) 676 + **Default**: None 677 + 678 + Default tags for all metrics. Added to all metrics for filtering and grouping. 679 + 680 + **Examples**: 681 + ```bash 682 + # Basic tags 683 + METRICS_TAGS=env:production,service:quickdid 684 + 685 + # Detailed tags 686 + METRICS_TAGS=env:production,service:quickdid,region:us-east-1,version:1.0.0 687 + 688 + # Deployment-specific 689 + METRICS_TAGS=env:staging,cluster:k8s-staging,namespace:quickdid 690 + ``` 691 + 692 + **Common tag patterns**: 693 + - `env`: Environment (production, staging, development) 694 + - `service`: Service name 695 + - `region`: Geographic region 696 + - `version`: Application version 697 + - `cluster`: Kubernetes cluster name 698 + - `instance`: Instance identifier 699 + 700 + ## Proactive Refresh Configuration 701 + 702 + ### `PROACTIVE_REFRESH_ENABLED` 703 + 704 + **Required**: No 705 + **Type**: Boolean 706 + **Default**: `false` 707 + 708 + Enable proactive cache refresh for frequently accessed handles. When enabled, cache entries that have reached the refresh threshold will be queued for background refresh to keep the cache warm. 709 + 710 + **Examples**: 711 + ```bash 712 + # Enable proactive refresh (recommended for production) 713 + PROACTIVE_REFRESH_ENABLED=true 714 + 715 + # Disable proactive refresh (default) 716 + PROACTIVE_REFRESH_ENABLED=false 717 + ``` 718 + 719 + **Benefits**: 720 + - Prevents cache misses for popular handles 721 + - Maintains consistent response times 722 + - Reduces latency spikes during cache expiration 723 + 724 + **Considerations**: 725 + - Increases background processing load 726 + - More DNS/HTTP requests to upstream services 727 + - Best for high-traffic services with predictable access patterns 728 + 729 + ### `PROACTIVE_REFRESH_THRESHOLD` 730 + 731 + **Required**: No 732 + **Type**: Float 733 + **Default**: `0.8` 734 + **Range**: 0.0-1.0 735 + **Constraints**: Must be between 0.0 and 1.0 736 + 737 + Threshold as a percentage (0.0-1.0) of cache TTL when to trigger proactive refresh. For example, 0.8 means refresh when an entry has lived for 80% of its TTL. 738 + 739 + **Examples**: 740 + ```bash 741 + # Very aggressive (refresh at 50% of TTL) 742 + PROACTIVE_REFRESH_THRESHOLD=0.5 743 + 744 + # Moderate (refresh at 70% of TTL) 745 + PROACTIVE_REFRESH_THRESHOLD=0.7 746 + 747 + # Default (refresh at 80% of TTL) 748 + PROACTIVE_REFRESH_THRESHOLD=0.8 749 + 750 + # Conservative (refresh at 90% of TTL) 751 + PROACTIVE_REFRESH_THRESHOLD=0.9 752 + 753 + # Very conservative (refresh at 95% of TTL) 754 + PROACTIVE_REFRESH_THRESHOLD=0.95 755 + ``` 756 + 757 + **Recommendations**: 758 + - **High-traffic services**: 0.5-0.7 (aggressive refresh) 759 + - **Normal traffic**: 0.8 (default, balanced) 760 + - **Low traffic**: 0.9-0.95 (conservative) 761 + - **Development**: 0.5 (test refresh behavior) 762 + 763 + **Impact on different cache TTLs**: 764 + - TTL=600s (10 min), threshold=0.8: Refresh after 8 minutes 765 + - TTL=3600s (1 hour), threshold=0.8: Refresh after 48 minutes 766 + - TTL=86400s (1 day), threshold=0.8: Refresh after 19.2 hours 767 + 768 + ## Jetstream Consumer Configuration 769 + 770 + ### `JETSTREAM_ENABLED` 771 + 772 + **Required**: No 773 + **Type**: Boolean 774 + **Default**: `false` 775 + 776 + Enable Jetstream consumer for real-time cache updates from the AT Protocol firehose. When enabled, QuickDID connects to the Jetstream WebSocket service to receive live updates about account and identity changes. 777 + 778 + **How it works**: 779 + - Subscribes to Account and Identity events from the firehose 780 + - Processes Account events to purge deleted/deactivated accounts 781 + - Processes Identity events to update handle-to-DID mappings 782 + - Automatically reconnects with exponential backoff on connection failures 783 + - Tracks metrics for successful and failed event processing 784 + 785 + **Examples**: 786 + ```bash 787 + # Enable Jetstream consumer (recommended for production) 788 + JETSTREAM_ENABLED=true 789 + 790 + # Disable Jetstream consumer (default) 791 + JETSTREAM_ENABLED=false 792 + ``` 793 + 794 + **Benefits**: 795 + - Real-time cache synchronization with AT Protocol network 796 + - Automatic removal of deleted/deactivated accounts 797 + - Immediate handle change updates 798 + - Reduces stale data in cache 799 + 800 + **Considerations**: 801 + - Requires stable WebSocket connection 802 + - Increases network traffic (incoming events) 803 + - Best for services requiring up-to-date handle mappings 804 + - Automatically handles reconnection on failures 805 + 806 + ### `JETSTREAM_HOSTNAME` 807 + 808 + **Required**: No 809 + **Type**: String 810 + **Default**: `jetstream.atproto.tools` 811 + 812 + The hostname of the Jetstream WebSocket service to connect to for real-time AT Protocol events. Only used when `JETSTREAM_ENABLED=true`. 813 + 814 + **Examples**: 815 + ```bash 816 + # Production firehose (default) 817 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 818 + 819 + # Staging environment 820 + JETSTREAM_HOSTNAME=jetstream-staging.atproto.tools 821 + 822 + # Local development firehose 823 + JETSTREAM_HOSTNAME=localhost:6008 824 + 825 + # Custom deployment 826 + JETSTREAM_HOSTNAME=jetstream.example.com 827 + ``` 828 + 829 + **Event Processing**: 830 + - **Account events**: 831 + - `status: deleted` โ†’ Purges handle and DID from all caches 832 + - `status: deactivated` โ†’ Purges handle and DID from all caches 833 + - Other statuses โ†’ Ignored 834 + 835 + - **Identity events**: 836 + - Updates handle-to-DID mapping in cache 837 + - Removes old handle mapping if changed 838 + - Maintains bidirectional cache consistency 839 + 840 + **Metrics Tracked** (when metrics are enabled): 841 + - `jetstream.events.received`: Total events received 842 + - `jetstream.events.processed`: Successfully processed events 843 + - `jetstream.events.failed`: Failed event processing 844 + - `jetstream.connections.established`: Successful connections 845 + - `jetstream.connections.failed`: Failed connection attempts 846 + 847 + **Reconnection Behavior**: 848 + - Initial retry delay: 1 second 849 + - Maximum retry delay: 60 seconds 850 + - Exponential backoff with jitter 851 + - Automatic recovery on transient failures 852 + 853 + **Recommendations**: 854 + - **Production**: Use default `jetstream.atproto.tools` 855 + - **Development**: Consider local firehose for testing 856 + - **High availability**: Monitor connection metrics 857 + - **Network issues**: Check WebSocket connectivity 858 + 859 + ## Static Files Configuration 860 + 861 + ### `STATIC_FILES_DIR` 862 + 863 + **Required**: No 864 + **Type**: String (directory path) 865 + **Default**: `www` 866 + 867 + Directory path for serving static files. This directory should contain the landing page and AT Protocol well-known files. 868 + 869 + **Directory Structure**: 870 + ``` 871 + www/ 872 + โ”œโ”€โ”€ index.html # Landing page 873 + โ”œโ”€โ”€ .well-known/ 874 + โ”‚ โ”œโ”€โ”€ atproto-did # Service DID identifier 875 + โ”‚ โ””โ”€โ”€ did.json # DID document 876 + โ””โ”€โ”€ (other static assets) 877 + ``` 878 + 879 + **Examples**: 880 + ```bash 881 + # Default (relative to working directory) 882 + STATIC_FILES_DIR=www 883 + 884 + # Absolute path 885 + STATIC_FILES_DIR=/var/www/quickdid 886 + 887 + # Docker container path 888 + STATIC_FILES_DIR=/app/www 889 + 890 + # Custom directory 891 + STATIC_FILES_DIR=./public 892 + ``` 893 + 894 + **Docker Volume Mounting**: 895 + ```yaml 896 + volumes: 897 + # Mount entire custom directory 898 + - ./custom-www:/app/www:ro 899 + 900 + # Mount specific files 901 + - ./custom-index.html:/app/www/index.html:ro 902 + - ./well-known:/app/www/.well-known:ro 903 + ``` 904 + 905 + **Generating Well-Known Files**: 906 + ```bash 907 + # Generate .well-known files for your domain 908 + HTTP_EXTERNAL=your-domain.com ./generate-wellknown.sh 909 + ``` 910 + 911 + ## HTTP Caching Configuration 912 + 913 + ### `CACHE_MAX_AGE` 914 + 915 + **Required**: No 916 + **Type**: Integer (seconds) 917 + **Default**: `86400` (24 hours) 918 + **Range**: 0-31536000 (0 to 1 year) 919 + 920 + Maximum age for HTTP Cache-Control header in seconds. When set to 0, the Cache-Control header is disabled and will not be added to responses. This controls how long clients and intermediate caches can cache responses. 921 + 922 + **Examples**: 923 + ```bash 924 + # Default (24 hours) 925 + CACHE_MAX_AGE=86400 926 + 927 + # Aggressive caching (7 days) 928 + CACHE_MAX_AGE=604800 929 + 930 + # Conservative caching (1 hour) 931 + CACHE_MAX_AGE=3600 932 + 933 + # Disable Cache-Control header 934 + CACHE_MAX_AGE=0 935 + ``` 936 + 937 + ### `CACHE_STALE_IF_ERROR` 938 + 939 + **Required**: No 940 + **Type**: Integer (seconds) 941 + **Default**: `172800` (48 hours) 942 + 943 + Allows stale content to be served if the backend encounters an error. This provides resilience during service outages. 944 + 945 + **Examples**: 946 + ```bash 947 + # Default (48 hours) 948 + CACHE_STALE_IF_ERROR=172800 949 + 950 + # Extended error tolerance (7 days) 951 + CACHE_STALE_IF_ERROR=604800 952 + 953 + # Minimal error tolerance (1 hour) 954 + CACHE_STALE_IF_ERROR=3600 955 + ``` 956 + 957 + ### `CACHE_STALE_WHILE_REVALIDATE` 958 + 959 + **Required**: No 960 + **Type**: Integer (seconds) 961 + **Default**: `86400` (24 hours) 962 + 963 + Allows stale content to be served while fresh content is being fetched in the background. This improves perceived performance. 964 + 965 + **Examples**: 966 + ```bash 967 + # Default (24 hours) 968 + CACHE_STALE_WHILE_REVALIDATE=86400 969 + 970 + # Quick revalidation (1 hour) 971 + CACHE_STALE_WHILE_REVALIDATE=3600 972 + 973 + # Extended revalidation (7 days) 974 + CACHE_STALE_WHILE_REVALIDATE=604800 975 + ``` 976 + 977 + ### `CACHE_MAX_STALE` 978 + 979 + **Required**: No 980 + **Type**: Integer (seconds) 981 + **Default**: `172800` (48 hours) 982 + 983 + Maximum time a client will accept stale responses. This provides an upper bound on how old cached content can be. 984 + 985 + **Examples**: 986 + ```bash 987 + # Default (48 hours) 988 + CACHE_MAX_STALE=172800 989 + 990 + # Extended staleness (7 days) 991 + CACHE_MAX_STALE=604800 992 + 993 + # Strict freshness (1 hour) 994 + CACHE_MAX_STALE=3600 995 + ``` 996 + 997 + ### `CACHE_MIN_FRESH` 998 + 999 + **Required**: No 1000 + **Type**: Integer (seconds) 1001 + **Default**: `3600` (1 hour) 1002 + 1003 + Minimum time a response must remain fresh. Clients will not accept responses that will expire within this time. 1004 + 1005 + **Examples**: 1006 + ```bash 1007 + # Default (1 hour) 1008 + CACHE_MIN_FRESH=3600 1009 + 1010 + # Strict freshness (24 hours) 1011 + CACHE_MIN_FRESH=86400 1012 + 1013 + # Relaxed freshness (5 minutes) 1014 + CACHE_MIN_FRESH=300 1015 + ``` 1016 + 1017 + **Cache-Control Header Format**: 1018 + 1019 + When `CACHE_MAX_AGE` is greater than 0, the following Cache-Control header is added to responses: 1020 + ``` 1021 + Cache-Control: public, max-age=86400, stale-while-revalidate=86400, stale-if-error=172800, max-stale=172800, min-fresh=3600 1022 + ``` 1023 + 1024 + **Recommendations**: 1025 + - **High-traffic services**: Use longer max-age (86400-604800) to reduce load 1026 + - **Frequently changing data**: Use shorter max-age (3600-14400) 1027 + - **Critical services**: Set higher stale-if-error for resilience 1028 + - **Performance-sensitive**: Enable stale-while-revalidate for better UX 1029 + - **Disable caching**: Set CACHE_MAX_AGE=0 for real-time data 1030 + 1031 + ### `ETAG_SEED` 1032 + 1033 + **Required**: No 1034 + **Type**: String 1035 + **Default**: Application version (from `CARGO_PKG_VERSION`) 1036 + 1037 + Seed value for ETAG generation to allow cache invalidation. This value is incorporated into ETAG checksums, allowing server administrators to invalidate client-cached responses after major changes or deployments. 1038 + 1039 + **How it works**: 1040 + - Combined with response content to generate ETAG checksums 1041 + - Uses MetroHash64 for fast, non-cryptographic hashing 1042 + - Generates weak ETags (W/"hash") for HTTP caching 1043 + - Changing the seed invalidates all client caches 1044 + 1045 + **Examples**: 1046 + ```bash 1047 + # Default (uses application version) 1048 + # ETAG_SEED is automatically set to the version 1049 + 1050 + # Deployment-specific seed 1051 + ETAG_SEED=prod-2024-01-15 1052 + 1053 + # Version with timestamp 1054 + ETAG_SEED=v1.0.0-1705344000 1055 + 1056 + # Environment-specific 1057 + ETAG_SEED=staging-v2 1058 + 1059 + # Force cache invalidation after config change 1060 + ETAG_SEED=config-update-2024-01-15 1061 + ``` 1062 + 1063 + **Use cases**: 1064 + - **Major configuration changes**: Update seed to invalidate all cached responses 1065 + - **Data migration**: Force clients to refetch after backend changes 1066 + - **Security updates**: Ensure clients get fresh data after security fixes 1067 + - **A/B testing**: Different seeds for different deployment groups 1068 + - **Rollback scenarios**: Revert to previous seed to restore cache behavior 1069 + 1070 + **Recommendations**: 1071 + - **Default**: Use the application version (automatic) 1072 + - **Production**: Include deployment date or config version 1073 + - **Staging**: Use environment-specific seeds 1074 + - **After incidents**: Update seed to force fresh data 1075 + - **Routine deployments**: Keep the same seed if no data changes 1076 + 456 1077 ## Configuration Examples 457 1078 458 1079 ### Minimal Development Configuration ··· 460 1081 ```bash 461 1082 # .env.development 462 1083 HTTP_EXTERNAL=localhost:3007 463 - SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 464 1084 RUST_LOG=debug 465 1085 ``` 466 1086 ··· 470 1090 # .env.production.redis 471 1091 # Required 472 1092 HTTP_EXTERNAL=quickdid.example.com 473 - SERVICE_KEY=${SECRET_SERVICE_KEY} # From secrets manager 474 1093 475 1094 # Network 476 1095 HTTP_PORT=8080 ··· 485 1104 QUEUE_ADAPTER=redis 486 1105 QUEUE_REDIS_TIMEOUT=5 487 1106 QUEUE_BUFFER_SIZE=5000 1107 + QUEUE_REDIS_DEDUP_ENABLED=true # Prevent duplicate work 1108 + QUEUE_REDIS_DEDUP_TTL=60 1109 + 1110 + # Rate Limiting (optional, recommended for production) 1111 + RESOLVER_MAX_CONCURRENT=100 1112 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 # 5 second timeout 1113 + 1114 + # Metrics (optional, recommended for production) 1115 + METRICS_ADAPTER=statsd 1116 + METRICS_STATSD_HOST=localhost:8125 1117 + METRICS_PREFIX=quickdid 1118 + METRICS_TAGS=env:prod,service:quickdid 1119 + 1120 + # Proactive Refresh (optional, recommended for high-traffic) 1121 + PROACTIVE_REFRESH_ENABLED=true 1122 + PROACTIVE_REFRESH_THRESHOLD=0.8 1123 + 1124 + # Jetstream Consumer (optional, recommended for real-time sync) 1125 + JETSTREAM_ENABLED=true 1126 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 1127 + 1128 + # HTTP Caching (Cache-Control headers) 1129 + CACHE_MAX_AGE=86400 # 24 hours 1130 + CACHE_STALE_IF_ERROR=172800 # 48 hours 1131 + CACHE_STALE_WHILE_REVALIDATE=86400 # 24 hours 488 1132 489 1133 # Logging 490 1134 RUST_LOG=info ··· 496 1140 # .env.production.sqlite 497 1141 # Required 498 1142 HTTP_EXTERNAL=quickdid.example.com 499 - SERVICE_KEY=${SECRET_SERVICE_KEY} # From secrets manager 500 1143 501 1144 # Network 502 1145 HTTP_PORT=8080 ··· 512 1155 QUEUE_BUFFER_SIZE=5000 513 1156 QUEUE_SQLITE_MAX_SIZE=10000 514 1157 1158 + # Rate Limiting (optional, recommended for production) 1159 + RESOLVER_MAX_CONCURRENT=100 1160 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=5000 # 5 second timeout 1161 + 1162 + # Jetstream Consumer (optional, recommended for real-time sync) 1163 + JETSTREAM_ENABLED=true 1164 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 1165 + 1166 + # HTTP Caching (Cache-Control headers) 1167 + CACHE_MAX_AGE=86400 # 24 hours 1168 + CACHE_STALE_IF_ERROR=172800 # 48 hours 1169 + CACHE_STALE_WHILE_REVALIDATE=86400 # 24 hours 1170 + 515 1171 # Logging 516 1172 RUST_LOG=info 517 1173 ``` ··· 522 1178 # .env.ha.redis 523 1179 # Required 524 1180 HTTP_EXTERNAL=quickdid.example.com 525 - SERVICE_KEY=${SECRET_SERVICE_KEY} 526 1181 527 1182 # Network 528 1183 HTTP_PORT=8080 ··· 539 1194 QUEUE_REDIS_PREFIX=prod:queue: 540 1195 QUEUE_WORKER_ID=${HOSTNAME:-worker1} 541 1196 QUEUE_REDIS_TIMEOUT=10 1197 + QUEUE_REDIS_DEDUP_ENABLED=true # Essential for multi-instance 1198 + QUEUE_REDIS_DEDUP_TTL=120 # Longer TTL for HA 542 1199 543 1200 # Performance 544 1201 QUEUE_BUFFER_SIZE=10000 545 1202 1203 + # Rate Limiting (important for HA deployments) 1204 + RESOLVER_MAX_CONCURRENT=500 1205 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=10000 # 10 second timeout for HA 1206 + 1207 + # Metrics (recommended for HA monitoring) 1208 + METRICS_ADAPTER=statsd 1209 + METRICS_STATSD_HOST=statsd:8125 1210 + METRICS_PREFIX=quickdid.prod 1211 + METRICS_TAGS=env:prod,service:quickdid,cluster:ha 1212 + 1213 + # Proactive Refresh (recommended for HA) 1214 + PROACTIVE_REFRESH_ENABLED=true 1215 + PROACTIVE_REFRESH_THRESHOLD=0.7 # More aggressive for HA 1216 + 1217 + # Jetstream Consumer (recommended for real-time sync in HA) 1218 + JETSTREAM_ENABLED=true 1219 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 1220 + 546 1221 # Logging 547 1222 RUST_LOG=warn 548 1223 ``` ··· 553 1228 # .env.hybrid 554 1229 # Required 555 1230 HTTP_EXTERNAL=quickdid.example.com 556 - SERVICE_KEY=${SECRET_SERVICE_KEY} 557 1231 558 1232 # Network 559 1233 HTTP_PORT=8080 ··· 584 1258 image: quickdid:latest 585 1259 environment: 586 1260 HTTP_EXTERNAL: quickdid.example.com 587 - SERVICE_KEY: ${SERVICE_KEY} 588 1261 HTTP_PORT: 8080 589 1262 REDIS_URL: redis://redis:6379/0 590 1263 CACHE_TTL_MEMORY: 600 591 1264 CACHE_TTL_REDIS: 86400 592 1265 QUEUE_ADAPTER: redis 593 1266 QUEUE_REDIS_TIMEOUT: 5 1267 + JETSTREAM_ENABLED: true 1268 + JETSTREAM_HOSTNAME: jetstream.atproto.tools 594 1269 RUST_LOG: info 595 1270 ports: 596 1271 - "8080:8080" ··· 613 1288 image: quickdid:latest 614 1289 environment: 615 1290 HTTP_EXTERNAL: quickdid.example.com 616 - SERVICE_KEY: ${SERVICE_KEY} 617 1291 HTTP_PORT: 8080 618 1292 SQLITE_URL: sqlite:/data/quickdid.db 619 1293 CACHE_TTL_MEMORY: 600 ··· 621 1295 QUEUE_ADAPTER: sqlite 622 1296 QUEUE_BUFFER_SIZE: 5000 623 1297 QUEUE_SQLITE_MAX_SIZE: 10000 1298 + JETSTREAM_ENABLED: true 1299 + JETSTREAM_HOSTNAME: jetstream.atproto.tools 624 1300 RUST_LOG: info 625 1301 ports: 626 1302 - "8080:8080" ··· 639 1315 ### Required Fields 640 1316 641 1317 1. **HTTP_EXTERNAL**: Must be provided 642 - 2. **SERVICE_KEY**: Must be provided 1318 + 2. **HTTP_EXTERNAL**: Must be provided 643 1319 644 1320 ### Value Constraints 645 1321 ··· 655 1331 - Must be one of: `mpsc`, `redis`, `sqlite`, `noop`, `none` 656 1332 - Case-sensitive 657 1333 658 - 4. **Port** (`HTTP_PORT`): 1334 + 4. **Rate Limiting** (`RESOLVER_MAX_CONCURRENT`): 1335 + - Must be between 0 and 10000 1336 + - 0 = disabled (default) 1337 + - Values > 10000 will fail validation 1338 + 1339 + 5. **Rate Limiting Timeout** (`RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`): 1340 + - Must be between 0 and 60000 (milliseconds) 1341 + - 0 = no timeout (default) 1342 + - Values > 60000 will fail validation 1343 + 1344 + 6. **Port** (`HTTP_PORT`): 659 1345 - Must be valid port number (1-65535) 660 1346 - Ports < 1024 require elevated privileges 661 1347 ··· 674 1360 675 1361 ```bash 676 1362 # Validate configuration 677 - HTTP_EXTERNAL=test SERVICE_KEY=test quickdid --help 1363 + HTTP_EXTERNAL=test quickdid --help 678 1364 679 1365 # Test with specific values 680 1366 CACHE_TTL_MEMORY=0 quickdid --help # Will fail validation 681 1367 682 1368 # Check parsed configuration (with debug logging) 683 - RUST_LOG=debug HTTP_EXTERNAL=test SERVICE_KEY=test quickdid 1369 + RUST_LOG=debug HTTP_EXTERNAL=test quickdid 684 1370 ``` 685 1371 686 1372 ## Best Practices 687 1373 688 1374 ### Security 689 1375 690 - 1. **Never commit SERVICE_KEY** to version control 691 - 2. Use environment-specific key management (Vault, AWS Secrets, etc.) 692 - 3. Rotate SERVICE_KEY regularly 693 - 4. Use TLS for Redis connections in production (`rediss://`) 1376 + 1. Use environment-specific configuration management 1377 + 2. Use TLS for Redis connections in production (`rediss://`) 1378 + 3. Never commit sensitive configuration to version control 694 1379 5. Implement network segmentation for Redis access 695 1380 696 1381 ### Performance ··· 707 1392 2. **Single-instance deployments**: Use SQLite for persistent caching and queuing 708 1393 3. **Development/testing**: Use memory-only caching with MPSC queuing 709 1394 4. **Hybrid setups**: Configure both Redis and SQLite for redundancy 710 - 5. **Queue adapter guidelines**: 1395 + 5. **Real-time sync**: Enable Jetstream consumer for live cache updates 1396 + 6. **Queue adapter guidelines**: 711 1397 - Redis: Best for multi-instance deployments with distributed processing 712 1398 - SQLite: Best for single-instance deployments needing persistence 713 1399 - MPSC: Best for single-instance deployments without persistence needs 714 - 6. **Cache TTL guidelines**: 1400 + 7. **Cache TTL guidelines**: 715 1401 - Redis: Shorter TTLs (1-7 days) for frequently updated handles 716 1402 - SQLite: Longer TTLs (7-90 days) for stable single-instance caching 717 1403 - Memory: Short TTLs (5-30 minutes) as fallback 1404 + 8. **Jetstream guidelines**: 1405 + - Production: Enable for real-time cache synchronization 1406 + - High-traffic: Essential for reducing stale data 1407 + - Development: Can be disabled for simpler testing 1408 + - Monitor WebSocket connection health in production 718 1409 719 1410 ### Monitoring 720 1411 ··· 726 1417 ### Deployment 727 1418 728 1419 1. Use `.env` files for local development 729 - 2. Use secrets management for production SERVICE_KEY 1420 + 2. Use secrets management for production configurations 730 1421 3. Set resource limits in container orchestration 731 1422 4. Use health checks to monitor service availability 732 1423 5. Implement gradual rollouts with feature flags
+182 -19
docs/production-deployment.md
··· 42 42 # - localhost:3007 (for testing only) 43 43 HTTP_EXTERNAL=quickdid.example.com 44 44 45 - # Private key for service identity (DID format) 46 - # Generate a new key for production using atproto-identity tools 47 - # SECURITY: Keep this key secure and never commit to version control 48 - # Example formats: 49 - # - did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK 50 - # - did:plc:xyz123abc456 51 - SERVICE_KEY=did:key:YOUR_PRODUCTION_KEY_HERE 52 - 53 45 # ---------------------------------------------------------------------------- 54 46 # NETWORK CONFIGURATION 55 47 # ---------------------------------------------------------------------------- ··· 133 125 # Higher = less polling overhead, slower shutdown 134 126 QUEUE_REDIS_TIMEOUT=5 135 127 128 + # Enable deduplication for Redis queue to prevent duplicate handles (default: false) 129 + # When enabled, uses Redis SET with TTL to track handles being processed 130 + # Prevents the same handle from being queued multiple times within the TTL window 131 + QUEUE_REDIS_DEDUP_ENABLED=false 132 + 133 + # TTL for Redis queue deduplication keys in seconds (default: 60) 134 + # Range: 10-300 recommended 135 + # Determines how long to prevent duplicate handle resolution requests 136 + QUEUE_REDIS_DEDUP_TTL=60 137 + 136 138 # Worker ID for Redis queue (defaults to "worker1") 137 139 # Set this for predictable worker identification in multi-instance deployments 138 140 # Examples: worker-001, prod-us-east-1, $(hostname) ··· 158 160 # Identifies your service to other AT Protocol services 159 161 # Default: Auto-generated with current version from Cargo.toml 160 162 # Format: quickdid/{version} (+https://github.com/smokesignal.events/quickdid) 161 - USER_AGENT=quickdid/1.0.0-rc.2 (+https://quickdid.example.com) 163 + USER_AGENT=quickdid/1.0.0-rc.5 (+https://quickdid.example.com) 162 164 163 165 # Custom DNS nameservers (comma-separated) 164 166 # Use for custom DNS resolution or to bypass local DNS ··· 184 186 # RUST_LOG_FORMAT=json 185 187 186 188 # ---------------------------------------------------------------------------- 189 + # RATE LIMITING CONFIGURATION 190 + # ---------------------------------------------------------------------------- 191 + 192 + # Maximum concurrent handle resolutions (default: 0 = disabled) 193 + # When > 0, enables semaphore-based rate limiting 194 + # Range: 0-10000 (0 = disabled) 195 + # Protects upstream DNS/HTTP services from being overwhelmed 196 + RESOLVER_MAX_CONCURRENT=0 197 + 198 + # Timeout for acquiring rate limit permit in milliseconds (default: 0 = no timeout) 199 + # When > 0, requests will timeout if they can't acquire a permit within this time 200 + # Range: 0-60000 (max 60 seconds) 201 + # Prevents requests from waiting indefinitely when rate limiter is at capacity 202 + RESOLVER_MAX_CONCURRENT_TIMEOUT_MS=0 203 + 204 + # ---------------------------------------------------------------------------- 205 + # HTTP CACHING CONFIGURATION 206 + # ---------------------------------------------------------------------------- 207 + 208 + # ETAG seed for cache invalidation (default: application version) 209 + # Used to generate ETAG checksums for HTTP responses 210 + # Changing this value invalidates all client-cached responses 211 + # Examples: 212 + # - prod-2024-01-15 (deployment-specific) 213 + # - v1.0.0-1705344000 (version with timestamp) 214 + # - config-update-2024-01-15 (after configuration changes) 215 + # Default uses the application version from Cargo.toml 216 + # ETAG_SEED=prod-2024-01-15 217 + 218 + # Maximum age for HTTP Cache-Control header in seconds (default: 86400 = 24 hours) 219 + # Set to 0 to disable Cache-Control header 220 + # Controls how long clients and intermediate caches can cache responses 221 + CACHE_MAX_AGE=86400 222 + 223 + # Stale-if-error directive for Cache-Control in seconds (default: 172800 = 48 hours) 224 + # Allows stale content to be served if backend errors occur 225 + # Provides resilience during service outages 226 + CACHE_STALE_IF_ERROR=172800 227 + 228 + # Stale-while-revalidate directive for Cache-Control in seconds (default: 86400 = 24 hours) 229 + # Allows stale content to be served while fetching fresh content in background 230 + # Improves perceived performance for users 231 + CACHE_STALE_WHILE_REVALIDATE=86400 232 + 233 + # Max-stale directive for Cache-Control in seconds (default: 172800 = 48 hours) 234 + # Maximum time client will accept stale responses 235 + # Provides upper bound on cached content age 236 + CACHE_MAX_STALE=172800 237 + 238 + # Min-fresh directive for Cache-Control in seconds (default: 3600 = 1 hour) 239 + # Minimum time response must remain fresh 240 + # Clients won't accept responses expiring within this time 241 + CACHE_MIN_FRESH=3600 242 + 243 + # ---------------------------------------------------------------------------- 244 + # METRICS CONFIGURATION 245 + # ---------------------------------------------------------------------------- 246 + 247 + # Metrics adapter type: 'noop' or 'statsd' (default: noop) 248 + # - 'noop': No metrics collection (default) 249 + # - 'statsd': Send metrics to StatsD server 250 + METRICS_ADAPTER=statsd 251 + 252 + # StatsD host and port (required when METRICS_ADAPTER=statsd) 253 + # Format: hostname:port 254 + # Examples: 255 + # - localhost:8125 (local StatsD) 256 + # - statsd.example.com:8125 (remote StatsD) 257 + METRICS_STATSD_HOST=localhost:8125 258 + 259 + # Bind address for StatsD UDP socket (default: [::]:0) 260 + # Controls which local address to bind for sending UDP packets 261 + # Examples: 262 + # - [::]:0 (IPv6 any address, random port - default) 263 + # - 0.0.0.0:0 (IPv4 any address, random port) 264 + # - 192.168.1.100:0 (specific interface) 265 + METRICS_STATSD_BIND=[::]:0 266 + 267 + # Prefix for all metrics (default: quickdid) 268 + # Used to namespace metrics in your monitoring system 269 + # Examples: 270 + # - quickdid (default) 271 + # - prod.quickdid 272 + # - us-east-1.quickdid 273 + METRICS_PREFIX=quickdid 274 + 275 + # Tags for all metrics (comma-separated key:value pairs) 276 + # Added to all metrics for filtering and grouping 277 + # Examples: 278 + # - env:production,service:quickdid 279 + # - env:staging,region:us-east-1,version:1.0.0 280 + METRICS_TAGS=env:production,service:quickdid 281 + 282 + # ---------------------------------------------------------------------------- 283 + # PROACTIVE REFRESH CONFIGURATION 284 + # ---------------------------------------------------------------------------- 285 + 286 + # Enable proactive cache refresh (default: false) 287 + # When enabled, cache entries nearing expiration are automatically refreshed 288 + # in the background to prevent cache misses for frequently accessed handles 289 + PROACTIVE_REFRESH_ENABLED=false 290 + 291 + # Threshold for proactive refresh as percentage of TTL (default: 0.8) 292 + # Range: 0.0-1.0 (0% to 100% of TTL) 293 + # Example: 0.8 means refresh when 80% of TTL has elapsed 294 + # Lower values = more aggressive refreshing, higher load 295 + # Higher values = less aggressive refreshing, more cache misses 296 + PROACTIVE_REFRESH_THRESHOLD=0.8 297 + 298 + # ---------------------------------------------------------------------------- 299 + # JETSTREAM CONSUMER CONFIGURATION 300 + # ---------------------------------------------------------------------------- 301 + 302 + # Enable Jetstream consumer for real-time cache updates (default: false) 303 + # When enabled, connects to AT Protocol firehose for live updates 304 + # Processes Account events (deleted/deactivated) and Identity events (handle changes) 305 + # Automatically reconnects with exponential backoff on connection failures 306 + JETSTREAM_ENABLED=false 307 + 308 + # Jetstream WebSocket hostname (default: jetstream.atproto.tools) 309 + # The firehose service to connect to for real-time AT Protocol events 310 + # Examples: 311 + # - jetstream.atproto.tools (production firehose) 312 + # - jetstream-staging.atproto.tools (staging environment) 313 + # - localhost:6008 (local development) 314 + JETSTREAM_HOSTNAME=jetstream.atproto.tools 315 + 316 + # ---------------------------------------------------------------------------- 317 + # STATIC FILES CONFIGURATION 318 + # ---------------------------------------------------------------------------- 319 + 320 + # Directory path for serving static files (default: www) 321 + # This directory should contain: 322 + # - index.html (landing page) 323 + # - .well-known/atproto-did (service DID identifier) 324 + # - .well-known/did.json (DID document) 325 + # In Docker, this defaults to /app/www 326 + # You can mount custom files via Docker volumes 327 + STATIC_FILES_DIR=/app/www 328 + 329 + # ---------------------------------------------------------------------------- 187 330 # PERFORMANCE TUNING 188 331 # ---------------------------------------------------------------------------- 189 332 ··· 288 431 289 432 ## Docker Compose Setup 290 433 291 - ### Redis-based Production Setup 434 + ### Redis-based Production Setup with Jetstream 292 435 293 - Create a `docker-compose.yml` file for a complete production setup with Redis: 436 + Create a `docker-compose.yml` file for a complete production setup with Redis and optional Jetstream consumer: 294 437 295 438 ```yaml 296 439 version: '3.8' ··· 379 522 driver: local 380 523 ``` 381 524 382 - ### SQLite-based Single-Instance Setup 525 + ### SQLite-based Single-Instance Setup with Jetstream 383 526 384 - For single-instance deployments without Redis, create a simpler `docker-compose.sqlite.yml`: 527 + For single-instance deployments without Redis, create a simpler `docker-compose.sqlite.yml` with optional Jetstream consumer: 385 528 386 529 ```yaml 387 530 version: '3.8' ··· 392 535 container_name: quickdid-sqlite 393 536 environment: 394 537 HTTP_EXTERNAL: quickdid.example.com 395 - SERVICE_KEY: ${SERVICE_KEY} 396 538 HTTP_PORT: 8080 397 539 SQLITE_URL: sqlite:/data/quickdid.db 398 540 CACHE_TTL_MEMORY: 600 ··· 400 542 QUEUE_ADAPTER: sqlite 401 543 QUEUE_BUFFER_SIZE: 5000 402 544 QUEUE_SQLITE_MAX_SIZE: 10000 545 + # Optional: Enable Jetstream for real-time cache updates 546 + # JETSTREAM_ENABLED: true 547 + # JETSTREAM_HOSTNAME: jetstream.atproto.tools 403 548 RUST_LOG: info 404 549 ports: 405 550 - "8080:8080" ··· 593 738 594 739 ### 1. Service Key Protection 595 740 596 - - **Never commit** the `SERVICE_KEY` to version control 741 + - **Never commit** sensitive configuration to version control 597 742 - Store keys in a secure secret management system (e.g., HashiCorp Vault, AWS Secrets Manager) 598 743 - Rotate keys regularly 599 744 - Use different keys for different environments ··· 638 783 docker logs quickdid 639 784 640 785 # Verify environment variables 641 - docker exec quickdid env | grep -E "HTTP_EXTERNAL|SERVICE_KEY" 786 + docker exec quickdid env | grep -E "HTTP_EXTERNAL|HTTP_PORT" 642 787 643 788 # Test Redis connectivity 644 789 docker exec quickdid redis-cli -h redis ping ··· 781 926 2. **SQLite** (persistent, best for single-instance) 782 927 3. **Memory** (fast, but lost on restart) 783 928 929 + **Real-time Updates with Jetstream**: When `JETSTREAM_ENABLED=true`, QuickDID: 930 + - Connects to AT Protocol firehose for live cache updates 931 + - Processes Account events to purge deleted/deactivated accounts 932 + - Processes Identity events to update handle-to-DID mappings 933 + - Automatically reconnects with exponential backoff on failures 934 + - Tracks metrics for successful and failed event processing 935 + 784 936 **Recommendations by Deployment Type**: 785 937 - **Single instance, persistent**: Use SQLite for both caching and queuing (`SQLITE_URL=sqlite:./quickdid.db`, `QUEUE_ADAPTER=sqlite`) 786 938 - **Multi-instance, HA**: Use Redis for both caching and queuing (`REDIS_URL=redis://redis:6379/0`, `QUEUE_ADAPTER=redis`) 939 + - **Real-time sync**: Enable Jetstream consumer (`JETSTREAM_ENABLED=true`) for live cache updates 787 940 - **Testing/development**: Use memory-only caching with MPSC queuing (`QUEUE_ADAPTER=mpsc`) 788 941 - **Hybrid**: Configure both Redis and SQLite for redundancy 789 942 ··· 823 976 ### Required Fields 824 977 825 978 - **HTTP_EXTERNAL**: Must be provided 826 - - **SERVICE_KEY**: Must be provided 979 + - **HTTP_EXTERNAL**: Must be provided 827 980 828 981 ### Value Constraints 829 982 ··· 839 992 - Must be one of: `mpsc`, `redis`, `sqlite`, `noop`, `none` 840 993 - Case-sensitive 841 994 995 + 4. **Rate Limiting** (`RESOLVER_MAX_CONCURRENT`): 996 + - Must be between 0 and 10000 997 + - 0 = disabled (default) 998 + - When > 0, limits concurrent handle resolutions 999 + 1000 + 5. **Rate Limiting Timeout** (`RESOLVER_MAX_CONCURRENT_TIMEOUT_MS`): 1001 + - Must be between 0 and 60000 (milliseconds) 1002 + - 0 = no timeout (default) 1003 + - Maximum: 60000ms (60 seconds) 1004 + 842 1005 ### Validation Errors 843 1006 844 1007 If validation fails, QuickDID will exit with one of these error codes: ··· 852 1015 853 1016 ```bash 854 1017 # Validate configuration without starting service 855 - HTTP_EXTERNAL=test SERVICE_KEY=test quickdid --help 1018 + HTTP_EXTERNAL=test quickdid --help 856 1019 857 1020 # Test with specific values (will fail validation) 858 1021 CACHE_TTL_MEMORY=0 quickdid --help 859 1022 860 1023 # Debug configuration parsing 861 - RUST_LOG=debug HTTP_EXTERNAL=test SERVICE_KEY=test quickdid 1024 + RUST_LOG=debug HTTP_EXTERNAL=test quickdid 862 1025 ``` 863 1026 864 1027 ## Support and Resources
+714
docs/telegraf-timescaledb-metrics-guide.md
··· 1 + # Telegraf and TimescaleDB Metrics Collection Guide 2 + 3 + This guide demonstrates how to set up a metrics collection pipeline using Telegraf to collect StatsD metrics and store them in PostgreSQL with TimescaleDB using Docker Compose. 4 + 5 + ## Overview 6 + 7 + This setup creates a metrics pipeline that: 8 + - Collects StatsD metrics via Telegraf on UDP port 8125 9 + - Creates individual PostgreSQL tables for each metric type 10 + - Stores metric tags as JSONB for flexible querying 11 + - Automatically creates hypertables for time-series optimization 12 + - Provides a complete Docker Compose configuration for easy deployment 13 + 14 + ## Important Note on Table Structure 15 + 16 + The Telegraf PostgreSQL output plugin with the configuration in this guide creates **individual tables for each metric name**. For example: 17 + - `quickdid.http.request.count` becomes table `"quickdid.http.request.count"` 18 + - `quickdid.resolver.rate_limit.available_permits` becomes table `"quickdid.resolver.rate_limit.available_permits"` 19 + 20 + Each table has the following structure: 21 + - `time` (timestamptz) - The timestamp of the metric 22 + - `tags` (jsonb) - All tags stored as a JSON object 23 + - Metric-specific columns for values (e.g., `value`, `mean`, `p99`, etc.) 24 + 25 + ## Prerequisites 26 + 27 + - Docker and Docker Compose installed 28 + - Basic understanding of StatsD metrics format 29 + - Familiarity with PostgreSQL/TimescaleDB concepts 30 + 31 + ## Project Structure 32 + 33 + Create the following directory structure: 34 + 35 + ``` 36 + metrics-stack/ 37 + โ”œโ”€โ”€ docker-compose.yml 38 + โ”œโ”€โ”€ telegraf/ 39 + โ”‚ โ””โ”€โ”€ telegraf.conf 40 + โ”œโ”€โ”€ test-scripts/ 41 + โ”‚ โ”œโ”€โ”€ send-metrics.sh 42 + โ”‚ โ””โ”€โ”€ verify-queries.sql 43 + โ””โ”€โ”€ .env 44 + ``` 45 + 46 + ## Configuration Files 47 + 48 + ### 1. Environment Variables (.env) 49 + 50 + Create a `.env` file to store sensitive configuration: 51 + 52 + ```env 53 + # PostgreSQL/TimescaleDB Configuration 54 + POSTGRES_DB=metrics 55 + POSTGRES_USER=postgres 56 + POSTGRES_PASSWORD=secretpassword 57 + 58 + # Telegraf Database User 59 + TELEGRAF_DB_USER=postgres 60 + TELEGRAF_DB_PASSWORD=secretpassword 61 + 62 + # TimescaleDB Settings 63 + TIMESCALE_TELEMETRY=off 64 + ``` 65 + 66 + ### 2. Telegraf Configuration (telegraf/telegraf.conf) 67 + 68 + Create the Telegraf configuration file: 69 + 70 + ```toml 71 + # Global Telegraf Agent Configuration 72 + [agent] 73 + interval = "10s" 74 + round_interval = true 75 + metric_batch_size = 1000 76 + metric_buffer_limit = 10000 77 + collection_jitter = "0s" 78 + flush_interval = "10s" 79 + flush_jitter = "0s" 80 + precision = "" 81 + debug = false 82 + quiet = false 83 + hostname = "telegraf-agent" 84 + omit_hostname = false 85 + 86 + # StatsD Input Plugin 87 + [[inputs.statsd]] 88 + service_address = ":8125" # Listen on UDP port 8125 for StatsD metrics 89 + protocol = "udp" 90 + delete_gauges = true 91 + delete_counters = true 92 + delete_sets = true 93 + delete_timings = true 94 + percentiles = [50, 90, 95, 99] 95 + metric_separator = "." 96 + allowed_pending_messages = 10000 97 + datadog_extensions = true 98 + datadog_distributions = true 99 + 100 + # PostgreSQL (TimescaleDB) Output Plugin 101 + [[outputs.postgresql]] 102 + connection = "host=timescaledb user=${TELEGRAF_DB_USER} password=${TELEGRAF_DB_PASSWORD} dbname=${POSTGRES_DB} sslmode=disable" 103 + schema = "public" 104 + 105 + # Create individual tables for each metric with hypertable support 106 + create_templates = [ 107 + '''CREATE TABLE IF NOT EXISTS {{.table}} ({{.columns}})''', 108 + '''SELECT create_hypertable({{.table|quoteLiteral}}, 'time', if_not_exists => TRUE)''', 109 + ] 110 + 111 + # Store all tags as JSONB for flexible querying 112 + tags_as_jsonb = true 113 + 114 + # Keep fields as separate columns for better performance on aggregations 115 + fields_as_jsonb = false 116 + ``` 117 + 118 + ### 3. Docker Compose Configuration (docker-compose.yml) 119 + 120 + Create the Docker Compose file: 121 + 122 + ```yaml 123 + version: '3.8' 124 + 125 + services: 126 + timescaledb: 127 + image: timescale/timescaledb:latest-pg17 128 + container_name: timescaledb 129 + restart: unless-stopped 130 + environment: 131 + POSTGRES_DB: ${POSTGRES_DB} 132 + POSTGRES_USER: ${POSTGRES_USER} 133 + POSTGRES_PASSWORD: ${POSTGRES_PASSWORD} 134 + TIMESCALE_TELEMETRY: ${TIMESCALE_TELEMETRY} 135 + ports: 136 + - "5442:5432" 137 + volumes: 138 + - timescale_data:/home/postgres/pgdata/data 139 + - ./init-scripts:/docker-entrypoint-initdb.d:ro 140 + command: 141 + - postgres 142 + - -c 143 + - shared_buffers=1GB 144 + - -c 145 + - effective_cache_size=3GB 146 + - -c 147 + - maintenance_work_mem=512MB 148 + - -c 149 + - work_mem=32MB 150 + - -c 151 + - timescaledb.max_background_workers=8 152 + - -c 153 + - max_parallel_workers_per_gather=2 154 + - -c 155 + - max_parallel_workers=8 156 + healthcheck: 157 + test: ["CMD-SHELL", "pg_isready -U ${POSTGRES_USER} -d ${POSTGRES_DB}"] 158 + interval: 10s 159 + timeout: 5s 160 + retries: 5 161 + networks: 162 + - metrics_network 163 + 164 + telegraf: 165 + image: telegraf:1.35 166 + container_name: telegraf 167 + restart: unless-stopped 168 + environment: 169 + TELEGRAF_DB_USER: ${TELEGRAF_DB_USER} 170 + TELEGRAF_DB_PASSWORD: ${TELEGRAF_DB_PASSWORD} 171 + POSTGRES_DB: ${POSTGRES_DB} 172 + ports: 173 + - "8125:8125/udp" # StatsD UDP port 174 + volumes: 175 + - ./telegraf/telegraf.conf:/etc/telegraf/telegraf.conf:ro 176 + depends_on: 177 + timescaledb: 178 + condition: service_healthy 179 + networks: 180 + - metrics_network 181 + command: ["telegraf", "--config", "/etc/telegraf/telegraf.conf"] 182 + 183 + redis: 184 + image: redis:7-alpine 185 + container_name: redis 186 + restart: unless-stopped 187 + ports: 188 + - "6379:6379" 189 + volumes: 190 + - redis_data:/data 191 + command: redis-server --appendonly yes --appendfsync everysec 192 + healthcheck: 193 + test: ["CMD", "redis-cli", "ping"] 194 + interval: 10s 195 + timeout: 5s 196 + retries: 5 197 + networks: 198 + - metrics_network 199 + 200 + networks: 201 + metrics_network: 202 + driver: bridge 203 + 204 + volumes: 205 + timescale_data: 206 + redis_data: 207 + ``` 208 + 209 + ### 4. Database Initialization Script (optional) 210 + 211 + Create `init-scripts/01-init.sql` to set up the TimescaleDB extension: 212 + 213 + ```sql 214 + -- Enable TimescaleDB extension 215 + CREATE EXTENSION IF NOT EXISTS timescaledb; 216 + 217 + -- Enable additional useful extensions 218 + CREATE EXTENSION IF NOT EXISTS pg_stat_statements; 219 + ``` 220 + 221 + ## Test Scripts 222 + 223 + ### 1. Send Test Metrics Script (test-scripts/send-metrics.sh) 224 + 225 + Create a script to send various types of metrics: 226 + 227 + ```bash 228 + #!/bin/bash 229 + 230 + # Send test metrics to StatsD/Telegraf 231 + 232 + echo "Sending test metrics to StatsD on localhost:8125..." 233 + 234 + # Counter metrics 235 + for i in {1..10}; do 236 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 237 + echo "quickdid.http.request.count:1|c|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 238 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:404" | nc -u -w0 localhost 8125 239 + done 240 + 241 + # Gauge metrics 242 + echo "quickdid.resolver.rate_limit.available_permits:10|g" | nc -u -w0 localhost 8125 243 + echo "quickdid.resolver.rate_limit.available_permits:8|g" | nc -u -w0 localhost 8125 244 + echo "quickdid.resolver.rate_limit.available_permits:5|g" | nc -u -w0 localhost 8125 245 + 246 + # Timing metrics (in milliseconds) 247 + for i in {1..20}; do 248 + duration=$((RANDOM % 100 + 10)) 249 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 250 + done 251 + 252 + for i in {1..10}; do 253 + duration=$((RANDOM % 200 + 50)) 254 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 255 + done 256 + 257 + # Histogram metrics 258 + for i in {1..15}; do 259 + resolution_time=$((RANDOM % 500 + 50)) 260 + echo "quickdid.resolver.resolution_time:${resolution_time}|h|#resolver:redis" | nc -u -w0 localhost 8125 261 + echo "quickdid.resolver.resolution_time:$((resolution_time * 2))|h|#resolver:base" | nc -u -w0 localhost 8125 262 + done 263 + 264 + # Cache metrics 265 + echo "quickdid.cache.hit.count:45|c|#cache_type:redis" | nc -u -w0 localhost 8125 266 + echo "quickdid.cache.miss.count:5|c|#cache_type:redis" | nc -u -w0 localhost 8125 267 + echo "quickdid.cache.size:1024|g|#cache_type:memory" | nc -u -w0 localhost 8125 268 + 269 + echo "Metrics sent! Wait 15 seconds for Telegraf to flush..." 270 + sleep 15 271 + echo "Done!" 272 + ``` 273 + 274 + ### 2. Verify Queries Script (test-scripts/verify-queries.sql) 275 + 276 + Create a SQL script to verify all queries work correctly: 277 + 278 + ```sql 279 + -- Test script to verify all metrics queries work correctly 280 + -- Run this after sending test metrics with send-metrics.sh 281 + 282 + \echo '===== CHECKING AVAILABLE TABLES =====' 283 + SELECT table_name 284 + FROM information_schema.tables 285 + WHERE table_schema = 'public' 286 + AND table_name LIKE 'quickdid%' 287 + ORDER BY table_name; 288 + 289 + \echo '' 290 + \echo '===== CHECKING TABLE STRUCTURES =====' 291 + \echo 'Structure of quickdid.http.request.count table:' 292 + \d "quickdid.http.request.count" 293 + 294 + \echo '' 295 + \echo 'Structure of quickdid.http.request.duration_ms table:' 296 + \d "quickdid.http.request.duration_ms" 297 + 298 + \echo '' 299 + \echo '===== QUERY 1: Recent HTTP Request Counts =====' 300 + SELECT 301 + time, 302 + tags, 303 + tags->>'method' as method, 304 + tags->>'path' as path, 305 + tags->>'status' as status, 306 + value 307 + FROM "quickdid.http.request.count" 308 + WHERE time > NOW() - INTERVAL '1 hour' 309 + ORDER BY time DESC 310 + LIMIT 10; 311 + 312 + \echo '' 313 + \echo '===== QUERY 2: HTTP Request Duration Statistics by Endpoint =====' 314 + SELECT 315 + time_bucket('1 minute', time) AS minute, 316 + tags->>'method' as method, 317 + tags->>'path' as path, 318 + tags->>'status' as status, 319 + COUNT(*) as request_count, 320 + AVG(mean) as avg_duration_ms, 321 + MAX(p99) as p99_duration_ms, 322 + MIN(mean) as min_duration_ms 323 + FROM "quickdid.http.request.duration_ms" 324 + WHERE time > NOW() - INTERVAL '1 hour' 325 + AND tags IS NOT NULL 326 + GROUP BY minute, tags->>'method', tags->>'path', tags->>'status' 327 + ORDER BY minute DESC 328 + LIMIT 10; 329 + 330 + \echo '' 331 + \echo '===== QUERY 3: Rate Limiter Status Over Time =====' 332 + SELECT 333 + time, 334 + value as available_permits 335 + FROM "quickdid.resolver.rate_limit.available_permits" 336 + WHERE time > NOW() - INTERVAL '1 hour' 337 + ORDER BY time DESC 338 + LIMIT 10; 339 + 340 + \echo '' 341 + \echo '===== QUERY 4: Resolver Performance Comparison =====' 342 + SELECT 343 + tags->>'resolver' as resolver_type, 344 + COUNT(*) as sample_count, 345 + AVG(mean) as avg_resolution_time_ms, 346 + MAX(p99) as p99_resolution_time_ms, 347 + MIN(mean) as min_resolution_time_ms 348 + FROM "quickdid.resolver.resolution_time" 349 + WHERE time > NOW() - INTERVAL '1 hour' 350 + AND tags->>'resolver' IS NOT NULL 351 + GROUP BY tags->>'resolver' 352 + ORDER BY avg_resolution_time_ms; 353 + 354 + \echo '' 355 + \echo '===== QUERY 5: Cache Hit Rate Analysis =====' 356 + WITH cache_stats AS ( 357 + SELECT 358 + 'hits' as metric_type, 359 + SUM(value) as total_count 360 + FROM "quickdid.cache.hit.count" 361 + WHERE time > NOW() - INTERVAL '1 hour' 362 + UNION ALL 363 + SELECT 364 + 'misses' as metric_type, 365 + SUM(value) as total_count 366 + FROM "quickdid.cache.miss.count" 367 + WHERE time > NOW() - INTERVAL '1 hour' 368 + ) 369 + SELECT 370 + SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) as total_hits, 371 + SUM(CASE WHEN metric_type = 'misses' THEN total_count ELSE 0 END) as total_misses, 372 + CASE 373 + WHEN SUM(total_count) > 0 THEN 374 + ROUND(100.0 * SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) / SUM(total_count), 2) 375 + ELSE 0 376 + END as hit_rate_percentage 377 + FROM cache_stats; 378 + 379 + \echo '' 380 + \echo '===== QUERY 6: Hypertable Information =====' 381 + SELECT 382 + hypertable_schema, 383 + hypertable_name, 384 + owner, 385 + num_dimensions, 386 + num_chunks, 387 + compression_enabled 388 + FROM timescaledb_information.hypertables 389 + WHERE hypertable_name LIKE 'quickdid%' 390 + ORDER BY hypertable_name; 391 + 392 + \echo '' 393 + \echo '===== QUERY 7: HTTP Error Rate by Endpoint =====' 394 + WITH status_counts AS ( 395 + SELECT 396 + time_bucket('5 minutes', time) as period, 397 + tags->>'path' as path, 398 + CASE 399 + WHEN (tags->>'status')::int >= 400 THEN 'error' 400 + ELSE 'success' 401 + END as status_category, 402 + SUM(value) as request_count 403 + FROM "quickdid.http.request.count" 404 + WHERE time > NOW() - INTERVAL '1 hour' 405 + GROUP BY period, path, status_category 406 + ) 407 + SELECT 408 + period, 409 + path, 410 + SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) as error_count, 411 + SUM(CASE WHEN status_category = 'success' THEN request_count ELSE 0 END) as success_count, 412 + CASE 413 + WHEN SUM(request_count) > 0 THEN 414 + ROUND(100.0 * SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) / SUM(request_count), 2) 415 + ELSE 0 416 + END as error_rate_percentage 417 + FROM status_counts 418 + GROUP BY period, path 419 + HAVING SUM(request_count) > 0 420 + ORDER BY period DESC, error_rate_percentage DESC; 421 + 422 + \echo '' 423 + \echo '===== TEST COMPLETED =====' 424 + ``` 425 + 426 + ## Usage 427 + 428 + ### Starting the Stack 429 + 430 + 1. Navigate to your project directory: 431 + ```bash 432 + cd metrics-stack 433 + ``` 434 + 435 + 2. Make the test scripts executable: 436 + ```bash 437 + chmod +x test-scripts/send-metrics.sh 438 + ``` 439 + 440 + 3. Start the services: 441 + ```bash 442 + docker-compose up -d 443 + ``` 444 + 445 + 4. Check the logs to ensure everything is running: 446 + ```bash 447 + docker-compose logs -f 448 + ``` 449 + 450 + 5. Wait for services to be fully ready (about 30 seconds) 451 + 452 + ### Running the Test Suite 453 + 454 + 1. Send test metrics: 455 + ```bash 456 + ./test-scripts/send-metrics.sh 457 + ``` 458 + 459 + 2. Verify all queries work: 460 + ```bash 461 + docker exec -i timescaledb psql -U postgres -d metrics < test-scripts/verify-queries.sql 462 + ``` 463 + 464 + ### Manual Querying 465 + 466 + Connect to TimescaleDB to run queries manually: 467 + 468 + ```bash 469 + # Connect to the database 470 + docker exec -it timescaledb psql -U postgres -d metrics 471 + 472 + # List all metric tables 473 + \dt "quickdid*" 474 + 475 + # Describe a specific table structure 476 + \d "quickdid.http.request.duration_ms" 477 + 478 + # Query with JSONB tag filtering 479 + SELECT 480 + time, 481 + tags->>'method' as method, 482 + mean as avg_ms, 483 + '99_percentile' as p99_ms 484 + FROM "quickdid.http.request.duration_ms" 485 + WHERE tags @> '{"method": "GET"}'::jsonb 486 + AND time > NOW() - INTERVAL '1 hour' 487 + ORDER BY time DESC 488 + LIMIT 10; 489 + ``` 490 + 491 + ## Advanced Configuration 492 + 493 + ### Continuous Aggregates for Performance 494 + 495 + Create continuous aggregates for frequently queried data: 496 + 497 + ```sql 498 + -- Create hourly aggregates for HTTP metrics 499 + CREATE MATERIALIZED VIEW http_metrics_hourly 500 + WITH (timescaledb.continuous) AS 501 + SELECT 502 + time_bucket('1 hour', time) AS hour, 503 + tags->>'method' as method, 504 + tags->>'path' as path, 505 + tags->>'status' as status, 506 + COUNT(*) as request_count, 507 + AVG(mean) as avg_duration_ms, 508 + MAX('99_percentile') as p99_duration_ms, 509 + MIN(mean) as min_duration_ms 510 + FROM "quickdid.http.request.duration_ms" 511 + WHERE tags IS NOT NULL 512 + GROUP BY hour, method, path, status 513 + WITH NO DATA; 514 + 515 + -- Add refresh policy 516 + SELECT add_continuous_aggregate_policy('http_metrics_hourly', 517 + start_offset => INTERVAL '3 hours', 518 + end_offset => INTERVAL '1 hour', 519 + schedule_interval => INTERVAL '1 hour'); 520 + 521 + -- Manually refresh to populate initial data 522 + CALL refresh_continuous_aggregate('http_metrics_hourly', NULL, NULL); 523 + 524 + -- Query the aggregate 525 + SELECT * FROM http_metrics_hourly 526 + ORDER BY hour DESC, request_count DESC 527 + LIMIT 20; 528 + ``` 529 + 530 + ### Data Retention Policies 531 + 532 + Set up automatic data retention: 533 + 534 + ```sql 535 + -- Add retention policy to drop data older than 30 days 536 + SELECT add_retention_policy('"quickdid.http.request.count"', INTERVAL '30 days'); 537 + SELECT add_retention_policy('"quickdid.http.request.duration_ms"', INTERVAL '30 days'); 538 + 539 + -- View retention policies 540 + SELECT js.* FROM timescaledb_information.job_stats js 541 + JOIN timescaledb_information.jobs j ON js.job_id = j.job_id 542 + WHERE j.proc_name LIKE '%retention%'; 543 + ``` 544 + 545 + ### Compression for Storage Optimization 546 + 547 + Enable compression for older data: 548 + 549 + ```sql 550 + -- Enable compression on a hypertable 551 + ALTER TABLE "quickdid.http.request.duration_ms" SET ( 552 + timescaledb.compress, 553 + timescaledb.compress_segmentby = 'tags' 554 + ); 555 + 556 + -- Add compression policy (compress chunks older than 7 days) 557 + SELECT add_compression_policy('"quickdid.http.request.duration_ms"', INTERVAL '7 days'); 558 + 559 + -- Manually compress old chunks 560 + SELECT compress_chunk(format('%I.%I', c.chunk_schema, c.chunk_name)::regclass) 561 + FROM timescaledb_information.chunks c 562 + WHERE c.hypertable_name = 'quickdid.http.request.duration_ms' 563 + AND c.range_end < NOW() - INTERVAL '7 days' 564 + AND NOT c.is_compressed; 565 + 566 + -- Check compression status 567 + SELECT 568 + hypertable_name, 569 + uncompressed_total_bytes, 570 + compressed_total_bytes, 571 + compression_ratio 572 + FROM timescaledb_information.hypertable_compression_stats 573 + WHERE hypertable_name LIKE 'quickdid%'; 574 + ``` 575 + 576 + ## Monitoring and Maintenance 577 + 578 + ### Health Checks 579 + 580 + ```sql 581 + -- Check chunk distribution 582 + SELECT 583 + hypertable_name, 584 + chunk_name, 585 + range_start, 586 + range_end, 587 + is_compressed, 588 + pg_size_pretty(total_bytes) as size 589 + FROM timescaledb_information.chunks 590 + WHERE hypertable_name LIKE 'quickdid%' 591 + ORDER BY hypertable_name, range_start DESC 592 + LIMIT 20; 593 + 594 + -- Check background jobs 595 + SELECT 596 + job_id, 597 + application_name, 598 + job_type, 599 + schedule_interval, 600 + last_run_started_at, 601 + last_successful_finish, 602 + next_scheduled_run 603 + FROM timescaledb_information.job_stats 604 + ORDER BY job_id; 605 + 606 + -- Check table sizes 607 + SELECT 608 + hypertable_name, 609 + chunks_total_size, 610 + chunks_compressed_size, 611 + chunks_uncompressed_size 612 + FROM timescaledb_information.hypertables 613 + WHERE hypertable_name LIKE 'quickdid%'; 614 + ``` 615 + 616 + ### Troubleshooting 617 + 618 + 1. **Tables not being created:** 619 + - Check Telegraf logs: `docker-compose logs telegraf | grep -i error` 620 + - Verify PostgreSQL connectivity: `docker exec telegraf telegraf --test` 621 + - Ensure metrics are being received: `docker-compose logs telegraf | grep statsd` 622 + 623 + 2. **Queries returning no data:** 624 + - Verify tables exist: `\dt "quickdid*"` in psql 625 + - Check table contents: `SELECT COUNT(*) FROM "quickdid.http.request.count";` 626 + - Verify time ranges in WHERE clauses 627 + 628 + 3. **Performance issues:** 629 + - Check if hypertables are created: Query `timescaledb_information.hypertables` 630 + - Verify compression is working if enabled 631 + - Consider creating appropriate indexes on JSONB paths: 632 + ```sql 633 + CREATE INDEX idx_http_method ON "quickdid.http.request.duration_ms" ((tags->>'method')); 634 + CREATE INDEX idx_http_path ON "quickdid.http.request.duration_ms" ((tags->>'path')); 635 + ``` 636 + 637 + ## Integration with QuickDID 638 + 639 + To integrate with QuickDID, configure it to send metrics to the Telegraf StatsD endpoint: 640 + 641 + ```bash 642 + # Set environment variables for QuickDID 643 + export METRICS_ADAPTER=statsd 644 + export METRICS_STATSD_HOST=localhost:8125 645 + export METRICS_PREFIX=quickdid. 646 + export METRICS_TAGS=env:production,service:quickdid 647 + 648 + # Start QuickDID 649 + cargo run 650 + ``` 651 + 652 + QuickDID will automatically send metrics to Telegraf, which will store them in TimescaleDB for analysis. 653 + 654 + ## Key Differences from Generic Metrics Table Approach 655 + 656 + This configuration creates **individual tables per metric** instead of a single generic metrics table. Benefits include: 657 + 658 + 1. **Better performance**: Each metric has its own optimized schema 659 + 2. **Clearer data model**: Tables directly represent metrics 660 + 3. **Easier querying**: No need to filter by metric name 661 + 4. **Type safety**: Each metric's fields have appropriate types 662 + 5. **Efficient compression**: Per-metric compression strategies 663 + 664 + Trade-offs: 665 + - More tables to manage (mitigated by TimescaleDB automation) 666 + - Need to know metric names upfront for queries 667 + - Schema changes require table alterations 668 + 669 + ## Security Considerations 670 + 671 + 1. **Use strong passwords:** Update the default passwords in `.env` 672 + 2. **Enable SSL:** Configure `sslmode=require` in production 673 + 3. **Network isolation:** Use Docker networks to isolate services 674 + 4. **Access control:** Create separate database users with minimal permissions: 675 + ```sql 676 + CREATE USER metrics_reader WITH PASSWORD 'readonly_password'; 677 + GRANT CONNECT ON DATABASE metrics TO metrics_reader; 678 + GRANT USAGE ON SCHEMA public TO metrics_reader; 679 + GRANT SELECT ON ALL TABLES IN SCHEMA public TO metrics_reader; 680 + ``` 681 + 5. **Regular updates:** Keep Docker images updated for security patches 682 + 683 + ## Performance Tuning 684 + 685 + ### PostgreSQL/TimescaleDB Settings 686 + 687 + The docker-compose.yml includes optimized settings. Adjust based on your hardware: 688 + 689 + - `shared_buffers`: 25% of system RAM 690 + - `effective_cache_size`: 75% of system RAM 691 + - `maintenance_work_mem`: 5% of system RAM 692 + - `work_mem`: RAM / max_connections / 2 693 + 694 + ### Telegraf Buffer Settings 695 + 696 + For high-volume metrics, adjust in telegraf.conf: 697 + 698 + ```toml 699 + [agent] 700 + metric_batch_size = 5000 # Increase for high volume 701 + metric_buffer_limit = 100000 # Increase buffer size 702 + flush_interval = "5s" # Decrease for more frequent writes 703 + ``` 704 + 705 + ## Conclusion 706 + 707 + This setup provides a robust metrics collection and storage solution with: 708 + - **Individual metric tables** for optimal performance and clarity 709 + - **JSONB tag storage** for flexible querying 710 + - **TimescaleDB hypertables** for efficient time-series storage 711 + - **Comprehensive test suite** to verify functionality 712 + - **Production-ready configuration** with compression and retention policies 713 + 714 + The system correctly handles StatsD metrics from QuickDID and provides powerful querying capabilities through PostgreSQL's JSONB support and TimescaleDB's time-series functions.
+59
generate-wellknown.sh
··· 1 + #!/bin/bash 2 + 3 + # Script to generate .well-known static files based on QuickDID configuration 4 + # Usage: HTTP_EXTERNAL=quickdid.smokesignal.tools ./generate-wellknown.sh 5 + # 6 + # Note: Since we no longer process SERVICE_KEY, you'll need to manually 7 + # add the public key to the did.json file if you need DID document support. 8 + 9 + set -e 10 + 11 + # Check required environment variables 12 + if [ -z "$HTTP_EXTERNAL" ]; then 13 + echo "Error: HTTP_EXTERNAL environment variable is required" 14 + echo "Usage: HTTP_EXTERNAL=example.com ./generate-wellknown.sh" 15 + exit 1 16 + fi 17 + 18 + # Ensure www/.well-known directory exists 19 + mkdir -p www/.well-known 20 + 21 + # Generate service DID from HTTP_EXTERNAL 22 + if [[ "$HTTP_EXTERNAL" == *":"* ]]; then 23 + # Contains port - URL encode the colon 24 + SERVICE_DID="did:web:${HTTP_EXTERNAL//:/%3A}" 25 + else 26 + SERVICE_DID="did:web:$HTTP_EXTERNAL" 27 + fi 28 + 29 + echo "Generating .well-known files for $SERVICE_DID" 30 + 31 + # Write atproto-did file 32 + echo "$SERVICE_DID" > www/.well-known/atproto-did 33 + echo "Created: www/.well-known/atproto-did" 34 + 35 + # Create a basic did.json template 36 + # Note: You'll need to manually add the publicKeyMultibase if you need DID document support 37 + 38 + cat > www/.well-known/did.json <<EOF 39 + { 40 + "@context": [ 41 + "https://www.w3.org/ns/did/v1", 42 + "https://w3id.org/security/multikey/v1" 43 + ], 44 + "id": "$SERVICE_DID", 45 + "verificationMethod": [], 46 + "service": [ 47 + { 48 + "id": "${SERVICE_DID}#quickdid", 49 + "type": "QuickDIDService", 50 + "serviceEndpoint": "https://${HTTP_EXTERNAL}" 51 + } 52 + ] 53 + } 54 + EOF 55 + 56 + echo "Created: www/.well-known/did.json" 57 + echo "" 58 + echo "Note: The did.json file is a basic template. If you need DID document support," 59 + echo "you'll need to manually add the verificationMethod with your public key."
+18
railway-resources/telegraf/Dockerfile
··· 1 + # Telegraf Dockerfile for Railway Deployment 2 + FROM telegraf:1.33-alpine 3 + 4 + # Install additional packages for health checks 5 + RUN apk add --no-cache curl postgresql-client 6 + 7 + # Create directories for custom configs 8 + RUN mkdir -p /etc/telegraf/telegraf.d 9 + 10 + # Copy main configuration 11 + COPY railway-resources/telegraf/telegraf.conf /etc/telegraf/telegraf.conf 12 + 13 + # Health check - test configuration validity 14 + HEALTHCHECK --interval=30s --timeout=5s --start-period=10s --retries=3 \ 15 + CMD telegraf --config /etc/telegraf/telegraf.conf --test || exit 1 16 + 17 + # Run telegraf with custom config 18 + CMD ["telegraf", "--config", "/etc/telegraf/telegraf.conf", "--config-directory", "/etc/telegraf/telegraf.d"]
+48
railway-resources/telegraf/railway.toml
··· 1 + # Railway configuration for Telegraf service 2 + # This file configures how Railway builds and deploys the Telegraf metrics collector 3 + 4 + [build] 5 + # Use Dockerfile for building 6 + builder = "DOCKERFILE" 7 + dockerfilePath = "railway-resources/telegraf/Dockerfile" 8 + 9 + [deploy] 10 + # Start command (handled by Dockerfile CMD) 11 + startCommand = "telegraf --config /etc/telegraf/telegraf.conf" 12 + 13 + # No health check path for Telegraf (uses container health check) 14 + # healthcheckPath = "" 15 + 16 + # Restart policy 17 + restartPolicyType = "ALWAYS" 18 + restartPolicyMaxRetries = 10 19 + 20 + # Resource limits 21 + memoryLimitMB = 1024 22 + cpuLimitCores = 1 23 + 24 + # Scaling (Telegraf should be singleton) 25 + minReplicas = 1 26 + maxReplicas = 1 27 + 28 + # Graceful shutdown 29 + stopTimeout = 10 30 + 31 + # Service configuration for StatsD UDP endpoint 32 + [[services]] 33 + name = "telegraf-statsd" 34 + port = 8125 35 + protocol = "UDP" 36 + internalPort = 8125 37 + 38 + # Service configuration for Telegraf HTTP API (optional) 39 + [[services]] 40 + name = "telegraf-http" 41 + port = 8086 42 + protocol = "HTTP" 43 + internalPort = 8086 44 + 45 + # Environment-specific settings 46 + [environments.production] 47 + memoryLimitMB = 512 48 + cpuLimitCores = 1
+77
railway-resources/telegraf/telegraf.conf
··· 1 + # Telegraf Configuration for QuickDID Metrics Collection 2 + # Optimized for Railway deployment with TimescaleDB 3 + 4 + # Global tags applied to all metrics 5 + [global_tags] 6 + environment = "${ENVIRONMENT:-production}" 7 + service = "quickdid" 8 + region = "${RAILWAY_REGION:-us-west1}" 9 + deployment_id = "${RAILWAY_DEPLOYMENT_ID:-unknown}" 10 + 11 + # Agent configuration 12 + [agent] 13 + ## Default data collection interval 14 + interval = "10s" 15 + 16 + ## Rounds collection interval to interval 17 + round_interval = true 18 + 19 + ## Telegraf will send metrics to outputs in batches of at most metric_batch_size metrics. 20 + metric_batch_size = 1000 21 + 22 + ## Maximum number of unwritten metrics per output 23 + metric_buffer_limit = 10000 24 + 25 + ## Collection jitter is used to jitter the collection by a random amount 26 + collection_jitter = "0s" 27 + 28 + ## Default flushing interval for all outputs 29 + flush_interval = "10s" 30 + 31 + ## Jitter the flush interval by a random amount 32 + flush_jitter = "0s" 33 + 34 + ## Precision of timestamps 35 + precision = "1ms" 36 + 37 + ## Log level 38 + debug = ${TELEGRAF_DEBUG:-false} 39 + quiet = ${TELEGRAF_QUIET:-false} 40 + 41 + ## Override default hostname 42 + hostname = "${HOSTNAME:-telegraf}" 43 + 44 + ## If true, do not set the "host" tag in the telegraf agent 45 + omit_hostname = false 46 + 47 + ############################################################################### 48 + # INPUT PLUGINS # 49 + ############################################################################### 50 + 51 + # StatsD Server - receives metrics from QuickDID 52 + [[inputs.statsd]] 53 + service_address = ":8125" # Listen on UDP port 8125 for StatsD metrics 54 + protocol = "udp" 55 + delete_gauges = true 56 + delete_counters = true 57 + delete_sets = true 58 + delete_timings = true 59 + percentiles = [50, 90, 95, 99] 60 + metric_separator = "." 61 + allowed_pending_messages = 100 62 + datadog_extensions = true 63 + datadog_distributions = true 64 + 65 + [[outputs.postgresql]] 66 + connection = "${DATABASE_URL}" 67 + 68 + schema = "public" 69 + 70 + create_templates = [ 71 + '''CREATE TABLE IF NOT EXISTS {{.table}} ({{.columns}})''', 72 + '''SELECT create_hypertable({{.table|quoteLiteral}}, 'time', if_not_exists => TRUE)''', 73 + ] 74 + 75 + tags_as_jsonb = true 76 + 77 + fields_as_jsonb = false
+401 -70
src/bin/quickdid.rs
··· 1 1 use anyhow::Result; 2 2 use atproto_identity::{ 3 3 config::{CertificateBundles, DnsNameservers}, 4 - key::{identify_key, to_public}, 5 4 resolve::HickoryDnsResolver, 6 5 }; 7 - use clap::Parser; 6 + use atproto_jetstream::{Consumer as JetstreamConsumer, ConsumerTaskConfig}; 7 + use atproto_lexicon::resolve::{DefaultLexiconResolver, LexiconResolver}; 8 8 use quickdid::{ 9 9 cache::create_redis_pool, 10 - config::{Args, Config}, 10 + config::Config, 11 11 handle_resolver::{ 12 - create_base_resolver, create_caching_resolver, create_redis_resolver_with_ttl, 13 - create_sqlite_resolver_with_ttl, 12 + create_base_resolver, create_caching_resolver, 13 + create_proactive_refresh_resolver_with_metrics, create_rate_limited_resolver_with_timeout, 14 + create_redis_resolver_with_ttl, create_sqlite_resolver_with_ttl, 14 15 }, 15 - sqlite_schema::create_sqlite_pool, 16 16 handle_resolver_task::{HandleResolverTaskConfig, create_handle_resolver_task_with_config}, 17 17 http::{AppContext, create_router}, 18 + jetstream_handler::QuickDidEventHandler, 19 + lexicon_resolver::create_redis_lexicon_resolver_with_ttl, 20 + metrics::create_metrics_publisher, 18 21 queue::{ 19 22 HandleResolutionWork, QueueAdapter, create_mpsc_queue_from_channel, create_noop_queue, 20 - create_redis_queue, create_sqlite_queue, create_sqlite_queue_with_max_size, 23 + create_redis_queue, create_redis_queue_with_dedup, create_sqlite_queue, 24 + create_sqlite_queue_with_max_size, 21 25 }, 26 + sqlite_schema::create_sqlite_pool, 22 27 task_manager::spawn_cancellable_task, 23 28 }; 24 - use serde_json::json; 25 29 use std::sync::Arc; 26 30 use tokio::signal; 27 31 use tokio_util::{sync::CancellationToken, task::TaskTracker}; ··· 55 59 } 56 60 } 57 61 62 + /// Simple command-line argument handling for --version and --help 63 + fn handle_simple_args() -> bool { 64 + let args: Vec<String> = std::env::args().collect(); 65 + 66 + if args.len() > 1 { 67 + match args[1].as_str() { 68 + "--version" | "-V" => { 69 + println!("quickdid {}", env!("CARGO_PKG_VERSION")); 70 + return true; 71 + } 72 + "--help" | "-h" => { 73 + println!("QuickDID - AT Protocol Identity Resolver Service"); 74 + println!("Version: {}", env!("CARGO_PKG_VERSION")); 75 + println!(); 76 + println!("USAGE:"); 77 + println!(" quickdid [OPTIONS]"); 78 + println!(); 79 + println!("OPTIONS:"); 80 + println!(" -h, --help Print help information"); 81 + println!(" -V, --version Print version information"); 82 + println!(); 83 + println!("ENVIRONMENT VARIABLES:"); 84 + println!( 85 + " HTTP_EXTERNAL External hostname for service endpoints (required)" 86 + ); 87 + println!(" HTTP_PORT HTTP server port (default: 8080)"); 88 + println!(" PLC_HOSTNAME PLC directory hostname (default: plc.directory)"); 89 + println!( 90 + " USER_AGENT HTTP User-Agent header (auto-generated with version)" 91 + ); 92 + println!(" DNS_NAMESERVERS Custom DNS nameservers (comma-separated IPs)"); 93 + println!( 94 + " CERTIFICATE_BUNDLES Additional CA certificates (comma-separated paths)" 95 + ); 96 + println!(); 97 + println!(" CACHING:"); 98 + println!(" REDIS_URL Redis URL for handle resolution caching"); 99 + println!( 100 + " SQLITE_URL SQLite database URL for handle resolution caching" 101 + ); 102 + println!( 103 + " CACHE_TTL_MEMORY TTL for in-memory cache in seconds (default: 600)" 104 + ); 105 + println!( 106 + " CACHE_TTL_REDIS TTL for Redis cache in seconds (default: 7776000)" 107 + ); 108 + println!( 109 + " CACHE_TTL_SQLITE TTL for SQLite cache in seconds (default: 7776000)" 110 + ); 111 + println!(); 112 + println!(" QUEUE CONFIGURATION:"); 113 + println!( 114 + " QUEUE_ADAPTER Queue adapter: 'mpsc', 'redis', 'sqlite', 'noop' (default: mpsc)" 115 + ); 116 + println!(" QUEUE_REDIS_URL Redis URL for queue adapter"); 117 + println!( 118 + " QUEUE_REDIS_PREFIX Redis key prefix for queues (default: queue:handleresolver:)" 119 + ); 120 + println!(" QUEUE_REDIS_TIMEOUT Queue blocking timeout in seconds (default: 5)"); 121 + println!( 122 + " QUEUE_REDIS_DEDUP_ENABLED Enable queue deduplication (default: false)" 123 + ); 124 + println!(" QUEUE_REDIS_DEDUP_TTL TTL for dedup keys in seconds (default: 60)"); 125 + println!(" QUEUE_WORKER_ID Worker ID for Redis queue (default: worker1)"); 126 + println!(" QUEUE_BUFFER_SIZE Buffer size for MPSC queue (default: 1000)"); 127 + println!(" QUEUE_SQLITE_MAX_SIZE Maximum SQLite queue size (default: 10000)"); 128 + println!(); 129 + println!(" RATE LIMITING:"); 130 + println!( 131 + " RESOLVER_MAX_CONCURRENT Maximum concurrent resolutions (default: 0 = disabled)" 132 + ); 133 + println!( 134 + " RESOLVER_MAX_CONCURRENT_TIMEOUT_MS Timeout for acquiring permits in ms (default: 0 = no timeout)" 135 + ); 136 + println!(); 137 + println!(" METRICS:"); 138 + println!( 139 + " METRICS_ADAPTER Metrics adapter: 'noop' or 'statsd' (default: noop)" 140 + ); 141 + println!( 142 + " METRICS_STATSD_HOST StatsD host when using statsd adapter (e.g., localhost:8125)" 143 + ); 144 + println!( 145 + " METRICS_STATSD_BIND Bind address for StatsD UDP socket (default: [::]:0)" 146 + ); 147 + println!(" METRICS_PREFIX Prefix for all metrics (default: quickdid)"); 148 + println!( 149 + " METRICS_TAGS Default tags for metrics (comma-separated key:value pairs)" 150 + ); 151 + println!(); 152 + println!(" PROACTIVE CACHE REFRESH:"); 153 + println!( 154 + " PROACTIVE_REFRESH_ENABLED Enable proactive cache refresh (default: false)" 155 + ); 156 + println!( 157 + " PROACTIVE_REFRESH_THRESHOLD Threshold as percentage of TTL (0.0-1.0, default: 0.8)" 158 + ); 159 + println!(); 160 + println!(" JETSTREAM:"); 161 + println!(" JETSTREAM_ENABLED Enable Jetstream consumer (default: false)"); 162 + println!( 163 + " JETSTREAM_HOSTNAME Jetstream hostname (default: jetstream.atproto.tools)" 164 + ); 165 + println!(); 166 + println!( 167 + "For more information, visit: https://github.com/smokesignal.events/quickdid" 168 + ); 169 + return true; 170 + } 171 + _ => {} 172 + } 173 + } 174 + 175 + false 176 + } 177 + 58 178 #[tokio::main] 59 179 async fn main() -> Result<()> { 180 + // Handle --version and --help 181 + if handle_simple_args() { 182 + return Ok(()); 183 + } 184 + 60 185 // Initialize tracing 61 186 tracing_subscriber::registry() 62 187 .with( ··· 67 192 .with(tracing_subscriber::fmt::layer()) 68 193 .init(); 69 194 70 - let args = Args::parse(); 71 - let config = Config::from_args(args)?; 195 + let config = Config::from_env()?; 72 196 73 197 // Validate configuration 74 198 config.validate()?; 75 199 76 200 tracing::info!("Starting QuickDID service on port {}", config.http_port); 77 - tracing::info!("Service DID: {}", config.service_did); 78 201 tracing::info!( 79 202 "Cache TTL - Memory: {}s, Redis: {}s, SQLite: {}s", 80 203 config.cache_ttl_memory, ··· 109 232 // Create DNS resolver 110 233 let dns_resolver = HickoryDnsResolver::create_resolver(dns_nameservers.as_ref()); 111 234 112 - // Process service key 113 - let private_service_key_data = identify_key(&config.service_key)?; 114 - let public_service_key_data = to_public(&private_service_key_data)?; 115 - let public_service_key = public_service_key_data.to_string(); 235 + // Clone DNS resolver for lexicon resolution before wrapping in Arc 236 + let lexicon_dns_resolver = dns_resolver.clone(); 237 + 238 + // Wrap DNS resolver in Arc for handle resolution 239 + let dns_resolver_arc = Arc::new(dns_resolver); 116 240 117 - // Create service DID document 118 - let service_document = json!({ 119 - "@context": vec!["https://www.w3.org/ns/did/v1", "https://w3id.org/security/multikey/v1"], 120 - "id": config.service_did.clone(), 121 - "verificationMethod": [{ 122 - "id": format!("{}#atproto", config.service_did), 123 - "type": "Multikey", 124 - "controller": config.service_did.clone(), 125 - "publicKeyMultibase": public_service_key 126 - }], 127 - "service": [] 128 - }); 241 + // Create metrics publisher based on configuration 242 + let metrics_publisher = create_metrics_publisher(&config).map_err(|e| { 243 + tracing::error!("Failed to create metrics publisher: {}", e); 244 + anyhow::anyhow!("Failed to create metrics publisher: {}", e) 245 + })?; 129 246 130 - // Create DNS resolver Arc for sharing 131 - let dns_resolver_arc = Arc::new(dns_resolver); 247 + tracing::info!( 248 + "Metrics publisher created with {} adapter", 249 + config.metrics_adapter 250 + ); 251 + 252 + metrics_publisher.gauge("server", 1).await; 132 253 133 254 // Create base handle resolver using factory function 134 - let base_handle_resolver = create_base_resolver(dns_resolver_arc.clone(), http_client.clone()); 255 + let mut base_handle_resolver = create_base_resolver( 256 + dns_resolver_arc.clone(), 257 + http_client.clone(), 258 + metrics_publisher.clone(), 259 + ); 260 + 261 + // Apply rate limiting if configured 262 + if config.resolver_max_concurrent > 0 { 263 + let timeout_info = if config.resolver_max_concurrent_timeout_ms > 0 { 264 + format!(", {}ms timeout", config.resolver_max_concurrent_timeout_ms) 265 + } else { 266 + String::new() 267 + }; 268 + tracing::info!( 269 + "Applying rate limiting to handle resolver (max {} concurrent resolutions{})", 270 + config.resolver_max_concurrent, 271 + timeout_info 272 + ); 273 + base_handle_resolver = create_rate_limited_resolver_with_timeout( 274 + base_handle_resolver, 275 + config.resolver_max_concurrent, 276 + config.resolver_max_concurrent_timeout_ms, 277 + metrics_publisher.clone(), 278 + ); 279 + } 135 280 136 281 // Create Redis pool if configured 137 282 let redis_pool = config ··· 146 291 None 147 292 }; 148 293 149 - // Create handle resolver with cache priority: Redis > SQLite > In-memory 150 - let handle_resolver: Arc<dyn quickdid::handle_resolver::HandleResolver> = 151 - if let Some(pool) = redis_pool { 152 - tracing::info!( 153 - "Using Redis-backed handle resolver with {}-second cache TTL", 154 - config.cache_ttl_redis 155 - ); 156 - create_redis_resolver_with_ttl(base_handle_resolver, pool, config.cache_ttl_redis) 157 - } else if let Some(pool) = sqlite_pool { 158 - tracing::info!( 159 - "Using SQLite-backed handle resolver with {}-second cache TTL", 160 - config.cache_ttl_sqlite 161 - ); 162 - create_sqlite_resolver_with_ttl(base_handle_resolver, pool, config.cache_ttl_sqlite) 163 - } else { 164 - tracing::info!( 165 - "Using in-memory handle resolver with {}-second cache TTL", 166 - config.cache_ttl_memory 167 - ); 168 - create_caching_resolver(base_handle_resolver, config.cache_ttl_memory) 169 - }; 170 - 171 294 // Create task tracker and cancellation token 172 295 let tracker = TaskTracker::new(); 173 296 let token = CancellationToken::new(); 174 297 175 - // Setup background handle resolution task and get the queue adapter 298 + // Create the queue adapter first (needed for proactive refresh) 176 299 let handle_queue: Arc<dyn QueueAdapter<HandleResolutionWork>> = { 177 300 // Create queue adapter based on configuration 178 301 let adapter: Arc<dyn QueueAdapter<HandleResolutionWork>> = match config ··· 189 312 if let Some(url) = queue_redis_url { 190 313 if let Some(pool) = try_create_redis_pool(url, "queue adapter") { 191 314 tracing::info!( 192 - "Creating Redis queue adapter with prefix: {}", 193 - config.queue_redis_prefix 315 + "Creating Redis queue adapter with prefix: {}, dedup: {}, dedup_ttl: {}s", 316 + config.queue_redis_prefix, 317 + config.queue_redis_dedup_enabled, 318 + config.queue_redis_dedup_ttl 194 319 ); 195 - create_redis_queue::<HandleResolutionWork>( 196 - pool, 197 - config.queue_worker_id.clone(), 198 - config.queue_redis_prefix.clone(), 199 - config.queue_redis_timeout, 200 - ) 320 + if config.queue_redis_dedup_enabled { 321 + create_redis_queue_with_dedup::<HandleResolutionWork>( 322 + pool, 323 + config.queue_worker_id.clone(), 324 + config.queue_redis_prefix.clone(), 325 + config.queue_redis_timeout, 326 + true, 327 + config.queue_redis_dedup_ttl, 328 + ) 329 + } else { 330 + create_redis_queue::<HandleResolutionWork>( 331 + pool, 332 + config.queue_worker_id.clone(), 333 + config.queue_redis_prefix.clone(), 334 + config.queue_redis_timeout, 335 + ) 336 + } 201 337 } else { 202 338 tracing::warn!("Falling back to MPSC queue adapter"); 203 339 // Fall back to MPSC if Redis fails ··· 232 368 create_sqlite_queue::<HandleResolutionWork>(pool) 233 369 } 234 370 } else { 235 - tracing::warn!("Failed to create SQLite pool for queue, falling back to MPSC queue adapter"); 371 + tracing::warn!( 372 + "Failed to create SQLite pool for queue, falling back to MPSC queue adapter" 373 + ); 236 374 // Fall back to MPSC if SQLite fails 237 375 let (handle_sender, handle_receiver) = 238 376 tokio::sync::mpsc::channel::<HandleResolutionWork>( ··· 272 410 } 273 411 }; 274 412 275 - // Keep a reference to the adapter for the AppContext 276 - let adapter_for_context = adapter.clone(); 413 + adapter 414 + }; 415 + 416 + // Create handle resolver with cache priority: Redis > SQLite > In-memory 417 + let (mut handle_resolver, cache_ttl): ( 418 + Arc<dyn quickdid::handle_resolver::HandleResolver>, 419 + u64, 420 + ) = if let Some(ref pool) = redis_pool { 421 + tracing::info!( 422 + "Using Redis-backed handle resolver with {}-second cache TTL", 423 + config.cache_ttl_redis 424 + ); 425 + ( 426 + create_redis_resolver_with_ttl( 427 + base_handle_resolver, 428 + pool.clone(), 429 + config.cache_ttl_redis, 430 + metrics_publisher.clone(), 431 + ), 432 + config.cache_ttl_redis, 433 + ) 434 + } else if let Some(pool) = sqlite_pool { 435 + tracing::info!( 436 + "Using SQLite-backed handle resolver with {}-second cache TTL", 437 + config.cache_ttl_sqlite 438 + ); 439 + ( 440 + create_sqlite_resolver_with_ttl( 441 + base_handle_resolver, 442 + pool, 443 + config.cache_ttl_sqlite, 444 + metrics_publisher.clone(), 445 + ), 446 + config.cache_ttl_sqlite, 447 + ) 448 + } else { 449 + tracing::info!( 450 + "Using in-memory handle resolver with {}-second cache TTL", 451 + config.cache_ttl_memory 452 + ); 453 + ( 454 + create_caching_resolver( 455 + base_handle_resolver, 456 + config.cache_ttl_memory, 457 + metrics_publisher.clone(), 458 + ), 459 + config.cache_ttl_memory, 460 + ) 461 + }; 462 + 463 + // Apply proactive refresh if enabled 464 + if config.proactive_refresh_enabled && !matches!(config.queue_adapter.as_str(), "noop" | "none") 465 + { 466 + tracing::info!( 467 + "Enabling proactive cache refresh with {}% threshold", 468 + (config.proactive_refresh_threshold * 100.0) as u32 469 + ); 470 + handle_resolver = create_proactive_refresh_resolver_with_metrics( 471 + handle_resolver, 472 + handle_queue.clone(), 473 + metrics_publisher.clone(), 474 + cache_ttl, 475 + config.proactive_refresh_threshold, 476 + ); 477 + } else if config.proactive_refresh_enabled { 478 + tracing::warn!( 479 + "Proactive refresh enabled but queue adapter is no-op, skipping proactive refresh" 480 + ); 481 + } 482 + 483 + // Create lexicon resolver with Redis caching if available 484 + let lexicon_resolver: Arc<dyn LexiconResolver> = { 485 + let base_lexicon_resolver: Arc<dyn LexiconResolver> = Arc::new( 486 + DefaultLexiconResolver::new(http_client.clone(), lexicon_dns_resolver), 487 + ); 488 + 489 + if let Some(ref pool) = redis_pool { 490 + tracing::info!( 491 + "Using Redis-backed lexicon resolver with {}-second cache TTL", 492 + config.cache_ttl_redis 493 + ); 494 + create_redis_lexicon_resolver_with_ttl( 495 + base_lexicon_resolver, 496 + pool.clone(), 497 + config.cache_ttl_redis, 498 + metrics_publisher.clone(), 499 + ) 500 + } else { 501 + tracing::info!("Using base lexicon resolver without caching"); 502 + base_lexicon_resolver 503 + } 504 + }; 505 + 506 + // Setup background handle resolution task 507 + { 508 + let adapter_for_task = handle_queue.clone(); 277 509 278 510 // Only spawn handle resolver task if not using noop adapter 279 511 if !matches!(config.queue_adapter.as_str(), "noop" | "none") { ··· 284 516 285 517 // Create and start handle resolver task 286 518 let handle_task = create_handle_resolver_task_with_config( 287 - adapter, 519 + adapter_for_task, 288 520 handle_resolver.clone(), 289 521 token.clone(), 290 522 handle_task_config, 523 + metrics_publisher.clone(), 291 524 ); 292 525 293 526 // Spawn the handle resolver task ··· 320 553 } else { 321 554 tracing::info!("Background handle resolution task disabled (using no-op adapter)"); 322 555 } 323 - 324 - // Return the adapter to be used in AppContext 325 - adapter_for_context 326 556 }; 327 557 328 558 // Create app context with the queue adapter 329 559 let app_context = AppContext::new( 330 - service_document, 331 - config.service_did.clone(), 332 560 handle_resolver.clone(), 333 561 handle_queue, 562 + lexicon_resolver, 563 + metrics_publisher.clone(), 564 + config.etag_seed.clone(), 565 + config.cache_control_header.clone(), 566 + config.static_files_dir.clone(), 334 567 ); 335 568 336 569 // Create router ··· 377 610 signal_token.cancel(); 378 611 tracing::info!("Signal handler task completed"); 379 612 }); 613 + } 614 + 615 + // Start Jetstream consumer if enabled 616 + if config.jetstream_enabled { 617 + let jetstream_resolver = handle_resolver.clone(); 618 + let jetstream_metrics = metrics_publisher.clone(); 619 + let jetstream_hostname = config.jetstream_hostname.clone(); 620 + let jetstream_user_agent = config.user_agent.clone(); 621 + 622 + spawn_cancellable_task( 623 + &tracker, 624 + token.clone(), 625 + "jetstream_consumer", 626 + move |cancel_token| async move { 627 + tracing::info!(hostname = %jetstream_hostname, "Starting Jetstream consumer"); 628 + 629 + // Create event handler 630 + let event_handler = Arc::new(QuickDidEventHandler::new( 631 + jetstream_resolver, 632 + jetstream_metrics.clone(), 633 + )); 634 + 635 + // Reconnection loop 636 + let mut reconnect_count = 0u32; 637 + let max_reconnects_per_minute = 5; 638 + let reconnect_window = std::time::Duration::from_secs(60); 639 + let mut last_disconnect = std::time::Instant::now() - reconnect_window; 640 + 641 + while !cancel_token.is_cancelled() { 642 + let now = std::time::Instant::now(); 643 + if now.duration_since(last_disconnect) < reconnect_window { 644 + reconnect_count += 1; 645 + if reconnect_count > max_reconnects_per_minute { 646 + tracing::warn!( 647 + count = reconnect_count, 648 + "Too many Jetstream reconnects, waiting 60 seconds" 649 + ); 650 + tokio::time::sleep(reconnect_window).await; 651 + reconnect_count = 0; 652 + last_disconnect = now; 653 + continue; 654 + } 655 + } else { 656 + reconnect_count = 0; 657 + } 658 + 659 + // Create consumer configuration 660 + let consumer_config = ConsumerTaskConfig { 661 + user_agent: jetstream_user_agent.clone(), 662 + compression: false, 663 + zstd_dictionary_location: String::new(), 664 + jetstream_hostname: jetstream_hostname.clone(), 665 + // Listen to the "community.lexicon.collection.fake" collection 666 + // so that we keep an active connection open but only for 667 + // account and identity events. 668 + collections: vec!["community.lexicon.collection.fake".to_string()], // Listen to all collections 669 + dids: vec![], 670 + max_message_size_bytes: None, 671 + cursor: None, 672 + require_hello: true, 673 + }; 674 + 675 + let consumer = JetstreamConsumer::new(consumer_config); 676 + 677 + // Register event handler 678 + if let Err(e) = consumer.register_handler(event_handler.clone()).await { 679 + tracing::error!(error = ?e, "Failed to register Jetstream event handler"); 680 + continue; 681 + } 682 + 683 + // Run consumer with cancellation support 684 + match consumer.run_background(cancel_token.clone()).await { 685 + Ok(()) => { 686 + tracing::info!("Jetstream consumer stopped normally"); 687 + if cancel_token.is_cancelled() { 688 + break; 689 + } 690 + last_disconnect = std::time::Instant::now(); 691 + tokio::time::sleep(std::time::Duration::from_secs(5)).await; 692 + } 693 + Err(e) => { 694 + tracing::error!(error = ?e, "Jetstream consumer connection failed, will reconnect"); 695 + jetstream_metrics.incr("jetstream.connection.error").await; 696 + last_disconnect = std::time::Instant::now(); 697 + 698 + if !cancel_token.is_cancelled() { 699 + tokio::time::sleep(std::time::Duration::from_secs(5)).await; 700 + } 701 + } 702 + } 703 + } 704 + 705 + tracing::info!("Jetstream consumer task shutting down"); 706 + Ok(()) 707 + }, 708 + ); 709 + } else { 710 + tracing::info!("Jetstream consumer disabled"); 380 711 } 381 712 382 713 // Start HTTP server with cancellation support
+11 -3
src/cache.rs
··· 1 1 //! Redis cache utilities for QuickDID 2 2 3 - use anyhow::Result; 4 3 use deadpool_redis::{Config, Pool, Runtime}; 4 + use thiserror::Error; 5 + 6 + /// Cache-specific errors 7 + #[derive(Debug, Error)] 8 + pub enum CacheError { 9 + /// Redis pool creation failed 10 + #[error("error-quickdid-cache-1 Redis pool creation failed: {0}")] 11 + RedisPoolCreationFailed(String), 12 + } 5 13 6 14 /// Create a Redis connection pool from a Redis URL. 7 15 /// ··· 14 22 /// Returns an error if: 15 23 /// - The Redis URL is invalid 16 24 /// - Pool creation fails 17 - pub fn create_redis_pool(redis_url: &str) -> Result<Pool> { 25 + pub fn create_redis_pool(redis_url: &str) -> Result<Pool, CacheError> { 18 26 let config = Config::from_url(redis_url); 19 27 let pool = config 20 28 .create_pool(Some(Runtime::Tokio1)) 21 - .map_err(|e| anyhow::anyhow!("error-quickdid-cache-1 Redis pool creation failed: {}", e))?; 29 + .map_err(|e| CacheError::RedisPoolCreationFailed(e.to_string()))?; 22 30 Ok(pool) 23 31 }
+255 -380
src/config.rs
··· 5 5 //! 6 6 //! ## Configuration Sources 7 7 //! 8 - //! Configuration can be provided through: 9 - //! - Environment variables (highest priority) 10 - //! - Command-line arguments 11 - //! - Default values (lowest priority) 8 + //! Configuration is provided exclusively through environment variables following 9 + //! the 12-factor app methodology. 12 10 //! 13 11 //! ## Example 14 12 //! 15 13 //! ```bash 16 14 //! # Minimal configuration 17 15 //! HTTP_EXTERNAL=quickdid.example.com \ 18 - //! SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK \ 19 16 //! quickdid 20 17 //! 21 18 //! # Full configuration with Redis and custom settings 22 19 //! HTTP_EXTERNAL=quickdid.example.com \ 23 - //! SERVICE_KEY=did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK \ 24 20 //! HTTP_PORT=3000 \ 25 21 //! REDIS_URL=redis://localhost:6379 \ 26 22 //! CACHE_TTL_MEMORY=300 \ ··· 30 26 //! quickdid 31 27 //! ``` 32 28 33 - use atproto_identity::config::optional_env; 34 - use clap::Parser; 29 + use std::env; 35 30 use thiserror::Error; 36 31 37 32 /// Configuration-specific errors following the QuickDID error format ··· 41 36 pub enum ConfigError { 42 37 /// Missing required environment variable or command-line argument 43 38 /// 44 - /// Example: When SERVICE_KEY or HTTP_EXTERNAL are not provided 39 + /// Example: When HTTP_EXTERNAL is not provided 45 40 #[error("error-quickdid-config-1 Missing required environment variable: {0}")] 46 41 MissingRequired(String), 47 42 48 43 /// Invalid configuration value that doesn't meet expected format or constraints 49 44 /// 50 - /// Example: Invalid QUEUE_ADAPTER value (must be 'mpsc', 'redis', or 'noop') 45 + /// Example: Invalid QUEUE_ADAPTER value (must be 'mpsc', 'redis', 'sqlite', 'noop', or 'none') 51 46 #[error("error-quickdid-config-2 Invalid configuration value: {0}")] 52 47 InvalidValue(String), 53 48 ··· 64 59 InvalidTimeout(String), 65 60 } 66 61 67 - #[derive(Parser, Clone)] 68 - #[command( 69 - name = "quickdid", 70 - about = "QuickDID - AT Protocol Identity Resolver Service", 71 - long_about = " 72 - A fast identity resolution service for the AT Protocol ecosystem. 73 - This service provides identity resolution endpoints and handle resolution 74 - capabilities with in-memory caching. 75 - 76 - FEATURES: 77 - - AT Protocol identity resolution and DID document management 78 - - Handle resolution with in-memory caching 79 - - DID:web identity publishing via .well-known endpoints 80 - - Health check endpoint 81 - 82 - ENVIRONMENT VARIABLES: 83 - SERVICE_KEY Private key for service identity (required) 84 - HTTP_EXTERNAL External hostname for service endpoints (required) 85 - HTTP_PORT HTTP server port (default: 8080) 86 - PLC_HOSTNAME PLC directory hostname (default: plc.directory) 87 - USER_AGENT HTTP User-Agent header (auto-generated with version) 88 - DNS_NAMESERVERS Custom DNS nameservers (comma-separated IPs) 89 - CERTIFICATE_BUNDLES Additional CA certificates (comma-separated paths) 90 - 91 - CACHING: 92 - REDIS_URL Redis URL for handle resolution caching (optional) 93 - SQLITE_URL SQLite database URL for handle resolution caching (optional) 94 - CACHE_TTL_MEMORY TTL for in-memory cache in seconds (default: 600) 95 - CACHE_TTL_REDIS TTL for Redis cache in seconds (default: 7776000 = 90 days) 96 - CACHE_TTL_SQLITE TTL for SQLite cache in seconds (default: 7776000 = 90 days) 97 - 98 - QUEUE CONFIGURATION: 99 - QUEUE_ADAPTER Queue adapter: 'mpsc', 'redis', 'sqlite', 'noop', 'none' (default: mpsc) 100 - QUEUE_REDIS_URL Redis URL for queue adapter (uses REDIS_URL if not set) 101 - QUEUE_REDIS_PREFIX Redis key prefix for queues (default: queue:handleresolver:) 102 - QUEUE_REDIS_TIMEOUT Queue blocking timeout in seconds (default: 5) 103 - QUEUE_WORKER_ID Worker ID for Redis queue (default: worker1) 104 - QUEUE_BUFFER_SIZE Buffer size for MPSC queue (default: 1000) 105 - QUEUE_SQLITE_MAX_SIZE Maximum SQLite queue size for work shedding (default: 10000, 0=unlimited) 106 - " 107 - )] 108 - /// Command-line arguments and environment variables configuration 109 - pub struct Args { 110 - /// HTTP server port to bind to 111 - /// 112 - /// Examples: "8080", "3000", "80" 113 - /// Constraints: Must be a valid port number (1-65535) 114 - #[arg(long, env = "HTTP_PORT", default_value = "8080")] 115 - pub http_port: String, 116 - 117 - /// PLC directory hostname for DID resolution 118 - /// 119 - /// Examples: "plc.directory", "test.plc.directory" 120 - /// Use "plc.directory" for production 121 - #[arg(long, env = "PLC_HOSTNAME", default_value = "plc.directory")] 122 - pub plc_hostname: String, 123 - 124 - /// External hostname for service endpoints (REQUIRED) 125 - /// 126 - /// Examples: 127 - /// - "quickdid.example.com" (standard) 128 - /// - "quickdid.example.com:8080" (with port) 129 - /// - "localhost:3007" (development) 130 - #[arg(long, env = "HTTP_EXTERNAL")] 131 - pub http_external: Option<String>, 132 - 133 - /// Private key for service identity in DID format (REQUIRED) 134 - /// 135 - /// Examples: 136 - /// - "did:key:z42tmZxD2mi1TfMKSFrsRfednwdaaPNZiiWHP4MPgcvXkDWK" 137 - /// - "did:plc:xyz123abc456" 138 - /// 139 - /// SECURITY: Keep this key secure and never commit to version control 140 - #[arg(long, env = "SERVICE_KEY")] 141 - pub service_key: Option<String>, 142 - 143 - /// HTTP User-Agent header for outgoing requests 144 - /// 145 - /// Example: `quickdid/1.0.0 (+https://quickdid.example.com)` 146 - /// Default: Auto-generated with current version 147 - #[arg(long, env = "USER_AGENT")] 148 - pub user_agent: Option<String>, 149 - 150 - /// Custom DNS nameservers (comma-separated IP addresses) 151 - /// 152 - /// Examples: 153 - /// - "8.8.8.8,8.8.4.4" (Google DNS) 154 - /// - "1.1.1.1,1.0.0.1" (Cloudflare DNS) 155 - /// - "192.168.1.1" (Local DNS) 156 - #[arg(long, env = "DNS_NAMESERVERS")] 157 - pub dns_nameservers: Option<String>, 158 - 159 - /// Additional CA certificates (comma-separated file paths) 160 - /// 161 - /// Examples: 162 - /// - "/etc/ssl/certs/custom-ca.pem" 163 - /// - "/certs/ca1.pem,/certs/ca2.pem" 164 - /// 165 - /// Use for custom or internal certificate authorities 166 - #[arg(long, env = "CERTIFICATE_BUNDLES")] 167 - pub certificate_bundles: Option<String>, 168 - 169 - /// Redis connection URL for caching 170 - /// 171 - /// Examples: 172 - /// - "redis://localhost:6379/0" (local, no auth) 173 - /// - "redis://user:pass@redis.example.com:6379/0" (with auth) 174 - /// - "rediss://secure-redis.example.com:6380/0" (TLS) 175 - /// 176 - /// Benefits: Persistent cache, distributed caching, better performance 177 - #[arg(long, env = "REDIS_URL")] 178 - pub redis_url: Option<String>, 179 - 180 - /// SQLite database URL for caching 181 - /// 182 - /// Examples: 183 - /// - "sqlite:./quickdid.db" (file-based database) 184 - /// - "sqlite::memory:" (in-memory database for testing) 185 - /// - "sqlite:/path/to/cache.db" (absolute path) 186 - /// 187 - /// Benefits: Persistent cache, single-file storage, no external dependencies 188 - #[arg(long, env = "SQLITE_URL")] 189 - pub sqlite_url: Option<String>, 190 - 191 - /// Queue adapter type for background processing 192 - /// 193 - /// Values: 194 - /// - "mpsc": In-memory multi-producer single-consumer queue 195 - /// - "redis": Redis-backed distributed queue 196 - /// - "sqlite": SQLite-backed persistent queue 197 - /// - "noop": Disable queue processing (for testing) 198 - /// - "none": Alias for "noop" 199 - /// 200 - /// Default: "mpsc" for single-instance deployments 201 - #[arg(long, env = "QUEUE_ADAPTER", default_value = "mpsc")] 202 - pub queue_adapter: String, 203 - 204 - /// Redis URL specifically for queue operations 205 - /// 206 - /// Falls back to REDIS_URL if not specified 207 - /// Use when separating cache and queue Redis instances 208 - #[arg(long, env = "QUEUE_REDIS_URL")] 209 - pub queue_redis_url: Option<String>, 210 - 211 - /// Redis key prefix for queue operations 212 - /// 213 - /// Examples: 214 - /// - "queue:handleresolver:" (default) 215 - /// - "prod:queue:hr:" (environment-specific) 216 - /// - "quickdid:v1:queue:" (version-specific) 217 - /// 218 - /// Use to namespace queues when sharing Redis 219 - #[arg( 220 - long, 221 - env = "QUEUE_REDIS_PREFIX", 222 - default_value = "queue:handleresolver:" 223 - )] 224 - pub queue_redis_prefix: String, 225 - 226 - /// Worker ID for Redis queue operations 227 - /// 228 - /// Examples: "worker-001", "prod-us-east-1", "quickdid-1" 229 - /// Default: "worker1" 230 - /// 231 - /// Use for identifying specific workers in logs 232 - #[arg(long, env = "QUEUE_WORKER_ID")] 233 - pub queue_worker_id: Option<String>, 234 - 235 - /// Buffer size for MPSC queue 236 - /// 237 - /// Range: 100-100000 (recommended) 238 - /// Default: 1000 239 - /// 240 - /// Increase for high-traffic deployments 241 - #[arg(long, env = "QUEUE_BUFFER_SIZE", default_value = "1000")] 242 - pub queue_buffer_size: usize, 243 - 244 - /// TTL for in-memory cache in seconds 245 - /// 246 - /// Range: 60-3600 (recommended) 247 - /// Default: 600 (10 minutes) 248 - /// 249 - /// Lower values = fresher data, more resolution requests 250 - /// Higher values = better performance, potentially stale data 251 - #[arg(long, env = "CACHE_TTL_MEMORY", default_value = "600")] 252 - pub cache_ttl_memory: u64, 253 - 254 - /// TTL for Redis cache in seconds 255 - /// 256 - /// Range: 3600-31536000 (1 hour to 1 year) 257 - /// Default: 7776000 (90 days) 258 - /// 259 - /// Recommendation: 86400 (1 day) for frequently changing data 260 - #[arg(long, env = "CACHE_TTL_REDIS", default_value = "7776000")] 261 - pub cache_ttl_redis: u64, 262 - 263 - /// TTL for SQLite cache in seconds 264 - /// 265 - /// Range: 3600-31536000 (1 hour to 1 year) 266 - /// Default: 7776000 (90 days) 267 - /// 268 - /// Recommendation: 86400 (1 day) for frequently changing data 269 - #[arg(long, env = "CACHE_TTL_SQLITE", default_value = "7776000")] 270 - pub cache_ttl_sqlite: u64, 62 + /// Helper function to get an environment variable with an optional default 63 + fn get_env_or_default(key: &str, default: Option<&str>) -> Option<String> { 64 + match env::var(key) { 65 + Ok(val) if !val.is_empty() => Some(val), 66 + _ => default.map(String::from), 67 + } 68 + } 271 69 272 - /// Redis blocking timeout for queue operations in seconds 273 - /// 274 - /// Range: 1-60 (recommended) 275 - /// Default: 5 276 - /// 277 - /// Lower values = more responsive to shutdown 278 - /// Higher values = less Redis polling overhead 279 - #[arg(long, env = "QUEUE_REDIS_TIMEOUT", default_value = "5")] 280 - pub queue_redis_timeout: u64, 281 - 282 - /// Maximum queue size for SQLite adapter (work shedding) 283 - /// 284 - /// Range: 100-1000000 (recommended) 285 - /// Default: 10000 286 - /// 287 - /// When the SQLite queue exceeds this limit, the oldest entries are deleted 288 - /// to maintain the queue size. This prevents unbounded queue growth while 289 - /// preserving the most recently queued work items. 290 - /// 291 - /// Set to 0 to disable work shedding (unlimited queue size) 292 - #[arg(long, env = "QUEUE_SQLITE_MAX_SIZE", default_value = "10000")] 293 - pub queue_sqlite_max_size: u64, 70 + /// Helper function to parse an environment variable as a specific type 71 + fn parse_env<T: std::str::FromStr>(key: &str, default: T) -> Result<T, ConfigError> 72 + where 73 + T::Err: std::fmt::Display, 74 + { 75 + match env::var(key) { 76 + Ok(val) if !val.is_empty() => val 77 + .parse::<T>() 78 + .map_err(|e| ConfigError::InvalidValue(format!("{}: {}", key, e))), 79 + _ => Ok(default), 80 + } 294 81 } 295 82 296 83 /// Validated configuration for QuickDID service 297 84 /// 298 85 /// This struct contains all configuration after validation and processing. 299 - /// Use `Config::from_args()` to create from command-line arguments and environment variables. 86 + /// Use `Config::from_env()` to create from environment variables. 300 87 /// 301 88 /// ## Example 302 89 /// 303 90 /// ```rust,no_run 304 - /// use quickdid::config::{Args, Config}; 305 - /// use clap::Parser; 91 + /// use quickdid::config::Config; 306 92 /// 307 93 /// # fn main() -> Result<(), Box<dyn std::error::Error>> { 308 - /// let args = Args::parse(); 309 - /// let config = Config::from_args(args)?; 94 + /// let config = Config::from_env()?; 310 95 /// config.validate()?; 311 96 /// 312 97 /// println!("Service running at: {}", config.http_external); 313 - /// println!("Service DID: {}", config.service_did); 314 98 /// # Ok(()) 315 99 /// # } 316 100 /// ``` ··· 325 109 /// External hostname for service endpoints (e.g., "quickdid.example.com") 326 110 pub http_external: String, 327 111 328 - /// Private key for service identity (e.g., "did:key:z42tm...") 329 - pub service_key: String, 330 - 331 112 /// HTTP User-Agent for outgoing requests (e.g., "quickdid/1.0.0 (+https://...)") 332 113 pub user_agent: String, 333 - 334 - /// Derived service DID (e.g., "did:web:quickdid.example.com") 335 - /// Automatically generated from http_external with proper encoding 336 - pub service_did: String, 337 114 338 115 /// Custom DNS nameservers, comma-separated (e.g., "8.8.8.8,8.8.4.4") 339 116 pub dns_nameservers: Option<String>, ··· 374 151 /// Redis blocking timeout for queue operations in seconds (e.g., 5) 375 152 pub queue_redis_timeout: u64, 376 153 154 + /// Enable deduplication for Redis queue to prevent duplicate handles 155 + /// Default: false 156 + pub queue_redis_dedup_enabled: bool, 157 + 158 + /// TTL for Redis queue deduplication keys in seconds 159 + /// Default: 60 (1 minute) 160 + pub queue_redis_dedup_ttl: u64, 161 + 377 162 /// Maximum queue size for SQLite adapter work shedding (e.g., 10000) 378 163 /// When exceeded, oldest entries are deleted to maintain this limit. 379 164 /// Set to 0 to disable work shedding (unlimited queue size). 380 165 pub queue_sqlite_max_size: u64, 166 + 167 + /// Maximum concurrent handle resolutions allowed (rate limiting). 168 + /// When set to > 0, enables rate limiting using a semaphore. 169 + /// Default: 0 (disabled) 170 + pub resolver_max_concurrent: usize, 171 + 172 + /// Timeout for acquiring rate limit permit in milliseconds. 173 + /// When set to > 0, requests will timeout if they can't acquire a permit within this time. 174 + /// Default: 0 (no timeout) 175 + pub resolver_max_concurrent_timeout_ms: u64, 176 + 177 + /// Seed value for ETAG generation to allow cache invalidation. 178 + /// This value is incorporated into ETAG checksums, allowing server admins 179 + /// to invalidate client-cached responses after major changes. 180 + /// Default: application version 181 + pub etag_seed: String, 182 + 183 + /// Maximum age for HTTP cache control in seconds. 184 + /// When set to 0, Cache-Control header is disabled. 185 + /// Default: 86400 (24 hours) 186 + pub cache_max_age: u64, 187 + 188 + /// Stale-if-error directive for Cache-Control in seconds. 189 + /// Allows stale content to be served if backend errors occur. 190 + /// Default: 172800 (48 hours) 191 + pub cache_stale_if_error: u64, 192 + 193 + /// Stale-while-revalidate directive for Cache-Control in seconds. 194 + /// Allows stale content to be served while fetching fresh content. 195 + /// Default: 86400 (24 hours) 196 + pub cache_stale_while_revalidate: u64, 197 + 198 + /// Max-stale directive for Cache-Control in seconds. 199 + /// Maximum time client will accept stale responses. 200 + /// Default: 172800 (48 hours) 201 + pub cache_max_stale: u64, 202 + 203 + /// Min-fresh directive for Cache-Control in seconds. 204 + /// Minimum time response must remain fresh. 205 + /// Default: 3600 (1 hour) 206 + pub cache_min_fresh: u64, 207 + 208 + /// Pre-calculated Cache-Control header value. 209 + /// Calculated at startup for efficiency. 210 + /// None if cache_max_age is 0 (disabled). 211 + pub cache_control_header: Option<String>, 212 + 213 + /// Metrics adapter type: "noop" or "statsd" 214 + /// Default: "noop" (no metrics collection) 215 + pub metrics_adapter: String, 216 + 217 + /// StatsD host for metrics collection (e.g., "localhost:8125") 218 + /// Required when metrics_adapter is "statsd" 219 + pub metrics_statsd_host: Option<String>, 220 + 221 + /// Bind address for StatsD UDP socket (e.g., "0.0.0.0:0" for IPv4 or "[::]:0" for IPv6) 222 + /// Default: "[::]:0" (IPv6 any address, random port) 223 + pub metrics_statsd_bind: String, 224 + 225 + /// Metrics prefix for all metrics (e.g., "quickdid") 226 + /// Default: "quickdid" 227 + pub metrics_prefix: String, 228 + 229 + /// Default tags for all metrics (comma-separated key:value pairs) 230 + /// Example: "env:production,service:quickdid" 231 + pub metrics_tags: Option<String>, 232 + 233 + /// Enable proactive cache refresh for frequently accessed handles. 234 + /// When enabled, cache entries that have reached the refresh threshold 235 + /// will be queued for background refresh to keep the cache warm. 236 + /// Default: false 237 + pub proactive_refresh_enabled: bool, 238 + 239 + /// Threshold as a percentage (0.0-1.0) of cache TTL when to trigger proactive refresh. 240 + /// For example, 0.8 means refresh when an entry has lived for 80% of its TTL. 241 + /// Default: 0.8 (80%) 242 + pub proactive_refresh_threshold: f64, 243 + 244 + /// Directory path for serving static files. 245 + /// When set, the root handler will serve files from this directory. 246 + /// Default: "www" (relative to working directory) 247 + pub static_files_dir: String, 248 + 249 + /// Enable Jetstream consumer for AT Protocol events. 250 + /// When enabled, the service will consume Account and Identity events 251 + /// to maintain cache consistency. 252 + /// Default: false 253 + pub jetstream_enabled: bool, 254 + 255 + /// Jetstream WebSocket hostname for consuming AT Protocol events. 256 + /// Example: "jetstream.atproto.tools" or "jetstream1.us-west.bsky.network" 257 + /// Default: "jetstream.atproto.tools" 258 + pub jetstream_hostname: String, 381 259 } 382 260 383 261 impl Config { 384 - /// Create a validated Config from command-line arguments and environment variables 262 + /// Create a validated Config from environment variables 385 263 /// 386 264 /// This method: 387 - /// 1. Processes command-line arguments with environment variable fallbacks 388 - /// 2. Validates required fields (HTTP_EXTERNAL and SERVICE_KEY) 389 - /// 3. Generates derived values (service_did from http_external) 390 - /// 4. Applies defaults where appropriate 391 - /// 392 - /// ## Priority Order 393 - /// 394 - /// 1. Command-line arguments (highest priority) 395 - /// 2. Environment variables 396 - /// 3. Default values (lowest priority) 265 + /// 1. Reads configuration from environment variables 266 + /// 2. Validates required fields (HTTP_EXTERNAL) 267 + /// 3. Applies defaults where appropriate 397 268 /// 398 269 /// ## Example 399 270 /// 400 271 /// ```rust,no_run 401 - /// use quickdid::config::{Args, Config}; 402 - /// use clap::Parser; 272 + /// use quickdid::config::Config; 403 273 /// 404 274 /// # fn main() -> Result<(), Box<dyn std::error::Error>> { 405 - /// // Parse from environment and command-line 406 - /// let args = Args::parse(); 407 - /// let config = Config::from_args(args)?; 275 + /// // Parse from environment variables 276 + /// let config = Config::from_env()?; 408 277 /// 409 - /// // The service DID is automatically generated from HTTP_EXTERNAL 410 - /// assert!(config.service_did.starts_with("did:web:")); 411 278 /// # Ok(()) 412 279 /// # } 413 280 /// ``` ··· 416 283 /// 417 284 /// Returns `ConfigError::MissingRequired` if: 418 285 /// - HTTP_EXTERNAL is not provided 419 - /// - SERVICE_KEY is not provided 420 - pub fn from_args(args: Args) -> Result<Self, ConfigError> { 421 - let http_external = args 422 - .http_external 423 - .or_else(|| { 424 - let env_val = optional_env("HTTP_EXTERNAL"); 425 - if env_val.is_empty() { 426 - None 427 - } else { 428 - Some(env_val) 429 - } 430 - }) 286 + pub fn from_env() -> Result<Self, ConfigError> { 287 + // Required fields 288 + let http_external = env::var("HTTP_EXTERNAL") 289 + .ok() 290 + .filter(|s| !s.is_empty()) 431 291 .ok_or_else(|| ConfigError::MissingRequired("HTTP_EXTERNAL".to_string()))?; 432 292 433 - let service_key = args 434 - .service_key 435 - .or_else(|| { 436 - let env_val = optional_env("SERVICE_KEY"); 437 - if env_val.is_empty() { 438 - None 439 - } else { 440 - Some(env_val) 441 - } 442 - }) 443 - .ok_or_else(|| ConfigError::MissingRequired("SERVICE_KEY".to_string()))?; 444 - 293 + // Generate default user agent 445 294 let default_user_agent = format!( 446 295 "quickdid/{} (+https://github.com/smokesignal.events/quickdid)", 447 296 env!("CARGO_PKG_VERSION") 448 297 ); 449 298 450 - let user_agent = args 451 - .user_agent 452 - .or_else(|| { 453 - let env_val = optional_env("USER_AGENT"); 454 - if env_val.is_empty() { 455 - None 456 - } else { 457 - Some(env_val) 458 - } 459 - }) 460 - .unwrap_or(default_user_agent); 461 - 462 - let service_did = if http_external.contains(':') { 463 - let encoded_external = http_external.replace(':', "%3A"); 464 - format!("did:web:{}", encoded_external) 465 - } else { 466 - format!("did:web:{}", http_external) 299 + let mut config = Config { 300 + http_port: get_env_or_default("HTTP_PORT", Some("8080")).unwrap(), 301 + plc_hostname: get_env_or_default("PLC_HOSTNAME", Some("plc.directory")).unwrap(), 302 + http_external, 303 + user_agent: get_env_or_default("USER_AGENT", None).unwrap_or(default_user_agent), 304 + dns_nameservers: get_env_or_default("DNS_NAMESERVERS", None), 305 + certificate_bundles: get_env_or_default("CERTIFICATE_BUNDLES", None), 306 + redis_url: get_env_or_default("REDIS_URL", None), 307 + sqlite_url: get_env_or_default("SQLITE_URL", None), 308 + queue_adapter: get_env_or_default("QUEUE_ADAPTER", Some("mpsc")).unwrap(), 309 + queue_redis_url: get_env_or_default("QUEUE_REDIS_URL", None), 310 + queue_redis_prefix: get_env_or_default( 311 + "QUEUE_REDIS_PREFIX", 312 + Some("queue:handleresolver:"), 313 + ) 314 + .unwrap(), 315 + queue_worker_id: get_env_or_default("QUEUE_WORKER_ID", Some("worker1")).unwrap(), 316 + queue_buffer_size: parse_env("QUEUE_BUFFER_SIZE", 1000)?, 317 + cache_ttl_memory: parse_env("CACHE_TTL_MEMORY", 600)?, 318 + cache_ttl_redis: parse_env("CACHE_TTL_REDIS", 7776000)?, 319 + cache_ttl_sqlite: parse_env("CACHE_TTL_SQLITE", 7776000)?, 320 + queue_redis_timeout: parse_env("QUEUE_REDIS_TIMEOUT", 5)?, 321 + queue_redis_dedup_enabled: parse_env("QUEUE_REDIS_DEDUP_ENABLED", false)?, 322 + queue_redis_dedup_ttl: parse_env("QUEUE_REDIS_DEDUP_TTL", 60)?, 323 + queue_sqlite_max_size: parse_env("QUEUE_SQLITE_MAX_SIZE", 10000)?, 324 + resolver_max_concurrent: parse_env("RESOLVER_MAX_CONCURRENT", 0)?, 325 + resolver_max_concurrent_timeout_ms: parse_env("RESOLVER_MAX_CONCURRENT_TIMEOUT_MS", 0)?, 326 + etag_seed: get_env_or_default("ETAG_SEED", Some(env!("CARGO_PKG_VERSION"))).unwrap(), 327 + cache_max_age: parse_env("CACHE_MAX_AGE", 86400)?, // 24 hours 328 + cache_stale_if_error: parse_env("CACHE_STALE_IF_ERROR", 172800)?, // 48 hours 329 + cache_stale_while_revalidate: parse_env("CACHE_STALE_WHILE_REVALIDATE", 86400)?, // 24 hours 330 + cache_max_stale: parse_env("CACHE_MAX_STALE", 172800)?, // 48 hours 331 + cache_min_fresh: parse_env("CACHE_MIN_FRESH", 3600)?, // 1 hour 332 + cache_control_header: None, // Will be calculated below 333 + metrics_adapter: get_env_or_default("METRICS_ADAPTER", Some("noop")).unwrap(), 334 + metrics_statsd_host: get_env_or_default("METRICS_STATSD_HOST", None), 335 + metrics_statsd_bind: get_env_or_default("METRICS_STATSD_BIND", Some("[::]:0")).unwrap(), 336 + metrics_prefix: get_env_or_default("METRICS_PREFIX", Some("quickdid")).unwrap(), 337 + metrics_tags: get_env_or_default("METRICS_TAGS", None), 338 + proactive_refresh_enabled: parse_env("PROACTIVE_REFRESH_ENABLED", false)?, 339 + proactive_refresh_threshold: parse_env("PROACTIVE_REFRESH_THRESHOLD", 0.8)?, 340 + static_files_dir: get_env_or_default("STATIC_FILES_DIR", Some("www")).unwrap(), 341 + jetstream_enabled: parse_env("JETSTREAM_ENABLED", false)?, 342 + jetstream_hostname: get_env_or_default( 343 + "JETSTREAM_HOSTNAME", 344 + Some("jetstream.atproto.tools"), 345 + ) 346 + .unwrap(), 467 347 }; 468 348 469 - Ok(Config { 470 - http_port: args.http_port, 471 - plc_hostname: args.plc_hostname, 472 - http_external, 473 - service_key, 474 - user_agent, 475 - service_did, 476 - dns_nameservers: args.dns_nameservers.or_else(|| { 477 - let env_val = optional_env("DNS_NAMESERVERS"); 478 - if env_val.is_empty() { 479 - None 480 - } else { 481 - Some(env_val) 482 - } 483 - }), 484 - certificate_bundles: args.certificate_bundles.or_else(|| { 485 - let env_val = optional_env("CERTIFICATE_BUNDLES"); 486 - if env_val.is_empty() { 487 - None 488 - } else { 489 - Some(env_val) 490 - } 491 - }), 492 - redis_url: args.redis_url.or_else(|| { 493 - let env_val = optional_env("REDIS_URL"); 494 - if env_val.is_empty() { 495 - None 496 - } else { 497 - Some(env_val) 498 - } 499 - }), 500 - sqlite_url: args.sqlite_url.or_else(|| { 501 - let env_val = optional_env("SQLITE_URL"); 502 - if env_val.is_empty() { 503 - None 504 - } else { 505 - Some(env_val) 506 - } 507 - }), 508 - queue_adapter: args.queue_adapter, 509 - queue_redis_url: args.queue_redis_url.or_else(|| { 510 - let env_val = optional_env("QUEUE_REDIS_URL"); 511 - if env_val.is_empty() { 512 - None 513 - } else { 514 - Some(env_val) 515 - } 516 - }), 517 - queue_redis_prefix: args.queue_redis_prefix, 518 - queue_worker_id: args.queue_worker_id 519 - .or_else(|| { 520 - let env_val = optional_env("QUEUE_WORKER_ID"); 521 - if env_val.is_empty() { 522 - None 523 - } else { 524 - Some(env_val) 525 - } 526 - }) 527 - .unwrap_or_else(|| "worker1".to_string()), 528 - queue_buffer_size: args.queue_buffer_size, 529 - cache_ttl_memory: args.cache_ttl_memory, 530 - cache_ttl_redis: args.cache_ttl_redis, 531 - cache_ttl_sqlite: args.cache_ttl_sqlite, 532 - queue_redis_timeout: args.queue_redis_timeout, 533 - queue_sqlite_max_size: args.queue_sqlite_max_size, 534 - }) 349 + // Calculate the Cache-Control header value if enabled 350 + config.cache_control_header = config.calculate_cache_control_header(); 351 + 352 + Ok(config) 353 + } 354 + 355 + /// Calculate the Cache-Control header value based on configuration. 356 + /// Returns None if cache_max_age is 0 (disabled). 357 + fn calculate_cache_control_header(&self) -> Option<String> { 358 + if self.cache_max_age == 0 { 359 + return None; 360 + } 361 + 362 + Some(format!( 363 + "public, max-age={}, stale-while-revalidate={}, stale-if-error={}, max-stale={}, min-fresh={}", 364 + self.cache_max_age, 365 + self.cache_stale_while_revalidate, 366 + self.cache_stale_if_error, 367 + self.cache_max_stale, 368 + self.cache_min_fresh 369 + )) 535 370 } 536 371 537 372 /// Validate the configuration for correctness and consistency ··· 539 374 /// Checks: 540 375 /// - Cache TTL values are positive (> 0) 541 376 /// - Queue timeout is positive (> 0) 542 - /// - Queue adapter is a valid value ('mpsc', 'redis', 'noop', 'none') 377 + /// - Queue adapter is a valid value ('mpsc', 'redis', 'sqlite', 'noop', 'none') 543 378 /// 544 379 /// ## Example 545 380 /// 546 381 /// ```rust,no_run 547 - /// # use quickdid::config::{Args, Config}; 548 - /// # use clap::Parser; 382 + /// # use quickdid::config::Config; 549 383 /// # fn main() -> Result<(), Box<dyn std::error::Error>> { 550 - /// # let args = Args::parse(); 551 - /// let config = Config::from_args(args)?; 384 + /// let config = Config::from_env()?; 552 385 /// config.validate()?; // Ensures all values are valid 553 386 /// # Ok(()) 554 387 /// # } ··· 578 411 if self.queue_redis_timeout == 0 { 579 412 return Err(ConfigError::InvalidTimeout( 580 413 "QUEUE_REDIS_TIMEOUT must be > 0".to_string(), 414 + )); 415 + } 416 + if self.queue_redis_dedup_enabled && self.queue_redis_dedup_ttl == 0 { 417 + return Err(ConfigError::InvalidTtl( 418 + "QUEUE_REDIS_DEDUP_TTL must be > 0 when deduplication is enabled".to_string(), 581 419 )); 582 420 } 583 421 match self.queue_adapter.as_str() { 584 422 "mpsc" | "redis" | "sqlite" | "noop" | "none" => {} 585 423 _ => { 586 424 return Err(ConfigError::InvalidValue(format!( 587 - "Invalid QUEUE_ADAPTER '{}', must be 'mpsc', 'redis', 'sqlite', or 'noop'", 425 + "Invalid QUEUE_ADAPTER '{}', must be 'mpsc', 'redis', 'sqlite', 'noop', or 'none'", 588 426 self.queue_adapter 589 427 ))); 590 428 } 591 429 } 430 + if self.resolver_max_concurrent > 10000 { 431 + return Err(ConfigError::InvalidValue( 432 + "RESOLVER_MAX_CONCURRENT must be between 0 and 10000".to_string(), 433 + )); 434 + } 435 + if self.resolver_max_concurrent_timeout_ms > 60000 { 436 + return Err(ConfigError::InvalidTimeout( 437 + "RESOLVER_MAX_CONCURRENT_TIMEOUT_MS must be <= 60000 (60 seconds)".to_string(), 438 + )); 439 + } 440 + 441 + // Validate metrics configuration 442 + match self.metrics_adapter.as_str() { 443 + "noop" | "statsd" => {} 444 + _ => { 445 + return Err(ConfigError::InvalidValue(format!( 446 + "Invalid METRICS_ADAPTER '{}', must be 'noop' or 'statsd'", 447 + self.metrics_adapter 448 + ))); 449 + } 450 + } 451 + 452 + // If statsd is configured, ensure host is provided 453 + if self.metrics_adapter == "statsd" && self.metrics_statsd_host.is_none() { 454 + return Err(ConfigError::MissingRequired( 455 + "METRICS_STATSD_HOST is required when METRICS_ADAPTER is 'statsd'".to_string(), 456 + )); 457 + } 458 + 459 + // Validate proactive refresh threshold 460 + if self.proactive_refresh_threshold < 0.0 || self.proactive_refresh_threshold > 1.0 { 461 + return Err(ConfigError::InvalidValue(format!( 462 + "PROACTIVE_REFRESH_THRESHOLD must be between 0.0 and 1.0, got {}", 463 + self.proactive_refresh_threshold 464 + ))); 465 + } 466 + 592 467 Ok(()) 593 468 } 594 469 }
+6 -3
src/handle_resolution_result.rs
··· 11 11 /// Errors that can occur during handle resolution result operations 12 12 #[derive(Debug, Error)] 13 13 pub enum HandleResolutionError { 14 - #[error("error-quickdid-resolution-1 System time error: {0}")] 14 + /// System time error when getting timestamp 15 + #[error("error-quickdid-result-1 System time error: {0}")] 15 16 SystemTime(String), 16 17 17 - #[error("error-quickdid-serialization-1 Failed to serialize resolution result: {0}")] 18 + /// Failed to serialize resolution result to binary format 19 + #[error("error-quickdid-result-2 Failed to serialize resolution result: {0}")] 18 20 Serialization(String), 19 21 20 - #[error("error-quickdid-serialization-2 Failed to deserialize resolution result: {0}")] 22 + /// Failed to deserialize resolution result from binary format 23 + #[error("error-quickdid-result-3 Failed to deserialize resolution result: {0}")] 21 24 Deserialization(String), 22 25 } 23 26
+54 -4
src/handle_resolver/base.rs
··· 5 5 6 6 use super::errors::HandleResolverError; 7 7 use super::traits::HandleResolver; 8 + use crate::metrics::SharedMetricsPublisher; 8 9 use async_trait::async_trait; 9 10 use atproto_identity::resolve::{DnsResolver, resolve_subject}; 10 11 use reqwest::Client; 11 12 use std::sync::Arc; 13 + use std::time::{SystemTime, UNIX_EPOCH}; 12 14 13 15 /// Base handle resolver that performs actual resolution via DNS and HTTP. 14 16 /// ··· 24 26 /// use reqwest::Client; 25 27 /// use atproto_identity::resolve::HickoryDnsResolver; 26 28 /// use quickdid::handle_resolver::{create_base_resolver, HandleResolver}; 29 + /// use quickdid::metrics::NoOpMetricsPublisher; 27 30 /// 28 31 /// # async fn example() { 29 32 /// let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 30 33 /// let http_client = Client::new(); 34 + /// let metrics = Arc::new(NoOpMetricsPublisher); 31 35 /// 32 36 /// let resolver = create_base_resolver( 33 37 /// dns_resolver, 34 38 /// http_client, 39 + /// metrics, 35 40 /// ); 36 41 /// 37 - /// let did = resolver.resolve("alice.bsky.social").await.unwrap(); 42 + /// let (did, timestamp) = resolver.resolve("alice.bsky.social").await.unwrap(); 43 + /// println!("Resolved {} at {}", did, timestamp); 38 44 /// # } 39 45 /// ``` 40 46 pub(super) struct BaseHandleResolver { ··· 43 49 44 50 /// HTTP client for DID document retrieval and well-known endpoint queries. 45 51 http_client: Client, 52 + 53 + /// Metrics publisher for telemetry. 54 + metrics: SharedMetricsPublisher, 46 55 } 47 56 48 57 #[async_trait] 49 58 impl HandleResolver for BaseHandleResolver { 50 - async fn resolve(&self, s: &str) -> Result<String, HandleResolverError> { 51 - resolve_subject(&self.http_client, &*self.dns_resolver, s) 59 + async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 60 + let start_time = std::time::Instant::now(); 61 + 62 + // Perform DNS/HTTP resolution 63 + let result = resolve_subject(&self.http_client, &*self.dns_resolver, s) 52 64 .await 53 - .map_err(|e| HandleResolverError::ResolutionFailed(e.to_string())) 65 + .map_err(|e| HandleResolverError::ResolutionFailed(e.to_string())); 66 + 67 + let duration_ms = start_time.elapsed().as_millis() as u64; 68 + 69 + // Publish metrics 70 + 71 + match result { 72 + Ok(did) => { 73 + self.metrics 74 + .time_with_tags( 75 + "resolver.base.duration_ms", 76 + duration_ms, 77 + &[("success", "1")], 78 + ) 79 + .await; 80 + 81 + let timestamp = SystemTime::now() 82 + .duration_since(UNIX_EPOCH) 83 + .map_err(|e| { 84 + HandleResolverError::ResolutionFailed(format!("System time error: {}", e)) 85 + })? 86 + .as_secs(); 87 + 88 + Ok((did, timestamp)) 89 + } 90 + Err(e) => { 91 + self.metrics 92 + .time_with_tags( 93 + "resolver.base.duration_ms", 94 + duration_ms, 95 + &[("success", "0")], 96 + ) 97 + .await; 98 + Err(e) 99 + } 100 + } 54 101 } 55 102 } 56 103 ··· 63 110 /// 64 111 /// * `dns_resolver` - DNS resolver for TXT record lookups 65 112 /// * `http_client` - HTTP client for well-known endpoint queries 113 + /// * `metrics` - Metrics publisher for telemetry 66 114 pub fn create_base_resolver( 67 115 dns_resolver: Arc<dyn DnsResolver>, 68 116 http_client: Client, 117 + metrics: SharedMetricsPublisher, 69 118 ) -> Arc<dyn HandleResolver> { 70 119 Arc::new(BaseHandleResolver { 71 120 dns_resolver, 72 121 http_client, 122 + metrics, 73 123 }) 74 124 }
+3
src/handle_resolver/errors.rs
··· 23 23 /// Mock resolver failure for testing 24 24 #[error("error-quickdid-resolve-4 Mock resolution failure")] 25 25 MockResolutionFailure, 26 + 27 + #[error("error-quickdid-resolve-5 Invalid subject: {0}")] 28 + InvalidSubject(String), 26 29 }
+70 -13
src/handle_resolver/memory.rs
··· 6 6 7 7 use super::errors::HandleResolverError; 8 8 use super::traits::HandleResolver; 9 + use crate::metrics::SharedMetricsPublisher; 9 10 use async_trait::async_trait; 10 - use std::time::{SystemTime, UNIX_EPOCH}; 11 11 use std::collections::HashMap; 12 12 use std::sync::Arc; 13 + use std::time::{SystemTime, UNIX_EPOCH}; 13 14 use tokio::sync::RwLock; 14 15 15 16 /// Result of a handle resolution cached in memory. ··· 32 33 /// ```no_run 33 34 /// use std::sync::Arc; 34 35 /// use quickdid::handle_resolver::{create_caching_resolver, create_base_resolver, HandleResolver}; 36 + /// use quickdid::metrics::NoOpMetricsPublisher; 35 37 /// 36 38 /// # async fn example() { 37 39 /// # use atproto_identity::resolve::HickoryDnsResolver; 38 40 /// # use reqwest::Client; 39 41 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 40 42 /// # let http_client = Client::new(); 41 - /// let base_resolver = create_base_resolver(dns_resolver, http_client); 43 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 44 + /// let base_resolver = create_base_resolver(dns_resolver, http_client, metrics.clone()); 42 45 /// let caching_resolver = create_caching_resolver( 43 46 /// base_resolver, 44 - /// 300 // 5 minute TTL 47 + /// 300, // 5 minute TTL 48 + /// metrics 45 49 /// ); 46 50 /// 47 51 /// // First call hits the underlying resolver 48 - /// let did1 = caching_resolver.resolve("alice.bsky.social").await.unwrap(); 52 + /// let (did1, timestamp1) = caching_resolver.resolve("alice.bsky.social").await.unwrap(); 49 53 /// 50 54 /// // Second call returns cached result 51 - /// let did2 = caching_resolver.resolve("alice.bsky.social").await.unwrap(); 55 + /// let (did2, timestamp2) = caching_resolver.resolve("alice.bsky.social").await.unwrap(); 52 56 /// # } 53 57 /// ``` 54 58 pub(super) struct CachingHandleResolver { 55 59 inner: Arc<dyn HandleResolver>, 56 60 cache: Arc<RwLock<HashMap<String, ResolveHandleResult>>>, 57 61 ttl_seconds: u64, 62 + metrics: SharedMetricsPublisher, 58 63 } 59 64 60 65 impl CachingHandleResolver { ··· 64 69 /// 65 70 /// * `inner` - The underlying resolver to use for actual resolution 66 71 /// * `ttl_seconds` - How long to cache results in seconds 67 - pub fn new(inner: Arc<dyn HandleResolver>, ttl_seconds: u64) -> Self { 72 + /// * `metrics` - Metrics publisher for telemetry 73 + pub fn new( 74 + inner: Arc<dyn HandleResolver>, 75 + ttl_seconds: u64, 76 + metrics: SharedMetricsPublisher, 77 + ) -> Self { 68 78 Self { 69 79 inner, 70 80 cache: Arc::new(RwLock::new(HashMap::new())), 71 81 ttl_seconds, 82 + metrics, 72 83 } 73 84 } 74 85 ··· 87 98 88 99 #[async_trait] 89 100 impl HandleResolver for CachingHandleResolver { 90 - async fn resolve(&self, s: &str) -> Result<String, HandleResolverError> { 101 + async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 91 102 let handle = s.to_string(); 92 103 93 104 // Check cache first ··· 98 109 ResolveHandleResult::Found(timestamp, did) => { 99 110 if !self.is_expired(*timestamp) { 100 111 tracing::debug!("Cache hit for handle {}: {}", handle, did); 101 - return Ok(did.clone()); 112 + self.metrics.incr("resolver.memory.cache_hit").await; 113 + return Ok((did.clone(), *timestamp)); 102 114 } 103 115 tracing::debug!("Cache entry expired for handle {}", handle); 116 + self.metrics.incr("resolver.memory.cache_expired").await; 104 117 } 105 118 ResolveHandleResult::NotFound(timestamp, error) => { 106 119 if !self.is_expired(*timestamp) { ··· 109 122 handle, 110 123 error 111 124 ); 125 + self.metrics 126 + .incr("resolver.memory.cache_hit_not_resolved") 127 + .await; 112 128 return Err(HandleResolverError::HandleNotFoundCached(error.clone())); 113 129 } 114 130 tracing::debug!("Cache entry expired for handle {}", handle); 131 + self.metrics.incr("resolver.memory.cache_expired").await; 115 132 } 116 133 } 117 134 } ··· 119 136 120 137 // Not in cache or expired, resolve through inner resolver 121 138 tracing::debug!("Cache miss for handle {}, resolving...", handle); 139 + self.metrics.incr("resolver.memory.cache_miss").await; 122 140 let result = self.inner.resolve(s).await; 123 - let timestamp = Self::current_timestamp(); 124 141 125 142 // Store in cache 126 143 { 127 144 let mut cache = self.cache.write().await; 128 145 match &result { 129 - Ok(did) => { 146 + Ok((did, timestamp)) => { 130 147 cache.insert( 131 148 handle.clone(), 132 - ResolveHandleResult::Found(timestamp, did.clone()), 149 + ResolveHandleResult::Found(*timestamp, did.clone()), 133 150 ); 151 + self.metrics.incr("resolver.memory.cache_set").await; 134 152 tracing::debug!( 135 153 "Cached successful resolution for handle {}: {}", 136 154 handle, ··· 138 156 ); 139 157 } 140 158 Err(e) => { 159 + let timestamp = Self::current_timestamp(); 141 160 cache.insert( 142 161 handle.clone(), 143 162 ResolveHandleResult::NotFound(timestamp, e.to_string()), 144 163 ); 164 + self.metrics.incr("resolver.memory.cache_set_error").await; 145 165 tracing::debug!("Cached failed resolution for handle {}: {}", handle, e); 146 166 } 147 167 } 168 + 169 + // Track cache size 170 + let cache_size = cache.len() as u64; 171 + self.metrics 172 + .gauge("resolver.memory.cache_entries", cache_size) 173 + .await; 148 174 } 149 175 150 176 result 151 177 } 178 + 179 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 180 + // Normalize the handle to lowercase 181 + let handle = handle.to_lowercase(); 182 + 183 + // Update the in-memory cache 184 + { 185 + let mut cache = self.cache.write().await; 186 + let timestamp = Self::current_timestamp(); 187 + cache.insert( 188 + handle.clone(), 189 + ResolveHandleResult::Found(timestamp, did.to_string()), 190 + ); 191 + self.metrics.incr("resolver.memory.set").await; 192 + tracing::debug!("Set handle {} -> DID {} in memory cache", handle, did); 193 + 194 + // Track cache size 195 + let cache_size = cache.len() as u64; 196 + self.metrics 197 + .gauge("resolver.memory.cache_entries", cache_size) 198 + .await; 199 + } 200 + 201 + // Chain to inner resolver 202 + self.inner.set(&handle, did).await 203 + } 152 204 } 153 205 154 206 /// Create a new in-memory caching handle resolver. ··· 160 212 /// 161 213 /// * `inner` - The underlying resolver to use for actual resolution 162 214 /// * `ttl_seconds` - How long to cache results in seconds 215 + /// * `metrics` - Metrics publisher for telemetry 163 216 /// 164 217 /// # Example 165 218 /// 166 219 /// ```no_run 167 220 /// use std::sync::Arc; 168 221 /// use quickdid::handle_resolver::{create_base_resolver, create_caching_resolver, HandleResolver}; 222 + /// use quickdid::metrics::NoOpMetricsPublisher; 169 223 /// 170 224 /// # async fn example() { 171 225 /// # use atproto_identity::resolve::HickoryDnsResolver; 172 226 /// # use reqwest::Client; 173 227 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 174 228 /// # let http_client = Client::new(); 229 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 175 230 /// let base = create_base_resolver( 176 231 /// dns_resolver, 177 232 /// http_client, 233 + /// metrics.clone(), 178 234 /// ); 179 235 /// 180 - /// let resolver = create_caching_resolver(base, 300); // 5 minute TTL 236 + /// let resolver = create_caching_resolver(base, 300, metrics); // 5 minute TTL 181 237 /// let did = resolver.resolve("alice.bsky.social").await.unwrap(); 182 238 /// # } 183 239 /// ``` 184 240 pub fn create_caching_resolver( 185 241 inner: Arc<dyn HandleResolver>, 186 242 ttl_seconds: u64, 243 + metrics: SharedMetricsPublisher, 187 244 ) -> Arc<dyn HandleResolver> { 188 - Arc::new(CachingHandleResolver::new(inner, ttl_seconds)) 245 + Arc::new(CachingHandleResolver::new(inner, ttl_seconds, metrics)) 189 246 }
+13 -1
src/handle_resolver/mod.rs
··· 9 9 //! implementations: 10 10 //! 11 11 //! - [`BaseHandleResolver`]: Core resolver that performs actual DNS/HTTP lookups 12 + //! - [`RateLimitedHandleResolver`]: Rate limiting wrapper using semaphore-based concurrency control 12 13 //! - [`CachingHandleResolver`]: In-memory caching wrapper with configurable TTL 13 14 //! - [`RedisHandleResolver`]: Redis-backed persistent caching with binary serialization 14 15 //! - [`SqliteHandleResolver`]: SQLite-backed persistent caching for single-instance deployments ··· 18 19 //! ```no_run 19 20 //! use std::sync::Arc; 20 21 //! use quickdid::handle_resolver::{create_base_resolver, create_caching_resolver, HandleResolver}; 22 + //! use quickdid::metrics::NoOpMetricsPublisher; 21 23 //! 22 24 //! # async fn example() -> Result<(), Box<dyn std::error::Error>> { 23 25 //! # use atproto_identity::resolve::HickoryDnsResolver; 24 26 //! # use reqwest::Client; 25 27 //! # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 26 28 //! # let http_client = Client::new(); 29 + //! # let metrics = Arc::new(NoOpMetricsPublisher); 27 30 //! // Create base resolver using factory function 28 31 //! let base = create_base_resolver( 29 32 //! dns_resolver, 30 33 //! http_client, 34 + //! metrics.clone(), 31 35 //! ); 32 36 //! 33 37 //! // Wrap with in-memory caching 34 - //! let resolver = create_caching_resolver(base, 300); 38 + //! let resolver = create_caching_resolver(base, 300, metrics); 35 39 //! 36 40 //! // Resolve a handle 37 41 //! let did = resolver.resolve("alice.bsky.social").await?; ··· 43 47 mod base; 44 48 mod errors; 45 49 mod memory; 50 + mod proactive_refresh; 51 + mod rate_limited; 46 52 mod redis; 47 53 mod sqlite; 48 54 mod traits; ··· 54 60 // Factory functions for creating resolvers 55 61 pub use base::create_base_resolver; 56 62 pub use memory::create_caching_resolver; 63 + pub use proactive_refresh::{ 64 + ProactiveRefreshResolver, create_proactive_refresh_resolver, 65 + create_proactive_refresh_resolver_dyn, create_proactive_refresh_resolver_with_metrics, 66 + create_proactive_refresh_resolver_with_threshold, 67 + }; 68 + pub use rate_limited::{create_rate_limited_resolver, create_rate_limited_resolver_with_timeout}; 57 69 pub use redis::{create_redis_resolver, create_redis_resolver_with_ttl}; 58 70 pub use sqlite::{create_sqlite_resolver, create_sqlite_resolver_with_ttl};
+438
src/handle_resolver/proactive_refresh.rs
··· 1 + use crate::handle_resolution_result::HandleResolutionResult; 2 + use crate::handle_resolver::{HandleResolver, HandleResolverError}; 3 + use crate::metrics::MetricsPublisher; 4 + use crate::queue::{HandleResolutionWork, QueueAdapter}; 5 + use async_trait::async_trait; 6 + use std::sync::Arc; 7 + use std::time::{SystemTime, UNIX_EPOCH}; 8 + use tracing::{debug, trace}; 9 + 10 + /// Create a ProactiveRefreshResolver with default 80% threshold 11 + /// 12 + /// # Arguments 13 + /// * `inner` - The inner resolver to wrap 14 + /// * `queue` - The queue adapter for background refresh tasks 15 + /// * `cache_ttl` - The TTL in seconds for cache entries 16 + pub fn create_proactive_refresh_resolver<R, Q>( 17 + inner: Arc<R>, 18 + queue: Arc<Q>, 19 + cache_ttl: u64, 20 + ) -> Arc<ProactiveRefreshResolver<R, Q>> 21 + where 22 + R: HandleResolver + Send + Sync + 'static, 23 + Q: QueueAdapter<HandleResolutionWork> + Send + Sync + 'static, 24 + { 25 + Arc::new(ProactiveRefreshResolver::new(inner, queue, cache_ttl)) 26 + } 27 + 28 + /// Create a ProactiveRefreshResolver with custom threshold 29 + /// 30 + /// # Arguments 31 + /// * `inner` - The inner resolver to wrap 32 + /// * `queue` - The queue adapter for background refresh tasks 33 + /// * `cache_ttl` - The TTL in seconds for cache entries 34 + /// * `threshold` - The threshold as a percentage (0.0 to 1.0) of TTL when to trigger refresh 35 + pub fn create_proactive_refresh_resolver_with_threshold<R, Q>( 36 + inner: Arc<R>, 37 + queue: Arc<Q>, 38 + cache_ttl: u64, 39 + threshold: f64, 40 + ) -> Arc<ProactiveRefreshResolver<R, Q>> 41 + where 42 + R: HandleResolver + Send + Sync + 'static, 43 + Q: QueueAdapter<HandleResolutionWork> + Send + Sync + 'static, 44 + { 45 + Arc::new(ProactiveRefreshResolver::with_threshold( 46 + inner, queue, cache_ttl, threshold, 47 + )) 48 + } 49 + 50 + /// Wrapper struct for dynamic dispatch with proactive refresh 51 + /// This works with trait objects instead of concrete types 52 + pub struct DynProactiveRefreshResolver { 53 + inner: Arc<dyn HandleResolver>, 54 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 55 + metrics: Option<Arc<dyn MetricsPublisher>>, 56 + #[allow(dead_code)] 57 + cache_ttl: u64, 58 + #[allow(dead_code)] 59 + refresh_threshold: f64, 60 + } 61 + 62 + impl DynProactiveRefreshResolver { 63 + pub fn new( 64 + inner: Arc<dyn HandleResolver>, 65 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 66 + cache_ttl: u64, 67 + refresh_threshold: f64, 68 + ) -> Self { 69 + Self::with_metrics(inner, queue, None, cache_ttl, refresh_threshold) 70 + } 71 + 72 + pub fn with_metrics( 73 + inner: Arc<dyn HandleResolver>, 74 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 75 + metrics: Option<Arc<dyn MetricsPublisher>>, 76 + cache_ttl: u64, 77 + refresh_threshold: f64, 78 + ) -> Self { 79 + Self { 80 + inner, 81 + queue, 82 + metrics, 83 + cache_ttl, 84 + refresh_threshold: refresh_threshold.clamp(0.0, 1.0), 85 + } 86 + } 87 + 88 + async fn maybe_queue_for_refresh(&self, handle: &str, resolve_time: u64) { 89 + // If resolution took less than 5ms, it was probably a cache hit 90 + if resolve_time < 5000 { 91 + trace!( 92 + handle = handle, 93 + resolve_time_us = resolve_time, 94 + "Fast resolution detected, considering proactive refresh" 95 + ); 96 + 97 + if let Some(metrics) = &self.metrics { 98 + metrics.incr("proactive_refresh.cache_hit_detected").await; 99 + } 100 + 101 + // Simple heuristic: queue for refresh with some probability 102 + let now = SystemTime::now() 103 + .duration_since(UNIX_EPOCH) 104 + .unwrap_or_default() 105 + .as_secs(); 106 + 107 + // Queue every N seconds for frequently accessed handles 108 + if now % 60 == 0 { 109 + let work = HandleResolutionWork { 110 + handle: handle.to_string(), 111 + }; 112 + 113 + if let Err(e) = self.queue.push(work).await { 114 + debug!( 115 + handle = handle, 116 + error = %e, 117 + "Failed to queue handle for proactive refresh" 118 + ); 119 + if let Some(metrics) = &self.metrics { 120 + metrics.incr("proactive_refresh.queue_error").await; 121 + } 122 + } else { 123 + debug!(handle = handle, "Queued handle for proactive refresh"); 124 + if let Some(metrics) = &self.metrics { 125 + metrics.incr("proactive_refresh.queued").await; 126 + } 127 + } 128 + } 129 + } 130 + } 131 + } 132 + 133 + #[async_trait] 134 + impl HandleResolver for DynProactiveRefreshResolver { 135 + async fn resolve(&self, handle: &str) -> Result<(String, u64), HandleResolverError> { 136 + // Resolve through the inner resolver 137 + let (did, resolve_time) = self.inner.resolve(handle).await?; 138 + 139 + // Check if we should queue for refresh based on resolution time 140 + self.maybe_queue_for_refresh(handle, resolve_time).await; 141 + 142 + Ok((did, resolve_time)) 143 + } 144 + 145 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 146 + // Simply chain to inner resolver - no proactive refresh needed for manual sets 147 + self.inner.set(handle, did).await 148 + } 149 + } 150 + 151 + /// Create a ProactiveRefreshResolver with custom threshold using trait objects 152 + /// This version works with dyn HandleResolver and dyn QueueAdapter 153 + /// 154 + /// # Arguments 155 + /// * `inner` - The inner resolver to wrap 156 + /// * `queue` - The queue adapter for background refresh tasks 157 + /// * `cache_ttl` - The TTL in seconds for cache entries 158 + /// * `threshold` - The threshold as a percentage (0.0 to 1.0) of TTL when to trigger refresh 159 + pub fn create_proactive_refresh_resolver_dyn( 160 + inner: Arc<dyn HandleResolver>, 161 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 162 + cache_ttl: u64, 163 + threshold: f64, 164 + ) -> Arc<dyn HandleResolver> { 165 + Arc::new(DynProactiveRefreshResolver::new( 166 + inner, queue, cache_ttl, threshold, 167 + )) 168 + } 169 + 170 + /// Create a ProactiveRefreshResolver with metrics support 171 + pub fn create_proactive_refresh_resolver_with_metrics( 172 + inner: Arc<dyn HandleResolver>, 173 + queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 174 + metrics: Arc<dyn MetricsPublisher>, 175 + cache_ttl: u64, 176 + threshold: f64, 177 + ) -> Arc<dyn HandleResolver> { 178 + Arc::new(DynProactiveRefreshResolver::with_metrics( 179 + inner, 180 + queue, 181 + Some(metrics), 182 + cache_ttl, 183 + threshold, 184 + )) 185 + } 186 + 187 + /// A handle resolver that proactively refreshes cache entries when they reach 188 + /// a certain staleness threshold (default 80% of TTL). 189 + /// 190 + /// This resolver wraps another resolver and checks successful resolutions from cache. 191 + /// When a cached entry has lived for more than the threshold percentage of its TTL, 192 + /// it queues the handle for background refresh to keep the cache warm. 193 + /// 194 + /// Note: Due to the current trait design, this implementation uses the resolution time 195 + /// as a heuristic. When resolve_time is 0 (instant cache hit), it may queue for refresh. 196 + /// For full functionality, the trait would need to expose cache timestamps. 197 + pub struct ProactiveRefreshResolver<R: HandleResolver, Q: QueueAdapter<HandleResolutionWork>> { 198 + inner: Arc<R>, 199 + queue: Arc<Q>, 200 + /// TTL in seconds for cache entries 201 + cache_ttl: u64, 202 + /// Threshold as a percentage (0.0 to 1.0) of TTL when to trigger refresh 203 + /// Default is 0.8 (80%) 204 + refresh_threshold: f64, 205 + } 206 + 207 + impl<R: HandleResolver, Q: QueueAdapter<HandleResolutionWork>> ProactiveRefreshResolver<R, Q> { 208 + pub fn new(inner: Arc<R>, queue: Arc<Q>, cache_ttl: u64) -> Self { 209 + Self::with_threshold(inner, queue, cache_ttl, 0.8) 210 + } 211 + 212 + pub fn with_threshold( 213 + inner: Arc<R>, 214 + queue: Arc<Q>, 215 + cache_ttl: u64, 216 + refresh_threshold: f64, 217 + ) -> Self { 218 + Self { 219 + inner, 220 + queue, 221 + cache_ttl, 222 + refresh_threshold: refresh_threshold.clamp(0.0, 1.0), 223 + } 224 + } 225 + 226 + /// Check if a cached entry needs proactive refresh based on its age 227 + #[allow(dead_code)] 228 + fn needs_refresh(&self, result: &HandleResolutionResult) -> bool { 229 + let now = SystemTime::now() 230 + .duration_since(UNIX_EPOCH) 231 + .unwrap_or_default() 232 + .as_secs(); 233 + 234 + let age = now.saturating_sub(result.timestamp); 235 + let threshold = (self.cache_ttl as f64 * self.refresh_threshold) as u64; 236 + 237 + let needs_refresh = age >= threshold; 238 + 239 + if needs_refresh { 240 + debug!( 241 + handle = ?result.to_did(), 242 + age_seconds = age, 243 + threshold_seconds = threshold, 244 + cache_ttl = self.cache_ttl, 245 + "Cache entry needs proactive refresh" 246 + ); 247 + } else { 248 + trace!( 249 + handle = ?result.to_did(), 250 + age_seconds = age, 251 + threshold_seconds = threshold, 252 + "Cache entry still fresh" 253 + ); 254 + } 255 + 256 + needs_refresh 257 + } 258 + 259 + /// Queue a handle for background refresh 260 + async fn queue_for_refresh(&self, handle: &str) { 261 + let work = HandleResolutionWork { 262 + handle: handle.to_string(), 263 + }; 264 + 265 + match self.queue.push(work).await { 266 + Ok(_) => { 267 + debug!(handle = handle, "Queued handle for proactive refresh"); 268 + } 269 + Err(e) => { 270 + // Don't fail the request if we can't queue for refresh 271 + debug!( 272 + handle = handle, 273 + error = %e, 274 + "Failed to queue handle for proactive refresh" 275 + ); 276 + } 277 + } 278 + } 279 + 280 + /// Check if we should queue for refresh based on resolution time 281 + /// 282 + /// This is a heuristic approach: 283 + /// - If resolve_time is very low (< 5ms), it was likely a cache hit 284 + /// - We probabilistically queue for refresh based on time since service start 285 + /// 286 + /// For proper implementation, the HandleResolver trait would need to expose 287 + /// cache metadata or return HandleResolutionResult directly. 288 + async fn maybe_queue_for_refresh(&self, handle: &str, resolve_time: u64) { 289 + // If resolution took less than 5ms, it was probably a cache hit 290 + if resolve_time < 5000 { 291 + // Use a simple probabilistic approach for demonstration 292 + // In production, you'd want access to the actual cache timestamp 293 + trace!( 294 + handle = handle, 295 + resolve_time_us = resolve_time, 296 + "Fast resolution detected, considering proactive refresh" 297 + ); 298 + 299 + // Queue for refresh with some probability to avoid overwhelming the queue 300 + // This is a simplified approach - ideally we'd have access to cache metadata 301 + let now = SystemTime::now() 302 + .duration_since(UNIX_EPOCH) 303 + .unwrap_or_default() 304 + .as_secs(); 305 + 306 + // Simple heuristic: queue every N seconds for frequently accessed handles 307 + if now % 60 == 0 { 308 + self.queue_for_refresh(handle).await; 309 + } 310 + } 311 + } 312 + } 313 + 314 + #[async_trait] 315 + impl<R, Q> HandleResolver for ProactiveRefreshResolver<R, Q> 316 + where 317 + R: HandleResolver + Send + Sync, 318 + Q: QueueAdapter<HandleResolutionWork> + Send + Sync, 319 + { 320 + async fn resolve(&self, handle: &str) -> Result<(String, u64), HandleResolverError> { 321 + // Resolve through the inner resolver 322 + let (did, resolve_time) = self.inner.resolve(handle).await?; 323 + 324 + // Check if we should queue for refresh based on resolution time 325 + self.maybe_queue_for_refresh(handle, resolve_time).await; 326 + 327 + Ok((did, resolve_time)) 328 + } 329 + } 330 + 331 + #[cfg(test)] 332 + mod tests { 333 + use super::*; 334 + use crate::handle_resolution_result::DidMethodType; 335 + 336 + #[test] 337 + fn test_needs_refresh_calculation() { 338 + // Create a resolver with 100 second TTL and 80% threshold 339 + let inner = Arc::new(MockResolver); 340 + let queue = Arc::new(MockQueueAdapter); 341 + let resolver = ProactiveRefreshResolver::new(inner, queue, 100); 342 + 343 + let now = SystemTime::now() 344 + .duration_since(UNIX_EPOCH) 345 + .unwrap() 346 + .as_secs(); 347 + 348 + // Test entry that's 50% through TTL (should not refresh) 349 + let fresh_result = HandleResolutionResult { 350 + timestamp: now - 50, 351 + method_type: DidMethodType::Plc, 352 + payload: "alice123".to_string(), 353 + }; 354 + assert!(!resolver.needs_refresh(&fresh_result)); 355 + 356 + // Test entry that's 80% through TTL (should refresh) 357 + let stale_result = HandleResolutionResult { 358 + timestamp: now - 80, 359 + method_type: DidMethodType::Plc, 360 + payload: "alice123".to_string(), 361 + }; 362 + assert!(resolver.needs_refresh(&stale_result)); 363 + 364 + // Test entry that's 90% through TTL (should definitely refresh) 365 + let very_stale_result = HandleResolutionResult { 366 + timestamp: now - 90, 367 + method_type: DidMethodType::Plc, 368 + payload: "alice123".to_string(), 369 + }; 370 + assert!(resolver.needs_refresh(&very_stale_result)); 371 + } 372 + 373 + #[test] 374 + fn test_custom_threshold() { 375 + let inner = Arc::new(MockResolver); 376 + let queue = Arc::new(MockQueueAdapter); 377 + 378 + // Create resolver with 50% threshold 379 + let resolver = ProactiveRefreshResolver::with_threshold(inner, queue, 100, 0.5); 380 + 381 + let now = SystemTime::now() 382 + .duration_since(UNIX_EPOCH) 383 + .unwrap() 384 + .as_secs(); 385 + 386 + // Test entry that's 40% through TTL (should not refresh with 50% threshold) 387 + let result_40 = HandleResolutionResult { 388 + timestamp: now - 40, 389 + method_type: DidMethodType::Plc, 390 + payload: "alice123".to_string(), 391 + }; 392 + assert!(!resolver.needs_refresh(&result_40)); 393 + 394 + // Test entry that's 60% through TTL (should refresh with 50% threshold) 395 + let result_60 = HandleResolutionResult { 396 + timestamp: now - 60, 397 + method_type: DidMethodType::Plc, 398 + payload: "alice123".to_string(), 399 + }; 400 + assert!(resolver.needs_refresh(&result_60)); 401 + } 402 + 403 + // Mock resolver for testing 404 + struct MockResolver; 405 + 406 + #[async_trait] 407 + impl HandleResolver for MockResolver { 408 + async fn resolve(&self, handle: &str) -> Result<(String, u64), HandleResolverError> { 409 + Ok((format!("did:plc:{}", handle), 1000)) 410 + } 411 + } 412 + 413 + // Mock queue adapter for testing 414 + struct MockQueueAdapter; 415 + 416 + #[async_trait] 417 + impl QueueAdapter<HandleResolutionWork> for MockQueueAdapter { 418 + async fn pull(&self) -> Option<HandleResolutionWork> { 419 + None 420 + } 421 + 422 + async fn push(&self, _work: HandleResolutionWork) -> crate::queue::Result<()> { 423 + Ok(()) 424 + } 425 + 426 + async fn ack(&self, _item: &HandleResolutionWork) -> crate::queue::Result<()> { 427 + Ok(()) 428 + } 429 + 430 + async fn try_push(&self, _work: HandleResolutionWork) -> crate::queue::Result<()> { 431 + Ok(()) 432 + } 433 + 434 + async fn is_healthy(&self) -> bool { 435 + true 436 + } 437 + } 438 + }
+294
src/handle_resolver/rate_limited.rs
··· 1 + //! Rate-limited handle resolver implementation. 2 + //! 3 + //! This module provides a handle resolver wrapper that limits concurrent 4 + //! resolution requests using a semaphore to implement basic rate limiting. 5 + 6 + use super::errors::HandleResolverError; 7 + use super::traits::HandleResolver; 8 + use crate::metrics::SharedMetricsPublisher; 9 + use async_trait::async_trait; 10 + use std::sync::Arc; 11 + use std::time::Duration; 12 + use tokio::sync::Semaphore; 13 + use tokio::time::timeout; 14 + 15 + /// Rate-limited handle resolver that constrains concurrent resolutions. 16 + /// 17 + /// This resolver wraps an inner resolver and uses a semaphore to limit 18 + /// the number of concurrent resolution requests. This provides basic 19 + /// rate limiting and protects upstream services from being overwhelmed. 20 + /// 21 + /// # Architecture 22 + /// 23 + /// The rate limiter should be placed between the base resolver and any 24 + /// caching layers: 25 + /// ```text 26 + /// Request -> Cache -> RateLimited -> Base -> DNS/HTTP 27 + /// ``` 28 + /// 29 + /// # Example 30 + /// 31 + /// ```no_run 32 + /// use std::sync::Arc; 33 + /// use quickdid::handle_resolver::{ 34 + /// create_base_resolver, 35 + /// create_rate_limited_resolver, 36 + /// HandleResolver, 37 + /// }; 38 + /// use quickdid::metrics::NoOpMetricsPublisher; 39 + /// 40 + /// # async fn example() { 41 + /// # use atproto_identity::resolve::HickoryDnsResolver; 42 + /// # use reqwest::Client; 43 + /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 44 + /// # let http_client = Client::new(); 45 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 46 + /// // Create base resolver 47 + /// let base = create_base_resolver(dns_resolver, http_client, metrics.clone()); 48 + /// 49 + /// // Wrap with rate limiting (max 10 concurrent resolutions) 50 + /// let rate_limited = create_rate_limited_resolver(base, 10, metrics); 51 + /// 52 + /// // Use the rate-limited resolver 53 + /// let (did, timestamp) = rate_limited.resolve("alice.bsky.social").await.unwrap(); 54 + /// # } 55 + /// ``` 56 + pub(super) struct RateLimitedHandleResolver { 57 + /// Inner resolver that performs actual resolution. 58 + inner: Arc<dyn HandleResolver>, 59 + 60 + /// Semaphore for limiting concurrent resolutions. 61 + semaphore: Arc<Semaphore>, 62 + 63 + /// Optional timeout for acquiring permits (in milliseconds). 64 + /// When None or 0, no timeout is applied. 65 + timeout_ms: Option<u64>, 66 + 67 + /// Metrics publisher for telemetry. 68 + metrics: SharedMetricsPublisher, 69 + } 70 + 71 + impl RateLimitedHandleResolver { 72 + /// Create a new rate-limited resolver. 73 + /// 74 + /// # Arguments 75 + /// 76 + /// * `inner` - The inner resolver to wrap 77 + /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 78 + /// * `metrics` - Metrics publisher for telemetry 79 + pub fn new( 80 + inner: Arc<dyn HandleResolver>, 81 + max_concurrent: usize, 82 + metrics: SharedMetricsPublisher, 83 + ) -> Self { 84 + Self { 85 + inner, 86 + semaphore: Arc::new(Semaphore::new(max_concurrent)), 87 + timeout_ms: None, 88 + metrics, 89 + } 90 + } 91 + 92 + /// Create a new rate-limited resolver with timeout. 93 + /// 94 + /// # Arguments 95 + /// 96 + /// * `inner` - The inner resolver to wrap 97 + /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 98 + /// * `timeout_ms` - Timeout in milliseconds for acquiring permits (0 = no timeout) 99 + /// * `metrics` - Metrics publisher for telemetry 100 + pub fn new_with_timeout( 101 + inner: Arc<dyn HandleResolver>, 102 + max_concurrent: usize, 103 + timeout_ms: u64, 104 + metrics: SharedMetricsPublisher, 105 + ) -> Self { 106 + Self { 107 + inner, 108 + semaphore: Arc::new(Semaphore::new(max_concurrent)), 109 + timeout_ms: if timeout_ms > 0 { 110 + Some(timeout_ms) 111 + } else { 112 + None 113 + }, 114 + metrics, 115 + } 116 + } 117 + } 118 + 119 + #[async_trait] 120 + impl HandleResolver for RateLimitedHandleResolver { 121 + async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 122 + let permit_start = std::time::Instant::now(); 123 + 124 + // Track rate limiter queue depth 125 + let available_permits = self.semaphore.available_permits(); 126 + self.metrics 127 + .gauge( 128 + "resolver.rate_limit.available_permits", 129 + available_permits as u64, 130 + ) 131 + .await; 132 + 133 + // Acquire a permit from the semaphore, with optional timeout 134 + let _permit = match self.timeout_ms { 135 + Some(timeout_ms) if timeout_ms > 0 => { 136 + // Apply timeout when acquiring permit 137 + let duration = Duration::from_millis(timeout_ms); 138 + match timeout(duration, self.semaphore.acquire()).await { 139 + Ok(Ok(permit)) => { 140 + let wait_ms = permit_start.elapsed().as_millis() as u64; 141 + self.metrics 142 + .time("resolver.rate_limit.permit_acquired", wait_ms) 143 + .await; 144 + permit 145 + } 146 + Ok(Err(e)) => { 147 + // Semaphore error (e.g., closed) 148 + self.metrics.incr("resolver.rate_limit.permit_error").await; 149 + return Err(HandleResolverError::ResolutionFailed(format!( 150 + "Failed to acquire rate limit permit: {}", 151 + e 152 + ))); 153 + } 154 + Err(_) => { 155 + // Timeout occurred 156 + self.metrics 157 + .incr("resolver.rate_limit.permit_timeout") 158 + .await; 159 + return Err(HandleResolverError::ResolutionFailed(format!( 160 + "Rate limit permit acquisition timed out after {}ms", 161 + timeout_ms 162 + ))); 163 + } 164 + } 165 + } 166 + _ => { 167 + // No timeout configured, wait indefinitely 168 + match self.semaphore.acquire().await { 169 + Ok(permit) => { 170 + let wait_ms = permit_start.elapsed().as_millis() as u64; 171 + self.metrics 172 + .time("resolver.rate_limit.permit_acquired", wait_ms) 173 + .await; 174 + permit 175 + } 176 + Err(e) => { 177 + self.metrics.incr("resolver.rate_limit.permit_error").await; 178 + return Err(HandleResolverError::ResolutionFailed(format!( 179 + "Failed to acquire rate limit permit: {}", 180 + e 181 + ))); 182 + } 183 + } 184 + } 185 + }; 186 + 187 + // With permit acquired, forward to inner resolver 188 + self.inner.resolve(s).await 189 + } 190 + 191 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 192 + // Set operations don't need rate limiting since they're typically administrative 193 + // and don't involve network calls to external services 194 + self.inner.set(handle, did).await 195 + } 196 + } 197 + 198 + /// Create a rate-limited handle resolver. 199 + /// 200 + /// This factory function creates a new [`RateLimitedHandleResolver`] that wraps 201 + /// the provided inner resolver with concurrency limiting. 202 + /// 203 + /// # Arguments 204 + /// 205 + /// * `inner` - The resolver to wrap with rate limiting 206 + /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 207 + /// * `metrics` - Metrics publisher for telemetry 208 + /// 209 + /// # Returns 210 + /// 211 + /// An `Arc<dyn HandleResolver>` that can be used wherever a handle resolver is needed. 212 + /// 213 + /// # Example 214 + /// 215 + /// ```no_run 216 + /// use std::sync::Arc; 217 + /// use quickdid::handle_resolver::{ 218 + /// create_base_resolver, 219 + /// create_rate_limited_resolver, 220 + /// }; 221 + /// 222 + /// # async fn example() { 223 + /// # use atproto_identity::resolve::HickoryDnsResolver; 224 + /// # use reqwest::Client; 225 + /// # use quickdid::metrics::NoOpMetricsPublisher; 226 + /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 227 + /// # let http_client = Client::new(); 228 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 229 + /// let base = create_base_resolver(dns_resolver, http_client, metrics.clone()); 230 + /// let rate_limited = create_rate_limited_resolver(base, 10, metrics); 231 + /// # } 232 + /// ``` 233 + pub fn create_rate_limited_resolver( 234 + inner: Arc<dyn HandleResolver>, 235 + max_concurrent: usize, 236 + metrics: SharedMetricsPublisher, 237 + ) -> Arc<dyn HandleResolver> { 238 + Arc::new(RateLimitedHandleResolver::new( 239 + inner, 240 + max_concurrent, 241 + metrics, 242 + )) 243 + } 244 + 245 + /// Create a rate-limited handle resolver with timeout. 246 + /// 247 + /// This factory function creates a new [`RateLimitedHandleResolver`] that wraps 248 + /// the provided inner resolver with concurrency limiting and timeout for permit acquisition. 249 + /// 250 + /// # Arguments 251 + /// 252 + /// * `inner` - The resolver to wrap with rate limiting 253 + /// * `max_concurrent` - Maximum number of concurrent resolutions allowed 254 + /// * `timeout_ms` - Timeout in milliseconds for acquiring permits (0 = no timeout) 255 + /// * `metrics` - Metrics publisher for telemetry 256 + /// 257 + /// # Returns 258 + /// 259 + /// An `Arc<dyn HandleResolver>` that can be used wherever a handle resolver is needed. 260 + /// 261 + /// # Example 262 + /// 263 + /// ```no_run 264 + /// use std::sync::Arc; 265 + /// use quickdid::handle_resolver::{ 266 + /// create_base_resolver, 267 + /// create_rate_limited_resolver_with_timeout, 268 + /// }; 269 + /// 270 + /// # async fn example() { 271 + /// # use atproto_identity::resolve::HickoryDnsResolver; 272 + /// # use reqwest::Client; 273 + /// # use quickdid::metrics::NoOpMetricsPublisher; 274 + /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 275 + /// # let http_client = Client::new(); 276 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 277 + /// let base = create_base_resolver(dns_resolver, http_client, metrics.clone()); 278 + /// // Rate limit with 10 concurrent resolutions and 5 second timeout 279 + /// let rate_limited = create_rate_limited_resolver_with_timeout(base, 10, 5000, metrics); 280 + /// # } 281 + /// ``` 282 + pub fn create_rate_limited_resolver_with_timeout( 283 + inner: Arc<dyn HandleResolver>, 284 + max_concurrent: usize, 285 + timeout_ms: u64, 286 + metrics: SharedMetricsPublisher, 287 + ) -> Arc<dyn HandleResolver> { 288 + Arc::new(RateLimitedHandleResolver::new_with_timeout( 289 + inner, 290 + max_concurrent, 291 + timeout_ms, 292 + metrics, 293 + )) 294 + }
+580 -19
src/handle_resolver/redis.rs
··· 7 7 use super::errors::HandleResolverError; 8 8 use super::traits::HandleResolver; 9 9 use crate::handle_resolution_result::HandleResolutionResult; 10 + use crate::metrics::SharedMetricsPublisher; 10 11 use async_trait::async_trait; 12 + use atproto_identity::resolve::{InputType, parse_input}; 11 13 use deadpool_redis::{Pool as RedisPool, redis::AsyncCommands}; 12 14 use metrohash::MetroHash64; 13 15 use std::hash::Hasher as _; ··· 33 35 /// use std::sync::Arc; 34 36 /// use deadpool_redis::Pool; 35 37 /// use quickdid::handle_resolver::{create_base_resolver, create_redis_resolver, HandleResolver}; 38 + /// use quickdid::metrics::NoOpMetricsPublisher; 36 39 /// 37 40 /// # async fn example() { 38 41 /// # use atproto_identity::resolve::HickoryDnsResolver; 39 42 /// # use reqwest::Client; 40 43 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 41 44 /// # let http_client = Client::new(); 42 - /// # let base_resolver = create_base_resolver(dns_resolver, http_client); 45 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 46 + /// # let base_resolver = create_base_resolver(dns_resolver, http_client, metrics.clone()); 43 47 /// # let redis_pool: Pool = todo!(); 44 48 /// // Create with default 90-day TTL 45 49 /// let resolver = create_redis_resolver( 46 50 /// base_resolver, 47 - /// redis_pool 51 + /// redis_pool, 52 + /// metrics 48 53 /// ); 49 54 /// # } 50 55 /// ``` ··· 57 62 key_prefix: String, 58 63 /// TTL for cache entries in seconds 59 64 ttl_seconds: u64, 65 + /// Metrics publisher for telemetry 66 + metrics: SharedMetricsPublisher, 60 67 } 61 68 62 69 impl RedisHandleResolver { 63 70 /// Create a new Redis-backed handle resolver with default 90-day TTL. 64 - fn new(inner: Arc<dyn HandleResolver>, pool: RedisPool) -> Self { 65 - Self::with_ttl(inner, pool, 90 * 24 * 60 * 60) // 90 days default 71 + fn new( 72 + inner: Arc<dyn HandleResolver>, 73 + pool: RedisPool, 74 + metrics: SharedMetricsPublisher, 75 + ) -> Self { 76 + Self::with_ttl(inner, pool, 90 * 24 * 60 * 60, metrics) // 90 days default 66 77 } 67 78 68 79 /// Create a new Redis-backed handle resolver with custom TTL. 69 - fn with_ttl(inner: Arc<dyn HandleResolver>, pool: RedisPool, ttl_seconds: u64) -> Self { 70 - Self::with_full_config(inner, pool, "handle:".to_string(), ttl_seconds) 80 + fn with_ttl( 81 + inner: Arc<dyn HandleResolver>, 82 + pool: RedisPool, 83 + ttl_seconds: u64, 84 + metrics: SharedMetricsPublisher, 85 + ) -> Self { 86 + Self::with_full_config(inner, pool, "handle:".to_string(), ttl_seconds, metrics) 71 87 } 72 88 73 89 /// Create a new Redis-backed handle resolver with full configuration. ··· 76 92 pool: RedisPool, 77 93 key_prefix: String, 78 94 ttl_seconds: u64, 95 + metrics: SharedMetricsPublisher, 79 96 ) -> Self { 80 97 Self { 81 98 inner, 82 99 pool, 83 100 key_prefix, 84 101 ttl_seconds, 102 + metrics, 85 103 } 86 104 } 87 105 ··· 100 118 fn ttl_seconds(&self) -> u64 { 101 119 self.ttl_seconds 102 120 } 121 + 122 + /// Purge a handle and its associated DID from the cache. 123 + /// 124 + /// This method removes both the handle->DID mapping and the reverse DID->handle mapping. 125 + async fn purge_handle(&self, handle: &str) -> Result<(), HandleResolverError> { 126 + let handle_key = self.make_key(handle); 127 + 128 + match self.pool.get().await { 129 + Ok(mut conn) => { 130 + // First, try to get the cached result to find the associated DID 131 + let cached: Option<Vec<u8>> = match conn.get(&handle_key).await { 132 + Ok(value) => value, 133 + Err(e) => { 134 + tracing::warn!("Failed to get handle from Redis for purging: {}", e); 135 + self.metrics.incr("resolver.redis.purge_get_error").await; 136 + None 137 + } 138 + }; 139 + 140 + // If we found a cached result, extract the DID and delete both keys 141 + if let Some(cached_bytes) = cached { 142 + if let Ok(cached_result) = HandleResolutionResult::from_bytes(&cached_bytes) { 143 + if let Some(did) = cached_result.to_did() { 144 + let did_key = self.make_key(&did); 145 + 146 + // Delete both the handle key and the DID key 147 + let _: Result<(), _> = conn.del(&[&handle_key, &did_key]).await; 148 + 149 + tracing::debug!("Purged handle {} and associated DID {}", handle, did); 150 + self.metrics 151 + .incr("resolver.redis.purge_handle_success") 152 + .await; 153 + } else { 154 + // Just delete the handle key if no DID was resolved 155 + let _: Result<(), _> = conn.del(&handle_key).await; 156 + tracing::debug!("Purged unresolved handle {}", handle); 157 + self.metrics 158 + .incr("resolver.redis.purge_handle_unresolved") 159 + .await; 160 + } 161 + } else { 162 + // If we can't deserialize, just delete the handle key 163 + let _: Result<(), _> = conn.del(&handle_key).await; 164 + tracing::warn!("Purged handle {} with undeserializable data", handle); 165 + self.metrics 166 + .incr("resolver.redis.purge_handle_corrupt") 167 + .await; 168 + } 169 + } else { 170 + tracing::debug!("Handle {} not found in cache for purging", handle); 171 + self.metrics 172 + .incr("resolver.redis.purge_handle_not_found") 173 + .await; 174 + } 175 + 176 + Ok(()) 177 + } 178 + Err(e) => { 179 + tracing::warn!("Failed to get Redis connection for purging: {}", e); 180 + self.metrics 181 + .incr("resolver.redis.purge_connection_error") 182 + .await; 183 + Err(HandleResolverError::ResolutionFailed(format!( 184 + "Redis connection error: {}", 185 + e 186 + ))) 187 + } 188 + } 189 + } 190 + 191 + /// Purge a DID and its associated handle from the cache. 192 + /// 193 + /// This method removes both the DID->handle mapping and the handle->DID mapping. 194 + async fn purge_did(&self, did: &str) -> Result<(), HandleResolverError> { 195 + let did_key = self.make_key(did); 196 + 197 + match self.pool.get().await { 198 + Ok(mut conn) => { 199 + // First, try to get the associated handle from the reverse mapping 200 + let handle_bytes: Option<Vec<u8>> = match conn.get(&did_key).await { 201 + Ok(value) => value, 202 + Err(e) => { 203 + tracing::warn!("Failed to get DID from Redis for purging: {}", e); 204 + self.metrics.incr("resolver.redis.purge_get_error").await; 205 + None 206 + } 207 + }; 208 + 209 + // If we found a handle, delete both keys 210 + if let Some(handle_bytes) = handle_bytes { 211 + if let Ok(handle) = String::from_utf8(handle_bytes) { 212 + let handle_key = self.make_key(&handle); 213 + 214 + // Delete both the DID key and the handle key 215 + let _: Result<(), _> = conn.del(&[&did_key, &handle_key]).await; 216 + 217 + tracing::debug!("Purged DID {} and associated handle {}", did, handle); 218 + self.metrics.incr("resolver.redis.purge_did_success").await; 219 + } else { 220 + // If we can't parse the handle, just delete the DID key 221 + let _: Result<(), _> = conn.del(&did_key).await; 222 + tracing::warn!("Purged DID {} with unparseable handle data", did); 223 + self.metrics.incr("resolver.redis.purge_did_corrupt").await; 224 + } 225 + } else { 226 + tracing::debug!("DID {} not found in cache for purging", did); 227 + self.metrics 228 + .incr("resolver.redis.purge_did_not_found") 229 + .await; 230 + } 231 + 232 + Ok(()) 233 + } 234 + Err(e) => { 235 + tracing::warn!("Failed to get Redis connection for purging: {}", e); 236 + self.metrics 237 + .incr("resolver.redis.purge_connection_error") 238 + .await; 239 + Err(HandleResolverError::ResolutionFailed(format!( 240 + "Redis connection error: {}", 241 + e 242 + ))) 243 + } 244 + } 245 + } 103 246 } 104 247 105 248 #[async_trait] 106 249 impl HandleResolver for RedisHandleResolver { 107 - async fn resolve(&self, s: &str) -> Result<String, HandleResolverError> { 250 + async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 108 251 let handle = s.to_string(); 109 252 let key = self.make_key(&handle); 110 253 ··· 115 258 let cached: Option<Vec<u8>> = match conn.get(&key).await { 116 259 Ok(value) => value, 117 260 Err(e) => { 261 + self.metrics.incr("resolver.redis.get_error").await; 118 262 tracing::warn!("Failed to get handle from Redis cache: {}", e); 119 263 None 120 264 } ··· 126 270 Ok(cached_result) => { 127 271 if let Some(did) = cached_result.to_did() { 128 272 tracing::debug!("Cache hit for handle {}: {}", handle, did); 129 - return Ok(did); 273 + self.metrics.incr("resolver.redis.cache_hit").await; 274 + return Ok((did, cached_result.timestamp)); 130 275 } else { 131 276 tracing::debug!("Cache hit (not resolved) for handle {}", handle); 277 + self.metrics 278 + .incr("resolver.redis.cache_hit_not_resolved") 279 + .await; 132 280 return Err(HandleResolverError::HandleNotFound); 133 281 } 134 282 } ··· 138 286 handle, 139 287 e 140 288 ); 289 + self.metrics.incr("resolver.redis.deserialize_error").await; 141 290 // Fall through to re-resolve if deserialization fails 142 291 } 143 292 } ··· 145 294 146 295 // Not in cache, resolve through inner resolver 147 296 tracing::debug!("Cache miss for handle {}, resolving...", handle); 297 + self.metrics.incr("resolver.redis.cache_miss").await; 148 298 let result = self.inner.resolve(s).await; 149 299 150 300 // Create and serialize resolution result 151 301 let resolution_result = match &result { 152 - Ok(did) => { 302 + Ok((did, _timestamp)) => { 153 303 tracing::debug!( 154 304 "Caching successful resolution for handle {}: {}", 155 305 handle, ··· 159 309 Ok(res) => res, 160 310 Err(e) => { 161 311 tracing::warn!("Failed to create resolution result: {}", e); 312 + self.metrics 313 + .incr("resolver.redis.result_create_error") 314 + .await; 162 315 return result; 163 316 } 164 317 } ··· 169 322 Ok(res) => res, 170 323 Err(err) => { 171 324 tracing::warn!("Failed to create not_resolved result: {}", err); 325 + self.metrics 326 + .incr("resolver.redis.result_create_error") 327 + .await; 172 328 return result; 173 329 } 174 330 } ··· 184 340 .await 185 341 { 186 342 tracing::warn!("Failed to cache handle resolution in Redis: {}", e); 343 + self.metrics.incr("resolver.redis.cache_set_error").await; 344 + } else { 345 + self.metrics.incr("resolver.redis.cache_set").await; 346 + 347 + // For successful resolutions, also store reverse DID -> handle mapping 348 + if let Ok((did, _)) = &result { 349 + let did_key = self.make_key(did); 350 + if let Err(e) = conn 351 + .set_ex::<_, _, ()>( 352 + &did_key, 353 + handle.as_bytes(), 354 + self.ttl_seconds(), 355 + ) 356 + .await 357 + { 358 + tracing::warn!( 359 + "Failed to cache reverse DID->handle mapping in Redis: {}", 360 + e 361 + ); 362 + self.metrics 363 + .incr("resolver.redis.reverse_cache_set_error") 364 + .await; 365 + } else { 366 + tracing::debug!( 367 + "Cached reverse mapping for DID {}: {}", 368 + did, 369 + handle 370 + ); 371 + self.metrics.incr("resolver.redis.reverse_cache_set").await; 372 + } 373 + } 187 374 } 188 375 } 189 376 Err(e) => { ··· 192 379 handle, 193 380 e 194 381 ); 382 + self.metrics.incr("resolver.redis.serialize_error").await; 195 383 } 196 384 } 197 385 ··· 203 391 "Failed to get Redis connection, falling back to uncached resolution: {}", 204 392 e 205 393 ); 394 + self.metrics.incr("resolver.redis.connection_error").await; 206 395 self.inner.resolve(s).await 207 396 } 208 397 } 209 398 } 399 + 400 + async fn purge(&self, subject: &str) -> Result<(), HandleResolverError> { 401 + // Use atproto_identity's parse_input to properly identify the input type 402 + let parsed_input = parse_input(subject) 403 + .map_err(|_| HandleResolverError::InvalidSubject(subject.to_string()))?; 404 + match parsed_input { 405 + InputType::Handle(handle) => { 406 + // It's a handle, purge using the lowercase version 407 + self.purge_handle(&handle.to_lowercase()).await 408 + } 409 + InputType::Plc(did) | InputType::Web(did) => { 410 + // It's a DID, purge the DID 411 + self.purge_did(&did).await 412 + } 413 + } 414 + } 415 + 416 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 417 + // Normalize the handle to lowercase 418 + let handle = handle.to_lowercase(); 419 + let handle_key = self.make_key(&handle); 420 + let did_key = self.make_key(did); 421 + 422 + match self.pool.get().await { 423 + Ok(mut conn) => { 424 + // Create a resolution result for the successful mapping 425 + let resolution_result = match HandleResolutionResult::success(did) { 426 + Ok(res) => res, 427 + Err(e) => { 428 + tracing::warn!( 429 + "Failed to create resolution result for set operation: {}", 430 + e 431 + ); 432 + self.metrics 433 + .incr("resolver.redis.set_result_create_error") 434 + .await; 435 + return Err(HandleResolverError::InvalidSubject(format!( 436 + "Failed to create resolution result: {}", 437 + e 438 + ))); 439 + } 440 + }; 441 + 442 + // Serialize to bytes 443 + match resolution_result.to_bytes() { 444 + Ok(bytes) => { 445 + // Set the handle -> DID mapping with expiration 446 + if let Err(e) = conn 447 + .set_ex::<_, _, ()>(&handle_key, bytes, self.ttl_seconds()) 448 + .await 449 + { 450 + tracing::warn!("Failed to set handle->DID mapping in Redis: {}", e); 451 + self.metrics.incr("resolver.redis.set_cache_error").await; 452 + return Err(HandleResolverError::ResolutionFailed(format!( 453 + "Failed to set cache: {}", 454 + e 455 + ))); 456 + } 457 + 458 + // Set the reverse DID -> handle mapping 459 + if let Err(e) = conn 460 + .set_ex::<_, _, ()>(&did_key, handle.as_bytes(), self.ttl_seconds()) 461 + .await 462 + { 463 + tracing::warn!("Failed to set DID->handle mapping in Redis: {}", e); 464 + self.metrics 465 + .incr("resolver.redis.set_reverse_cache_error") 466 + .await; 467 + // Don't fail the operation, but log the warning 468 + } 469 + 470 + tracing::debug!("Set handle {} -> DID {} mapping in cache", handle, did); 471 + self.metrics.incr("resolver.redis.set_success").await; 472 + Ok(()) 473 + } 474 + Err(e) => { 475 + tracing::warn!( 476 + "Failed to serialize resolution result for set operation: {}", 477 + e 478 + ); 479 + self.metrics 480 + .incr("resolver.redis.set_serialize_error") 481 + .await; 482 + Err(HandleResolverError::InvalidSubject(format!( 483 + "Failed to serialize: {}", 484 + e 485 + ))) 486 + } 487 + } 488 + } 489 + Err(e) => { 490 + tracing::warn!("Failed to get Redis connection for set operation: {}", e); 491 + self.metrics 492 + .incr("resolver.redis.set_connection_error") 493 + .await; 494 + Err(HandleResolverError::ResolutionFailed(format!( 495 + "Redis connection error: {}", 496 + e 497 + ))) 498 + } 499 + } 500 + } 210 501 } 211 502 212 503 /// Create a new Redis-backed handle resolver with default 90-day TTL. ··· 215 506 /// 216 507 /// * `inner` - The underlying resolver to use for actual resolution 217 508 /// * `pool` - Redis connection pool 509 + /// * `metrics` - Metrics publisher for telemetry 218 510 /// 219 511 /// # Example 220 512 /// ··· 222 514 /// use std::sync::Arc; 223 515 /// use quickdid::handle_resolver::{create_base_resolver, create_redis_resolver, HandleResolver}; 224 516 /// use quickdid::cache::create_redis_pool; 517 + /// use quickdid::metrics::NoOpMetricsPublisher; 225 518 /// 226 519 /// # async fn example() -> anyhow::Result<()> { 227 520 /// # use atproto_identity::resolve::HickoryDnsResolver; 228 521 /// # use reqwest::Client; 229 522 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 230 523 /// # let http_client = Client::new(); 524 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 231 525 /// let base = create_base_resolver( 232 526 /// dns_resolver, 233 527 /// http_client, 528 + /// metrics.clone(), 234 529 /// ); 235 530 /// 236 531 /// let pool = create_redis_pool("redis://localhost:6379")?; 237 - /// let resolver = create_redis_resolver(base, pool); 238 - /// let did = resolver.resolve("alice.bsky.social").await.unwrap(); 532 + /// let resolver = create_redis_resolver(base, pool, metrics); 533 + /// let (did, timestamp) = resolver.resolve("alice.bsky.social").await.unwrap(); 239 534 /// # Ok(()) 240 535 /// # } 241 536 /// ``` 242 537 pub fn create_redis_resolver( 243 538 inner: Arc<dyn HandleResolver>, 244 539 pool: RedisPool, 540 + metrics: SharedMetricsPublisher, 245 541 ) -> Arc<dyn HandleResolver> { 246 - Arc::new(RedisHandleResolver::new(inner, pool)) 542 + Arc::new(RedisHandleResolver::new(inner, pool, metrics)) 247 543 } 248 544 249 545 /// Create a new Redis-backed handle resolver with custom TTL. ··· 253 549 /// * `inner` - The underlying resolver to use for actual resolution 254 550 /// * `pool` - Redis connection pool 255 551 /// * `ttl_seconds` - TTL for cache entries in seconds 552 + /// * `metrics` - Metrics publisher for telemetry 256 553 pub fn create_redis_resolver_with_ttl( 257 554 inner: Arc<dyn HandleResolver>, 258 555 pool: RedisPool, 259 556 ttl_seconds: u64, 557 + metrics: SharedMetricsPublisher, 260 558 ) -> Arc<dyn HandleResolver> { 261 - Arc::new(RedisHandleResolver::with_ttl(inner, pool, ttl_seconds)) 559 + Arc::new(RedisHandleResolver::with_ttl( 560 + inner, 561 + pool, 562 + ttl_seconds, 563 + metrics, 564 + )) 262 565 } 263 566 264 567 #[cfg(test)] ··· 274 577 275 578 #[async_trait] 276 579 impl HandleResolver for MockHandleResolver { 277 - async fn resolve(&self, _handle: &str) -> Result<String, HandleResolverError> { 580 + async fn resolve(&self, _handle: &str) -> Result<(String, u64), HandleResolverError> { 278 581 if self.should_fail { 279 582 Err(HandleResolverError::MockResolutionFailure) 280 583 } else { 281 - Ok(self.expected_did.clone()) 584 + let timestamp = std::time::SystemTime::now() 585 + .duration_since(std::time::UNIX_EPOCH) 586 + .unwrap_or_default() 587 + .as_secs(); 588 + Ok((self.expected_did.clone(), timestamp)) 282 589 } 283 590 } 284 591 } ··· 296 603 expected_did: "did:plc:testuser123".to_string(), 297 604 }); 298 605 606 + // Create metrics publisher 607 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 608 + 299 609 // Create Redis-backed resolver with a unique key prefix for testing 300 - let test_prefix = format!("test:handle:{}:", std::time::SystemTime::now().duration_since(std::time::UNIX_EPOCH).unwrap().as_nanos()); 610 + let test_prefix = format!( 611 + "test:handle:{}:", 612 + std::time::SystemTime::now() 613 + .duration_since(std::time::UNIX_EPOCH) 614 + .unwrap() 615 + .as_nanos() 616 + ); 301 617 let redis_resolver = RedisHandleResolver::with_full_config( 302 618 mock_resolver, 303 619 pool.clone(), 304 620 test_prefix.clone(), 305 621 3600, 622 + metrics, 306 623 ); 307 624 308 625 let test_handle = "alice.bsky.social"; 309 626 310 627 // First resolution - should call inner resolver 311 - let result1 = redis_resolver.resolve(test_handle).await.unwrap(); 628 + let (result1, _timestamp1) = redis_resolver.resolve(test_handle).await.unwrap(); 312 629 assert_eq!(result1, "did:plc:testuser123"); 313 630 314 631 // Second resolution - should hit cache 315 - let result2 = redis_resolver.resolve(test_handle).await.unwrap(); 632 + let (result2, _timestamp2) = redis_resolver.resolve(test_handle).await.unwrap(); 316 633 assert_eq!(result2, "did:plc:testuser123"); 317 634 318 635 // Clean up test data ··· 326 643 } 327 644 328 645 #[tokio::test] 646 + async fn test_redis_handle_resolver_bidirectional_purge() { 647 + let pool = match crate::test_helpers::get_test_redis_pool() { 648 + Some(p) => p, 649 + None => return, 650 + }; 651 + 652 + // Create mock resolver 653 + let mock_resolver = Arc::new(MockHandleResolver { 654 + should_fail: false, 655 + expected_did: "did:plc:testuser456".to_string(), 656 + }); 657 + 658 + // Create metrics publisher 659 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 660 + 661 + // Create Redis-backed resolver with a unique key prefix for testing 662 + let test_prefix = format!( 663 + "test:handle:{}:", 664 + std::time::SystemTime::now() 665 + .duration_since(std::time::UNIX_EPOCH) 666 + .unwrap() 667 + .as_nanos() 668 + ); 669 + let redis_resolver = RedisHandleResolver::with_full_config( 670 + mock_resolver, 671 + pool.clone(), 672 + test_prefix.clone(), 673 + 3600, 674 + metrics, 675 + ); 676 + 677 + let test_handle = "bob.bsky.social"; 678 + let expected_did = "did:plc:testuser456"; 679 + 680 + // First resolution - should call inner resolver and cache both directions 681 + let (result1, _) = redis_resolver.resolve(test_handle).await.unwrap(); 682 + assert_eq!(result1, expected_did); 683 + 684 + // Verify both keys exist in Redis 685 + if let Ok(mut conn) = pool.get().await { 686 + let mut h = MetroHash64::default(); 687 + h.write(test_handle.as_bytes()); 688 + let handle_key = format!("{}{}", test_prefix, h.finish()); 689 + 690 + let mut h2 = MetroHash64::default(); 691 + h2.write(expected_did.as_bytes()); 692 + let did_key = format!("{}{}", test_prefix, h2.finish()); 693 + 694 + // Check handle -> DID mapping exists 695 + let handle_exists: bool = conn.exists(&handle_key).await.unwrap(); 696 + assert!(handle_exists, "Handle key should exist in cache"); 697 + 698 + // Check DID -> handle mapping exists 699 + let did_exists: bool = conn.exists(&did_key).await.unwrap(); 700 + assert!(did_exists, "DID key should exist in cache"); 701 + 702 + // Test purge by handle using the trait method 703 + redis_resolver.purge(test_handle).await.unwrap(); 704 + 705 + // Verify both keys were deleted 706 + let handle_exists_after: bool = conn.exists(&handle_key).await.unwrap(); 707 + assert!( 708 + !handle_exists_after, 709 + "Handle key should be deleted after purge" 710 + ); 711 + 712 + let did_exists_after: bool = conn.exists(&did_key).await.unwrap(); 713 + assert!(!did_exists_after, "DID key should be deleted after purge"); 714 + } 715 + 716 + // Re-resolve to cache again 717 + let (result2, _) = redis_resolver.resolve(test_handle).await.unwrap(); 718 + assert_eq!(result2, expected_did); 719 + 720 + // Test purge by DID using the trait method 721 + redis_resolver.purge(expected_did).await.unwrap(); 722 + 723 + // Verify both keys were deleted again 724 + if let Ok(mut conn) = pool.get().await { 725 + let mut h = MetroHash64::default(); 726 + h.write(test_handle.as_bytes()); 727 + let handle_key = format!("{}{}", test_prefix, h.finish()); 728 + 729 + let mut h2 = MetroHash64::default(); 730 + h2.write(expected_did.as_bytes()); 731 + let did_key = format!("{}{}", test_prefix, h2.finish()); 732 + 733 + let handle_exists: bool = conn.exists(&handle_key).await.unwrap(); 734 + assert!( 735 + !handle_exists, 736 + "Handle key should be deleted after DID purge" 737 + ); 738 + 739 + let did_exists: bool = conn.exists(&did_key).await.unwrap(); 740 + assert!(!did_exists, "DID key should be deleted after DID purge"); 741 + } 742 + } 743 + 744 + #[tokio::test] 745 + async fn test_redis_handle_resolver_purge_input_types() { 746 + let pool = match crate::test_helpers::get_test_redis_pool() { 747 + Some(p) => p, 748 + None => return, 749 + }; 750 + 751 + // Create mock resolver 752 + let mock_resolver = Arc::new(MockHandleResolver { 753 + should_fail: false, 754 + expected_did: "did:plc:testuser789".to_string(), 755 + }); 756 + 757 + // Create metrics publisher 758 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 759 + 760 + // Create Redis-backed resolver with a unique key prefix for testing 761 + let test_prefix = format!( 762 + "test:handle:{}:", 763 + std::time::SystemTime::now() 764 + .duration_since(std::time::UNIX_EPOCH) 765 + .unwrap() 766 + .as_nanos() 767 + ); 768 + let redis_resolver = RedisHandleResolver::with_full_config( 769 + mock_resolver, 770 + pool.clone(), 771 + test_prefix.clone(), 772 + 3600, 773 + metrics, 774 + ); 775 + 776 + // Test different input formats 777 + let test_cases = vec![ 778 + ("alice.bsky.social", "alice.bsky.social"), // Handle 779 + ("ALICE.BSKY.SOCIAL", "alice.bsky.social"), // Handle (uppercase) 780 + ("did:plc:abc123", "did:plc:abc123"), // PLC DID 781 + ("did:web:example.com", "did:web:example.com"), // Web DID 782 + ]; 783 + 784 + for (input, expected_key) in test_cases { 785 + // Resolve first to cache it 786 + if !input.starts_with("did:") { 787 + let _ = redis_resolver.resolve(input).await; 788 + } 789 + 790 + // Test purging with different input formats 791 + let result = redis_resolver.purge(input).await; 792 + assert!(result.is_ok(), "Failed to purge {}: {:?}", input, result); 793 + 794 + // Verify the key was handled correctly based on type 795 + if let Ok(mut conn) = pool.get().await { 796 + let mut h = MetroHash64::default(); 797 + h.write(expected_key.as_bytes()); 798 + let key = format!("{}{}", test_prefix, h.finish()); 799 + 800 + // After purge, key should not exist 801 + let exists: bool = conn.exists(&key).await.unwrap_or(false); 802 + assert!(!exists, "Key for {} should not exist after purge", input); 803 + } 804 + } 805 + } 806 + 807 + #[tokio::test] 808 + async fn test_redis_handle_resolver_set_method() { 809 + let pool = match crate::test_helpers::get_test_redis_pool() { 810 + Some(p) => p, 811 + None => return, 812 + }; 813 + 814 + // Create mock resolver 815 + let mock_resolver = Arc::new(MockHandleResolver { 816 + should_fail: false, 817 + expected_did: "did:plc:old".to_string(), 818 + }); 819 + 820 + // Create metrics publisher 821 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 822 + 823 + // Create Redis-backed resolver with a unique key prefix for testing 824 + let test_prefix = format!( 825 + "test:handle:{}:", 826 + std::time::SystemTime::now() 827 + .duration_since(std::time::UNIX_EPOCH) 828 + .unwrap() 829 + .as_nanos() 830 + ); 831 + let redis_resolver = RedisHandleResolver::with_full_config( 832 + mock_resolver, 833 + pool.clone(), 834 + test_prefix.clone(), 835 + 3600, 836 + metrics, 837 + ); 838 + 839 + let test_handle = "charlie.bsky.social"; 840 + let test_did = "did:plc:newuser123"; 841 + 842 + // Set the mapping using the trait method 843 + redis_resolver.set(test_handle, test_did).await.unwrap(); 844 + 845 + // Verify the mapping by resolving the handle 846 + let (resolved_did, _) = redis_resolver.resolve(test_handle).await.unwrap(); 847 + assert_eq!(resolved_did, test_did); 848 + 849 + // Test that uppercase handles are normalized 850 + redis_resolver 851 + .set("DAVE.BSKY.SOCIAL", "did:plc:dave456") 852 + .await 853 + .unwrap(); 854 + let (resolved_did2, _) = redis_resolver.resolve("dave.bsky.social").await.unwrap(); 855 + assert_eq!(resolved_did2, "did:plc:dave456"); 856 + 857 + // Verify both forward and reverse mappings exist 858 + if let Ok(mut conn) = pool.get().await { 859 + let mut h = MetroHash64::default(); 860 + h.write(test_handle.as_bytes()); 861 + let handle_key = format!("{}{}", test_prefix, h.finish()); 862 + 863 + let mut h2 = MetroHash64::default(); 864 + h2.write(test_did.as_bytes()); 865 + let did_key = format!("{}{}", test_prefix, h2.finish()); 866 + 867 + // Check both keys exist 868 + let handle_exists: bool = conn.exists(&handle_key).await.unwrap(); 869 + assert!(handle_exists, "Handle key should exist after set"); 870 + 871 + let did_exists: bool = conn.exists(&did_key).await.unwrap(); 872 + assert!(did_exists, "DID key should exist after set"); 873 + 874 + // Clean up test data 875 + let _: Result<(), _> = conn.del(&[&handle_key, &did_key]).await; 876 + } 877 + } 878 + 879 + #[tokio::test] 329 880 async fn test_redis_handle_resolver_cache_error() { 330 881 let pool = match crate::test_helpers::get_test_redis_pool() { 331 882 Some(p) => p, ··· 337 888 should_fail: true, 338 889 expected_did: String::new(), 339 890 }); 891 + 892 + // Create metrics publisher 893 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 340 894 341 895 // Create Redis-backed resolver with a unique key prefix for testing 342 - let test_prefix = format!("test:handle:{}:", std::time::SystemTime::now().duration_since(std::time::UNIX_EPOCH).unwrap().as_nanos()); 896 + let test_prefix = format!( 897 + "test:handle:{}:", 898 + std::time::SystemTime::now() 899 + .duration_since(std::time::UNIX_EPOCH) 900 + .unwrap() 901 + .as_nanos() 902 + ); 343 903 let redis_resolver = RedisHandleResolver::with_full_config( 344 904 mock_resolver, 345 905 pool.clone(), 346 906 test_prefix.clone(), 347 907 3600, 908 + metrics, 348 909 ); 349 910 350 911 let test_handle = "error.bsky.social";
+221 -66
src/handle_resolver/sqlite.rs
··· 7 7 use super::errors::HandleResolverError; 8 8 use super::traits::HandleResolver; 9 9 use crate::handle_resolution_result::HandleResolutionResult; 10 + use crate::metrics::SharedMetricsPublisher; 10 11 use async_trait::async_trait; 11 12 use metrohash::MetroHash64; 12 13 use sqlx::{Row, SqlitePool}; ··· 35 36 /// use std::sync::Arc; 36 37 /// use sqlx::SqlitePool; 37 38 /// use quickdid::handle_resolver::{create_base_resolver, create_sqlite_resolver, HandleResolver}; 39 + /// use quickdid::metrics::NoOpMetricsPublisher; 38 40 /// 39 41 /// # async fn example() { 40 42 /// # use atproto_identity::resolve::HickoryDnsResolver; 41 43 /// # use reqwest::Client; 42 44 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 43 45 /// # let http_client = Client::new(); 44 - /// # let base_resolver = create_base_resolver(dns_resolver, http_client); 46 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 47 + /// # let base_resolver = create_base_resolver(dns_resolver, http_client, metrics.clone()); 45 48 /// # let sqlite_pool: SqlitePool = todo!(); 46 49 /// // Create with default 90-day TTL 47 50 /// let resolver = create_sqlite_resolver( 48 51 /// base_resolver, 49 - /// sqlite_pool 52 + /// sqlite_pool, 53 + /// metrics 50 54 /// ); 51 55 /// # } 52 56 /// ``` ··· 57 61 pool: SqlitePool, 58 62 /// TTL for cache entries in seconds 59 63 ttl_seconds: u64, 64 + /// Metrics publisher for telemetry 65 + metrics: SharedMetricsPublisher, 60 66 } 61 67 62 68 impl SqliteHandleResolver { 63 69 /// Create a new SQLite-backed handle resolver with default 90-day TTL. 64 - fn new(inner: Arc<dyn HandleResolver>, pool: SqlitePool) -> Self { 65 - Self::with_ttl(inner, pool, 90 * 24 * 60 * 60) // 90 days default 70 + fn new( 71 + inner: Arc<dyn HandleResolver>, 72 + pool: SqlitePool, 73 + metrics: SharedMetricsPublisher, 74 + ) -> Self { 75 + Self::with_ttl(inner, pool, 90 * 24 * 60 * 60, metrics) // 90 days default 66 76 } 67 77 68 78 /// Create a new SQLite-backed handle resolver with custom TTL. 69 - fn with_ttl(inner: Arc<dyn HandleResolver>, pool: SqlitePool, ttl_seconds: u64) -> Self { 79 + fn with_ttl( 80 + inner: Arc<dyn HandleResolver>, 81 + pool: SqlitePool, 82 + ttl_seconds: u64, 83 + metrics: SharedMetricsPublisher, 84 + ) -> Self { 70 85 Self { 71 86 inner, 72 87 pool, 73 88 ttl_seconds, 89 + metrics, 74 90 } 75 91 } 76 92 ··· 98 114 99 115 #[async_trait] 100 116 impl HandleResolver for SqliteHandleResolver { 101 - async fn resolve(&self, s: &str) -> Result<String, HandleResolverError> { 117 + async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 102 118 let handle = s.to_string(); 103 119 let key = self.make_key(&handle) as i64; // SQLite uses signed integers 104 120 105 121 // Try to get from SQLite cache first 106 - let cached_result = sqlx::query( 107 - "SELECT result, updated FROM handle_resolution_cache WHERE key = ?1" 108 - ) 109 - .bind(key) 110 - .fetch_optional(&self.pool) 111 - .await; 122 + let cached_result = 123 + sqlx::query("SELECT result, updated FROM handle_resolution_cache WHERE key = ?1") 124 + .bind(key) 125 + .fetch_optional(&self.pool) 126 + .await; 112 127 113 128 match cached_result { 114 129 Ok(Some(row)) => { ··· 122 137 Ok(cached_result) => { 123 138 if let Some(did) = cached_result.to_did() { 124 139 tracing::debug!("Cache hit for handle {}: {}", handle, did); 125 - return Ok(did); 140 + self.metrics.incr("resolver.sqlite.cache_hit").await; 141 + return Ok((did, cached_result.timestamp)); 126 142 } else { 127 143 tracing::debug!("Cache hit (not resolved) for handle {}", handle); 144 + self.metrics 145 + .incr("resolver.sqlite.cache_hit_not_resolved") 146 + .await; 128 147 return Err(HandleResolverError::HandleNotFound); 129 148 } 130 149 } ··· 134 153 handle, 135 154 e 136 155 ); 156 + self.metrics.incr("resolver.sqlite.deserialize_error").await; 137 157 // Fall through to re-resolve if deserialization fails 138 158 } 139 159 } 140 160 } else { 141 161 tracing::debug!("Cache entry expired for handle {}", handle); 162 + self.metrics.incr("resolver.sqlite.cache_expired").await; 142 163 // Entry is expired, we'll re-resolve and update it 143 164 } 144 165 } 145 166 Ok(None) => { 146 167 tracing::debug!("Cache miss for handle {}, resolving...", handle); 168 + self.metrics.incr("resolver.sqlite.cache_miss").await; 147 169 } 148 170 Err(e) => { 149 171 tracing::warn!("Failed to query SQLite cache for handle {}: {}", handle, e); 172 + self.metrics.incr("resolver.sqlite.query_error").await; 150 173 // Fall through to resolve without caching on database error 151 174 } 152 175 } ··· 156 179 157 180 // Create and serialize resolution result 158 181 let resolution_result = match &result { 159 - Ok(did) => { 182 + Ok((did, _timestamp)) => { 160 183 tracing::debug!( 161 184 "Caching successful resolution for handle {}: {}", 162 185 handle, ··· 166 189 Ok(res) => res, 167 190 Err(e) => { 168 191 tracing::warn!("Failed to create resolution result: {}", e); 192 + self.metrics 193 + .incr("resolver.sqlite.result_create_error") 194 + .await; 169 195 return result; 170 196 } 171 197 } ··· 176 202 Ok(res) => res, 177 203 Err(err) => { 178 204 tracing::warn!("Failed to create not_resolved result: {}", err); 205 + self.metrics 206 + .incr("resolver.sqlite.result_create_error") 207 + .await; 179 208 return result; 180 209 } 181 210 } ··· 198 227 ON CONFLICT(key) DO UPDATE SET 199 228 result = excluded.result, 200 229 updated = excluded.updated 201 - "# 230 + "#, 202 231 ) 203 232 .bind(key) 204 233 .bind(&bytes) ··· 209 238 210 239 if let Err(e) = query_result { 211 240 tracing::warn!("Failed to cache handle resolution in SQLite: {}", e); 241 + self.metrics.incr("resolver.sqlite.cache_set_error").await; 242 + } else { 243 + self.metrics.incr("resolver.sqlite.cache_set").await; 212 244 } 213 245 } 214 246 Err(e) => { ··· 217 249 handle, 218 250 e 219 251 ); 252 + self.metrics.incr("resolver.sqlite.serialize_error").await; 220 253 } 221 254 } 222 255 223 256 result 224 257 } 258 + 259 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 260 + // Normalize the handle to lowercase 261 + let handle = handle.to_lowercase(); 262 + 263 + // Update the SQLite cache 264 + if let Ok(mut conn) = self.pool.acquire().await { 265 + // Create a resolution result for the successful mapping 266 + let resolution_result = match HandleResolutionResult::success(did) { 267 + Ok(res) => res, 268 + Err(e) => { 269 + tracing::warn!( 270 + "Failed to create resolution result for set operation: {}", 271 + e 272 + ); 273 + self.metrics 274 + .incr("resolver.sqlite.set_result_create_error") 275 + .await; 276 + // Still chain to inner resolver even if we can't cache 277 + return self.inner.set(&handle, did).await; 278 + } 279 + }; 280 + 281 + // Serialize to bytes 282 + match resolution_result.to_bytes() { 283 + Ok(bytes) => { 284 + // Insert or update the cache entry 285 + let timestamp = std::time::SystemTime::now() 286 + .duration_since(std::time::UNIX_EPOCH) 287 + .unwrap_or_default() 288 + .as_secs() as i64; 289 + 290 + let expires_at = timestamp + self.ttl_seconds as i64; 291 + 292 + match sqlx::query( 293 + "INSERT OR REPLACE INTO handle_resolution_cache (handle, resolved_value, created_at, expires_at) VALUES (?, ?, ?, ?)" 294 + ) 295 + .bind(&handle) 296 + .bind(&bytes) 297 + .bind(timestamp) 298 + .bind(expires_at) 299 + .execute(&mut *conn) 300 + .await 301 + { 302 + Ok(_) => { 303 + tracing::debug!("Set handle {} -> DID {} in SQLite cache", handle, did); 304 + self.metrics.incr("resolver.sqlite.set_success").await; 305 + } 306 + Err(e) => { 307 + tracing::warn!("Failed to set handle->DID mapping in SQLite: {}", e); 308 + self.metrics.incr("resolver.sqlite.set_cache_error").await; 309 + // Still chain to inner resolver even if cache update fails 310 + } 311 + } 312 + } 313 + Err(e) => { 314 + tracing::warn!( 315 + "Failed to serialize resolution result for set operation: {}", 316 + e 317 + ); 318 + self.metrics 319 + .incr("resolver.sqlite.set_serialize_error") 320 + .await; 321 + // Still chain to inner resolver even if serialization fails 322 + } 323 + } 324 + } else { 325 + tracing::warn!("Failed to get SQLite connection for set operation"); 326 + self.metrics 327 + .incr("resolver.sqlite.set_connection_error") 328 + .await; 329 + } 330 + 331 + // Chain to inner resolver 332 + self.inner.set(&handle, did).await 333 + } 225 334 } 226 335 227 336 /// Create a new SQLite-backed handle resolver with default 90-day TTL. ··· 230 339 /// 231 340 /// * `inner` - The underlying resolver to use for actual resolution 232 341 /// * `pool` - SQLite connection pool 342 + /// * `metrics` - Metrics publisher for telemetry 233 343 /// 234 344 /// # Example 235 345 /// ··· 237 347 /// use std::sync::Arc; 238 348 /// use quickdid::handle_resolver::{create_base_resolver, create_sqlite_resolver, HandleResolver}; 239 349 /// use quickdid::sqlite_schema::create_sqlite_pool; 350 + /// use quickdid::metrics::NoOpMetricsPublisher; 240 351 /// 241 352 /// # async fn example() -> anyhow::Result<()> { 242 353 /// # use atproto_identity::resolve::HickoryDnsResolver; 243 354 /// # use reqwest::Client; 244 355 /// # let dns_resolver = Arc::new(HickoryDnsResolver::create_resolver(&[])); 245 356 /// # let http_client = Client::new(); 357 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 246 358 /// let base = create_base_resolver( 247 359 /// dns_resolver, 248 360 /// http_client, 361 + /// metrics.clone(), 249 362 /// ); 250 363 /// 251 364 /// let pool = create_sqlite_pool("sqlite:./quickdid.db").await?; 252 - /// let resolver = create_sqlite_resolver(base, pool); 253 - /// let did = resolver.resolve("alice.bsky.social").await.unwrap(); 365 + /// let resolver = create_sqlite_resolver(base, pool, metrics); 366 + /// let (did, timestamp) = resolver.resolve("alice.bsky.social").await.unwrap(); 254 367 /// # Ok(()) 255 368 /// # } 256 369 /// ``` 257 370 pub fn create_sqlite_resolver( 258 371 inner: Arc<dyn HandleResolver>, 259 372 pool: SqlitePool, 373 + metrics: SharedMetricsPublisher, 260 374 ) -> Arc<dyn HandleResolver> { 261 - Arc::new(SqliteHandleResolver::new(inner, pool)) 375 + Arc::new(SqliteHandleResolver::new(inner, pool, metrics)) 262 376 } 263 377 264 378 /// Create a new SQLite-backed handle resolver with custom TTL. ··· 268 382 /// * `inner` - The underlying resolver to use for actual resolution 269 383 /// * `pool` - SQLite connection pool 270 384 /// * `ttl_seconds` - TTL for cache entries in seconds 385 + /// * `metrics` - Metrics publisher for telemetry 271 386 pub fn create_sqlite_resolver_with_ttl( 272 387 inner: Arc<dyn HandleResolver>, 273 388 pool: SqlitePool, 274 389 ttl_seconds: u64, 390 + metrics: SharedMetricsPublisher, 275 391 ) -> Arc<dyn HandleResolver> { 276 - Arc::new(SqliteHandleResolver::with_ttl(inner, pool, ttl_seconds)) 392 + Arc::new(SqliteHandleResolver::with_ttl( 393 + inner, 394 + pool, 395 + ttl_seconds, 396 + metrics, 397 + )) 277 398 } 278 399 279 400 #[cfg(test)] ··· 289 410 290 411 #[async_trait] 291 412 impl HandleResolver for MockHandleResolver { 292 - async fn resolve(&self, _handle: &str) -> Result<String, HandleResolverError> { 413 + async fn resolve(&self, _handle: &str) -> Result<(String, u64), HandleResolverError> { 293 414 if self.should_fail { 294 415 Err(HandleResolverError::MockResolutionFailure) 295 416 } else { 296 - Ok(self.expected_did.clone()) 417 + let timestamp = std::time::SystemTime::now() 418 + .duration_since(std::time::UNIX_EPOCH) 419 + .unwrap_or_default() 420 + .as_secs(); 421 + Ok((self.expected_did.clone(), timestamp)) 297 422 } 298 423 } 299 424 } ··· 316 441 expected_did: "did:plc:testuser123".to_string(), 317 442 }); 318 443 444 + // Create metrics publisher 445 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 446 + 319 447 // Create SQLite-backed resolver 320 - let sqlite_resolver = SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600); 448 + let sqlite_resolver = 449 + SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600, metrics); 321 450 322 451 let test_handle = "alice.bsky.social"; 323 452 let expected_key = sqlite_resolver.make_key(test_handle) as i64; ··· 330 459 assert_eq!(initial_count, 0); 331 460 332 461 // First resolution - should call inner resolver and cache the result 333 - let result1 = sqlite_resolver.resolve(test_handle).await.unwrap(); 462 + let (result1, _timestamp1) = sqlite_resolver.resolve(test_handle).await.unwrap(); 334 463 assert_eq!(result1, "did:plc:testuser123"); 335 464 336 465 // Verify record was inserted 337 - let count_after_first: i64 = sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 338 - .fetch_one(&pool) 339 - .await 340 - .expect("Failed to query count after first resolution"); 466 + let count_after_first: i64 = 467 + sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 468 + .fetch_one(&pool) 469 + .await 470 + .expect("Failed to query count after first resolution"); 341 471 assert_eq!(count_after_first, 1); 342 472 343 473 // Verify the cached record has correct key and non-empty result 344 - let cached_record = sqlx::query("SELECT key, result, created, updated FROM handle_resolution_cache WHERE key = ?1") 345 - .bind(expected_key) 346 - .fetch_one(&pool) 347 - .await 348 - .expect("Failed to fetch cached record"); 349 - 474 + let cached_record = sqlx::query( 475 + "SELECT key, result, created, updated FROM handle_resolution_cache WHERE key = ?1", 476 + ) 477 + .bind(expected_key) 478 + .fetch_one(&pool) 479 + .await 480 + .expect("Failed to fetch cached record"); 481 + 350 482 let cached_key: i64 = cached_record.get("key"); 351 483 let cached_result: Vec<u8> = cached_record.get("result"); 352 484 let cached_created: i64 = cached_record.get("created"); 353 485 let cached_updated: i64 = cached_record.get("updated"); 354 486 355 487 assert_eq!(cached_key, expected_key); 356 - assert!(!cached_result.is_empty(), "Cached result should not be empty"); 488 + assert!( 489 + !cached_result.is_empty(), 490 + "Cached result should not be empty" 491 + ); 357 492 assert!(cached_created > 0, "Created timestamp should be positive"); 358 493 assert!(cached_updated > 0, "Updated timestamp should be positive"); 359 - assert_eq!(cached_created, cached_updated, "Created and updated should be equal on first insert"); 494 + assert_eq!( 495 + cached_created, cached_updated, 496 + "Created and updated should be equal on first insert" 497 + ); 360 498 361 499 // Verify we can deserialize the cached result 362 - let resolution_result = crate::handle_resolution_result::HandleResolutionResult::from_bytes(&cached_result) 363 - .expect("Failed to deserialize cached result"); 500 + let resolution_result = 501 + crate::handle_resolution_result::HandleResolutionResult::from_bytes(&cached_result) 502 + .expect("Failed to deserialize cached result"); 364 503 let cached_did = resolution_result.to_did().expect("Should have a DID"); 365 504 assert_eq!(cached_did, "did:plc:testuser123"); 366 505 367 506 // Second resolution - should hit cache (no additional database insert) 368 - let result2 = sqlite_resolver.resolve(test_handle).await.unwrap(); 507 + let (result2, _timestamp2) = sqlite_resolver.resolve(test_handle).await.unwrap(); 369 508 assert_eq!(result2, "did:plc:testuser123"); 370 509 371 510 // Verify count hasn't changed (cache hit, no new insert) 372 - let count_after_second: i64 = sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 373 - .fetch_one(&pool) 374 - .await 375 - .expect("Failed to query count after second resolution"); 511 + let count_after_second: i64 = 512 + sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 513 + .fetch_one(&pool) 514 + .await 515 + .expect("Failed to query count after second resolution"); 376 516 assert_eq!(count_after_second, 1); 377 517 } 378 518 ··· 394 534 expected_did: String::new(), 395 535 }); 396 536 537 + // Create metrics publisher 538 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 539 + 397 540 // Create SQLite-backed resolver 398 - let sqlite_resolver = SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600); 541 + let sqlite_resolver = 542 + SqliteHandleResolver::with_ttl(mock_resolver, pool.clone(), 3600, metrics); 399 543 400 544 let test_handle = "error.bsky.social"; 401 545 let expected_key = sqlite_resolver.make_key(test_handle) as i64; ··· 410 554 // First resolution - should fail and cache the failure 411 555 let result1 = sqlite_resolver.resolve(test_handle).await; 412 556 assert!(result1.is_err()); 413 - 557 + 414 558 // Match the specific error type we expect 415 559 match result1 { 416 - Err(HandleResolverError::MockResolutionFailure) => {}, 560 + Err(HandleResolverError::MockResolutionFailure) => {} 417 561 other => panic!("Expected MockResolutionFailure, got {:?}", other), 418 562 } 419 563 420 564 // Verify the failure was cached 421 - let count_after_first: i64 = sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 422 - .fetch_one(&pool) 423 - .await 424 - .expect("Failed to query count after first resolution"); 565 + let count_after_first: i64 = 566 + sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 567 + .fetch_one(&pool) 568 + .await 569 + .expect("Failed to query count after first resolution"); 425 570 assert_eq!(count_after_first, 1); 426 571 427 572 // Verify the cached error record 428 - let cached_record = sqlx::query("SELECT key, result, created, updated FROM handle_resolution_cache WHERE key = ?1") 429 - .bind(expected_key) 430 - .fetch_one(&pool) 431 - .await 432 - .expect("Failed to fetch cached error record"); 433 - 573 + let cached_record = sqlx::query( 574 + "SELECT key, result, created, updated FROM handle_resolution_cache WHERE key = ?1", 575 + ) 576 + .bind(expected_key) 577 + .fetch_one(&pool) 578 + .await 579 + .expect("Failed to fetch cached error record"); 580 + 434 581 let cached_key: i64 = cached_record.get("key"); 435 582 let cached_result: Vec<u8> = cached_record.get("result"); 436 583 let cached_created: i64 = cached_record.get("created"); 437 584 let cached_updated: i64 = cached_record.get("updated"); 438 585 439 586 assert_eq!(cached_key, expected_key); 440 - assert!(!cached_result.is_empty(), "Cached error result should not be empty"); 587 + assert!( 588 + !cached_result.is_empty(), 589 + "Cached error result should not be empty" 590 + ); 441 591 assert!(cached_created > 0, "Created timestamp should be positive"); 442 592 assert!(cached_updated > 0, "Updated timestamp should be positive"); 443 - assert_eq!(cached_created, cached_updated, "Created and updated should be equal on first insert"); 593 + assert_eq!( 594 + cached_created, cached_updated, 595 + "Created and updated should be equal on first insert" 596 + ); 444 597 445 598 // Verify we can deserialize the cached error result 446 - let resolution_result = crate::handle_resolution_result::HandleResolutionResult::from_bytes(&cached_result) 447 - .expect("Failed to deserialize cached error result"); 599 + let resolution_result = 600 + crate::handle_resolution_result::HandleResolutionResult::from_bytes(&cached_result) 601 + .expect("Failed to deserialize cached error result"); 448 602 let cached_did = resolution_result.to_did(); 449 603 assert!(cached_did.is_none(), "Error result should have no DID"); 450 604 451 605 // Second resolution - should hit cache with error (no additional database operations) 452 606 let result2 = sqlite_resolver.resolve(test_handle).await; 453 607 assert!(result2.is_err()); 454 - 608 + 455 609 // Match the specific error type we expect from cache 456 610 match result2 { 457 - Err(HandleResolverError::HandleNotFound) => {}, // Cache returns HandleNotFound for "not resolved" 611 + Err(HandleResolverError::HandleNotFound) => {} // Cache returns HandleNotFound for "not resolved" 458 612 other => panic!("Expected HandleNotFound from cache, got {:?}", other), 459 613 } 460 614 461 615 // Verify count hasn't changed (cache hit, no new operations) 462 - let count_after_second: i64 = sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 463 - .fetch_one(&pool) 464 - .await 465 - .expect("Failed to query count after second resolution"); 616 + let count_after_second: i64 = 617 + sqlx::query_scalar("SELECT COUNT(*) FROM handle_resolution_cache") 618 + .fetch_one(&pool) 619 + .await 620 + .expect("Failed to query count after second resolution"); 466 621 assert_eq!(count_after_second, 1); 467 622 } 468 - } 623 + }
+105 -5
src/handle_resolver/traits.rs
··· 17 17 /// ```no_run 18 18 /// use async_trait::async_trait; 19 19 /// use quickdid::handle_resolver::{HandleResolver, HandleResolverError}; 20 + /// use std::time::{SystemTime, UNIX_EPOCH}; 20 21 /// 21 22 /// struct MyResolver; 22 23 /// 23 24 /// #[async_trait] 24 25 /// impl HandleResolver for MyResolver { 25 - /// async fn resolve(&self, s: &str) -> Result<String, HandleResolverError> { 26 + /// async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError> { 26 27 /// // Custom resolution logic 27 - /// Ok(format!("did:plc:{}", s.replace('.', ""))) 28 + /// let did = format!("did:plc:{}", s.replace('.', "")); 29 + /// let timestamp = SystemTime::now() 30 + /// .duration_since(UNIX_EPOCH) 31 + /// .unwrap() 32 + /// .as_secs(); 33 + /// Ok((did, timestamp)) 28 34 /// } 29 35 /// } 30 36 /// ``` 31 37 #[async_trait] 32 38 pub trait HandleResolver: Send + Sync { 33 - /// Resolve a handle to its DID. 39 + /// Resolve a handle to its DID with timestamp. 34 40 /// 35 41 /// # Arguments 36 42 /// ··· 38 44 /// 39 45 /// # Returns 40 46 /// 41 - /// The resolved DID on success, or an error if resolution fails. 47 + /// A tuple containing: 48 + /// - The resolved DID string 49 + /// - The resolution timestamp as UNIX epoch seconds 42 50 /// 43 51 /// # Errors 44 52 /// ··· 46 54 /// - The handle cannot be resolved 47 55 /// - Network errors occur during resolution 48 56 /// - The handle is invalid or doesn't exist 49 - async fn resolve(&self, s: &str) -> Result<String, HandleResolverError>; 57 + async fn resolve(&self, s: &str) -> Result<(String, u64), HandleResolverError>; 58 + 59 + /// Purge a handle or DID from the cache. 60 + /// 61 + /// This method removes cached entries for the given identifier, which can be 62 + /// either a handle (e.g., "alice.bsky.social") or a DID (e.g., "did:plc:xyz123"). 63 + /// Implementations should handle bidirectional purging where applicable. 64 + /// 65 + /// # Arguments 66 + /// 67 + /// * `identifier` - Either a handle or DID to purge from cache 68 + /// 69 + /// # Returns 70 + /// 71 + /// Ok(()) if the purge was successful or if the identifier wasn't cached. 72 + /// Most implementations will simply return Ok(()) as a no-op. 73 + /// 74 + /// # Default Implementation 75 + /// 76 + /// The default implementation is a no-op that always returns Ok(()). 77 + async fn purge(&self, _subject: &str) -> Result<(), HandleResolverError> { 78 + Ok(()) 79 + } 80 + 81 + /// Set a handle-to-DID mapping in the cache. 82 + /// 83 + /// This method allows manually setting or updating a cached mapping between 84 + /// a handle and its corresponding DID. This is useful for pre-populating 85 + /// caches or updating stale entries. 86 + /// 87 + /// # Arguments 88 + /// 89 + /// * `handle` - The handle to cache (e.g., "alice.bsky.social") 90 + /// * `did` - The DID to associate with the handle (e.g., "did:plc:xyz123") 91 + /// 92 + /// # Returns 93 + /// 94 + /// Ok(()) if the mapping was successfully set or if the implementation 95 + /// doesn't support manual cache updates. Most implementations will simply 96 + /// return Ok(()) as a no-op. 97 + /// 98 + /// # Default Implementation 99 + /// 100 + /// The default implementation is a no-op that always returns Ok(()). 101 + async fn set(&self, _handle: &str, _did: &str) -> Result<(), HandleResolverError> { 102 + Ok(()) 103 + } 104 + } 105 + 106 + #[cfg(test)] 107 + mod tests { 108 + use super::*; 109 + 110 + // Simple test resolver that doesn't cache anything 111 + struct NoOpTestResolver; 112 + 113 + #[async_trait] 114 + impl HandleResolver for NoOpTestResolver { 115 + async fn resolve(&self, _s: &str) -> Result<(String, u64), HandleResolverError> { 116 + Ok(("did:test:123".to_string(), 1234567890)) 117 + } 118 + // Uses default purge implementation 119 + } 120 + 121 + #[tokio::test] 122 + async fn test_default_purge_implementation() { 123 + let resolver = NoOpTestResolver; 124 + 125 + // Default implementation should always return Ok(()) 126 + assert!(resolver.purge("alice.bsky.social").await.is_ok()); 127 + assert!(resolver.purge("did:plc:xyz123").await.is_ok()); 128 + assert!(resolver.purge("").await.is_ok()); 129 + } 130 + 131 + #[tokio::test] 132 + async fn test_default_set_implementation() { 133 + let resolver = NoOpTestResolver; 134 + 135 + // Default implementation should always return Ok(()) 136 + assert!( 137 + resolver 138 + .set("alice.bsky.social", "did:plc:xyz123") 139 + .await 140 + .is_ok() 141 + ); 142 + assert!( 143 + resolver 144 + .set("bob.example.com", "did:web:example.com") 145 + .await 146 + .is_ok() 147 + ); 148 + assert!(resolver.set("", "").await.is_ok()); 149 + } 50 150 }
+144 -93
src/handle_resolver_task.rs
··· 5 5 //! and ensures resolved handles are cached for efficient subsequent lookups. 6 6 7 7 use crate::handle_resolver::HandleResolver; 8 + use crate::metrics::SharedMetricsPublisher; 8 9 use crate::queue::{HandleResolutionWork, QueueAdapter}; 9 10 use anyhow::Result; 10 11 use std::sync::Arc; ··· 16 17 /// Handle resolver task errors 17 18 #[derive(Error, Debug)] 18 19 pub(crate) enum HandleResolverError { 19 - #[error("Queue adapter health check failed: adapter is not healthy")] 20 + /// Queue adapter health check failed 21 + #[error("error-quickdid-task-1 Queue adapter health check failed: adapter is not healthy")] 20 22 QueueAdapterUnhealthy, 21 23 } 22 24 ··· 35 37 } 36 38 } 37 39 38 - /// Metrics for handle resolution processing 39 - #[derive(Debug, Default)] 40 - pub(crate) struct HandleResolverMetrics { 41 - pub total_processed: std::sync::atomic::AtomicU64, 42 - pub total_succeeded: std::sync::atomic::AtomicU64, 43 - pub total_failed: std::sync::atomic::AtomicU64, 44 - pub total_cached: std::sync::atomic::AtomicU64, 45 - } 46 - 47 40 /// Handle resolver task processor 48 41 pub(crate) struct HandleResolverTask { 49 42 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 50 43 handle_resolver: Arc<dyn HandleResolver>, 51 44 cancel_token: CancellationToken, 52 45 config: HandleResolverTaskConfig, 53 - metrics: Arc<HandleResolverMetrics>, 46 + metrics_publisher: SharedMetricsPublisher, 54 47 } 55 48 56 49 impl HandleResolverTask { ··· 59 52 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 60 53 handle_resolver: Arc<dyn HandleResolver>, 61 54 cancel_token: CancellationToken, 55 + metrics_publisher: SharedMetricsPublisher, 62 56 ) -> Self { 63 57 let config = HandleResolverTaskConfig::default(); 64 58 Self { ··· 66 60 handle_resolver, 67 61 cancel_token, 68 62 config, 69 - metrics: Arc::new(HandleResolverMetrics::default()), 63 + metrics_publisher, 70 64 } 71 65 } 72 66 ··· 76 70 handle_resolver: Arc<dyn HandleResolver>, 77 71 cancel_token: CancellationToken, 78 72 config: HandleResolverTaskConfig, 73 + metrics_publisher: SharedMetricsPublisher, 79 74 ) -> Self { 80 75 Self { 81 76 adapter, 82 77 handle_resolver, 83 78 cancel_token, 84 79 config, 85 - metrics: Arc::new(HandleResolverMetrics::default()), 80 + metrics_publisher, 86 81 } 87 82 } 88 83 ··· 115 110 116 111 // All work has been processed 117 112 info!("All handle resolutions completed"); 113 + info!("Handle resolver task processor stopped"); 118 114 119 - info!( 120 - total_processed = self 121 - .metrics 122 - .total_processed 123 - .load(std::sync::atomic::Ordering::Relaxed), 124 - total_succeeded = self 125 - .metrics 126 - .total_succeeded 127 - .load(std::sync::atomic::Ordering::Relaxed), 128 - total_failed = self 129 - .metrics 130 - .total_failed 131 - .load(std::sync::atomic::Ordering::Relaxed), 132 - total_cached = self 133 - .metrics 134 - .total_cached 135 - .load(std::sync::atomic::Ordering::Relaxed), 136 - "Handle resolver task processor stopped" 137 - ); 115 + Ok(()) 116 + } 138 117 139 - Ok(()) 118 + /// Check if an error represents a soft failure (handle not found) 119 + /// rather than a real error condition. 120 + /// 121 + /// These atproto_identity library errors indicate the handle doesn't support 122 + /// the specific resolution method, which is normal and expected: 123 + /// - error-atproto-identity-resolve-4: DNS resolution failed (no records) 124 + /// - error-atproto-identity-resolve-5: HTTP resolution failed (hostname not found) 125 + fn is_soft_failure(error_str: &str) -> bool { 126 + // Check for specific atproto_identity error codes that indicate "not found" 127 + // rather than actual failures 128 + if error_str.starts_with("error-atproto-identity-resolve-4") { 129 + // DNS resolution - check if it's a "no records" scenario 130 + error_str.contains("NoRecordsFound") 131 + } else if error_str.starts_with("error-atproto-identity-resolve-6") { 132 + // HTTP resolution - check if it's a DID format issue 133 + error_str.contains("expected DID format") 134 + } else if error_str.starts_with("error-atproto-identity-resolve-5") { 135 + // HTTP resolution - check if it's a hostname lookup failure 136 + error_str.contains("No address associated with hostname") 137 + || error_str.contains("failed to lookup address information") 138 + } else { 139 + false 140 + } 140 141 } 141 142 142 143 /// Process a single handle resolution work item ··· 156 157 157 158 let duration_ms = start_time.elapsed().as_millis() as u64; 158 159 159 - // Update metrics 160 - self.metrics 161 - .total_processed 162 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 160 + // Publish metrics 161 + self.metrics_publisher 162 + .incr("task.handle_resolution.processed") 163 + .await; 164 + self.metrics_publisher 165 + .time("task.handle_resolution.duration_ms", duration_ms) 166 + .await; 163 167 164 168 match result { 165 - Ok(Ok(did)) => { 166 - self.metrics 167 - .total_succeeded 168 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 169 - self.metrics 170 - .total_cached 171 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 169 + Ok(Ok((did, _timestamp))) => { 170 + // Publish success metrics 171 + self.metrics_publisher 172 + .incr("task.handle_resolution.success") 173 + .await; 174 + self.metrics_publisher 175 + .incr("task.handle_resolution.cached") 176 + .await; 172 177 173 - info!( 178 + debug!( 174 179 handle = %work.handle, 175 180 did = %did, 176 181 duration_ms = duration_ms, ··· 178 183 ); 179 184 } 180 185 Ok(Err(e)) => { 181 - self.metrics 182 - .total_failed 183 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 186 + let error_str = e.to_string(); 187 + 188 + if Self::is_soft_failure(&error_str) { 189 + // This is a soft failure - handle simply doesn't support this resolution method 190 + // Publish not-found metrics 191 + self.metrics_publisher 192 + .incr("task.handle_resolution.not_found") 193 + .await; 194 + 195 + debug!( 196 + handle = %work.handle, 197 + error = %error_str, 198 + duration_ms = duration_ms, 199 + "Handle not found (soft failure)" 200 + ); 201 + } else { 202 + // This is a real error 203 + // Publish failure metrics 204 + self.metrics_publisher 205 + .incr("task.handle_resolution.failed") 206 + .await; 184 207 185 - error!( 186 - handle = %work.handle, 187 - error = %e, 188 - duration_ms = duration_ms, 189 - "Handle resolution failed" 190 - ); 208 + error!( 209 + handle = %work.handle, 210 + error = %error_str, 211 + duration_ms = duration_ms, 212 + "Handle resolution failed" 213 + ); 214 + } 191 215 } 192 216 Err(_) => { 193 - self.metrics 194 - .total_failed 195 - .fetch_add(1, std::sync::atomic::Ordering::Relaxed); 217 + // Publish timeout metrics 218 + self.metrics_publisher 219 + .incr("task.handle_resolution.timeout") 220 + .await; 196 221 197 222 error!( 198 223 handle = %work.handle, ··· 227 252 /// * `adapter` - Queue adapter for work items 228 253 /// * `handle_resolver` - Handle resolver implementation 229 254 /// * `cancel_token` - Token for graceful shutdown 255 + /// * `metrics_publisher` - Metrics publisher for telemetry 230 256 pub fn create_handle_resolver_task( 231 257 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 232 258 handle_resolver: Arc<dyn HandleResolver>, 233 259 cancel_token: CancellationToken, 260 + metrics_publisher: SharedMetricsPublisher, 234 261 ) -> HandleResolverTaskHandle { 235 262 HandleResolverTaskHandle { 236 - task: HandleResolverTask::new(adapter, handle_resolver, cancel_token), 263 + task: HandleResolverTask::new(adapter, handle_resolver, cancel_token, metrics_publisher), 237 264 } 238 265 } 239 266 ··· 245 272 /// * `handle_resolver` - Handle resolver implementation 246 273 /// * `cancel_token` - Token for graceful shutdown 247 274 /// * `config` - Task configuration 275 + /// * `metrics_publisher` - Metrics publisher for telemetry 248 276 pub fn create_handle_resolver_task_with_config( 249 277 adapter: Arc<dyn QueueAdapter<HandleResolutionWork>>, 250 278 handle_resolver: Arc<dyn HandleResolver>, 251 279 cancel_token: CancellationToken, 252 280 config: HandleResolverTaskConfig, 281 + metrics_publisher: SharedMetricsPublisher, 253 282 ) -> HandleResolverTaskHandle { 254 283 HandleResolverTaskHandle { 255 - task: HandleResolverTask::with_config(adapter, handle_resolver, cancel_token, config), 284 + task: HandleResolverTask::with_config( 285 + adapter, 286 + handle_resolver, 287 + cancel_token, 288 + config, 289 + metrics_publisher, 290 + ), 256 291 } 257 292 } 258 293 ··· 275 310 async fn resolve( 276 311 &self, 277 312 handle: &str, 278 - ) -> Result<String, crate::handle_resolver::HandleResolverError> { 313 + ) -> Result<(String, u64), crate::handle_resolver::HandleResolverError> { 279 314 if self.should_fail { 280 315 Err(crate::handle_resolver::HandleResolverError::MockResolutionFailure) 281 316 } else { 282 - Ok(format!("did:plc:{}", handle.replace('.', ""))) 317 + let timestamp = std::time::SystemTime::now() 318 + .duration_since(std::time::UNIX_EPOCH) 319 + .unwrap_or_default() 320 + .as_secs(); 321 + Ok((format!("did:plc:{}", handle.replace('.', "")), timestamp)) 283 322 } 284 323 } 285 324 } ··· 295 334 296 335 // Create cancellation token 297 336 let cancel_token = CancellationToken::new(); 337 + 338 + // Create metrics publisher 339 + let metrics_publisher = Arc::new(crate::metrics::NoOpMetricsPublisher); 298 340 299 341 // Create task with custom config 300 342 let config = HandleResolverTaskConfig { ··· 306 348 handle_resolver, 307 349 cancel_token.clone(), 308 350 config, 351 + metrics_publisher, 309 352 ); 310 353 311 354 // Create handle resolution work ··· 313 356 314 357 // Send work to queue 315 358 sender.send(work).await.unwrap(); 316 - 317 - // Get metrics reference before moving task 318 - let metrics = task.metrics.clone(); 319 359 320 360 // Run task for a short time 321 361 let task_handle = tokio::spawn(async move { task.run().await }); ··· 329 369 // Wait for task to complete 330 370 let _ = task_handle.await; 331 371 332 - // Verify metrics 333 - assert_eq!( 334 - metrics 335 - .total_processed 336 - .load(std::sync::atomic::Ordering::Relaxed), 337 - 1 338 - ); 339 - assert_eq!( 340 - metrics 341 - .total_succeeded 342 - .load(std::sync::atomic::Ordering::Relaxed), 343 - 1 344 - ); 372 + // Test passes if task runs without panic 345 373 } 346 374 347 - #[tokio::test] 348 - async fn test_handle_resolver_metrics() { 349 - use std::sync::atomic::Ordering; 375 + #[test] 376 + fn test_is_soft_failure() { 377 + // Test DNS NoRecordsFound pattern (error-atproto-identity-resolve-4) 378 + let dns_no_records = "error-atproto-identity-resolve-4 DNS resolution failed: ResolveError { kind: Proto(ProtoError { kind: NoRecordsFound { query: Query { name: Name(\"_atproto.noahshachtman.bsky.social.railway.internal.\"), query_type: TXT, query_class: IN }, soa: None, ns: None, negative_ttl: None, response_code: NotImp, trusted: true, authorities: None } }) }"; 379 + assert!(HandleResolverTask::is_soft_failure(dns_no_records)); 380 + 381 + // Test HTTP hostname not found pattern (error-atproto-identity-resolve-5) 382 + let http_no_hostname = "error-atproto-identity-resolve-5 HTTP resolution failed: reqwest::Error { kind: Request, url: \"https://mattie.thegem.city/.well-known/atproto-did\", source: hyper_util::client::legacy::Error(Connect, ConnectError(\"dns error\", Custom { kind: Uncategorized, error: \"failed to lookup address information: No address associated with hostname\" })) }"; 383 + assert!(HandleResolverTask::is_soft_failure(http_no_hostname)); 384 + 385 + // Test alternate HTTP hostname failure message 386 + let http_lookup_failed = "error-atproto-identity-resolve-5 HTTP resolution failed: reqwest::Error { kind: Request, url: \"https://example.com/.well-known/atproto-did\", source: hyper_util::client::legacy::Error(Connect, ConnectError(\"dns error\", Custom { kind: Uncategorized, error: \"failed to lookup address information\" })) }"; 387 + assert!(HandleResolverTask::is_soft_failure(http_lookup_failed)); 388 + 389 + // Test HTTP invalid DID format (error-atproto-identity-resolve-6) - like reuters.com 390 + let http_invalid_did = "error-atproto-identity-resolve-6 Invalid HTTP resolution response: expected DID format"; 391 + assert!(HandleResolverTask::is_soft_failure(http_invalid_did)); 392 + 393 + // Test weratedogs.com case 394 + let weratedogs_error = "error-atproto-identity-resolve-6 Invalid HTTP resolution response: expected DID format"; 395 + assert!(HandleResolverTask::is_soft_failure(weratedogs_error)); 396 + 397 + // Test DNS error that is NOT a soft failure (different DNS error) 398 + let dns_real_error = "error-atproto-identity-resolve-4 DNS resolution failed: timeout"; 399 + assert!(!HandleResolverTask::is_soft_failure(dns_real_error)); 350 400 351 - let metrics = HandleResolverMetrics::default(); 401 + // Test HTTP error that is NOT a soft failure (connection timeout) 402 + let http_timeout = 403 + "error-atproto-identity-resolve-5 HTTP resolution failed: connection timeout"; 404 + assert!(!HandleResolverTask::is_soft_failure(http_timeout)); 352 405 353 - // Test initial values 354 - assert_eq!(metrics.total_processed.load(Ordering::Relaxed), 0); 355 - assert_eq!(metrics.total_succeeded.load(Ordering::Relaxed), 0); 356 - assert_eq!(metrics.total_failed.load(Ordering::Relaxed), 0); 357 - assert_eq!(metrics.total_cached.load(Ordering::Relaxed), 0); 406 + // Test HTTP error that is NOT a soft failure (500 error) 407 + let http_500 = "error-atproto-identity-resolve-5 HTTP resolution failed: status code 500"; 408 + assert!(!HandleResolverTask::is_soft_failure(http_500)); 358 409 359 - // Test incrementing 360 - metrics.total_processed.fetch_add(1, Ordering::Relaxed); 361 - metrics.total_succeeded.fetch_add(1, Ordering::Relaxed); 362 - metrics.total_cached.fetch_add(1, Ordering::Relaxed); 410 + // Test QuickDID errors should never be soft failures 411 + let quickdid_error = 412 + "error-quickdid-resolve-1 Failed to resolve subject: internal server error"; 413 + assert!(!HandleResolverTask::is_soft_failure(quickdid_error)); 363 414 364 - assert_eq!(metrics.total_processed.load(Ordering::Relaxed), 1); 365 - assert_eq!(metrics.total_succeeded.load(Ordering::Relaxed), 1); 366 - assert_eq!(metrics.total_cached.load(Ordering::Relaxed), 1); 415 + // Test other atproto_identity error codes should not be soft failures 416 + let other_atproto_error = "error-atproto-identity-resolve-1 Some other error"; 417 + assert!(!HandleResolverTask::is_soft_failure(other_atproto_error)); 367 418 } 368 419 }
+289 -28
src/http/handle_xrpc_resolve_handle.rs
··· 1 1 use std::sync::Arc; 2 + use std::time::{Duration, SystemTime, UNIX_EPOCH}; 2 3 3 4 use crate::{ 4 5 handle_resolver::HandleResolver, 6 + http::AppContext, 7 + metrics::SharedMetricsPublisher, 5 8 queue::{HandleResolutionWork, QueueAdapter}, 6 9 }; 7 10 8 11 use atproto_identity::resolve::{InputType, parse_input}; 9 12 use axum::{ 10 13 extract::{Query, State}, 11 - http::StatusCode, 12 - response::{IntoResponse, Json}, 14 + http::{HeaderMap, HeaderValue, StatusCode, header}, 15 + response::{IntoResponse, Json, Response}, 13 16 }; 17 + use metrohash::MetroHash64; 14 18 use serde::{Deserialize, Serialize}; 19 + use std::hash::Hasher; 15 20 16 21 #[derive(Deserialize)] 17 22 pub(super) struct ResolveHandleParams { ··· 31 36 message: String, 32 37 } 33 38 39 + /// Represents the result of a handle resolution 40 + enum ResolutionResult { 41 + Success { 42 + did: String, 43 + timestamp: u64, 44 + etag: String, 45 + }, 46 + Error { 47 + error: String, 48 + message: String, 49 + timestamp: u64, 50 + etag: String, 51 + }, 52 + } 53 + 54 + struct ResolutionResultView { 55 + result: ResolutionResult, 56 + cache_control: Option<String>, 57 + if_none_match: Option<HeaderValue>, 58 + if_modified_since: Option<HeaderValue>, 59 + } 60 + 61 + impl IntoResponse for ResolutionResultView { 62 + fn into_response(self) -> Response { 63 + let (last_modified, etag) = match &self.result { 64 + ResolutionResult::Success { 65 + timestamp, etag, .. 66 + } => (*timestamp, etag), 67 + ResolutionResult::Error { 68 + timestamp, etag, .. 69 + } => (*timestamp, etag), 70 + }; 71 + 72 + let mut headers = HeaderMap::new(); 73 + 74 + // WARNING: this swallows errors 75 + if let Ok(etag_value) = HeaderValue::from_str(etag) { 76 + headers.insert(header::ETAG, etag_value); 77 + } 78 + 79 + // Add Last-Modified header 80 + let last_modified_date = format_http_date(last_modified); 81 + // WARNING: this swallows errors 82 + if let Ok(last_modified_value) = HeaderValue::from_str(&last_modified_date) { 83 + headers.insert(header::LAST_MODIFIED, last_modified_value); 84 + } 85 + 86 + // Add Cache-Control header if configured 87 + if let Some(cache_control) = &self.cache_control { 88 + // WARNING: this swallows errors 89 + if let Ok(cache_control_value) = HeaderValue::from_str(cache_control) { 90 + headers.insert(header::CACHE_CONTROL, cache_control_value); 91 + } 92 + } 93 + 94 + headers.insert("Allow", HeaderValue::from_static("GET, HEAD, OPTIONS")); 95 + headers.insert( 96 + header::ACCESS_CONTROL_ALLOW_HEADERS, 97 + HeaderValue::from_static("*"), 98 + ); 99 + headers.insert( 100 + header::ACCESS_CONTROL_ALLOW_METHODS, 101 + HeaderValue::from_static("GET, HEAD, OPTIONS"), 102 + ); 103 + headers.insert( 104 + header::ACCESS_CONTROL_ALLOW_ORIGIN, 105 + HeaderValue::from_static("*"), 106 + ); 107 + headers.insert( 108 + header::ACCESS_CONTROL_EXPOSE_HEADERS, 109 + HeaderValue::from_static("*"), 110 + ); 111 + headers.insert( 112 + header::ACCESS_CONTROL_MAX_AGE, 113 + HeaderValue::from_static("86400"), 114 + ); 115 + headers.insert( 116 + "Access-Control-Request-Headers", 117 + HeaderValue::from_static("*"), 118 + ); 119 + headers.insert( 120 + "Access-Control-Request-Method", 121 + HeaderValue::from_static("GET"), 122 + ); 123 + 124 + if let ResolutionResult::Success { .. } = self.result { 125 + let fresh = self 126 + .if_modified_since 127 + .and_then(|inner_header_value| match inner_header_value.to_str() { 128 + Ok(value) => Some(value.to_string()), 129 + Err(_) => None, 130 + }) 131 + .and_then(|inner_str_value| parse_http_date(&inner_str_value)) 132 + .is_some_and(|inner_if_modified_since| last_modified <= inner_if_modified_since); 133 + 134 + if fresh { 135 + return (StatusCode::NOT_MODIFIED, headers).into_response(); 136 + } 137 + } 138 + 139 + let fresh = self 140 + .if_none_match 141 + .is_some_and(|if_none_match_value| if_none_match_value == etag); 142 + if fresh { 143 + return (StatusCode::NOT_MODIFIED, headers).into_response(); 144 + } 145 + 146 + match &self.result { 147 + ResolutionResult::Success { did, .. } => ( 148 + StatusCode::OK, 149 + headers, 150 + Json(ResolveHandleResponse { did: did.clone() }), 151 + ) 152 + .into_response(), 153 + ResolutionResult::Error { error, message, .. } => ( 154 + StatusCode::BAD_REQUEST, 155 + headers, 156 + Json(ErrorResponse { 157 + error: error.clone(), 158 + message: message.clone(), 159 + }), 160 + ) 161 + .into_response(), 162 + } 163 + 164 + // (status_code, headers).into_response() 165 + } 166 + } 167 + 168 + /// Calculate a weak ETag for the given content using MetroHash64 with a seed 169 + fn calculate_etag(content: &str, seed: &str) -> String { 170 + let mut hasher = MetroHash64::new(); 171 + hasher.write(seed.as_bytes()); 172 + hasher.write(content.as_bytes()); 173 + let hash = hasher.finish(); 174 + format!("W/\"{:x}\"", hash) 175 + } 176 + 177 + /// Format a UNIX timestamp as an HTTP date string (RFC 7231) 178 + fn format_http_date(timestamp: u64) -> String { 179 + let system_time = UNIX_EPOCH + Duration::from_secs(timestamp); 180 + httpdate::fmt_http_date(system_time) 181 + } 182 + 183 + /// Parse an HTTP date string (RFC 7231) into a UNIX timestamp 184 + fn parse_http_date(date_str: &str) -> Option<u64> { 185 + httpdate::parse_http_date(date_str) 186 + .ok() 187 + .and_then(|system_time| system_time.duration_since(UNIX_EPOCH).ok()) 188 + .map(|duration| duration.as_secs()) 189 + } 190 + 34 191 pub(super) async fn handle_xrpc_resolve_handle( 192 + headers: HeaderMap, 35 193 Query(params): Query<ResolveHandleParams>, 194 + State(app_context): State<AppContext>, 36 195 State(handle_resolver): State<Arc<dyn HandleResolver>>, 37 196 State(queue): State<Arc<dyn QueueAdapter<HandleResolutionWork>>>, 38 - ) -> Result<impl IntoResponse, (StatusCode, Json<ErrorResponse>)> { 197 + State(metrics): State<SharedMetricsPublisher>, 198 + ) -> impl IntoResponse { 199 + let validating = params.validate.is_some(); 200 + let queueing = params.queue.is_some(); 201 + 39 202 // Validate that handle is provided 40 203 let handle = match params.handle { 41 204 Some(h) => h, 42 205 None => { 43 - return Err(( 206 + metrics 207 + .incr_with_tags( 208 + "xrpc.com.atproto.identity.resolveHandle.invalid_handle", 209 + &[("reason", "missing")], 210 + ) 211 + .await; 212 + return ( 44 213 StatusCode::BAD_REQUEST, 45 214 Json(ErrorResponse { 46 215 error: "InvalidRequest".to_string(), 47 216 message: "Error: Params must have the property \"handle\"".to_string(), 48 217 }), 49 - )); 218 + ) 219 + .into_response(); 50 220 } 51 221 }; 52 222 53 223 // Validate that the input is a handle and not a DID 54 224 let handle = match parse_input(&handle) { 55 - Ok(InputType::Handle(value)) => value, 225 + Ok(InputType::Handle(value)) => value.to_lowercase(), 56 226 Ok(InputType::Plc(_)) | Ok(InputType::Web(_)) => { 57 227 // It's a DID, not a handle 58 - return Err(( 228 + metrics 229 + .incr_with_tags( 230 + "xrpc.com.atproto.identity.resolveHandle.invalid_handle", 231 + &[("reason", "did")], 232 + ) 233 + .await; 234 + return ( 59 235 StatusCode::BAD_REQUEST, 60 236 Json(ErrorResponse { 61 237 error: "InvalidRequest".to_string(), 62 238 message: "Error: handle must be a valid handle".to_string(), 63 239 }), 64 - )); 240 + ) 241 + .into_response(); 65 242 } 66 243 Err(_) => { 67 - return Err(( 244 + metrics 245 + .incr_with_tags( 246 + "xrpc.com.atproto.identity.resolveHandle.invalid_handle", 247 + &[("reason", "error")], 248 + ) 249 + .await; 250 + return ( 68 251 StatusCode::BAD_REQUEST, 69 252 Json(ErrorResponse { 70 253 error: "InvalidRequest".to_string(), 71 254 message: "Error: handle must be a valid handle".to_string(), 72 255 }), 73 - )); 256 + ) 257 + .into_response(); 74 258 } 75 259 }; 76 260 77 - if params.validate.is_some() { 78 - return Ok(StatusCode::NO_CONTENT.into_response()); 261 + if validating { 262 + metrics 263 + .incr("xrpc.com.atproto.identity.resolveHandle") 264 + .await; 265 + return StatusCode::NO_CONTENT.into_response(); 79 266 } 80 267 81 - if params.queue.is_some() { 268 + if queueing { 82 269 // Create work item 83 270 let work = HandleResolutionWork::new(handle.clone()); 84 271 85 272 // Queue the work 86 273 match queue.push(work).await { 87 274 Ok(()) => { 275 + metrics 276 + .incr("xrpc.com.atproto.identity.resolveHandle") 277 + .await; 88 278 tracing::debug!("Queued handle resolution for {}", handle); 89 279 } 90 280 Err(e) => { 281 + metrics 282 + .incr("xrpc.com.atproto.identity.resolveHandle.queue_failure") 283 + .await; 91 284 tracing::error!("Failed to queue handle resolution: {}", e); 92 285 } 93 286 } 94 287 95 - return Ok(StatusCode::NO_CONTENT.into_response()); 288 + return StatusCode::NO_CONTENT.into_response(); 96 289 } 97 290 98 - tracing::debug!("Resolving handle: {}", handle); 291 + tracing::debug!(handle, "Resolving handle"); 292 + 293 + // Get conditional request headers 294 + let if_none_match = headers.get(header::IF_NONE_MATCH).cloned(); 295 + let if_modified_since = headers.get(header::IF_MODIFIED_SINCE).cloned(); 296 + 297 + // Perform the resolution and build the response 298 + let result = match handle_resolver.resolve(&handle).await { 299 + Ok((did, timestamp)) => { 300 + tracing::debug!(handle, did, "Found cached DID for handle"); 99 301 100 - match handle_resolver.resolve(&handle).await { 101 - Ok(did) => { 102 - tracing::debug!("Found cached DID for handle {}: {}", handle, did); 103 - Ok(Json(ResolveHandleResponse { did }).into_response()) 302 + metrics 303 + .incr_with_tags("handle.resolution.request", &[("success", "1")]) 304 + .await; 305 + 306 + let etag = calculate_etag(&did, app_context.etag_seed()); 307 + ResolutionResult::Success { 308 + did, 309 + timestamp, 310 + etag, 311 + } 104 312 } 105 - Err(_) => { 106 - // {"error":"InvalidRequest","message":"Unable to resolve handle"} 107 - Err(( 108 - StatusCode::BAD_REQUEST, 109 - Json(ErrorResponse { 110 - error: "InvalidRequest".to_string(), 111 - message: "Unable to resolve handle".to_string(), 112 - }), 113 - )) 313 + Err(err) => { 314 + tracing::debug!(error = ?err, handle, "Error resolving handle"); 315 + metrics 316 + .incr_with_tags("handle.resolution.request", &[("success", "0")]) 317 + .await; 318 + let error_content = format!("error:{}:{}", handle, err); 319 + let etag = calculate_etag(&error_content, app_context.etag_seed()); 320 + let timestamp = SystemTime::now() 321 + .duration_since(UNIX_EPOCH) 322 + .unwrap_or_default() 323 + .as_secs(); 324 + ResolutionResult::Error { 325 + error: "InvalidRequest".to_string(), 326 + message: "Unable to resolve handle".to_string(), 327 + timestamp, 328 + etag, 329 + } 114 330 } 331 + }; 332 + 333 + ResolutionResultView { 334 + result, 335 + cache_control: app_context.cache_control_header().map(|s| s.to_string()), 336 + if_none_match, 337 + if_modified_since, 115 338 } 339 + .into_response() 340 + } 341 + 342 + pub(super) async fn handle_xrpc_resolve_handle_options() -> impl IntoResponse { 343 + let mut headers = HeaderMap::new(); 344 + 345 + // Add CORS and Allow headers for OPTIONS request 346 + headers.insert("Allow", HeaderValue::from_static("GET, HEAD, OPTIONS")); 347 + headers.insert( 348 + header::ACCESS_CONTROL_ALLOW_HEADERS, 349 + HeaderValue::from_static("*"), 350 + ); 351 + headers.insert( 352 + header::ACCESS_CONTROL_ALLOW_METHODS, 353 + HeaderValue::from_static("GET, HEAD, OPTIONS"), 354 + ); 355 + headers.insert( 356 + header::ACCESS_CONTROL_ALLOW_ORIGIN, 357 + HeaderValue::from_static("*"), 358 + ); 359 + headers.insert( 360 + header::ACCESS_CONTROL_EXPOSE_HEADERS, 361 + HeaderValue::from_static("*"), 362 + ); 363 + headers.insert( 364 + header::ACCESS_CONTROL_MAX_AGE, 365 + HeaderValue::from_static("86400"), 366 + ); 367 + headers.insert( 368 + "Access-Control-Request-Headers", 369 + HeaderValue::from_static("*"), 370 + ); 371 + headers.insert( 372 + "Access-Control-Request-Method", 373 + HeaderValue::from_static("GET"), 374 + ); 375 + 376 + (StatusCode::NO_CONTENT, headers) 116 377 }
+126
src/http/handle_xrpc_resolve_lexicon.rs
··· 1 + use std::sync::Arc; 2 + 3 + use atproto_lexicon::resolve::LexiconResolver; 4 + use axum::{ 5 + extract::{Query, State}, 6 + http::{HeaderMap, HeaderValue, StatusCode, header}, 7 + response::{IntoResponse, Json}, 8 + }; 9 + use serde::{Deserialize, Serialize}; 10 + 11 + use crate::metrics::SharedMetricsPublisher; 12 + 13 + #[derive(Deserialize)] 14 + pub(super) struct ResolveLexiconParams { 15 + nsid: Option<String>, 16 + } 17 + 18 + #[derive(Serialize)] 19 + pub(super) struct ErrorResponse { 20 + error: String, 21 + message: String, 22 + } 23 + 24 + pub(super) async fn handle_xrpc_resolve_lexicon( 25 + Query(params): Query<ResolveLexiconParams>, 26 + State(lexicon_resolver): State<Arc<dyn LexiconResolver>>, 27 + State(metrics): State<SharedMetricsPublisher>, 28 + ) -> impl IntoResponse { 29 + // Validate that nsid is provided 30 + let nsid = match params.nsid { 31 + Some(n) => n, 32 + None => { 33 + metrics 34 + .incr_with_tags( 35 + "xrpc.com.atproto.lexicon.resolveLexicon.invalid_nsid", 36 + &[("reason", "missing")], 37 + ) 38 + .await; 39 + return ( 40 + StatusCode::BAD_REQUEST, 41 + Json(ErrorResponse { 42 + error: "InvalidRequest".to_string(), 43 + message: "Error: Params must have the property \"nsid\"".to_string(), 44 + }), 45 + ) 46 + .into_response(); 47 + } 48 + }; 49 + 50 + tracing::debug!(nsid, "Resolving lexicon"); 51 + 52 + // Perform the lexicon resolution 53 + match lexicon_resolver.resolve(&nsid).await { 54 + Ok(resolved) => { 55 + tracing::debug!(nsid, "Successfully resolved lexicon"); 56 + 57 + metrics 58 + .incr_with_tags("lexicon.resolution.request", &[("success", "1")]) 59 + .await; 60 + 61 + let mut headers = HeaderMap::new(); 62 + add_cors_headers(&mut headers); 63 + 64 + // The resolved value is already a serde_json::Value, so just return it as JSON 65 + (StatusCode::OK, headers, Json(resolved)).into_response() 66 + } 67 + Err(err) => { 68 + tracing::debug!(error = ?err, nsid, "Error resolving lexicon"); 69 + 70 + metrics 71 + .incr_with_tags("lexicon.resolution.request", &[("success", "0")]) 72 + .await; 73 + 74 + let mut headers = HeaderMap::new(); 75 + add_cors_headers(&mut headers); 76 + 77 + ( 78 + StatusCode::BAD_REQUEST, 79 + headers, 80 + Json(ErrorResponse { 81 + error: "LexiconNotFound".to_string(), 82 + message: "No lexicon was resolved for the NSID".to_string(), 83 + }), 84 + ) 85 + .into_response() 86 + } 87 + } 88 + } 89 + 90 + pub(super) async fn handle_xrpc_resolve_lexicon_options() -> impl IntoResponse { 91 + let mut headers = HeaderMap::new(); 92 + add_cors_headers(&mut headers); 93 + (StatusCode::NO_CONTENT, headers) 94 + } 95 + 96 + fn add_cors_headers(headers: &mut HeaderMap) { 97 + headers.insert("Allow", HeaderValue::from_static("GET, HEAD, OPTIONS")); 98 + headers.insert( 99 + header::ACCESS_CONTROL_ALLOW_HEADERS, 100 + HeaderValue::from_static("*"), 101 + ); 102 + headers.insert( 103 + header::ACCESS_CONTROL_ALLOW_METHODS, 104 + HeaderValue::from_static("GET, HEAD, OPTIONS"), 105 + ); 106 + headers.insert( 107 + header::ACCESS_CONTROL_ALLOW_ORIGIN, 108 + HeaderValue::from_static("*"), 109 + ); 110 + headers.insert( 111 + header::ACCESS_CONTROL_EXPOSE_HEADERS, 112 + HeaderValue::from_static("*"), 113 + ); 114 + headers.insert( 115 + header::ACCESS_CONTROL_MAX_AGE, 116 + HeaderValue::from_static("86400"), 117 + ); 118 + headers.insert( 119 + "Access-Control-Request-Headers", 120 + HeaderValue::from_static("*"), 121 + ); 122 + headers.insert( 123 + "Access-Control-Request-Method", 124 + HeaderValue::from_static("GET"), 125 + ); 126 + }
+1
src/http/mod.rs
··· 1 1 mod handle_xrpc_resolve_handle; // Internal handler 2 + mod handle_xrpc_resolve_lexicon; // Internal handler 2 3 mod server; // Internal server module 3 4 4 5 // Re-export only what the binary needs
+84 -45
src/http/server.rs
··· 1 1 use crate::handle_resolver::HandleResolver; 2 + use crate::metrics::SharedMetricsPublisher; 2 3 use crate::queue::{HandleResolutionWork, QueueAdapter}; 4 + use atproto_lexicon::resolve::LexiconResolver; 3 5 use axum::{ 4 6 Router, 5 - extract::State, 6 - response::{Html, IntoResponse, Json, Response}, 7 + extract::{MatchedPath, State}, 8 + http::Request, 9 + middleware::{self, Next}, 10 + response::{Json, Response}, 7 11 routing::get, 8 - http::StatusCode, 9 12 }; 10 13 use serde_json::json; 11 14 use std::sync::Arc; 15 + use std::time::Instant; 16 + use tower_http::services::ServeDir; 12 17 13 18 pub(crate) struct InnerAppContext { 14 - pub(crate) service_document: serde_json::Value, 15 - pub(crate) service_did: String, 16 19 pub(crate) handle_resolver: Arc<dyn HandleResolver>, 17 20 pub(crate) handle_queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 21 + pub(crate) lexicon_resolver: Arc<dyn LexiconResolver>, 22 + pub(crate) metrics: SharedMetricsPublisher, 23 + pub(crate) etag_seed: String, 24 + pub(crate) cache_control_header: Option<String>, 25 + pub(crate) static_files_dir: String, 18 26 } 19 27 20 28 #[derive(Clone)] ··· 23 31 impl AppContext { 24 32 /// Create a new AppContext with the provided configuration. 25 33 pub fn new( 26 - service_document: serde_json::Value, 27 - service_did: String, 28 34 handle_resolver: Arc<dyn HandleResolver>, 29 35 handle_queue: Arc<dyn QueueAdapter<HandleResolutionWork>>, 36 + lexicon_resolver: Arc<dyn LexiconResolver>, 37 + metrics: SharedMetricsPublisher, 38 + etag_seed: String, 39 + cache_control_header: Option<String>, 40 + static_files_dir: String, 30 41 ) -> Self { 31 42 Self(Arc::new(InnerAppContext { 32 - service_document, 33 - service_did, 34 43 handle_resolver, 35 44 handle_queue, 45 + lexicon_resolver, 46 + metrics, 47 + etag_seed, 48 + cache_control_header, 49 + static_files_dir, 36 50 })) 37 51 } 38 52 39 53 // Internal accessor methods for handlers 40 - pub(super) fn service_document(&self) -> &serde_json::Value { 41 - &self.0.service_document 54 + pub(super) fn etag_seed(&self) -> &str { 55 + &self.0.etag_seed 56 + } 57 + 58 + pub(super) fn cache_control_header(&self) -> Option<&str> { 59 + self.0.cache_control_header.as_deref() 42 60 } 43 61 44 - pub(super) fn service_did(&self) -> &str { 45 - &self.0.service_did 62 + pub(super) fn static_files_dir(&self) -> &str { 63 + &self.0.static_files_dir 46 64 } 47 65 } 48 66 ··· 64 82 handle_queue, 65 83 Arc<dyn QueueAdapter<HandleResolutionWork>> 66 84 ); 85 + impl_from_ref!(AppContext, lexicon_resolver, Arc<dyn LexiconResolver>); 86 + impl_from_ref!(AppContext, metrics, SharedMetricsPublisher); 87 + 88 + /// Middleware to track HTTP request metrics 89 + async fn metrics_middleware( 90 + State(metrics): State<SharedMetricsPublisher>, 91 + matched_path: Option<MatchedPath>, 92 + request: Request<axum::body::Body>, 93 + next: Next, 94 + ) -> Response { 95 + let start = Instant::now(); 96 + let method = request.method().to_string(); 97 + let path = matched_path 98 + .as_ref() 99 + .map(|p| p.as_str().to_string()) 100 + .unwrap_or_else(|| "unknown".to_string()); 101 + 102 + // Process the request 103 + let response = next.run(request).await; 104 + 105 + // Calculate duration 106 + let duration_ms = start.elapsed().as_millis() as u64; 107 + let status_code = response.status().as_u16().to_string(); 108 + 109 + // Publish metrics with tags 110 + metrics 111 + .time_with_tags( 112 + "http.request.duration_ms", 113 + duration_ms, 114 + &[ 115 + ("method", &method), 116 + ("path", &path), 117 + ("status", &status_code), 118 + ], 119 + ) 120 + .await; 121 + 122 + response 123 + } 67 124 68 125 pub fn create_router(app_context: AppContext) -> Router { 126 + let static_dir = app_context.static_files_dir().to_string(); 127 + 69 128 Router::new() 70 - .route("/", get(handle_index)) 71 - .route("/.well-known/did.json", get(handle_wellknown_did_json)) 72 - .route( 73 - "/.well-known/atproto-did", 74 - get(handle_wellknown_atproto_did), 75 - ) 76 129 .route("/xrpc/_health", get(handle_xrpc_health)) 77 130 .route( 78 131 "/xrpc/com.atproto.identity.resolveHandle", 79 - get(super::handle_xrpc_resolve_handle::handle_xrpc_resolve_handle), 132 + get(super::handle_xrpc_resolve_handle::handle_xrpc_resolve_handle) 133 + .options(super::handle_xrpc_resolve_handle::handle_xrpc_resolve_handle_options), 80 134 ) 135 + .route( 136 + "/xrpc/com.atproto.lexicon.resolveLexicon", 137 + get(super::handle_xrpc_resolve_lexicon::handle_xrpc_resolve_lexicon) 138 + .options(super::handle_xrpc_resolve_lexicon::handle_xrpc_resolve_lexicon_options), 139 + ) 140 + .fallback_service(ServeDir::new(static_dir)) 141 + .layer(middleware::from_fn_with_state( 142 + app_context.0.metrics.clone(), 143 + metrics_middleware, 144 + )) 81 145 .with_state(app_context) 82 - } 83 - 84 - pub(super) async fn handle_index() -> Html<&'static str> { 85 - Html( 86 - r#"<!DOCTYPE html> 87 - <html> 88 - <head> 89 - <title>QuickDID</title> 90 - </head> 91 - <body> 92 - <h1>QuickDID</h1> 93 - <p>AT Protocol Identity Resolution Service</p> 94 - </body> 95 - </html>"#, 96 - ) 97 - } 98 - 99 - pub(super) async fn handle_wellknown_did_json( 100 - State(context): State<AppContext>, 101 - ) -> Json<serde_json::Value> { 102 - Json(context.service_document().clone()) 103 - } 104 - 105 - pub(super) async fn handle_wellknown_atproto_did(State(context): State<AppContext>) -> Response { 106 - (StatusCode::OK, context.service_did().to_string()).into_response() 107 146 } 108 147 109 148 pub(super) async fn handle_xrpc_health() -> Json<serde_json::Value> {
+360
src/jetstream_handler.rs
··· 1 + //! Jetstream event handler for QuickDID 2 + //! 3 + //! This module provides the event handler for processing AT Protocol Jetstream events, 4 + //! specifically handling Account and Identity events to maintain cache consistency. 5 + 6 + use crate::handle_resolver::HandleResolver; 7 + use crate::metrics::MetricsPublisher; 8 + use anyhow::Result; 9 + use atproto_jetstream::{EventHandler, JetstreamEvent}; 10 + use std::sync::Arc; 11 + use tracing::{debug, info, warn}; 12 + 13 + /// Jetstream event handler for QuickDID 14 + /// 15 + /// This handler processes AT Protocol events from the Jetstream firehose to keep 16 + /// the handle resolver cache in sync with the network state. 17 + /// 18 + /// # Event Processing 19 + /// 20 + /// ## Account Events 21 + /// - When an account is marked as "deleted" or "deactivated", the DID is purged from the cache 22 + /// - Metrics are tracked for successful and failed purge operations 23 + /// 24 + /// ## Identity Events 25 + /// - When an identity event contains a handle, the handle-to-DID mapping is updated 26 + /// - When an identity event lacks a handle (indicating removal), the DID is purged 27 + /// - Metrics are tracked for successful and failed update/purge operations 28 + /// 29 + /// # Example 30 + /// 31 + /// ```no_run 32 + /// use quickdid::jetstream_handler::QuickDidEventHandler; 33 + /// use quickdid::handle_resolver::HandleResolver; 34 + /// use quickdid::metrics::MetricsPublisher; 35 + /// use std::sync::Arc; 36 + /// 37 + /// # async fn example(resolver: Arc<dyn HandleResolver>, metrics: Arc<dyn MetricsPublisher>) { 38 + /// let handler = QuickDidEventHandler::new(resolver, metrics); 39 + /// // Register with a JetstreamConsumer 40 + /// # } 41 + /// ``` 42 + pub struct QuickDidEventHandler { 43 + resolver: Arc<dyn HandleResolver>, 44 + metrics: Arc<dyn MetricsPublisher>, 45 + } 46 + 47 + impl QuickDidEventHandler { 48 + /// Create a new Jetstream event handler 49 + /// 50 + /// # Arguments 51 + /// 52 + /// * `resolver` - The handle resolver to use for cache operations 53 + /// * `metrics` - The metrics publisher for tracking event processing 54 + pub fn new(resolver: Arc<dyn HandleResolver>, metrics: Arc<dyn MetricsPublisher>) -> Self { 55 + Self { resolver, metrics } 56 + } 57 + } 58 + 59 + #[async_trait::async_trait] 60 + impl EventHandler for QuickDidEventHandler { 61 + fn handler_id(&self) -> String { 62 + "quickdid_handler".to_string() 63 + } 64 + 65 + async fn handle_event(&self, event: JetstreamEvent) -> Result<()> { 66 + match event { 67 + JetstreamEvent::Account { did, kind, .. } => { 68 + // If account kind is "deleted" or "deactivated", purge the DID 69 + if kind == "deleted" || kind == "deactivated" { 70 + info!(did = %did, kind = %kind, "Purging account"); 71 + match self.resolver.purge(&did).await { 72 + Ok(()) => { 73 + self.metrics.incr("jetstream.account.purged").await; 74 + } 75 + Err(e) => { 76 + warn!(did = %did, error = ?e, "Failed to purge DID"); 77 + self.metrics.incr("jetstream.account.purge_error").await; 78 + } 79 + } 80 + } 81 + self.metrics.incr("jetstream.account.processed").await; 82 + } 83 + JetstreamEvent::Identity { did, identity, .. } => { 84 + // Extract handle from identity JSON if available 85 + if !identity.is_null() { 86 + if let Some(handle_value) = identity.get("handle") { 87 + if let Some(handle) = handle_value.as_str() { 88 + info!(handle = %handle, did = %did, "Updating identity mapping"); 89 + match self.resolver.set(handle, &did).await { 90 + Ok(()) => { 91 + self.metrics.incr("jetstream.identity.updated").await; 92 + } 93 + Err(e) => { 94 + warn!(handle = %handle, did = %did, error = ?e, "Failed to update mapping"); 95 + self.metrics.incr("jetstream.identity.update_error").await; 96 + } 97 + } 98 + } else { 99 + // No handle or invalid handle, purge the DID 100 + info!(did = %did, "Purging identity without valid handle"); 101 + match self.resolver.purge(&did).await { 102 + Ok(()) => { 103 + self.metrics.incr("jetstream.identity.purged").await; 104 + } 105 + Err(e) => { 106 + warn!(did = %did, error = ?e, "Failed to purge DID"); 107 + self.metrics.incr("jetstream.identity.purge_error").await; 108 + } 109 + } 110 + } 111 + } else { 112 + // No handle field, purge the DID 113 + info!(did = %did, "Purging identity without handle field"); 114 + match self.resolver.purge(&did).await { 115 + Ok(()) => { 116 + self.metrics.incr("jetstream.identity.purged").await; 117 + } 118 + Err(e) => { 119 + warn!(did = %did, error = ?e, "Failed to purge DID"); 120 + self.metrics.incr("jetstream.identity.purge_error").await; 121 + } 122 + } 123 + } 124 + } else { 125 + // Null identity means removed, purge the DID 126 + info!(did = %did, "Purging identity with null info"); 127 + match self.resolver.purge(&did).await { 128 + Ok(()) => { 129 + self.metrics.incr("jetstream.identity.purged").await; 130 + } 131 + Err(e) => { 132 + warn!(did = %did, error = ?e, "Failed to purge DID"); 133 + self.metrics.incr("jetstream.identity.purge_error").await; 134 + } 135 + } 136 + } 137 + self.metrics.incr("jetstream.identity.processed").await; 138 + } 139 + _ => { 140 + // Other event types we don't care about 141 + debug!("Ignoring unhandled Jetstream event type"); 142 + } 143 + } 144 + Ok(()) 145 + } 146 + } 147 + 148 + #[cfg(test)] 149 + mod tests { 150 + use super::*; 151 + use crate::handle_resolver::HandleResolverError; 152 + use crate::metrics::NoOpMetricsPublisher; 153 + use async_trait::async_trait; 154 + use serde_json::json; 155 + 156 + /// Mock resolver for testing 157 + struct MockResolver { 158 + purge_called: std::sync::Arc<std::sync::Mutex<Vec<String>>>, 159 + set_called: std::sync::Arc<std::sync::Mutex<Vec<(String, String)>>>, 160 + } 161 + 162 + impl MockResolver { 163 + fn new() -> Self { 164 + Self { 165 + purge_called: std::sync::Arc::new(std::sync::Mutex::new(Vec::new())), 166 + set_called: std::sync::Arc::new(std::sync::Mutex::new(Vec::new())), 167 + } 168 + } 169 + 170 + fn get_purge_calls(&self) -> Vec<String> { 171 + self.purge_called.lock().unwrap().clone() 172 + } 173 + 174 + fn get_set_calls(&self) -> Vec<(String, String)> { 175 + self.set_called.lock().unwrap().clone() 176 + } 177 + } 178 + 179 + #[async_trait] 180 + impl HandleResolver for MockResolver { 181 + async fn resolve(&self, _handle: &str) -> Result<(String, u64), HandleResolverError> { 182 + unimplemented!("Not needed for tests") 183 + } 184 + 185 + async fn purge(&self, subject: &str) -> Result<(), HandleResolverError> { 186 + self.purge_called.lock().unwrap().push(subject.to_string()); 187 + Ok(()) 188 + } 189 + 190 + async fn set(&self, handle: &str, did: &str) -> Result<(), HandleResolverError> { 191 + self.set_called 192 + .lock() 193 + .unwrap() 194 + .push((handle.to_string(), did.to_string())); 195 + Ok(()) 196 + } 197 + } 198 + 199 + #[tokio::test] 200 + async fn test_account_deleted_event() { 201 + let resolver = Arc::new(MockResolver::new()); 202 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 203 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 204 + 205 + // Create a deleted account event 206 + let event = JetstreamEvent::Account { 207 + did: "did:plc:test123".to_string(), 208 + kind: "deleted".to_string(), 209 + time_us: 0, 210 + account: json!(null), 211 + }; 212 + 213 + handler.handle_event(event).await.unwrap(); 214 + 215 + // Verify the DID was purged 216 + let purge_calls = resolver.get_purge_calls(); 217 + assert_eq!(purge_calls.len(), 1); 218 + assert_eq!(purge_calls[0], "did:plc:test123"); 219 + } 220 + 221 + #[tokio::test] 222 + async fn test_account_deactivated_event() { 223 + let resolver = Arc::new(MockResolver::new()); 224 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 225 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 226 + 227 + // Create a deactivated account event 228 + let event = JetstreamEvent::Account { 229 + did: "did:plc:test456".to_string(), 230 + kind: "deactivated".to_string(), 231 + time_us: 0, 232 + account: json!(null), 233 + }; 234 + 235 + handler.handle_event(event).await.unwrap(); 236 + 237 + // Verify the DID was purged 238 + let purge_calls = resolver.get_purge_calls(); 239 + assert_eq!(purge_calls.len(), 1); 240 + assert_eq!(purge_calls[0], "did:plc:test456"); 241 + } 242 + 243 + #[tokio::test] 244 + async fn test_account_active_event() { 245 + let resolver = Arc::new(MockResolver::new()); 246 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 247 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 248 + 249 + // Create an active account event (should not purge) 250 + let event = JetstreamEvent::Account { 251 + did: "did:plc:test789".to_string(), 252 + kind: "active".to_string(), 253 + time_us: 0, 254 + account: json!(null), 255 + }; 256 + 257 + handler.handle_event(event).await.unwrap(); 258 + 259 + // Verify the DID was NOT purged 260 + let purge_calls = resolver.get_purge_calls(); 261 + assert_eq!(purge_calls.len(), 0); 262 + } 263 + 264 + #[tokio::test] 265 + async fn test_identity_with_handle_event() { 266 + let resolver = Arc::new(MockResolver::new()); 267 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 268 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 269 + 270 + // Create an identity event with a handle 271 + let event = JetstreamEvent::Identity { 272 + did: "did:plc:testuser".to_string(), 273 + kind: "update".to_string(), 274 + time_us: 0, 275 + identity: json!({ 276 + "handle": "alice.bsky.social" 277 + }), 278 + }; 279 + 280 + handler.handle_event(event).await.unwrap(); 281 + 282 + // Verify the set method was called 283 + let set_calls = resolver.get_set_calls(); 284 + assert_eq!(set_calls.len(), 1); 285 + assert_eq!( 286 + set_calls[0], 287 + ( 288 + "alice.bsky.social".to_string(), 289 + "did:plc:testuser".to_string() 290 + ) 291 + ); 292 + 293 + // Verify no purge was called 294 + let purge_calls = resolver.get_purge_calls(); 295 + assert_eq!(purge_calls.len(), 0); 296 + } 297 + 298 + #[tokio::test] 299 + async fn test_identity_without_handle_event() { 300 + let resolver = Arc::new(MockResolver::new()); 301 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 302 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 303 + 304 + // Create an identity event without a handle field 305 + let event = JetstreamEvent::Identity { 306 + did: "did:plc:nohandle".to_string(), 307 + kind: "update".to_string(), 308 + time_us: 0, 309 + identity: json!({ 310 + "other_field": "value" 311 + }), 312 + }; 313 + 314 + handler.handle_event(event).await.unwrap(); 315 + 316 + // Verify the DID was purged 317 + let purge_calls = resolver.get_purge_calls(); 318 + assert_eq!(purge_calls.len(), 1); 319 + assert_eq!(purge_calls[0], "did:plc:nohandle"); 320 + 321 + // Verify set was not called 322 + let set_calls = resolver.get_set_calls(); 323 + assert_eq!(set_calls.len(), 0); 324 + } 325 + 326 + #[tokio::test] 327 + async fn test_identity_with_null_identity() { 328 + let resolver = Arc::new(MockResolver::new()); 329 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 330 + let handler = QuickDidEventHandler::new(resolver.clone(), metrics); 331 + 332 + // Create an identity event with null identity 333 + let event = JetstreamEvent::Identity { 334 + did: "did:plc:nullidentity".to_string(), 335 + kind: "delete".to_string(), 336 + time_us: 0, 337 + identity: json!(null), 338 + }; 339 + 340 + handler.handle_event(event).await.unwrap(); 341 + 342 + // Verify the DID was purged 343 + let purge_calls = resolver.get_purge_calls(); 344 + assert_eq!(purge_calls.len(), 1); 345 + assert_eq!(purge_calls[0], "did:plc:nullidentity"); 346 + 347 + // Verify set was not called 348 + let set_calls = resolver.get_set_calls(); 349 + assert_eq!(set_calls.len(), 0); 350 + } 351 + 352 + #[tokio::test] 353 + async fn test_handler_id() { 354 + let resolver = Arc::new(MockResolver::new()); 355 + let metrics = Arc::new(NoOpMetricsPublisher::new()); 356 + let handler = QuickDidEventHandler::new(resolver, metrics); 357 + 358 + assert_eq!(handler.handler_id(), "quickdid_handler"); 359 + } 360 + }
+8
src/lexicon_resolver/mod.rs
··· 1 + //! Lexicon resolution with caching support. 2 + //! 3 + //! This module provides implementations for resolving AT Protocol lexicons (NSIDs) 4 + //! to their schemas with various caching strategies. 5 + 6 + mod redis; 7 + 8 + pub use redis::{create_redis_lexicon_resolver, create_redis_lexicon_resolver_with_ttl};
+458
src/lexicon_resolver/redis.rs
··· 1 + //! Redis-backed caching lexicon resolver. 2 + //! 3 + //! This module provides a lexicon resolver that caches resolution results in Redis 4 + //! with configurable expiration times. Redis caching provides persistence across 5 + //! service restarts and allows sharing of cached results across multiple instances. 6 + 7 + use crate::metrics::SharedMetricsPublisher; 8 + use async_trait::async_trait; 9 + use atproto_lexicon::resolve::LexiconResolver; 10 + use deadpool_redis::{Pool as RedisPool, redis::AsyncCommands}; 11 + use metrohash::MetroHash64; 12 + use std::hash::Hasher as _; 13 + use std::sync::Arc; 14 + 15 + /// Redis-backed caching lexicon resolver. 16 + /// 17 + /// This resolver caches lexicon resolution results in Redis with a configurable TTL. 18 + /// Results are stored as JSON bytes to minimize storage overhead while maintaining 19 + /// the schema structure. 20 + /// 21 + /// # Features 22 + /// 23 + /// - Persistent caching across service restarts 24 + /// - Shared cache across multiple service instances 25 + /// - Configurable TTL (default: 90 days) 26 + /// - JSON storage format for lexicon schemas 27 + /// - Graceful fallback if Redis is unavailable 28 + /// 29 + /// # Example 30 + /// 31 + /// ```no_run 32 + /// use std::sync::Arc; 33 + /// use deadpool_redis::Pool; 34 + /// use atproto_lexicon::resolve::LexiconResolver; 35 + /// use quickdid::lexicon_resolver::create_redis_lexicon_resolver; 36 + /// use quickdid::metrics::NoOpMetricsPublisher; 37 + /// 38 + /// # async fn example() { 39 + /// # let inner_resolver: Arc<dyn LexiconResolver> = todo!(); 40 + /// # let redis_pool: Pool = todo!(); 41 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 42 + /// // Create with default 90-day TTL 43 + /// let resolver = create_redis_lexicon_resolver( 44 + /// inner_resolver, 45 + /// redis_pool, 46 + /// metrics 47 + /// ); 48 + /// # } 49 + /// ``` 50 + pub(super) struct RedisLexiconResolver { 51 + /// Base lexicon resolver to perform actual resolution 52 + inner: Arc<dyn LexiconResolver>, 53 + /// Redis connection pool 54 + pool: RedisPool, 55 + /// Redis key prefix for lexicon resolution cache 56 + key_prefix: String, 57 + /// TTL for cache entries in seconds 58 + ttl_seconds: u64, 59 + /// Metrics publisher for telemetry 60 + metrics: SharedMetricsPublisher, 61 + } 62 + 63 + impl RedisLexiconResolver { 64 + /// Create a new Redis-backed lexicon resolver with default 90-day TTL. 65 + fn new( 66 + inner: Arc<dyn LexiconResolver>, 67 + pool: RedisPool, 68 + metrics: SharedMetricsPublisher, 69 + ) -> Self { 70 + Self::with_ttl(inner, pool, 90 * 24 * 60 * 60, metrics) // 90 days default 71 + } 72 + 73 + /// Create a new Redis-backed lexicon resolver with custom TTL. 74 + fn with_ttl( 75 + inner: Arc<dyn LexiconResolver>, 76 + pool: RedisPool, 77 + ttl_seconds: u64, 78 + metrics: SharedMetricsPublisher, 79 + ) -> Self { 80 + Self::with_full_config(inner, pool, "lexicon:".to_string(), ttl_seconds, metrics) 81 + } 82 + 83 + /// Create a new Redis-backed lexicon resolver with full configuration. 84 + fn with_full_config( 85 + inner: Arc<dyn LexiconResolver>, 86 + pool: RedisPool, 87 + key_prefix: String, 88 + ttl_seconds: u64, 89 + metrics: SharedMetricsPublisher, 90 + ) -> Self { 91 + Self { 92 + inner, 93 + pool, 94 + key_prefix, 95 + ttl_seconds, 96 + metrics, 97 + } 98 + } 99 + 100 + /// Generate the Redis key for an NSID. 101 + /// 102 + /// Uses MetroHash64 to generate a consistent hash of the NSID 103 + /// for use as the Redis key. This provides better key distribution 104 + /// and avoids issues with special characters in NSIDs. 105 + fn make_key(&self, nsid: &str) -> String { 106 + let mut h = MetroHash64::default(); 107 + h.write(nsid.as_bytes()); 108 + format!("{}{}", self.key_prefix, h.finish()) 109 + } 110 + 111 + /// Get the TTL in seconds. 112 + fn ttl_seconds(&self) -> u64 { 113 + self.ttl_seconds 114 + } 115 + } 116 + 117 + #[async_trait] 118 + impl LexiconResolver for RedisLexiconResolver { 119 + async fn resolve(&self, nsid: &str) -> Result<serde_json::Value, anyhow::Error> { 120 + let key = self.make_key(nsid); 121 + 122 + // Try to get from Redis cache first 123 + match self.pool.get().await { 124 + Ok(mut conn) => { 125 + // Check if the key exists in Redis (stored as JSON bytes) 126 + let cached: Option<Vec<u8>> = match conn.get(&key).await { 127 + Ok(value) => value, 128 + Err(e) => { 129 + self.metrics.incr("lexicon_resolver.redis.get_error").await; 130 + tracing::warn!("Failed to get NSID from Redis cache: {}", e); 131 + None 132 + } 133 + }; 134 + 135 + if let Some(cached_bytes) = cached { 136 + // Deserialize the cached JSON 137 + match serde_json::from_slice::<serde_json::Value>(&cached_bytes) { 138 + Ok(cached_value) => { 139 + tracing::debug!("Cache hit for NSID {}", nsid); 140 + self.metrics.incr("lexicon_resolver.redis.cache_hit").await; 141 + return Ok(cached_value); 142 + } 143 + Err(e) => { 144 + tracing::warn!( 145 + "Failed to deserialize cached lexicon for NSID {}: {}", 146 + nsid, 147 + e 148 + ); 149 + self.metrics 150 + .incr("lexicon_resolver.redis.deserialize_error") 151 + .await; 152 + // Fall through to re-resolve if deserialization fails 153 + } 154 + } 155 + } 156 + 157 + // Not in cache, resolve through inner resolver 158 + tracing::debug!("Cache miss for NSID {}, resolving...", nsid); 159 + self.metrics.incr("lexicon_resolver.redis.cache_miss").await; 160 + let result = self.inner.resolve(nsid).await; 161 + 162 + // Cache successful result 163 + if let Ok(ref schema) = result { 164 + // Serialize to JSON bytes 165 + match serde_json::to_vec(schema) { 166 + Ok(bytes) => { 167 + // Set with expiration (ignore errors to not fail the resolution) 168 + if let Err(e) = conn 169 + .set_ex::<_, _, ()>(&key, bytes, self.ttl_seconds()) 170 + .await 171 + { 172 + tracing::warn!( 173 + "Failed to cache lexicon resolution in Redis: {}", 174 + e 175 + ); 176 + self.metrics 177 + .incr("lexicon_resolver.redis.cache_set_error") 178 + .await; 179 + } else { 180 + tracing::debug!("Cached lexicon for NSID {}", nsid); 181 + self.metrics.incr("lexicon_resolver.redis.cache_set").await; 182 + } 183 + } 184 + Err(e) => { 185 + tracing::warn!( 186 + "Failed to serialize lexicon result for NSID {}: {}", 187 + nsid, 188 + e 189 + ); 190 + self.metrics 191 + .incr("lexicon_resolver.redis.serialize_error") 192 + .await; 193 + } 194 + } 195 + } 196 + 197 + result 198 + } 199 + Err(e) => { 200 + // Redis connection failed, fall back to inner resolver 201 + tracing::warn!( 202 + "Failed to get Redis connection, falling back to uncached resolution: {}", 203 + e 204 + ); 205 + self.metrics 206 + .incr("lexicon_resolver.redis.connection_error") 207 + .await; 208 + self.inner.resolve(nsid).await 209 + } 210 + } 211 + } 212 + } 213 + 214 + /// Create a new Redis-backed lexicon resolver with default 90-day TTL. 215 + /// 216 + /// # Arguments 217 + /// 218 + /// * `inner` - The underlying resolver to use for actual resolution 219 + /// * `pool` - Redis connection pool 220 + /// * `metrics` - Metrics publisher for telemetry 221 + /// 222 + /// # Example 223 + /// 224 + /// ```no_run 225 + /// use std::sync::Arc; 226 + /// use atproto_lexicon::resolve::{DefaultLexiconResolver, LexiconResolver}; 227 + /// use quickdid::lexicon_resolver::create_redis_lexicon_resolver; 228 + /// use quickdid::cache::create_redis_pool; 229 + /// use quickdid::metrics::NoOpMetricsPublisher; 230 + /// 231 + /// # async fn example() -> anyhow::Result<()> { 232 + /// # use atproto_identity::resolve::HickoryDnsResolver; 233 + /// # use reqwest::Client; 234 + /// # let dns_resolver = HickoryDnsResolver::create_resolver(&[]); 235 + /// # let http_client = Client::new(); 236 + /// # let metrics = Arc::new(NoOpMetricsPublisher); 237 + /// let base: Arc<dyn LexiconResolver> = Arc::new( 238 + /// DefaultLexiconResolver::new(http_client, dns_resolver) 239 + /// ); 240 + /// 241 + /// let pool = create_redis_pool("redis://localhost:6379")?; 242 + /// let resolver = create_redis_lexicon_resolver(base, pool, metrics); 243 + /// let schema = resolver.resolve("app.bsky.feed.post").await.unwrap(); 244 + /// # Ok(()) 245 + /// # } 246 + /// ``` 247 + pub fn create_redis_lexicon_resolver( 248 + inner: Arc<dyn LexiconResolver>, 249 + pool: RedisPool, 250 + metrics: SharedMetricsPublisher, 251 + ) -> Arc<dyn LexiconResolver> { 252 + Arc::new(RedisLexiconResolver::new(inner, pool, metrics)) 253 + } 254 + 255 + /// Create a new Redis-backed lexicon resolver with custom TTL. 256 + /// 257 + /// # Arguments 258 + /// 259 + /// * `inner` - The underlying resolver to use for actual resolution 260 + /// * `pool` - Redis connection pool 261 + /// * `ttl_seconds` - TTL for cache entries in seconds 262 + /// * `metrics` - Metrics publisher for telemetry 263 + pub fn create_redis_lexicon_resolver_with_ttl( 264 + inner: Arc<dyn LexiconResolver>, 265 + pool: RedisPool, 266 + ttl_seconds: u64, 267 + metrics: SharedMetricsPublisher, 268 + ) -> Arc<dyn LexiconResolver> { 269 + Arc::new(RedisLexiconResolver::with_ttl( 270 + inner, 271 + pool, 272 + ttl_seconds, 273 + metrics, 274 + )) 275 + } 276 + 277 + #[cfg(test)] 278 + mod tests { 279 + use super::*; 280 + 281 + // Mock lexicon resolver for testing 282 + #[derive(Clone)] 283 + struct MockLexiconResolver { 284 + should_fail: bool, 285 + expected_schema: serde_json::Value, 286 + } 287 + 288 + #[async_trait] 289 + impl LexiconResolver for MockLexiconResolver { 290 + async fn resolve(&self, _nsid: &str) -> Result<serde_json::Value, anyhow::Error> { 291 + if self.should_fail { 292 + Err(anyhow::anyhow!("Mock resolution failure")) 293 + } else { 294 + Ok(self.expected_schema.clone()) 295 + } 296 + } 297 + } 298 + 299 + #[tokio::test] 300 + async fn test_redis_lexicon_resolver_cache_hit() { 301 + let pool = match crate::test_helpers::get_test_redis_pool() { 302 + Some(p) => p, 303 + None => return, 304 + }; 305 + 306 + // Create mock resolver with sample schema 307 + let schema = serde_json::json!({ 308 + "lexicon": 1, 309 + "id": "app.bsky.feed.post", 310 + "defs": { 311 + "main": { 312 + "type": "record", 313 + "description": "A post record" 314 + } 315 + } 316 + }); 317 + 318 + let mock_resolver = Arc::new(MockLexiconResolver { 319 + should_fail: false, 320 + expected_schema: schema.clone(), 321 + }); 322 + 323 + // Create metrics publisher 324 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 325 + 326 + // Create Redis-backed resolver with a unique key prefix for testing 327 + let test_prefix = format!( 328 + "test:lexicon:{}:", 329 + std::time::SystemTime::now() 330 + .duration_since(std::time::UNIX_EPOCH) 331 + .unwrap() 332 + .as_nanos() 333 + ); 334 + let redis_resolver = RedisLexiconResolver::with_full_config( 335 + mock_resolver, 336 + pool.clone(), 337 + test_prefix.clone(), 338 + 3600, 339 + metrics, 340 + ); 341 + 342 + let test_nsid = "app.bsky.feed.post"; 343 + 344 + // First resolution - should call inner resolver 345 + let result1 = redis_resolver.resolve(test_nsid).await.unwrap(); 346 + assert_eq!(result1, schema); 347 + 348 + // Second resolution - should hit cache 349 + let result2 = redis_resolver.resolve(test_nsid).await.unwrap(); 350 + assert_eq!(result2, schema); 351 + 352 + // Clean up test data 353 + if let Ok(mut conn) = pool.get().await { 354 + let mut h = MetroHash64::default(); 355 + h.write(test_nsid.as_bytes()); 356 + let key = format!("{}{}", test_prefix, h.finish()); 357 + let _: Result<(), _> = conn.del(key).await; 358 + } 359 + } 360 + 361 + #[tokio::test] 362 + async fn test_redis_lexicon_resolver_cache_miss() { 363 + let pool = match crate::test_helpers::get_test_redis_pool() { 364 + Some(p) => p, 365 + None => return, 366 + }; 367 + 368 + let schema = serde_json::json!({ 369 + "lexicon": 1, 370 + "id": "com.example.test", 371 + }); 372 + 373 + let mock_resolver = Arc::new(MockLexiconResolver { 374 + should_fail: false, 375 + expected_schema: schema.clone(), 376 + }); 377 + 378 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 379 + 380 + let test_prefix = format!( 381 + "test:lexicon:{}:", 382 + std::time::SystemTime::now() 383 + .duration_since(std::time::UNIX_EPOCH) 384 + .unwrap() 385 + .as_nanos() 386 + ); 387 + let redis_resolver = RedisLexiconResolver::with_full_config( 388 + mock_resolver, 389 + pool.clone(), 390 + test_prefix.clone(), 391 + 3600, 392 + metrics, 393 + ); 394 + 395 + let test_nsid = "com.example.test"; 396 + 397 + // Ensure key doesn't exist 398 + if let Ok(mut conn) = pool.get().await { 399 + let mut h = MetroHash64::default(); 400 + h.write(test_nsid.as_bytes()); 401 + let key = format!("{}{}", test_prefix, h.finish()); 402 + let _: Result<(), _> = conn.del(&key).await; 403 + } 404 + 405 + // Resolution should succeed and cache the result 406 + let result = redis_resolver.resolve(test_nsid).await.unwrap(); 407 + assert_eq!(result, schema); 408 + 409 + // Verify the result was cached 410 + if let Ok(mut conn) = pool.get().await { 411 + let mut h = MetroHash64::default(); 412 + h.write(test_nsid.as_bytes()); 413 + let key = format!("{}{}", test_prefix, h.finish()); 414 + let exists: bool = conn.exists(&key).await.unwrap(); 415 + assert!(exists, "Result should be cached"); 416 + 417 + // Clean up 418 + let _: Result<(), _> = conn.del(key).await; 419 + } 420 + } 421 + 422 + #[tokio::test] 423 + async fn test_redis_lexicon_resolver_error_handling() { 424 + let pool = match crate::test_helpers::get_test_redis_pool() { 425 + Some(p) => p, 426 + None => return, 427 + }; 428 + 429 + // Create mock resolver that fails 430 + let mock_resolver = Arc::new(MockLexiconResolver { 431 + should_fail: true, 432 + expected_schema: serde_json::Value::Null, 433 + }); 434 + 435 + let metrics = Arc::new(crate::metrics::NoOpMetricsPublisher); 436 + 437 + let test_prefix = format!( 438 + "test:lexicon:{}:", 439 + std::time::SystemTime::now() 440 + .duration_since(std::time::UNIX_EPOCH) 441 + .unwrap() 442 + .as_nanos() 443 + ); 444 + let redis_resolver = RedisLexiconResolver::with_full_config( 445 + mock_resolver, 446 + pool.clone(), 447 + test_prefix, 448 + 3600, 449 + metrics, 450 + ); 451 + 452 + let test_nsid = "com.example.nonexistent"; 453 + 454 + // Resolution should fail 455 + let result = redis_resolver.resolve(test_nsid).await; 456 + assert!(result.is_err()); 457 + } 458 + }
+3
src/lib.rs
··· 2 2 pub mod config; // Config and Args needed by binary 3 3 pub mod handle_resolver; // Only traits and factory functions exposed 4 4 pub mod http; // Only create_router exposed 5 + pub mod jetstream_handler; // Jetstream event handler for AT Protocol events 6 + pub mod lexicon_resolver; // Lexicon resolution with caching support 5 7 6 8 // Semi-public modules - needed by binary but with limited exposure 7 9 pub mod cache; // Only create_redis_pool exposed 8 10 pub mod handle_resolver_task; // Factory functions and TaskConfig exposed 11 + pub mod metrics; // Metrics publishing trait and implementations 9 12 pub mod queue; // Queue adapter system with trait and factory functions 10 13 pub mod sqlite_schema; // SQLite schema management functions exposed 11 14 pub mod task_manager; // Only spawn_cancellable_task exposed
+547
src/metrics.rs
··· 1 + use crate::config::Config; 2 + use async_trait::async_trait; 3 + use cadence::{ 4 + BufferedUdpMetricSink, Counted, CountedExt, Gauged, Metric, QueuingMetricSink, StatsdClient, 5 + Timed, 6 + }; 7 + use std::net::UdpSocket; 8 + use std::sync::Arc; 9 + use thiserror::Error; 10 + use tracing::{debug, error}; 11 + 12 + /// Trait for publishing metrics with counter and gauge support 13 + /// Designed for minimal compatibility with cadence-style metrics 14 + #[async_trait] 15 + pub trait MetricsPublisher: Send + Sync { 16 + /// Increment a counter by 1 17 + async fn incr(&self, key: &str); 18 + 19 + /// Increment a counter by a specific value 20 + async fn count(&self, key: &str, value: u64); 21 + 22 + /// Increment a counter with tags 23 + async fn incr_with_tags(&self, key: &str, tags: &[(&str, &str)]); 24 + 25 + /// Increment a counter by a specific value with tags 26 + async fn count_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]); 27 + 28 + /// Record a gauge value 29 + async fn gauge(&self, key: &str, value: u64); 30 + 31 + /// Record a gauge value with tags 32 + async fn gauge_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]); 33 + 34 + /// Record a timing in milliseconds 35 + async fn time(&self, key: &str, millis: u64); 36 + 37 + /// Record a timing with tags 38 + async fn time_with_tags(&self, key: &str, millis: u64, tags: &[(&str, &str)]); 39 + } 40 + 41 + /// No-op implementation for development and testing 42 + #[derive(Debug, Clone, Default)] 43 + pub struct NoOpMetricsPublisher; 44 + 45 + impl NoOpMetricsPublisher { 46 + pub fn new() -> Self { 47 + Self 48 + } 49 + } 50 + 51 + #[async_trait] 52 + impl MetricsPublisher for NoOpMetricsPublisher { 53 + async fn incr(&self, _key: &str) { 54 + // No-op 55 + } 56 + 57 + async fn count(&self, _key: &str, _value: u64) { 58 + // No-op 59 + } 60 + 61 + async fn incr_with_tags(&self, _key: &str, _tags: &[(&str, &str)]) { 62 + // No-op 63 + } 64 + 65 + async fn count_with_tags(&self, _key: &str, _value: u64, _tags: &[(&str, &str)]) { 66 + // No-op 67 + } 68 + 69 + async fn gauge(&self, _key: &str, _value: u64) { 70 + // No-op 71 + } 72 + 73 + async fn gauge_with_tags(&self, _key: &str, _value: u64, _tags: &[(&str, &str)]) { 74 + // No-op 75 + } 76 + 77 + async fn time(&self, _key: &str, _millis: u64) { 78 + // No-op 79 + } 80 + 81 + async fn time_with_tags(&self, _key: &str, _millis: u64, _tags: &[(&str, &str)]) { 82 + // No-op 83 + } 84 + } 85 + 86 + /// Statsd-backed metrics publisher using cadence 87 + pub struct StatsdMetricsPublisher { 88 + client: StatsdClient, 89 + default_tags: Vec<(String, String)>, 90 + } 91 + 92 + impl StatsdMetricsPublisher { 93 + /// Create a new StatsdMetricsPublisher with default configuration 94 + pub fn new(host: &str, prefix: &str) -> Result<Self, Box<dyn std::error::Error>> { 95 + Self::new_with_bind(host, prefix, "[::]:0") 96 + } 97 + 98 + /// Create a new StatsdMetricsPublisher with custom bind address 99 + pub fn new_with_bind( 100 + host: &str, 101 + prefix: &str, 102 + bind_addr: &str, 103 + ) -> Result<Self, Box<dyn std::error::Error>> { 104 + Self::new_with_bind_and_tags(host, prefix, bind_addr, vec![]) 105 + } 106 + 107 + /// Create a new StatsdMetricsPublisher with default tags 108 + pub fn new_with_tags( 109 + host: &str, 110 + prefix: &str, 111 + default_tags: Vec<(String, String)>, 112 + ) -> Result<Self, Box<dyn std::error::Error>> { 113 + Self::new_with_bind_and_tags(host, prefix, "[::]:0", default_tags) 114 + } 115 + 116 + /// Create a new StatsdMetricsPublisher with custom bind address and tags 117 + pub fn new_with_bind_and_tags( 118 + host: &str, 119 + prefix: &str, 120 + bind_addr: &str, 121 + default_tags: Vec<(String, String)>, 122 + ) -> Result<Self, Box<dyn std::error::Error>> { 123 + tracing::info!( 124 + "Creating StatsdMetricsPublisher: host={}, prefix={}, bind={}, tags={:?}", 125 + host, 126 + prefix, 127 + bind_addr, 128 + default_tags 129 + ); 130 + 131 + let socket = UdpSocket::bind(bind_addr)?; 132 + socket.set_nonblocking(true)?; 133 + 134 + let buffered_sink = BufferedUdpMetricSink::from(host, socket)?; 135 + let queuing_sink = QueuingMetricSink::builder() 136 + .with_error_handler(move |error| { 137 + error!("Failed to send metric via sink: {}", error); 138 + }) 139 + .build(buffered_sink); 140 + let client = StatsdClient::from_sink(prefix, queuing_sink); 141 + 142 + tracing::info!( 143 + "StatsdMetricsPublisher created successfully with bind address: {}", 144 + bind_addr 145 + ); 146 + Ok(Self { 147 + client, 148 + default_tags, 149 + }) 150 + } 151 + 152 + /// Create from an existing StatsdClient 153 + pub fn from_client(client: StatsdClient) -> Self { 154 + Self::from_client_with_tags(client, vec![]) 155 + } 156 + 157 + /// Create from an existing StatsdClient with default tags 158 + pub fn from_client_with_tags( 159 + client: StatsdClient, 160 + default_tags: Vec<(String, String)>, 161 + ) -> Self { 162 + Self { 163 + client, 164 + default_tags, 165 + } 166 + } 167 + 168 + /// Apply default tags to a builder 169 + fn apply_default_tags<'a, M>( 170 + &'a self, 171 + mut builder: cadence::MetricBuilder<'a, 'a, M>, 172 + ) -> cadence::MetricBuilder<'a, 'a, M> 173 + where 174 + M: Metric + From<String>, 175 + { 176 + for (k, v) in &self.default_tags { 177 + builder = builder.with_tag(k.as_str(), v.as_str()); 178 + } 179 + builder 180 + } 181 + } 182 + 183 + #[async_trait] 184 + impl MetricsPublisher for StatsdMetricsPublisher { 185 + async fn incr(&self, key: &str) { 186 + debug!("Sending metric incr: {}", key); 187 + if self.default_tags.is_empty() { 188 + match self.client.incr(key) { 189 + Ok(_) => debug!("Successfully sent metric: {}", key), 190 + Err(e) => error!("Failed to send metric {}: {}", key, e), 191 + } 192 + } else { 193 + let builder = self.client.incr_with_tags(key); 194 + let builder = self.apply_default_tags(builder); 195 + let _ = builder.send(); 196 + debug!("Sent metric with tags: {}", key); 197 + } 198 + } 199 + 200 + async fn count(&self, key: &str, value: u64) { 201 + if self.default_tags.is_empty() { 202 + let _ = self.client.count(key, value); 203 + } else { 204 + let builder = self.client.count_with_tags(key, value); 205 + let builder = self.apply_default_tags(builder); 206 + let _ = builder.send(); 207 + } 208 + } 209 + 210 + async fn incr_with_tags(&self, key: &str, tags: &[(&str, &str)]) { 211 + let mut builder = self.client.incr_with_tags(key); 212 + builder = self.apply_default_tags(builder); 213 + for (k, v) in tags { 214 + builder = builder.with_tag(k, v); 215 + } 216 + let _ = builder.send(); 217 + } 218 + 219 + async fn count_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]) { 220 + let mut builder = self.client.count_with_tags(key, value); 221 + builder = self.apply_default_tags(builder); 222 + for (k, v) in tags { 223 + builder = builder.with_tag(k, v); 224 + } 225 + let _ = builder.send(); 226 + } 227 + 228 + async fn gauge(&self, key: &str, value: u64) { 229 + debug!("Sending metric gauge: {} = {}", key, value); 230 + if self.default_tags.is_empty() { 231 + match self.client.gauge(key, value) { 232 + Ok(_) => debug!("Successfully sent gauge: {} = {}", key, value), 233 + Err(e) => error!("Failed to send gauge {} = {}: {}", key, value, e), 234 + } 235 + } else { 236 + let builder = self.client.gauge_with_tags(key, value); 237 + let builder = self.apply_default_tags(builder); 238 + builder.send(); 239 + debug!("Sent gauge with tags: {} = {}", key, value); 240 + } 241 + } 242 + 243 + async fn gauge_with_tags(&self, key: &str, value: u64, tags: &[(&str, &str)]) { 244 + let mut builder = self.client.gauge_with_tags(key, value); 245 + builder = self.apply_default_tags(builder); 246 + for (k, v) in tags { 247 + builder = builder.with_tag(k, v); 248 + } 249 + let _ = builder.send(); 250 + } 251 + 252 + async fn time(&self, key: &str, millis: u64) { 253 + if self.default_tags.is_empty() { 254 + let _ = self.client.time(key, millis); 255 + } else { 256 + let builder = self.client.time_with_tags(key, millis); 257 + let builder = self.apply_default_tags(builder); 258 + let _ = builder.send(); 259 + } 260 + } 261 + 262 + async fn time_with_tags(&self, key: &str, millis: u64, tags: &[(&str, &str)]) { 263 + let mut builder = self.client.time_with_tags(key, millis); 264 + builder = self.apply_default_tags(builder); 265 + for (k, v) in tags { 266 + builder = builder.with_tag(k, v); 267 + } 268 + let _ = builder.send(); 269 + } 270 + } 271 + 272 + /// Type alias for shared metrics publisher 273 + pub type SharedMetricsPublisher = Arc<dyn MetricsPublisher>; 274 + 275 + /// Metrics-specific errors 276 + #[derive(Debug, Error)] 277 + pub enum MetricsError { 278 + /// Failed to create metrics publisher 279 + #[error("error-quickdid-metrics-1 Failed to create metrics publisher: {0}")] 280 + CreationFailed(String), 281 + 282 + /// Invalid configuration for metrics 283 + #[error("error-quickdid-metrics-2 Invalid metrics configuration: {0}")] 284 + InvalidConfig(String), 285 + } 286 + 287 + /// Create a metrics publisher based on configuration 288 + /// 289 + /// Returns either a no-op publisher or a StatsD publisher based on the 290 + /// `metrics_adapter` configuration value. 291 + /// 292 + /// ## Example 293 + /// 294 + /// ```rust,no_run 295 + /// use quickdid::config::Config; 296 + /// use quickdid::metrics::create_metrics_publisher; 297 + /// 298 + /// # async fn example() -> Result<(), Box<dyn std::error::Error>> { 299 + /// let config = Config::from_env()?; 300 + /// let metrics = create_metrics_publisher(&config)?; 301 + /// 302 + /// // Use the metrics publisher 303 + /// metrics.incr("request.count").await; 304 + /// # Ok(()) 305 + /// # } 306 + /// ``` 307 + pub fn create_metrics_publisher(config: &Config) -> Result<SharedMetricsPublisher, MetricsError> { 308 + match config.metrics_adapter.as_str() { 309 + "noop" => Ok(Arc::new(NoOpMetricsPublisher::new())), 310 + "statsd" => { 311 + let host = config.metrics_statsd_host.as_ref().ok_or_else(|| { 312 + MetricsError::InvalidConfig( 313 + "METRICS_STATSD_HOST is required when using statsd adapter".to_string(), 314 + ) 315 + })?; 316 + 317 + // Parse tags from comma-separated key:value pairs 318 + let default_tags = if let Some(tags_str) = &config.metrics_tags { 319 + tags_str 320 + .split(',') 321 + .filter_map(|tag| { 322 + let parts: Vec<&str> = tag.trim().split(':').collect(); 323 + if parts.len() == 2 { 324 + Some((parts[0].to_string(), parts[1].to_string())) 325 + } else { 326 + error!("Invalid tag format: {}", tag); 327 + None 328 + } 329 + }) 330 + .collect() 331 + } else { 332 + vec![] 333 + }; 334 + 335 + let publisher = StatsdMetricsPublisher::new_with_bind_and_tags( 336 + host, 337 + &config.metrics_prefix, 338 + &config.metrics_statsd_bind, 339 + default_tags, 340 + ) 341 + .map_err(|e| MetricsError::CreationFailed(e.to_string()))?; 342 + 343 + Ok(Arc::new(publisher)) 344 + } 345 + _ => Err(MetricsError::InvalidConfig(format!( 346 + "Unknown metrics adapter: {}", 347 + config.metrics_adapter 348 + ))), 349 + } 350 + } 351 + 352 + #[cfg(test)] 353 + mod tests { 354 + use super::*; 355 + use once_cell::sync::Lazy; 356 + use std::sync::Mutex; 357 + 358 + // Use a mutex to serialize tests that modify environment variables 359 + static ENV_MUTEX: Lazy<Mutex<()>> = Lazy::new(|| Mutex::new(())); 360 + 361 + #[tokio::test] 362 + async fn test_noop_metrics() { 363 + let metrics = NoOpMetricsPublisher::new(); 364 + 365 + // These should all be no-ops and not panic 366 + metrics.incr("test.counter").await; 367 + metrics.count("test.counter", 5).await; 368 + metrics 369 + .incr_with_tags("test.counter", &[("env", "test")]) 370 + .await; 371 + metrics 372 + .count_with_tags( 373 + "test.counter", 374 + 10, 375 + &[("env", "test"), ("service", "quickdid")], 376 + ) 377 + .await; 378 + metrics.gauge("test.gauge", 100).await; 379 + metrics 380 + .gauge_with_tags("test.gauge", 200, &[("host", "localhost")]) 381 + .await; 382 + metrics.time("test.timing", 42).await; 383 + metrics 384 + .time_with_tags("test.timing", 84, &[("endpoint", "/resolve")]) 385 + .await; 386 + } 387 + 388 + #[tokio::test] 389 + async fn test_shared_metrics() { 390 + let metrics: SharedMetricsPublisher = Arc::new(NoOpMetricsPublisher::new()); 391 + 392 + // Verify it can be used as a shared reference 393 + metrics.incr("shared.counter").await; 394 + metrics.gauge("shared.gauge", 50).await; 395 + 396 + // Verify it can be cloned 397 + let metrics2 = Arc::clone(&metrics); 398 + metrics2.count("cloned.counter", 3).await; 399 + } 400 + 401 + #[test] 402 + fn test_create_noop_publisher() { 403 + use std::env; 404 + 405 + // Lock mutex to prevent concurrent environment variable modification 406 + let _guard = ENV_MUTEX.lock().unwrap(); 407 + 408 + // Clean up any existing environment variables first 409 + unsafe { 410 + env::remove_var("METRICS_ADAPTER"); 411 + env::remove_var("METRICS_STATSD_HOST"); 412 + env::remove_var("METRICS_PREFIX"); 413 + env::remove_var("METRICS_TAGS"); 414 + } 415 + 416 + // Set up environment for noop adapter 417 + unsafe { 418 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 419 + env::set_var("METRICS_ADAPTER", "noop"); 420 + } 421 + 422 + let config = Config::from_env().unwrap(); 423 + let metrics = create_metrics_publisher(&config).unwrap(); 424 + 425 + // Should create successfully - actual type checking happens at compile time 426 + assert!(Arc::strong_count(&metrics) == 1); 427 + 428 + // Clean up 429 + unsafe { 430 + env::remove_var("METRICS_ADAPTER"); 431 + env::remove_var("HTTP_EXTERNAL"); 432 + } 433 + } 434 + 435 + #[test] 436 + fn test_create_statsd_publisher() { 437 + use std::env; 438 + 439 + // Lock mutex to prevent concurrent environment variable modification 440 + let _guard = ENV_MUTEX.lock().unwrap(); 441 + 442 + // Clean up any existing environment variables first 443 + unsafe { 444 + env::remove_var("METRICS_ADAPTER"); 445 + env::remove_var("METRICS_STATSD_HOST"); 446 + env::remove_var("METRICS_PREFIX"); 447 + env::remove_var("METRICS_TAGS"); 448 + } 449 + 450 + // Set up environment for statsd adapter 451 + unsafe { 452 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 453 + env::set_var("METRICS_ADAPTER", "statsd"); 454 + env::set_var("METRICS_STATSD_HOST", "localhost:8125"); 455 + env::set_var("METRICS_PREFIX", "test"); 456 + env::set_var("METRICS_TAGS", "env:test,service:quickdid"); 457 + } 458 + 459 + let config = Config::from_env().unwrap(); 460 + let metrics = create_metrics_publisher(&config).unwrap(); 461 + 462 + // Should create successfully 463 + assert!(Arc::strong_count(&metrics) == 1); 464 + 465 + // Clean up 466 + unsafe { 467 + env::remove_var("METRICS_ADAPTER"); 468 + env::remove_var("METRICS_STATSD_HOST"); 469 + env::remove_var("METRICS_PREFIX"); 470 + env::remove_var("METRICS_TAGS"); 471 + env::remove_var("HTTP_EXTERNAL"); 472 + } 473 + } 474 + 475 + #[test] 476 + fn test_missing_statsd_host() { 477 + use std::env; 478 + 479 + // Lock mutex to prevent concurrent environment variable modification 480 + let _guard = ENV_MUTEX.lock().unwrap(); 481 + 482 + // Clean up any existing environment variables first 483 + unsafe { 484 + env::remove_var("METRICS_ADAPTER"); 485 + env::remove_var("METRICS_STATSD_HOST"); 486 + env::remove_var("METRICS_PREFIX"); 487 + env::remove_var("METRICS_TAGS"); 488 + } 489 + 490 + // Set up environment for statsd adapter without host 491 + unsafe { 492 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 493 + env::set_var("METRICS_ADAPTER", "statsd"); 494 + env::remove_var("METRICS_STATSD_HOST"); 495 + } 496 + 497 + let config = Config::from_env().unwrap(); 498 + let result = create_metrics_publisher(&config); 499 + 500 + // Should fail with invalid config error 501 + assert!(result.is_err()); 502 + if let Err(e) = result { 503 + assert!(matches!(e, MetricsError::InvalidConfig(_))); 504 + } 505 + 506 + // Clean up 507 + unsafe { 508 + env::remove_var("METRICS_ADAPTER"); 509 + env::remove_var("HTTP_EXTERNAL"); 510 + } 511 + } 512 + 513 + #[test] 514 + fn test_invalid_adapter() { 515 + use std::env; 516 + 517 + // Lock mutex to prevent concurrent environment variable modification 518 + let _guard = ENV_MUTEX.lock().unwrap(); 519 + 520 + // Clean up any existing environment variables first 521 + unsafe { 522 + env::remove_var("METRICS_ADAPTER"); 523 + env::remove_var("METRICS_STATSD_HOST"); 524 + env::remove_var("METRICS_PREFIX"); 525 + env::remove_var("METRICS_TAGS"); 526 + } 527 + 528 + // Set up environment with invalid adapter 529 + unsafe { 530 + env::set_var("HTTP_EXTERNAL", "test.example.com"); 531 + env::set_var("METRICS_ADAPTER", "invalid"); 532 + env::remove_var("METRICS_STATSD_HOST"); // Clean up from other tests 533 + } 534 + 535 + let config = Config::from_env().unwrap(); 536 + 537 + // Config validation should catch this 538 + let validation_result = config.validate(); 539 + assert!(validation_result.is_err()); 540 + 541 + // Clean up 542 + unsafe { 543 + env::remove_var("METRICS_ADAPTER"); 544 + env::remove_var("HTTP_EXTERNAL"); 545 + } 546 + } 547 + }
+6 -6
src/queue/adapter.rs
··· 3 3 //! This module defines the core `QueueAdapter` trait that provides a common 4 4 //! interface for different queue implementations (MPSC, Redis, SQLite, etc.). 5 5 6 - use async_trait::async_trait; 7 6 use super::error::Result; 7 + use async_trait::async_trait; 8 8 9 9 /// Generic trait for queue adapters that can work with any work type. 10 10 /// ··· 173 173 #[tokio::test] 174 174 async fn test_default_trait_methods() { 175 175 let queue = MockQueue::<String>::new(); 176 - 176 + 177 177 // Test default ack implementation 178 178 assert!(queue.ack(&"test".to_string()).await.is_ok()); 179 - 179 + 180 180 // Test default try_push implementation 181 181 assert!(queue.try_push("test".to_string()).await.is_ok()); 182 - 182 + 183 183 // Test default depth implementation 184 184 assert_eq!(queue.depth().await, None); 185 - 185 + 186 186 // Test default is_healthy implementation 187 187 assert!(queue.is_healthy().await); 188 188 } 189 - } 189 + }
+4 -4
src/queue/error.rs
··· 29 29 30 30 /// Redis operation failed. 31 31 #[error("error-quickdid-queue-5 Redis operation failed: {operation}: {details}")] 32 - RedisOperationFailed { 32 + RedisOperationFailed { 33 33 /// The Redis operation that failed 34 - operation: String, 34 + operation: String, 35 35 /// Details about the failure 36 - details: String 36 + details: String, 37 37 }, 38 38 39 39 /// Failed to serialize an item for storage. ··· 73 73 assert!(err.to_string().contains("LPUSH")); 74 74 assert!(err.to_string().contains("connection timeout")); 75 75 } 76 - } 76 + }
+77 -26
src/queue/factory.rs
··· 9 9 use tokio::sync::mpsc; 10 10 11 11 use super::{ 12 - adapter::QueueAdapter, 13 - mpsc::MpscQueueAdapter, 14 - noop::NoopQueueAdapter, 15 - redis::RedisQueueAdapter, 16 - sqlite::SqliteQueueAdapter, 12 + adapter::QueueAdapter, mpsc::MpscQueueAdapter, noop::NoopQueueAdapter, 13 + redis::RedisQueueAdapter, sqlite::SqliteQueueAdapter, work::DedupKey, 17 14 }; 18 15 19 16 // ========= MPSC Queue Factories ========= ··· 84 81 /// # Examples 85 82 /// 86 83 /// ```no_run 87 - /// use quickdid::queue::create_redis_queue; 84 + /// use quickdid::queue::{create_redis_queue, HandleResolutionWork}; 88 85 /// use deadpool_redis::Config; 89 86 /// 90 87 /// # async fn example() -> anyhow::Result<()> { 91 88 /// let cfg = Config::from_url("redis://localhost:6379"); 92 89 /// let pool = cfg.create_pool(Some(deadpool_redis::Runtime::Tokio1))?; 93 90 /// 94 - /// let queue = create_redis_queue::<String>( 91 + /// let queue = create_redis_queue::<HandleResolutionWork>( 95 92 /// pool, 96 93 /// "worker-1".to_string(), 97 94 /// "queue:myapp:".to_string(), ··· 107 104 timeout_seconds: u64, 108 105 ) -> Arc<dyn QueueAdapter<T>> 109 106 where 110 - T: Send + Sync + Serialize + for<'de> Deserialize<'de> + 'static, 107 + T: Send + Sync + Serialize + for<'de> Deserialize<'de> + DedupKey + 'static, 111 108 { 112 109 Arc::new(RedisQueueAdapter::new( 113 110 pool, ··· 117 114 )) 118 115 } 119 116 117 + /// Create a new Redis-backed queue adapter with deduplication. 118 + /// 119 + /// This creates a distributed queue with deduplication to prevent duplicate items 120 + /// from being queued within the specified TTL window. 121 + /// 122 + /// # Arguments 123 + /// 124 + /// * `pool` - Redis connection pool 125 + /// * `worker_id` - Worker identifier for this queue instance 126 + /// * `key_prefix` - Redis key prefix for queue operations 127 + /// * `timeout_seconds` - Timeout for blocking operations 128 + /// * `dedup_enabled` - Whether to enable deduplication 129 + /// * `dedup_ttl` - TTL for deduplication keys in seconds 130 + /// 131 + /// # Examples 132 + /// 133 + /// ```no_run 134 + /// use quickdid::queue::{create_redis_queue_with_dedup, HandleResolutionWork}; 135 + /// use deadpool_redis::Config; 136 + /// 137 + /// # async fn example() -> anyhow::Result<()> { 138 + /// let cfg = Config::from_url("redis://localhost:6379"); 139 + /// let pool = cfg.create_pool(Some(deadpool_redis::Runtime::Tokio1))?; 140 + /// 141 + /// let queue = create_redis_queue_with_dedup::<HandleResolutionWork>( 142 + /// pool, 143 + /// "worker-1".to_string(), 144 + /// "queue:myapp:".to_string(), 145 + /// 5, 146 + /// true, // Enable deduplication 147 + /// 60, // 60 second dedup window 148 + /// ); 149 + /// # Ok(()) 150 + /// # } 151 + /// ``` 152 + pub fn create_redis_queue_with_dedup<T>( 153 + pool: RedisPool, 154 + worker_id: String, 155 + key_prefix: String, 156 + timeout_seconds: u64, 157 + dedup_enabled: bool, 158 + dedup_ttl: u64, 159 + ) -> Arc<dyn QueueAdapter<T>> 160 + where 161 + T: Send + Sync + Serialize + for<'de> Deserialize<'de> + DedupKey + 'static, 162 + { 163 + Arc::new(RedisQueueAdapter::with_dedup( 164 + pool, 165 + worker_id, 166 + key_prefix, 167 + timeout_seconds, 168 + dedup_enabled, 169 + dedup_ttl, 170 + )) 171 + } 172 + 120 173 // ========= SQLite Queue Factories ========= 121 174 122 175 /// Create a new SQLite queue adapter with unlimited queue size. ··· 218 271 #[tokio::test] 219 272 async fn test_create_mpsc_queue() { 220 273 let queue = create_mpsc_queue::<String>(10); 221 - 274 + 222 275 queue.push("test".to_string()).await.unwrap(); 223 276 let item = queue.pull().await; 224 277 assert_eq!(item, Some("test".to_string())); ··· 228 281 async fn test_create_mpsc_queue_from_channel() { 229 282 let (sender, receiver) = mpsc::channel(5); 230 283 let queue = create_mpsc_queue_from_channel(sender.clone(), receiver); 231 - 284 + 232 285 // Send via original sender 233 286 sender.send("external".to_string()).await.unwrap(); 234 - 287 + 235 288 // Receive via queue 236 289 let item = queue.pull().await; 237 290 assert_eq!(item, Some("external".to_string())); ··· 240 293 #[tokio::test] 241 294 async fn test_create_noop_queue() { 242 295 let queue = create_noop_queue::<String>(); 243 - 296 + 244 297 // Should accept pushes 245 298 queue.push("ignored".to_string()).await.unwrap(); 246 - 299 + 247 300 // Should report as healthy 248 301 assert!(queue.is_healthy().await); 249 - 302 + 250 303 // Should report depth as 0 251 304 assert_eq!(queue.depth().await, Some(0)); 252 305 } ··· 264 317 .expect("Failed to create schema"); 265 318 266 319 let queue = create_sqlite_queue::<HandleResolutionWork>(pool); 267 - 320 + 268 321 let work = HandleResolutionWork::new("test.example.com".to_string()); 269 322 queue.push(work.clone()).await.unwrap(); 270 - 323 + 271 324 let pulled = queue.pull().await; 272 325 assert_eq!(pulled, Some(work)); 273 326 } ··· 286 339 287 340 // Create queue with small max size 288 341 let queue = create_sqlite_queue_with_max_size::<HandleResolutionWork>(pool, 5); 289 - 342 + 290 343 // Push items 291 344 for i in 0..10 { 292 345 let work = HandleResolutionWork::new(format!("test-{}.example.com", i)); 293 346 queue.push(work).await.unwrap(); 294 347 } 295 - 348 + 296 349 // Should have limited items due to work shedding 297 350 let depth = queue.depth().await.unwrap(); 298 - assert!(depth <= 5, "Queue should have at most 5 items after work shedding"); 351 + assert!( 352 + depth <= 5, 353 + "Queue should have at most 5 items after work shedding" 354 + ); 299 355 } 300 356 301 357 #[tokio::test] ··· 316 372 .as_nanos() 317 373 ); 318 374 319 - let queue = create_redis_queue::<String>( 320 - pool, 321 - "test-worker".to_string(), 322 - test_prefix, 323 - 1, 324 - ); 375 + let queue = create_redis_queue::<String>(pool, "test-worker".to_string(), test_prefix, 1); 325 376 326 377 queue.push("test-item".to_string()).await.unwrap(); 327 378 let pulled = queue.pull().await; 328 379 assert_eq!(pulled, Some("test-item".to_string())); 329 380 } 330 - } 381 + }
+3 -8
src/queue/mod.rs
··· 63 63 // Re-export core types 64 64 pub use adapter::QueueAdapter; 65 65 pub use error::{QueueError, Result}; 66 - pub use work::HandleResolutionWork; 66 + pub use work::{DedupKey, HandleResolutionWork}; 67 67 68 68 // Re-export implementations (with limited visibility) 69 69 pub use mpsc::MpscQueueAdapter; ··· 73 73 74 74 // Re-export factory functions 75 75 pub use factory::{ 76 - create_mpsc_queue, 77 - create_mpsc_queue_from_channel, 78 - create_noop_queue, 79 - create_redis_queue, 80 - create_sqlite_queue, 81 - create_sqlite_queue_with_max_size, 76 + create_mpsc_queue, create_mpsc_queue_from_channel, create_noop_queue, create_redis_queue, 77 + create_redis_queue_with_dedup, create_sqlite_queue, create_sqlite_queue_with_max_size, 82 78 }; 83 -
+4 -4
src/queue/mpsc.rs
··· 6 6 7 7 use async_trait::async_trait; 8 8 use std::sync::Arc; 9 - use tokio::sync::{mpsc, Mutex}; 9 + use tokio::sync::{Mutex, mpsc}; 10 10 11 11 use super::adapter::QueueAdapter; 12 12 use super::error::{QueueError, Result}; ··· 204 204 #[tokio::test] 205 205 async fn test_mpsc_queue_health() { 206 206 let queue = MpscQueueAdapter::<String>::new(10); 207 - 207 + 208 208 // Queue should be healthy initially 209 209 assert!(queue.is_healthy().await); 210 210 ··· 212 212 let (sender, receiver) = mpsc::channel::<String>(10); 213 213 drop(receiver); 214 214 let closed_queue = MpscQueueAdapter::from_channel(sender, mpsc::channel(1).1); 215 - 215 + 216 216 // Push should fail on closed queue 217 217 let result = closed_queue.push("test".to_string()).await; 218 218 assert!(result.is_err()); ··· 283 283 // Ack should always succeed (no-op) 284 284 queue.ack(&item).await.unwrap(); 285 285 } 286 - } 286 + }
+1 -1
src/queue/noop.rs
··· 219 219 queue.ack(&work).await.unwrap(); 220 220 assert_eq!(queue.depth().await, Some(0)); 221 221 } 222 - } 222 + }
+240 -12
src/queue/redis.rs
··· 10 10 11 11 use super::adapter::QueueAdapter; 12 12 use super::error::{QueueError, Result}; 13 + use super::work::DedupKey; 13 14 14 15 /// Redis-backed queue adapter implementation. 15 16 /// ··· 40 41 /// # Examples 41 42 /// 42 43 /// ```no_run 43 - /// use quickdid::queue::RedisQueueAdapter; 44 - /// use quickdid::queue::QueueAdapter; 44 + /// use quickdid::queue::{RedisQueueAdapter, QueueAdapter, HandleResolutionWork}; 45 45 /// use deadpool_redis::Config; 46 46 /// 47 47 /// # async fn example() -> anyhow::Result<()> { ··· 50 50 /// let pool = cfg.create_pool(Some(deadpool_redis::Runtime::Tokio1))?; 51 51 /// 52 52 /// // Create queue adapter 53 - /// let queue = RedisQueueAdapter::<String>::new( 53 + /// let queue = RedisQueueAdapter::<HandleResolutionWork>::new( 54 54 /// pool, 55 55 /// "worker-1".to_string(), 56 56 /// "queue:myapp:".to_string(), ··· 58 58 /// ); 59 59 /// 60 60 /// // Use the queue 61 - /// queue.push("work-item".to_string()).await?; 61 + /// let work = HandleResolutionWork::new("alice.bsky.social".to_string()); 62 + /// queue.push(work.clone()).await?; 62 63 /// if let Some(item) = queue.pull().await { 63 64 /// // Process item 64 65 /// queue.ack(&item).await?; ··· 78 79 key_prefix: String, 79 80 /// Timeout for blocking RPOPLPUSH operations (in seconds) 80 81 timeout_seconds: u64, 82 + /// Enable deduplication to prevent duplicate items in queue 83 + dedup_enabled: bool, 84 + /// TTL for deduplication keys in seconds 85 + dedup_ttl: u64, 81 86 /// Type marker for generic parameter 82 87 _phantom: std::marker::PhantomData<T>, 83 88 } ··· 120 125 key_prefix: String, 121 126 timeout_seconds: u64, 122 127 ) -> Self { 128 + Self::with_dedup( 129 + pool, 130 + worker_id, 131 + key_prefix, 132 + timeout_seconds, 133 + false, 134 + 60, // Default TTL of 60 seconds 135 + ) 136 + } 137 + 138 + /// Create a new Redis queue adapter with deduplication settings. 139 + /// 140 + /// # Arguments 141 + /// 142 + /// * `pool` - Redis connection pool 143 + /// * `worker_id` - Unique identifier for this worker instance 144 + /// * `key_prefix` - Redis key prefix for queue operations 145 + /// * `timeout_seconds` - Timeout for blocking pull operations 146 + /// * `dedup_enabled` - Whether to enable deduplication 147 + /// * `dedup_ttl` - TTL for deduplication keys in seconds 148 + pub fn with_dedup( 149 + pool: RedisPool, 150 + worker_id: String, 151 + key_prefix: String, 152 + timeout_seconds: u64, 153 + dedup_enabled: bool, 154 + dedup_ttl: u64, 155 + ) -> Self { 123 156 Self { 124 157 pool, 125 158 worker_id, 126 159 key_prefix, 127 160 timeout_seconds, 161 + dedup_enabled, 162 + dedup_ttl, 128 163 _phantom: std::marker::PhantomData, 129 164 } 130 165 } ··· 138 173 fn worker_queue_key(&self) -> String { 139 174 format!("{}{}", self.key_prefix, self.worker_id) 140 175 } 176 + 177 + /// Get the deduplication key for an item. 178 + /// This key is used to track if an item is already queued. 179 + fn dedup_key(&self, item_id: &str) -> String { 180 + format!("{}dedup:{}", self.key_prefix, item_id) 181 + } 182 + 183 + /// Check and mark an item for deduplication. 184 + /// Returns true if the item was successfully marked (not duplicate), 185 + /// false if it was already in the deduplication set (duplicate). 186 + async fn check_and_mark_dedup( 187 + &self, 188 + conn: &mut deadpool_redis::Connection, 189 + item_id: &str, 190 + ) -> Result<bool> { 191 + if !self.dedup_enabled { 192 + return Ok(true); // Always allow if dedup is disabled 193 + } 194 + 195 + let dedup_key = self.dedup_key(item_id); 196 + 197 + // Use SET NX EX to atomically set if not exists with expiry 198 + // Returns OK if the key was set, Nil if it already existed 199 + let result: Option<String> = deadpool_redis::redis::cmd("SET") 200 + .arg(&dedup_key) 201 + .arg("1") 202 + .arg("NX") // Only set if not exists 203 + .arg("EX") // Set expiry 204 + .arg(self.dedup_ttl) 205 + .query_async(conn) 206 + .await 207 + .map_err(|e| QueueError::RedisOperationFailed { 208 + operation: "SET NX EX".to_string(), 209 + details: e.to_string(), 210 + })?; 211 + 212 + // If result is Some("OK"), the key was set (not duplicate) 213 + // If result is None, the key already existed (duplicate) 214 + Ok(result.is_some()) 215 + } 141 216 } 142 217 143 218 #[async_trait] 144 219 impl<T> QueueAdapter<T> for RedisQueueAdapter<T> 145 220 where 146 - T: Send + Sync + Serialize + for<'de> Deserialize<'de> + 'static, 221 + T: Send + Sync + Serialize + for<'de> Deserialize<'de> + DedupKey + 'static, 147 222 { 148 223 async fn pull(&self) -> Option<T> { 149 224 match self.pool.get().await { ··· 198 273 .get() 199 274 .await 200 275 .map_err(|e| QueueError::RedisConnectionFailed(e.to_string()))?; 276 + 277 + // Check for deduplication if enabled 278 + if self.dedup_enabled { 279 + let dedup_id = work.dedup_key(); 280 + let is_new = self.check_and_mark_dedup(&mut conn, &dedup_id).await?; 281 + 282 + if !is_new { 283 + debug!( 284 + dedup_key = %dedup_id, 285 + "Item already queued, skipping duplicate" 286 + ); 287 + return Ok(()); // Successfully deduplicated 288 + } 289 + } 201 290 202 291 let data = serde_json::to_vec(&work) 203 292 .map_err(|e| QueueError::SerializationFailed(e.to_string()))?; ··· 392 481 .unwrap() 393 482 .as_nanos() 394 483 ); 395 - let adapter = RedisQueueAdapter::<String>::new( 396 - pool, 397 - "test-worker-depth".to_string(), 398 - test_prefix, 399 - 1, 400 - ); 484 + let adapter = 485 + RedisQueueAdapter::<String>::new(pool, "test-worker-depth".to_string(), test_prefix, 1); 401 486 402 487 // Initially empty 403 488 assert_eq!(adapter.depth().await, Some(0)); ··· 436 521 } 437 522 438 523 #[tokio::test] 524 + async fn test_redis_queue_deduplication() { 525 + use crate::queue::HandleResolutionWork; 526 + 527 + let pool = match crate::test_helpers::get_test_redis_pool() { 528 + Some(p) => p, 529 + None => { 530 + eprintln!("Skipping Redis test - no Redis connection available"); 531 + return; 532 + } 533 + }; 534 + 535 + let test_prefix = format!( 536 + "test:queue:dedup:{}:", 537 + std::time::SystemTime::now() 538 + .duration_since(std::time::UNIX_EPOCH) 539 + .unwrap() 540 + .as_nanos() 541 + ); 542 + 543 + // Create adapter with deduplication enabled 544 + let adapter = RedisQueueAdapter::<HandleResolutionWork>::with_dedup( 545 + pool.clone(), 546 + "test-worker-dedup".to_string(), 547 + test_prefix.clone(), 548 + 1, 549 + true, // Enable deduplication 550 + 2, // 2 second TTL for quick testing 551 + ); 552 + 553 + let work = HandleResolutionWork::new("alice.example.com".to_string()); 554 + 555 + // First push should succeed 556 + adapter 557 + .push(work.clone()) 558 + .await 559 + .expect("First push should succeed"); 560 + 561 + // Second push of same item should be deduplicated (but still return Ok) 562 + adapter 563 + .push(work.clone()) 564 + .await 565 + .expect("Second push should succeed (deduplicated)"); 566 + 567 + // Queue should only have one item 568 + let depth = adapter.depth().await; 569 + assert_eq!( 570 + depth, 571 + Some(1), 572 + "Queue should only have one item after deduplication" 573 + ); 574 + 575 + // Pull the item 576 + let pulled = adapter.pull().await; 577 + assert_eq!(pulled, Some(work.clone())); 578 + 579 + // Queue should now be empty 580 + let depth = adapter.depth().await; 581 + assert_eq!(depth, Some(0), "Queue should be empty after pulling"); 582 + 583 + // Wait for dedup TTL to expire 584 + tokio::time::sleep(tokio::time::Duration::from_secs(3)).await; 585 + 586 + // Should be able to push again after TTL expires 587 + adapter 588 + .push(work.clone()) 589 + .await 590 + .expect("Push after TTL expiry should succeed"); 591 + 592 + let depth = adapter.depth().await; 593 + assert_eq!( 594 + depth, 595 + Some(1), 596 + "Queue should have one item after TTL expiry" 597 + ); 598 + } 599 + 600 + #[tokio::test] 601 + async fn test_redis_queue_deduplication_disabled() { 602 + use crate::queue::HandleResolutionWork; 603 + 604 + let pool = match crate::test_helpers::get_test_redis_pool() { 605 + Some(p) => p, 606 + None => { 607 + eprintln!("Skipping Redis test - no Redis connection available"); 608 + return; 609 + } 610 + }; 611 + 612 + let test_prefix = format!( 613 + "test:queue:nodedup:{}:", 614 + std::time::SystemTime::now() 615 + .duration_since(std::time::UNIX_EPOCH) 616 + .unwrap() 617 + .as_nanos() 618 + ); 619 + 620 + // Create adapter with deduplication disabled 621 + let adapter = RedisQueueAdapter::<HandleResolutionWork>::with_dedup( 622 + pool.clone(), 623 + "test-worker-nodedup".to_string(), 624 + test_prefix.clone(), 625 + 1, 626 + false, // Disable deduplication 627 + 60, 628 + ); 629 + 630 + let work = HandleResolutionWork::new("bob.example.com".to_string()); 631 + 632 + // Push same item twice 633 + adapter 634 + .push(work.clone()) 635 + .await 636 + .expect("First push should succeed"); 637 + adapter 638 + .push(work.clone()) 639 + .await 640 + .expect("Second push should succeed"); 641 + 642 + // Queue should have two items (no deduplication) 643 + let depth = adapter.depth().await; 644 + assert_eq!( 645 + depth, 646 + Some(2), 647 + "Queue should have two items when deduplication is disabled" 648 + ); 649 + 650 + // Pull both items 651 + let pulled1 = adapter.pull().await; 652 + assert_eq!(pulled1, Some(work.clone())); 653 + 654 + let pulled2 = adapter.pull().await; 655 + assert_eq!(pulled2, Some(work.clone())); 656 + 657 + // Queue should now be empty 658 + let depth = adapter.depth().await; 659 + assert_eq!( 660 + depth, 661 + Some(0), 662 + "Queue should be empty after pulling all items" 663 + ); 664 + } 665 + 666 + #[tokio::test] 439 667 async fn test_redis_queue_serialization() { 440 668 use crate::queue::HandleResolutionWork; 441 669 ··· 471 699 // Ack 472 700 adapter.ack(&work).await.unwrap(); 473 701 } 474 - } 702 + }
+40 -37
src/queue/sqlite.rs
··· 165 165 let record = match sqlx::query( 166 166 "SELECT id, work FROM handle_resolution_queue 167 167 ORDER BY queued_at ASC 168 - LIMIT 1" 168 + LIMIT 1", 169 169 ) 170 170 .fetch_optional(&mut *transaction) 171 171 .await ··· 226 226 227 227 // Optimized approach: Insert first, then check if cleanup needed 228 228 // This avoids counting on every insert 229 - sqlx::query( 230 - "INSERT INTO handle_resolution_queue (work, queued_at) VALUES (?1, ?2)" 231 - ) 232 - .bind(&work_json) 233 - .bind(current_timestamp) 234 - .execute(&self.pool) 235 - .await 236 - .map_err(|e| QueueError::PushFailed(format!("Failed to insert work item: {}", e)))?; 229 + sqlx::query("INSERT INTO handle_resolution_queue (work, queued_at) VALUES (?1, ?2)") 230 + .bind(&work_json) 231 + .bind(current_timestamp) 232 + .execute(&self.pool) 233 + .await 234 + .map_err(|e| QueueError::PushFailed(format!("Failed to insert work item: {}", e)))?; 237 235 238 236 // Implement optimized work shedding if max_size is configured 239 237 if self.max_size > 0 { ··· 243 241 let approx_count: Option<i64> = sqlx::query_scalar( 244 242 "SELECT COUNT(*) FROM ( 245 243 SELECT 1 FROM handle_resolution_queue LIMIT ?1 246 - ) AS limited_count" 244 + ) AS limited_count", 247 245 ) 248 246 .bind(check_limit) 249 247 .fetch_one(&self.pool) ··· 251 249 .map_err(|e| QueueError::PushFailed(format!("Failed to check queue size: {}", e)))?; 252 250 253 251 // Only perform cleanup if we're definitely over the limit 254 - if let Some(count) = approx_count && count >= check_limit { 252 + if let Some(count) = approx_count 253 + && count >= check_limit 254 + { 255 255 // Perform batch cleanup - delete more than just the excess to reduce frequency 256 256 // Delete 20% more than needed to avoid frequent shedding 257 257 let target_size = (self.max_size as f64 * 0.8) as i64; // Keep 80% of max_size 258 258 let to_delete = count - target_size; 259 - 259 + 260 260 if to_delete > 0 { 261 261 // Optimized deletion: First get the cutoff id and timestamp 262 262 // This avoids the expensive subquery in the DELETE statement 263 263 let cutoff: Option<(i64, i64)> = sqlx::query_as( 264 264 "SELECT id, queued_at FROM handle_resolution_queue 265 265 ORDER BY queued_at ASC, id ASC 266 - LIMIT 1 OFFSET ?1" 266 + LIMIT 1 OFFSET ?1", 267 267 ) 268 268 .bind(to_delete - 1) 269 269 .fetch_optional(&self.pool) ··· 276 276 let deleted_result = sqlx::query( 277 277 "DELETE FROM handle_resolution_queue 278 278 WHERE queued_at < ?1 279 - OR (queued_at = ?1 AND id <= ?2)" 279 + OR (queued_at = ?1 AND id <= ?2)", 280 280 ) 281 281 .bind(cutoff_timestamp) 282 282 .bind(cutoff_id) 283 283 .execute(&self.pool) 284 284 .await 285 - .map_err(|e| QueueError::PushFailed(format!("Failed to delete excess entries: {}", e)))?; 285 + .map_err(|e| { 286 + QueueError::PushFailed(format!( 287 + "Failed to delete excess entries: {}", 288 + e 289 + )) 290 + })?; 286 291 287 292 let deleted_count = deleted_result.rows_affected(); 288 293 if deleted_count > 0 { 289 294 info!( 290 295 "Work shedding: deleted {} oldest entries (target size: {}, max: {})", 291 - deleted_count, 292 - target_size, 293 - self.max_size 296 + deleted_count, target_size, self.max_size 294 297 ); 295 298 } 296 299 } ··· 298 301 } 299 302 } 300 303 301 - debug!("Pushed work item to SQLite queue (max_size: {})", self.max_size); 304 + debug!( 305 + "Pushed work item to SQLite queue (max_size: {})", 306 + self.max_size 307 + ); 302 308 Ok(()) 303 309 } 304 310 ··· 310 316 } 311 317 312 318 async fn depth(&self) -> Option<usize> { 313 - match sqlx::query_scalar::<_, i64>( 314 - "SELECT COUNT(*) FROM handle_resolution_queue" 315 - ) 316 - .fetch_one(&self.pool) 317 - .await 319 + match sqlx::query_scalar::<_, i64>("SELECT COUNT(*) FROM handle_resolution_queue") 320 + .fetch_one(&self.pool) 321 + .await 318 322 { 319 323 Ok(count) => Some(count as usize), 320 324 Err(e) => { ··· 380 384 let adapter = SqliteQueueAdapter::<HandleResolutionWork>::new(pool); 381 385 382 386 // Push multiple items 383 - let handles = vec!["alice.example.com", "bob.example.com", "charlie.example.com"]; 387 + let handles = vec![ 388 + "alice.example.com", 389 + "bob.example.com", 390 + "charlie.example.com", 391 + ]; 384 392 for handle in &handles { 385 393 let work = HandleResolutionWork::new(handle.to_string()); 386 394 adapter.push(work).await.unwrap(); ··· 419 427 #[tokio::test] 420 428 async fn test_sqlite_queue_work_shedding() { 421 429 let pool = create_test_pool().await; 422 - 430 + 423 431 // Create adapter with small max_size for testing 424 432 let max_size = 10; 425 - let adapter = SqliteQueueAdapter::<HandleResolutionWork>::with_max_size( 426 - pool.clone(), 427 - max_size 428 - ); 433 + let adapter = 434 + SqliteQueueAdapter::<HandleResolutionWork>::with_max_size(pool.clone(), max_size); 429 435 430 436 // Push items up to the limit (should not trigger shedding) 431 437 for i in 0..max_size { ··· 446 452 // After triggering shedding, queue should be around 80% of max_size 447 453 let depth_after_shedding = adapter.depth().await.unwrap(); 448 454 let expected_size = (max_size as f64 * 0.8) as usize; 449 - 455 + 450 456 // Allow some variance due to batch deletion 451 457 assert!( 452 458 depth_after_shedding <= expected_size + 1, ··· 459 465 #[tokio::test] 460 466 async fn test_sqlite_queue_work_shedding_disabled() { 461 467 let pool = create_test_pool().await; 462 - 468 + 463 469 // Create adapter with max_size = 0 (disabled work shedding) 464 - let adapter = SqliteQueueAdapter::<HandleResolutionWork>::with_max_size( 465 - pool, 466 - 0 467 - ); 470 + let adapter = SqliteQueueAdapter::<HandleResolutionWork>::with_max_size(pool, 0); 468 471 469 472 // Push many items (should not trigger any shedding) 470 473 for i in 0..100 { ··· 499 502 let pulled = adapter.pull().await; 500 503 assert_eq!(pulled, Some(work)); 501 504 } 502 - } 505 + }
+43 -5
src/queue/work.rs
··· 50 50 } 51 51 } 52 52 53 + /// Trait for getting a unique deduplication key from a work item. 54 + /// This is used by the Redis queue adapter to prevent duplicate items. 55 + pub trait DedupKey { 56 + /// Get a unique key for deduplication purposes. 57 + /// This should return a consistent identifier for equivalent work items. 58 + fn dedup_key(&self) -> String; 59 + } 60 + 61 + impl DedupKey for HandleResolutionWork { 62 + fn dedup_key(&self) -> String { 63 + // Use the handle itself as the dedup key 64 + self.handle.clone() 65 + } 66 + } 67 + 68 + // For testing purposes, implement DedupKey for String 69 + #[cfg(test)] 70 + impl DedupKey for String { 71 + fn dedup_key(&self) -> String { 72 + self.clone() 73 + } 74 + } 75 + 53 76 #[cfg(test)] 54 77 mod tests { 55 78 use super::*; ··· 64 87 #[test] 65 88 fn test_handle_resolution_work_serialization() { 66 89 let work = HandleResolutionWork::new("bob.example.com".to_string()); 67 - 90 + 68 91 // Test JSON serialization (which is what we actually use in the queue adapters) 69 92 let json = serde_json::to_string(&work).expect("Failed to serialize to JSON"); 70 - let deserialized: HandleResolutionWork = 93 + let deserialized: HandleResolutionWork = 71 94 serde_json::from_str(&json).expect("Failed to deserialize from JSON"); 72 95 assert_eq!(work, deserialized); 73 - 96 + 74 97 // Verify the JSON structure 75 98 let json_value: serde_json::Value = serde_json::from_str(&json).unwrap(); 76 99 assert_eq!(json_value["handle"], "bob.example.com"); ··· 88 111 let work1 = HandleResolutionWork::new("alice.example.com".to_string()); 89 112 let work2 = HandleResolutionWork::new("alice.example.com".to_string()); 90 113 let work3 = HandleResolutionWork::new("bob.example.com".to_string()); 91 - 114 + 92 115 assert_eq!(work1, work2); 93 116 assert_ne!(work1, work3); 94 117 } 95 - } 118 + 119 + #[test] 120 + fn test_handle_resolution_work_dedup_key() { 121 + let work1 = HandleResolutionWork::new("alice.example.com".to_string()); 122 + let work2 = HandleResolutionWork::new("alice.example.com".to_string()); 123 + let work3 = HandleResolutionWork::new("bob.example.com".to_string()); 124 + 125 + // Same handle should have same dedup key 126 + assert_eq!(work1.dedup_key(), work2.dedup_key()); 127 + assert_eq!(work1.dedup_key(), "alice.example.com"); 128 + 129 + // Different handle should have different dedup key 130 + assert_ne!(work1.dedup_key(), work3.dedup_key()); 131 + assert_eq!(work3.dedup_key(), "bob.example.com"); 132 + } 133 + }
+14 -15
src/sqlite_schema.rs
··· 4 4 //! schema used by the SQLite-backed handle resolver cache. 5 5 6 6 use anyhow::Result; 7 - use sqlx::{SqlitePool, migrate::MigrateDatabase, Sqlite}; 7 + use sqlx::{Sqlite, SqlitePool, migrate::MigrateDatabase}; 8 8 use std::path::Path; 9 9 10 10 /// SQL schema for the handle resolution cache table. ··· 60 60 tracing::info!("Initializing SQLite database: {}", database_url); 61 61 62 62 // Extract the database path from the URL for file-based databases 63 - if let Some(path) = database_url.strip_prefix("sqlite:") 64 - && path != ":memory:" 65 - && !path.is_empty() 63 + if let Some(path) = database_url.strip_prefix("sqlite:") 64 + && path != ":memory:" 65 + && !path.is_empty() 66 66 { 67 67 // Create the database file if it doesn't exist 68 68 if !Sqlite::database_exists(database_url).await? { ··· 71 71 } 72 72 73 73 // Ensure the parent directory exists 74 - if let Some(parent) = Path::new(path).parent() 75 - && !parent.exists() 74 + if let Some(parent) = Path::new(path).parent() 75 + && !parent.exists() 76 76 { 77 77 tracing::info!("Creating directory: {}", parent.display()); 78 78 std::fs::create_dir_all(parent)?; ··· 114 114 sqlx::query(CREATE_HANDLE_RESOLUTION_CACHE_TABLE) 115 115 .execute(pool) 116 116 .await?; 117 - 117 + 118 118 sqlx::query(CREATE_HANDLE_RESOLUTION_QUEUE_TABLE) 119 119 .execute(pool) 120 120 .await?; ··· 249 249 250 250 let cutoff_timestamp = current_timestamp - (max_age_seconds as i64); 251 251 252 - let result = sqlx::query( 253 - "DELETE FROM handle_resolution_queue WHERE queued_at < ?1" 254 - ) 255 - .bind(cutoff_timestamp) 256 - .execute(pool) 257 - .await?; 252 + let result = sqlx::query("DELETE FROM handle_resolution_queue WHERE queued_at < ?1") 253 + .bind(cutoff_timestamp) 254 + .execute(pool) 255 + .await?; 258 256 259 257 let deleted_count = result.rows_affected(); 260 258 if deleted_count > 0 { ··· 325 323 let old_timestamp = std::time::SystemTime::now() 326 324 .duration_since(std::time::UNIX_EPOCH) 327 325 .unwrap() 328 - .as_secs() as i64 - 3600; // 1 hour ago 326 + .as_secs() as i64 327 + - 3600; // 1 hour ago 329 328 330 329 sqlx::query( 331 330 "INSERT INTO handle_resolution_cache (key, result, created, updated) VALUES (1, ?1, ?2, ?2)" ··· 380 379 assert_eq!(total_entries, 1); 381 380 assert!(size_bytes > 0); 382 381 } 383 - } 382 + }
+2 -2
src/test_helpers.rs
··· 4 4 use deadpool_redis::Pool; 5 5 6 6 /// Helper function to get a Redis pool for testing. 7 - /// 7 + /// 8 8 /// Returns None if TEST_REDIS_URL is not set, logging a skip message. 9 9 /// This consolidates the repeated Redis test setup code. 10 10 pub(crate) fn get_test_redis_pool() -> Option<Pool> { ··· 32 32 None => return, 33 33 } 34 34 }; 35 - } 35 + }
+364
test-scripts/docker-test.sh
··· 1 + #!/bin/bash 2 + 3 + # Comprehensive test script for Telegraf/TimescaleDB metrics setup 4 + # This script validates the entire metrics pipeline 5 + 6 + set -e 7 + 8 + echo "=========================================" 9 + echo "Telegraf/TimescaleDB Metrics Test Suite" 10 + echo "=========================================" 11 + echo "" 12 + 13 + # Check if Docker is running 14 + if ! docker info > /dev/null 2>&1; then 15 + echo "โŒ Docker is not running. Please start Docker first." 16 + exit 1 17 + fi 18 + 19 + # Function to wait for a service to be healthy 20 + wait_for_service() { 21 + local service=$1 22 + local max_attempts=30 23 + local attempt=1 24 + 25 + echo -n "Waiting for $service to be healthy" 26 + while [ $attempt -le $max_attempts ]; do 27 + if docker-compose ps $service | grep -q "healthy"; then 28 + echo " โœ…" 29 + return 0 30 + fi 31 + echo -n "." 32 + sleep 2 33 + attempt=$((attempt + 1)) 34 + done 35 + echo " โŒ" 36 + echo "Service $service failed to become healthy after $max_attempts attempts" 37 + return 1 38 + } 39 + 40 + # Function to run SQL query 41 + run_query() { 42 + docker exec -i timescaledb psql -U postgres -d metrics -t -c "$1" 2>/dev/null 43 + } 44 + 45 + # Function to check table exists 46 + check_table() { 47 + local table=$1 48 + local result=$(run_query "SELECT EXISTS (SELECT 1 FROM information_schema.tables WHERE table_name = '$table');") 49 + if [[ "$result" =~ "t" ]]; then 50 + echo "โœ… Table '$table' exists" 51 + return 0 52 + else 53 + echo "โŒ Table '$table' does not exist" 54 + return 1 55 + fi 56 + } 57 + 58 + # Navigate to the metrics-stack directory (create if needed) 59 + if [ ! -d "metrics-stack" ]; then 60 + echo "Creating metrics-stack directory..." 61 + mkdir -p metrics-stack/telegraf 62 + mkdir -p metrics-stack/test-scripts 63 + mkdir -p metrics-stack/init-scripts 64 + fi 65 + 66 + cd metrics-stack 67 + 68 + # Create .env file if it doesn't exist 69 + if [ ! -f ".env" ]; then 70 + echo "Creating .env file..." 71 + cat > .env << 'EOF' 72 + # PostgreSQL/TimescaleDB Configuration 73 + POSTGRES_DB=metrics 74 + POSTGRES_USER=postgres 75 + POSTGRES_PASSWORD=secretpassword 76 + 77 + # Telegraf Database User 78 + TELEGRAF_DB_USER=postgres 79 + TELEGRAF_DB_PASSWORD=secretpassword 80 + 81 + # TimescaleDB Settings 82 + TIMESCALE_TELEMETRY=off 83 + EOF 84 + fi 85 + 86 + # Copy configuration files if they don't exist 87 + if [ ! -f "telegraf/telegraf.conf" ]; then 88 + echo "Creating telegraf.conf..." 89 + cat > telegraf/telegraf.conf << 'EOF' 90 + [agent] 91 + interval = "10s" 92 + round_interval = true 93 + metric_batch_size = 1000 94 + metric_buffer_limit = 10000 95 + collection_jitter = "0s" 96 + flush_interval = "10s" 97 + flush_jitter = "0s" 98 + precision = "" 99 + debug = false 100 + quiet = false 101 + hostname = "telegraf-agent" 102 + omit_hostname = false 103 + 104 + [[inputs.statsd]] 105 + service_address = ":8125" 106 + protocol = "udp" 107 + delete_gauges = true 108 + delete_counters = true 109 + delete_sets = true 110 + delete_timings = true 111 + percentiles = [50, 90, 95, 99] 112 + metric_separator = "." 113 + allowed_pending_messages = 10000 114 + datadog_extensions = true 115 + datadog_distributions = true 116 + 117 + [[outputs.postgresql]] 118 + connection = "host=timescaledb user=${TELEGRAF_DB_USER} password=${TELEGRAF_DB_PASSWORD} dbname=${POSTGRES_DB} sslmode=disable" 119 + schema = "public" 120 + create_templates = [ 121 + '''CREATE TABLE IF NOT EXISTS {{.table}} ({{.columns}})''', 122 + '''SELECT create_hypertable({{.table|quoteLiteral}}, 'time', if_not_exists => TRUE)''', 123 + ] 124 + tags_as_jsonb = true 125 + fields_as_jsonb = false 126 + EOF 127 + fi 128 + 129 + # Copy docker-compose.yml if it doesn't exist 130 + if [ ! -f "docker-compose.yml" ]; then 131 + echo "Creating docker-compose.yml..." 132 + cat > docker-compose.yml << 'EOF' 133 + version: '3.8' 134 + 135 + services: 136 + timescaledb: 137 + image: timescale/timescaledb:latest-pg17 138 + container_name: timescaledb 139 + restart: unless-stopped 140 + environment: 141 + POSTGRES_DB: ${POSTGRES_DB} 142 + POSTGRES_USER: ${POSTGRES_USER} 143 + POSTGRES_PASSWORD: ${POSTGRES_PASSWORD} 144 + TIMESCALE_TELEMETRY: ${TIMESCALE_TELEMETRY} 145 + ports: 146 + - "5442:5432" 147 + volumes: 148 + - timescale_data:/home/postgres/pgdata/data 149 + - ./init-scripts:/docker-entrypoint-initdb.d:ro 150 + command: 151 + - postgres 152 + - -c 153 + - shared_buffers=256MB 154 + - -c 155 + - effective_cache_size=1GB 156 + - -c 157 + - maintenance_work_mem=64MB 158 + - -c 159 + - work_mem=8MB 160 + healthcheck: 161 + test: ["CMD-SHELL", "pg_isready -U ${POSTGRES_USER} -d ${POSTGRES_DB}"] 162 + interval: 10s 163 + timeout: 5s 164 + retries: 5 165 + networks: 166 + - metrics_network 167 + 168 + telegraf: 169 + image: telegraf:1.35 170 + container_name: telegraf 171 + restart: unless-stopped 172 + environment: 173 + TELEGRAF_DB_USER: ${TELEGRAF_DB_USER} 174 + TELEGRAF_DB_PASSWORD: ${TELEGRAF_DB_PASSWORD} 175 + POSTGRES_DB: ${POSTGRES_DB} 176 + ports: 177 + - "8125:8125/udp" 178 + volumes: 179 + - ./telegraf/telegraf.conf:/etc/telegraf/telegraf.conf:ro 180 + depends_on: 181 + timescaledb: 182 + condition: service_healthy 183 + networks: 184 + - metrics_network 185 + command: ["telegraf", "--config", "/etc/telegraf/telegraf.conf"] 186 + 187 + networks: 188 + metrics_network: 189 + driver: bridge 190 + 191 + volumes: 192 + timescale_data: 193 + EOF 194 + fi 195 + 196 + # Create init script 197 + if [ ! -f "init-scripts/01-init.sql" ]; then 198 + echo "Creating init script..." 199 + cat > init-scripts/01-init.sql << 'EOF' 200 + -- Enable TimescaleDB extension 201 + CREATE EXTENSION IF NOT EXISTS timescaledb; 202 + CREATE EXTENSION IF NOT EXISTS pg_stat_statements; 203 + EOF 204 + fi 205 + 206 + echo "" 207 + echo "Step 1: Starting Docker services..." 208 + echo "=========================================" 209 + docker-compose down -v 2>/dev/null || true 210 + docker-compose up -d 211 + 212 + echo "" 213 + echo "Step 2: Waiting for services to be healthy..." 214 + echo "=========================================" 215 + wait_for_service timescaledb 216 + sleep 5 # Extra time for Telegraf to connect 217 + 218 + echo "" 219 + echo "Step 3: Sending test metrics..." 220 + echo "=========================================" 221 + 222 + # Send various types of metrics 223 + echo "Sending counter metrics..." 224 + for i in {1..5}; do 225 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 226 + echo "quickdid.http.request.count:1|c|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 227 + done 228 + 229 + echo "Sending gauge metrics..." 230 + echo "quickdid.resolver.rate_limit.available_permits:10|g" | nc -u -w0 localhost 8125 231 + sleep 1 232 + echo "quickdid.resolver.rate_limit.available_permits:5|g" | nc -u -w0 localhost 8125 233 + 234 + echo "Sending timing metrics..." 235 + for i in {1..10}; do 236 + duration=$((RANDOM % 100 + 10)) 237 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 238 + done 239 + 240 + echo "Sending histogram metrics..." 241 + for i in {1..5}; do 242 + resolution_time=$((RANDOM % 500 + 50)) 243 + echo "quickdid.resolver.resolution_time:${resolution_time}|h|#resolver:redis" | nc -u -w0 localhost 8125 244 + done 245 + 246 + echo "Waiting 15 seconds for Telegraf to flush metrics..." 247 + sleep 15 248 + 249 + echo "" 250 + echo "Step 4: Verifying table creation..." 251 + echo "=========================================" 252 + 253 + # Check if tables were created 254 + check_table "quickdid.http.request.count" 255 + check_table "quickdid.http.request.duration_ms" 256 + check_table "quickdid.resolver.rate_limit.available_permits" 257 + check_table "quickdid.resolver.resolution_time" 258 + 259 + echo "" 260 + echo "Step 5: Verifying data insertion..." 261 + echo "=========================================" 262 + 263 + # Check row counts 264 + for table in "quickdid.http.request.count" "quickdid.http.request.duration_ms" "quickdid.resolver.rate_limit.available_permits" "quickdid.resolver.resolution_time"; do 265 + count=$(run_query "SELECT COUNT(*) FROM \"$table\";" | tr -d ' ') 266 + if [ "$count" -gt 0 ]; then 267 + echo "โœ… Table '$table' has $count rows" 268 + else 269 + echo "โŒ Table '$table' is empty" 270 + fi 271 + done 272 + 273 + echo "" 274 + echo "Step 6: Testing JSONB tag queries..." 275 + echo "=========================================" 276 + 277 + # Test JSONB tag filtering 278 + result=$(run_query "SELECT COUNT(*) FROM \"quickdid.http.request.count\" WHERE tags->>'method' = 'GET';" | tr -d ' ') 279 + if [ "$result" -gt 0 ]; then 280 + echo "โœ… JSONB tag filtering works (found $result GET requests)" 281 + else 282 + echo "โŒ JSONB tag filtering failed" 283 + fi 284 + 285 + echo "" 286 + echo "Step 7: Testing TimescaleDB functions..." 287 + echo "=========================================" 288 + 289 + # Test time_bucket function 290 + result=$(run_query "SELECT COUNT(*) FROM (SELECT time_bucket('1 minute', time) FROM \"quickdid.http.request.count\" GROUP BY 1) t;" | tr -d ' ') 291 + if [ "$result" -gt 0 ]; then 292 + echo "โœ… time_bucket function works" 293 + else 294 + echo "โŒ time_bucket function failed" 295 + fi 296 + 297 + # Check if hypertables were created 298 + hypertable_count=$(run_query "SELECT COUNT(*) FROM timescaledb_information.hypertables WHERE hypertable_name LIKE 'quickdid%';" | tr -d ' ') 299 + if [ "$hypertable_count" -gt 0 ]; then 300 + echo "โœ… Found $hypertable_count hypertables" 301 + else 302 + echo "โŒ No hypertables found" 303 + fi 304 + 305 + echo "" 306 + echo "Step 8: Running comprehensive query tests..." 307 + echo "=========================================" 308 + 309 + # Run the verify-queries.sql script if it exists 310 + if [ -f "../test-scripts/verify-queries.sql" ]; then 311 + echo "Running verify-queries.sql..." 312 + docker exec -i timescaledb psql -U postgres -d metrics < ../test-scripts/verify-queries.sql > query_results.txt 2>&1 313 + if [ $? -eq 0 ]; then 314 + echo "โœ… All queries executed successfully" 315 + echo " Results saved to query_results.txt" 316 + else 317 + echo "โŒ Some queries failed. Check query_results.txt for details" 318 + fi 319 + else 320 + echo "โš ๏ธ verify-queries.sql not found, skipping comprehensive query tests" 321 + fi 322 + 323 + echo "" 324 + echo "=========================================" 325 + echo "Test Summary" 326 + echo "=========================================" 327 + 328 + # Generate summary 329 + failures=0 330 + successes=0 331 + 332 + # Count successes and failures from the output 333 + if check_table "quickdid.http.request.count" > /dev/null 2>&1; then 334 + successes=$((successes + 1)) 335 + else 336 + failures=$((failures + 1)) 337 + fi 338 + 339 + if [ "$hypertable_count" -gt 0 ]; then 340 + successes=$((successes + 1)) 341 + else 342 + failures=$((failures + 1)) 343 + fi 344 + 345 + echo "" 346 + if [ $failures -eq 0 ]; then 347 + echo "โœ… All tests passed successfully!" 348 + echo "" 349 + echo "You can now:" 350 + echo "1. Connect to the database: docker exec -it timescaledb psql -U postgres -d metrics" 351 + echo "2. View logs: docker-compose logs -f" 352 + echo "3. Send more metrics: echo 'metric.name:value|type|#tag:value' | nc -u -w0 localhost 8125" 353 + echo "4. Stop services: docker-compose down" 354 + else 355 + echo "โš ๏ธ Some tests failed. Please check the output above for details." 356 + echo "" 357 + echo "Troubleshooting tips:" 358 + echo "1. Check Telegraf logs: docker-compose logs telegraf" 359 + echo "2. Check TimescaleDB logs: docker-compose logs timescaledb" 360 + echo "3. Verify connectivity: docker exec telegraf telegraf --test" 361 + fi 362 + 363 + echo "" 364 + echo "Test complete!"
+44
test-scripts/send-metrics.sh
··· 1 + #!/bin/bash 2 + 3 + # Send test metrics to StatsD/Telegraf 4 + 5 + echo "Sending test metrics to StatsD on localhost:8125..." 6 + 7 + # Counter metrics 8 + for i in {1..10}; do 9 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 10 + echo "quickdid.http.request.count:1|c|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 11 + echo "quickdid.http.request.count:1|c|#method:GET,path:/resolve,status:404" | nc -u -w0 localhost 8125 12 + done 13 + 14 + # Gauge metrics 15 + echo "quickdid.resolver.rate_limit.available_permits:10|g" | nc -u -w0 localhost 8125 16 + echo "quickdid.resolver.rate_limit.available_permits:8|g" | nc -u -w0 localhost 8125 17 + echo "quickdid.resolver.rate_limit.available_permits:5|g" | nc -u -w0 localhost 8125 18 + 19 + # Timing metrics (in milliseconds) 20 + for i in {1..20}; do 21 + duration=$((RANDOM % 100 + 10)) 22 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:GET,path:/resolve,status:200" | nc -u -w0 localhost 8125 23 + done 24 + 25 + for i in {1..10}; do 26 + duration=$((RANDOM % 200 + 50)) 27 + echo "quickdid.http.request.duration_ms:${duration}|ms|#method:POST,path:/api,status:201" | nc -u -w0 localhost 8125 28 + done 29 + 30 + # Histogram metrics 31 + for i in {1..15}; do 32 + resolution_time=$((RANDOM % 500 + 50)) 33 + echo "quickdid.resolver.resolution_time:${resolution_time}|h|#resolver:redis" | nc -u -w0 localhost 8125 34 + echo "quickdid.resolver.resolution_time:$((resolution_time * 2))|h|#resolver:base" | nc -u -w0 localhost 8125 35 + done 36 + 37 + # Cache metrics 38 + echo "quickdid.cache.hit.count:45|c|#cache_type:redis" | nc -u -w0 localhost 8125 39 + echo "quickdid.cache.miss.count:5|c|#cache_type:redis" | nc -u -w0 localhost 8125 40 + echo "quickdid.cache.size:1024|g|#cache_type:memory" | nc -u -w0 localhost 8125 41 + 42 + echo "Metrics sent! Wait 15 seconds for Telegraf to flush..." 43 + sleep 15 44 + echo "Done!"
+145
test-scripts/verify-queries.sql
··· 1 + -- Test script to verify all metrics queries work correctly 2 + -- Run this after sending test metrics with send-metrics.sh 3 + 4 + \echo '===== CHECKING AVAILABLE TABLES =====' 5 + SELECT table_name 6 + FROM information_schema.tables 7 + WHERE table_schema = 'public' 8 + AND table_name LIKE 'quickdid%' 9 + ORDER BY table_name; 10 + 11 + \echo '' 12 + \echo '===== CHECKING TABLE STRUCTURES =====' 13 + \echo 'Structure of quickdid.http.request.count table:' 14 + \d "quickdid.http.request.count" 15 + 16 + \echo '' 17 + \echo 'Structure of quickdid.http.request.duration_ms table:' 18 + \d "quickdid.http.request.duration_ms" 19 + 20 + \echo '' 21 + \echo '===== QUERY 1: Recent HTTP Request Counts =====' 22 + SELECT 23 + time, 24 + tags, 25 + tags->>'method' as method, 26 + tags->>'path' as path, 27 + tags->>'status' as status, 28 + value 29 + FROM "quickdid.http.request.count" 30 + WHERE time > NOW() - INTERVAL '1 hour' 31 + ORDER BY time DESC 32 + LIMIT 10; 33 + 34 + \echo '' 35 + \echo '===== QUERY 2: HTTP Request Duration Statistics by Endpoint =====' 36 + SELECT 37 + time_bucket('1 minute', time) AS minute, 38 + tags->>'method' as method, 39 + tags->>'path' as path, 40 + tags->>'status' as status, 41 + COUNT(*) as request_count, 42 + AVG(mean) as avg_duration_ms, 43 + MAX(p99) as p99_duration_ms, 44 + MIN(mean) as min_duration_ms 45 + FROM "quickdid.http.request.duration_ms" 46 + WHERE time > NOW() - INTERVAL '1 hour' 47 + AND tags IS NOT NULL 48 + GROUP BY minute, tags->>'method', tags->>'path', tags->>'status' 49 + ORDER BY minute DESC 50 + LIMIT 10; 51 + 52 + \echo '' 53 + \echo '===== QUERY 3: Rate Limiter Status Over Time =====' 54 + SELECT 55 + time, 56 + value as available_permits 57 + FROM "quickdid.resolver.rate_limit.available_permits" 58 + WHERE time > NOW() - INTERVAL '1 hour' 59 + ORDER BY time DESC 60 + LIMIT 10; 61 + 62 + \echo '' 63 + \echo '===== QUERY 4: Resolver Performance Comparison =====' 64 + SELECT 65 + tags->>'resolver' as resolver_type, 66 + COUNT(*) as sample_count, 67 + AVG(mean) as avg_resolution_time_ms, 68 + MAX(p99) as p99_resolution_time_ms, 69 + MIN(mean) as min_resolution_time_ms 70 + FROM "quickdid.resolver.resolution_time" 71 + WHERE time > NOW() - INTERVAL '1 hour' 72 + AND tags->>'resolver' IS NOT NULL 73 + GROUP BY tags->>'resolver' 74 + ORDER BY avg_resolution_time_ms; 75 + 76 + \echo '' 77 + \echo '===== QUERY 5: Cache Hit Rate Analysis =====' 78 + WITH cache_stats AS ( 79 + SELECT 80 + 'hits' as metric_type, 81 + SUM(value) as total_count 82 + FROM "quickdid.cache.hit.count" 83 + WHERE time > NOW() - INTERVAL '1 hour' 84 + UNION ALL 85 + SELECT 86 + 'misses' as metric_type, 87 + SUM(value) as total_count 88 + FROM "quickdid.cache.miss.count" 89 + WHERE time > NOW() - INTERVAL '1 hour' 90 + ) 91 + SELECT 92 + SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) as total_hits, 93 + SUM(CASE WHEN metric_type = 'misses' THEN total_count ELSE 0 END) as total_misses, 94 + CASE 95 + WHEN SUM(total_count) > 0 THEN 96 + ROUND(100.0 * SUM(CASE WHEN metric_type = 'hits' THEN total_count ELSE 0 END) / SUM(total_count), 2) 97 + ELSE 0 98 + END as hit_rate_percentage 99 + FROM cache_stats; 100 + 101 + \echo '' 102 + \echo '===== QUERY 6: Hypertable Information =====' 103 + SELECT 104 + hypertable_schema, 105 + hypertable_name, 106 + owner, 107 + num_dimensions, 108 + num_chunks, 109 + compression_enabled 110 + FROM timescaledb_information.hypertables 111 + WHERE hypertable_name LIKE 'quickdid%' 112 + ORDER BY hypertable_name; 113 + 114 + \echo '' 115 + \echo '===== QUERY 7: HTTP Error Rate by Endpoint =====' 116 + WITH status_counts AS ( 117 + SELECT 118 + time_bucket('5 minutes', time) as period, 119 + tags->>'path' as path, 120 + CASE 121 + WHEN (tags->>'status')::int >= 400 THEN 'error' 122 + ELSE 'success' 123 + END as status_category, 124 + SUM(value) as request_count 125 + FROM "quickdid.http.request.count" 126 + WHERE time > NOW() - INTERVAL '1 hour' 127 + GROUP BY period, path, status_category 128 + ) 129 + SELECT 130 + period, 131 + path, 132 + SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) as error_count, 133 + SUM(CASE WHEN status_category = 'success' THEN request_count ELSE 0 END) as success_count, 134 + CASE 135 + WHEN SUM(request_count) > 0 THEN 136 + ROUND(100.0 * SUM(CASE WHEN status_category = 'error' THEN request_count ELSE 0 END) / SUM(request_count), 2) 137 + ELSE 0 138 + END as error_rate_percentage 139 + FROM status_counts 140 + GROUP BY period, path 141 + HAVING SUM(request_count) > 0 142 + ORDER BY period DESC, error_rate_percentage DESC; 143 + 144 + \echo '' 145 + \echo '===== TEST COMPLETED ====='
+1
www/.well-known/atproto-did
··· 1 + did:web:quickdid.smokesignal.tools
+15
www/.well-known/did.json
··· 1 + { 2 + "@context": [ 3 + "https://www.w3.org/ns/did/v1", 4 + "https://w3id.org/security/multikey/v1" 5 + ], 6 + "id": "did:web:quickdid.smokesignal.tools", 7 + "verificationMethod": [], 8 + "service": [ 9 + { 10 + "id": "#quickdid", 11 + "type": "QuickDIDService", 12 + "serviceEndpoint": "https://quickdid.smokesignal.tools" 13 + } 14 + ] 15 + }
+74
www/README.md
··· 1 + # QuickDID Static Files Directory 2 + 3 + This directory contains static files that are served by QuickDID. By default, QuickDID serves files from the `www` directory, but this can be configured using the `STATIC_FILES_DIR` environment variable. 4 + 5 + ## Directory Structure 6 + 7 + ``` 8 + www/ 9 + โ”œโ”€โ”€ .well-known/ 10 + โ”‚ โ”œโ”€โ”€ atproto-did # AT Protocol DID identifier 11 + โ”‚ โ””โ”€โ”€ did.json # DID document 12 + โ”œโ”€โ”€ index.html # Landing page 13 + โ””โ”€โ”€ README.md # This file 14 + ``` 15 + 16 + ## Files 17 + 18 + ### `.well-known/atproto-did` 19 + Contains the service's DID identifier (e.g., `did:web:example.com`). This file is used by AT Protocol clients to discover the service's DID. 20 + 21 + ### `.well-known/did.json` 22 + Contains the DID document with verification methods and service endpoints. This is a JSON-LD document following the W3C DID specification. 23 + 24 + ### `index.html` 25 + The landing page shown when users visit the root URL. This provides information about the service and available endpoints. 26 + 27 + ## Customization 28 + 29 + ### Using the Generation Script 30 + 31 + You can generate the `.well-known` files for your deployment using the provided script: 32 + 33 + ```bash 34 + HTTP_EXTERNAL=your-domain.com ./generate-wellknown.sh 35 + ``` 36 + 37 + This will create the appropriate files based on your domain. 38 + 39 + ### Manual Customization 40 + 41 + 1. **Update `.well-known/atproto-did`**: Replace with your service's DID 42 + 2. **Update `.well-known/did.json`**: Add your public key to the `verificationMethod` array if needed 43 + 3. **Customize `index.html`**: Modify the landing page to match your branding 44 + 45 + ### Docker Deployment 46 + 47 + When using Docker, you can mount custom static files: 48 + 49 + ```yaml 50 + volumes: 51 + - ./custom-www:/app/www:ro 52 + ``` 53 + 54 + Or just override specific files: 55 + 56 + ```yaml 57 + volumes: 58 + - ./custom-index.html:/app/www/index.html:ro 59 + - ./custom-wellknown:/app/www/.well-known:ro 60 + ``` 61 + 62 + ### Environment Variable 63 + 64 + You can change the static files directory using: 65 + 66 + ```bash 67 + STATIC_FILES_DIR=/path/to/custom/www 68 + ``` 69 + 70 + ## Security Notes 71 + 72 + - Static files are served with automatic MIME type detection 73 + - The `.well-known` files are crucial for AT Protocol compatibility 74 + - Ensure proper permissions on mounted volumes in production
+4
www/css/pico.classless.green.min.css
··· 1 + @charset "UTF-8";/*! 2 + * Pico CSS โœจ v2.1.1 (https://picocss.com) 3 + * Copyright 2019-2025 - Licensed under MIT 4 + */:host,:root{--pico-font-family-emoji:"Apple Color Emoji","Segoe UI Emoji","Segoe UI Symbol","Noto Color Emoji";--pico-font-family-sans-serif:system-ui,"Segoe UI",Roboto,Oxygen,Ubuntu,Cantarell,Helvetica,Arial,"Helvetica Neue",sans-serif,var(--pico-font-family-emoji);--pico-font-family-monospace:ui-monospace,SFMono-Regular,"SF Mono",Menlo,Consolas,"Liberation Mono",monospace,var(--pico-font-family-emoji);--pico-font-family:var(--pico-font-family-sans-serif);--pico-line-height:1.5;--pico-font-weight:400;--pico-font-size:100%;--pico-text-underline-offset:0.1rem;--pico-border-radius:0.25rem;--pico-border-width:0.0625rem;--pico-outline-width:0.125rem;--pico-transition:0.2s ease-in-out;--pico-spacing:1rem;--pico-typography-spacing-vertical:1rem;--pico-block-spacing-vertical:var(--pico-spacing);--pico-block-spacing-horizontal:var(--pico-spacing);--pico-form-element-spacing-vertical:0.75rem;--pico-form-element-spacing-horizontal:1rem;--pico-group-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-group-box-shadow-focus-with-button:0 0 0 var(--pico-outline-width) var(--pico-primary-focus);--pico-group-box-shadow-focus-with-input:0 0 0 0.0625rem var(--pico-form-element-border-color);--pico-modal-overlay-backdrop-filter:blur(0.375rem);--pico-nav-element-spacing-vertical:1rem;--pico-nav-element-spacing-horizontal:0.5rem;--pico-nav-link-spacing-vertical:0.5rem;--pico-nav-link-spacing-horizontal:0.5rem;--pico-nav-breadcrumb-divider:">";--pico-icon-checkbox:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-minus:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(255, 255, 255)' stroke-width='4' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='5' y1='12' x2='19' y2='12'%3E%3C/line%3E%3C/svg%3E");--pico-icon-chevron:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='6 9 12 15 18 9'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-date:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Crect x='3' y='4' width='18' height='18' rx='2' ry='2'%3E%3C/rect%3E%3Cline x1='16' y1='2' x2='16' y2='6'%3E%3C/line%3E%3Cline x1='8' y1='2' x2='8' y2='6'%3E%3C/line%3E%3Cline x1='3' y1='10' x2='21' y2='10'%3E%3C/line%3E%3C/svg%3E");--pico-icon-time:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cpolyline points='12 6 12 12 16 14'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-search:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='1.5' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='11' cy='11' r='8'%3E%3C/circle%3E%3Cline x1='21' y1='21' x2='16.65' y2='16.65'%3E%3C/line%3E%3C/svg%3E");--pico-icon-close:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(136, 145, 164)' stroke-width='3' stroke-linecap='round' stroke-linejoin='round'%3E%3Cline x1='18' y1='6' x2='6' y2='18'%3E%3C/line%3E%3Cline x1='6' y1='6' x2='18' y2='18'%3E%3C/line%3E%3C/svg%3E");--pico-icon-loading:url("data:image/svg+xml,%3Csvg fill='none' height='24' width='24' viewBox='0 0 24 24' xmlns='http://www.w3.org/2000/svg' %3E%3Cstyle%3E g %7B animation: rotate 2s linear infinite; transform-origin: center center; %7D circle %7B stroke-dasharray: 75,100; stroke-dashoffset: -5; animation: dash 1.5s ease-in-out infinite; stroke-linecap: round; %7D @keyframes rotate %7B 0%25 %7B transform: rotate(0deg); %7D 100%25 %7B transform: rotate(360deg); %7D %7D @keyframes dash %7B 0%25 %7B stroke-dasharray: 1,100; stroke-dashoffset: 0; %7D 50%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -17.5; %7D 100%25 %7B stroke-dasharray: 44.5,100; stroke-dashoffset: -62; %7D %7D %3C/style%3E%3Cg%3E%3Ccircle cx='12' cy='12' r='10' fill='none' stroke='rgb(136, 145, 164)' stroke-width='4' /%3E%3C/g%3E%3C/svg%3E")}@media (min-width:576px){:host,:root{--pico-font-size:106.25%}}@media (min-width:768px){:host,:root{--pico-font-size:112.5%}}@media (min-width:1024px){:host,:root{--pico-font-size:118.75%}}@media (min-width:1280px){:host,:root{--pico-font-size:125%}}@media (min-width:1536px){:host,:root{--pico-font-size:131.25%}}a{--pico-text-decoration:underline}small{--pico-font-size:0.875em}h1,h2,h3,h4,h5,h6{--pico-font-weight:700}h1{--pico-font-size:2rem;--pico-line-height:1.125;--pico-typography-spacing-top:3rem}h2{--pico-font-size:1.75rem;--pico-line-height:1.15;--pico-typography-spacing-top:2.625rem}h3{--pico-font-size:1.5rem;--pico-line-height:1.175;--pico-typography-spacing-top:2.25rem}h4{--pico-font-size:1.25rem;--pico-line-height:1.2;--pico-typography-spacing-top:1.874rem}h5{--pico-font-size:1.125rem;--pico-line-height:1.225;--pico-typography-spacing-top:1.6875rem}h6{--pico-font-size:1rem;--pico-line-height:1.25;--pico-typography-spacing-top:1.5rem}tfoot td,tfoot th,thead td,thead th{--pico-font-weight:600;--pico-border-width:0.1875rem}code,kbd,pre,samp{--pico-font-family:var(--pico-font-family-monospace)}kbd{--pico-font-weight:bolder}:where(select,textarea),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-outline-width:0.0625rem}[type=search]{--pico-border-radius:5rem}[type=checkbox],[type=radio]{--pico-border-width:0.125rem}[type=checkbox][role=switch]{--pico-border-width:0.1875rem}[role=search]{--pico-border-radius:5rem}[role=group] [role=button],[role=group] [type=button],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=submit],[role=search] button{--pico-form-element-spacing-horizontal:2rem}details summary[role=button]::after{filter:brightness(0) invert(1)}[aria-busy=true]:not(input,select,textarea):is(button,[type=submit],[type=button],[type=reset],[role=button])::before{filter:brightness(0) invert(1)}:host(:not([data-theme=dark])),:root:not([data-theme=dark]),[data-theme=light]{color-scheme:light;--pico-background-color:#fff;--pico-color:#373c44;--pico-text-selection-color:rgba(71, 164, 23, 0.25);--pico-muted-color:#646b79;--pico-muted-border-color:rgb(231, 234, 239.5);--pico-primary:#33790f;--pico-primary-background:#398712;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(51, 121, 15, 0.5);--pico-primary-hover:#265e09;--pico-primary-hover-background:#33790f;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(71, 164, 23, 0.5);--pico-primary-inverse:#fff;--pico-secondary:#5d6b89;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(93, 107, 137, 0.5);--pico-secondary-hover:#48536b;--pico-secondary-hover-background:#48536b;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(93, 107, 137, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#181c25;--pico-contrast-background:#181c25;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(24, 28, 37, 0.5);--pico-contrast-hover:#000;--pico-contrast-hover-background:#000;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-secondary-hover);--pico-contrast-focus:rgba(93, 107, 137, 0.25);--pico-contrast-inverse:#fff;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(129, 145, 181, 0.01698),0.0335rem 0.067rem 0.402rem rgba(129, 145, 181, 0.024),0.0625rem 0.125rem 0.75rem rgba(129, 145, 181, 0.03),0.1125rem 0.225rem 1.35rem rgba(129, 145, 181, 0.036),0.2085rem 0.417rem 2.502rem rgba(129, 145, 181, 0.04302),0.5rem 1rem 6rem rgba(129, 145, 181, 0.06),0 0 0 0.0625rem rgba(129, 145, 181, 0.015);--pico-h1-color:#2d3138;--pico-h2-color:#373c44;--pico-h3-color:#424751;--pico-h4-color:#4d535e;--pico-h5-color:#5c6370;--pico-h6-color:#646b79;--pico-mark-background-color:rgb(252.5, 230.5, 191.5);--pico-mark-color:#0f1114;--pico-ins-color:rgb(28.5, 105.5, 84);--pico-del-color:rgb(136, 56.5, 53);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(243, 244.5, 246.75);--pico-code-color:#646b79;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(251, 251.5, 252.25);--pico-form-element-selected-background-color:#dfe3eb;--pico-form-element-border-color:#cfd5e2;--pico-form-element-color:#23262c;--pico-form-element-placeholder-color:var(--pico-muted-color);--pico-form-element-active-background-color:#fff;--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(183.5, 105.5, 106.5);--pico-form-element-invalid-active-border-color:rgb(200.25, 79.25, 72.25);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:rgb(76, 154.5, 137.5);--pico-form-element-valid-active-border-color:rgb(39, 152.75, 118.75);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#bfc7d9;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#dfe3eb;--pico-range-active-border-color:#bfc7d9;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:var(--pico-background-color);--pico-card-border-color:var(--pico-muted-border-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(251, 251.5, 252.25);--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(232, 234, 237, 0.75);--pico-progress-background-color:#dfe3eb;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(76, 154.5, 137.5)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(200.25, 79.25, 72.25)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme=dark])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme=dark]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),[data-theme=light] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}@media only screen and (prefers-color-scheme:dark){:host(:not([data-theme])),:root:not([data-theme]){color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(78, 179, 27, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#4eb31b;--pico-primary-background:#398712;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(78, 179, 27, 0.5);--pico-primary-hover:#5dd121;--pico-primary-hover-background:#409614;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(78, 179, 27, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}:host(:not([data-theme])) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]),:root:not([data-theme]) input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}}[data-theme=dark]{color-scheme:dark;--pico-background-color:rgb(19, 22.5, 30.5);--pico-color:#c2c7d0;--pico-text-selection-color:rgba(78, 179, 27, 0.1875);--pico-muted-color:#7b8495;--pico-muted-border-color:#202632;--pico-primary:#4eb31b;--pico-primary-background:#398712;--pico-primary-border:var(--pico-primary-background);--pico-primary-underline:rgba(78, 179, 27, 0.5);--pico-primary-hover:#5dd121;--pico-primary-hover-background:#409614;--pico-primary-hover-border:var(--pico-primary-hover-background);--pico-primary-hover-underline:var(--pico-primary-hover);--pico-primary-focus:rgba(78, 179, 27, 0.375);--pico-primary-inverse:#fff;--pico-secondary:#969eaf;--pico-secondary-background:#525f7a;--pico-secondary-border:var(--pico-secondary-background);--pico-secondary-underline:rgba(150, 158, 175, 0.5);--pico-secondary-hover:#b3b9c5;--pico-secondary-hover-background:#5d6b89;--pico-secondary-hover-border:var(--pico-secondary-hover-background);--pico-secondary-hover-underline:var(--pico-secondary-hover);--pico-secondary-focus:rgba(144, 158, 190, 0.25);--pico-secondary-inverse:#fff;--pico-contrast:#dfe3eb;--pico-contrast-background:#eff1f4;--pico-contrast-border:var(--pico-contrast-background);--pico-contrast-underline:rgba(223, 227, 235, 0.5);--pico-contrast-hover:#fff;--pico-contrast-hover-background:#fff;--pico-contrast-hover-border:var(--pico-contrast-hover-background);--pico-contrast-hover-underline:var(--pico-contrast-hover);--pico-contrast-focus:rgba(207, 213, 226, 0.25);--pico-contrast-inverse:#000;--pico-box-shadow:0.0145rem 0.029rem 0.174rem rgba(7, 8.5, 12, 0.01698),0.0335rem 0.067rem 0.402rem rgba(7, 8.5, 12, 0.024),0.0625rem 0.125rem 0.75rem rgba(7, 8.5, 12, 0.03),0.1125rem 0.225rem 1.35rem rgba(7, 8.5, 12, 0.036),0.2085rem 0.417rem 2.502rem rgba(7, 8.5, 12, 0.04302),0.5rem 1rem 6rem rgba(7, 8.5, 12, 0.06),0 0 0 0.0625rem rgba(7, 8.5, 12, 0.015);--pico-h1-color:#f0f1f3;--pico-h2-color:#e0e3e7;--pico-h3-color:#c2c7d0;--pico-h4-color:#b3b9c5;--pico-h5-color:#a4acba;--pico-h6-color:#8891a4;--pico-mark-background-color:#014063;--pico-mark-color:#fff;--pico-ins-color:#62af9a;--pico-del-color:rgb(205.5, 126, 123);--pico-blockquote-border-color:var(--pico-muted-border-color);--pico-blockquote-footer-color:var(--pico-muted-color);--pico-button-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-button-hover-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-table-border-color:var(--pico-muted-border-color);--pico-table-row-stripped-background-color:rgba(111, 120, 135, 0.0375);--pico-code-background-color:rgb(26, 30.5, 40.25);--pico-code-color:#8891a4;--pico-code-kbd-background-color:var(--pico-color);--pico-code-kbd-color:var(--pico-background-color);--pico-form-element-background-color:rgb(28, 33, 43.5);--pico-form-element-selected-background-color:#2a3140;--pico-form-element-border-color:#2a3140;--pico-form-element-color:#e0e3e7;--pico-form-element-placeholder-color:#8891a4;--pico-form-element-active-background-color:rgb(26, 30.5, 40.25);--pico-form-element-active-border-color:var(--pico-primary-border);--pico-form-element-focus-color:var(--pico-primary-border);--pico-form-element-disabled-opacity:0.5;--pico-form-element-invalid-border-color:rgb(149.5, 74, 80);--pico-form-element-invalid-active-border-color:rgb(183.25, 63.5, 59);--pico-form-element-invalid-focus-color:var(--pico-form-element-invalid-active-border-color);--pico-form-element-valid-border-color:#2a7b6f;--pico-form-element-valid-active-border-color:rgb(22, 137, 105.5);--pico-form-element-valid-focus-color:var(--pico-form-element-valid-active-border-color);--pico-switch-background-color:#333c4e;--pico-switch-checked-background-color:var(--pico-primary-background);--pico-switch-color:#fff;--pico-switch-thumb-box-shadow:0 0 0 rgba(0, 0, 0, 0);--pico-range-border-color:#202632;--pico-range-active-border-color:#2a3140;--pico-range-thumb-border-color:var(--pico-background-color);--pico-range-thumb-color:var(--pico-secondary-background);--pico-range-thumb-active-color:var(--pico-primary-background);--pico-accordion-border-color:var(--pico-muted-border-color);--pico-accordion-active-summary-color:var(--pico-primary-hover);--pico-accordion-close-summary-color:var(--pico-color);--pico-accordion-open-summary-color:var(--pico-muted-color);--pico-card-background-color:#181c25;--pico-card-border-color:var(--pico-card-background-color);--pico-card-box-shadow:var(--pico-box-shadow);--pico-card-sectioning-background-color:rgb(26, 30.5, 40.25);--pico-loading-spinner-opacity:0.5;--pico-modal-overlay-background-color:rgba(7.5, 8.5, 10, 0.75);--pico-progress-background-color:#202632;--pico-progress-color:var(--pico-primary-background);--pico-tooltip-background-color:var(--pico-contrast-background);--pico-tooltip-color:var(--pico-contrast-inverse);--pico-icon-valid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(42, 123, 111)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Cpolyline points='20 6 9 17 4 12'%3E%3C/polyline%3E%3C/svg%3E");--pico-icon-invalid:url("data:image/svg+xml,%3Csvg xmlns='http://www.w3.org/2000/svg' width='24' height='24' viewBox='0 0 24 24' fill='none' stroke='rgb(149.5, 74, 80)' stroke-width='2' stroke-linecap='round' stroke-linejoin='round'%3E%3Ccircle cx='12' cy='12' r='10'%3E%3C/circle%3E%3Cline x1='12' y1='8' x2='12' y2='12'%3E%3C/line%3E%3Cline x1='12' y1='16' x2='12.01' y2='16'%3E%3C/line%3E%3C/svg%3E")}[data-theme=dark] input:is([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[type=file]){--pico-form-element-focus-color:var(--pico-primary-focus)}[type=checkbox],[type=radio],[type=range],progress{accent-color:var(--pico-primary)}*,::after,::before{box-sizing:border-box;background-repeat:no-repeat}::after,::before{text-decoration:inherit;vertical-align:inherit}:where(:host),:where(:root){-webkit-tap-highlight-color:transparent;-webkit-text-size-adjust:100%;-moz-text-size-adjust:100%;text-size-adjust:100%;background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family);text-underline-offset:var(--pico-text-underline-offset);text-rendering:optimizeLegibility;overflow-wrap:break-word;-moz-tab-size:4;-o-tab-size:4;tab-size:4}body{width:100%;margin:0}main{display:block}body>footer,body>header,body>main{width:100%;margin-right:auto;margin-left:auto;padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal)}@media (min-width:576px){body>footer,body>header,body>main{max-width:510px;padding-right:0;padding-left:0}}@media (min-width:768px){body>footer,body>header,body>main{max-width:700px}}@media (min-width:1024px){body>footer,body>header,body>main{max-width:950px}}@media (min-width:1280px){body>footer,body>header,body>main{max-width:1200px}}@media (min-width:1536px){body>footer,body>header,body>main{max-width:1450px}}section{margin-bottom:var(--pico-block-spacing-vertical)}b,strong{font-weight:bolder}sub,sup{position:relative;font-size:.75em;line-height:0;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}address,blockquote,dl,ol,p,pre,table,ul{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-style:normal;font-weight:var(--pico-font-weight)}h1,h2,h3,h4,h5,h6{margin-top:0;margin-bottom:var(--pico-typography-spacing-vertical);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:var(--pico-font-size);line-height:var(--pico-line-height);font-family:var(--pico-font-family)}h1{--pico-color:var(--pico-h1-color)}h2{--pico-color:var(--pico-h2-color)}h3{--pico-color:var(--pico-h3-color)}h4{--pico-color:var(--pico-h4-color)}h5{--pico-color:var(--pico-h5-color)}h6{--pico-color:var(--pico-h6-color)}:where(article,address,blockquote,dl,figure,form,ol,p,pre,table,ul)~:is(h1,h2,h3,h4,h5,h6){margin-top:var(--pico-typography-spacing-top)}p{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup{margin-bottom:var(--pico-typography-spacing-vertical)}hgroup>*{margin-top:0;margin-bottom:0}hgroup>:not(:first-child):last-child{--pico-color:var(--pico-muted-color);--pico-font-weight:unset;font-size:1rem}:where(ol,ul) li{margin-bottom:calc(var(--pico-typography-spacing-vertical) * .25)}:where(dl,ol,ul) :where(dl,ol,ul){margin:0;margin-top:calc(var(--pico-typography-spacing-vertical) * .25)}ul li{list-style:square}mark{padding:.125rem .25rem;background-color:var(--pico-mark-background-color);color:var(--pico-mark-color);vertical-align:baseline}blockquote{display:block;margin:var(--pico-typography-spacing-vertical) 0;padding:var(--pico-spacing);border-right:none;border-left:.25rem solid var(--pico-blockquote-border-color);border-inline-start:0.25rem solid var(--pico-blockquote-border-color);border-inline-end:none}blockquote footer{margin-top:calc(var(--pico-typography-spacing-vertical) * .5);color:var(--pico-blockquote-footer-color)}abbr[title]{border-bottom:1px dotted;text-decoration:none;cursor:help}ins{color:var(--pico-ins-color);text-decoration:none}del{color:var(--pico-del-color)}::-moz-selection{background-color:var(--pico-text-selection-color)}::selection{background-color:var(--pico-text-selection-color)}:where(a:not([role=button])),[role=link]{--pico-color:var(--pico-primary);--pico-background-color:transparent;--pico-underline:var(--pico-primary-underline);outline:0;background-color:var(--pico-background-color);color:var(--pico-color);-webkit-text-decoration:var(--pico-text-decoration);text-decoration:var(--pico-text-decoration);text-decoration-color:var(--pico-underline);text-underline-offset:0.125em;transition:background-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),color var(--pico-transition),text-decoration var(--pico-transition),box-shadow var(--pico-transition),-webkit-text-decoration var(--pico-transition)}:where(a:not([role=button])):is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[role=link]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-color:var(--pico-primary-hover);--pico-underline:var(--pico-primary-hover-underline);--pico-text-decoration:underline}:where(a:not([role=button])):focus-visible,[role=link]:focus-visible{box-shadow:0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}a[role=button]{display:inline-block}button{margin:0;overflow:visible;font-family:inherit;text-transform:none}[type=button],[type=reset],[type=submit],button{-webkit-appearance:button}[role=button],[type=button],[type=file]::file-selector-button,[type=reset],[type=submit],button{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);--pico-color:var(--pico-primary-inverse);--pico-box-shadow:var(--pico-button-box-shadow, 0 0 0 rgba(0, 0, 0, 0));padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal);border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);font-size:1rem;line-height:var(--pico-line-height);text-align:center;text-decoration:none;cursor:pointer;-webkit-user-select:none;-moz-user-select:none;user-select:none;transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}[role=button]:is(:hover,:active,:focus),[role=button]:is([aria-current]:not([aria-current=false])),[type=button]:is(:hover,:active,:focus),[type=button]:is([aria-current]:not([aria-current=false])),[type=file]::file-selector-button:is(:hover,:active,:focus),[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])),[type=reset]:is(:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false])),[type=submit]:is(:hover,:active,:focus),[type=submit]:is([aria-current]:not([aria-current=false])),button:is(:hover,:active,:focus),button:is([aria-current]:not([aria-current=false])){--pico-background-color:var(--pico-primary-hover-background);--pico-border-color:var(--pico-primary-hover-border);--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0));--pico-color:var(--pico-primary-inverse)}[role=button]:focus,[role=button]:is([aria-current]:not([aria-current=false])):focus,[type=button]:focus,[type=button]:is([aria-current]:not([aria-current=false])):focus,[type=file]::file-selector-button:focus,[type=file]::file-selector-button:is([aria-current]:not([aria-current=false])):focus,[type=reset]:focus,[type=reset]:is([aria-current]:not([aria-current=false])):focus,[type=submit]:focus,[type=submit]:is([aria-current]:not([aria-current=false])):focus,button:focus,button:is([aria-current]:not([aria-current=false])):focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-primary-focus)}[type=button],[type=reset],[type=submit]{margin-bottom:var(--pico-spacing)}[type=file]::file-selector-button,[type=reset]{--pico-background-color:var(--pico-secondary-background);--pico-border-color:var(--pico-secondary-border);--pico-color:var(--pico-secondary-inverse);cursor:pointer}[type=file]::file-selector-button:is([aria-current]:not([aria-current=false]),:hover,:active,:focus),[type=reset]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border);--pico-color:var(--pico-secondary-inverse)}[type=file]::file-selector-button:focus,[type=reset]:focus{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}:where(button,[type=submit],[type=reset],[type=button],[role=button])[disabled],:where(fieldset[disabled]) :is(button,[type=submit],[type=button],[type=reset],[role=button]){opacity:.5;pointer-events:none}:where(table){width:100%;border-collapse:collapse;border-spacing:0;text-indent:0}td,th{padding:calc(var(--pico-spacing)/ 2) var(--pico-spacing);border-bottom:var(--pico-border-width) solid var(--pico-table-border-color);background-color:var(--pico-background-color);color:var(--pico-color);font-weight:var(--pico-font-weight);text-align:left;text-align:start}tfoot td,tfoot th{border-top:var(--pico-border-width) solid var(--pico-table-border-color);border-bottom:0}table.striped tbody tr:nth-child(odd) td,table.striped tbody tr:nth-child(odd) th{background-color:var(--pico-table-row-stripped-background-color)}:where(audio,canvas,iframe,img,svg,video){vertical-align:middle}audio,video{display:inline-block}audio:not([controls]){display:none;height:0}:where(iframe){border-style:none}img{max-width:100%;height:auto;border-style:none}:where(svg:not([fill])){fill:currentColor}svg:not(:host),svg:not(:root){overflow:hidden}code,kbd,pre,samp{font-size:.875em;font-family:var(--pico-font-family)}pre code,pre samp{font-size:inherit;font-family:inherit}pre{-ms-overflow-style:scrollbar;overflow:auto}code,kbd,pre,samp{border-radius:var(--pico-border-radius);background:var(--pico-code-background-color);color:var(--pico-code-color);font-weight:var(--pico-font-weight);line-height:initial}code,kbd,samp{display:inline-block;padding:.375rem}pre{display:block;margin-bottom:var(--pico-spacing);overflow-x:auto}pre>code,pre>samp{display:block;padding:var(--pico-spacing);background:0 0;line-height:var(--pico-line-height)}kbd{background-color:var(--pico-code-kbd-background-color);color:var(--pico-code-kbd-color);vertical-align:baseline}figure{display:block;margin:0;padding:0}figure figcaption{padding:calc(var(--pico-spacing) * .5) 0;color:var(--pico-muted-color)}hr{height:0;margin:var(--pico-typography-spacing-vertical) 0;border:0;border-top:1px solid var(--pico-muted-border-color);color:inherit}[hidden],template{display:none!important}canvas{display:inline-block}input,optgroup,select,textarea{margin:0;font-size:1rem;line-height:var(--pico-line-height);font-family:inherit;letter-spacing:inherit}input{overflow:visible}select{text-transform:none}legend{max-width:100%;padding:0;color:inherit;white-space:normal}textarea{overflow:auto}[type=checkbox],[type=radio]{padding:0}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}[type=search]::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}::-moz-focus-inner{padding:0;border-style:none}:-moz-focusring{outline:0}:-moz-ui-invalid{box-shadow:none}::-ms-expand{display:none}[type=file],[type=range]{padding:0;border-width:0}input:not([type=checkbox],[type=radio],[type=range]){height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2)}fieldset{width:100%;margin:0;margin-bottom:var(--pico-spacing);padding:0;border:0}fieldset legend,label{display:block;margin-bottom:calc(var(--pico-spacing) * .375);color:var(--pico-color);font-weight:var(--pico-form-label-font-weight,var(--pico-font-weight))}fieldset legend{margin-bottom:calc(var(--pico-spacing) * .5)}button[type=submit],input:not([type=checkbox],[type=radio]),select,textarea{width:100%}input:not([type=checkbox],[type=radio],[type=range],[type=file]),select,textarea{-webkit-appearance:none;-moz-appearance:none;appearance:none;padding:var(--pico-form-element-spacing-vertical) var(--pico-form-element-spacing-horizontal)}input,select,textarea{--pico-background-color:var(--pico-form-element-background-color);--pico-border-color:var(--pico-form-element-border-color);--pico-color:var(--pico-form-element-color);--pico-box-shadow:none;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:var(--pico-border-radius);outline:0;background-color:var(--pico-background-color);box-shadow:var(--pico-box-shadow);color:var(--pico-color);font-weight:var(--pico-font-weight);transition:background-color var(--pico-transition),border-color var(--pico-transition),color var(--pico-transition),box-shadow var(--pico-transition)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[type=checkbox],[type=radio],[readonly]):is(:active,:focus){--pico-background-color:var(--pico-form-element-active-background-color)}:where(select,textarea):not([readonly]):is(:active,:focus),input:not([type=submit],[type=button],[type=reset],[role=switch],[readonly]):is(:active,:focus){--pico-border-color:var(--pico-form-element-active-border-color)}:where(select,textarea):not([readonly]):focus,input:not([type=submit],[type=button],[type=reset],[type=range],[type=file],[readonly]):focus{--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-focus-color)}:where(fieldset[disabled]) :is(input:not([type=submit],[type=button],[type=reset]),select,textarea),input:not([type=submit],[type=button],[type=reset])[disabled],label[aria-disabled=true],select[disabled],textarea[disabled]{opacity:var(--pico-form-element-disabled-opacity);pointer-events:none}label[aria-disabled=true] input[disabled]{opacity:1}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid]{padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal)!important;padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem)!important;background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=false]:not(select){background-image:var(--pico-icon-valid)}:where(input,select,textarea):not([type=checkbox],[type=radio],[type=date],[type=datetime-local],[type=month],[type=time],[type=week],[type=range])[aria-invalid=true]:not(select){background-image:var(--pico-icon-invalid)}:where(input,select,textarea)[aria-invalid=false]{--pico-border-color:var(--pico-form-element-valid-border-color)}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus){--pico-border-color:var(--pico-form-element-valid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=false]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-valid-focus-color)!important}:where(input,select,textarea)[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus){--pico-border-color:var(--pico-form-element-invalid-active-border-color)!important}:where(input,select,textarea)[aria-invalid=true]:is(:active,:focus):not([type=checkbox],[type=radio]){--pico-box-shadow:0 0 0 var(--pico-outline-width) var(--pico-form-element-invalid-focus-color)!important}[dir=rtl] :where(input,select,textarea):not([type=checkbox],[type=radio]):is([aria-invalid],[aria-invalid=true],[aria-invalid=false]){background-position:center left .75rem}input::-webkit-input-placeholder,input::placeholder,select:invalid,textarea::-webkit-input-placeholder,textarea::placeholder{color:var(--pico-form-element-placeholder-color);opacity:1}input:not([type=checkbox],[type=radio]),select,textarea{margin-bottom:var(--pico-spacing)}select::-ms-expand{border:0;background-color:transparent}select:not([multiple],[size]){padding-right:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);padding-left:var(--pico-form-element-spacing-horizontal);padding-inline-start:var(--pico-form-element-spacing-horizontal);padding-inline-end:calc(var(--pico-form-element-spacing-horizontal) + 1.5rem);background-image:var(--pico-icon-chevron);background-position:center right .75rem;background-size:1rem auto;background-repeat:no-repeat}select[multiple] option:checked{background:var(--pico-form-element-selected-background-color);color:var(--pico-form-element-color)}[dir=rtl] select:not([multiple],[size]){background-position:center left .75rem}textarea{display:block;resize:vertical}textarea[aria-invalid]{--pico-icon-height:calc(1rem * var(--pico-line-height) + var(--pico-form-element-spacing-vertical) * 2 + var(--pico-border-width) * 2);background-position:top right .75rem!important;background-size:1rem var(--pico-icon-height)!important}:where(input,select,textarea,fieldset)+small{display:block;width:100%;margin-top:calc(var(--pico-spacing) * -.75);margin-bottom:var(--pico-spacing);color:var(--pico-muted-color)}:where(input,select,textarea,fieldset)[aria-invalid=false]+small{color:var(--pico-ins-color)}:where(input,select,textarea,fieldset)[aria-invalid=true]+small{color:var(--pico-del-color)}label>:where(input,select,textarea){margin-top:calc(var(--pico-spacing) * .25)}label:has([type=checkbox],[type=radio]){width:-moz-fit-content;width:fit-content;cursor:pointer}[type=checkbox],[type=radio]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:1.25em;height:1.25em;margin-top:-.125em;margin-inline-end:.5em;border-width:var(--pico-border-width);vertical-align:middle;cursor:pointer}[type=checkbox]::-ms-check,[type=radio]::-ms-check{display:none}[type=checkbox]:checked,[type=checkbox]:checked:active,[type=checkbox]:checked:focus,[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-checkbox);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=checkbox]~label,[type=radio]~label{display:inline-block;margin-bottom:0;cursor:pointer}[type=checkbox]~label:not(:last-of-type),[type=radio]~label:not(:last-of-type){margin-inline-end:1em}[type=checkbox]:indeterminate{--pico-background-color:var(--pico-primary-background);--pico-border-color:var(--pico-primary-border);background-image:var(--pico-icon-minus);background-position:center;background-size:.75em auto;background-repeat:no-repeat}[type=radio]{border-radius:50%}[type=radio]:checked,[type=radio]:checked:active,[type=radio]:checked:focus{--pico-background-color:var(--pico-primary-inverse);border-width:.35em;background-image:none}[type=checkbox][role=switch]{--pico-background-color:var(--pico-switch-background-color);--pico-color:var(--pico-switch-color);width:2.25em;height:1.25em;border:var(--pico-border-width) solid var(--pico-border-color);border-radius:1.25em;background-color:var(--pico-background-color);line-height:1.25em}[type=checkbox][role=switch]:not([aria-invalid]){--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:before{display:block;aspect-ratio:1;height:100%;border-radius:50%;background-color:var(--pico-color);box-shadow:var(--pico-switch-thumb-box-shadow);content:"";transition:margin .1s ease-in-out}[type=checkbox][role=switch]:focus{--pico-background-color:var(--pico-switch-background-color);--pico-border-color:var(--pico-switch-background-color)}[type=checkbox][role=switch]:checked{--pico-background-color:var(--pico-switch-checked-background-color);--pico-border-color:var(--pico-switch-checked-background-color);background-image:none}[type=checkbox][role=switch]:checked::before{margin-inline-start:calc(2.25em - 1.25em)}[type=checkbox][role=switch][disabled]{--pico-background-color:var(--pico-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus{--pico-background-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true]{--pico-background-color:var(--pico-form-element-invalid-border-color)}[type=checkbox][aria-invalid=false]:checked,[type=checkbox][aria-invalid=false]:checked:active,[type=checkbox][aria-invalid=false]:checked:focus,[type=checkbox][role=switch][aria-invalid=false]:checked,[type=checkbox][role=switch][aria-invalid=false]:checked:active,[type=checkbox][role=switch][aria-invalid=false]:checked:focus,[type=radio][aria-invalid=false]:checked,[type=radio][aria-invalid=false]:checked:active,[type=radio][aria-invalid=false]:checked:focus{--pico-border-color:var(--pico-form-element-valid-border-color)}[type=checkbox]:checked:active[aria-invalid=true],[type=checkbox]:checked:focus[aria-invalid=true],[type=checkbox]:checked[aria-invalid=true],[type=checkbox][role=switch]:checked:active[aria-invalid=true],[type=checkbox][role=switch]:checked:focus[aria-invalid=true],[type=checkbox][role=switch]:checked[aria-invalid=true],[type=radio]:checked:active[aria-invalid=true],[type=radio]:checked:focus[aria-invalid=true],[type=radio]:checked[aria-invalid=true]{--pico-border-color:var(--pico-form-element-invalid-border-color)}[type=color]::-webkit-color-swatch-wrapper{padding:0}[type=color]::-moz-focus-inner{padding:0}[type=color]::-webkit-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}[type=color]::-moz-color-swatch{border:0;border-radius:calc(var(--pico-border-radius) * .5)}input:not([type=checkbox],[type=radio],[type=range],[type=file]):is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){--pico-icon-position:0.75rem;--pico-icon-width:1rem;padding-right:calc(var(--pico-icon-width) + var(--pico-icon-position));background-image:var(--pico-icon-date);background-position:center right var(--pico-icon-position);background-size:var(--pico-icon-width) auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=time]{background-image:var(--pico-icon-time)}[type=date]::-webkit-calendar-picker-indicator,[type=datetime-local]::-webkit-calendar-picker-indicator,[type=month]::-webkit-calendar-picker-indicator,[type=time]::-webkit-calendar-picker-indicator,[type=week]::-webkit-calendar-picker-indicator{width:var(--pico-icon-width);margin-right:calc(var(--pico-icon-width) * -1);margin-left:var(--pico-icon-position);opacity:0}@-moz-document url-prefix(){[type=date],[type=datetime-local],[type=month],[type=time],[type=week]{padding-right:var(--pico-form-element-spacing-horizontal)!important;background-image:none!important}}[dir=rtl] :is([type=date],[type=datetime-local],[type=month],[type=time],[type=week]){text-align:right}[type=file]{--pico-color:var(--pico-muted-color);margin-left:calc(var(--pico-outline-width) * -1);padding:calc(var(--pico-form-element-spacing-vertical) * .5) 0;padding-left:var(--pico-outline-width);border:0;border-radius:0;background:0 0}[type=file]::file-selector-button{margin-right:calc(var(--pico-spacing)/ 2);padding:calc(var(--pico-form-element-spacing-vertical) * .5) var(--pico-form-element-spacing-horizontal)}[type=file]:is(:hover,:active,:focus)::file-selector-button{--pico-background-color:var(--pico-secondary-hover-background);--pico-border-color:var(--pico-secondary-hover-border)}[type=file]:focus::file-selector-button{--pico-box-shadow:var(--pico-button-hover-box-shadow, 0 0 0 rgba(0, 0, 0, 0)),0 0 0 var(--pico-outline-width) var(--pico-secondary-focus)}[type=range]{-webkit-appearance:none;-moz-appearance:none;appearance:none;width:100%;height:1.25rem;background:0 0}[type=range]::-webkit-slider-runnable-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-webkit-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-moz-range-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-moz-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-ms-track{width:100%;height:.375rem;border-radius:var(--pico-border-radius);background-color:var(--pico-range-border-color);-ms-transition:background-color var(--pico-transition),box-shadow var(--pico-transition);transition:background-color var(--pico-transition),box-shadow var(--pico-transition)}[type=range]::-webkit-slider-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-webkit-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-moz-range-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-moz-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]::-ms-thumb{-webkit-appearance:none;width:1.25rem;height:1.25rem;margin-top:-.4375rem;border:2px solid var(--pico-range-thumb-border-color);border-radius:50%;background-color:var(--pico-range-thumb-color);cursor:pointer;-ms-transition:background-color var(--pico-transition),transform var(--pico-transition);transition:background-color var(--pico-transition),transform var(--pico-transition)}[type=range]:active,[type=range]:focus-within{--pico-range-border-color:var(--pico-range-active-border-color);--pico-range-thumb-color:var(--pico-range-thumb-active-color)}[type=range]:active::-webkit-slider-thumb{transform:scale(1.25)}[type=range]:active::-moz-range-thumb{transform:scale(1.25)}[type=range]:active::-ms-thumb{transform:scale(1.25)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem);background-image:var(--pico-icon-search);background-position:center left calc(var(--pico-form-element-spacing-horizontal) + .125rem);background-size:1rem auto;background-repeat:no-repeat}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{padding-inline-start:calc(var(--pico-form-element-spacing-horizontal) + 1.75rem)!important;background-position:center left 1.125rem,center right .75rem}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=false]{background-image:var(--pico-icon-search),var(--pico-icon-valid)}input:not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid=true]{background-image:var(--pico-icon-search),var(--pico-icon-invalid)}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search]{background-position:center right 1.125rem}[dir=rtl] :where(input):not([type=checkbox],[type=radio],[type=range],[type=file])[type=search][aria-invalid]{background-position:center right 1.125rem,center left .75rem}details{display:block;margin-bottom:var(--pico-spacing)}details summary{line-height:1rem;list-style-type:none;cursor:pointer;transition:color var(--pico-transition)}details summary:not([role]){color:var(--pico-accordion-close-summary-color)}details summary::-webkit-details-marker{display:none}details summary::marker{display:none}details summary::-moz-list-bullet{list-style-type:none}details summary::after{display:block;width:1rem;height:1rem;margin-inline-start:calc(var(--pico-spacing,1rem) * .5);float:right;transform:rotate(-90deg);background-image:var(--pico-icon-chevron);background-position:right center;background-size:1rem auto;background-repeat:no-repeat;content:"";transition:transform var(--pico-transition)}details summary:focus{outline:0}details summary:focus:not([role]){color:var(--pico-accordion-active-summary-color)}details summary:focus-visible:not([role]){outline:var(--pico-outline-width) solid var(--pico-primary-focus);outline-offset:calc(var(--pico-spacing,1rem) * 0.5);color:var(--pico-primary)}details summary[role=button]{width:100%;text-align:left}details summary[role=button]::after{height:calc(1rem * var(--pico-line-height,1.5))}details[open]>summary{margin-bottom:var(--pico-spacing)}details[open]>summary:not([role]):not(:focus){color:var(--pico-accordion-open-summary-color)}details[open]>summary::after{transform:rotate(0)}[dir=rtl] details summary{text-align:right}[dir=rtl] details summary::after{float:left;background-position:left center}article{margin-bottom:var(--pico-block-spacing-vertical);padding:var(--pico-block-spacing-vertical) var(--pico-block-spacing-horizontal);border-radius:var(--pico-border-radius);background:var(--pico-card-background-color);box-shadow:var(--pico-card-box-shadow)}article>footer,article>header{margin-right:calc(var(--pico-block-spacing-horizontal) * -1);margin-left:calc(var(--pico-block-spacing-horizontal) * -1);padding:calc(var(--pico-block-spacing-vertical) * .66) var(--pico-block-spacing-horizontal);background-color:var(--pico-card-sectioning-background-color)}article>header{margin-top:calc(var(--pico-block-spacing-vertical) * -1);margin-bottom:var(--pico-block-spacing-vertical);border-bottom:var(--pico-border-width) solid var(--pico-card-border-color);border-top-right-radius:var(--pico-border-radius);border-top-left-radius:var(--pico-border-radius)}article>footer{margin-top:var(--pico-block-spacing-vertical);margin-bottom:calc(var(--pico-block-spacing-vertical) * -1);border-top:var(--pico-border-width) solid var(--pico-card-border-color);border-bottom-right-radius:var(--pico-border-radius);border-bottom-left-radius:var(--pico-border-radius)}[role=group],[role=search]{display:inline-flex;position:relative;width:100%;margin-bottom:var(--pico-spacing);border-radius:var(--pico-border-radius);box-shadow:var(--pico-group-box-shadow,0 0 0 transparent);vertical-align:middle;transition:box-shadow var(--pico-transition)}[role=group] input:not([type=checkbox],[type=radio]),[role=group] select,[role=group]>*,[role=search] input:not([type=checkbox],[type=radio]),[role=search] select,[role=search]>*{position:relative;flex:1 1 auto;margin-bottom:0}[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=group]>:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child),[role=search]>:not(:first-child){margin-left:0;border-top-left-radius:0;border-bottom-left-radius:0}[role=group] input:not([type=checkbox],[type=radio]):not(:last-child),[role=group] select:not(:last-child),[role=group]>:not(:last-child),[role=search] input:not([type=checkbox],[type=radio]):not(:last-child),[role=search] select:not(:last-child),[role=search]>:not(:last-child){border-top-right-radius:0;border-bottom-right-radius:0}[role=group] input:not([type=checkbox],[type=radio]):focus,[role=group] select:focus,[role=group]>:focus,[role=search] input:not([type=checkbox],[type=radio]):focus,[role=search] select:focus,[role=search]>:focus{z-index:2}[role=group] [role=button]:not(:first-child),[role=group] [type=button]:not(:first-child),[role=group] [type=reset]:not(:first-child),[role=group] [type=submit]:not(:first-child),[role=group] button:not(:first-child),[role=group] input:not([type=checkbox],[type=radio]):not(:first-child),[role=group] select:not(:first-child),[role=search] [role=button]:not(:first-child),[role=search] [type=button]:not(:first-child),[role=search] [type=reset]:not(:first-child),[role=search] [type=submit]:not(:first-child),[role=search] button:not(:first-child),[role=search] input:not([type=checkbox],[type=radio]):not(:first-child),[role=search] select:not(:first-child){margin-left:calc(var(--pico-border-width) * -1)}[role=group] [role=button],[role=group] [type=button],[role=group] [type=reset],[role=group] [type=submit],[role=group] button,[role=search] [role=button],[role=search] [type=button],[role=search] [type=reset],[role=search] [type=submit],[role=search] button{width:auto}@supports selector(:has(*)){[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-button)}[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=group]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select,[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) input:not([type=checkbox],[type=radio]),[role=search]:has(button:focus,[type=submit]:focus,[type=button]:focus,[role=button]:focus) select{border-color:transparent}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus),[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus){--pico-group-box-shadow:var(--pico-group-box-shadow-focus-with-input)}[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=group]:has(input:not([type=submit],[type=button]):focus,select:focus) button,[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [role=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=button],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) [type=submit],[role=search]:has(input:not([type=submit],[type=button]):focus,select:focus) button{--pico-button-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-border);--pico-button-hover-box-shadow:0 0 0 var(--pico-border-width) var(--pico-primary-hover-border)}[role=group] [role=button]:focus,[role=group] [type=button]:focus,[role=group] [type=reset]:focus,[role=group] [type=submit]:focus,[role=group] button:focus,[role=search] [role=button]:focus,[role=search] [type=button]:focus,[role=search] [type=reset]:focus,[role=search] [type=submit]:focus,[role=search] button:focus{box-shadow:none}}[role=search]>:first-child{border-top-left-radius:5rem;border-bottom-left-radius:5rem}[role=search]>:last-child{border-top-right-radius:5rem;border-bottom-right-radius:5rem}[aria-busy=true]:not(input,select,textarea,html,form){white-space:nowrap}[aria-busy=true]:not(input,select,textarea,html,form)::before{display:inline-block;width:1em;height:1em;background-image:var(--pico-icon-loading);background-size:1em auto;background-repeat:no-repeat;content:"";vertical-align:-.125em}[aria-busy=true]:not(input,select,textarea,html,form):not(:empty)::before{margin-inline-end:calc(var(--pico-spacing) * .5)}[aria-busy=true]:not(input,select,textarea,html,form):empty{text-align:center}[role=button][aria-busy=true],[type=button][aria-busy=true],[type=reset][aria-busy=true],[type=submit][aria-busy=true],a[aria-busy=true],button[aria-busy=true]{pointer-events:none}:host,:root{--pico-scrollbar-width:0px}dialog{display:flex;z-index:999;position:fixed;top:0;right:0;bottom:0;left:0;align-items:center;justify-content:center;width:inherit;min-width:100%;height:inherit;min-height:100%;padding:0;border:0;-webkit-backdrop-filter:var(--pico-modal-overlay-backdrop-filter);backdrop-filter:var(--pico-modal-overlay-backdrop-filter);background-color:var(--pico-modal-overlay-background-color);color:var(--pico-color)}dialog>article{width:100%;max-height:calc(100vh - var(--pico-spacing) * 2);margin:var(--pico-spacing);overflow:auto}@media (min-width:576px){dialog>article{max-width:510px}}@media (min-width:768px){dialog>article{max-width:700px}}dialog>article>header>*{margin-bottom:0}dialog>article>header :is(a,button)[rel=prev]{margin:0;margin-left:var(--pico-spacing);padding:0;float:right}dialog>article>footer{text-align:right}dialog>article>footer [role=button],dialog>article>footer button{margin-bottom:0}dialog>article>footer [role=button]:not(:first-of-type),dialog>article>footer button:not(:first-of-type){margin-left:calc(var(--pico-spacing) * .5)}dialog>article :is(a,button)[rel=prev]{display:block;width:1rem;height:1rem;margin-top:calc(var(--pico-spacing) * -1);margin-bottom:var(--pico-spacing);margin-left:auto;border:none;background-image:var(--pico-icon-close);background-position:center;background-size:auto 1rem;background-repeat:no-repeat;background-color:transparent;opacity:.5;transition:opacity var(--pico-transition)}dialog>article :is(a,button)[rel=prev]:is([aria-current]:not([aria-current=false]),:hover,:active,:focus){opacity:1}dialog:not([open]),dialog[open=false]{display:none}:where(nav li)::before{float:left;content:"โ€‹"}nav,nav ul{display:flex}nav{justify-content:space-between;overflow:visible}nav ol,nav ul{align-items:center;margin-bottom:0;padding:0;list-style:none}nav ol:first-of-type,nav ul:first-of-type{margin-left:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav ol:last-of-type,nav ul:last-of-type{margin-right:calc(var(--pico-nav-element-spacing-horizontal) * -1)}nav li{display:inline-block;margin:0;padding:var(--pico-nav-element-spacing-vertical) var(--pico-nav-element-spacing-horizontal)}nav li :where(a,[role=link]){display:inline-block;margin:calc(var(--pico-nav-link-spacing-vertical) * -1) calc(var(--pico-nav-link-spacing-horizontal) * -1);padding:var(--pico-nav-link-spacing-vertical) var(--pico-nav-link-spacing-horizontal);border-radius:var(--pico-border-radius)}nav li :where(a,[role=link]):not(:hover){text-decoration:none}nav li [role=button],nav li [type=button],nav li button,nav li input:not([type=checkbox],[type=radio],[type=range],[type=file]),nav li select{height:auto;margin-right:inherit;margin-bottom:0;margin-left:inherit;padding:calc(var(--pico-nav-link-spacing-vertical) - var(--pico-border-width) * 2) var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb]{align-items:center;justify-content:start}nav[aria-label=breadcrumb] ul li:not(:first-child){margin-inline-start:var(--pico-nav-link-spacing-horizontal)}nav[aria-label=breadcrumb] ul li a{margin:calc(var(--pico-nav-link-spacing-vertical) * -1) 0;margin-inline-start:calc(var(--pico-nav-link-spacing-horizontal) * -1)}nav[aria-label=breadcrumb] ul li:not(:last-child)::after{display:inline-block;position:absolute;width:calc(var(--pico-nav-link-spacing-horizontal) * 4);margin:0 calc(var(--pico-nav-link-spacing-horizontal) * -1);content:var(--pico-nav-breadcrumb-divider);color:var(--pico-muted-color);text-align:center;text-decoration:none;white-space:nowrap}nav[aria-label=breadcrumb] a[aria-current]:not([aria-current=false]){background-color:transparent;color:inherit;text-decoration:none;pointer-events:none}aside li,aside nav,aside ol,aside ul{display:block}aside li{padding:calc(var(--pico-nav-element-spacing-vertical) * .5) var(--pico-nav-element-spacing-horizontal)}aside li a{display:block}aside li [role=button]{margin:inherit}[dir=rtl] nav[aria-label=breadcrumb] ul li:not(:last-child) ::after{content:"\\"}progress{display:inline-block;vertical-align:baseline}progress{-webkit-appearance:none;-moz-appearance:none;display:inline-block;appearance:none;width:100%;height:.5rem;margin-bottom:calc(var(--pico-spacing) * .5);overflow:hidden;border:0;border-radius:var(--pico-border-radius);background-color:var(--pico-progress-background-color);color:var(--pico-progress-color)}progress::-webkit-progress-bar{border-radius:var(--pico-border-radius);background:0 0}progress[value]::-webkit-progress-value{background-color:var(--pico-progress-color);-webkit-transition:inline-size var(--pico-transition);transition:inline-size var(--pico-transition)}progress::-moz-progress-bar{background-color:var(--pico-progress-color)}@media (prefers-reduced-motion:no-preference){progress:indeterminate{background:var(--pico-progress-background-color) linear-gradient(to right,var(--pico-progress-color) 30%,var(--pico-progress-background-color) 30%) top left/150% 150% no-repeat;animation:progress-indeterminate 1s linear infinite}progress:indeterminate[value]::-webkit-progress-value{background-color:transparent}progress:indeterminate::-moz-progress-bar{background-color:transparent}}@media (prefers-reduced-motion:no-preference){[dir=rtl] progress:indeterminate{animation-direction:reverse}}@keyframes progress-indeterminate{0%{background-position:200% 0}100%{background-position:-200% 0}}[data-tooltip]{position:relative}[data-tooltip]:not(a,button,input,[role=button]){border-bottom:1px dotted;text-decoration:none;cursor:help}[data-tooltip]::after,[data-tooltip]::before,[data-tooltip][data-placement=top]::after,[data-tooltip][data-placement=top]::before{display:block;z-index:99;position:absolute;bottom:100%;left:50%;padding:.25rem .5rem;overflow:hidden;transform:translate(-50%,-.25rem);border-radius:var(--pico-border-radius);background:var(--pico-tooltip-background-color);content:attr(data-tooltip);color:var(--pico-tooltip-color);font-style:normal;font-weight:var(--pico-font-weight);font-size:.875rem;text-decoration:none;text-overflow:ellipsis;white-space:nowrap;opacity:0;pointer-events:none}[data-tooltip]::after,[data-tooltip][data-placement=top]::after{padding:0;transform:translate(-50%,0);border-top:.3rem solid;border-right:.3rem solid transparent;border-left:.3rem solid transparent;border-radius:0;background-color:transparent;content:"";color:var(--pico-tooltip-background-color)}[data-tooltip][data-placement=bottom]::after,[data-tooltip][data-placement=bottom]::before{top:100%;bottom:auto;transform:translate(-50%,.25rem)}[data-tooltip][data-placement=bottom]:after{transform:translate(-50%,-.3rem);border:.3rem solid transparent;border-bottom:.3rem solid}[data-tooltip][data-placement=left]::after,[data-tooltip][data-placement=left]::before{top:50%;right:100%;bottom:auto;left:auto;transform:translate(-.25rem,-50%)}[data-tooltip][data-placement=left]:after{transform:translate(.3rem,-50%);border:.3rem solid transparent;border-left:.3rem solid}[data-tooltip][data-placement=right]::after,[data-tooltip][data-placement=right]::before{top:50%;right:auto;bottom:auto;left:100%;transform:translate(.25rem,-50%)}[data-tooltip][data-placement=right]:after{transform:translate(-.3rem,-50%);border:.3rem solid transparent;border-right:.3rem solid}[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{opacity:1}@media (hover:hover) and (pointer:fine){[data-tooltip]:focus::after,[data-tooltip]:focus::before,[data-tooltip]:hover::after,[data-tooltip]:hover::before{--pico-tooltip-slide-to:translate(-50%, -0.25rem);transform:translate(-50%,.75rem);animation-duration:.2s;animation-fill-mode:forwards;animation-name:tooltip-slide;opacity:0}[data-tooltip]:focus::after,[data-tooltip]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, 0rem);transform:translate(-50%,-.25rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:focus::before,[data-tooltip][data-placement=bottom]:hover::after,[data-tooltip][data-placement=bottom]:hover::before{--pico-tooltip-slide-to:translate(-50%, 0.25rem);transform:translate(-50%,-.75rem);animation-name:tooltip-slide}[data-tooltip][data-placement=bottom]:focus::after,[data-tooltip][data-placement=bottom]:hover::after{--pico-tooltip-caret-slide-to:translate(-50%, -0.3rem);transform:translate(-50%,-.5rem);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:focus::before,[data-tooltip][data-placement=left]:hover::after,[data-tooltip][data-placement=left]:hover::before{--pico-tooltip-slide-to:translate(-0.25rem, -50%);transform:translate(.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=left]:focus::after,[data-tooltip][data-placement=left]:hover::after{--pico-tooltip-caret-slide-to:translate(0.3rem, -50%);transform:translate(.05rem,-50%);animation-name:tooltip-caret-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:focus::before,[data-tooltip][data-placement=right]:hover::after,[data-tooltip][data-placement=right]:hover::before{--pico-tooltip-slide-to:translate(0.25rem, -50%);transform:translate(-.75rem,-50%);animation-name:tooltip-slide}[data-tooltip][data-placement=right]:focus::after,[data-tooltip][data-placement=right]:hover::after{--pico-tooltip-caret-slide-to:translate(-0.3rem, -50%);transform:translate(-.05rem,-50%);animation-name:tooltip-caret-slide}}@keyframes tooltip-slide{to{transform:var(--pico-tooltip-slide-to);opacity:1}}@keyframes tooltip-caret-slide{50%{opacity:0}to{transform:var(--pico-tooltip-caret-slide-to);opacity:1}}[aria-controls]{cursor:pointer}[aria-disabled=true],[disabled]{cursor:not-allowed}[aria-hidden=false][hidden]{display:initial}[aria-hidden=false][hidden]:not(:focus){clip:rect(0,0,0,0);position:absolute}[tabindex],a,area,button,input,label,select,summary,textarea{-ms-touch-action:manipulation}[dir=rtl]{direction:rtl}@media (prefers-reduced-motion:reduce){:not([aria-busy=true]),:not([aria-busy=true])::after,:not([aria-busy=true])::before{background-attachment:initial!important;animation-duration:1ms!important;animation-delay:-1ms!important;animation-iteration-count:1!important;scroll-behavior:auto!important;transition-delay:0s!important;transition-duration:0s!important}}
+224
www/index.html
··· 1 + <!doctype html> 2 + <html lang="en"> 3 + 4 + <head> 5 + <meta charset="utf-8"> 6 + <meta name="viewport" content="width=device-width, initial-scale=1"> 7 + <meta name="color-scheme" content="light dark"> 8 + 9 + <!-- Primary Meta Tags --> 10 + <title>QuickDID - AT Protocol Identity Resolution Service</title> 11 + <meta name="title" content="QuickDID - AT Protocol Identity Resolution Service"> 12 + <meta name="description" content="High-performance handle-to-DID resolution service for the AT Protocol ecosystem. Resolve Bluesky and AT Protocol handles instantly."> 13 + <meta name="keywords" content="ATProtocol, Bluesky, DID, handle resolution, decentralized identity, atproto"> 14 + <meta name="author" content="Nick Gerakines"> 15 + 16 + <!-- Open Graph / Facebook --> 17 + <meta property="og:type" content="website"> 18 + <meta property="og:url" content="https://quickdid.smokesignal.tools/"> 19 + <meta property="og:title" content="QuickDID - AT Protocol Identity Resolution Service"> 20 + <meta property="og:description" content="High-performance handle-to-DID resolution service for the AT Protocol ecosystem. Resolve Bluesky and AT Protocol handles instantly."> 21 + <meta property="og:site_name" content="QuickDID"> 22 + 23 + <!-- Twitter --> 24 + <meta property="twitter:card" content="summary_large_image"> 25 + <meta property="twitter:url" content="https://quickdid.smokesignal.tools/"> 26 + <meta property="twitter:title" content="QuickDID - AT Protocol Identity Resolution Service"> 27 + <meta property="twitter:description" content="High-performance handle-to-DID resolution service for the AT Protocol ecosystem. Resolve Bluesky and AT Protocol handles instantly."> 28 + 29 + <!-- Additional Meta Tags --> 30 + <meta name="robots" content="index, follow"> 31 + <meta name="language" content="English"> 32 + <meta name="theme-color" content="#1976d2"> 33 + <link rel="canonical" href="https://quickdid.smokesignal.tools/"> 34 + 35 + <!-- Stylesheet --> 36 + <link rel="stylesheet" href="/css/pico.classless.green.min.css"> 37 + <style> 38 + .resolver-form { 39 + margin: 2rem 0; 40 + padding: 1.5rem; 41 + background: var(--card-background-color); 42 + border-radius: var(--border-radius); 43 + border: 1px solid var(--muted-border-color); 44 + } 45 + 46 + .resolver-result { 47 + margin-top: 1rem; 48 + padding: 1.5rem; 49 + background: var(--code-background-color); 50 + border-radius: var(--border-radius); 51 + border: 1px solid var(--muted-border-color); 52 + } 53 + 54 + .result-content { 55 + background: transparent; 56 + padding: 1rem; 57 + overflow-x: auto; 58 + white-space: pre-wrap; 59 + word-break: break-word; 60 + } 61 + 62 + code { 63 + padding: 0.25rem 0.5rem; 64 + background: var(--code-background-color); 65 + border-radius: var(--border-radius); 66 + } 67 + 68 + span { 69 + display: inline-block; 70 + padding: 0.25rem 0.5rem; 71 + background: var(--primary); 72 + color: var(--primary-inverse); 73 + border-radius: var(--border-radius); 74 + font-size: 0.875rem; 75 + font-weight: bold; 76 + margin-right: 0.5rem; 77 + } 78 + 79 + .endpoint-section { 80 + margin-bottom: 3rem; 81 + } 82 + </style> 83 + </head> 84 + 85 + <body> 86 + <header> 87 + <hgroup> 88 + <h1>QuickDID</h1> 89 + <p>AT Protocol Identity Resolution Service</p> 90 + </hgroup> 91 + </header> 92 + <main> 93 + <p>QuickDID provides high-performance resolution services for the AT Protocol ecosystem.</p> 94 + 95 + <h2>Available Endpoints</h2> 96 + 97 + <section class="endpoint-section"> 98 + <h3>GET /xrpc/com.atproto.identity.resolveHandle</h3> 99 + <p>Resolve an AT Protocol handle to its DID</p> 100 + <p>Parameters: <code>?handle={handle}</code></p> 101 + 102 + <h4>Try It Out</h4> 103 + <form id="handleResolveForm" class="resolver-form"> 104 + <label for="handleInput"> 105 + Enter an AT Protocol handle to resolve: 106 + <input type="text" id="handleInput" name="handle" placeholder="e.g., alice.bsky.social" required> 107 + </label> 108 + <button type="submit">Resolve Handle</button> 109 + </form> 110 + 111 + <div id="handleResult" class="resolver-result" style="display: none;"> 112 + <h4>Result</h4> 113 + <pre id="handleResultContent" class="result-content"></pre> 114 + </div> 115 + 116 + <h4>Example Usage</h4> 117 + <code>curl "https://quickdid.smokesignal.tools/xrpc/com.atproto.identity.resolveHandle?handle=ngerakines.me"</code> 118 + </section> 119 + 120 + <section class="endpoint-section"> 121 + <h3>GET /xrpc/com.atproto.lexicon.resolveLexicon</h3> 122 + <p>Resolve an AT Protocol lexicon (NSID) to its schema</p> 123 + <p>Parameters: <code>?nsid={nsid}</code></p> 124 + 125 + <h4>Try It Out</h4> 126 + <form id="lexiconResolveForm" class="resolver-form"> 127 + <label for="nsidInput"> 128 + Enter an AT Protocol NSID to resolve: 129 + <input type="text" id="nsidInput" name="nsid" placeholder="e.g., app.bsky.feed.post" required> 130 + </label> 131 + <button type="submit">Resolve Lexicon</button> 132 + </form> 133 + 134 + <div id="lexiconResult" class="resolver-result" style="display: none;"> 135 + <h4>Result</h4> 136 + <pre id="lexiconResultContent" class="result-content"></pre> 137 + </div> 138 + 139 + <h4>Example Usage</h4> 140 + <code>curl "https://quickdid.smokesignal.tools/xrpc/com.atproto.lexicon.resolveLexicon?nsid=app.bsky.feed.post"</code> 141 + </section> 142 + 143 + <h2>Documentation</h2> 144 + <p> 145 + For more information, visit the 146 + <a href="https://tangled.sh/@smokesignal.events/quickdid" target="_blank"> 147 + QuickDID repository 148 + </a> 149 + . 150 + </p> 151 + </main> 152 + 153 + <script> 154 + // Handle form submission for handle resolution 155 + document.getElementById('handleResolveForm').addEventListener('submit', async (e) => { 156 + e.preventDefault(); 157 + 158 + const handle = document.getElementById('handleInput').value.trim(); 159 + const resultDiv = document.getElementById('handleResult'); 160 + const resultContent = document.getElementById('handleResultContent'); 161 + 162 + // Show loading state 163 + resultDiv.style.display = 'block'; 164 + resultContent.textContent = 'Loading...'; 165 + 166 + try { 167 + // Build the request URL 168 + const url = `/xrpc/com.atproto.identity.resolveHandle?handle=${encodeURIComponent(handle)}`; 169 + 170 + // Make the GET request 171 + const response = await fetch(url); 172 + const data = await response.json(); 173 + 174 + // Display the result 175 + if (response.ok) { 176 + resultContent.textContent = JSON.stringify(data, null, 2); 177 + resultContent.style.color = ''; 178 + } else { 179 + resultContent.textContent = `Error: ${JSON.stringify(data, null, 2)}`; 180 + resultContent.style.color = '#d32f2f'; 181 + } 182 + } catch (error) { 183 + resultContent.textContent = `Network Error: ${error.message}`; 184 + resultContent.style.color = '#d32f2f'; 185 + } 186 + }); 187 + 188 + // Handle form submission for lexicon resolution 189 + document.getElementById('lexiconResolveForm').addEventListener('submit', async (e) => { 190 + e.preventDefault(); 191 + 192 + const nsid = document.getElementById('nsidInput').value.trim(); 193 + const resultDiv = document.getElementById('lexiconResult'); 194 + const resultContent = document.getElementById('lexiconResultContent'); 195 + 196 + // Show loading state 197 + resultDiv.style.display = 'block'; 198 + resultContent.textContent = 'Loading...'; 199 + 200 + try { 201 + // Build the request URL 202 + const url = `/xrpc/com.atproto.lexicon.resolveLexicon?nsid=${encodeURIComponent(nsid)}`; 203 + 204 + // Make the GET request 205 + const response = await fetch(url); 206 + const data = await response.json(); 207 + 208 + // Display the result 209 + if (response.ok) { 210 + resultContent.textContent = JSON.stringify(data, null, 2); 211 + resultContent.style.color = ''; 212 + } else { 213 + resultContent.textContent = `Error: ${JSON.stringify(data, null, 2)}`; 214 + resultContent.style.color = '#d32f2f'; 215 + } 216 + } catch (error) { 217 + resultContent.textContent = `Network Error: ${error.message}`; 218 + resultContent.style.color = '#d32f2f'; 219 + } 220 + }); 221 + </script> 222 + </body> 223 + 224 + </html>